CS199698B2 - Method of producing esters of phenylethylamine derivatives - Google Patents
Method of producing esters of phenylethylamine derivatives Download PDFInfo
- Publication number
- CS199698B2 CS199698B2 CS778424A CS842477A CS199698B2 CS 199698 B2 CS199698 B2 CS 199698B2 CS 778424 A CS778424 A CS 778424A CS 842477 A CS842477 A CS 842477A CS 199698 B2 CS199698 B2 CS 199698B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- formula
- hydrogen
- methyl
- complex
- Prior art date
Links
- 150000002148 esters Chemical class 0.000 title claims abstract description 31
- 238000000034 method Methods 0.000 title claims abstract description 31
- 150000007925 phenylethylamine derivatives Chemical class 0.000 title claims description 4
- 239000002253 acid Substances 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 23
- 238000002360 preparation method Methods 0.000 claims abstract description 15
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 5
- -1 hydroxymethylene group Chemical group 0.000 claims description 82
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 38
- 150000001875 compounds Chemical class 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 239000007858 starting material Substances 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 8
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 8
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 8
- 239000003085 diluting agent Substances 0.000 claims description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000012458 free base Substances 0.000 claims description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 5
- 239000003208 petroleum Substances 0.000 claims description 5
- 150000001450 anions Chemical class 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 abstract description 19
- 206010061218 Inflammation Diseases 0.000 abstract description 8
- 230000004054 inflammatory process Effects 0.000 abstract description 8
- 241001465754 Metazoa Species 0.000 abstract description 4
- 150000005690 diesters Chemical class 0.000 abstract description 3
- 150000003840 hydrochlorides Chemical class 0.000 abstract description 3
- 238000004519 manufacturing process Methods 0.000 abstract description 3
- 150000007513 acids Chemical class 0.000 abstract description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 abstract description 2
- 230000000699 topical effect Effects 0.000 abstract description 2
- VXALGUOBEQGSPR-UHFFFAOYSA-N [2-(2,2-dimethylpropanoyloxy)-4-[1-hydroxy-2-[2-[(2-phenylacetyl)amino]ethylamino]ethyl]phenyl] 2,2-dimethylpropanoate Chemical compound C1=C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)=CC=C1C(O)CNCCNC(=O)CC1=CC=CC=C1 VXALGUOBEQGSPR-UHFFFAOYSA-N 0.000 abstract 1
- SRCOWHUPXKTKOC-UHFFFAOYSA-N [2-(2,2-dimethylpropanoyloxy)-4-[1-hydroxy-2-[[2-methyl-1-[(2-phenoxyacetyl)amino]propan-2-yl]amino]ethyl]phenyl] 2,2-dimethylpropanoate Chemical compound C1=C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)=CC=C1C(O)CNC(C)(C)CNC(=O)COC1=CC=CC=C1 SRCOWHUPXKTKOC-UHFFFAOYSA-N 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 150000005691 triesters Chemical class 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 63
- 239000000243 solution Substances 0.000 description 56
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 46
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 45
- 239000000203 mixture Substances 0.000 description 41
- 239000000047 product Substances 0.000 description 29
- 125000003118 aryl group Chemical group 0.000 description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 26
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 17
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 16
- 239000000741 silica gel Substances 0.000 description 16
