CS202093B2 - Halogen atoms containing polymers with retarded burning - Google Patents
Halogen atoms containing polymers with retarded burning Download PDFInfo
- Publication number
- CS202093B2 CS202093B2 CS78575A CS57578A CS202093B2 CS 202093 B2 CS202093 B2 CS 202093B2 CS 78575 A CS78575 A CS 78575A CS 57578 A CS57578 A CS 57578A CS 202093 B2 CS202093 B2 CS 202093B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- polymer
- halogen
- polymers
- group
- compounds
- Prior art date
Links
- 229920000642 polymer Polymers 0.000 title claims abstract description 79
- 125000005843 halogen group Chemical group 0.000 title claims description 20
- 239000000203 mixture Substances 0.000 claims abstract description 30
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 24
- 150000002367 halogens Chemical class 0.000 claims abstract description 24
- 230000002378 acidificating effect Effects 0.000 claims abstract description 5
- 150000007514 bases Chemical class 0.000 claims abstract description 5
- 239000000463 material Substances 0.000 claims abstract description 4
- 238000000197 pyrolysis Methods 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 24
- 239000003063 flame retardant Substances 0.000 claims description 16
- -1 polypropylene Polymers 0.000 claims description 16
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 claims description 9
- 239000000347 magnesium hydroxide Substances 0.000 claims description 9
- 229910001862 magnesium hydroxide Inorganic materials 0.000 claims description 9
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 239000000178 monomer Substances 0.000 claims description 6
- 150000002894 organic compounds Chemical class 0.000 claims description 6
- 229920000728 polyester Polymers 0.000 claims description 6
- 150000001298 alcohols Chemical class 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 239000006227 byproduct Substances 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 229920001577 copolymer Polymers 0.000 claims description 4
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 claims description 4
- 239000004593 Epoxy Substances 0.000 claims description 3
- 239000004952 Polyamide Substances 0.000 claims description 3
- 239000004743 Polypropylene Substances 0.000 claims description 3
- 239000004793 Polystyrene Substances 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 3
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 3
- 239000000920 calcium hydroxide Substances 0.000 claims description 3
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 3
- 229920002647 polyamide Polymers 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 229920002223 polystyrene Polymers 0.000 claims description 3
- 229920001897 terpolymer Polymers 0.000 claims description 3
- 239000011686 zinc sulphate Substances 0.000 claims description 3
- 235000009529 zinc sulphate Nutrition 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 150000002009 diols Chemical class 0.000 claims description 2
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 claims description 2
- 239000004417 polycarbonate Substances 0.000 claims description 2
- 229920000515 polycarbonate Polymers 0.000 claims description 2
- 229920006395 saturated elastomer Chemical class 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 2
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 claims 1
- 239000001273 butane Substances 0.000 claims 1
- 150000001991 dicarboxylic acids Chemical class 0.000 claims 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 claims 1
- 229920000098 polyolefin Polymers 0.000 claims 1
- 229910052722 tritium Inorganic materials 0.000 claims 1
- 239000005083 Zinc sulfide Substances 0.000 abstract description 31
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 abstract description 31
- 229910052984 zinc sulfide Inorganic materials 0.000 abstract description 26
- 229920005613 synthetic organic polymer Polymers 0.000 abstract description 6
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 43
- 238000012360 testing method Methods 0.000 description 19
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 18
- 239000001301 oxygen Substances 0.000 description 18
- 229910052760 oxygen Inorganic materials 0.000 description 18
- 238000002485 combustion reaction Methods 0.000 description 12
- 238000009472 formulation Methods 0.000 description 11
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical group N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 8
