CS201519B2 - Means for regulation of the growth of plants and method of making the active component - Google Patents
Means for regulation of the growth of plants and method of making the active component Download PDFInfo
- Publication number
- CS201519B2 CS201519B2 CS787496A CS749678A CS201519B2 CS 201519 B2 CS201519 B2 CS 201519B2 CS 787496 A CS787496 A CS 787496A CS 749678 A CS749678 A CS 749678A CS 201519 B2 CS201519 B2 CS 201519B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- growth
- plants
- acid
- active
- active ingredient
- Prior art date
Links
- 230000008635 plant growth Effects 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000004480 active ingredient Substances 0.000 claims description 30
- 239000002904 solvent Substances 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 54
- 239000013543 active substance Substances 0.000 description 45
- 230000012010 growth Effects 0.000 description 26
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 150000001875 compounds Chemical class 0.000 description 22
- -1 α-isocyan-β-methylcaproic acid Chemical compound 0.000 description 21
- 230000000694 effects Effects 0.000 description 20
- 239000003995 emulsifying agent Substances 0.000 description 20
- 239000003630 growth substance Substances 0.000 description 18
- 239000000126 substance Substances 0.000 description 15
- 235000013399 edible fruits Nutrition 0.000 description 12
- 230000009036 growth inhibition Effects 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 229920000742 Cotton Polymers 0.000 description 9
- 241000219146 Gossypium Species 0.000 description 9
- 244000061176 Nicotiana tabacum Species 0.000 description 9
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000005648 plant growth regulator Substances 0.000 description 8
- 238000003306 harvesting Methods 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- 239000008187 granular material Substances 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 230000000638 stimulation Effects 0.000 description 5
- 230000009105 vegetative growth Effects 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 240000003768 Solanum lycopersicum Species 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- RRSCOUPNURHZBJ-UHFFFAOYSA-N 2-chloroethanesulfinic acid Chemical compound OS(=O)CCCl RRSCOUPNURHZBJ-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LLVUVAFIZLGBRB-UHFFFAOYSA-N C(CCCCCCCCCCC)O.C(CCCCCCCCC)O.C(CCCCCCC)O.C(CCCCC)O Chemical compound C(CCCCCCCCCCC)O.C(CCCCCCCCC)O.C(CCCCCCC)O.C(CCCCC)O LLVUVAFIZLGBRB-UHFFFAOYSA-N 0.000 description 3
- 235000010469 Glycine max Nutrition 0.000 description 3
- 240000005979 Hordeum vulgare Species 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- 229920001213 Polysorbate 20 Polymers 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 241000209140 Triticum Species 0.000 description 3
- 230000001133 acceleration Effects 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 3
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 3
- 230000005070 ripening Effects 0.000 description 3
- 239000000779 smoke Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 230000001629 suppression Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RMHLITODGAKLHU-UHFFFAOYSA-N 2-isocyanopropanoic acid Chemical compound [C-]#[N+]C(C)C(O)=O RMHLITODGAKLHU-UHFFFAOYSA-N 0.000 description 2
- 244000099147 Ananas comosus Species 0.000 description 2
- 235000007119 Ananas comosus Nutrition 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 244000068988 Glycine max Species 0.000 description 2
- 240000002024 Gossypium herbaceum Species 0.000 description 2
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 2
- 206010053759 Growth retardation Diseases 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical group [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 244000038559 crop plants Species 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000007954 growth retardant Substances 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 239000004816 latex Substances 0.000 description 2
- 229920000126 latex Polymers 0.000 description 2
