CS264254B2 - Servo system for vehicle brakes system - Google Patents
Servo system for vehicle brakes system Download PDFInfo
- Publication number
- CS264254B2 CS264254B2 CS786839A CS683978A CS264254B2 CS 264254 B2 CS264254 B2 CS 264254B2 CS 786839 A CS786839 A CS 786839A CS 683978 A CS683978 A CS 683978A CS 264254 B2 CS264254 B2 CS 264254B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- rod
- housing
- wall
- servo
- servo device
- Prior art date
Links
- 239000012528 membrane Substances 0.000 claims abstract description 43
- 238000007789 sealing Methods 0.000 claims description 16
- 239000004033 plastic Substances 0.000 abstract description 7
- 229920003023 plastic Polymers 0.000 abstract description 7
- 229910052751 metal Inorganic materials 0.000 abstract description 5
- 239000002184 metal Substances 0.000 abstract description 5
- 238000000465 moulding Methods 0.000 abstract description 3
- 230000003014 reinforcing effect Effects 0.000 abstract description 2
- 230000002787 reinforcement Effects 0.000 description 12
- 230000002093 peripheral effect Effects 0.000 description 9
- 239000003570 air Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 4
- 238000010276 construction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003351 stiffener Substances 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000012080 ambient air Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 238000003466 welding Methods 0.000 description 2
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- 229910000851 Alloy steel Inorganic materials 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000003546 flue gas Substances 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 239000003562 lightweight material Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000002991 molded plastic Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- GUIJLPKNGJMXKV-AZUAARDMSA-N rod-188 Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1[C@@H]([C@H]2OC(=O)CC2)C2=CC=CC=C2CC1 GUIJLPKNGJMXKV-AZUAARDMSA-N 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60T—VEHICLE BRAKE CONTROL SYSTEMS OR PARTS THEREOF; BRAKE CONTROL SYSTEMS OR PARTS THEREOF, IN GENERAL; ARRANGEMENT OF BRAKING ELEMENTS ON VEHICLES IN GENERAL; PORTABLE DEVICES FOR PREVENTING UNWANTED MOVEMENT OF VEHICLES; VEHICLE MODIFICATIONS TO FACILITATE COOLING OF BRAKES
- B60T13/00—Transmitting braking action from initiating means to ultimate brake actuator with power assistance or drive; Brake systems incorporating such transmitting means, e.g. air-pressure brake systems
- B60T13/10—Transmitting braking action from initiating means to ultimate brake actuator with power assistance or drive; Brake systems incorporating such transmitting means, e.g. air-pressure brake systems with fluid assistance, drive, or release
- B60T13/24—Transmitting braking action from initiating means to ultimate brake actuator with power assistance or drive; Brake systems incorporating such transmitting means, e.g. air-pressure brake systems with fluid assistance, drive, or release the fluid being gaseous
- B60T13/46—Vacuum systems
- B60T13/52—Vacuum systems indirect, i.e. vacuum booster units