- 229910002027 silica gel Inorganic materials 0.000 description 16
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 13
- 239000006260 foam Substances 0.000 description 13
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 13
- 235000019341 magnesium sulphate Nutrition 0.000 description 13
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- 150000003254 radicals Chemical group 0.000 description 10
- 238000004809 thin layer chromatography Methods 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 9
- 150000008062 acetophenones Chemical class 0.000 description 9
- 238000006722 reduction reaction Methods 0.000 description 8
- 239000012279 sodium borohydride Substances 0.000 description 8
- 229910000033 sodium borohydride Inorganic materials 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 6
- WEMKUJXGNHGSFH-UHFFFAOYSA-N n-[2-(benzylamino)ethyl]-2-phenylacetamide Chemical compound C=1C=CC=CC=1CNCCNC(=O)CC1=CC=CC=C1 WEMKUJXGNHGSFH-UHFFFAOYSA-N 0.000 description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical class BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 5
- HAZSHWVIEFFWDA-UHFFFAOYSA-N 1-phenylethanone;hydrobromide Chemical compound Br.CC(=O)C1=CC=CC=C1 HAZSHWVIEFFWDA-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 230000003110 anti-inflammatory effect Effects 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 4
- OTIZTAXUFMCICV-UHFFFAOYSA-N phenacyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCC(=O)C1=CC=CC=C1 OTIZTAXUFMCICV-UHFFFAOYSA-N 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 3
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical class S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- FMKMEWWKBLDKST-UHFFFAOYSA-N (5-acetyl-2-acetyloxyphenyl)methyl acetate Chemical compound CC(=O)OCC1=CC(C(C)=O)=CC=C1OC(C)=O FMKMEWWKBLDKST-UHFFFAOYSA-N 0.000 description 2
- WLCMPLHGHIZKAR-UHFFFAOYSA-N (5-acetyl-2-pentanoyloxyphenyl)methyl pentanoate Chemical compound CCCCC(=O)OCC1=CC(C(C)=O)=CC=C1OC(=O)CCCC WLCMPLHGHIZKAR-UHFFFAOYSA-N 0.000 description 2
- JLIDRDJNLAWIKT-UHFFFAOYSA-N 1,2-dimethyl-3h-benzo[e]indole Chemical compound C1=CC=CC2=C(C(=C(C)N3)C)C3=CC=C21 JLIDRDJNLAWIKT-UHFFFAOYSA-N 0.000 description 2
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 2
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 2
- OBZRMGAHCFVOQW-UHFFFAOYSA-N 2-chloro-3,4-bis(phenylmethoxy)benzoic acid Chemical compound C=1C=CC=CC=1COC1=C(Cl)C(C(=O)O)=CC=C1OCC1=CC=CC=C1 OBZRMGAHCFVOQW-UHFFFAOYSA-N 0.000 description 2
- UCQUAMAQHHEXGD-UHFFFAOYSA-N 3',4'-dihydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C(O)=C1 UCQUAMAQHHEXGD-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 101100048447 Caenorhabditis elegans unc-4 gene Proteins 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 101150065749 Churc1 gene Proteins 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 238000004566 IR spectroscopy Methods 0.000 description 2
- 102100038239 Protein Churchill Human genes 0.000 description 2
- ACXQCCHCVNCXCL-UHFFFAOYSA-N [2-(2,2-dimethylpropanoyloxy)-4-[1-hydroxy-2-[2-[(2-phenylacetyl)amino]ethylamino]ethyl]phenyl] 2,2-dimethylpropanoate;hydrobromide Chemical compound Br.C1=C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)=CC=C1C(O)CNCCNC(=O)CC1=CC=CC=C1 ACXQCCHCVNCXCL-UHFFFAOYSA-N 0.000 description 2
- WEGPVOIZVSYAPG-UHFFFAOYSA-N [5-(2-bromoacetyl)-2-pentanoyloxyphenyl]methyl pentanoate Chemical compound CCCCC(=O)OCC1=CC(C(=O)CBr)=CC=C1OC(=O)CCCC WEGPVOIZVSYAPG-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000001263 acyl chlorides Chemical class 0.000 description 2
- 150000001266 acyl halides Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- DULCUDSUACXJJC-UHFFFAOYSA-N benzeneacetic acid ethyl ester Natural products CCOC(=O)CC1=CC=CC=C1 DULCUDSUACXJJC-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 208000027866 inflammatory disease Diseases 0.000 description 2
