CN108602813B - 作为apj受体激动剂的杂芳基羟基嘧啶酮 - Google Patents
作为apj受体激动剂的杂芳基羟基嘧啶酮 Download PDFInfo
- Publication number
- CN108602813B CN108602813B CN201680081704.3A CN201680081704A CN108602813B CN 108602813 B CN108602813 B CN 108602813B CN 201680081704 A CN201680081704 A CN 201680081704A CN 108602813 B CN108602813 B CN 108602813B
- Authority
- CN
- China
- Prior art keywords
- oxadiazol
- methyl
- hydroxy
- independently selected
- dihydropyrimidin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229940124752 APJ receptor agonist Drugs 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 248
- 239000003814 drug Substances 0.000 claims abstract description 49
- 238000011282 treatment Methods 0.000 claims abstract description 34
- 208000024172 Cardiovascular disease Diseases 0.000 claims abstract description 6
- -1 substituted Chemical class 0.000 claims description 186
- 125000000623 heterocyclic group Chemical group 0.000 claims description 141
- 125000000217 alkyl group Chemical group 0.000 claims description 128
- 229910052801 chlorine Inorganic materials 0.000 claims description 126
- 229910052731 fluorine Inorganic materials 0.000 claims description 119
- 229910052794 bromium Inorganic materials 0.000 claims description 97
- 229910052799 carbon Inorganic materials 0.000 claims description 86
- 229910052739 hydrogen Inorganic materials 0.000 claims description 81
- 150000003839 salts Chemical class 0.000 claims description 66
- 229910052757 nitrogen Inorganic materials 0.000 claims description 61
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 46
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 41
- 206010019280 Heart failures Diseases 0.000 claims description 40
- 229910052760 oxygen Inorganic materials 0.000 claims description 40
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 39
- 150000001721 carbon Chemical group 0.000 claims description 38
- 125000004432 carbon atom Chemical group C* 0.000 claims description 37
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 37
- 229910052717 sulfur Inorganic materials 0.000 claims description 36
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 30
- 125000003118 aryl group Chemical group 0.000 claims description 28
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 26
- 229910052736 halogen Inorganic materials 0.000 claims description 25
- 150000002367 halogens Chemical class 0.000 claims description 25
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 24
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 23
- 125000005842 heteroatom Chemical group 0.000 claims description 22
- 239000008194 pharmaceutical composition Substances 0.000 claims description 20
- 125000001072 heteroaryl group Chemical group 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- 125000004076 pyridyl group Chemical group 0.000 claims description 18
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 13
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 12
- 206010012601 diabetes mellitus Diseases 0.000 claims description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 10
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 10
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 10
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 9
- 125000004452 carbocyclyl group Chemical group 0.000 claims description 8
- 208000029078 coronary artery disease Diseases 0.000 claims description 8
- 125000001544 thienyl group Chemical group 0.000 claims description 8
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000002541 furyl group Chemical group 0.000 claims description 7
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 7
- 208000010125 myocardial infarction Diseases 0.000 claims description 7
- 125000002971 oxazolyl group Chemical group 0.000 claims description 7
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 7
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 7
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 7
- 125000000335 thiazolyl group Chemical group 0.000 claims description 7
- 125000004306 triazinyl group Chemical group 0.000 claims description 7
- 125000004122 cyclic group Chemical group 0.000 claims description 6
- 125000002883 imidazolyl group Chemical group 0.000 claims description 6
- 230000002107 myocardial effect Effects 0.000 claims description 6
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 6
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 6
- 125000001425 triazolyl group Chemical group 0.000 claims description 6
- 125000005955 1H-indazolyl group Chemical group 0.000 claims description 5
- 208000006011 Stroke Diseases 0.000 claims description 5
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000000160 oxazolidinyl group Chemical group 0.000 claims description 5
- 125000004525 thiadiazinyl group Chemical group S1NN=C(C=C1)* 0.000 claims description 5
- OWZXVYWBKRDTPQ-UHFFFAOYSA-N C(CCC)C1=NC(=C(C(N1C(C)C1=CC=NC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1C(C)C1=CC=NC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O OWZXVYWBKRDTPQ-UHFFFAOYSA-N 0.000 claims description 4
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 4
- 125000002837 carbocyclic group Chemical group 0.000 claims description 4
- 125000002757 morpholinyl group Chemical group 0.000 claims description 4
- 125000004193 piperazinyl group Chemical group 0.000 claims description 4
- 125000003386 piperidinyl group Chemical group 0.000 claims description 4
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 4
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 4
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 4
- BTWJHXDDGRUVCN-UHFFFAOYSA-N 2,6-dicyclopropylaniline Chemical compound C1(CC1)C1=C(N)C(=CC=C1)C1CC1 BTWJHXDDGRUVCN-UHFFFAOYSA-N 0.000 claims description 3
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 claims description 3
- HTBOYGSCRSWFJA-UHFFFAOYSA-N C(C1=CC=CC=C1)N1N=CC(=C1)C=1C(N(C(=NC=1O)CCCC)C1=C(C=CC=C1OC)OC)=O Chemical compound C(C1=CC=CC=C1)N1N=CC(=C1)C=1C(N(C(=NC=1O)CCCC)C1=C(C=CC=C1OC)OC)=O HTBOYGSCRSWFJA-UHFFFAOYSA-N 0.000 claims description 3
- DLXIIUHCSBWTKT-UHFFFAOYSA-N C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O)C1=C(C=CC=C1OC1CC1)OC1CC1 Chemical compound C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O)C1=C(C=CC=C1OC1CC1)OC1CC1 DLXIIUHCSBWTKT-UHFFFAOYSA-N 0.000 claims description 3
- WMCRVHLXPDMMSC-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CC(=O)N(CC)CC)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CC(=O)N(CC)CC)O)C1=C(C=CC=C1OC)OC WMCRVHLXPDMMSC-UHFFFAOYSA-N 0.000 claims description 3
- ZJPLFQZENSGJNK-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CN(C(C1=NC=CC=C1)=O)C)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CN(C(C1=NC=CC=C1)=O)C)O)C1=C(C=CC=C1OC)OC ZJPLFQZENSGJNK-UHFFFAOYSA-N 0.000 claims description 3
- 206010007572 Cardiac hypertrophy Diseases 0.000 claims description 3
- 208000006029 Cardiomegaly Diseases 0.000 claims description 3
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 claims description 3
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 claims description 3
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 claims description 3
- 125000004935 benzoxazolinyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 3
- 125000002632 imidazolidinyl group Chemical group 0.000 claims description 3
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 claims description 3
- IBENILMLQGLCTI-MRXNPFEDSA-N 5-[5-(1,2-benzoxazol-3-ylmethyl)-1,3,4-oxadiazol-2-yl]-2-butyl-6-hydroxy-3-[(1R)-1-(2-methoxyphenyl)ethyl]pyrimidin-4-one Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H](C)C1=C(C=CC=C1)OC)=O IBENILMLQGLCTI-MRXNPFEDSA-N 0.000 claims description 2
- CYPCVBLRQLRMJB-UHFFFAOYSA-N C(CC=C)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O)C1=C(C=CC=C1OC)OC Chemical compound C(CC=C)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O)C1=C(C=CC=C1OC)OC CYPCVBLRQLRMJB-UHFFFAOYSA-N 0.000 claims description 2
- ZRSIMRRIMMJHGT-UHFFFAOYSA-N C(CC=C)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=NC(=NO1)C1=NC=CC=C1)O)C1=C(C=CC=C1OC)OC Chemical compound C(CC=C)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=NC(=NO1)C1=NC=CC=C1)O)C1=C(C=CC=C1OC)OC ZRSIMRRIMMJHGT-UHFFFAOYSA-N 0.000 claims description 2
- BBUMQEWQESEOFA-UHFFFAOYSA-N C(CCC)C1=NC(=C(C(N1C(C(C)C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1C(C(C)C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O BBUMQEWQESEOFA-UHFFFAOYSA-N 0.000 claims description 2
- PIXROMBOTMUZMB-UHFFFAOYSA-N C(CCC)C1=NC(=C(C(N1C(C)C=1C=NC=CC=1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1C(C)C=1C=NC=CC=1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O PIXROMBOTMUZMB-UHFFFAOYSA-N 0.000 claims description 2
- ZSJFHPVXHKIXQP-UHFFFAOYSA-N C(CCC)C1=NC(=C(C(N1C(C)C=1C=NC=CC=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1C(C)C=1C=NC=CC=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O ZSJFHPVXHKIXQP-UHFFFAOYSA-N 0.000 claims description 2
- GHWPXRHJKGYJCL-UHFFFAOYSA-N C(CCC)C1=NC(=C(C(N1C1=C(C=CC=C1OC)OC)=O)C=1C=NN(C=1)CC1=CC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1C1=C(C=CC=C1OC)OC)=O)C=1C=NN(C=1)CC1=CC=C(C=C1)Cl)O GHWPXRHJKGYJCL-UHFFFAOYSA-N 0.000 claims description 2
- HGODFKHCVRSQSS-HNNXBMFYSA-N C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC(=CC=C1)OC)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC(=CC=C1)OC)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O HGODFKHCVRSQSS-HNNXBMFYSA-N 0.000 claims description 2
- UCAUMZAHBRKIJF-AWEZNQCLSA-N C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC=C(C=C1)F)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC=C(C=C1)F)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O UCAUMZAHBRKIJF-AWEZNQCLSA-N 0.000 claims description 2
- VCSXDRYKIWULQZ-ZDUSSCGKSA-N C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC=C(C=C1)F)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC=C(C=C1)F)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O VCSXDRYKIWULQZ-ZDUSSCGKSA-N 0.000 claims description 2
- ULPPTQXIFDOULD-HNNXBMFYSA-N C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O ULPPTQXIFDOULD-HNNXBMFYSA-N 0.000 claims description 2
- CAJUADQQHLOWGI-AWEZNQCLSA-N C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O CAJUADQQHLOWGI-AWEZNQCLSA-N 0.000 claims description 2
- JJDSBXGSQPMOGI-FQEVSTJZSA-N C(CCC)C1=NC(=C(C(N1[C@@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O JJDSBXGSQPMOGI-FQEVSTJZSA-N 0.000 claims description 2
- RGFSVHZTUZFQLL-IBGZPJMESA-N C(CCC)C1=NC(=C(C(N1[C@@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O RGFSVHZTUZFQLL-IBGZPJMESA-N 0.000 claims description 2
- MOQXCLBVTAOJOD-SFHVURJKSA-N C(CCC)C1=NC(=C(C(N1[C@@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O MOQXCLBVTAOJOD-SFHVURJKSA-N 0.000 claims description 2
- PIJWRZFLSPGMGS-FQEVSTJZSA-N C(CCC)C1=NC(=C(C(N1[C@@H](CCC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](CCC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O PIJWRZFLSPGMGS-FQEVSTJZSA-N 0.000 claims description 2
- UTBKJTGFDKQQLY-IBGZPJMESA-N C(CCC)C1=NC(=C(C(N1[C@@H](CCC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](CCC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O UTBKJTGFDKQQLY-IBGZPJMESA-N 0.000 claims description 2
- ABXROTYIZABWRF-IBGZPJMESA-N C(CCC)C1=NC(=C(C(N1[C@@H](COC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](COC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O ABXROTYIZABWRF-IBGZPJMESA-N 0.000 claims description 2
- FMSMIHBDXGRQEP-SFHVURJKSA-N C(CCC)C1=NC(=C(C(N1[C@@H](COC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](COC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O FMSMIHBDXGRQEP-SFHVURJKSA-N 0.000 claims description 2
- MBEZYGIKMRFBHP-LJQANCHMSA-N C(CCC)C1=NC(=C(C(N1[C@@H]1CCC2=CC=CC=C12)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H]1CCC2=CC=CC=C12)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O MBEZYGIKMRFBHP-LJQANCHMSA-N 0.000 claims description 2
- OAMIJXRKLULGPY-MRXNPFEDSA-N C(CCC)C1=NC(=C(C(N1[C@H](C)C1=C(C=CC=C1)OC)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](C)C1=C(C=CC=C1)OC)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O OAMIJXRKLULGPY-MRXNPFEDSA-N 0.000 claims description 2
- PHNWRQBUKUYDRC-CQSZACIVSA-N C(CCC)C1=NC(=C(C(N1[C@H](C)C1=C(C=CC=C1)OC)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](C)C1=C(C=CC=C1)OC)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O PHNWRQBUKUYDRC-CQSZACIVSA-N 0.000 claims description 2
- PNNIJYGZLUGNRH-MRXNPFEDSA-N C(CCC)C1=NC(=C(C(N1[C@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O PNNIJYGZLUGNRH-MRXNPFEDSA-N 0.000 claims description 2
- ULPPTQXIFDOULD-OAHLLOKOSA-N C(CCC)C1=NC(=C(C(N1[C@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O ULPPTQXIFDOULD-OAHLLOKOSA-N 0.000 claims description 2
- CAJUADQQHLOWGI-CQSZACIVSA-N C(CCC)C1=NC(=C(C(N1[C@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O CAJUADQQHLOWGI-CQSZACIVSA-N 0.000 claims description 2
- DLGNIBIETVEUSL-LLVKDONJSA-N C(CCC)C1=NC(=C(C(N1[C@H](C)C1CC1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](C)C1CC1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O DLGNIBIETVEUSL-LLVKDONJSA-N 0.000 claims description 2
- JJDSBXGSQPMOGI-HXUWFJFHSA-N C(CCC)C1=NC(=C(C(N1[C@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O JJDSBXGSQPMOGI-HXUWFJFHSA-N 0.000 claims description 2
- MOQXCLBVTAOJOD-GOSISDBHSA-N C(CCC)C1=NC(=C(C(N1[C@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](CC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O MOQXCLBVTAOJOD-GOSISDBHSA-N 0.000 claims description 2
- ABXROTYIZABWRF-LJQANCHMSA-N C(CCC)C1=NC(=C(C(N1[C@H](COC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](COC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O ABXROTYIZABWRF-LJQANCHMSA-N 0.000 claims description 2
- FMSMIHBDXGRQEP-GOSISDBHSA-N C(CCC)C1=NC(=C(C(N1[C@H](COC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H](COC)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O FMSMIHBDXGRQEP-GOSISDBHSA-N 0.000 claims description 2