- B60T13/567—Vacuum systems indirect, i.e. vacuum booster units characterised by constructional features of the casing or by its strengthening or mounting arrangements
- B60T13/5675—Supportstruts
Landscapes
- Engineering & Computer Science (AREA)
- Transportation (AREA)
- Mechanical Engineering (AREA)
- Braking Systems And Boosters (AREA)
- Valves And Accessory Devices For Braking Systems (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4364477 | 1977-10-20 | ||
| GB248878 | 1978-01-21 | ||
| GB7829255 | 1978-07-08 | ||
| GB7829253 | 1978-07-08 | ||
| AU46990/79A AU534064B2 (en) | 1977-10-20 | 1979-05-11 | Servo booster for vehicle braking systems |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS683978A2 CS683978A2 (en) | 1988-09-16 |
| CS264254B2 true CS264254B2 (en) | 1989-06-13 |
Family
ID=27506935
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS786839A CS264254B2 (en) | 1977-10-20 | 1978-10-20 | Servo system for vehicle brakes system |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS6048379B2 (pl) |
| AR (1) | AR216959A1 (pl) |
| AU (1) | AU534064B2 (pl) |
| CS (1) | CS264254B2 (pl) |
| DE (1) | DE2845794C2 (pl) |
| ES (1) | ES474387A1 (pl) |
| IT (1) | IT1099395B (pl) |
| PH (1) | PH18419A (pl) |
| PL (1) | PL114889B1 (pl) |
| PT (1) | PT68684A (pl) |
| TR (1) | TR20168A (pl) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES480732A2 (es) * | 1978-05-20 | 1980-07-01 | Girling Ltd | Servo-amplificador de fuerza para sistema de frenos de vehi-culo. |
| JPS592667B2 (ja) * | 1978-05-31 | 1984-01-19 | トキコ株式会社 | 気圧式倍力装置 |
| DE2830262A1 (de) * | 1978-07-10 | 1980-01-24 | Teves Gmbh Alfred | Bremskraftverstaerker fuer ein kraftfahrzeug |
| DE2918912A1 (de) * | 1979-05-10 | 1980-12-11 | Teves Gmbh Alfred | Bremskraftverstaerker |
| AU530317B2 (en) * | 1978-09-20 | 1983-07-14 | Tokico Ltd. | Vacuum booster for hydraulic brakes |
| DE2908516A1 (de) * | 1979-03-05 | 1980-10-16 | Teves Gmbh Alfred | Bremskraftverstaerker fuer ein kraftfahrzeug |
| DE2918914A1 (de) * | 1979-05-10 | 1980-12-11 | Teves Gmbh Alfred | Bremskraftverstaerker |
| DE2918911A1 (de) * | 1979-05-10 | 1980-12-11 | Teves Gmbh Alfred | Bremskraftverstaerker fuer kraftfahrzeuge |
| JPS5923653Y2 (ja) * | 1979-07-20 | 1984-07-13 | トキコ株式会社 | 気圧式倍力装置 |
| DE2941198A1 (de) * | 1979-10-11 | 1981-05-14 | Alfred Teves Gmbh, 6000 Frankfurt | Hauptbremszylinder fuer eine hydraulische bremsanlage |
| DE3007148A1 (de) | 1980-02-26 | 1981-09-03 | FAG Kugelfischer Georg Schäfer & Co, 8720 Schweinfurt | Hydraulisch, pneumatisches bremskraftverstaerkergeraet |
| JPS56120443A (en) * | 1980-02-27 | 1981-09-21 | Aisin Seiki Co Ltd | Brake booster for automobile |
| JPS5718551A (en) * | 1980-05-28 | 1982-01-30 | Nissin Kogyo Kk | Negative pressure type doubler device |
| DE3031206A1 (de) * | 1980-08-19 | 1982-04-01 | Alfred Teves Gmbh, 6000 Frankfurt | Unterdruckgehaeuse fuer einen bremskraftverstaerker |
| DE3031247A1 (de) * | 1980-08-19 | 1982-03-25 | Alfred Teves Gmbh, 6000 Frankfurt | Unterdruckgehaeuse fuer einen bremskraftverstaerker |
| DE3032049A1 (de) * | 1980-08-26 | 1982-04-08 | Alfred Teves Gmbh, 6000 Frankfurt | Unterdruckgehaeuse fuer einen bremskraftverstaerker |