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 2
- 229940011051 isopropyl acetate Drugs 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- DUVVKZQEZWPDOD-UHFFFAOYSA-N n-(2-amino-2-methylpropyl)-2-phenylacetamide Chemical compound CC(C)(N)CNC(=O)CC1=CC=CC=C1 DUVVKZQEZWPDOD-UHFFFAOYSA-N 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000005932 reductive alkylation reaction Methods 0.000 description 2
- 238000004611 spectroscopical analysis Methods 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- UCTUWXMZPHRXHF-UHFFFAOYSA-N 1-(2-chloro-3,4-dihydroxyphenyl)ethanone Chemical class CC(=O)C1=CC=C(O)C(O)=C1Cl UCTUWXMZPHRXHF-UHFFFAOYSA-N 0.000 description 1
- OBGWXJCJFQACLK-UHFFFAOYSA-N 1-[3,4-bis(phenylmethoxy)phenyl]-2-bromo-2-chloroethanone Chemical compound C=1C=CC=CC=1COC1=CC(C(=O)C(Br)Cl)=CC=C1OCC1=CC=CC=C1 OBGWXJCJFQACLK-UHFFFAOYSA-N 0.000 description 1
- LAMHAMBOLINJML-UHFFFAOYSA-N 1-[3-(chloromethyl)-4-hydroxyphenyl]ethanone Chemical compound CC(=O)C1=CC=C(O)C(CCl)=C1 LAMHAMBOLINJML-UHFFFAOYSA-N 0.000 description 1
- AIBHEDDHFNHGES-UHFFFAOYSA-N 1-phenylethanone 2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CC(=O)C1=CC=CC=C1 AIBHEDDHFNHGES-UHFFFAOYSA-N 0.000 description 1
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- OZONPHRTCGSRJV-UHFFFAOYSA-N 2-chloro-3,4-bis(phenylmethoxy)benzaldehyde Chemical compound C=1C=CC=CC=1COC=1C(Cl)=C(C=O)C=CC=1OCC1=CC=CC=C1 OZONPHRTCGSRJV-UHFFFAOYSA-N 0.000 description 1
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical class NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 1
- ISULZYQDGYXDFW-UHFFFAOYSA-N 3-methylbutanoyl chloride Chemical compound CC(C)CC(Cl)=O ISULZYQDGYXDFW-UHFFFAOYSA-N 0.000 description 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 101100231508 Caenorhabditis elegans ceh-5 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- YQNREGAUZFSHOQ-UHFFFAOYSA-N ClCC(C=CC(OCC1=CC=CC=C1)=C1OCC2=CC=CC=C2)=C1Cl Chemical compound ClCC(C=CC(OCC1=CC=CC=C1)=C1OCC2=CC=CC=C2)=C1Cl YQNREGAUZFSHOQ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000003810 Jones reagent Substances 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 101710193132 Pre-hexon-linking protein VIII Proteins 0.000 description 1
- 229910008048 Si-S Inorganic materials 0.000 description 1
- 229910006336 Si—S Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- RJBMFZCTKPMADN-UHFFFAOYSA-N [2-acetyloxy-4-(2-bromoacetyl)phenyl] acetate Chemical compound CC(=O)OC1=CC=C(C(=O)CBr)C=C1OC(C)=O RJBMFZCTKPMADN-UHFFFAOYSA-N 0.000 description 1
- PSJNTDWQRFXBLP-UHFFFAOYSA-N [2-acetyloxy-4-[2-[benzyl-[2-[(2-phenylacetyl)amino]ethyl]amino]acetyl]phenyl] acetate Chemical compound C1=C(OC(C)=O)C(OC(=O)C)=CC=C1C(=O)CN(CC=1C=CC=CC=1)CCNC(=O)CC1=CC=CC=C1 PSJNTDWQRFXBLP-UHFFFAOYSA-N 0.000 description 1
- ZILZXOHDNPLQNJ-UHFFFAOYSA-N [3-(2,2-dimethylpropanoyloxy)-5-[1-hydroxy-2-[2-[(2-phenoxyacetyl)amino]ethylamino]ethyl]phenyl] 2,2-dimethylpropanoate;hydrobromide Chemical compound Br.CC(C)(C)C(=O)OC1=CC(OC(=O)C(C)(C)C)=CC(C(O)CNCCNC(=O)COC=2C=CC=CC=2)=C1 ZILZXOHDNPLQNJ-UHFFFAOYSA-N 0.000 description 1
- AQDMBAYYUBDTPG-UHFFFAOYSA-N [3-(2-bromoacetyl)-5-(2,2-dimethylpropanoyloxy)phenyl] 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC1=CC(OC(=O)C(C)(C)C)=CC(C(=O)CBr)=C1 AQDMBAYYUBDTPG-UHFFFAOYSA-N 0.000 description 1
- BJPBOMIJLZQQJZ-UHFFFAOYSA-N [3-chloro-4-[1-hydroxy-2-[2-[(2-phenylacetyl)amino]ethylamino]ethyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate;hydrobromide Chemical compound Br.ClC1=C(OC(=O)CC(C)C)C(OC(=O)CC(C)C)=CC=C1C(O)CNCCNC(=O)CC1=CC=CC=C1 BJPBOMIJLZQQJZ-UHFFFAOYSA-N 0.000 description 1
