DD142543A5 - Verfahren zur herstellung von thiocarbamaten - Google Patents
Verfahren zur herstellung von thiocarbamaten Download PDFInfo
- Publication number
- DD142543A5 DD142543A5 DD79211717A DD21171779A DD142543A5 DD 142543 A5 DD142543 A5 DD 142543A5 DD 79211717 A DD79211717 A DD 79211717A DD 21171779 A DD21171779 A DD 21171779A DD 142543 A5 DD142543 A5 DD 142543A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- alkyl
- group
- alkenyl
- item
- reaction
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 43
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 title claims abstract description 32
- 238000002360 preparation method Methods 0.000 title claims abstract description 12
- 238000006243 chemical reaction Methods 0.000 claims abstract description 55
- 150000004820 halides Chemical class 0.000 claims abstract description 18
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims abstract description 8
- 230000003197 catalytic effect Effects 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- 125000003342 alkenyl group Chemical group 0.000 claims description 18
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 claims description 11
- -1 mtro Chemical group 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 125000005082 alkoxyalkenyl group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910001415 sodium ion Inorganic materials 0.000 claims description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 claims description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 229910001414 potassium ion Inorganic materials 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 4
- 125000004650 C1-C8 alkynyl group Chemical group 0.000 claims 1
- 125000003358 C2-C20 alkenyl group Chemical group 0.000 claims 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 claims 1
- 239000012736 aqueous medium Substances 0.000 abstract description 7
- 239000003054 catalyst Substances 0.000 description 24
- JJWKPURADFRFRB-UHFFFAOYSA-N carbonyl sulfide Chemical compound O=C=S JJWKPURADFRFRB-UHFFFAOYSA-N 0.000 description 19
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 13
- 239000000047 product Substances 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 239000002585 base Substances 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 8
- 125000001931 aliphatic group Chemical group 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 238000001816 cooling Methods 0.000 description 6
- 239000000376 reactant Substances 0.000 description 5
- 150000001340 alkali metals Chemical class 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UMGQVBVEWTXECF-UHFFFAOYSA-N 1,1,2,3-tetrachloroprop-1-ene Chemical compound ClCC(Cl)=C(Cl)Cl UMGQVBVEWTXECF-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- FEKGWIHDBVDVSM-UHFFFAOYSA-N 1,1,1,2-tetrachloropropane Chemical compound CC(Cl)C(Cl)(Cl)Cl FEKGWIHDBVDVSM-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- PDQRIMRBJSQRSL-UHFFFAOYSA-N di(propan-2-yl)carbamothioic s-acid Chemical compound CC(C)N(C(C)C)C(S)=O PDQRIMRBJSQRSL-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 150000003560 thiocarbamic acids Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- SPANOECCGNXGNR-UITAMQMPSA-N Diallat Chemical compound CC(C)N(C(C)C)C(=O)SC\C(Cl)=C\Cl SPANOECCGNXGNR-UITAMQMPSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OKUGPJPKMAEJOE-UHFFFAOYSA-N S-propyl dipropylcarbamothioate Chemical compound CCCSC(=O)N(CCC)CCC OKUGPJPKMAEJOE-UHFFFAOYSA-N 0.000 description 1
- MWBPRDONLNQCFV-UHFFFAOYSA-N Tri-allate Chemical compound CC(C)N(C(C)C)C(=O)SCC(Cl)=C(Cl)Cl MWBPRDONLNQCFV-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- XNRHTMDHGDWBGP-UHFFFAOYSA-N carbamic acid;hydrochloride Chemical compound Cl.NC(O)=O XNRHTMDHGDWBGP-UHFFFAOYSA-N 0.000 description 1