- YGCBASJGZGBYCW-SFHVURJKSA-N C(CCC)C1=NC(=C(C(N1[C@H]1CCC2=CC=CC=C12)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H]1CCC2=CC=CC=C12)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O YGCBASJGZGBYCW-SFHVURJKSA-N 0.000 claims description 2
- HEPJVYCBZRKCQG-FQEVSTJZSA-N C(CCC)C1=NC(=C(C(N1[C@H]1CCCC2=CC=CC=C12)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@H]1CCCC2=CC=CC=C12)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O HEPJVYCBZRKCQG-FQEVSTJZSA-N 0.000 claims description 2
- TZKAZXPKUCDKAV-UHFFFAOYSA-N C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O)C1=C(C=CC=C1OCC)OCC Chemical compound C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O)C1=C(C=CC=C1OCC)OCC TZKAZXPKUCDKAV-UHFFFAOYSA-N 0.000 claims description 2
- FYNYWEIOUXVDCL-UHFFFAOYSA-N C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OC)OC Chemical compound C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OC)OC FYNYWEIOUXVDCL-UHFFFAOYSA-N 0.000 claims description 2
- NSRZFEALDADTQK-UHFFFAOYSA-N C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OCC)OCC Chemical compound C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OCC)OCC NSRZFEALDADTQK-UHFFFAOYSA-N 0.000 claims description 2
- AEZMRNIQFPNBET-UHFFFAOYSA-N C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(C=CC=C1)=O)O)C1=C(C=CC=C1OC)OC Chemical compound C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(C=CC=C1)=O)O)C1=C(C=CC=C1OC)OC AEZMRNIQFPNBET-UHFFFAOYSA-N 0.000 claims description 2
- VKVREHMPBFVZCF-UHFFFAOYSA-N C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(CCC1)=O)O)C1=C(C=CC=C1OC)OC Chemical compound C(CCC)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(CCC1)=O)O)C1=C(C=CC=C1OC)OC VKVREHMPBFVZCF-UHFFFAOYSA-N 0.000 claims description 2
- DZWOPDNQOTYUIR-HNNXBMFYSA-N C(CCC)C=1N(C(C(=C(N=1)O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)=O)[C@@H](C)C=1C=C(C#N)C=CC=1 Chemical compound C(CCC)C=1N(C(C(=C(N=1)O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)=O)[C@@H](C)C=1C=C(C#N)C=CC=1 DZWOPDNQOTYUIR-HNNXBMFYSA-N 0.000 claims description 2
- HGFDAIXTUSPWHV-AWEZNQCLSA-N C(CCC)C=1N(C(C(=C(N=1)O)C=1OC(=NN=1)CC=1N=C(SC=1)C)=O)[C@@H](C)C=1C=C(C#N)C=CC=1 Chemical compound C(CCC)C=1N(C(C(=C(N=1)O)C=1OC(=NN=1)CC=1N=C(SC=1)C)=O)[C@@H](C)C=1C=C(C#N)C=CC=1 HGFDAIXTUSPWHV-AWEZNQCLSA-N 0.000 claims description 2
- PKQDWVJCISVGRT-UHFFFAOYSA-N C1(CC1)CC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=NC(=NO1)C1=NC=CC=C1)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=NC(=NO1)C1=NC=CC=C1)O)C1=C(C=CC=C1OC)OC PKQDWVJCISVGRT-UHFFFAOYSA-N 0.000 claims description 2
- IBSLURNSMQSJBI-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CN1C(COCC1)=O)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CN1C(COCC1)=O)O)C1=C(C=CC=C1OC)OC IBSLURNSMQSJBI-UHFFFAOYSA-N 0.000 claims description 2
- XVQSKPPFAQSYIK-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)F)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)F)O)C1=C(C=CC=C1OC)OC XVQSKPPFAQSYIK-UHFFFAOYSA-N 0.000 claims description 2
- QVKLEXAJULUIIS-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OC)OC QVKLEXAJULUIIS-UHFFFAOYSA-N 0.000 claims description 2
- SBBWHFPXCMFVLZ-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(C=CC=C1)=O)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(C=CC=C1)=O)O)C1=C(C=CC=C1OC)OC SBBWHFPXCMFVLZ-UHFFFAOYSA-N 0.000 claims description 2
- NNQZAMRVDLQFPZ-UHFFFAOYSA-N C1(CCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OC)OC NNQZAMRVDLQFPZ-UHFFFAOYSA-N 0.000 claims description 2
- NRVIVCKIVMAECC-UHFFFAOYSA-N C1(CCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(CCC1)=O)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(CCC1)=O)O)C1=C(C=CC=C1OC)OC NRVIVCKIVMAECC-UHFFFAOYSA-N 0.000 claims description 2
- MTAALOMRBORGMH-UHFFFAOYSA-N C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)F)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)F)O)C1=C(C=CC=C1OC)OC MTAALOMRBORGMH-UHFFFAOYSA-N 0.000 claims description 2
- WOCYBAANEBMZEH-UHFFFAOYSA-N C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1C=NC(=CC=1)C)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1C=NC(=CC=1)C)O)C1=C(C=CC=C1OC)OC WOCYBAANEBMZEH-UHFFFAOYSA-N 0.000 claims description 2
- ZIHSIKYBQUFPFI-UHFFFAOYSA-N C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CC=1N=C(SC=1)C)O)C1=C(C=CC=C1OC)OC ZIHSIKYBQUFPFI-UHFFFAOYSA-N 0.000 claims description 2
- DARGZOLBJYQOIF-UHFFFAOYSA-N C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(CCC1)=O)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(CCC1)=O)O)C1=C(C=CC=C1OC)OC DARGZOLBJYQOIF-UHFFFAOYSA-N 0.000 claims description 2
- LQIDAIWCYSFZBE-UHFFFAOYSA-N CCCCC1=NC(=O)C(C2=NN=C(CC3=NC(=NO3)C3=NC=CC=C3)O2)=C(O)N1C1=C(OC)C=CC=C1OC Chemical compound CCCCC1=NC(=O)C(C2=NN=C(CC3=NC(=NO3)C3=NC=CC=C3)O2)=C(O)N1C1=C(OC)C=CC=C1OC LQIDAIWCYSFZBE-UHFFFAOYSA-N 0.000 claims description 2
- RZEBYIMLNDECPJ-UHFFFAOYSA-N CCCCC1=NC(=O)C(C2=NN=C(CC3=NOC4=C3C=CC=C4)O2)=C(O)N1C1=C(OC)C=CC=C1C Chemical compound CCCCC1=NC(=O)C(C2=NN=C(CC3=NOC4=C3C=CC=C4)O2)=C(O)N1C1=C(OC)C=CC=C1C RZEBYIMLNDECPJ-UHFFFAOYSA-N 0.000 claims description 2
- LZGBIBKKAPJSIL-UHFFFAOYSA-N COC1=C(C(=CC=C1)OC)N1C(=NC(C(=C1O)C=1OC(=NN=1)CC=1N=C(SC=1)C1=CC=CC=C1)=O)COCC Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NC(C(=C1O)C=1OC(=NN=1)CC=1N=C(SC=1)C1=CC=CC=C1)=O)COCC LZGBIBKKAPJSIL-UHFFFAOYSA-N 0.000 claims description 2
- GPIKFANKLSYNGQ-UHFFFAOYSA-N COC1=C(C(=CC=C1)OC)N1C(=NC(C(=C1O)C=1OC(=NN=1)CN1C(C=CC=C1)=O)=O)CCC(C)C Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NC(C(=C1O)C=1OC(=NN=1)CN1C(C=CC=C1)=O)=O)CCC(C)C GPIKFANKLSYNGQ-UHFFFAOYSA-N 0.000 claims description 2
- LQXLBWOIKLWHKG-UHFFFAOYSA-N COC1=C(C(=CC=C1)OC)N1C(=NC(C(=C1O)C=1OC(=NN=1)CN1C(CCC1)=O)=O)CCC(C)C Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NC(C(=C1O)C=1OC(=NN=1)CN1C(CCC1)=O)=O)CCC(C)C LQXLBWOIKLWHKG-UHFFFAOYSA-N 0.000 claims description 2
- NHPQOAHSZUNWQJ-UHFFFAOYSA-N COC1=CC=CC(OC)=C1N1C(O)=C(C2=NN=C(CC3=CC=C(Cl)C=C3)O2)C(=O)N=C1CC1CC1 Chemical compound COC1=CC=CC(OC)=C1N1C(O)=C(C2=NN=C(CC3=CC=C(Cl)C=C3)O2)C(=O)N=C1CC1CC1 NHPQOAHSZUNWQJ-UHFFFAOYSA-N 0.000 claims description 2
- TZALDFIRMLWQQA-UHFFFAOYSA-N COC1=CC=CC(OC)=C1N1C(O)=C(C2=NN=C(CC3=NOC4=C3C=CC=C4)O2)C(=O)N=C1CCC=C Chemical compound COC1=CC=CC(OC)=C1N1C(O)=C(C2=NN=C(CC3=NOC4=C3C=CC=C4)O2)C(=O)N=C1CCC=C TZALDFIRMLWQQA-UHFFFAOYSA-N 0.000 claims description 2
- ZFNFYCCKMMXCMI-UHFFFAOYSA-N COC1=CC=CC(OC)=C1N1C(O)=C(C2=NN=C(CN3CCOCC3=O)O2)C(=O)N=C1CCC(C)C Chemical compound COC1=CC=CC(OC)=C1N1C(O)=C(C2=NN=C(CN3CCOCC3=O)O2)C(=O)N=C1CCC(C)C ZFNFYCCKMMXCMI-UHFFFAOYSA-N 0.000 claims description 2
- 208000031229 Cardiomyopathies Diseases 0.000 claims description 2
- XEKLAZRFRALLPR-UHFFFAOYSA-N ClC1=C(C=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COCC)=O)F Chemical compound ClC1=C(C=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COCC)=O)F XEKLAZRFRALLPR-UHFFFAOYSA-N 0.000 claims description 2
- SBXALHJIIWYLNM-UHFFFAOYSA-N ClC1=CC(=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COC(C)C)=O)F Chemical compound ClC1=CC(=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COC(C)C)=O)F SBXALHJIIWYLNM-UHFFFAOYSA-N 0.000 claims description 2
- NUXJOCJWIGOOBD-UHFFFAOYSA-N ClC1=CC=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1CC)CC)COCC)=O Chemical compound ClC1=CC=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1CC)CC)COCC)=O NUXJOCJWIGOOBD-UHFFFAOYSA-N 0.000 claims description 2
- NQZHRUYQEGZCEY-UHFFFAOYSA-N ClC1=CC=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CCC1CC1)=O Chemical compound ClC1=CC=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CCC1CC1)=O NQZHRUYQEGZCEY-UHFFFAOYSA-N 0.000 claims description 2
- KZWMVINSVSZGFZ-UHFFFAOYSA-N ClC1=CC=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COC(C)C)=O Chemical compound ClC1=CC=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COC(C)C)=O KZWMVINSVSZGFZ-UHFFFAOYSA-N 0.000 claims description 2
- DGYLWKLQHVNSDD-UHFFFAOYSA-N ClC1=CC=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COCC)=O Chemical compound ClC1=CC=C(C=C1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COCC)=O DGYLWKLQHVNSDD-UHFFFAOYSA-N 0.000 claims description 2
- OGGDYGWQZBLRGO-UHFFFAOYSA-N ClC1=CC=C(C=N1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCCC1)=O Chemical compound ClC1=CC=C(C=N1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCCC1)=O OGGDYGWQZBLRGO-UHFFFAOYSA-N 0.000 claims description 2
- GMOUAWBHSYBCCK-UHFFFAOYSA-N ClC=1C=C(C(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCC1)=O)F Chemical compound ClC=1C=C(C(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCC1)=O)F GMOUAWBHSYBCCK-UHFFFAOYSA-N 0.000 claims description 2
- DNJOWKHMPNCZNP-UHFFFAOYSA-N ClC=1C=C(C(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCCC1)=O)F Chemical compound ClC=1C=C(C(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCCC1)=O)F DNJOWKHMPNCZNP-UHFFFAOYSA-N 0.000 claims description 2
- SWIAJSZQGMBUOW-UHFFFAOYSA-N ClC=1C=CC(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCC1)=O Chemical compound ClC=1C=CC(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCC1)=O SWIAJSZQGMBUOW-UHFFFAOYSA-N 0.000 claims description 2
- MCXIJGWFHIBMAE-UHFFFAOYSA-N ClC=1C=CC(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCCC1)=O Chemical compound ClC=1C=CC(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)C1CCCC1)=O MCXIJGWFHIBMAE-UHFFFAOYSA-N 0.000 claims description 2
- UMGLSZSEOLUDEE-UHFFFAOYSA-N ClC=1C=CC(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CCC1CC1)=O Chemical compound ClC=1C=CC(=NC=1)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CCC1CC1)=O UMGLSZSEOLUDEE-UHFFFAOYSA-N 0.000 claims description 2
- 206010061216 Infarction Diseases 0.000 claims description 2
- ABJMZHNHUDUCII-INIZCTEOSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C1=C(N=C(N(C1=O)[C@@H](C)C=1C=C(C#N)C=CC=1)CCCC)O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C1=C(N=C(N(C1=O)[C@@H](C)C=1C=C(C#N)C=CC=1)CCCC)O ABJMZHNHUDUCII-INIZCTEOSA-N 0.000 claims description 2
- JWAVLGXGTJURLG-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)C(C(C)C)C1=CC=CC=C1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)C(C(C)C)C1=CC=CC=C1)=O JWAVLGXGTJURLG-UHFFFAOYSA-N 0.000 claims description 2
- XKYYTVIVVBXXAX-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)C(C)C1=CC=NC=C1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)C(C)C1=CC=NC=C1)=O XKYYTVIVVBXXAX-UHFFFAOYSA-N 0.000 claims description 2
- DSVDMLHGIHXMSD-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)C(C)C=1C=NC=CC=1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)C(C)C=1C=NC=CC=1)=O DSVDMLHGIHXMSD-UHFFFAOYSA-N 0.000 claims description 2
- PXXVYYFPXOMCGB-INIZCTEOSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](C)C1=CC(=CC=C1)OC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](C)C1=CC(=CC=C1)OC)=O PXXVYYFPXOMCGB-INIZCTEOSA-N 0.000 claims description 2
- PBOMTICKQTZXCO-INIZCTEOSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](C)C1=CC=C(C=C1)OC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](C)C1=CC=C(C=C1)OC)=O PBOMTICKQTZXCO-INIZCTEOSA-N 0.000 claims description 2
- SUVIMHBRFFFHOK-INIZCTEOSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](C)C1=CC=CC=C1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](C)C1=CC=CC=C1)=O SUVIMHBRFFFHOK-INIZCTEOSA-N 0.000 claims description 2
- VZKQNEGZUIOKJJ-NRFANRHFSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](CCC)C1=CC=CC=C1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](CCC)C1=CC=CC=C1)=O VZKQNEGZUIOKJJ-NRFANRHFSA-N 0.000 claims description 2
- AQHJYTPNGFNCCY-FQEVSTJZSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](COC)C1=CC=CC=C1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](COC)C1=CC=CC=C1)=O AQHJYTPNGFNCCY-FQEVSTJZSA-N 0.000 claims description 2
- GRWXRGPESFYWBI-HXUWFJFHSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H]1CCC2=CC=CC=C12)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H]1CCC2=CC=CC=C12)=O GRWXRGPESFYWBI-HXUWFJFHSA-N 0.000 claims description 2
- SUVIMHBRFFFHOK-MRXNPFEDSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H](C)C1=CC=CC=C1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H](C)C1=CC=CC=C1)=O SUVIMHBRFFFHOK-MRXNPFEDSA-N 0.000 claims description 2
- SPVAILQIYQDACK-HXUWFJFHSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H](CC)C1=CC=CC=C1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H](CC)C1=CC=CC=C1)=O SPVAILQIYQDACK-HXUWFJFHSA-N 0.000 claims description 2
- AQHJYTPNGFNCCY-HXUWFJFHSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H](COC)C1=CC=CC=C1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H](COC)C1=CC=CC=C1)=O AQHJYTPNGFNCCY-HXUWFJFHSA-N 0.000 claims description 2
- GRWXRGPESFYWBI-FQEVSTJZSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H]1CCC2=CC=CC=C12)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H]1CCC2=CC=CC=C12)=O GRWXRGPESFYWBI-FQEVSTJZSA-N 0.000 claims description 2
- VBBOZLPPEZRWTR-NRFANRHFSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H]1CCCC2=CC=CC=C12)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@H]1CCCC2=CC=CC=C12)=O VBBOZLPPEZRWTR-NRFANRHFSA-N 0.000 claims description 2
- WWFYBAQOOLWGDJ-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1Br)Br)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1Br)Br)CCCC)=O WWFYBAQOOLWGDJ-UHFFFAOYSA-N 0.000 claims description 2
- TXAOBLGIIXWHHK-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1C)OC)CCC=C)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1C)OC)CCC=C)=O TXAOBLGIIXWHHK-UHFFFAOYSA-N 0.000 claims description 2
- CYJMFDHMQFTTIV-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1CC)CC)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1CC)CC)CCCC)=O CYJMFDHMQFTTIV-UHFFFAOYSA-N 0.000 claims description 2