- DGHBXKAPOODQPA-UHFFFAOYSA-N [4-(2-bromoacetyl)-2-(2,2-dimethylpropanoyloxy)phenyl] 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC1=CC=C(C(=O)CBr)C=C1OC(=O)C(C)(C)C DGHBXKAPOODQPA-UHFFFAOYSA-N 0.000 description 1
- FNWUBUCGGQMNLI-UHFFFAOYSA-N [4-[2-[benzyl-[2-[(2-phenylacetyl)amino]ethyl]amino]-1-hydroxyethyl]-2-(2,2-dimethylpropanoyloxy)phenyl] 2,2-dimethylpropanoate Chemical compound C1=C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)=CC=C1C(O)CN(CC=1C=CC=CC=1)CCNC(=O)CC1=CC=CC=C1 FNWUBUCGGQMNLI-UHFFFAOYSA-N 0.000 description 1
- YAXSBLNGGPCLBN-UHFFFAOYSA-N [5-(2-bromoacetyl)-2-(3-methylbutanoyloxy)phenyl]methyl 3-methylbutanoate Chemical compound CC(C)CC(=O)OCC1=CC(C(=O)CBr)=CC=C1OC(=O)CC(C)C YAXSBLNGGPCLBN-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000001262 acyl bromides Chemical class 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- NHOWLEZFTHYCTP-UHFFFAOYSA-N benzylhydrazine Chemical compound NNCC1=CC=CC=C1 NHOWLEZFTHYCTP-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 125000000837 carbohydrate group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229940117173 croton oil Drugs 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 235000013365 dairy product Nutrition 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 150000002171 ethylene diamines Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- ZIMOHSZCIYGHAR-UHFFFAOYSA-N n-(2-aminoethyl)-2-phenylacetamide Chemical compound NCCNC(=O)CC1=CC=CC=C1 ZIMOHSZCIYGHAR-UHFFFAOYSA-N 0.000 description 1
- HWIYFGXCJZFCDN-UHFFFAOYSA-N n-[2-(benzylamino)ethyl]-2-phenoxyacetamide Chemical compound C=1C=CC=CC=1CNCCNC(=O)COC1=CC=CC=C1 HWIYFGXCJZFCDN-UHFFFAOYSA-N 0.000 description 1
- FPOZAJVSEVWPMB-UHFFFAOYSA-N n-[2-(benzylamino)ethyl]-2-phenylacetamide;hydrochloride Chemical compound Cl.C=1C=CC=CC=1CNCCNC(=O)CC1=CC=CC=C1 FPOZAJVSEVWPMB-UHFFFAOYSA-N 0.000 description 1
- YZOLQLVXRIDKLY-UHFFFAOYSA-N n-[2-[benzyl-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]amino]ethyl]-2-phenylacetamide;hydrobromide Chemical compound Br.C1=C(O)C(O)=CC=C1C(=O)CN(CC=1C=CC=CC=1)CCNC(=O)CC1=CC=CC=C1 YZOLQLVXRIDKLY-UHFFFAOYSA-N 0.000 description 1
- DOWZVDBZXJDDQN-UHFFFAOYSA-N n-methyl-n-nitroso-1-phenylmethanesulfonamide Chemical compound O=NN(C)S(=O)(=O)CC1=CC=CC=C1 DOWZVDBZXJDDQN-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- FKYJVAUNEQSKGM-UHFFFAOYSA-N phenacyl 2-cyclopentylacetate Chemical compound C1(CCCC1)CC(=O)OCC(=O)C1=CC=CC=C1 FKYJVAUNEQSKGM-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012260 resinous material Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- WMOVHXAZOJBABW-UHFFFAOYSA-N tert-butyl acetate Chemical compound CC(=O)OC(C)(C)C WMOVHXAZOJBABW-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- PHCCHUUBFXDNIW-UHFFFAOYSA-J tetrasodium tetrabromide Chemical compound [Na+].[Na+].[Na+].[Na+].[Br-].[Br-].[Br-].[Br-] PHCCHUUBFXDNIW-UHFFFAOYSA-J 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/34—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups
- C07C233/35—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/40—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom having the carbon atom of the carboxamide group bound to an acyclic carbon atom of a carbon skeleton containing six-membered aromatic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/64—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings
- C07C233/77—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups
- C07C233/78—Carboxylic acid amides having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by amino groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C235/10—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having the nitrogen atom of at least one of the carboxamide groups bound to an acyclic carbon atom of a hydrocarbon radical substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/32—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C235/34—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton containing six-membered aromatic rings having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/50—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atom of at least one of the carboxamide groups bound to an acyclic carbon atom of a hydrocarbon radical substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pain & Pain Management (AREA)
- Pharmacology & Pharmacy (AREA)
- Rheumatology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicinal Preparation (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS791570A CS199699B2 (cs) | 1976-12-16 | 1979-03-08 | Způsob výroby esterů derivátů fenylethylaminu |
| CS791571A CS199700B2 (cs) | 1976-12-16 | 1979-03-08 | Způsob výroby esterů derivátů fenylethylaminu |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB52553/76A GB1591618A (en) | 1976-12-16 | 1976-12-16 | Esters of hydroxy amino amides |
| GB4077377 | 1977-09-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS199698B2 true CS199698B2 (en) | 1980-07-31 |
Family
ID=26264498
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS778424A CS199698B2 (en) | 1976-12-16 | 1977-12-15 | Method of producing esters of phenylethylamine derivatives |
Country Status (26)
| Country | Link |
|---|---|
| US (2) | US4423070A (pl) |
| JP (1) | JPS5384928A (pl) |
| AR (1) | AR217094A1 (pl) |
| AT (1) | AT356083B (pl) |
| AU (1) | AU518148B2 (pl) |
| CA (1) | CA1121379A (pl) |
| CS (1) | CS199698B2 (pl) |
| DD (1) | DD133941A5 (pl) |
| DE (1) | DE2756001A1 (pl) |
| DK (1) | DK562177A (pl) |
| ES (2) | ES465149A1 (pl) |
| FI (1) | FI67842C (pl) |
| FR (1) | FR2374300A1 (pl) |
| GR (1) | GR63097B (pl) |
| HU (1) | HU176680B (pl) |
| IE (1) | IE45991B1 (pl) |
| IL (1) | IL53466A (pl) |
| IT (1) | IT1143786B (pl) |
| LU (1) | LU78688A1 (pl) |
| NL (1) | NL7713655A (pl) |
| NO (1) | NO148263C (pl) |
| PL (3) | PL114111B1 (pl) |
| PT (1) | PT67412B (pl) |
| SE (1) | SE437019B (pl) |
| SU (3) | SU822753A3 (pl) |
| YU (1) | YU298777A (pl) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0006298B1 (en) * | 1978-06-15 | 1982-03-31 | Imperial Chemical Industries Plc | Anti-inflammatory 1-phenyl-2-aminoethanol derivatives, pharmaceutical compositions thereof for topical use, and processes for their manufacture |
| CA1241967A (en) * | 1984-05-11 | 1988-09-13 | George C. Buzby Jr. | Sulfonamides useful as anti-arrhythmic agents |
| CN109232251B (zh) * | 2018-09-05 | 2022-03-25 | 潍坊医学院 | 青心酮衍生物、其制备方法、应用及药物组合物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1298711A (en) | 1970-01-26 | 1972-12-06 | Binder Engineering Company Ltd | Test bush |
| DE2401450A1 (de) | 1973-01-16 | 1974-07-18 | John James Voorhees | Pharmazeutische zusammensetzung zur linderung von hautproliferationserkrankungen |
| GB1460593A (en) * | 1973-06-22 | 1977-01-06 | Ici Ltd | Ethanolamine derivatives |
| GB1468156A (en) * | 1973-07-19 | 1977-03-23 | Ici Ltd | Phenylethylamine derivatives |
| US3957870A (en) * | 1973-07-19 | 1976-05-18 | Imperial Chemical Industries Limited | Organic compounds |
-
1977
- 1977-11-21 IE IE2355/77A patent/IE45991B1/en unknown
- 1977-11-22 CA CA000291507A patent/CA1121379A/en not_active Expired
- 1977-11-23 AU AU30869/77A patent/AU518148B2/en not_active Expired
- 1977-11-23 US US05/855,004 patent/US4423070A/en not_active Expired - Lifetime
- 1977-11-25 IL IL53466A patent/IL53466A/xx unknown
- 1977-12-02 GR GR54912A patent/GR63097B/el unknown
- 1977-12-06 SE SE7713830A patent/SE437019B/sv unknown
- 1977-12-09 NL NL7713655A patent/NL7713655A/xx not_active Application Discontinuation
- 1977-12-14 PL PL1977202935A patent/PL114111B1/pl unknown