- 229940070765 laurate Drugs 0.000 description 2
- 235000012054 meals Nutrition 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000017066 negative regulation of growth Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000017363 positive regulation of growth Effects 0.000 description 2
- 229910001414 potassium ion Chemical group 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910001415 sodium ion Inorganic materials 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- YXBFCLYILRJMIR-UHFFFAOYSA-N 1-isocyanocyclopropane-1-carboxylic acid Chemical compound OC(=O)C1([N+]#[C-])CC1 YXBFCLYILRJMIR-UHFFFAOYSA-N 0.000 description 1
- GHERKZSZPVSWBQ-UHFFFAOYSA-N 2-ethyl-2-isocyanobutanoic acid Chemical compound CCC(CC)([N+]#[C-])C(O)=O GHERKZSZPVSWBQ-UHFFFAOYSA-N 0.000 description 1
- YTJURFIZKYIJJB-UHFFFAOYSA-N 2-isocyano-2-methylbutanoic acid Chemical compound CCC(C)([N+]#[C-])C(O)=O YTJURFIZKYIJJB-UHFFFAOYSA-N 0.000 description 1
- GNHRTWYZEIYCRW-UHFFFAOYSA-N 2-isocyano-2-methylpropanoic acid Chemical compound [C-]#[N+]C(C)(C)C(O)=O GNHRTWYZEIYCRW-UHFFFAOYSA-N 0.000 description 1
- OYCJHELUKJMXIN-UHFFFAOYSA-N 2-isocyano-3-methylbutanoic acid Chemical compound CC(C)C([N+]#[C-])C(O)=O OYCJHELUKJMXIN-UHFFFAOYSA-N 0.000 description 1
- CFCNTIFLYGKEIO-UHFFFAOYSA-N 2-isocyanoacetic acid Chemical compound OC(=O)C[N+]#[C-] CFCNTIFLYGKEIO-UHFFFAOYSA-N 0.000 description 1
- HBLAXMITNSURQX-UHFFFAOYSA-N 2-isocyanobutanoic acid Chemical compound CCC([N+]#[C-])C(O)=O HBLAXMITNSURQX-UHFFFAOYSA-N 0.000 description 1
- XRNVIFDBCJXAPN-UHFFFAOYSA-N 2-isocyanopentanoic acid Chemical compound CCCC([N+]#[C-])C(O)=O XRNVIFDBCJXAPN-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- 241000209134 Arundinaria Species 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 239000004604 Blowing Agent Substances 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 240000007154 Coffea arabica Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 101000652359 Homo sapiens Spermatogenesis-associated protein 2 Proteins 0.000 description 1
- 101000642464 Homo sapiens Spermatogenesis-associated protein 2-like protein Proteins 0.000 description 1
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 102100030254 Spermatogenesis-associated protein 2 Human genes 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000002969 artificial stone Substances 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- DJIBHHGQPSAZCY-UHFFFAOYSA-N butoxy-bis(butylsulfanyl)-sulfanylidene-$l^{5}-phosphane Chemical compound CCCCOP(=S)(SCCCC)SCCCC DJIBHHGQPSAZCY-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000004345 fruit ripening Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003966 growth inhibitor Substances 0.000 description 1
- 231100000001 growth retardation Toxicity 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000011890 leaf development Effects 0.000 description 1
- 230000002015 leaf growth Effects 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 150000002696 manganese Chemical class 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- UFGJMIRODOAASM-UHFFFAOYSA-N methyl 2-isocyanopropanoate Chemical compound COC(=O)C(C)[N+]#[C-] UFGJMIRODOAASM-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000003359 percent control normalization Methods 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- QMYAUOGCTFKFIV-UHFFFAOYSA-M potassium;1-isocyanocyclopropane-1-carboxylate Chemical compound [K+].[O-]C(=O)C1([N+]#[C-])CC1 QMYAUOGCTFKFIV-UHFFFAOYSA-M 0.000 description 1
- CQKHUQUTXVGQGJ-UHFFFAOYSA-M potassium;2-isocyano-2-methylpropanoate Chemical compound [K+].[C-]#[N+]C(C)(C)C([O-])=O CQKHUQUTXVGQGJ-UHFFFAOYSA-M 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 230000007226 seed germination Effects 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- HLMMCKMTLSIMBC-UHFFFAOYSA-M sodium;1-isocyanocyclopropane-1-carboxylate Chemical compound [Na+].[O-]C(=O)C1([N+]#[C-])CC1 HLMMCKMTLSIMBC-UHFFFAOYSA-M 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 230000005068 transpiration Effects 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772751783 DE2751783A1 (de) | 1977-11-19 | 1977-11-19 | Alpha-isocyanocarbonsaeure-salze, verfahren zu ihrer herstellung und ihre verwendung als pflanzenwachstumsregulatoren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS201519B2 true CS201519B2 (en) | 1980-11-28 |