- CKJSZGAMWSSVEK-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1CC)CC)COCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1CC)CC)COCC)=O CKJSZGAMWSSVEK-UHFFFAOYSA-N 0.000 claims description 2
- WLVUSKYEOZIUJN-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1Cl)Cl)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1Cl)Cl)CCCC)=O WLVUSKYEOZIUJN-UHFFFAOYSA-N 0.000 claims description 2
- YXNWZYMTEZKOMK-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC(C)C)OC(C)C)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC(C)C)OC(C)C)CCCC)=O YXNWZYMTEZKOMK-UHFFFAOYSA-N 0.000 claims description 2
- FYMJPFKDEGIYLG-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CC1CC1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CC1CC1)=O FYMJPFKDEGIYLG-UHFFFAOYSA-N 0.000 claims description 2
- YGCSWOJICGKXQF-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CCCC(F)(F)F)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CCCC(F)(F)F)=O YGCSWOJICGKXQF-UHFFFAOYSA-N 0.000 claims description 2
- KODVMOAEXIPLCA-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COC(C)C)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COC(C)C)=O KODVMOAEXIPLCA-UHFFFAOYSA-N 0.000 claims description 2
- SLYSORWMBVBPAQ-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC1CC1)OC1CC1)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC1CC1)OC1CC1)CCCC)=O SLYSORWMBVBPAQ-UHFFFAOYSA-N 0.000 claims description 2
- YUNYXHODEFLQAS-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C=1C(=NC=NC=1OC)OC)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C=1C(=NC=NC=1OC)OC)CCCC)=O YUNYXHODEFLQAS-UHFFFAOYSA-N 0.000 claims description 2
- 208000038003 heart failure with preserved ejection fraction Diseases 0.000 claims description 2
- 125000005945 imidazopyridyl group Chemical group 0.000 claims description 2
- 230000007574 infarction Effects 0.000 claims description 2
- 125000005493 quinolyl group Chemical group 0.000 claims description 2
- 238000007634 remodeling Methods 0.000 claims description 2
- 235000019256 formaldehyde Nutrition 0.000 claims 11
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 5
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 claims 3
- JNRLEMMIVRBKJE-UHFFFAOYSA-N 4,4'-Methylenebis(N,N-dimethylaniline) Chemical compound C1=CC(N(C)C)=CC=C1CC1=CC=C(N(C)C)C=C1 JNRLEMMIVRBKJE-UHFFFAOYSA-N 0.000 claims 2
- 206010049694 Left Ventricular Dysfunction Diseases 0.000 claims 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 claims 1
- PIGNZTTWTGIFPO-XERRXZQWSA-N C(OC1=C(C(=CC=C1)OC([2H])([2H])[2H])N1C(=NC(C(=C1O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)=O)CCCC)([2H])([2H])[2H] Chemical compound C(OC1=C(C(=CC=C1)OC([2H])([2H])[2H])N1C(=NC(C(=C1O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)=O)CCCC)([2H])([2H])[2H] PIGNZTTWTGIFPO-XERRXZQWSA-N 0.000 claims 1
- DGYLWKLQHVNSDD-XERRXZQWSA-N C(OC1=C(C(=CC=C1)OC([2H])([2H])[2H])N1C(=NC(C(=C1O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)=O)COCC)([2H])([2H])[2H] Chemical compound C(OC1=C(C(=CC=C1)OC([2H])([2H])[2H])N1C(=NC(C(=C1O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)=O)COCC)([2H])([2H])[2H] DGYLWKLQHVNSDD-XERRXZQWSA-N 0.000 claims 1
- RZQSQDQIRFLTDT-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CNC(=O)C1=NC=CC=C1)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CNC(=O)C1=NC=CC=C1)O)C1=C(C=CC=C1OC)OC RZQSQDQIRFLTDT-UHFFFAOYSA-N 0.000 claims 1
- HUVPWOHNRRPVEF-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CNC(=O)C=1C=NC=CC=1)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CNC(=O)C=1C=NC=CC=1)O)C1=C(C=CC=C1OC)OC HUVPWOHNRRPVEF-UHFFFAOYSA-N 0.000 claims 1
- PIFVBTWHBSNHJR-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CNC(C1=CC=CC=C1)=O)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C1=NN=C(O1)CNC(C1=CC=CC=C1)=O)O)C1=C(C=CC=C1OC)OC PIFVBTWHBSNHJR-UHFFFAOYSA-N 0.000 claims 1
- VSGCPRZRCRMPOI-UHFFFAOYSA-N COC1=CC=CC(OC)=C1N1C(O)=C(C2=NN=C(CC3=NOC4=CC=CC=C34)O2)C(=O)N=C1CCC1CC1 Chemical compound COC1=CC=CC(OC)=C1N1C(O)=C(C2=NN=C(CC3=NOC4=CC=CC=C34)O2)C(=O)N=C1CCC1CC1 VSGCPRZRCRMPOI-UHFFFAOYSA-N 0.000 claims 1
- 206010007559 Cardiac failure congestive Diseases 0.000 claims 1
- FLOFJPDOKMJQKV-UHFFFAOYSA-N ClC=1C=C(C(=O)NCC=2OC(=NN=2)C=2C(N=C(N(C=2O)C2=C(C=CC=C2OC)OC)CCC2CC2)=O)C=CC=1 Chemical compound ClC=1C=C(C(=O)NCC=2OC(=NN=2)C=2C(N=C(N(C=2O)C2=C(C=CC=C2OC)OC)CCC2CC2)=O)C=CC=1 FLOFJPDOKMJQKV-UHFFFAOYSA-N 0.000 claims 1
- 208000003037 Diastolic Heart Failure Diseases 0.000 claims 1
- SPVAILQIYQDACK-FQEVSTJZSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](CC)C1=CC=CC=C1)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N(C(=NC=1O)CCCC)[C@@H](CC)C1=CC=CC=C1)=O SPVAILQIYQDACK-FQEVSTJZSA-N 0.000 claims 1
- WSEDPNJMJCKNSW-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C#N)C=CC=C1C#N)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C#N)C=CC=C1C#N)CCCC)=O WSEDPNJMJCKNSW-UHFFFAOYSA-N 0.000 claims 1
- IKDUHFVWQUJBGP-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1C1CC1)C1CC1)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1C1CC1)C1CC1)CCCC)=O IKDUHFVWQUJBGP-UHFFFAOYSA-N 0.000 claims 1
- UQSPDQBZYCFYTL-XERRXZQWSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC([2H])([2H])[2H])OC([2H])([2H])[2H])CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC([2H])([2H])[2H])OC([2H])([2H])[2H])CCCC)=O UQSPDQBZYCFYTL-XERRXZQWSA-N 0.000 claims 1
- PWINAHJVANBCCW-XERRXZQWSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC([2H])([2H])[2H])OC([2H])([2H])[2H])COCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC([2H])([2H])[2H])OC([2H])([2H])[2H])COCC)=O PWINAHJVANBCCW-XERRXZQWSA-N 0.000 claims 1
- UQSPDQBZYCFYTL-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)CCCC)=O UQSPDQBZYCFYTL-UHFFFAOYSA-N 0.000 claims 1
- PWINAHJVANBCCW-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OC)OC)COCC)=O PWINAHJVANBCCW-UHFFFAOYSA-N 0.000 claims 1
- CQIXTCOZPWAVCI-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OCC)OCC)CCCC)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1OCC)OCC)CCCC)=O CQIXTCOZPWAVCI-UHFFFAOYSA-N 0.000 claims 1
- PCKPVGOLPKLUHR-UHFFFAOYSA-N OH-Indolxyl Natural products C1=CC=C2C(O)=CNC2=C1 PCKPVGOLPKLUHR-UHFFFAOYSA-N 0.000 claims 1
- 208000008253 Systolic Heart Failure Diseases 0.000 claims 1
- 208000033774 Ventricular Remodeling Diseases 0.000 claims 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims 1
- 238000007675 cardiac surgery Methods 0.000 claims 1
- 208000018578 heart valve disease Diseases 0.000 claims 1
- 229910052738 indium Inorganic materials 0.000 claims 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims 1
- JYGFTBXVXVMTGB-UHFFFAOYSA-N indolin-2-one Chemical compound C1=CC=C2NC(=O)CC2=C1 JYGFTBXVXVMTGB-UHFFFAOYSA-N 0.000 claims 1
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 45
- 239000000556 agonist Substances 0.000 abstract description 10
- 229940079593 drug Drugs 0.000 abstract description 10
- 239000000460 chlorine Substances 0.000 description 96
- 238000000034 method Methods 0.000 description 80
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 77
- 239000011541 reaction mixture Substances 0.000 description 69
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 55
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 48
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 46
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 43
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 40
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 39
- 238000005160 1H NMR spectroscopy Methods 0.000 description 38
- 230000002829 reductive effect Effects 0.000 description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- 108010052412 Apelin Proteins 0.000 description 37
- 239000012453 solvate Substances 0.000 description 37
- 239000000243 solution Substances 0.000 description 36
- 102000018746 Apelin Human genes 0.000 description 34
- 101000793362 Homo sapiens Apelin receptor Proteins 0.000 description 34
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 34
- 235000019439 ethyl acetate Nutrition 0.000 description 34
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 34
- BWVPHIKGXQBZPV-QKFDDRBGSA-N apelin Chemical compound NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N1[C@H](C(=O)N[C@@H](CC(O)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=2NC=NC=2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=2NC=NC=2)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CCSC)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(O)=O)CCC1 BWVPHIKGXQBZPV-QKFDDRBGSA-N 0.000 description 33
- 239000003795 chemical substances by application Substances 0.000 description 33
- 102100030949 Apelin receptor Human genes 0.000 description 31
- 229940124597 therapeutic agent Drugs 0.000 description 31
- 239000012071 phase Substances 0.000 description 29
- 201000010099 disease Diseases 0.000 description 28
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 26
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 24
- 125000005605 benzo group Chemical group 0.000 description 24
- 229910052796 boron Inorganic materials 0.000 description 24
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 24
- 150000003254 radicals Chemical class 0.000 description 24
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 23
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 22
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 22
- 230000002265 prevention Effects 0.000 description 22
- 239000000651 prodrug Substances 0.000 description 20
- 229940002612 prodrug Drugs 0.000 description 20
- 239000007787 solid Substances 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- CSNNHWWHGAXBCP-UHFFFAOYSA-L magnesium sulphate Substances [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 18
- 239000002904 solvent Substances 0.000 description 18
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- 238000002360 preparation method Methods 0.000 description 17
- 239000002585 base Substances 0.000 description 16
- 238000006467 substitution reaction Methods 0.000 description 16
- 125000004429 atom Chemical group 0.000 description 15
- 230000014759 maintenance of location Effects 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 239000004480 active ingredient Substances 0.000 description 14
- 239000012267 brine Substances 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 14
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 13
- 101100323464 Homo sapiens APLNR gene Proteins 0.000 description 13
- 238000010898 silica gel chromatography Methods 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 208000035475 disorder Diseases 0.000 description 12
- 150000002148 esters Chemical class 0.000 description 12
- 125000001424 substituent group Chemical group 0.000 description 12
- 239000005695 Ammonium acetate Substances 0.000 description 11
- 229940043376 ammonium acetate Drugs 0.000 description 11
- 235000019257 ammonium acetate Nutrition 0.000 description 11
- OHCQJHSOBUTRHG-KGGHGJDLSA-N FORSKOLIN Chemical compound O=C([C@@]12O)C[C@](C)(C=C)O[C@]1(C)[C@@H](OC(=O)C)[C@@H](O)[C@@H]1[C@]2(C)[C@@H](O)CCC1(C)C OHCQJHSOBUTRHG-KGGHGJDLSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000003556 assay Methods 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 230000000670 limiting effect Effects 0.000 description 10
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 10
- 239000002245 particle Substances 0.000 description 10
- 238000003786 synthesis reaction Methods 0.000 description 10
- 108091008803 APLNR Proteins 0.000 description 9
- 206010020772 Hypertension Diseases 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 230000000747 cardiac effect Effects 0.000 description 9
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 241000282414 Homo sapiens Species 0.000 description 8
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- 239000002671 adjuvant Substances 0.000 description 8
- 239000012044 organic layer Substances 0.000 description 8
- 238000002953 preparative HPLC Methods 0.000 description 8
- 230000008569 process Effects 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- 208000008589 Obesity Diseases 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- 239000003472 antidiabetic agent Substances 0.000 description 7
- 239000002552 dosage form Substances 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 125000002950 monocyclic group Chemical group 0.000 description 7
- 235000020824 obesity Nutrition 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 238000002560 therapeutic procedure Methods 0.000 description 7
- 208000004476 Acute Coronary Syndrome Diseases 0.000 description 6
- 201000001320 Atherosclerosis Diseases 0.000 description 6
- 239000013543 active substance Substances 0.000 description 6
- 125000002619 bicyclic group Chemical group 0.000 description 6
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- 206010002383 Angina Pectoris Diseases 0.000 description 5
- SUZLHDUTVMZSEV-UHFFFAOYSA-N Deoxycoleonol Natural products C12C(=O)CC(C)(C=C)OC2(C)C(OC(=O)C)C(O)C2C1(C)C(O)CCC2(C)C SUZLHDUTVMZSEV-UHFFFAOYSA-N 0.000 description 5
- 241000124008 Mammalia Species 0.000 description 5
- 229910003813 NRa Inorganic materials 0.000 description 5
- 206010063837 Reperfusion injury Diseases 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- 229940125708 antidiabetic agent Drugs 0.000 description 5
- 239000003524 antilipemic agent Substances 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 230000001684 chronic effect Effects 0.000 description 5
- OHCQJHSOBUTRHG-UHFFFAOYSA-N colforsin Natural products OC12C(=O)CC(C)(C=C)OC1(C)C(OC(=O)C)C(O)C1C2(C)C(O)CCC1(C)C OHCQJHSOBUTRHG-UHFFFAOYSA-N 0.000 description 5
- 238000001514 detection method Methods 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 125000001188 haloalkyl group Chemical group 0.000 description 5