- 1977-12-14 FI FI773779A patent/FI67842C/fi not_active IP Right Cessation
- 1977-12-14 AR AR270354A patent/AR217094A1/es active
- 1977-12-14 PL PL1977216324A patent/PL113857B1/pl unknown
- 1977-12-14 LU LU7778688A patent/LU78688A1/xx unknown
- 1977-12-14 PL PL1977216323A patent/PL113856B1/pl unknown
- 1977-12-14 HU HU77IE817A patent/HU176680B/hu unknown
- 1977-12-15 YU YU02987/77A patent/YU298777A/xx unknown
- 1977-12-15 FR FR7737940A patent/FR2374300A1/fr active Granted
- 1977-12-15 NO NO774326A patent/NO148263C/no unknown
- 1977-12-15 PT PT67412A patent/PT67412B/pt unknown
- 1977-12-15 DD DD77202671A patent/DD133941A5/xx unknown
- 1977-12-15 DE DE19772756001 patent/DE2756001A1/de not_active Ceased
- 1977-12-15 CS CS778424A patent/CS199698B2/cs unknown
- 1977-12-16 IT IT30848/77A patent/IT1143786B/it active
- 1977-12-16 SU SU772553500A patent/SU822753A3/ru active
- 1977-12-16 DK DK562177A patent/DK562177A/da not_active Application Discontinuation
- 1977-12-16 AT AT902277A patent/AT356083B/de not_active IP Right Cessation
- 1977-12-16 ES ES465149A patent/ES465149A1/es not_active Expired
- 1977-12-16 JP JP15229877A patent/JPS5384928A/ja active Pending
-
1978
- 1978-10-16 ES ES474222A patent/ES474222A1/es not_active Expired
-
1979
- 1979-06-18 SU SU792780255A patent/SU860691A3/ru active
- 1979-06-18 SU SU792776609A patent/SU974935A3/ru active
-
1982
- 1982-09-09 US US06/416,369 patent/US4470997A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU606848B2 (en) | (N-substituted-2-hydroxy) benzamides and N-substituted- 2-hydroxy-a-oxo-benzeneacetamides, pharmaceutical compositions and methods of use thereof having activity as modulators of the arachidonic acid cascade | |
| Erhardt et al. | Ultra-short-acting. beta.-adrenergic receptor blocking agents. 1.(Aryloxy) propanolamines containing esters in the nitrogen substituent | |
| EP0048037A1 (en) | Optically active 1-alkyl-3-(4-substituted-phenyl)-propylamines | |
| CA1116611A (en) | Imidazole derivatives exhibiting anticonvulsant activity | |
| PL113879B1 (en) | Process for preparing novel racemic or optically active1-aryloxy-2-hydroxy-3-alkylenaminopropanes | |
| JP2554322B2 (ja) | ５−リポキシゲナ−ゼ阻害剤としての２−置換−１−ナフト−ル類 | |
| AU631822B2 (en) | Novel naphthalene carboxylic acids | |
| EP0142283B1 (en) | Phenylethylamines, process for their preparation and compositions containing them | |
| USRE38921E1 (en) | Phenoxyalkylcarboxylic acid derivatives and process for their preparations | |
| EP0375670B1 (en) | Process for preparing 3-polyfluoroalkylisoxazolylamines | |
| GB1576007A (en) | Hypolipidaemic compositions | |
| NZ241864A (en) | Acylaminophenol derivatives and pharmaceutical compositions thereof | |
| PT87503B (pt) | Processo para a preparacao de novos derivados de catecolamina | |
| CS199698B2 (en) | Method of producing esters of phenylethylamine derivatives | |
| US6214882B1 (en) | Benzenesulphonamide derivatives, preparation thereof and therapeutical uses thereof | |
| US4275219A (en) | Novel process and intermediates useful in the preparation of sympathomimetic amines | |
| US4211876A (en) | 3-Pyrazolidinone carboxamides | |
| FI67216C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1,-ditiolanyl(2)- och 1,3-ditianyl(2)-foereningar | |
| US3997608A (en) | N-substituted-dihydroxyphenethylamines | |
| US4008269A (en) | Phenylacetic acids | |
| US4048231A (en) | 4-[3-(Substituted amino)-2-hydroxypropoxy]-5,6,7,8-tetrahydro-1,6,7-naphthalenetriols | |
| CS199699B2 (cs) | Způsob výroby esterů derivátů fenylethylaminu | |
| EP0031184B1 (en) | Process for the preparation of 4-(2-(dimethylamino)-ethoxy)-2-methyl-5-(1-methylethyl)-phenol esters and their salts | |
| US4985442A (en) | 2-substituted-1-naphthols as 5-lipoxygenase inhibitors | |
| KR850001757B1 (ko) | 페닐에틸아민 에스테르 유도체의 제조방법 |