DE2950608C2 - - Google Patents
Info
- Publication number
- DE2950608C2 DE2950608C2 DE2950608A DE2950608A DE2950608C2 DE 2950608 C2 DE2950608 C2 DE 2950608C2 DE 2950608 A DE2950608 A DE 2950608A DE 2950608 A DE2950608 A DE 2950608A DE 2950608 C2 DE2950608 C2 DE 2950608C2
- Authority
- DE
- Germany
- Prior art keywords
- phenoxy
- phenyl
- acid
- propionic acid
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 32
- 238000000034 method Methods 0.000 claims description 27
- RDJGLLICXDHJDY-UHFFFAOYSA-N fenoprofen Chemical compound OC(=O)C(C)C1=CC=CC(OC=2C=CC=CC=2)=C1 RDJGLLICXDHJDY-UHFFFAOYSA-N 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- SPRFQFFNDBIQDY-UHFFFAOYSA-N 2-cyano-2-(3-phenoxyphenyl)propanamide Chemical compound N#CC(C)(C(N)=O)C1=CC=CC(OC=2C=CC=CC=2)=C1 SPRFQFFNDBIQDY-UHFFFAOYSA-N 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 11
- DKGMALJGFUHPGB-UHFFFAOYSA-N 2-(3-phenoxyphenyl)acetonitrile Chemical compound N#CCC1=CC=CC(OC=2C=CC=CC=2)=C1 DKGMALJGFUHPGB-UHFFFAOYSA-N 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 150000002148 esters Chemical class 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 7
- 230000007062 hydrolysis Effects 0.000 claims description 7
- 238000006460 hydrolysis reaction Methods 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- FPJBPTQTHPZNBE-UHFFFAOYSA-N 2-cyano-2-(3-phenoxyphenyl)propanoic acid Chemical compound N#CC(C)(C(O)=O)C1=CC=CC(OC=2C=CC=CC=2)=C1 FPJBPTQTHPZNBE-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- AVCXUPSTLHKNGB-UHFFFAOYSA-N 2-cyano-2-(3-phenoxyphenyl)acetic acid Chemical compound OC(=O)C(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 AVCXUPSTLHKNGB-UHFFFAOYSA-N 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 238000006114 decarboxylation reaction Methods 0.000 claims description 5
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 claims description 5
- 238000002955 isolation Methods 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- 239000000543 intermediate Substances 0.000 claims description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims 1
- 230000001035 methylating effect Effects 0.000 claims 1
- 230000011987 methylation Effects 0.000 claims 1
- 238000007069 methylation reaction Methods 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 24
- 238000009835 boiling Methods 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 238000003756 stirring Methods 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 12
- -1 2- (3-phenoxy-phenyl) propionic acid 2- (3-phenoxy-phenyl) propionitrile Chemical compound 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 9
- 229910052938 sodium sulfate Inorganic materials 0.000 description 9
- 235000011152 sodium sulphate Nutrition 0.000 description 9
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 8
- RDJGLLICXDHJDY-NSHDSACASA-N (2s)-2-(3-phenoxyphenyl)propanoic acid Chemical compound OC(=O)[C@@H](C)C1=CC=CC(OC=2C=CC=CC=2)=C1 RDJGLLICXDHJDY-NSHDSACASA-N 0.000 description 7
- 229960001419 fenoprofen Drugs 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- RFALKMQNBPHELA-UHFFFAOYSA-N ethyl 2-cyano-2-(3-phenoxyphenyl)propanoate Chemical compound CCOC(=O)C(C)(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 RFALKMQNBPHELA-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 4