- 150000002430 hydrocarbons Chemical group 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 125000001041 indolyl group Chemical group 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 208000031225 myocardial ischemia Diseases 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 208000002815 pulmonary hypertension Diseases 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- 125000002769 thiazolinyl group Chemical group 0.000 description 5
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 5
- 230000002792 vascular Effects 0.000 description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- 229940127291 Calcium channel antagonist Drugs 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 208000001145 Metabolic Syndrome Diseases 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 201000000690 abdominal obesity-metabolic syndrome Diseases 0.000 description 4
- 229940083712 aldosterone antagonist Drugs 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 4
- 239000002830 appetite depressant Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000000480 calcium channel blocker Substances 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 229940125904 compound 1 Drugs 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- 239000002934 diuretic Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 4
- 210000001035 gastrointestinal tract Anatomy 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 4
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 4
- 238000001802 infusion Methods 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 208000028867 ischemia Diseases 0.000 description 4
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 4
- 125000001624 naphthyl group Chemical group 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 125000004430 oxygen atom Chemical group O* 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 4
- 108090000765 processed proteins & peptides Proteins 0.000 description 4
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 208000037803 restenosis Diseases 0.000 description 4
- 238000012552 review Methods 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 125000004434 sulfur atom Chemical group 0.000 description 4
- 238000004704 ultra performance liquid chromatography Methods 0.000 description 4
- 239000003643 water by type Substances 0.000 description 4
- 125000006706 (C3-C6) carbocyclyl group Chemical group 0.000 description 3
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 3
- 125000004607 1,2,3,4-tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 3
- ZLCPKMIJYMHZMJ-UHFFFAOYSA-N 2-nitrobenzene-1,3-diol Chemical compound OC1=CC=CC(O)=C1[N+]([O-])=O ZLCPKMIJYMHZMJ-UHFFFAOYSA-N 0.000 description 3
- 239000005541 ACE inhibitor Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 102400000252 Apelin-13 Human genes 0.000 description 3
- 206010003658 Atrial Fibrillation Diseases 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 206010007556 Cardiac failure acute Diseases 0.000 description 3
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 3
- 241000208011 Digitalis Species 0.000 description 3
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 3
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- RFFFKMOABOFIDF-UHFFFAOYSA-N Pentanenitrile Chemical compound CCCCC#N RFFFKMOABOFIDF-UHFFFAOYSA-N 0.000 description 3
- 208000018262 Peripheral vascular disease Diseases 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 230000001154 acute effect Effects 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 125000006242 amine protecting group Chemical group 0.000 description 3
- 239000000883 anti-obesity agent Substances 0.000 description 3
- 239000003529 anticholesteremic agent Substances 0.000 description 3
- 229940030600 antihypertensive agent Drugs 0.000 description 3
- 239000002220 antihypertensive agent Substances 0.000 description 3
- 229940125710 antiobesity agent Drugs 0.000 description 3
- XXCCRHIAIBQDPX-PEWBXTNBSA-N apelin-13 Chemical compound C([C@@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCSC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](N)CCC(N)=O)C1=CN=CN1 XXCCRHIAIBQDPX-PEWBXTNBSA-N 0.000 description 3
- 108010040480 apelin-13 peptide Proteins 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 3
- 239000002876 beta blocker Substances 0.000 description 3
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Substances BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 3
- 239000002327 cardiovascular agent Substances 0.000 description 3
- 229940125692 cardiovascular agent Drugs 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- NLUNLVTVUDIHFE-UHFFFAOYSA-N cyclooctylcyclooctane Chemical compound C1CCCCCCC1C1CCCCCCC1 NLUNLVTVUDIHFE-UHFFFAOYSA-N 0.000 description 3
- 229910052805 deuterium Inorganic materials 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 229940030606 diuretics Drugs 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 125000004438 haloalkoxy group Chemical group 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 208000017169 kidney disease Diseases 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000007774 longterm Effects 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 239000002394 mineralocorticoid antagonist Substances 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 239000000123 paper Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 238000009117 preventive therapy Methods 0.000 description 3
- 238000011321 prophylaxis Methods 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 125000002098 pyridazinyl group Chemical group 0.000 description 3
- 230000002441 reversible effect Effects 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000013268 sustained release Methods 0.000 description 3
- 239000012730 sustained-release form Substances 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- JYRWUSXRTGACLY-UHFFFAOYSA-N tert-butyl 4-[[3-(4-methylsulfonylphenyl)-[1,2]oxazolo[4,5-d]pyrimidin-7-yl]oxy]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1OC1=NC=NC2=C1ON=C2C1=CC=C(S(C)(=O)=O)C=C1 JYRWUSXRTGACLY-UHFFFAOYSA-N 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- 238000000844 transformation Methods 0.000 description 3
- AGZPNUZBDCYTBB-UHFFFAOYSA-N triethyl methanetricarboxylate Chemical compound CCOC(=O)C(C(=O)OCC)C(=O)OCC AGZPNUZBDCYTBB-UHFFFAOYSA-N 0.000 description 3
- OGNSCSPNOLGXSM-UHFFFAOYSA-N (+/-)-DABA Natural products NCCC(N)C(O)=O OGNSCSPNOLGXSM-UHFFFAOYSA-N 0.000 description 2
- HBENZIXOGRCSQN-VQWWACLZSA-N (1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-16-[(2S)-2-hydroxy-3,3-dimethylpentan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol Chemical compound N1([C@@H]2CC=3C4=C(C(=CC=3)O)O[C@H]3[C@@]5(OC)CC[C@@]2([C@@]43CC1)C[C@@H]5[C@](C)(O)C(C)(C)CC)CC1CC1 HBENZIXOGRCSQN-VQWWACLZSA-N 0.000 description 2
- XUFXOAAUWZOOIT-SXARVLRPSA-N (2R,3R,4R,5S,6R)-5-[[(2R,3R,4R,5S,6R)-5-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-1-cyclohex-2-enyl]amino]-2-oxanyl]oxy]-3,4-dihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]-6-(hydroxymethyl)oxane-2,3,4-triol Chemical compound O([C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@@H]([C@H]([C@H](O)[C@H]1O)N[C@@H]1[C@@H]([C@@H](O)[C@H](O)C(CO)=C1)O)C)[C@@H]1[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]1O XUFXOAAUWZOOIT-SXARVLRPSA-N 0.000 description 2
- DAAXYQZSKBPJOX-FQEVSTJZSA-N (2S)-2-amino-3-[4-[5-[3-(4-hydroxyphenyl)-4-methoxyphenyl]-1,2,4-oxadiazol-3-yl]phenyl]propanoic acid Chemical compound COC1=C(C=C(C=C1)C2=NC(=NO2)C3=CC=C(C=C3)C[C@@H](C(=O)O)N)C4=CC=C(C=C4)O DAAXYQZSKBPJOX-FQEVSTJZSA-N 0.000 description 2
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 2
- PHDIJLFSKNMCMI-ITGJKDDRSA-N (3R,4S,5R,6R)-6-(hydroxymethyl)-4-(8-quinolin-6-yloxyoctoxy)oxane-2,3,5-triol Chemical compound OC[C@@H]1[C@H]([C@@H]([C@H](C(O1)O)O)OCCCCCCCCOC=1C=C2C=CC=NC2=CC=1)O PHDIJLFSKNMCMI-ITGJKDDRSA-N 0.000 description 2
- UDQTXCHQKHIQMH-KYGLGHNPSA-N (3ar,5s,6s,7r,7ar)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3ah-pyrano[3,2-d][1,3]thiazole-6,7-diol Chemical compound S1C(NCC)=N[C@H]2[C@@H]1O[C@H](C(F)F)[C@@H](O)[C@@H]2O UDQTXCHQKHIQMH-KYGLGHNPSA-N 0.000 description 2
- CUKWUWBLQQDQAC-VEQWQPCFSA-N (3s)-3-amino-4-[[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2s,3s)-1-[[(2s)-1-[(2s)-2-[[(1s)-1-carboxyethyl]carbamoyl]pyrrolidin-1-yl]-3-(1h-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-methyl-1-ox Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 CUKWUWBLQQDQAC-VEQWQPCFSA-N 0.000 description 2
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 description 2
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 2
- LLJFMFZYVVLQKT-UHFFFAOYSA-N 1-cyclohexyl-3-[4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxo-2-isoquinolinyl)ethyl]phenyl]sulfonylurea Chemical compound C=1C(OC)=CC=C(C(C2=O)(C)C)C=1C(=O)N2CCC(C=C1)=CC=C1S(=O)(=O)NC(=O)NC1CCCCC1 LLJFMFZYVVLQKT-UHFFFAOYSA-N 0.000 description 2
- PAQZWJGSJMLPMG-UHFFFAOYSA-N 2,4,6-tripropyl-1,3,5,2$l^{5},4$l^{5},6$l^{5}-trioxatriphosphinane 2,4,6-trioxide Chemical compound CCCP1(=O)OP(=O)(CCC)OP(=O)(CCC)O1 PAQZWJGSJMLPMG-UHFFFAOYSA-N 0.000 description 2
- HQBJSEKQNRSDAZ-UHFFFAOYSA-N 2,6-dimethoxyaniline Chemical compound COC1=CC=CC(OC)=C1N HQBJSEKQNRSDAZ-UHFFFAOYSA-N 0.000 description 2
- VGOALPIDEXVYQI-UHFFFAOYSA-N 3-(2-imidazo[1,2-b]pyridazin-3-ylethynyl)-n-[3-imidazol-1-yl-5-(trifluoromethyl)phenyl]-4-methylbenzamide Chemical compound C1=C(C#CC=2N3N=CC=CC3=NC=2)C(C)=CC=C1C(=O)NC(C=C(C=1)C(F)(F)F)=CC=1N1C=CN=C1 VGOALPIDEXVYQI-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- MVXAKOGJWVQPKC-UHFFFAOYSA-N 5-(3-ethynyl-5-fluorophenyl)-2-pyridin-2-yl-4,6,7,8-tetrahydro-[1,3]oxazolo[4,5-c]azepine Chemical compound FC1=CC(C#C)=CC(N2CC=3N=C(OC=3CCC2)C=2N=CC=CC=2)=C1 MVXAKOGJWVQPKC-UHFFFAOYSA-N 0.000 description 2
- 101150059573 AGTR1 gene Proteins 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 102400000345 Angiotensin-2 Human genes 0.000 description 2
- 101800000733 Angiotensin-2 Proteins 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- 229930186147 Cephalosporin Natural products 0.000 description 2
- 229940126639 Compound 33 Drugs 0.000 description 2
- IVOMOUWHDPKRLL-KQYNXXCUSA-N Cyclic adenosine monophosphate Chemical compound C([C@H]1O2)OP(O)(=O)O[C@H]1[C@@H](O)[C@@H]2N1C(N=CN=C2N)=C2N=C1 IVOMOUWHDPKRLL-KQYNXXCUSA-N 0.000 description 2
- 102000016622 Dipeptidyl Peptidase 4 Human genes 0.000 description 2
- JRWZLRBJNMZMFE-UHFFFAOYSA-N Dobutamine Chemical compound C=1C=C(O)C(O)=CC=1CCNC(C)CCC1=CC=C(O)C=C1 JRWZLRBJNMZMFE-UHFFFAOYSA-N 0.000 description 2
- 101000930822 Giardia intestinalis Dipeptidyl-peptidase 4 Proteins 0.000 description 2
- FAEKWTJYAYMJKF-QHCPKHFHSA-N GlucoNorm Chemical compound C1=C(C(O)=O)C(OCC)=CC(CC(=O)N[C@@H](CC(C)C)C=2C(=CC=CC=2)N2CCCCC2)=C1 FAEKWTJYAYMJKF-QHCPKHFHSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N Pd(PPh3)4 Substances [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 229930182555 Penicillin Natural products 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- 208000005764 Peripheral Arterial Disease Diseases 0.000 description 2
- 208000030831 Peripheral arterial occlusive disease Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 208000017442 Retinal disease Diseases 0.000 description 2
- 206010038923 Retinopathy Diseases 0.000 description 2
- 241000283984 Rodentia Species 0.000 description 2
- YASAKCUCGLMORW-UHFFFAOYSA-N Rosiglitazone Chemical compound C=1C=CC=NC=1N(C)CCOC(C=C1)=CC=C1CC1SC(=O)NC1=O YASAKCUCGLMORW-UHFFFAOYSA-N 0.000 description 2
- PNUZDKCDAWUEGK-CYZMBNFOSA-N Sitafloxacin Chemical compound C([C@H]1N)N(C=2C(=C3C(C(C(C(O)=O)=CN3[C@H]3[C@H](C3)F)=O)=CC=2F)Cl)CC11CC1 PNUZDKCDAWUEGK-CYZMBNFOSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000009982 Ventricular Dysfunction Diseases 0.000 description 2
- FZNCGRZWXLXZSZ-CIQUZCHMSA-N Voglibose Chemical compound OCC(CO)N[C@H]1C[C@](O)(CO)[C@@H](O)[C@H](O)[C@H]1O FZNCGRZWXLXZSZ-CIQUZCHMSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 2
- 229960002632 acarbose Drugs 0.000 description 2
- XUFXOAAUWZOOIT-UHFFFAOYSA-N acarviostatin I01 Natural products OC1C(O)C(NC2C(C(O)C(O)C(CO)=C2)O)C(C)OC1OC(C(C1O)O)C(CO)OC1OC1C(CO)OC(O)C(O)C1O XUFXOAAUWZOOIT-UHFFFAOYSA-N 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 239000000048 adrenergic agonist Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 230000008484 agonism Effects 0.000 description 2
- 125000004450 alkenylene group Chemical group 0.000 description 2
- 125000004419 alkynylene group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000002333 angiotensin II receptor antagonist Substances 0.000 description 2
- 229950006323 angiotensin ii Drugs 0.000 description 2
- 229940125709 anorectic agent Drugs 0.000 description 2
- 230000000879 anti-atherosclerotic effect Effects 0.000 description 2
- 230000002769 anti-restenotic effect Effects 0.000 description 2
- 229940125682 antidementia agent Drugs 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000012131 assay buffer Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 229940097320 beta blocking agent Drugs 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 239000011111 cardboard Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 229940124587 cephalosporin Drugs 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- 208000026106 cerebrovascular disease Diseases 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 239000013066 combination product Substances 0.000 description 2
- 229940127555 combination product Drugs 0.000 description 2
- 229940127204 compound 29 Drugs 0.000 description 2
- 229940125877 compound 31 Drugs 0.000 description 2
- 229940125936 compound 42 Drugs 0.000 description 2
- 230000008602 contraction Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 229940095074 cyclic amp Drugs 0.000 description 2
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 2
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 2
