SU1209025A3 - Способ получени @ -феноксибензилового спирта - Google Patents
Способ получени @ -феноксибензилового спирта Download PDFInfo
- Publication number
- SU1209025A3 SU1209025A3 SU813306783A SU3306783A SU1209025A3 SU 1209025 A3 SU1209025 A3 SU 1209025A3 SU 813306783 A SU813306783 A SU 813306783A SU 3306783 A SU3306783 A SU 3306783A SU 1209025 A3 SU1209025 A3 SU 1209025A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- solution
- reaction mixture
- water
- acetate
- distilled
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 10
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 title claims abstract description 8
- -1 m-phenoxy-benzyl Chemical group 0.000 claims abstract description 10
- 239000000460 chlorine Substances 0.000 claims abstract description 3
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 3
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims abstract 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract 2
- 229910052794 bromium Chemical group 0.000 claims abstract 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 51
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 27
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 18
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 12
- 239000008096 xylene Substances 0.000 claims description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 5
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 230000032050 esterification Effects 0.000 claims description 2
- 238000005886 esterification reaction Methods 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims 1
- 239000003377 acid catalyst Substances 0.000 claims 1
- QIRAYNIFEOXSPW-UHFFFAOYSA-N dimepheptanol Chemical compound C=1C=CC=CC=1C(CC(C)N(C)C)(C(O)CC)C1=CC=CC=C1 QIRAYNIFEOXSPW-UHFFFAOYSA-N 0.000 claims 1
- 229950004655 dimepheptanol Drugs 0.000 claims 1
- 239000003456 ion exchange resin Substances 0.000 claims 1
- 229920003303 ion-exchange polymer Polymers 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 claims 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 abstract description 8
- 150000001875 compounds Chemical class 0.000 abstract description 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 125000001624 naphthyl group Chemical group 0.000 abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000004185 ester group Chemical group 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 230000007062 hydrolysis Effects 0.000 abstract 1
- 238000006460 hydrolysis reaction Methods 0.000 abstract 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 42
- 239000011541 reaction mixture Substances 0.000 description 39
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 239000012074 organic phase Substances 0.000 description 17
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 14
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- 238000009835 boiling Methods 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- XPHQNMNGUGOWGU-UHFFFAOYSA-N (3-phenoxyphenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 XPHQNMNGUGOWGU-UHFFFAOYSA-N 0.000 description 7
- 229940022663 acetate Drugs 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- FSWNRRSWFBXQCL-UHFFFAOYSA-N (3-bromophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1 FSWNRRSWFBXQCL-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 238000010533 azeotropic distillation Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 235000011118 potassium hydroxide Nutrition 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- LKRBJGQCGJSSSX-UHFFFAOYSA-N (3-bromophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC(Br)=C1 LKRBJGQCGJSSSX-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- ZSRDNPVYGSFUMD-UHFFFAOYSA-N (3-chlorophenyl)methanol Chemical compound OCC1=CC=CC(Cl)=C1 ZSRDNPVYGSFUMD-UHFFFAOYSA-N 0.000 description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 230000002441 reversible effect Effects 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- XLMVMSDHBQJNTL-UHFFFAOYSA-N (3-chlorophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC(Cl)=C1 XLMVMSDHBQJNTL-UHFFFAOYSA-N 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- 239000003518 caustics Substances 0.000 description 3
- 150000001879 copper Chemical class 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 description 2
