DD141304A5 - Verfahren zur herstellung von aethyl-und isopropylestern - Google Patents
Verfahren zur herstellung von aethyl-und isopropylestern Download PDFInfo
- Publication number
- DD141304A5 DD141304A5 DD79210454A DD21045479A DD141304A5 DD 141304 A5 DD141304 A5 DD 141304A5 DD 79210454 A DD79210454 A DD 79210454A DD 21045479 A DD21045479 A DD 21045479A DD 141304 A5 DD141304 A5 DD 141304A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- catalyst
- items
- reaction
- acid
- ethyl
- Prior art date
Links
- -1 ISOPROPYL ESTERS Chemical class 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 239000003054 catalyst Substances 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 9
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 9
- 239000005977 Ethylene Substances 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 7
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 7
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000007791 liquid phase Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 150000001735 carboxylic acids Chemical class 0.000 claims description 5
- 125000004494 ethyl ester group Chemical group 0.000 claims description 5
- 239000011541 reaction mixture Substances 0.000 claims description 4
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 2
- 229940011051 isopropyl acetate Drugs 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 2
- 238000010517 secondary reaction Methods 0.000 description 2
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229910000990 Ni alloy Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910000856 hastalloy Inorganic materials 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid group Chemical group C(CCCCC)(=O)O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 125000005395 methacrylic acid group Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000005608 naphthenic acid group Chemical group 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7801571A FR2414492A1 (fr) | 1978-01-16 | 1978-01-16 | Procede pour la preparation d'esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD141304A5 true DD141304A5 (de) | 1980-04-23 |
Family
ID=9203669
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD79210454A DD141304A5 (de) | 1978-01-16 | 1979-01-12 | Verfahren zur herstellung von aethyl-und isopropylestern |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4266076A (enExample) |
| EP (1) | EP0003206B1 (enExample) |
| JP (1) | JPS599537B2 (enExample) |
| BR (1) | BR7900231A (enExample) |
| CA (1) | CA1128542A (enExample) |
| DD (1) | DD141304A5 (enExample) |
| DE (1) | DE2960204D1 (enExample) |
| DK (1) | DK18879A (enExample) |
| ES (1) | ES476886A1 (enExample) |
| FR (1) | FR2414492A1 (enExample) |
| NO (1) | NO790099L (enExample) |
| YU (1) | YU6679A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1234837A (en) * | 1983-06-28 | 1988-04-05 | Robert J. Knopf | Continuous process for producing linear, secondary, aliphatic alcohols |
| US4921999A (en) * | 1988-08-23 | 1990-05-01 | General Electric Company | Method for making tertiary butyl esters |
| JP2002080422A (ja) * | 2000-09-06 | 2002-03-19 | Daikin Ind Ltd | トリフルオロ酢酸エチルの合成方法 |
| US9328054B1 (en) | 2013-09-27 | 2016-05-03 | Travis Danner | Method of alcoholisis of fatty acids and fatty acid gyicerides |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA447461A (en) * | 1948-03-23 | A. Bruson Herman | Ester of hydroxydihydronorpolycyclopentadiene | |
| US2006734A (en) * | 1933-09-02 | 1935-07-02 | Shell Dev | Production of esterified olefines |
| US2224809A (en) * | 1935-10-21 | 1940-12-10 | Dow Chemical Co | Method of making isopropyl esters of aliphatic acids |
| US2551643A (en) * | 1949-01-25 | 1951-05-08 | Socony Vacuum Oil Co Inc | Synthetic lubricants from alphamonoolefins and unsaturated esters and method for producing the same |
| US2858331A (en) * | 1953-10-21 | 1958-10-28 | Exxon Research Engineering Co | Production of chemicals from olefins with aid of a perfluoroacid |