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- FMGSKLZLMKYGDP-USOAJAOKSA-N dehydroepiandrosterone Chemical compound C1[C@@H](O)CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC=C21 FMGSKLZLMKYGDP-USOAJAOKSA-N 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 2
- 229960001089 dobutamine Drugs 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 230000004064 dysfunction Effects 0.000 description 2
- 239000006274 endogenous ligand Substances 0.000 description 2
- 239000002702 enteric coating Substances 0.000 description 2
- 238000009505 enteric coating Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000010408 film Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 230000009760 functional impairment Effects 0.000 description 2
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 2
- 230000002496 gastric effect Effects 0.000 description 2
- 229960003468 gliquidone Drugs 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 210000005003 heart tissue Anatomy 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000000004 hemodynamic effect Effects 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000007972 injectable composition Substances 0.000 description 2
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 230000003834 intracellular effect Effects 0.000 description 2
- 230000000302 ischemic effect Effects 0.000 description 2
- LAQPNDIUHRHNCV-UHFFFAOYSA-N isophthalonitrile Chemical compound N#CC1=CC=CC(C#N)=C1 LAQPNDIUHRHNCV-UHFFFAOYSA-N 0.000 description 2
- 125000005956 isoquinolyl group Chemical group 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 125000004284 isoxazol-3-yl group Chemical group [H]C1=C([H])C(*)=NO1 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 230000006883 memory enhancing effect Effects 0.000 description 2
- GVOISEJVFFIGQE-YCZSINBZSA-N n-[(1r,2s,5r)-5-[methyl(propan-2-yl)amino]-2-[(3s)-2-oxo-3-[[6-(trifluoromethyl)quinazolin-4-yl]amino]pyrrolidin-1-yl]cyclohexyl]acetamide Chemical compound CC(=O)N[C@@H]1C[C@H](N(C)C(C)C)CC[C@@H]1N1C(=O)[C@@H](NC=2C3=CC(=CC=C3N=CN=2)C(F)(F)F)CC1 GVOISEJVFFIGQE-YCZSINBZSA-N 0.000 description 2
- 229960000698 nateglinide Drugs 0.000 description 2
- OELFLUMRDSZNSF-BRWVUGGUSA-N nateglinide Chemical compound C1C[C@@H](C(C)C)CC[C@@H]1C(=O)N[C@@H](C(O)=O)CC1=CC=CC=C1 OELFLUMRDSZNSF-BRWVUGGUSA-N 0.000 description 2
- 201000001119 neuropathy Diseases 0.000 description 2
- 235000005152 nicotinamide Nutrition 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 239000012457 nonaqueous media Substances 0.000 description 2
- 239000002664 nootropic agent Substances 0.000 description 2
- 239000006186 oral dosage form Substances 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 125000004095 oxindolyl group Chemical group N1(C(CC2=CC=CC=C12)=O)* 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 229940049954 penicillin Drugs 0.000 description 2
- 230000002093 peripheral effect Effects 0.000 description 2
- 208000033808 peripheral neuropathy Diseases 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 125000004625 phenanthrolinyl group Chemical group N1=C(C=CC2=CC=C3C=CC=NC3=C12)* 0.000 description 2
- DHHVAGZRUROJKS-UHFFFAOYSA-N phentermine Chemical compound CC(C)(N)CC1=CC=CC=C1 DHHVAGZRUROJKS-UHFFFAOYSA-N 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- HYAFETHFCAUJAY-UHFFFAOYSA-N pioglitazone Chemical compound N1=CC(CC)=CC=C1CCOC(C=C1)=CC=C1CC1C(=O)NC(=O)S1 HYAFETHFCAUJAY-UHFFFAOYSA-N 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 229960003611 pramlintide Drugs 0.000 description 2
- 108010029667 pramlintide Proteins 0.000 description 2
- NRKVKVQDUCJPIZ-MKAGXXMWSA-N pramlintide acetate Chemical compound C([C@@H](C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CS)NC(=O)[C@@H](N)CCCCN)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 NRKVKVQDUCJPIZ-MKAGXXMWSA-N 0.000 description 2
- 230000009862 primary prevention Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003230 pyrimidines Chemical class 0.000 description 2
- 125000001422 pyrrolinyl group Chemical group 0.000 description 2
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000002461 renin inhibitor Substances 0.000 description 2
- 229940086526 renin-inhibitors Drugs 0.000 description 2
- 229960002354 repaglinide Drugs 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- QGJUIPDUBHWZPV-SGTAVMJGSA-N saxagliptin Chemical compound C1C(C2)CC(C3)CC2(O)CC13[C@H](N)C(=O)N1[C@H](C#N)C[C@@H]2C[C@@H]21 QGJUIPDUBHWZPV-SGTAVMJGSA-N 0.000 description 2
- 229960004937 saxagliptin Drugs 0.000 description 2
- 108010033693 saxagliptin Proteins 0.000 description 2
- 230000009863 secondary prevention Effects 0.000 description 2
- MFFMDFFZMYYVKS-SECBINFHSA-N sitagliptin Chemical compound C([C@H](CC(=O)N1CC=2N(C(=NN=2)C(F)(F)F)CC1)N)C1=CC(F)=C(F)C=C1F MFFMDFFZMYYVKS-SECBINFHSA-N 0.000 description 2
- 229960004034 sitagliptin Drugs 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 150000003413 spiro compounds Chemical class 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 238000004808 supercritical fluid chromatography Methods 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 238000010189 synthetic method Methods 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 2
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 2
- PQDJYEQOELDLCP-UHFFFAOYSA-N trimethylsilane Chemical compound C[SiH](C)C PQDJYEQOELDLCP-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 230000000304 vasodilatating effect Effects 0.000 description 2
- 230000006815 ventricular dysfunction Effects 0.000 description 2
- 229960001729 voglibose Drugs 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- DBGIVFWFUFKIQN-VIFPVBQESA-N (+)-Fenfluramine Chemical compound CCN[C@@H](C)CC1=CC=CC(C(F)(F)F)=C1 DBGIVFWFUFKIQN-VIFPVBQESA-N 0.000 description 1
- DBGIVFWFUFKIQN-UHFFFAOYSA-N (+-)-Fenfluramine Chemical compound CCNC(C)CC1=CC=CC(C(F)(F)F)=C1 DBGIVFWFUFKIQN-UHFFFAOYSA-N 0.000 description 1
- AQFLVLHRZFLDDV-VIFPVBQESA-N (1s)-1-phenylpropan-1-amine Chemical compound CC[C@H](N)C1=CC=CC=C1 AQFLVLHRZFLDDV-VIFPVBQESA-N 0.000 description 1
- STPKWKPURVSAJF-LJEWAXOPSA-N (4r,5r)-5-[4-[[4-(1-aza-4-azoniabicyclo[2.2.2]octan-4-ylmethyl)phenyl]methoxy]phenyl]-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-4,5-dihydro-2h-1$l^{6}-benzothiepin-4-ol Chemical compound O[C@H]1C(CCCC)(CCCC)CS(=O)(=O)C2=CC=C(N(C)C)C=C2[C@H]1C(C=C1)=CC=C1OCC(C=C1)=CC=C1C[N+]1(CC2)CCN2CC1 STPKWKPURVSAJF-LJEWAXOPSA-N 0.000 description 1
- 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 description 1
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 1
- FIARMZDBEGVMLV-UHFFFAOYSA-N 1,1,2,2,2-pentafluoroethanolate Chemical group [O-]C(F)(F)C(F)(F)F FIARMZDBEGVMLV-UHFFFAOYSA-N 0.000 description 1
- 125000004605 1,2,3,4-tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical compound C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- FKASFBLJDCHBNZ-UHFFFAOYSA-N 1,3,4-oxadiazole Chemical compound C1=NN=CO1 FKASFBLJDCHBNZ-UHFFFAOYSA-N 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- SAJZFNKUQDMWRX-UHFFFAOYSA-N 1,3,5,2,4,6-trioxatriphosphinane Chemical compound O1POPOP1 SAJZFNKUQDMWRX-UHFFFAOYSA-N 0.000 description 1
- DNNLLVKQTRCODG-UHFFFAOYSA-N 1,3-bis(2-chloroethoxy)-2-nitrobenzene Chemical compound ClCCOC1=C(C(=CC=C1)OCCCl)[N+](=O)[O-] DNNLLVKQTRCODG-UHFFFAOYSA-N 0.000 description 1
- UGQDAAPDTCVIJY-UHFFFAOYSA-N 1,3-diethoxy-2-nitrobenzene Chemical compound C(C)OC1=C(C(=CC=C1)OCC)[N+](=O)[O-] UGQDAAPDTCVIJY-UHFFFAOYSA-N 0.000 description 1
- BOVGTQGAOIONJV-BETUJISGSA-N 1-[(3ar,6as)-3,3a,4,5,6,6a-hexahydro-1h-cyclopenta[c]pyrrol-2-yl]-3-(4-methylphenyl)sulfonylurea Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NN1C[C@H]2CCC[C@H]2C1 BOVGTQGAOIONJV-BETUJISGSA-N 0.000 description 1
- ZVPORPUUZXIPEF-UHFFFAOYSA-N 1-benzyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole Chemical compound O1C(C)(C)C(C)(C)OB1C1=CN(CC=2C=CC=CC=2)N=C1 ZVPORPUUZXIPEF-UHFFFAOYSA-N 0.000 description 1
- 125000006432 1-methyl cyclopropyl group Chemical group [H]C([H])([H])C1(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- XIRRDAWDNHRRLB-UHFFFAOYSA-N 2,6-dibromoaniline Chemical compound NC1=C(Br)C=CC=C1Br XIRRDAWDNHRRLB-UHFFFAOYSA-N 0.000 description 1
- XHNDTWIUBZHABC-UHFFFAOYSA-N 2,6-diethoxyaniline Chemical compound CCOC1=CC=CC(OCC)=C1N XHNDTWIUBZHABC-UHFFFAOYSA-N 0.000 description 1
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical group COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 description 1
- BVSIAYQIMUUCRW-UHFFFAOYSA-N 2-(1,2-benzoxazol-3-yl)acetic acid Chemical compound C1=CC=C2C(CC(=O)O)=NOC2=C1 BVSIAYQIMUUCRW-UHFFFAOYSA-N 0.000 description 1
- QFBYQIUBLBNTDO-UHFFFAOYSA-N 2-(2,6-dimethoxyphenyl)acetic acid Chemical compound COC1=CC=CC(OC)=C1CC(O)=O QFBYQIUBLBNTDO-UHFFFAOYSA-N 0.000 description 1
- YRXIMPFOTQVOHG-UHFFFAOYSA-N 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid Chemical compound OC(=O)CN(C)C(=O)OC(C)(C)C YRXIMPFOTQVOHG-UHFFFAOYSA-N 0.000 description 1
- 125000005273 2-acetoxybenzoic acid group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- ZXNMIUJDTOMBPV-UHFFFAOYSA-N 2-chloroethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCCl)C=C1 ZXNMIUJDTOMBPV-UHFFFAOYSA-N 0.000 description 1
- LUNMJRJMSXZSLC-UHFFFAOYSA-N 2-cyclopropylethanol Chemical compound OCCC1CC1 LUNMJRJMSXZSLC-UHFFFAOYSA-N 0.000 description 1
- JVOCWIRGDNWGKH-UHFFFAOYSA-N 2-cyclopropylethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1CC1 JVOCWIRGDNWGKH-UHFFFAOYSA-N 0.000 description 1
- UGJAFWCNMWRQBK-UHFFFAOYSA-N 2-ethoxyacetamide Chemical compound [CH2]COCC(N)=O UGJAFWCNMWRQBK-UHFFFAOYSA-N 0.000 description 1
- WPYUCWSMVJJWFI-UHFFFAOYSA-N 2-ethoxyacetonitrile Chemical compound CCOCC#N WPYUCWSMVJJWFI-UHFFFAOYSA-N 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- HKOJYPPTIPJZAZ-UHFFFAOYSA-N 2-methoxy-6-methylaniline Chemical compound COC1=CC=CC(C)=C1N HKOJYPPTIPJZAZ-UHFFFAOYSA-N 0.000 description 1
- ILPUOPPYSQEBNJ-UHFFFAOYSA-N 2-methyl-2-phenoxypropanoic acid Chemical class OC(=O)C(C)(C)OC1=CC=CC=C1 ILPUOPPYSQEBNJ-UHFFFAOYSA-N 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- MVBXGGHFJZBKFJ-WFGJKAKNSA-N 2-nitro-1,3-bis(trideuteriomethoxy)benzene Chemical compound C(OC1=C(C(=CC=C1)OC([2H])([2H])[2H])[N+](=O)[O-])([2H])([2H])[2H] MVBXGGHFJZBKFJ-WFGJKAKNSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003119 4-methyl-3-pentenyl group Chemical group [H]\C(=C(/C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- TZKBVRDEOITLRB-UHFFFAOYSA-N 4-methyl-n-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-3-[2-(1h-pyrazolo[3,4-b]pyridin-5-yl)ethynyl]benzamide Chemical compound C1CN(C)CCN1CC(C(=C1)C(F)(F)F)=CC=C1NC(=O)C1=CC=C(C)C(C#CC=2C=C3C=NNC3=NC=2)=C1 TZKBVRDEOITLRB-UHFFFAOYSA-N 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 1
- 125000004608 5,6,7,8-tetrahydroquinolinyl group Chemical group N1=C(C=CC=2CCCCC12)* 0.000 description 1
- NKOHRVBBQISBSB-UHFFFAOYSA-N 5-[(4-hydroxyphenyl)methyl]-1,3-thiazolidine-2,4-dione Chemical compound C1=CC(O)=CC=C1CC1C(=O)NC(=O)S1 NKOHRVBBQISBSB-UHFFFAOYSA-N 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 1
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical group OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- ITZMJCSORYKOSI-AJNGGQMLSA-N APGPR Enterostatin Chemical compound C[C@H](N)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N1[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(O)=O)CCC1 ITZMJCSORYKOSI-AJNGGQMLSA-N 0.000 description 1
- 229940077274 Alpha glucosidase inhibitor Drugs 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 108050000824 Angiotensin II receptor Proteins 0.000 description 1
- 102000008873 Angiotensin II receptor Human genes 0.000 description 1
- 101710081722 Antitrypsin Proteins 0.000 description 1
- 208000026828 Aorta coarctation Diseases 0.000 description 1
- 208000006179 Aortic Coarctation Diseases 0.000 description 1
- 102000016555 Apelin receptors Human genes 0.000 description 1
- 102400000251 Apelin-36 Human genes 0.000 description 1
- 101800001808 Apelin-36 Proteins 0.000 description 1
- 206010003225 Arteriospasm coronary Diseases 0.000 description 1
- 241000937413 Axia Species 0.000 description 1
- 229910015845 BBr3 Inorganic materials 0.000 description 1
- 229940123208 Biguanide Drugs 0.000 description 1
- 102000013585 Bombesin Human genes 0.000 description 1
- 108010051479 Bombesin Proteins 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- WFACTEDYJWUDLJ-UHFFFAOYSA-N C(CCC)C1=NC(=C(C(N1C(C(C)C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1C(C(C)C)C1=CC=CC=C1)=O)C=1OC(=NN=1)CC1=NC=C(C=C1)Cl)O WFACTEDYJWUDLJ-UHFFFAOYSA-N 0.000 description 1
- XEGVFCIYLFJGNY-ZDUSSCGKSA-N C(CCC)C1=NC(=C(C(N1[C@@H](C)C1CC1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O Chemical compound C(CCC)C1=NC(=C(C(N1[C@@H](C)C1CC1)=O)C=1OC(=NN=1)CC1=CC=C(C=C1)Cl)O XEGVFCIYLFJGNY-ZDUSSCGKSA-N 0.000 description 1
- LTOSWGNOTRAAQN-HNNXBMFYSA-N C(CCC)C=1N(C(C(=C(N=1)O)C(=O)OCC)=O)[C@@H](CC)C1=CC=CC=C1 Chemical compound C(CCC)C=1N(C(C(=C(N=1)O)C(=O)OCC)=O)[C@@H](CC)C1=CC=CC=C1 LTOSWGNOTRAAQN-HNNXBMFYSA-N 0.000 description 1
- NSBIQPJIWUJBBX-FIBGUPNXSA-N C(ONC1=CC=CC=C1)([2H])([2H])[2H] Chemical compound C(ONC1=CC=CC=C1)([2H])([2H])[2H] NSBIQPJIWUJBBX-FIBGUPNXSA-N 0.000 description 1
- INWAVOCXTPZPCP-UHFFFAOYSA-N C1(CC1)CCC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(CCC1)=O)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CC1)CCC=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(CCC1)=O)O)C1=C(C=CC=C1OC)OC INWAVOCXTPZPCP-UHFFFAOYSA-N 0.000 description 1
- GODRTMPKJIGKGJ-UHFFFAOYSA-N C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(C=CC=C1)=O)O)C1=C(C=CC=C1OC)OC Chemical compound C1(CCCC1)C=1N(C(=C(C(N=1)=O)C=1OC(=NN=1)CN1C(C=CC=C1)=O)O)C1=C(C=CC=C1OC)OC GODRTMPKJIGKGJ-UHFFFAOYSA-N 0.000 description 1
- PIGNZTTWTGIFPO-UHFFFAOYSA-N CCCCC1=NC(=O)C(C2=NN=C(CC3=CC=C(Cl)C=C3)O2)=C(O)N1C1=C(OC)C=CC=C1OC Chemical compound CCCCC1=NC(=O)C(C2=NN=C(CC3=CC=C(Cl)C=C3)O2)=C(O)N1C1=C(OC)C=CC=C1OC PIGNZTTWTGIFPO-UHFFFAOYSA-N 0.000 description 1