| DE3133121A1 (de) * | 1980-08-26 | 1982-04-29 | Alfred Teves Gmbh, 6000 Frankfurt | Bremskraftverstaerker fuer kraftfahrzeuge |
| JPS5758548A (en) * | 1980-09-26 | 1982-04-08 | Nissin Kogyo Kk | Pneumatic pressure type doubler device |
| DE3037421A1 (de) * | 1980-10-03 | 1982-05-06 | Alfred Teves Gmbh, 6000 Frankfurt | Unterdruckgehaeuse fuer einen bremskraftverstaerker |
| DE3041883A1 (de) * | 1980-11-06 | 1982-06-09 | Alfred Teves Gmbh, 6000 Frankfurt | Unterdruckgehaeuse fuer einen bremskrftverstaerker |
| JPS5751561A (en) * | 1980-12-06 | 1982-03-26 | Nissin Kogyo Kk | Assembly unit of power magnifying device and master cylinder |
| DE3203495C2 (de) * | 1982-02-03 | 1986-04-10 | FAG Kugelfischer Georg Schäfer KGaA, 8720 Schweinfurt | Vorrichtung zur gemeinsamen Befestigung eines Bremskraftverstärkers und eines Hauptbremszylinders am Kraftfahrzeug |
| DE4209648A1 (de) * | 1992-03-25 | 1993-09-30 | Teves Gmbh Alfred | Betätigungseinheit für eine hydraulische Kraftfahrzeugbremsanlage |
| DE4228656A1 (de) * | 1992-05-15 | 1993-11-18 | Teves Gmbh Alfred | Unterdruckbremskraftverstärker für Kraftfahrzeuge |
| DE19523021A1 (de) * | 1995-06-24 | 1997-01-02 | Teves Gmbh Alfred | Unterdruckbremskraftverstärker für Kraftfahrzeuge |
| DE29514063U1 (de) * | 1995-09-01 | 1997-01-09 | Lucas Industries P.L.C., Solihull, West Midlands | Bremskraftverstärker/Hauptzylinder-Einheit mit Verbindungsbolzen |
| GB9519753D0 (en) * | 1995-09-28 | 1995-11-29 | Lucas Ind Plc | Improvements in pneumatically-operated boosters for vehicle braking systems |
| DE19716404C1 (de) | 1997-04-18 | 1998-10-29 | Lucas Automotive Gmbh | Hydraulische Bremsanlage für Kraftfahrzeuge |
| US6161903A (en) * | 1997-04-18 | 2000-12-19 | Lucas Industries Public Limited Company | Brake-pressure-transmitter arrangement for a hydraulic motor-vehicle brake system, and brake system equipped therewith |
| DE19825110C1 (de) * | 1998-06-05 | 2000-02-03 | Lucas Automotive Gmbh | Bremsdruckgebervorrichtung für eine hydraulische Fahrzeugbremsanlage |
| DE10138301A1 (de) | 2001-08-10 | 2003-02-27 | Continental Teves Ag & Co Ohg | Gegen Crash gesicherter Unterdruckbremskraftverstärker für Kraftfahrzeuge |
| DE10302780B4 (de) * | 2003-01-24 | 2008-04-24 | Lucas Automotive Gmbh | Ventilelement für ein Steuerventil eines Bremskraftverstärkers, Bremskraftverstärker und Verfahren zur Herstellung eines Ventilelements |
| DE10359175A1 (de) * | 2003-05-14 | 2004-12-02 | Continental Teves Ag & Co. Ohg | Gehäusemodul für einen Bremskraftverstärker |
| DE502004003054D1 (de) | 2003-05-14 | 2007-04-12 | Continental Teves Ag & Co Ohg | Gehäusemodul für einen bremskraftverstärker |
| DE10329488A1 (de) * | 2003-07-01 | 2005-01-27 | Continental Teves Ag & Co. Ohg | Bremskraftverstärker |
| DE102009018604A1 (de) | 2008-05-24 | 2009-12-03 | Continental Teves Ag & Co. Ohg | Gehäuse für ein Bauteil einer Kraftfahrzeugbremsanlage |
| DE102010001812B4 (de) * | 2009-04-21 | 2024-09-19 | Continental Automotive Technologies GmbH | Pneumatischer Bremskraftverstärker |
| DE102015217520A1 (de) * | 2015-09-14 | 2017-03-16 | Robert Bosch Gmbh | Elektromechanischer Bremskraftverstärker und Bremssystem |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2369797A (en) * | 1942-05-04 | 1945-02-20 | Trico Products Corp | Window operator |