- GNVMUORYQLCPJZ-UHFFFAOYSA-N carbamothioic s-acid Chemical group NC(S)=O GNVMUORYQLCPJZ-UHFFFAOYSA-N 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C333/00—Derivatives of thiocarbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C333/02—Monothiocarbamic acids; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/889,175 US4147715A (en) | 1978-03-23 | 1978-03-23 | Thiocarbamate preparation utilizing quaternary ammonium salt catalysts |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD142543A5 true DD142543A5 (de) | 1980-07-02 |
Family
ID=25394632
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD79211717A DD142543A5 (de) | 1978-03-23 | 1979-03-21 | Verfahren zur herstellung von thiocarbamaten |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4147715A (cs) |
| EP (1) | EP0004377B1 (cs) |
| JP (1) | JPS6029704B2 (cs) |
| AR (1) | AR219792A1 (cs) |
| AU (1) | AU523600B2 (cs) |
| BR (1) | BR7901414A (cs) |
| CA (1) | CA1113483A (cs) |
| CS (1) | CS205143B2 (cs) |
| DD (1) | DD142543A5 (cs) |
| DE (1) | DE2962268D1 (cs) |
| DK (1) | DK120579A (cs) |
| ES (1) | ES479019A1 (cs) |
| HU (1) | HU175662B (cs) |
| IL (1) | IL56929A (cs) |
| IN (1) | IN149468B (cs) |
| PL (1) | PL117490B1 (cs) |
| RO (1) | RO76946A (cs) |
| YU (1) | YU33379A (cs) |
| ZA (1) | ZA791376B (cs) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS56138176A (en) * | 1980-03-31 | 1981-10-28 | Mitsubishi Petrochem Co Ltd | Preparation of thiolcarbamate derivative |
| JPS572265A (en) * | 1980-06-05 | 1982-01-07 | Ihara Chem Ind Co Ltd | Preparation of n-substituted thiolcarbamate |
| JPS572264A (en) * | 1980-06-05 | 1982-01-07 | Ihara Chem Ind Co Ltd | Preparation of n-substituted thiolcarbamate |
| NZ201284A (en) * | 1981-07-27 | 1985-08-16 | Stauffer Chemical Co | S-benzylthiolcarbamates as herbicides |
| US4447246A (en) * | 1983-05-16 | 1984-05-08 | Phillips Petroleum Company | Diesel fuel |
| US4922339A (en) * | 1988-03-31 | 1990-05-01 | Stout Video Systems | Means and method for visual surveillance and documentation |
| ATA11932000A (de) * | 2000-07-11 | 2005-04-15 | Greiner Perfoam Gmbh | Verfahren zur herstellung von schaumstoffprodukten |
| US6866797B1 (en) | 2000-08-03 | 2005-03-15 | Bj Services Company | Corrosion inhibitors and methods of use |
| US8078463B2 (en) * | 2004-11-23 | 2011-12-13 | Nice Systems, Ltd. | Method and apparatus for speaker spotting |
| US7575601B2 (en) * | 2006-04-27 | 2009-08-18 | Warsaw Orthopedic, Inc. | Locking expandable implant and method |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3330821A (en) * | 1959-05-06 | 1967-07-11 | Monsanto Co | Certain thiolcarbamate compounds |
| US3167571A (en) * | 1959-07-13 | 1965-01-26 | Monsanto Co | Manufacture of thiolcarbamates |
| US3992432A (en) * | 1967-04-05 | 1976-11-16 | Continental Oil Company | Phase transfer catalysis of heterogeneous reactions by quaternary salts |
| DE2738628A1 (de) * | 1976-09-03 | 1978-03-09 | Stauffer Chemical Co | Verfahren zur herstellung von estern von thiocarbamidsaeuren |
-
1978
- 1978-03-23 US US05/889,175 patent/US4147715A/en not_active Expired - Lifetime
-
1979
- 1979-02-13 YU YU00333/79A patent/YU33379A/xx unknown
- 1979-03-08 BR BR7901414A patent/BR7901414A/pt unknown
- 1979-03-15 CA CA323,621A patent/CA1113483A/en not_active Expired
- 1979-03-16 IN IN258/CAL/79A patent/IN149468B/en unknown
- 1979-03-20 JP JP54033168A patent/JPS6029704B2/ja not_active Expired
- 1979-03-21 EP EP79100860A patent/EP0004377B1/en not_active Expired
- 1979-03-21 DE DE7979100860T patent/DE2962268D1/de not_active Expired
- 1979-03-21 CS CS791852A patent/CS205143B2/cs unknown
- 1979-03-21 DD DD79211717A patent/DD142543A5/de unknown