- YDPYYUICURUDIO-ZDUSSCGKSA-N CCCCC1=NC(O)=C(C(=O)NN)C(=O)N1[C@@H](CC)C1=CC=CC=C1 Chemical compound CCCCC1=NC(O)=C(C(=O)NN)C(=O)N1[C@@H](CC)C1=CC=CC=C1 YDPYYUICURUDIO-ZDUSSCGKSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical class ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 1
- RKWGIWYCVPQPMF-UHFFFAOYSA-N Chloropropamide Chemical compound CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 RKWGIWYCVPQPMF-UHFFFAOYSA-N 0.000 description 1
- 101800001982 Cholecystokinin Proteins 0.000 description 1
- 102100025841 Cholecystokinin Human genes 0.000 description 1
- 229920001268 Cholestyramine Polymers 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- KPSRODZRAIWAKH-JTQLQIEISA-N Ciprofibrate Natural products C1=CC(OC(C)(C)C(O)=O)=CC=C1[C@H]1C(Cl)(Cl)C1 KPSRODZRAIWAKH-JTQLQIEISA-N 0.000 description 1
- 206010009807 Coarctation of the aorta Diseases 0.000 description 1
- 229920002911 Colestipol Polymers 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 208000003890 Coronary Vasospasm Diseases 0.000 description 1
- 108010022152 Corticotropin-Releasing Hormone Proteins 0.000 description 1
- 102000012289 Corticotropin-Releasing Hormone Human genes 0.000 description 1
- 239000000055 Corticotropin-Releasing Hormone Substances 0.000 description 1
- FMGSKLZLMKYGDP-UHFFFAOYSA-N Dehydroepiandrosterone Natural products C1C(O)CCC2(C)C3CCC(C)(C(CC4)=O)C4C3CC=C21 FMGSKLZLMKYGDP-UHFFFAOYSA-N 0.000 description 1
- 101000783577 Dendroaspis angusticeps Thrombostatin Proteins 0.000 description 1
- 101000783578 Dendroaspis jamesoni kaimosae Dendroaspin Proteins 0.000 description 1
- 208000032928 Dyslipidaemia Diseases 0.000 description 1
- 208000000059 Dyspnea Diseases 0.000 description 1
- 206010013975 Dyspnoeas Diseases 0.000 description 1
- 239000004131 EU approved raising agent Substances 0.000 description 1
- 208000037487 Endotoxemia Diseases 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- YZGQDNOIGFBYKF-UHFFFAOYSA-N Ethoxyacetic acid Chemical compound CCOCC(O)=O YZGQDNOIGFBYKF-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- HTQBXNHDCUEHJF-XWLPCZSASA-N Exenatide Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 HTQBXNHDCUEHJF-XWLPCZSASA-N 0.000 description 1
- 108010011459 Exenatide Proteins 0.000 description 1
- 206010051301 Exercise tolerance decreased Diseases 0.000 description 1
- 206010016654 Fibrosis Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 101710198884 GATA-type zinc finger protein 1 Proteins 0.000 description 1
- 102400001370 Galanin Human genes 0.000 description 1
- 101800002068 Galanin Proteins 0.000 description 1
- 102000034354 Gi proteins Human genes 0.000 description 1
- 108091006101 Gi proteins Proteins 0.000 description 1
- 102400000322 Glucagon-like peptide 1 Human genes 0.000 description 1
- DTHNMHAUYICORS-KTKZVXAJSA-N Glucagon-like peptide 1 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC=1N=CNC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 DTHNMHAUYICORS-KTKZVXAJSA-N 0.000 description 1
- 229940121710 HMGCoA reductase inhibitor Drugs 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 208000031226 Hyperlipidaemia Diseases 0.000 description 1
- 206010020880 Hypertrophy Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 102000004877 Insulin Human genes 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- 206010022489 Insulin Resistance Diseases 0.000 description 1
- 229940122199 Insulin secretagogue Drugs 0.000 description 1
- 229940122355 Insulin sensitizer Drugs 0.000 description 1
- 108010041872 Islet Amyloid Polypeptide Proteins 0.000 description 1
- 102000036770 Islet Amyloid Polypeptide Human genes 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 102000000853 LDL receptors Human genes 0.000 description 1
- 108010001831 LDL receptors Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 102000016267 Leptin Human genes 0.000 description 1
- 108010092277 Leptin Proteins 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 229940127470 Lipase Inhibitors Drugs 0.000 description 1
- 208000017170 Lipid metabolism disease Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- ZPXSCAKFGYXMGA-UHFFFAOYSA-N Mazindol Chemical compound N12CCN=C2C2=CC=CC=C2C1(O)C1=CC=C(Cl)C=C1 ZPXSCAKFGYXMGA-UHFFFAOYSA-N 0.000 description 1
- 239000000637 Melanocyte-Stimulating Hormone Substances 0.000 description 1
- 108010007013 Melanocyte-Stimulating Hormones Proteins 0.000 description 1
- 101710151321 Melanostatin Proteins 0.000 description 1
- IBAQFPQHRJAVAV-ULAWRXDQSA-N Miglitol Chemical compound OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO IBAQFPQHRJAVAV-ULAWRXDQSA-N 0.000 description 1
- HGINADPHJQTSKN-UHFFFAOYSA-N Monoethyl malonic acid Chemical compound CCOC(=O)CC(O)=O HGINADPHJQTSKN-UHFFFAOYSA-N 0.000 description 1
- NOHSCNZCHROOCV-ZDUSSCGKSA-N N'-[(1S)-1-phenylpropyl]pentanimidamide Chemical compound C1(=CC=CC=C1)[C@H](CC)NC(CCCC)=N NOHSCNZCHROOCV-ZDUSSCGKSA-N 0.000 description 1
- HPKJGHVHQWJOOT-ZJOUEHCJSA-N N-[(2S)-3-cyclohexyl-1-oxo-1-({(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl}amino)propan-2-yl]-1H-indole-2-carboxamide Chemical compound C1C(CCCC1)C[C@H](NC(=O)C=1NC2=CC=CC=C2C=1)C(=O)N[C@@H](C[C@H]1C(=O)NCC1)C=O HPKJGHVHQWJOOT-ZJOUEHCJSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 102400000064 Neuropeptide Y Human genes 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 102000008052 Nitric Oxide Synthase Type III Human genes 0.000 description 1
- 108010075520 Nitric Oxide Synthase Type III Proteins 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- SZUGNRWQEBUYCC-UHFFFAOYSA-N O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1C1CC1)C1CC1)COC(C)C)=O Chemical compound O1N=C(C2=C1C=CC=C2)CC1=NN=C(O1)C=1C(N=C(N(C=1O)C1=C(C=CC=C1C1CC1)C1CC1)COC(C)C)=O SZUGNRWQEBUYCC-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 108010028924 PPAR alpha Proteins 0.000 description 1
- 102000023984 PPAR alpha Human genes 0.000 description 1
- 108010016731 PPAR gamma Proteins 0.000 description 1
- 102000000536 PPAR gamma Human genes 0.000 description 1
- 108010044210 PPAR-beta Proteins 0.000 description 1
- 108010081690 Pertussis Toxin Proteins 0.000 description 1
- 108091000080 Phosphotransferase Proteins 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- 206010037423 Pulmonary oedema Diseases 0.000 description 1
- 108700018615 Pyr(1)- apelin 13 Proteins 0.000 description 1
- 241001620634 Roger Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- 229940123464 Thiazolidinedione Drugs 0.000 description 1
- 229910003074 TiCl4 Inorganic materials 0.000 description 1
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 108010062481 Type 1 Angiotensin Receptor Proteins 0.000 description 1
- 102000010913 Type 1 Angiotensin Receptor Human genes 0.000 description 1
- GXBMIBRIOWHPDT-UHFFFAOYSA-N Vasopressin Natural products N1C(=O)C(CC=2C=C(O)C=CC=2)NC(=O)C(N)CSSCC(C(=O)N2C(CCC2)C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CC1=CC=CC=C1 GXBMIBRIOWHPDT-UHFFFAOYSA-N 0.000 description 1
- 102000002852 Vasopressins Human genes 0.000 description 1
- 108010004977 Vasopressins Proteins 0.000 description 1
- BQOWUDKEXDCGQS-UHFFFAOYSA-N [CH]1CCCC1 Chemical compound [CH]1CCCC1 BQOWUDKEXDCGQS-UHFFFAOYSA-N 0.000 description 1
- CKUAXEQHGKSLHN-UHFFFAOYSA-N [C].[N] Chemical group [C].[N] CKUAXEQHGKSLHN-UHFFFAOYSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 206010000891 acute myocardial infarction Diseases 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000005076 adamantyloxycarbonyl group Chemical group C12(CC3CC(CC(C1)C3)C2)OC(=O)* 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000808 adrenergic beta-agonist Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 238000011292 agonist therapy Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000002170 aldosterone antagonist Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 239000003888 alpha glucosidase inhibitor Substances 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000002253 anti-ischaemic effect Effects 0.000 description 1
- 230000002946 anti-pancreatic effect Effects 0.000 description 1
- 230000001475 anti-trypsic effect Effects 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 229940127218 antiplatelet drug Drugs 0.000 description 1
- 229960004676 antithrombotic agent Drugs 0.000 description 1
- SVWSKJCJNAIKNH-MJZUAXFLSA-N apelin-17 Chemical compound C([C@@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCSC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](N)CCCCN)C1=CN=CN1 SVWSKJCJNAIKNH-MJZUAXFLSA-N 0.000 description 1
- BVTLGARMSLXAHI-VDEROMQGSA-N apelin-36 Chemical compound C([C@@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCSC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)CNC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC(C)C)C(C)C)C1=CN=CN1 BVTLGARMSLXAHI-VDEROMQGSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- KBZOIRJILGZLEJ-LGYYRGKSSA-N argipressin Chemical compound C([C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CSSC[C@@H](C(N[C@@H](CC=2C=CC(O)=CC=2)C(=O)N1)=O)N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(N)=O)C1=CC=CC=C1 KBZOIRJILGZLEJ-LGYYRGKSSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000003305 autocrine Effects 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical compound C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 1
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 235000021028 berry Nutrition 0.000 description 1
- 102000012740 beta Adrenergic Receptors Human genes 0.000 description 1
- 108010079452 beta Adrenergic Receptors Proteins 0.000 description 1
- 102000015005 beta-adrenergic receptor activity proteins Human genes 0.000 description 1
- 108040006818 beta-adrenergic receptor activity proteins Proteins 0.000 description 1
- 229960000516 bezafibrate Drugs 0.000 description 1
- IIBYAHWJQTYFKB-UHFFFAOYSA-N bezafibrate Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1CCNC(=O)C1=CC=C(Cl)C=C1 IIBYAHWJQTYFKB-UHFFFAOYSA-N 0.000 description 1
- 150000004283 biguanides Chemical class 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- DNDCVAGJPBKION-DOPDSADYSA-N bombesin Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(N)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC=1NC2=CC=CC=C2C=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1NC(=O)CC1)C(C)C)C1=CN=CN1 DNDCVAGJPBKION-DOPDSADYSA-N 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 210000004900 c-terminal fragment Anatomy 0.000 description 1
- 230000001593 cAMP accumulation Effects 0.000 description 1
- 238000013262 cAMP assay Methods 0.000 description 1
- 230000003491 cAMP production Effects 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000004623 carbolinyl group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000009787 cardiac fibrosis Effects 0.000 description 1
- 210000004413 cardiac myocyte Anatomy 0.000 description 1
- 230000003293 cardioprotective effect Effects 0.000 description 1
- 230000009084 cardiovascular function Effects 0.000 description 1
- 238000001023 centrifugal evaporation Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- ARQRPTNYUOLOGH-UHFFFAOYSA-N chcl3 chloroform Chemical compound ClC(Cl)Cl.ClC(Cl)Cl ARQRPTNYUOLOGH-UHFFFAOYSA-N 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 1
- 229960001761 chlorpropamide Drugs 0.000 description 1
- 229940107137 cholecystokinin Drugs 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 230000001906 cholesterol absorption Effects 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- YZFWTZACSRHJQD-UHFFFAOYSA-N ciglitazone Chemical compound C=1C=C(CC2C(NC(=O)S2)=O)C=CC=1OCC1(C)CCCCC1 YZFWTZACSRHJQD-UHFFFAOYSA-N 0.000 description 1
- 229950009226 ciglitazone Drugs 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 229960002174 ciprofibrate Drugs 0.000 description 1
- KPSRODZRAIWAKH-UHFFFAOYSA-N ciprofibrate Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1C1C(Cl)(Cl)C1 KPSRODZRAIWAKH-UHFFFAOYSA-N 0.000 description 1
- 208000035850 clinical syndrome Diseases 0.000 description 1
- 229960001214 clofibrate Drugs 0.000 description 1
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 239000002475 cognitive enhancer Substances 0.000 description 1
- GMRWGQCZJGVHKL-UHFFFAOYSA-N colestipol Chemical compound ClCC1CO1.NCCNCCNCCNCCN GMRWGQCZJGVHKL-UHFFFAOYSA-N 0.000 description 1
- 229960002604 colestipol Drugs 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 201000011634 coronary artery vasospasm Diseases 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 210000004748 cultured cell Anatomy 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- XSYZCZPCBXYQTE-UHFFFAOYSA-N cyclodecylcyclodecane Chemical compound C1CCCCCCCCC1C1CCCCCCCCC1 XSYZCZPCBXYQTE-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 1
- WLVKDFJTYKELLQ-UHFFFAOYSA-N cyclopropylboronic acid Chemical compound OB(O)C1CC1 WLVKDFJTYKELLQ-UHFFFAOYSA-N 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 125000004431 deuterium atom Chemical group 0.000 description 1
- 229960004597 dexfenfluramine Drugs 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229960004890 diethylpropion Drugs 0.000 description 1
- XXEPPPIWZFICOJ-UHFFFAOYSA-N diethylpropion Chemical compound CCN(CC)C(C)C(=O)C1=CC=CC=C1 XXEPPPIWZFICOJ-UHFFFAOYSA-N 0.000 description 1
- HQWPLXHWEZZGKY-UHFFFAOYSA-N diethylzinc Chemical compound CC[Zn]CC HQWPLXHWEZZGKY-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 102000038379 digestive enzymes Human genes 0.000 description 1
- 108091007734 digestive enzymes Proteins 0.000 description 1
- 125000005047 dihydroimidazolyl group Chemical group N1(CNC=C1)* 0.000 description 1
- NZZFYRREKKOMAT-UHFFFAOYSA-N diiodomethane Chemical compound ICI NZZFYRREKKOMAT-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- DLNKOYKMWOXYQA-UHFFFAOYSA-N dl-pseudophenylpropanolamine Natural products CC(N)C(O)C1=CC=CC=C1 DLNKOYKMWOXYQA-UHFFFAOYSA-N 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 230000008406 drug-drug interaction Effects 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002085 enols Chemical group 0.000 description 1