| CH368383A (de) * | 1959-02-21 | 1963-03-31 | Straumann Inst Ag | Druckübertrager |
| US2987888A (en) * | 1959-11-23 | 1961-06-13 | Crowell Designs Inc | Hydraulic master drive unit |
| US3312147A (en) * | 1966-03-07 | 1967-04-04 | Bendix Corp | Fluid pressure servomotor |
| US3910165A (en) * | 1972-11-20 | 1975-10-07 | John M Sheesley | Extended guide-tie rods |
| DE2308291C3 (de) * | 1973-02-20 | 1979-04-05 | Research Engineering Co., Houston, Tex. (V.St.A.) | Stellantrieb mit Rfickschnellf ederung für Ventile u.dgl |
-
1978
- 1978-10-20 ES ES474387A patent/ES474387A1/es not_active Expired
- 1978-10-20 PL PL1978210408A patent/PL114889B1/pl unknown
- 1978-10-20 AR AR274166A patent/AR216959A1/es active
- 1978-10-20 JP JP53129422A patent/JPS6048379B2/ja not_active Expired
- 1978-10-20 DE DE2845794A patent/DE2845794C2/de not_active Expired
- 1978-10-20 TR TR20168A patent/TR20168A/xx unknown
- 1978-10-20 PH PH21720A patent/PH18419A/en unknown
- 1978-10-20 IT IT28945/78A patent/IT1099395B/it active
- 1978-10-20 CS CS786839A patent/CS264254B2/cs unknown
- 1978-10-20 PT PT68684A patent/PT68684A/pt unknown
-
1979
- 1979-05-11 AU AU46990/79A patent/AU534064B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| TR20168A (tr) | 1980-09-29 |
| DE2845794C2 (de) | 1988-12-22 |
| PT68684A (en) | 1978-11-01 |
| ES474387A1 (es) | 1979-11-01 |
| PH18419A (en) | 1985-06-26 |
| AR216959A1 (es) | 1980-02-15 |
| PL114889B1 (en) | 1981-02-28 |
| JPS6048379B2 (ja) | 1985-10-26 |
| JPS5477873A (en) | 1979-06-21 |
| AU4699079A (en) | 1980-11-13 |
| IT1099395B (it) | 1985-09-18 |
| PL210408A1 (pl) | 1979-07-16 |
| CS683978A2 (en) | 1988-09-16 |
| IT7828945A0 (it) | 1978-10-20 |
| AU534064B2 (en) | 1984-01-05 |
| DE2845794A1 (de) | 1979-04-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS264254B2 (en) | Servo system for vehicle brakes system | |
| US4256016A (en) | Servo booster for vehicle braking systems | |
| US4417500A (en) | Air pressure servomotor | |
| US3053235A (en) | Fluid pressure motor construction | |
| US4270353A (en) | Servo boosters for vehicle brake systems | |
| US4286501A (en) | Servo boosters for vehicle braking systems | |
| US4069742A (en) | Power brake booster system | |
| US4338854A (en) | Servo boosters for vehicle braking systems | |
| GB2079390A (en) | Brake booster | |
| US4377966A (en) | Servo boosters for vehicle braking systems | |
| JPS5996049A (ja) | 動力援助ブレ−キ装置用サ−ボモ−タ | |
| US4328738A (en) | Vacuum servo booster | |
| GB2092251A (en) | Vacuum booster assembly | |
| US4270438A (en) | Servo boosters for vehicle braking systems | |
| KR840002437B1 (ko) | 보조제동(制動)용 서어보 모우터 | |
| US4428274A (en) | Vacuum booster device | |
| GB2087498A (en) | Vacuum suspended brake booster | |
| US20120304849A1 (en) | Vacuum booster for a vehicular brake | |
| GB2082275A (en) | Brake Booster | |
| US4655119A (en) | Low-pressure casing for a brake booster | |
| JP2739875B2 (ja) | 車両ブレーキ装置用空気圧倍力装置 | |
| EP0009393B1 (en) | Pneumatic force multiplying device | |
| US4474103A (en) | Brake boosters | |
| SK103395A3 (en) | Vacuum brake booster for motor vehicles | |
| US6578360B2 (en) | Master cylinder |