Family
ID=6024140
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS787496A CS201519B2 (en) | 1977-11-19 | 1978-11-16 | Means for regulation of the growth of plants and method of making the active component |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4292072A (fr) |
| EP (1) | EP0002014B1 (fr) |
| JP (1) | JPS5479230A (fr) |
| AT (1) | AT361017B (fr) |
| AU (1) | AU4168978A (fr) |
| BR (1) | BR7807547A (fr) |
| CA (1) | CA1114836A (fr) |
| CS (1) | CS201519B2 (fr) |
| DD (1) | DD141254A5 (fr) |
| DE (2) | DE2751783A1 (fr) |
| DK (1) | DK513178A (fr) |
| ES (1) | ES475189A1 (fr) |
| GR (1) | GR72770B (fr) |
| IL (1) | IL55962A (fr) |
| IT (1) | IT1101706B (fr) |
| NZ (1) | NZ188929A (fr) |
| OA (1) | OA06103A (fr) |
| PL (1) | PL110796B1 (fr) |
| PT (1) | PT68799A (fr) |
| RO (1) | RO79084A (fr) |
| TR (1) | TR20095A (fr) |
| ZA (1) | ZA786469B (fr) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2842639A1 (de) * | 1978-09-29 | 1980-04-10 | Bayer Ag | Alpha -isocyano-carbonsaeureamide, verfahren zu ihrer herstellung und ihre verwendung als pflanzenwachstumsregulatoren |
| MX2013007379A (es) | 2010-12-21 | 2013-07-15 | Bayer Cropscience Lp | Mutantes tipo papel lija de bacillus y metodos de uso de los mismos para mejorar el crecimiento vegetal, promover la salud de plantas y controlar enfermedades y plagas. |
| EP2755485A1 (fr) | 2011-09-12 | 2014-07-23 | Bayer Cropscience LP | Procédés améliorant la santé d'une plante et/ou favorisant la croissance d'une plante et/ou favorisant le mûrissement d'un fruit |
| JP6164610B2 (ja) * | 2013-08-26 | 2017-07-19 | 国立大学法人東京農工大学 | アミノ酸イソニトリル骨格を有する水中付着生物の防汚剤 |
| KR101886053B1 (ko) * | 2016-08-22 | 2018-08-07 | 서울과학기술대학교 산학협력단 | 벅 부스트 컨버터 |
| CN116924943A (zh) * | 2022-03-31 | 2023-10-24 | 中国科学院理化技术研究所 | 氨基酸类异氰酸盐衍生物的制备及应用 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2749231A (en) * | 1952-05-06 | 1956-06-05 | Ethyl Corp | Bromophenyl cyanoacrylic acids and derivatives |
| US3201466A (en) * | 1963-03-08 | 1965-08-17 | Gulf Oil Corp | Substituted cyclopropanecarboxanilide herbicides |
| CH495111A (de) * | 1968-03-14 | 1970-08-31 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| US3597469A (en) * | 1968-07-29 | 1971-08-03 | Gaf Corp | Cycloalkyl unsaturated esters |
| US3584037A (en) * | 1969-05-21 | 1971-06-08 | Velsicol Chemical Corp | 1-carboxy-3-methylene-1,2,2,4,5-pentachloropent-4-ene |
| JPS5220473B1 (fr) * | 1970-06-29 | 1977-06-03 | ||
| DE2043666A1 (en) * | 1970-09-03 | 1972-03-09 | Cyano-amino-polycarboxylic acids and their esters - prepn from isocyanoalkane esters and unsatd esters | |
| US3773824A (en) * | 1971-06-14 | 1973-11-20 | Mobil Oil Corp | 3-(4-methyl-3-cyclohexenyl)butyl esters of organic acids |
| DE2147707A1 (de) * | 1971-09-24 | 1973-03-29 | Basf Ag | Verfahren zur herstellung von carbonsaeuren |
| DE2218009A1 (de) * | 1972-04-14 | 1973-11-08 | Agfa Gevaert Ag | Verfahren zur haertung gelatinehaltiger schichten |
| DE2349108A1 (de) * | 1973-09-29 | 1975-04-03 | Hoechst Ag | 2,2-difluorcyclopropancarbonitrile und verfahren zu deren herstellung |
| DE2405819A1 (de) * | 1974-02-07 | 1975-08-21 | Agfa Gevaert Ag | Verfahren zum fixieren von photographischen materialien |
| US4098600A (en) * | 1976-05-24 | 1978-07-04 | Monsanto Company | Isocyanoacylamides |
| US4083863A (en) * | 1976-06-01 | 1978-04-11 | American Cyanamid Corporation | Process for the preparation of cyclopropane carboxylic acids and esters |
| GB1578139A (en) * | 1976-07-07 | 1980-11-05 | Ici Ltd | Preparation of alicyclic compounds |
-
1977
- 1977-11-19 DE DE19772751783 patent/DE2751783A1/de not_active Withdrawn
-
1978
- 1978-10-27 US US05/955,435 patent/US4292072A/en not_active Expired - Lifetime
- 1978-10-30 CA CA314,682A patent/CA1114836A/fr not_active Expired
- 1978-11-04 EP EP78101306A patent/EP0002014B1/fr not_active Expired
- 1978-11-04 DE DE7878101306T patent/DE2860381D1/de not_active Expired