- 230000010856 establishment of protein localization Effects 0.000 description 1
- OLAMWIPURJGSKE-UHFFFAOYSA-N et2o diethylether Chemical compound CCOCC.CCOCC OLAMWIPURJGSKE-UHFFFAOYSA-N 0.000 description 1
- OCLXJTCGWSSVOE-UHFFFAOYSA-N ethanol etoh Chemical compound CCO.CCO OCLXJTCGWSSVOE-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 229960001519 exenatide Drugs 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000013213 extrapolation Methods 0.000 description 1
- 206010016256 fatigue Diseases 0.000 description 1
- 229960001582 fenfluramine Drugs 0.000 description 1
- 229960002297 fenofibrate Drugs 0.000 description 1
- YMTINGFKWWXKFG-UHFFFAOYSA-N fenofibrate Chemical compound C1=CC(OC(C)(C)C(=O)OC(C)C)=CC=C1C(=O)C1=CC=C(Cl)C=C1 YMTINGFKWWXKFG-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229940125753 fibrate Drugs 0.000 description 1
- 230000004761 fibrosis Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000003709 fluoroalkyl group Chemical group 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 229960004580 glibenclamide Drugs 0.000 description 1
- 229960000346 gliclazide Drugs 0.000 description 1
- 229960004346 glimepiride Drugs 0.000 description 1
- WIGIZIANZCJQQY-RUCARUNLSA-N glimepiride Chemical compound O=C1C(CC)=C(C)CN1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)N[C@@H]2CC[C@@H](C)CC2)C=C1 WIGIZIANZCJQQY-RUCARUNLSA-N 0.000 description 1
- 229960001381 glipizide Drugs 0.000 description 1
- ZJJXGWJIGJFDTL-UHFFFAOYSA-N glipizide Chemical compound C1=NC(C)=CN=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZJJXGWJIGJFDTL-UHFFFAOYSA-N 0.000 description 1
- ZNNLBTZKUZBEKO-UHFFFAOYSA-N glyburide Chemical compound COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZNNLBTZKUZBEKO-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000004995 haloalkylthio group Chemical group 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 208000038002 heart failure with reduced ejection fraction Diseases 0.000 description 1
- 125000006343 heptafluoro propyl group Chemical group 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 238000004896 high resolution mass spectrometry Methods 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 102000047215 human APLNR Human genes 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 239000002471 hydroxymethylglutaryl coenzyme A reductase inhibitor Substances 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 125000004857 imidazopyridinyl group Chemical group N1C(=NC2=C1C=CC=N2)* 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229940125396 insulin Drugs 0.000 description 1
- 208000001286 intracranial vasospasm Diseases 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 201000007170 intrinsic cardiomyopathy Diseases 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000004936 isatinoyl group Chemical group N1(C(=O)C(=O)C2=CC=CC=C12)C(=O)* 0.000 description 1
- 208000037906 ischaemic injury Diseases 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical class OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 230000003907 kidney function Effects 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- NRYBAZVQPHGZNS-ZSOCWYAHSA-N leptin Chemical compound O=C([C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(C)C)CCSC)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CS)C(O)=O NRYBAZVQPHGZNS-ZSOCWYAHSA-N 0.000 description 1
- 229940039781 leptin Drugs 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 1
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 1
- 230000003908 liver function Effects 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000012139 lysis buffer Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229960000299 mazindol Drugs 0.000 description 1
- BCVXHSPFUWZLGQ-UHFFFAOYSA-N mecn acetonitrile Chemical compound CC#N.CC#N BCVXHSPFUWZLGQ-UHFFFAOYSA-N 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical compound CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 1
- 229960003105 metformin Drugs 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 229960001110 miglitol Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000000116 mitigating effect Effects 0.000 description 1
- SLZIZIJTGAYEKK-CIJSCKBQSA-N molport-023-220-247 Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1N=CNC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1N=CNC=1)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)CN)[C@@H](C)O)C1=CNC=N1 SLZIZIJTGAYEKK-CIJSCKBQSA-N 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- 210000000107 myocyte Anatomy 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 239000006070 nanosuspension Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000011570 nicotinamide Substances 0.000 description 1
- 150000005480 nicotinamides Chemical class 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- URPYMXQQVHTUDU-OFGSCBOVSA-N nucleopeptide y Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)CC=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 URPYMXQQVHTUDU-OFGSCBOVSA-N 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- AHLBNYSZXLDEJQ-FWEHEUNISA-N orlistat Chemical compound CCCCCCCCCCC[C@H](OC(=O)[C@H](CC(C)C)NC=O)C[C@@H]1OC(=O)[C@H]1CCCCCC AHLBNYSZXLDEJQ-FWEHEUNISA-N 0.000 description 1
- 229960001243 orlistat Drugs 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- GGMAXEWLXWJGSF-PEWBXTNBSA-N p-Glu-Arg-Pro-Arg-Leu-Ser-His-Lys-Gly-Pro-Met-Pro-Phe Chemical compound C([C@@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCSC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H]1NC(=O)CC1)C1=CN=CN1 GGMAXEWLXWJGSF-PEWBXTNBSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- MXQOYLRVSVOCQT-UHFFFAOYSA-N palladium;tritert-butylphosphane Chemical compound [Pd].CC(C)(C)P(C(C)(C)C)C(C)(C)C.CC(C)(C)P(C(C)(C)C)C(C)(C)C MXQOYLRVSVOCQT-UHFFFAOYSA-N 0.000 description 1
- 230000003076 paracrine Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- XDRYMKDFEDOLFX-UHFFFAOYSA-N pentamidine Chemical compound C1=CC(C(=N)N)=CC=C1OCCCCCOC1=CC=C(C(N)=N)C=C1 XDRYMKDFEDOLFX-UHFFFAOYSA-N 0.000 description 1
- 229960004448 pentamidine Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 230000036513 peripheral conductance Effects 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 229960003562 phentermine Drugs 0.000 description 1
- 229960001999 phentolamine Drugs 0.000 description 1
- MRBDMNSDAVCSSF-UHFFFAOYSA-N phentolamine Chemical compound C1=CC(C)=CC=C1N(C=1C=C(O)C=CC=1)CC1=NCCN1 MRBDMNSDAVCSSF-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- DLNKOYKMWOXYQA-APPZFPTMSA-N phenylpropanolamine Chemical compound C[C@@H](N)[C@H](O)C1=CC=CC=C1 DLNKOYKMWOXYQA-APPZFPTMSA-N 0.000 description 1
- 229960000395 phenylpropanolamine Drugs 0.000 description 1
- 102000020233 phosphotransferase Human genes 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical compound NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 description 1
- 229940081066 picolinic acid Drugs 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229960005095 pioglitazone Drugs 0.000 description 1
- 125000004928 piperidonyl group Chemical group 0.000 description 1
- 210000002826 placenta Anatomy 0.000 description 1
- 229940096701 plain lipid modifying drug hmg coa reductase inhibitors Drugs 0.000 description 1
- 239000000106 platelet aggregation inhibitor Substances 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 125000004585 polycyclic heterocycle group Chemical group 0.000 description 1
- 102000054765 polymorphisms of proteins Human genes 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229960002847 prasterone Drugs 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- FYPMFJGVHOHGLL-UHFFFAOYSA-N probucol Chemical compound C=1C(C(C)(C)C)=C(O)C(C(C)(C)C)=CC=1SC(C)(C)SC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 FYPMFJGVHOHGLL-UHFFFAOYSA-N 0.000 description 1
- 229960003912 probucol Drugs 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 108010070701 procolipase Proteins 0.000 description 1
- 238000004393 prognosis Methods 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 230000004224 protection Effects 0.000 description 1
- 230000007026 protein scission Effects 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 208000005333 pulmonary edema Diseases 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 description 1
- 229960004622 raloxifene Drugs 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 239000003087 receptor blocking agent Substances 0.000 description 1
- 230000033300 receptor internalization Effects 0.000 description 1
- 230000010410 reperfusion Effects 0.000 description 1
- 230000003252 repetitive effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 102000027483 retinoid hormone receptors Human genes 0.000 description 1
- 108091008679 retinoid hormone receptors Proteins 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 238000011808 rodent model Methods 0.000 description 1
- 229960004586 rosiglitazone Drugs 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 230000003248 secreting effect Effects 0.000 description 1
- 239000008299 semisolid dosage form Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 208000013220 shortness of breath Diseases 0.000 description 1
- 229960004425 sibutramine Drugs 0.000 description 1
- UNAANXDKBXWMLN-UHFFFAOYSA-N sibutramine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)CC(C)C)CCC1 UNAANXDKBXWMLN-UHFFFAOYSA-N 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 230000007727 signaling mechanism Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical compound [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- IZTQOLKUZKXIRV-YRVFCXMDSA-N sincalide Chemical compound C([C@@H](C(=O)N[C@@H](CCSC)C(=O)NCC(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(N)=O)NC(=O)[C@@H](N)CC(O)=O)C1=CC=C(OS(O)(=O)=O)C=C1 IZTQOLKUZKXIRV-YRVFCXMDSA-N 0.000 description 1
- 210000000329 smooth muscle myocyte Anatomy 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- WGRULTCAYDOGQK-UHFFFAOYSA-M sodium;sodium;hydroxide Chemical compound [OH-].[Na].[Na+] WGRULTCAYDOGQK-UHFFFAOYSA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010922 spray-dried dispersion Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000002626 targeted therapy Methods 0.000 description 1
- IMCGHZIGRANKHV-AJNGGQMLSA-N tert-butyl (3s,5s)-2-oxo-5-[(2s,4s)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidine-1-carboxylate Chemical compound O1C(=O)[C@H](C(C)C)C[C@H]1[C@H]1N(C(=O)OC(C)(C)C)C(=O)[C@H](C(C)C)C1 IMCGHZIGRANKHV-AJNGGQMLSA-N 0.000 description 1
- JHLVEBNWCCKSGY-UHFFFAOYSA-N tert-butyl n-methylcarbamate Chemical compound CNC(=O)OC(C)(C)C JHLVEBNWCCKSGY-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- PHCBRBWANGJMHS-UHFFFAOYSA-J tetrasodium;disulfate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O PHCBRBWANGJMHS-UHFFFAOYSA-J 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 150000001467 thiazolidinediones Chemical class 0.000 description 1
- CBDKQYKMCICBOF-UHFFFAOYSA-N thiazoline Chemical compound C1CN=CS1 CBDKQYKMCICBOF-UHFFFAOYSA-N 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- 125000005403 thiohaloalkoxy group Chemical group 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 230000007838 tissue remodeling Effects 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 229960002277 tolazamide Drugs 0.000 description 1
- OUDSBRTVNLOZBN-UHFFFAOYSA-N tolazamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NN1CCCCCC1 OUDSBRTVNLOZBN-UHFFFAOYSA-N 0.000 description 1
- 229960005371 tolbutamide Drugs 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-FIBGUPNXSA-N trideuterio(iodo)methane Chemical compound [2H]C([2H])([2H])I INQOMBQAUSQDDS-FIBGUPNXSA-N 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- GXPHKUHSUJUWKP-UHFFFAOYSA-N troglitazone Chemical compound C1CC=2C(C)=C(O)C(C)=C(C)C=2OC1(C)COC(C=C1)=CC=C1CC1SC(=O)NC1=O GXPHKUHSUJUWKP-UHFFFAOYSA-N 0.000 description 1
- 229960001641 troglitazone Drugs 0.000 description 1
- GXPHKUHSUJUWKP-NTKDMRAZSA-N troglitazone Natural products C([C@@]1(OC=2C(C)=C(C(=C(C)C=2CC1)O)C)C)OC(C=C1)=CC=C1C[C@H]1SC(=O)NC1=O GXPHKUHSUJUWKP-NTKDMRAZSA-N 0.000 description 1
- 239000002753 trypsin inhibitor Substances 0.000 description 1
- 229940046728 tumor necrosis factor alpha inhibitor Drugs 0.000 description 1
- 239000002452 tumor necrosis factor alpha inhibitor Substances 0.000 description 1
- 208000001072 type 2 diabetes mellitus Diseases 0.000 description 1
- 210000003556 vascular endothelial cell Anatomy 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 229960003726 vasopressin Drugs 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 239000011715 vitamin B12 Substances 0.000 description 1
- 239000011726 vitamin B6 Substances 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- UGOMMVLRQDMAQQ-UHFFFAOYSA-N xphos Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 UGOMMVLRQDMAQQ-UHFFFAOYSA-N 0.000 description 1
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/513—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim having oxo groups directly attached to the heterocyclic ring, e.g. cytosine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Cardiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Heart & Thoracic Surgery (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Hospice & Palliative Care (AREA)
- Epidemiology (AREA)
- Urology & Nephrology (AREA)
- Vascular Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201562267997P | 2015-12-16 | 2015-12-16 | |
| US62/267,997 | 2015-12-16 | ||
| PCT/US2016/066750 WO2017106396A1 (en) | 2015-12-16 | 2016-12-15 | Heteroarylhydroxypyrimidinones as agonists of the apj receptor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CN108602813A CN108602813A (zh) | 2018-09-28 |
| CN108602813B true CN108602813B (zh) | 2021-10-29 |
Family