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XHCCJTHVHXHMDJ-UHFFFAOYSA-N C(C)(=O)O.BrC1=CC=CC=C1 Chemical compound C(C)(=O)O.BrC1=CC=CC=C1 XHCCJTHVHXHMDJ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 239000003637 basic solution Substances 0.000 description 2
- 229940007550 benzyl acetate Drugs 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- DZCPZXMIJRDUTK-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2-methylbutanoate Chemical compound CCC(C)C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 DZCPZXMIJRDUTK-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-N 2-methylbutyric acid Chemical compound CCC(C)C(O)=O WLAMNBDJUVNPJU-UHFFFAOYSA-N 0.000 description 1
- SUISZCALMBHJQX-UHFFFAOYSA-N 3-bromobenzaldehyde Chemical compound BrC1=CC=CC(C=O)=C1 SUISZCALMBHJQX-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000557 Nafion® Polymers 0.000 description 1
- 102100040678 Programmed cell death protein 1 Human genes 0.000 description 1
- 101710089372 Programmed cell death protein 1 Proteins 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000005489 p-toluenesulfonic acid group Chemical class 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- CKFBFQHBUCDOHL-UHFFFAOYSA-N phenoxy(phenyl)methanol Chemical compound C=1C=CC=CC=1C(O)OC1=CC=CC=C1 CKFBFQHBUCDOHL-UHFFFAOYSA-N 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- KMIOJWCYOHBUJS-HAKPAVFJSA-N vorolanib Chemical compound C1N(C(=O)N(C)C)CC[C@@H]1NC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C KMIOJWCYOHBUJS-HAKPAVFJSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/263—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings the aromatic rings being non-condensed
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/14—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/295—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings containing hydroxy or O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU801719A HU181737B (en) | 1980-07-10 | 1980-07-10 | Process for preparing diphenyl-ether derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1209025A3 true SU1209025A3 (ru) | 1986-01-30 |
Family
ID=10955841
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU813306783A SU1209025A3 (ru) | 1980-07-10 | 1981-07-09 | Способ получени @ -феноксибензилового спирта |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4709081A (enExample) |
| JP (1) | JPS5740431A (enExample) |
| AU (1) | AU542642B2 (enExample) |
| BR (1) | BR8104406A (enExample) |
| CA (1) | CA1202319A (enExample) |
| CH (1) | CH650488A5 (enExample) |
| CS (1) | CS221849B2 (enExample) |
| DD (1) | DD200795A5 (enExample) |
| DE (1) | DE3126429A1 (enExample) |
| ES (1) | ES8204711A1 (enExample) |
| FR (1) | FR2486526B1 (enExample) |
| GB (1) | GB2080799B (enExample) |
| HU (1) | HU181737B (enExample) |
| IE (1) | IE51362B1 (enExample) |
| IT (1) | IT1144742B (enExample) |
| NL (1) | NL8103280A (enExample) |
| PL (1) | PL132134B1 (enExample) |
| SU (1) | SU1209025A3 (enExample) |
| YU (1) | YU42413B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HUT39077A (en) * | 1985-01-08 | 1986-08-28 | Chinoin Gyogyszer Es Vegyeszet | Process for production of piretroids |
| GB8728064D0 (en) * | 1987-12-01 | 1988-01-06 | Shell Int Research | Process for preparation of substituted phenoxy propanoic acids |
| WO1999018057A1 (en) * | 1997-10-06 | 1999-04-15 | Massachusetts Institute Of Technology | Preparation of diaryl ether by condensation reactions |
| KR102937451B1 (ko) * | 2020-08-28 | 2026-03-10 | 닛뽕 케미파 가부시키가이샤 | 신규한 구리 촉매를 사용하여 디아릴 에테르 골격을 갖는 모르피난 유도체를 제조하는 방법 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4861443A (enExample) * | 1971-12-03 | 1973-08-28 | ||
| CA1041531A (en) * | 1973-10-29 | 1978-10-31 | Eisai Co. Ltd. | M-phenoxyphenyl propionic acid derivatives and preparation thereof |
| DE2707232A1 (de) * | 1977-02-19 | 1978-08-24 | Bayer Ag | Verfahren zur herstellung halogenmethylierter diphenylaether |
| GB1579151A (en) * | 1977-06-04 | 1980-11-12 | Croda Synthetic Chem Ltd | Preparation of diphenyl ether compounds |
| GB2010837B (en) * | 1977-12-22 | 1982-07-28 | Croda Synthetic Chem Ltd | Process for preparing aralkyl halides |
-
1980
- 1980-07-10 HU HU801719A patent/HU181737B/hu unknown
-
1981