- 239000003517 fume Substances 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 7
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 7
- 229910052788 barium Inorganic materials 0.000 description 7
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 7
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 7
- 150000003752 zinc compounds Chemical class 0.000 description 7
- 230000002411 adverse Effects 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 229930195733 hydrocarbon Natural products 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 229910000019 calcium carbonate Inorganic materials 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- 238000002834 transmittance Methods 0.000 description 4
- 239000011787 zinc oxide Substances 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- 239000002861 polymer material Substances 0.000 description 3
- 229920000915 polyvinyl chloride Polymers 0.000 description 3
- 239000004800 polyvinyl chloride Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000007598 dipping method Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 229920000620 organic polymer Polymers 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000779 smoke Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 235000012424 soybean oil Nutrition 0.000 description 2
- 239000003549 soybean oil Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229960001763 zinc sulfate Drugs 0.000 description 2
- 229910000368 zinc sulfate Inorganic materials 0.000 description 2
- BMSUWQXMTMGEOM-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-ethenylbenzene Chemical compound BrC1=C(Br)C(Br)=C(C=C)C(Br)=C1Br BMSUWQXMTMGEOM-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical class CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 241000168096 Glareolidae Species 0.000 description 1
- 102100020870 La-related protein 6 Human genes 0.000 description 1
- 108050008265 La-related protein 6 Proteins 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920001944 Plastisol Polymers 0.000 description 1
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical class CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- QHWKHLYUUZGSCW-UHFFFAOYSA-N Tetrabromophthalic anhydride Chemical compound BrC1=C(Br)C(Br)=C2C(=O)OC(=O)C2=C1Br QHWKHLYUUZGSCW-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- KYIKRXIYLAGAKQ-UHFFFAOYSA-N abcn Chemical compound C1CCCCC1(C#N)N=NC1(C#N)CCCCC1 KYIKRXIYLAGAKQ-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000004951 benzene Polymers 0.000 description 1
- 150000001555 benzenes Polymers 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- ZFMQKOWCDKKBIF-UHFFFAOYSA-N bis(3,5-difluorophenyl)phosphane Chemical compound FC1=CC(F)=CC(PC=2C=C(F)C=C(F)C=2)=C1 ZFMQKOWCDKKBIF-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 235000013844 butane Nutrition 0.000 description 1
- FEXXLIKDYGCVGJ-UHFFFAOYSA-N butyl 8-(3-octyloxiran-2-yl)octanoate Chemical compound CCCCCCCCC1OC1CCCCCCCC(=O)OCCCC FEXXLIKDYGCVGJ-UHFFFAOYSA-N 0.000 description 1
- 229940065285 cadmium compound Drugs 0.000 description 1
- 150000001662 cadmium compounds Chemical class 0.000 description 1
- LVZWBOGDXURBJA-UHFFFAOYSA-N cadmium;octadecanoic acid Chemical compound [Cd].CCCCCCCCCCCCCCCCCC(O)=O LVZWBOGDXURBJA-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- WHHGLZMJPXIBIX-UHFFFAOYSA-N decabromodiphenyl ether Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br WHHGLZMJPXIBIX-UHFFFAOYSA-N 0.000 description 1
- 238000001739 density measurement Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000007590 electrostatic spraying Methods 0.000 description 1
- 230000002996 emotional effect Effects 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000000816 ethylene group Chemical class [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 210000001061 forehead Anatomy 0.000 description 1
- 239000005350 fused silica glass Substances 0.000 description 1
- 238000002309 gasification Methods 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 150000007974 melamines Chemical class 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 125000001997 phenyl group Polymers [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004999 plastisol Substances 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000013849 propane Nutrition 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- OQQUTVSCNMFMID-UHFFFAOYSA-N s-(benzoyldisulfanyl) benzenecarbothioate Chemical compound C=1C=CC=CC=1C(=O)SSSC(=O)C1=CC=CC=C1 OQQUTVSCNMFMID-UHFFFAOYSA-N 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- LGERWORIZMAZTA-UHFFFAOYSA-N silicon zinc Chemical compound [Si].[Zn] LGERWORIZMAZTA-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 1