| US3474131A (en) * | 1966-10-31 | 1969-10-21 | Universal Oil Prod Co | Preparation of primary alkyl esters |
| US3907873A (en) * | 1970-05-14 | 1975-09-23 | Int Flavors & Fragrances Inc | Novel fragrance materials and process |
| US4048220A (en) * | 1975-05-30 | 1977-09-13 | Scm Corporation | Process for preparation of 1,4-haloallylic esters from dienes |
-
1978
- 1978-01-16 FR FR7801571A patent/FR2414492A1/fr active Granted
-
1979
- 1979-01-10 DE DE7979420002T patent/DE2960204D1/de not_active Expired
- 1979-01-10 EP EP79420002A patent/EP0003206B1/fr not_active Expired
- 1979-01-11 JP JP54002126A patent/JPS599537B2/ja not_active Expired
- 1979-01-12 DD DD79210454A patent/DD141304A5/de unknown
- 1979-01-12 NO NO790099A patent/NO790099L/no unknown
- 1979-01-15 YU YU00066/79A patent/YU6679A/xx unknown
- 1979-01-15 BR BR7900231A patent/BR7900231A/pt unknown
- 1979-01-15 CA CA319,670A patent/CA1128542A/fr not_active Expired
- 1979-01-16 ES ES476886A patent/ES476886A1/es not_active Expired
- 1979-01-16 DK DK18879A patent/DK18879A/da not_active Application Discontinuation
- 1979-01-16 US US06/003,815 patent/US4266076A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS599537B2 (ja) | 1984-03-03 |
| DE2960204D1 (en) | 1981-04-16 |
| CA1128542A (fr) | 1982-07-27 |
| EP0003206A1 (fr) | 1979-07-25 |
| YU6679A (en) | 1982-10-31 |
| ES476886A1 (es) | 1979-05-16 |
| US4266076A (en) | 1981-05-05 |
| JPS54130513A (en) | 1979-10-09 |
| FR2414492B1 (enExample) | 1980-08-22 |
| BR7900231A (pt) | 1979-08-14 |
| NO790099L (no) | 1979-07-17 |
| EP0003206B1 (fr) | 1981-03-25 |
| FR2414492A1 (fr) | 1979-08-10 |
| DK18879A (da) | 1979-07-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2848369C3 (de) | Verfahren zur Herstellung von Carbonsäureestern | |
| DE60020128T2 (de) | Rhodium/anorganisches iodid katalysatorsystem für das verfahren zur methanolcarbonylierung mit verbessertem verunreinigungsprofil | |
| DE2847170C2 (de) | Verfahren zur kontinuierlichen Herstellung von Terephthalsäure | |
| EP0304763A1 (de) | Verfahren zur Herstellung von Ethercarbonsäuren | |
| EP0335295A2 (de) | Verfahren zur Herstellung von Carbonsäureestern von Alkylenglykolethern und deren Verwendung | |
| DD141304A5 (de) | Verfahren zur herstellung von aethyl-und isopropylestern | |
| DE2820518A1 (de) | Verfahren zur herstellung von 3- hydroxy-2,2,4-trimethylpentylisobutyrat | |
| DE2908934A1 (de) | Verfahren zur herstellung von benzolcarbonsaeuren | |
| DE3221173C2 (de) | Verfahren zur Herstellung von Isobutyrylfluorid | |
| EP0647614B1 (de) | Verfahren zur Herstellung von 5-Fluoranthranilsäure | |
| DE2126785C3 (de) | Verfahren zur Herstellung eines C tief 1 -bis C tief 4 -Fettsäurediesters von Bis (beta-hydroxyäthyl) therephthalat | |
| EP0091604A1 (de) | Verfahren zur Herstellung von Isobuttersäurefluorid bzw. Isobuttersäure | |
| AT262954B (de) | Verfahren zur Herstellung von ɛ-Caprolacton und seiner Alkylderivate | |
| DE60009785T2 (de) | Verfahren zur Herstellung von Pyromellitsäure | |
| DE2337158C2 (de) | Verfahren zur Herstellung von Alkancarbonsäuren | |
| DE1111163B (de) | Verfahren zur Herstellung von Gemischen aus ª‡, ª‡, ª†- und ª‡, ª†, ª†-Trimethyladipinsaeure | |
| EP0128489B1 (de) | Verfahren zur Herstellung von Succinylobernsteinsäuredialkylestern | |
| DE2632898A1 (de) | Kobaltkatalysierte oxidation von gesaettigten, aliphatischen c tief 3 - c tief 7 -kohlenwasserstoffen zu essigsaeure | |
| DD141303A5 (de) | Verfahren zur herstellung von aethylestern | |
| DE1957996C3 (de) | Verfahren zur Herstellung von Monocarbonsäurediestern von 2-Methylenpropandiol-13 | |
| DE1568980C (de) | Verfahren zur Herstellung von Glykol estern von Carbonsauren | |
| DE3545583A1 (de) | Verfahren zur herstellung organischer ester aus halogenkohlenstoffverbindungen | |
| DE2264906C3 (de) | Verfahren zur Herstellung von Vorläufern für Polyethylenterephthalat | |
| EP0032989A1 (de) | Verfahren zur Herstellung von alpha-Epoxiden mit 11 bis 24 Kohlenstoffatomen | |
| DE1283832B (de) | Verfahren zur Herstellung von Anhydriden der Sorbinsaeure |