- 1979-03-22 AU AU45338/79A patent/AU523600B2/en not_active Ceased
- 1979-03-22 IL IL56929A patent/IL56929A/xx unknown
- 1979-03-22 AR AR275913A patent/AR219792A1/es active
- 1979-03-22 ZA ZA791376A patent/ZA791376B/xx unknown
- 1979-03-22 RO RO7997010D patent/RO76946A/ro unknown
- 1979-03-23 PL PL1979214336A patent/PL117490B1/pl unknown
- 1979-03-23 DK DK120579A patent/DK120579A/da not_active Application Discontinuation
- 1979-03-23 HU HU79SA3168A patent/HU175662B/hu unknown
- 1979-03-28 ES ES479019A patent/ES479019A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IN149468B (cs) | 1981-12-19 |
| CS205143B2 (en) | 1981-04-30 |
| HU175662B (hu) | 1980-09-28 |
| AU523600B2 (en) | 1982-08-05 |
| YU33379A (en) | 1982-10-31 |
| DE2962268D1 (de) | 1982-04-15 |
| AR219792A1 (es) | 1980-09-15 |
| EP0004377B1 (en) | 1982-03-17 |
| RO76946A (ro) | 1982-02-26 |
| JPS6029704B2 (ja) | 1985-07-12 |
| ES479019A1 (es) | 1979-07-01 |
| JPS54132524A (en) | 1979-10-15 |
| BR7901414A (pt) | 1979-10-09 |
| DK120579A (da) | 1979-09-24 |
| AU4533879A (en) | 1979-09-27 |
| PL214336A1 (pl) | 1979-11-19 |
| ZA791376B (en) | 1980-06-25 |
| US4147715A (en) | 1979-04-03 |
| PL117490B1 (en) | 1981-08-31 |
| EP0004377A1 (en) | 1979-10-03 |
| IL56929A0 (en) | 1979-05-31 |
| IL56929A (en) | 1983-07-31 |
| CA1113483A (en) | 1981-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE112020001084T5 (de) | Arylsulfid mit Benzylaminstruktur und dessen Syntheseverfahren und Anwendung | |
| DD142543A5 (de) | Verfahren zur herstellung von thiocarbamaten | |
| DE2854078A1 (de) | Stabilisierte, waessrige, antimikrobielle zusammensetzung und verfahren zu ihrer herstellung | |
| DE2513789A1 (de) | Haloacylanilide als mikrobizide wirkstoffe | |
| DE1297111B (de) | Thiabicyclo-2-nonenverbindungen | |
| DE1493022A1 (de) | Verfahren zur Herstellung von alpha-Monochlor-N,N-dialkylacetessigsaeureamiden | |
| DE2265028B2 (de) | 2-amino-4-hydroxy-5-butyl-pyrimidin- piperid-1-yl-sulfonsaeureester und diese enthaltende fungizide mittel | |
| DE2105473B2 (cs) | ||
| CH640844A5 (de) | Isothiazole, deren herstellung und verwendung. | |
| DE2305517C3 (de) | 2-Imino-13-dithiacyclobutane, Verfahren zu ihrer Herstellung und sie enthaltende Warmblüterschutzmittel gegen Schildzecken | |
| DE19652531A1 (de) | Verfahren zur Herstellung eines 3-Isothiazolongemisches und eine das Gemisch enthaltende Zusammensetzung | |
| DE2604276A1 (de) | Verfahren zur alpha-chlorierung von alkylchloraromatischen verbindungen | |
| DE1292664B (de) | 1, 2, 3, 5, 6-Pentathiacycloheptan, Verfahren zu dessen Herstellung und Verwendung | |
| DE2851371C2 (de) | Verfahren zur Herstellung von Ketonen | |
| DE2735057A1 (de) | Verfahren zur herstellung von triorganozinnhalogeniden | |
| CH502302A (de) | Verfahren zur Herstellung neuer quaternärer Ammoniumsalze | |
| DE2611602A1 (de) | Jod-komplexe von dialkylsaeureamiden und n-alkyllactamen | |
| CH616430A5 (en) | Process for preparing organic esters of phosphorus | |
| US3202571A (en) | New fungicidal compounds | |
| AT299244B (de) | Verfahren zur Herstellung von neuen Organozinnverbindungen | |
| DE2215863C3 (de) | Jodäthylester aromatischer Carbonsäuren, Verfahren zu deren Herstellung sowie Mittel zur Beeinflussung des Pflanzenstoffwechsels enthaltend die genannten Ester | |
| DE2814453A1 (de) | Carbamoyloxyphenyl-verbindungen | |
| DE1793733A1 (de) | Salze von alkylcyancarbamaten mit o-phenylendiaminen, verfahren zu ihrer herstellung und solche verbindungen enthaltende mittel | |
| DE879695C (de) | Verfahren zur Herstellung von Salzen tertiaerer und quaternaerer AEthyleniminbasen | |
| AT209347B (de) | Verfahren zur Herstellung von neuen N-Thiotrichlormethylderivaten heterocyclischer Stickstoffverbindungen |