- 229920006305 unsaturated polyester Polymers 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 229940007718 zinc hydroxide Drugs 0.000 description 1
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-RKEGKUSMSA-N zinc-72 Chemical compound [72Zn] HCHKCACWOHOZIP-RKEGKUSMSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/30—Sulfur-, selenium- or tellurium-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS791313A CS202094B2 (cs) | 1977-01-28 | 1979-02-27 | Prostředek pro zpomaleni hoření syntetických organických polymerů |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/763,350 US4111905A (en) | 1977-01-28 | 1977-01-28 | Flame retarding agents and polymer compositions containing same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS202093B2 true CS202093B2 (en) | 1980-12-31 |
Family
ID=25067581
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS78575A CS202093B2 (en) | 1977-01-28 | 1978-01-27 | Halogen atoms containing polymers with retarded burning |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4111905A (pl) |
| JP (2) | JPS5943054B2 (pl) |
| AU (1) | AU513572B2 (pl) |
| BE (1) | BE863260A (pl) |
| BR (1) | BR7800493A (pl) |
| CA (1) | CA1102937A (pl) |
| CS (1) | CS202093B2 (pl) |
| DE (1) | DE2802047C2 (pl) |
| ES (1) | ES466335A1 (pl) |
| FR (2) | FR2383985A1 (pl) |
| GB (1) | GB1591692A (pl) |
| IT (1) | IT1103085B (pl) |
| NL (1) | NL181585C (pl) |
| PL (1) | PL112659B1 (pl) |
| SE (1) | SE443148B (pl) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4346187A (en) * | 1977-11-21 | 1982-08-24 | Borg-Warner Chemicals, Inc. | Flame retardant polypropylene compositions containing trityl synergists |
| US4373044A (en) * | 1979-11-28 | 1983-02-08 | Ciba-Geigy Corporation | Flame-proofed plastics moulding compounds |
| US4859366A (en) * | 1985-11-27 | 1989-08-22 | Shell Oil Company | Low smoke modified polypropylene insulation compositions |
| JPH03157448A (ja) * | 1989-11-15 | 1991-07-05 | Mitsubishi Electric Corp | 半導体封止用エポキシ樹脂組成物 |
| IL97956A0 (en) * | 1990-05-10 | 1992-06-21 | Raychem Corp | Stabilizing ethylene-tetrafluoroethylene copolymers |
| EP0796892A1 (de) * | 1996-03-22 | 1997-09-24 | Metallgesellschaft Ag | Flammhemmende, raucharme und thermostabile Polymerzusammensetzung |
| US6071612A (en) * | 1999-10-22 | 2000-06-06 | Arteva North America S.A.R.L. | Fiber and filament with zinc sulfide delusterant |
| FR2846976B1 (fr) * | 2002-11-08 | 2005-12-09 | Rhodianyl | Fils,fibres,filaments et articles textiles a activite antibacterienne et antifongique |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2711968A (en) * | 1952-09-05 | 1955-06-28 | Monsanto Chemicals | Stabilization of zinc sulfide white pigment |
| US2772158A (en) * | 1953-02-18 | 1956-11-27 | Ferro Corp | Photographic method using a light sensitive resin composition |
| US2905555A (en) * | 1957-08-19 | 1959-09-22 | Ferro Corp | Photosensitive composition of matter and method of making same |
| US3202629A (en) * | 1959-04-17 | 1965-08-24 | Anaconda Wire & Cable Co | Cross-linked composition of polyethylene with pigment of the group consisting of lithopone and antimony oxide |
| BE597511A (pl) * | 1959-11-25 | 1900-01-01 | ||
| BE636312A (pl) * | 1962-10-31 | |||
| NL121883C (pl) * | 1962-10-31 | |||
| US3331811A (en) * | 1964-05-18 | 1967-07-18 | Allied Chem | Stabilized trifluorochloroethylene polymers containing (a) zinc oxide and (b) hydroquinone or chloranil |
| US3535257A (en) * | 1967-08-04 | 1970-10-20 | Hercules Inc | Stabilization of olefin polymers against copper-induced degradation |
| GB1237164A (en) * | 1968-04-27 | 1971-06-30 | Mitsubishi Rayon Co | Polymer paper and method for preparing the same |
| US3962154A (en) * | 1971-06-01 | 1976-06-08 | Standard Oil Company | Method for producing an improved molded thermoplastic article |
| US3912792A (en) * | 1972-08-04 | 1975-10-14 | M & T Chemicals Inc | Flame retardant compositions |
| US3900441A (en) * | 1973-03-12 | 1975-08-19 | Armstrong Cork Co | Zinc and molybdenum-containing compounds as smoke depressants for poly(vinyl chloride) resin compositions |
| US3945974A (en) * | 1973-12-20 | 1976-03-23 | N L Industries, Inc. | Smoke suppressants for halogen-containing plastic compositions |