- 1978-11-10 DD DD78209019A patent/DD141254A5/de unknown
- 1978-11-15 RO RO7895687A patent/RO79084A/fr unknown
- 1978-11-16 CS CS787496A patent/CS201519B2/cs unknown
- 1978-11-16 NZ NZ188929A patent/NZ188929A/xx unknown
- 1978-11-16 OA OA56660A patent/OA06103A/fr unknown
- 1978-11-16 IL IL55962A patent/IL55962A/xx unknown
- 1978-11-17 ZA ZA00786469A patent/ZA786469B/xx unknown
- 1978-11-17 ES ES475189A patent/ES475189A1/es not_active Expired
- 1978-11-17 PT PT68799A patent/PT68799A/pt unknown
- 1978-11-17 IT IT29894/78A patent/IT1101706B/it active
- 1978-11-17 AU AU41689/78A patent/AU4168978A/en active Pending
- 1978-11-17 BR BR7807547A patent/BR7807547A/pt unknown
- 1978-11-17 AT AT822778A patent/AT361017B/de not_active IP Right Cessation
- 1978-11-17 TR TR20095A patent/TR20095A/xx unknown
- 1978-11-17 JP JP14123678A patent/JPS5479230A/ja active Pending
- 1978-11-17 DK DK513178A patent/DK513178A/da not_active Application Discontinuation
- 1978-11-17 GR GR57670A patent/GR72770B/el unknown
- 1978-11-18 PL PL1978211045A patent/PL110796B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| TR20095A (tr) | 1980-07-08 |
| EP0002014A1 (fr) | 1979-05-30 |
| BR7807547A (pt) | 1979-07-24 |
| DE2751783A1 (de) | 1979-05-23 |
| CA1114836A (fr) | 1981-12-22 |
| NZ188929A (en) | 1980-05-08 |
| AU4168978A (en) | 1979-05-24 |
| OA06103A (fr) | 1981-06-30 |
| IT1101706B (it) | 1985-10-07 |
| PL110796B1 (en) | 1980-07-31 |
| AT361017B (de) | 1981-02-10 |
| RO79084A (fr) | 1982-06-25 |
| DD141254A5 (de) | 1980-04-23 |
| DE2860381D1 (en) | 1981-03-19 |
| IT7829894A0 (it) | 1978-11-17 |
| GR72770B (fr) | 1983-12-05 |
| DK513178A (da) | 1979-05-20 |
| EP0002014B1 (fr) | 1981-01-28 |
| ZA786469B (en) | 1979-10-31 |
| JPS5479230A (en) | 1979-06-25 |
| US4292072A (en) | 1981-09-29 |
| ATA822778A (de) | 1980-07-15 |
| PL211045A1 (pl) | 1979-06-18 |
| ES475189A1 (es) | 1979-04-16 |
| IL55962A (en) | 1982-09-30 |
| PT68799A (pt) | 1978-12-01 |
| IL55962A0 (en) | 1979-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0413349B2 (fr) | ||
| KR840001772B1 (ko) | 1-하이드록시에틸-아졸 유도체의 제조방법 | |
| US4554017A (en) | Method and compositions for regulating plant growth using cycloalkane-carboxylic acid compounds | |
| US4367344A (en) | Process for the preparation of 1-amino-cyclopropane-carboxylic acid compounds | |
| US4525204A (en) | Method and compositions for regulating plant growth using pyrimidine-butanol compounds | |
| CS236691B2 (en) | Agent for regulation of plant growth and fungicide agent and production method of its efficient components | |
| US4457870A (en) | Regulating plant growth with novel 1-amino-cyclopropanecarboxylic acid metal complexes | |
| US4227918A (en) | Novel halogenoethyl sulphones and their use as plant growth regulators | |
| CS201519B2 (en) | Means for regulation of the growth of plants and method of making the active component | |
| CS230598B2 (en) | Fungicid agent and for regulation of growing of plants and method manufacture of efficient compound | |
| CS201518B2 (en) | Means for regulation of the plants growth | |
| CS236695B2 (en) | Fungicide agent and for regulation of plant growth and production method of its efficient components | |
| CS214799B2 (cs) | Prostředek k regulaci růstu rostlin a způsob výroby účinných látek | |
| US4261731A (en) | Alpha-isocyano-carboxylic acid amide compounds and plant growth regulant compositions | |
| US3979204A (en) | Plant growth regulant compositions comprising 2-cyano-bicyclo[2,2,1]heptane | |
| US4293331A (en) | Novel acyloxamides and plant growth regulant compositions | |
| JPS5946248A (ja) | 4−トリフルオロメチルベンジルアンモニウム塩 | |
| JPH0881310A (ja) | 植物生長調節剤 | |
| JPS61145185A (ja) | 新規複素環化合物、その製法並びに農園芸用殺菌剤及び植物生長調整剤 | |
| CS208499B2 (en) | Means for regulation of the plants growth,particularly the vegetables | |
| PL100337B1 (pl) | Srodek do regulowania wzrostu roslin | |
| GB1574430A (en) | Plant growth regulating 3-phenyl-1,2,4-thiadiazol derivate | |
| PL94237B1 (fr) | ||
| JPH01151582A (ja) | アゾリルスピロ化合物 | |
| CS241499B2 (cs) | Prostředek k regulaci růstu rostlin a fungicidní prostředek a způsob výroby účinné složky |