ID=57708840
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CN201680081704.3A Active CN108602813B (zh) | 2015-12-16 | 2016-12-15 | 作为apj受体激动剂的杂芳基羟基嘧啶酮 |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US10669261B2 (enExample) |
| EP (1) | EP3390400B1 (enExample) |
| JP (1) | JP6948322B2 (enExample) |
| KR (1) | KR102742744B1 (enExample) |
| CN (1) | CN108602813B (enExample) |
| AR (1) | AR107061A1 (enExample) |
| AU (1) | AU2016372048B2 (enExample) |
| BR (1) | BR112018012112A2 (enExample) |
| CA (1) | CA3008630A1 (enExample) |
| CL (1) | CL2018001621A1 (enExample) |
| CO (1) | CO2018007221A2 (enExample) |
| EA (1) | EA036736B1 (enExample) |
| ES (1) | ES2854733T3 (enExample) |
| HK (1) | HK1255163A1 (enExample) |
| IL (1) | IL259947B (enExample) |
| MX (1) | MX380669B (enExample) |
| PE (1) | PE20181487A1 (enExample) |
| SG (1) | SG11201804674UA (enExample) |
| TW (1) | TW201725203A (enExample) |
| UY (1) | UY37026A (enExample) |
| WO (1) | WO2017106396A1 (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MY189453A (en) | 2015-06-03 | 2022-02-14 | Bristol Myers Squibb Co | 4-hydroxy-3-(heteroaryl)pyridine-2-one apj agonists for use in the treatment of cardiovascular disorders |
| CA3001974A1 (en) | 2015-10-14 | 2017-04-20 | Bristol-Myers Squibb Company | 2,4-dihydroxy-nicotinamides as apj agonists |
| WO2017096130A1 (en) | 2015-12-04 | 2017-06-08 | Bristol-Myers Squibb Company | Apelin receptor agonists and methods of use |
| PT3390395T (pt) | 2015-12-16 | 2020-11-03 | Loxo Oncology Inc | Compostos úteis como inibidores de quinase |
| MA43761A (fr) | 2016-03-24 | 2021-05-05 | Bristol Myers Squibb Co | 6-hydroxy-4-oxo-1,4-dihydropyrimidine-5-carboxamides comme inhibiteurs de la apj |
| WO2017192485A1 (en) | 2016-05-03 | 2017-11-09 | Amgen Inc. | Heterocyclic triazole compounds as agonists of the apj receptor |
| KR102521955B1 (ko) | 2016-06-14 | 2023-04-13 | 브리스톨-마이어스 스큅 컴퍼니 | Apj 수용체 효능제로서의 4-히드록시-3-술포닐피리딘-2(1h)-온 |
| US10508104B2 (en) | 2016-06-14 | 2019-12-17 | Bristol-Myers Squibb Company | 6-hydroxy-5-(phenyl/heteroarylsulfonyl)pyrimidin-4(1H)-one as APJ agonists |
| EP3526198B1 (en) | 2016-10-14 | 2020-08-12 | Bristol-Myers Squibb Company | 3-sulfonyl-5-aminopyridine-2,4-diol apj agonists |
| US10906890B2 (en) | 2016-11-16 | 2021-02-02 | Amgen Inc. | Triazole phenyl compounds as agonists of the APJ receptor |
| MA46827A (fr) | 2016-11-16 | 2019-09-25 | Amgen Inc | Composés de triazole à substitution cycloalkyle en tant qu'agonistes du récepteur apj |
| EP3541792B1 (en) | 2016-11-16 | 2020-12-23 | Amgen Inc. | Triazole furan compounds as agonists of the apj receptor |
| WO2018097945A1 (en) | 2016-11-16 | 2018-05-31 | Amgen Inc. | Heteroaryl-substituted triazoles as apj receptor agonists |
| WO2018093580A1 (en) | 2016-11-16 | 2018-05-24 | Amgen Inc. | Triazole pyridyl compounds as agonists of the apj receptor |
| US11191762B2 (en) | 2016-11-16 | 2021-12-07 | Amgen Inc. | Alkyl substituted triazole compounds as agonists of the APJ Receptor |
| WO2019213006A1 (en) | 2018-05-01 | 2019-11-07 | Amgen Inc. | Substituted pyrimidinones as agonists of the apj receptor |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1179952C (zh) * | 2000-02-16 | 2004-12-15 | 史密斯克莱·比奇曼公司 | 作为ldl-pla2抑制剂的嘧啶-4-酮衍生物 |
| WO2015184011A2 (en) * | 2014-05-28 | 2015-12-03 | Sanford-Burnham Medical Research Institute | Agonists of the apelin receptor and methods of use thereof |
| WO2016196771A1 (en) * | 2015-06-03 | 2016-12-08 | Bristol-Myers Squibb Company | 4-hydroxy-3-(heteroaryl)pyridine-2-one apj agonists for use in the treatment of cardiovascular disorders |
Family Cites Families (49)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2263639A (en) | 1992-01-28 | 1993-08-04 | Merck & Co Inc | Substituted pyrimidinones as neurotensin antagonists |
| US6174998B1 (en) | 1996-03-12 | 2001-01-16 | Roche Diagnostics Gmbh | C-nucleoside derivatives and their use in the detection of nucleic acids |
| JPH08311041A (ja) | 1995-03-16 | 1996-11-26 | Takeda Chem Ind Ltd | 複素環化合物およびその剤 |
| BR9711098B1 (pt) | 1996-07-01 | 2011-10-04 | compostos heterocìclicos, processo para sua preparação e composições farmacêuticas contendo os mesmos e seu uso no tratamento de diabetes e doenças relacionadas. | |
| US6369067B1 (en) | 1997-10-27 | 2002-04-09 | Dr. Reddy's Research Foundation | Monocyclic compounds and their use in medicine: process for their preparation and pharmaceutical compositions containing them |
| AU2001280590A1 (en) | 2000-07-18 | 2002-01-30 | Neurogen Corporation | 5-substituted 2-aryl-4-pyrimidinones |
| WO2002081454A1 (en) | 2001-04-09 | 2002-10-17 | Dr. Reddy's Laboratories Ltd. | Derivatives of aryl acids, their use in medicine, process for their preparation and pharmaceutical compositions containing them |
| WO2003094839A2 (en) | 2002-05-09 | 2003-11-20 | Cytokinetics, Inc. | Pyrimidinone compounds, compositions and methods |
| EP1509507A4 (en) | 2002-05-23 | 2006-09-13 | Merck & Co Inc | INHIBITORS OF MITOTIC KINESINE |
| US20070167621A1 (en) | 2003-04-03 | 2007-07-19 | Pharmacia Corporation | Substituted pyrimidinones |
| WO2004094408A1 (en) | 2003-04-23 | 2004-11-04 | Pharmacia & Upjohn Company Llc | Substituted pyrimidinones and pyrimidinthiones as crf antagonists |
| WO2005026148A1 (en) | 2003-09-08 | 2005-03-24 | Takeda San Diego, Inc. | Dipeptidyl peptidase inhibitors |
| WO2005041888A2 (en) | 2003-11-03 | 2005-05-12 | Cytokinetics, Inc. | Pyrimidin-4-one compounds, compositions and methods |
| JP2007518711A (ja) | 2003-12-19 | 2007-07-12 | メルク エンド カムパニー インコーポレーテッド | 有糸分裂キネシン阻害剤 |
| JP4517349B2 (ja) | 2004-07-28 | 2010-08-04 | 宇部興産株式会社 | ピリミジン−4−オン化合物の製造方法 |
| DE102005025315A1 (de) | 2005-06-02 | 2006-12-14 | Merck Patent Gmbh | Ionische Flüssigkeiten mit niedriger Viskosität |
| WO2007037543A1 (ja) | 2005-09-29 | 2007-04-05 | Banyu Pharmaceutical Co., Ltd. | ビアリールアミド誘導体 |
| KR20080080584A (ko) | 2005-11-30 | 2008-09-04 | 버텍스 파마슈티칼스 인코포레이티드 | c-Met의 억제제 및 이의 용도 |
| EP2016056A4 (en) | 2006-04-21 | 2010-11-10 | Univ Boston | IONIC VISCOELASTIC AND VISCOELASTIC SALTS |
| EP2079707B1 (de) | 2006-10-10 | 2014-12-03 | proionic GmbH & Co KG | Verfahren zur umsetzung von 1,3-hetero-aromatischen 2-carboxylaten mit wasser |
| WO2008052861A2 (de) | 2006-10-10 | 2008-05-08 | Proionic Production Of Ionic Substances Gmbh & Co Keg | Verfahren zur herstellung von 1,3 -hetero-aromatischen carbonaten |
| EP2114898A2 (en) | 2007-02-16 | 2009-11-11 | Amgen Inc. | Nitrogen-containing heterocyclyl ketones and their use as c-met inhibitors |
| EP2279192B1 (en) | 2008-05-28 | 2013-10-30 | Merck Patent GmbH | Ionic liquids |
| DE102008031480A1 (de) | 2008-07-03 | 2010-01-07 | Merck Patent Gmbh | Salze enthaltend ein Pyrimidincarbonsäure-Derivat |
| WO2010072696A2 (de) | 2008-12-22 | 2010-07-01 | Basf Se | Mischungen hydrophober und hydrophiler ionischer flüssigkeiten und ihre verwendung in flüssigkeitsringverdichtern |
| US9040538B2 (en) | 2009-05-21 | 2015-05-26 | Universite Laval | Pyrimidines as novel therapeutic agents |
| US9212130B2 (en) | 2010-08-10 | 2015-12-15 | Shionogi & Co., Ltd. | Heterocyclic derivative and pharmaceutical composition comprising the same |
| KR20140039242A (ko) | 2011-05-31 | 2014-04-01 | 메르크 파텐트 게엠베하 | 전해질 제형 |
| TWI567084B (zh) | 2011-05-31 | 2017-01-21 | 麥克專利有限公司 | 含有氫-三氰-硼酸根陰離子之化合物 |
| CN102903954B (zh) | 2011-07-25 | 2015-06-03 | 微宏动力系统(湖州)有限公司 | 含有离子液体电解质的锂离子二次电池 |
| DE102012006896A1 (de) | 2012-04-05 | 2013-10-10 | Merck Patent Gmbh | Silikate mit organischen Kationen |
| CN110664816A (zh) | 2012-06-07 | 2020-01-10 | 佐治亚州立大学研究基金会公司 | Seca抑制剂以及其制备和使用方法 |
| HUE031733T2 (en) * | 2012-09-21 | 2017-07-28 | Sanofi Sa | Benzimidazole carboxylic acid amide derivatives for the treatment of metabolic or cardiovascular diseases |
| WO2014056844A1 (en) | 2012-10-10 | 2014-04-17 | Basf Se | Ionic liquids based on oxalic acid mono esters |
| DE102012021452A1 (de) | 2012-10-31 | 2014-04-30 | Merck Patent Gmbh | Salze mit Trihydroperfluoralkoxybutansulfonat- oder Trihydroperfluoralkoxypropansulfonat-Anion |
| HK1212235A1 (en) | 2012-11-16 | 2016-06-10 | Biocryst Pharmaceuticals, Inc. | Antiviral azasugar-containing nucleosides |
| WO2014207100A1 (en) | 2013-06-27 | 2014-12-31 | Basf Se | A process for coating paper with cellulose using a solution containing cellulose |
| DE102013016324A1 (de) | 2013-10-04 | 2015-04-09 | Merck Patent Gmbh | Perfluoralkylfluor- oder Perfluoralkylchlorgermanate |
| ES2906062T3 (es) | 2013-11-29 | 2022-04-13 | Proionic Gmbh | Procedimiento para la unión de un material termoplástico por medio de radiación de microondas |
| KR101550846B1 (ko) | 2014-01-29 | 2015-09-07 | 한국과학기술연구원 | 단일공정을 이용한 탄소소재의 다원소 도핑방법 및 그 용도 |
| KR101531023B1 (ko) | 2014-05-27 | 2015-06-23 | 한국과학기술연구원 | 열분해 가스 도핑에 의한 고강도 고전도성 탄소나노튜브섬유의 제조방법 및 이에 따라 제조된 탄소나노튜브섬유 |
| EP3152200A1 (en) * | 2014-06-06 | 2017-04-12 | Research Triangle Institute | Apelin receptor (apj) agonists and uses thereof |
| WO2016074757A1 (de) | 2014-11-11 | 2016-05-19 | Merck Patent Gmbh | Verfahren zur herstellung von mono- und bis(perfluoralkyl)fluorophosphatsalzen und deren säuren |
| CA3001974A1 (en) | 2015-10-14 | 2017-04-20 | Bristol-Myers Squibb Company | 2,4-dihydroxy-nicotinamides as apj agonists |
| WO2017096130A1 (en) | 2015-12-04 | 2017-06-08 | Bristol-Myers Squibb Company | Apelin receptor agonists and methods of use |
| MA43761A (fr) | 2016-03-24 | 2021-05-05 | Bristol Myers Squibb Co | 6-hydroxy-4-oxo-1,4-dihydropyrimidine-5-carboxamides comme inhibiteurs de la apj |
| KR102521955B1 (ko) | 2016-06-14 | 2023-04-13 | 브리스톨-마이어스 스큅 컴퍼니 | Apj 수용체 효능제로서의 4-히드록시-3-술포닐피리딘-2(1h)-온 |
| US10508104B2 (en) | 2016-06-14 | 2019-12-17 | Bristol-Myers Squibb Company | 6-hydroxy-5-(phenyl/heteroarylsulfonyl)pyrimidin-4(1H)-one as APJ agonists |
| EP3526198B1 (en) | 2016-10-14 | 2020-08-12 | Bristol-Myers Squibb Company | 3-sulfonyl-5-aminopyridine-2,4-diol apj agonists |
-
2016
- 2016-12-15 TW TW105141572A patent/TW201725203A/zh unknown
- 2016-12-15 CA CA3008630A patent/CA3008630A1/en not_active Abandoned
- 2016-12-15 MX MX2018007155A patent/MX380669B/es unknown
- 2016-12-15 ES ES16820507T patent/ES2854733T3/es active Active
- 2016-12-15 KR KR1020187019799A patent/KR102742744B1/ko active Active
- 2016-12-15 SG SG11201804674UA patent/SG11201804674UA/en unknown
- 2016-12-15 UY UY0001037026A patent/UY37026A/es unknown
- 2016-12-15 JP JP2018531333A patent/JP6948322B2/ja active Active
- 2016-12-15 BR BR112018012112-6A patent/BR112018012112A2/pt not_active Application Discontinuation
- 2016-12-15 EP EP16820507.8A patent/EP3390400B1/en active Active
- 2016-12-15 WO PCT/US2016/066750 patent/WO2017106396A1/en not_active Ceased
- 2016-12-15 PE PE2018001129A patent/PE20181487A1/es unknown
- 2016-12-15 AU AU2016372048A patent/AU2016372048B2/en not_active Ceased
- 2016-12-15 CN CN201680081704.3A patent/CN108602813B/zh active Active
- 2016-12-15 HK HK18114280.0A patent/HK1255163A1/zh unknown
- 2016-12-15 AR ARP160103867A patent/AR107061A1/es unknown
- 2016-12-15 US US16/061,365 patent/US10669261B2/en active Active
- 2016-12-15 EA EA201891336A patent/EA036736B1/ru not_active IP Right Cessation
-
2018
- 2018-06-11 IL IL259947A patent/IL259947B/en active IP Right Grant
- 2018-06-15 CL CL2018001621A patent/CL2018001621A1/es unknown
- 2018-07-11 CO CONC2018/0007221A patent/CO2018007221A2/es unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1179952C (zh) * | 2000-02-16 | 2004-12-15 | 史密斯克莱·比奇曼公司 | 作为ldl-pla2抑制剂的嘧啶-4-酮衍生物 |
| WO2015184011A2 (en) * | 2014-05-28 | 2015-12-03 | Sanford-Burnham Medical Research Institute | Agonists of the apelin receptor and methods of use thereof |
| WO2016196771A1 (en) * | 2015-06-03 | 2016-12-08 | Bristol-Myers Squibb Company | 4-hydroxy-3-(heteroaryl)pyridine-2-one apj agonists for use in the treatment of cardiovascular disorders |
Non-Patent Citations (1)
| Title |
|---|
| Synthesis and evaluation of the antitumor agent TMC-69-6H and a focused library of analogs;Alois Furstner et al.;《Tetrahedron》;20040821;第60卷(第43期);第9543-9558页 * |
Also Published As
| Publication number | Publication date |
|---|---|
| CO2018007221A2 (es) | 2018-07-19 |
| JP6948322B2 (ja) | 2021-10-13 |
| JP2018538304A (ja) | 2018-12-27 |
| ES2854733T3 (es) | 2021-09-22 |
| CL2018001621A1 (es) | 2018-08-03 |
| MX2018007155A (es) | 2018-08-15 |
| BR112018012112A2 (pt) | 2018-12-04 |
| PE20181487A1 (es) | 2018-09-18 |
| IL259947A (en) | 2018-07-31 |
| MX380669B (es) | 2025-03-12 |
| TW201725203A (zh) | 2017-07-16 |
| KR20180095577A (ko) | 2018-08-27 |
| AU2016372048B2 (en) | 2021-02-04 |
| UY37026A (es) | 2017-06-30 |
| US10669261B2 (en) | 2020-06-02 |
| KR102742744B1 (ko) | 2024-12-12 |
| HK1255163A1 (zh) | 2019-08-09 |
| EA201891336A1 (ru) | 2019-01-31 |
| US20180362508A1 (en) | 2018-12-20 |
| EA036736B1 (ru) | 2020-12-14 |
| AR107061A1 (es) | 2018-03-14 |
| WO2017106396A1 (en) | 2017-06-22 |
| SG11201804674UA (en) | 2018-06-28 |
| AU2016372048A1 (en) | 2018-08-02 |
| IL259947B (en) | 2020-10-29 |
| EP3390400B1 (en) | 2021-01-20 |
| CA3008630A1 (en) | 2017-06-22 |
| EP3390400A1 (en) | 2018-10-24 |
| CN108602813A (zh) | 2018-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN108602813B (zh) | 作为apj受体激动剂的杂芳基羟基嘧啶酮 | |
| US12168655B2 (en) | Apelin receptor agonists and methods of use | |
| US10336739B2 (en) | 4-hydroxy-3-(heteroaryl)pyridine-2-one APJ agonists | |
| KR102384668B1 (ko) | Apj 효능제로서의 6-히드록시-5-(페닐/헤테로아릴술포닐)피리미딘-4(1h)-온 | |
| CN109195963B (zh) | 作为apj激动剂的6-羟基-4-氧代-1,4-二氢嘧啶-5-甲酰胺 | |
| CN108368087B (zh) | 作为apj激动剂的2,4-二羟基-烟酰胺 | |
| KR102521956B1 (ko) | 3-술포닐-5-아미노피리딘-2,4-디올 apj 효능제 | |
| CN106061968B (zh) | 四唑酮-取代的二氢吡啶酮mgat2抑制剂 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PB01 | Publication | ||
| PB01 | Publication | ||
| SE01 | Entry into force of request for substantive examination | ||
| SE01 | Entry into force of request for substantive examination | ||
| GR01 | Patent grant | ||
| GR01 | Patent grant |