-
1977
- 1977-01-28 US US05/763,350 patent/US4111905A/en not_active Expired - Lifetime
-
1978
- 1978-01-10 GB GB927/78A patent/GB1591692A/en not_active Expired
- 1978-01-11 AU AU32342/78A patent/AU513572B2/en not_active Expired
- 1978-01-18 DE DE2802047A patent/DE2802047C2/de not_active Expired
- 1978-01-23 NL NLAANVRAGE7800788,A patent/NL181585C/xx not_active IP Right Cessation
- 1978-01-23 FR FR7801792A patent/FR2383985A1/fr active Granted
- 1978-01-24 BE BE184592A patent/BE863260A/xx not_active IP Right Cessation
- 1978-01-25 IT IT09321/78A patent/IT1103085B/it active
- 1978-01-26 ES ES466335A patent/ES466335A1/es not_active Expired
- 1978-01-26 BR BR7800493A patent/BR7800493A/pt unknown
- 1978-01-26 SE SE7800980A patent/SE443148B/sv not_active IP Right Cessation
- 1978-01-27 CA CA295,813A patent/CA1102937A/en not_active Expired
- 1978-01-27 PL PL1978204297A patent/PL112659B1/pl unknown
- 1978-01-27 CS CS78575A patent/CS202093B2/cs unknown
- 1978-01-28 JP JP53007866A patent/JPS5943054B2/ja not_active Expired
- 1978-05-29 FR FR7815933A patent/FR2383986A1/fr active Granted
-
1984
- 1984-03-01 JP JP59037396A patent/JPS59182858A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5396052A (en) | 1978-08-22 |
| BR7800493A (pt) | 1978-08-22 |
| FR2383985B1 (pl) | 1984-03-16 |
| US4111905A (en) | 1978-09-05 |
| IT1103085B (it) | 1985-10-14 |
| ES466335A1 (es) | 1979-09-01 |
| FR2383986B1 (pl) | 1983-08-19 |
| NL181585C (nl) | 1987-09-16 |
| NL7800788A (nl) | 1978-08-01 |
| NL181585B (nl) | 1987-04-16 |
| AU513572B2 (en) | 1980-12-11 |
| BE863260A (fr) | 1978-05-16 |
| IT7809321A0 (it) | 1978-01-25 |
| JPS59182858A (ja) | 1984-10-17 |
| DE2802047A1 (de) | 1978-08-03 |
| PL112659B1 (en) | 1980-10-31 |
| FR2383985A1 (fr) | 1978-10-13 |
| PL204297A1 (pl) | 1978-10-23 |
| GB1591692A (en) | 1981-06-24 |
| CA1102937A (en) | 1981-06-09 |
| DE2802047C2 (de) | 1987-10-01 |
| SE7800980L (sv) | 1978-07-29 |
| AU3234278A (en) | 1979-07-19 |
| JPS617226B2 (pl) | 1986-03-05 |
| SE443148B (sv) | 1986-02-17 |
| JPS5943054B2 (ja) | 1984-10-19 |
| FR2383986A1 (fr) | 1978-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Xie et al. | Synergistic effects of expandable graphite with some halogen-free flame retardants in polyolefin blends | |
| US3075944A (en) | Flame retardant compositions containing polyolefines, antimony oxide and ethers having at least three bromine atoms | |
| KR20010095168A (ko) | 방염 도료 | |
| US4154721A (en) | Flame-retardant phosphonate compositions | |
| CS202093B2 (en) | Halogen atoms containing polymers with retarded burning | |
| US3723139A (en) | Adding antimony oxide-antimonate compositions to render polyvinyl chloride compositions flame retardant | |
| US4461862A (en) | Self extinguishing polymeric compositions, which upon contacting a flame provide a nondropping char-forming incandescent crust, and which do not produce flame neither toxic fumes | |
| Siat et al. | Combustion behaviour of ethylene vinyl acetate copolymer‐based intumescent formulations using oxygen consumption calorimetry | |
| CS222686B2 (en) | Softened polyvinylchloride substance | |
| US4957961A (en) | Modified fluoropolymers for low flame/low smoke plenum cables | |
| JP2620203B2 (ja) | 難燃性ポリプロピレン組成物 | |
| Wu et al. | Thermal behavior and flame retardancy of flexible poly (vinyl chloride) treated with zinc hydroxystannate and zinc stannate | |
| US4579894A (en) | Self-extinguishing polyolefinic compositions having improved flame resistance characteristics and a high thermal stability | |
| CN109161242A (zh) | 一种具有阻燃抑烟效果的无溶剂型双组份聚氨酯防水涂料 | |
| Pawelec | New families of highly efficient, halogen-free flame retardants for polypropylene (PP) | |
| KR20050070812A (ko) | 수성계 발포성 방염도료 조성물 | |
| CS202094B2 (cs) | Prostředek pro zpomaleni hoření syntetických organických polymerů | |
| US4104250A (en) | Flame-retardant polymers with 1,3,5-triazines having halo- and halo-aryl substitutents | |
| US3956399A (en) | Halogenated-methylbenzyl phenyl ethers | |
| JPH02129137A (ja) | ハロゲン化ビス（４−フェノキシフェニル）エーテルおよびそれを含む難燃性高子組成物 | |
| US3489715A (en) | Process for reducing the inflammability of high organic polymers | |
| EP0332932A2 (en) | Modified fluoropolymers for low flame/low smoke plenum cables | |
| CN109280287A (zh) | 一种阻燃电加热毯膜及其制备方法 | |
| RU2487151C1 (ru) | Огнезащитная композиция | |
| Cullis | Thermal stability and flammability of organic polymers |