- 125000005907 alkyl ester group Chemical group 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- QUYVTGFWFHQVRO-UHFFFAOYSA-N 1-(chloromethyl)-3-phenoxybenzene Chemical compound ClCC1=CC=CC(OC=2C=CC=CC=2)=C1 QUYVTGFWFHQVRO-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 159000000007 calcium salts Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- VGLCBSOALKYKJU-UHFFFAOYSA-N ethyl 2-cyano-2-(3-phenoxyphenyl)acetate Chemical compound CCOC(=O)C(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 VGLCBSOALKYKJU-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000012022 methylating agents Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- XFKRMUHUTOKOBT-UHFFFAOYSA-N 2-methyl-2-(3-phenoxyphenyl)propanedioic acid Chemical compound OC(=O)C(C)(C(O)=O)C1=CC=CC(OC=2C=CC=CC=2)=C1 XFKRMUHUTOKOBT-UHFFFAOYSA-N 0.000 description 2
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229930003836 cresol Natural products 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- CUGDBFARXMYFIW-UHFFFAOYSA-N methyl 2-cyano-2-(3-phenoxyphenyl)acetate Chemical compound COC(=O)C(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 CUGDBFARXMYFIW-UHFFFAOYSA-N 0.000 description 2
- XUDXNGUORATCNY-UHFFFAOYSA-N methyl 2-cyano-2-(3-phenoxyphenyl)propanoate Chemical compound COC(=O)C(C)(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 XUDXNGUORATCNY-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- CJOMHFSNAMKXCS-UHFFFAOYSA-N 1-(2-methylprop-1-enyl)-3-phenoxybenzene Chemical compound CC(C)=CC1=CC=CC(OC=2C=CC=CC=2)=C1 CJOMHFSNAMKXCS-UHFFFAOYSA-N 0.000 description 1
- MYWBBBSIAHHXJK-UHFFFAOYSA-N 1-(3-phenoxyphenyl)ethanol Chemical compound CC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 MYWBBBSIAHHXJK-UHFFFAOYSA-N 0.000 description 1
- FZCDBGYCFVKRDV-UHFFFAOYSA-N 1-(3-phenoxyphenyl)ethanone Chemical compound CC(=O)C1=CC=CC(OC=2C=CC=CC=2)=C1 FZCDBGYCFVKRDV-UHFFFAOYSA-N 0.000 description 1
- OBTDVRGUJLGMIN-UHFFFAOYSA-N 1-phenoxy-3-prop-1-ynylbenzene Chemical compound CC#CC1=CC=CC(OC=2C=CC=CC=2)=C1 OBTDVRGUJLGMIN-UHFFFAOYSA-N 0.000 description 1
- HORQAOAYAYGIBM-UHFFFAOYSA-N 2,4-dinitrophenylhydrazine Chemical compound NNC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O HORQAOAYAYGIBM-UHFFFAOYSA-N 0.000 description 1
- JSCONFOVXYGOST-UHFFFAOYSA-N 2-(3-phenoxyphenyl)propanenitrile Chemical compound N#CC(C)C1=CC=CC(OC=2C=CC=CC=2)=C1 JSCONFOVXYGOST-UHFFFAOYSA-N 0.000 description 1
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 1
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 description 1
- XHTRHEMAXFRQDD-UHFFFAOYSA-N 4-methyl-N-(4-methylbenzoyl)iminobenzamide Chemical compound C1=CC(C)=CC=C1C(=O)N=NC(=O)C1=CC=C(C)C=C1 XHTRHEMAXFRQDD-UHFFFAOYSA-N 0.000 description 1
- HIGFVVGEUKKNAJ-UHFFFAOYSA-N CI.S(=O)(=O)(OC)OC Chemical compound CI.S(=O)(=O)(OC)OC HIGFVVGEUKKNAJ-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- LKPVHTAWGPBJMM-UHFFFAOYSA-M [O-]C1=CC=CC=C1.[Mg+]C1=CC=CC=C1 Chemical compound [O-]C1=CC=CC=C1.[Mg+]C1=CC=CC=C1 LKPVHTAWGPBJMM-UHFFFAOYSA-M 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- 230000003356 anti-rheumatic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000000911 decarboxylating effect Effects 0.000 description 1