- 1981-06-30 IE IE1469/81A patent/IE51362B1/en not_active IP Right Cessation
- 1981-07-04 DE DE3126429A patent/DE3126429A1/de not_active Withdrawn
- 1981-07-08 IT IT67944/81A patent/IT1144742B/it active
- 1981-07-08 PL PL1981232106A patent/PL132134B1/pl unknown
- 1981-07-08 YU YU1677/81A patent/YU42413B/xx unknown
- 1981-07-08 FR FR8113435A patent/FR2486526B1/fr not_active Expired
- 1981-07-09 CS CS815296A patent/CS221849B2/cs unknown
- 1981-07-09 SU SU813306783A patent/SU1209025A3/ru active
- 1981-07-09 BR BR8104406A patent/BR8104406A/pt unknown
- 1981-07-09 JP JP56106322A patent/JPS5740431A/ja active Granted
- 1981-07-09 NL NL8103280A patent/NL8103280A/nl not_active Application Discontinuation
- 1981-07-09 GB GB8121207A patent/GB2080799B/en not_active Expired
- 1981-07-09 AU AU72715/81A patent/AU542642B2/en not_active Ceased
- 1981-07-09 CH CH4518/81A patent/CH650488A5/de not_active IP Right Cessation
- 1981-07-10 DD DD81231661A patent/DD200795A5/de not_active IP Right Cessation
- 1981-07-10 ES ES504338A patent/ES8204711A1/es not_active Expired
- 1981-07-13 CA CA000381574A patent/CA1202319A/en not_active Expired
-
1985
- 1985-09-26 US US06/781,303 patent/US4709081A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| FR2486526A1 (fr) | 1982-01-15 |
| HU181737B (en) | 1983-11-28 |
| IE51362B1 (en) | 1986-12-10 |
| GB2080799B (en) | 1984-05-31 |
| DE3126429A1 (de) | 1982-06-03 |
| IT1144742B (it) | 1986-10-29 |
| DD200795A5 (de) | 1983-06-15 |
| YU167781A (en) | 1983-10-31 |
| IT8167944A0 (it) | 1981-07-08 |
| YU42413B (en) | 1988-08-31 |
| AU7271581A (en) | 1982-01-14 |
| ES504338A0 (es) | 1982-06-01 |
| PL132134B1 (en) | 1985-02-28 |
| IE811469L (en) | 1982-01-10 |
| US4709081A (en) | 1987-11-24 |
| BR8104406A (pt) | 1982-03-30 |
| NL8103280A (nl) | 1982-02-01 |
| FR2486526B1 (fr) | 1986-04-04 |
| JPS5740431A (en) | 1982-03-06 |
| PL232106A1 (enExample) | 1982-03-29 |
| CH650488A5 (de) | 1985-07-31 |
| CA1202319A (en) | 1986-03-25 |
| ES8204711A1 (es) | 1982-06-01 |
| GB2080799A (en) | 1982-02-10 |
| JPH0131495B2 (enExample) | 1989-06-26 |
| AU542642B2 (en) | 1985-02-28 |
| CS221849B2 (en) | 1983-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1209025A3 (ru) | Способ получени @ -феноксибензилового спирта | |
| JPS6230181B2 (enExample) | ||
| SU453823A3 (ru) | Способ получения 4- | |
| IL44859A (en) | 4-hydroxy-3-(1,2,3,4-tetrahydronaphth-1-yl)-coumarin derivatives | |
| EP0023959B1 (en) | Method of preparing optically active 4-hydroxy-3-methyl-2-(2-propynyl)-2-cyclopentenolone and intermediates therefor and the compounds thus obtained | |
| US3828033A (en) | Process for preparing 2-(6-methoxy-2-naphthyl)propionic acid and intermediates therefor | |
| JP2007522139A (ja) | 2,5−ジメチルフェニル酢酸の調製方法 | |
| US4314071A (en) | Method of preparing monoesters | |
| JPS642109B2 (enExample) | ||
| US4022803A (en) | Process for preparing isocitric acid, alloisocitric acid and lactones thereof | |
| US4393008A (en) | 2-Cyano-2-(3-phenoxy-phenyl)-propionic acid amide and preparation thereof | |
| Manske et al. | Some Derivatives of Dialkoxy-phthalides | |
| US3282984A (en) | Racemization of optically active transchrysanthemic acid | |
| JPS6319496B2 (enExample) | ||
| US3590077A (en) | Salts of chrysanthemic acid with 1-p-nitrophenyl - 2-n,n - dimethyl-aminopropane-1,3-diols | |
| DE839353C (de) | Verfahren zur Darstellung von Vitamin A-acetat | |
| KR860001545B1 (ko) | 키랄 3-(치환된 페닐)-4-(3-하이드록시프로필) 시클로헥산올의 합성방법 | |
| JP2002030005A (ja) | カルボン酸アリールエステルの製造方法 | |
| MILLER et al. | STUDIES IN THE THIOPHENE SERIES. VII. 1 THE APPLICATION OF THE REFORMATSKY REACTION TO THIOPHENE ALDEHYDES AND KETONES | |
| US5120874A (en) | Process for the preparation of 5-hydroxydiprafenone and its acid addition salts | |
| US3506714A (en) | Process for the preparation of methyl (3 - lower alkoxy - 4 - hydroxybenzyl)ketones | |
| EP0029092B1 (en) | Cis-(1r,2s)-3,3-dimethyl-2-((4s)-3-methyl-2-(2-propynyl)cyclopent-2-en-1-on-4-yloxyhydroxymethyl)-cyclopropanecarboxylic lactone and method of producing (s)-4-hydroxy-3-methyl-2-(2-propynyl)-cyclopent-2-en-1-on | |
| US2895927A (en) | Synthesis of thyronine compounds | |
| EP0040478A1 (en) | Process for preparing pyridine derivatives and intermediates useful in the process | |
| JPS581097B2 (ja) | 光学活性α−置換アリ−ル酢酸のラセミ化方法 |