- MGMPTGMQQYUFFX-UHFFFAOYSA-N diethyl 2-methyl-2-(3-phenoxyphenyl)propanedioate Chemical compound CCOC(=O)C(C)(C(=O)OCC)C1=CC=CC(OC=2C=CC=CC=2)=C1 MGMPTGMQQYUFFX-UHFFFAOYSA-N 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- FYWSTUCDSVYLPV-UHFFFAOYSA-N nitrooxythallium Chemical compound [Tl+].[O-][N+]([O-])=O FYWSTUCDSVYLPV-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI001894 | 1978-12-29 | ||
| HUCI001979 HU181672B (hu) | 1979-10-25 | 1979-10-25 | Eljárás 2-(3-fenoxi-fenil)-propionsav és sói új intermedieren keresztül történő előállítására |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2950608A1 DE2950608A1 (de) | 1980-07-10 |
| DE2950608C2 true DE2950608C2 (enExample) | 1990-09-13 |
Family
ID=26318424
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19792950608 Granted DE2950608A1 (de) | 1978-12-29 | 1979-12-15 | Verfahren zur herstellung von 2-(3-phenoxy-phenyl)-propionsaeure |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US4304930A (enExample) |
| CH (1) | CH646944A5 (enExample) |
| DD (1) | DD149507A5 (enExample) |
| DE (1) | DE2950608A1 (enExample) |
| FR (1) | FR2445314A1 (enExample) |
| GB (1) | GB2039479B (enExample) |
| RO (1) | RO79023A (enExample) |
| SU (1) | SU1039439A3 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8318889D0 (en) * | 1983-07-13 | 1983-08-17 | Lilly Industries Ltd | Pharmaceutical compounds |
| US4760089A (en) * | 1985-09-09 | 1988-07-26 | Smithkline Beckman Corporation | Irreversible dopamine-β-hydroxylase inhibitors |
| ATE136018T1 (de) * | 1991-05-09 | 1996-04-15 | Hoffmann La Roche | Substituierte carbonsäurederivate |
| RU2059603C1 (ru) * | 1991-05-09 | 1996-05-10 | Хоффманн-Ля Рош АГ | ПРОИЗВОДНЫЕ α -ЗАМЕЩЕННЫХ АРИЛУКСУСНЫХ КИСЛОТ И ФАРМАЦЕВТИЧЕСКАЯ КОМПОЗИЦИЯ |
| PT1115683E (pt) * | 1998-09-26 | 2004-04-30 | Aventis Pharma Gmbh | Procedimento para a sintese sem pressao do acido alfa,alfa-dimetilfenilacetico a partir do cianeto de alfa,alfa-dimetilbenzilo |
| RU2451669C1 (ru) * | 2011-02-14 | 2012-05-27 | Государственное образовательное учреждение высшего профессионального образования Волгоградский государственный технический университет (ВолгГТУ) | Способ получения 3-феноксифенилацетонитрила |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE363818B (enExample) * | 1968-08-15 | 1974-02-04 | Lilly Co Eli | |
| US3853905A (en) * | 1968-08-15 | 1974-12-10 | Lilly Co Eli | Certain 5-(phenoxyphenalkyl) tetrazoles |
| SE419538B (sv) * | 1973-10-29 | 1981-08-10 | Eisai Co Ltd | Analogiforfaranden for framstellning av 2-(n-fenoxfenyl)-propionsyraderivat |
| JPS582934B2 (ja) * | 1974-07-29 | 1983-01-19 | ニツシンセイフン カブシキガイシヤ | 2−(置換アリ−ル)−プロピオン酸の製法 |
| JPS5312835A (en) * | 1976-07-22 | 1978-02-04 | Grelan Pharmaceut Co Ltd | Preparation of 2-(3-phenoxyphenyl) propionic acid |
| HU180811B (en) * | 1976-11-23 | 1983-04-29 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing phenyl-alkyl-carboxylic acids |
-
1979
- 1979-12-15 DE DE19792950608 patent/DE2950608A1/de active Granted
- 1979-12-20 GB GB7943954A patent/GB2039479B/en not_active Expired
- 1979-12-21 US US06/105,988 patent/US4304930A/en not_active Expired - Lifetime
- 1979-12-27 FR FR7931784A patent/FR2445314A1/fr active Granted
- 1979-12-28 CH CH1151279A patent/CH646944A5/de not_active IP Right Cessation
- 1979-12-28 DD DD79218215A patent/DD149507A5/de not_active IP Right Cessation
- 1979-12-28 SU SU792860205A patent/SU1039439A3/ru active
- 1979-12-28 RO RO7999753A patent/RO79023A/ro unknown
-
1981
- 1981-08-12 US US06/292,194 patent/US4393008A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US4304930A (en) | 1981-12-08 |
| DD149507A5 (de) | 1981-07-15 |
| GB2039479A (en) | 1980-08-13 |
| FR2445314B1 (enExample) | 1984-09-07 |
| GB2039479B (en) | 1982-11-24 |
| SU1039439A3 (ru) | 1983-08-30 |
| US4393008A (en) | 1983-07-12 |
| FR2445314A1 (fr) | 1980-07-25 |
| RO79023A (ro) | 1982-12-06 |
| CH646944A5 (de) | 1984-12-28 |
| DE2950608A1 (de) | 1980-07-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0512211B1 (de) | Verfahren zur Herstellung von substituierten Malonesteraniliden und Malonsäure-monoaniliden | |
| DE2721264C2 (de) | Verfahren zur Herstellung von Di-n-propylessigsäure und deren nichttoxischen Alkali- und Erdalkalimetallsalzen | |
| DE2419970B2 (enExample) | ||
| DE19704449A1 (de) | Verfahren zur Herstellung von Malonsäure und Alkylmalonsäuren | |
| DE2950608C2 (enExample) | ||
| DE2751610A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| DD239591A5 (de) | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoesaeure | |
| DE2251556C3 (de) | Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| CH619955A5 (enExample) | ||
| EP0676390B1 (de) | Verfahren zur Herstellung von 1-Aminocyclopropancarbonsäurehydrochlorid | |
| DE1668990A1 (de) | Halogensubstituierte p-(p-Alkoxyphenoxy)-phenoxyalkancarbonsaeuren und die entsprechenden Alkylester und Alkancarbonsaeureamide | |
| DE2708185B2 (de) | Verfahren zur Herstellung von a -Ketocarbonsäuren (B) | |
| EP0811607B1 (de) | Verfahren zur Nitrosierung von C-H-aciden Verbindungen | |
| EP0037948B1 (de) | Verfahren zur Herstellung von N,N-Dimethyl-N'-(2-brom-4-methyl-phenyl)-triazen | |
| EP0050778A1 (de) | Verfahren zur Herstellung von Phosphonoformaldehyd-Hydrat | |
| EP0873984B1 (de) | Verfahren zur Herstellung von Alkyl- und Arylmalonsäuren | |
| DE2415061A1 (de) | Verfahren zur herstellung von 2nitrobenzaldehyd | |
| DE2619321C2 (de) | Oxalsäurederivate, ihre Herstellung und ihre Verwendung | |
| DE1768582C3 (enExample) | ||
| DD200795A5 (de) | Verfahren zur herstellung von diphenylaether-derivaten | |
| DE2065698A1 (de) | Verfahren zur herstellung von 2isopropyl-6-methyl-4(3h)-pyrimidon | |
| DE1802942C3 (de) | Verfahren zur Herstellung von Aminoketonen | |
| EP0115811A2 (de) | 2,4-Dichlor-5-thiazolcarboxaldehyd und ein Verfahren zu seiner Herstellung | |
| DE2513952C2 (de) | Verfahren zur herstellung von monochlorbenzoesaeuren | |
| DE19934231B4 (de) | Verfahren zur Herstellung von 1-substituierten 5-Hydroxy-imidazolin-2,4-dionen und 1-substituierten 5-Alkoxy-imidazolin-2,4-dionen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: C07C 59/68 |
|
| 8128 | New person/name/address of the agent |
Representative=s name: LOTTERHOS, H., DIPL.-ING. DR.-ING. BARTSCH, E., DI |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |