CN101365806B - 用于鉴定治疗反应的生物标记的方法和装置及其预测疗效的用途 - Google Patents
用于鉴定治疗反应的生物标记的方法和装置及其预测疗效的用途 Download PDFInfo
- Publication number
- CN101365806B CN101365806B CN200680052220.2A CN200680052220A CN101365806B CN 101365806 B CN101365806 B CN 101365806B CN 200680052220 A CN200680052220 A CN 200680052220A CN 101365806 B CN101365806 B CN 101365806B
- Authority
- CN
- China
- Prior art keywords
- gene
- treatment
- patient
- purposes
- cancer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000000034 method Methods 0.000 title abstract description 40
- 239000000090 biomarker Substances 0.000 title description 12
- 230000000694 effects Effects 0.000 title description 10
- 230000004797 therapeutic response Effects 0.000 title description 2
- 108090000623 proteins and genes Proteins 0.000 claims abstract description 187
- 238000011282 treatment Methods 0.000 claims abstract description 121
- 230000035945 sensitivity Effects 0.000 claims abstract description 40
- 230000014509 gene expression Effects 0.000 claims description 107
- 206010028980 Neoplasm Diseases 0.000 claims description 54
- -1 methyl meticortelone Chemical compound 0.000 claims description 49
- 201000011510 cancer Diseases 0.000 claims description 46
- 239000003112 inhibitor Substances 0.000 claims description 38
- 102000039446 nucleic acids Human genes 0.000 claims description 32
- 108020004707 nucleic acids Proteins 0.000 claims description 32
- 150000007523 nucleic acids Chemical class 0.000 claims description 32
- 125000003729 nucleotide group Chemical group 0.000 claims description 30
- 239000002773 nucleotide Substances 0.000 claims description 29
- 230000000295 complement effect Effects 0.000 claims description 17
- XAUDJQYHKZQPEU-KVQBGUIXSA-N 5-aza-2'-deoxycytidine Chemical compound O=C1N=C(N)N=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 XAUDJQYHKZQPEU-KVQBGUIXSA-N 0.000 claims description 15
- 101000738771 Homo sapiens Receptor-type tyrosine-protein phosphatase C Proteins 0.000 claims description 15
- 102100037422 Receptor-type tyrosine-protein phosphatase C Human genes 0.000 claims description 15
- 102000003964 Histone deacetylase Human genes 0.000 claims description 13
- 108090000353 Histone deacetylase Proteins 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 13
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 claims description 12
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 claims description 12
- 229960004316 cisplatin Drugs 0.000 claims description 12
- 229960005420 etoposide Drugs 0.000 claims description 12
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 claims description 12
- NWXMGUDVXFXRIG-WESIUVDSSA-N (4s,4as,5as,6s,12ar)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide Chemical compound C1=CC=C2[C@](O)(C)[C@H]3C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C3=C(O)C2=C1O NWXMGUDVXFXRIG-WESIUVDSSA-N 0.000 claims description 11
- 229930195573 Amycin Natural products 0.000 claims description 11
- 101000599038 Homo sapiens DNA-binding protein Ikaros Proteins 0.000 claims description 11
- 101000980823 Homo sapiens Leukocyte surface antigen CD53 Proteins 0.000 claims description 11
- 102100024221 Leukocyte surface antigen CD53 Human genes 0.000 claims description 11
- 108091034117 Oligonucleotide Proteins 0.000 claims description 11
- USZYSDMBJDPRIF-SVEJIMAYSA-N aclacinomycin A Chemical compound O([C@H]1[C@@H](O)C[C@@H](O[C@H]1C)O[C@H]1[C@H](C[C@@H](O[C@H]1C)O[C@H]1C[C@]([C@@H](C2=CC=3C(=O)C4=CC=CC(O)=C4C(=O)C=3C(O)=C21)C(=O)OC)(O)CC)N(C)C)[C@H]1CCC(=O)[C@H](C)O1 USZYSDMBJDPRIF-SVEJIMAYSA-N 0.000 claims description 10
- 229960004176 aclarubicin Drugs 0.000 claims description 10
- 102100028233 Coronin-1A Human genes 0.000 claims description 9
- 101000860852 Homo sapiens Coronin-1A Proteins 0.000 claims description 9
- 101001051291 Homo sapiens Lysosomal-associated transmembrane protein 5 Proteins 0.000 claims description 9
- 101001135804 Homo sapiens Protein tyrosine phosphatase receptor type C-associated protein Proteins 0.000 claims description 9
- 102100024625 Lysosomal-associated transmembrane protein 5 Human genes 0.000 claims description 9
- 102100036937 Protein tyrosine phosphatase receptor type C-associated protein Human genes 0.000 claims description 9
- 229960003603 decitabine Drugs 0.000 claims description 9
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 claims description 9
- 229960003957 dexamethasone Drugs 0.000 claims description 9
- 102100041007 Glia maturation factor gamma Human genes 0.000 claims description 7
- 102100023954 Guanine nucleotide-binding protein subunit alpha-15 Human genes 0.000 claims description 7
- 102100027385 Hematopoietic lineage cell-specific protein Human genes 0.000 claims description 7
- 101001039458 Homo sapiens Glia maturation factor gamma Proteins 0.000 claims description 7
- 101000904080 Homo sapiens Guanine nucleotide-binding protein subunit alpha-15 Proteins 0.000 claims description 7
- 101001009091 Homo sapiens Hematopoietic lineage cell-specific protein Proteins 0.000 claims description 7
- 101001024704 Homo sapiens Nck-associated protein 1-like Proteins 0.000 claims description 7
- 102100036942 Nck-associated protein 1-like Human genes 0.000 claims description 7
- 101001050476 Homo sapiens Tyrosine-protein kinase ITK/TSK Proteins 0.000 claims description 6
- 102100023345 Tyrosine-protein kinase ITK/TSK Human genes 0.000 claims description 6
- 229960004679 doxorubicin Drugs 0.000 claims description 6
- 102100022749 Aminopeptidase N Human genes 0.000 claims description 5
- 108010049990 CD13 Antigens Proteins 0.000 claims description 5
- 102000053602 DNA Human genes 0.000 claims description 5
- 108020004414 DNA Proteins 0.000 claims description 5
- 101000935040 Homo sapiens Integrin beta-2 Proteins 0.000 claims description 5
- 101000777628 Homo sapiens Leukocyte antigen CD37 Proteins 0.000 claims description 5
- 102100025390 Integrin beta-2 Human genes 0.000 claims description 5
- 102100031586 Leukocyte antigen CD37 Human genes 0.000 claims description 5
- 102100040768 60S ribosomal protein L32 Human genes 0.000 claims description 4
- 101000672453 Homo sapiens 60S ribosomal protein L32 Proteins 0.000 claims description 4
- 101000716149 Homo sapiens T-cell surface glycoprotein CD1b Proteins 0.000 claims description 4
- 101000653540 Homo sapiens Transcription factor 7 Proteins 0.000 claims description 4
- 101000917519 Homo sapiens rRNA 2'-O-methyltransferase fibrillarin Proteins 0.000 claims description 4
- 102100035982 T-cell surface glycoprotein CD1b Human genes 0.000 claims description 4
- 102100030627 Transcription factor 7 Human genes 0.000 claims description 4
- 102100029526 rRNA 2'-O-methyltransferase fibrillarin Human genes 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- 102100035990 Adenosine receptor A2a Human genes 0.000 claims description 3
- 102100035631 Bloom syndrome protein Human genes 0.000 claims description 3
- 108091009167 Bloom syndrome protein Proteins 0.000 claims description 3
- 102100039297 Cyclic AMP-responsive element-binding protein 3-like protein 1 Human genes 0.000 claims description 3
- 101000783751 Homo sapiens Adenosine receptor A2a Proteins 0.000 claims description 3
- 101000745631 Homo sapiens Cyclic AMP-responsive element-binding protein 3-like protein 1 Proteins 0.000 claims description 3
- 101000893493 Homo sapiens Protein flightless-1 homolog Proteins 0.000 claims description 3
- 101001051767 Homo sapiens Protein kinase C beta type Proteins 0.000 claims description 3
- 101000829211 Homo sapiens Serine/arginine repetitive matrix protein 1 Proteins 0.000 claims description 3
- 102100040923 Protein flightless-1 homolog Human genes 0.000 claims description 3
- 102100024923 Protein kinase C beta type Human genes 0.000 claims description 3
- 102100023664 Serine/arginine repetitive matrix protein 1 Human genes 0.000 claims description 3
- 102100040373 UDP-glucuronosyltransferase 2B17 Human genes 0.000 claims description 3
- 101710200687 UDP-glucuronosyltransferase 2B17 Proteins 0.000 claims description 3
- 108020004999 messenger RNA Proteins 0.000 claims description 3
- 238000001514 detection method Methods 0.000 claims description 2
- 238000002493 microarray Methods 0.000 claims 18
- 108020005187 Oligonucleotide Probes Proteins 0.000 claims 6
- 239000002751 oligonucleotide probe Substances 0.000 claims 6
- 241000218636 Thuja Species 0.000 claims 1
- 229960001810 meprednisone Drugs 0.000 claims 1
- PIDANAQULIKBQS-RNUIGHNZSA-N meprednisone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@@H]2[C@@H]1[C@@H]1C[C@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)CC2=O PIDANAQULIKBQS-RNUIGHNZSA-N 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 16
- 230000001225 therapeutic effect Effects 0.000 abstract description 5
- 238000002372 labelling Methods 0.000 abstract 1
- 210000004027 cell Anatomy 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 18
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 16
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 15
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Chemical compound CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 14
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 14
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 13
- 229930012538 Paclitaxel Natural products 0.000 description 13
- 239000002585 base Substances 0.000 description 13
- 230000012010 growth Effects 0.000 description 13
- 229960001592 paclitaxel Drugs 0.000 description 13
- 101000946863 Homo sapiens T-cell surface glycoprotein CD3 delta chain Proteins 0.000 description 12
- 102100035891 T-cell surface glycoprotein CD3 delta chain Human genes 0.000 description 12
- 229960005277 gemcitabine Drugs 0.000 description 12
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 12
- 229960001156 mitoxantrone Drugs 0.000 description 12
- 210000001519 tissue Anatomy 0.000 description 12
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 11
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 11
- 229960002949 fluorouracil Drugs 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- PTOAARAWEBMLNO-KVQBGUIXSA-N Cladribine Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 PTOAARAWEBMLNO-KVQBGUIXSA-N 0.000 description 10
- 102100037799 DNA-binding protein Ikaros Human genes 0.000 description 10
- 239000005557 antagonist Substances 0.000 description 10
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 10
- 101150075418 ARHGAP15 gene Proteins 0.000 description 9
- 102100028218 Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Human genes 0.000 description 9
- 101000724276 Homo sapiens Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Proteins 0.000 description 9
- 101000652382 Homo sapiens O-phosphoseryl-tRNA(Sec) selenium transferase Proteins 0.000 description 9
- 101000666634 Homo sapiens Rho-related GTP-binding protein RhoH Proteins 0.000 description 9
- 101000689199 Homo sapiens Src-like-adapter Proteins 0.000 description 9
- 101000738335 Homo sapiens T-cell surface glycoprotein CD3 zeta chain Proteins 0.000 description 9
- 108010050904 Interferons Proteins 0.000 description 9
- 102000014150 Interferons Human genes 0.000 description 9
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 9
- 102100027660 Rho GTPase-activating protein 15 Human genes 0.000 description 9
- 102100038338 Rho-related GTP-binding protein RhoH Human genes 0.000 description 9
- 108010011033 Signaling Lymphocytic Activation Molecule Associated Protein Proteins 0.000 description 9
- 102000013970 Signaling Lymphocytic Activation Molecule Associated Protein Human genes 0.000 description 9
- 102100024519 Src-like-adapter Human genes 0.000 description 9
- 102100037906 T-cell surface glycoprotein CD3 zeta chain Human genes 0.000 description 9
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 9
- 229960004562 carboplatin Drugs 0.000 description 9
- 229940079322 interferon Drugs 0.000 description 9
- 229960004528 vincristine Drugs 0.000 description 9
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 9
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 9
- 108010006654 Bleomycin Proteins 0.000 description 8
- 101000738506 Homo sapiens Psychosine receptor Proteins 0.000 description 8
- 101000999079 Homo sapiens Radiation-inducible immediate-early gene IEX-1 Proteins 0.000 description 8
- 101000693722 Homo sapiens SAM and SH3 domain-containing protein 3 Proteins 0.000 description 8
- 101000632314 Homo sapiens Septin-6 Proteins 0.000 description 8
- 101000617278 Homo sapiens Tyrosine-protein phosphatase non-receptor type 7 Proteins 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- 102100037860 Psychosine receptor Human genes 0.000 description 8
- 102100025544 SAM and SH3 domain-containing protein 3 Human genes 0.000 description 8
- 102100027982 Septin-6 Human genes 0.000 description 8
- 102100021648 Tyrosine-protein phosphatase non-receptor type 7 Human genes 0.000 description 8
- 229940045719 antineoplastic alkylating agent nitrosoureas Drugs 0.000 description 8
- 229960003539 mitoguazone Drugs 0.000 description 8
- MXWHMTNPTTVWDM-NXOFHUPFSA-N mitoguazone Chemical compound NC(N)=N\N=C(/C)\C=N\N=C(N)N MXWHMTNPTTVWDM-NXOFHUPFSA-N 0.000 description 8
- 229910052697 platinum Inorganic materials 0.000 description 8
- 230000005855 radiation Effects 0.000 description 8
- 229960004641 rituximab Drugs 0.000 description 8
- 239000000523 sample Substances 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 229940083542 sodium Drugs 0.000 description 8
- 102100040121 Allograft inflammatory factor 1 Human genes 0.000 description 7
- 108060001253 CD99 Proteins 0.000 description 7
- 102000024905 CD99 Human genes 0.000 description 7
- 102100026234 Cytokine receptor common subunit gamma Human genes 0.000 description 7
- 102100031597 Dedicator of cytokinesis protein 2 Human genes 0.000 description 7
- 101000890626 Homo sapiens Allograft inflammatory factor 1 Proteins 0.000 description 7
- 101001055227 Homo sapiens Cytokine receptor common subunit gamma Proteins 0.000 description 7
- 101000866237 Homo sapiens Dedicator of cytokinesis protein 2 Proteins 0.000 description 7
- 101001050472 Homo sapiens Integral membrane protein 2A Proteins 0.000 description 7
- 101001138062 Homo sapiens Leukocyte-associated immunoglobulin-like receptor 1 Proteins 0.000 description 7
- 101001090688 Homo sapiens Lymphocyte cytosolic protein 2 Proteins 0.000 description 7
- 101001059991 Homo sapiens Mitogen-activated protein kinase kinase kinase kinase 1 Proteins 0.000 description 7
- 101000738413 Homo sapiens T-cell surface glycoprotein CD3 gamma chain Proteins 0.000 description 7
- 101000819111 Homo sapiens Trans-acting T-cell-specific transcription factor GATA-3 Proteins 0.000 description 7
- 101000636213 Homo sapiens Transcriptional activator Myb Proteins 0.000 description 7
- 102100023351 Integral membrane protein 2A Human genes 0.000 description 7
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 7
- 102100020943 Leukocyte-associated immunoglobulin-like receptor 1 Human genes 0.000 description 7
- 102100034709 Lymphocyte cytosolic protein 2 Human genes 0.000 description 7
- 102100028199 Mitogen-activated protein kinase kinase kinase kinase 1 Human genes 0.000 description 7
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 7
- 108010015499 Protein Kinase C-theta Proteins 0.000 description 7
- 102100021566 Protein kinase C theta type Human genes 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- 102100037911 T-cell surface glycoprotein CD3 gamma chain Human genes 0.000 description 7
- 102100021386 Trans-acting T-cell-specific transcription factor GATA-3 Human genes 0.000 description 7
- 102100030780 Transcriptional activator Myb Human genes 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- 229960004961 mechlorethamine Drugs 0.000 description 7
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical compound ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 7
- 229960000485 methotrexate Drugs 0.000 description 7
- 239000001117 sulphuric acid Substances 0.000 description 7
- 235000011149 sulphuric acid Nutrition 0.000 description 7
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 6
- QNKJFXARIMSDBR-UHFFFAOYSA-N 3-[2-[bis(2-chloroethyl)amino]ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione Chemical compound O=C1N(CCN(CCCl)CCCl)C(=O)NC11CCCCC1 QNKJFXARIMSDBR-UHFFFAOYSA-N 0.000 description 6
- 102100027398 A disintegrin and metalloproteinase with thrombospondin motifs 1 Human genes 0.000 description 6
- 108091005660 ADAMTS1 Proteins 0.000 description 6
- 102100036664 Adenosine deaminase Human genes 0.000 description 6
- 102100031456 Centriolin Human genes 0.000 description 6
- 102100031502 Collagen alpha-2(V) chain Human genes 0.000 description 6
- 108010092160 Dactinomycin Proteins 0.000 description 6
- 102100031602 Dedicator of cytokinesis protein 10 Human genes 0.000 description 6
- 102100039928 Gamma-interferon-inducible protein 16 Human genes 0.000 description 6
- 102100030385 Granzyme B Human genes 0.000 description 6
- 101000929495 Homo sapiens Adenosine deaminase Proteins 0.000 description 6
- 101000762448 Homo sapiens Cdc42 effector protein 1 Proteins 0.000 description 6
- 101000941711 Homo sapiens Centriolin Proteins 0.000 description 6
- 101000941594 Homo sapiens Collagen alpha-2(V) chain Proteins 0.000 description 6
- 101000866268 Homo sapiens Dedicator of cytokinesis protein 10 Proteins 0.000 description 6
- 101000960209 Homo sapiens Gamma-interferon-inducible protein 16 Proteins 0.000 description 6
- 101001009603 Homo sapiens Granzyme B Proteins 0.000 description 6
- 101001047640 Homo sapiens Linker for activation of T-cells family member 1 Proteins 0.000 description 6
- 101000763322 Homo sapiens M1-specific T cell receptor beta chain Proteins 0.000 description 6
- 101000873418 Homo sapiens P-selectin glycoprotein ligand 1 Proteins 0.000 description 6
- 101000987581 Homo sapiens Perforin-1 Proteins 0.000 description 6
- 101000596046 Homo sapiens Plastin-2 Proteins 0.000 description 6
- 101000822478 Homo sapiens Protein transport protein Sec31B Proteins 0.000 description 6
- 101000927799 Homo sapiens Rho guanine nucleotide exchange factor 6 Proteins 0.000 description 6
- 101000763321 Homo sapiens T cell receptor beta chain MC.7.G5 Proteins 0.000 description 6
- 101000980827 Homo sapiens T-cell surface glycoprotein CD1a Proteins 0.000 description 6
- 101000762938 Homo sapiens TOX high mobility group box family member 4 Proteins 0.000 description 6
- 108010000817 Leuprolide Proteins 0.000 description 6
- 102100024032 Linker for activation of T-cells family member 1 Human genes 0.000 description 6
- 102100026964 M1-specific T cell receptor beta chain Human genes 0.000 description 6
- 241001597008 Nomeidae Species 0.000 description 6
- 102100034925 P-selectin glycoprotein ligand 1 Human genes 0.000 description 6
- 102100028467 Perforin-1 Human genes 0.000 description 6
- 102100022485 Protein transport protein Sec31B Human genes 0.000 description 6
- 102100033202 Rho guanine nucleotide exchange factor 6 Human genes 0.000 description 6
- OTKJDMGTUTTYMP-ROUUACIJSA-N Safingol ( L-threo-sphinganine) Chemical compound CCCCCCCCCCCCCCC[C@H](O)[C@@H](N)CO OTKJDMGTUTTYMP-ROUUACIJSA-N 0.000 description 6
- 102100024219 T-cell surface glycoprotein CD1a Human genes 0.000 description 6
- 102100034922 T-cell surface glycoprotein CD8 alpha chain Human genes 0.000 description 6
- 102100026749 TOX high mobility group box family member 4 Human genes 0.000 description 6
- GKLVYJBZJHMRIY-OUBTZVSYSA-N Technetium-99 Chemical compound [99Tc] GKLVYJBZJHMRIY-OUBTZVSYSA-N 0.000 description 6
- IVTVGDXNLFLDRM-HNNXBMFYSA-N Tomudex Chemical compound C=1C=C2NC(C)=NC(=O)C2=CC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)S1 IVTVGDXNLFLDRM-HNNXBMFYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 229960001220 amsacrine Drugs 0.000 description 6
- XCPGHVQEEXUHNC-UHFFFAOYSA-N amsacrine Chemical compound COC1=CC(NS(C)(=O)=O)=CC=C1NC1=C(C=CC=C2)C2=NC2=CC=CC=C12 XCPGHVQEEXUHNC-UHFFFAOYSA-N 0.000 description 6
- 229960001561 bleomycin Drugs 0.000 description 6
- 230000008859 change Effects 0.000 description 6
- 229960000640 dactinomycin Drugs 0.000 description 6
- OTKJDMGTUTTYMP-UHFFFAOYSA-N dihydrosphingosine Natural products CCCCCCCCCCCCCCCC(O)C(N)CO OTKJDMGTUTTYMP-UHFFFAOYSA-N 0.000 description 6
- 229960001776 edrecolomab Drugs 0.000 description 6
- LIQODXNTTZAGID-OCBXBXKTSA-N etoposide phosphate Chemical compound COC1=C(OP(O)(O)=O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 LIQODXNTTZAGID-OCBXBXKTSA-N 0.000 description 6
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 6
- 229960001101 ifosfamide Drugs 0.000 description 6
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 6
- GURKHSYORGJETM-WAQYZQTGSA-N irinotecan hydrochloride (anhydrous) Chemical compound Cl.C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 GURKHSYORGJETM-WAQYZQTGSA-N 0.000 description 6
- RGLRXNKKBLIBQS-XNHQSDQCSA-N leuprolide acetate Chemical compound CC(O)=O.CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)CC1=CC=C(O)C=C1 RGLRXNKKBLIBQS-XNHQSDQCSA-N 0.000 description 6
- BLOFGONIVNXZME-YDMGZANHSA-N mannostatin A Chemical compound CS[C@@H]1[C@@H](N)[C@@H](O)[C@@H](O)[C@H]1O BLOFGONIVNXZME-YDMGZANHSA-N 0.000 description 6
- 108090000765 processed proteins & peptides Proteins 0.000 description 6
- 229960004432 raltitrexed Drugs 0.000 description 6
- 229950008902 safingol Drugs 0.000 description 6
- 229950006050 spiromustine Drugs 0.000 description 6
- 229940063683 taxotere Drugs 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 6
- 102100037563 40S ribosomal protein S2 Human genes 0.000 description 5
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 5
- 102100025616 Beta-1,3-N-acetylglucosaminyltransferase manic fringe Human genes 0.000 description 5
- 102100036301 C-C chemokine receptor type 7 Human genes 0.000 description 5
- 102100031650 C-X-C chemokine receptor type 4 Human genes 0.000 description 5
- 101001110283 Canis lupus familiaris Ras-related C3 botulinum toxin substrate 1 Proteins 0.000 description 5
- 102100040792 DNA primase small subunit Human genes 0.000 description 5
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 5
- 101001098029 Homo sapiens 40S ribosomal protein S2 Proteins 0.000 description 5
- 101000575420 Homo sapiens Beta-1,3-N-acetylglucosaminyltransferase manic fringe Proteins 0.000 description 5
- 101000716065 Homo sapiens C-C chemokine receptor type 7 Proteins 0.000 description 5
- 101000922348 Homo sapiens C-X-C chemokine receptor type 4 Proteins 0.000 description 5
- 101000611567 Homo sapiens DNA primase small subunit Proteins 0.000 description 5
- 101001076680 Homo sapiens Insulin-induced gene 1 protein Proteins 0.000 description 5
- 101000972291 Homo sapiens Lymphoid enhancer-binding factor 1 Proteins 0.000 description 5
- 101001043352 Homo sapiens Lysyl oxidase homolog 2 Proteins 0.000 description 5
- 101000974015 Homo sapiens Nucleosome assembly protein 1-like 1 Proteins 0.000 description 5
- 101000600387 Homo sapiens Phosphoglycerate mutase 1 Proteins 0.000 description 5
- 101000600395 Homo sapiens Probable phosphoglycerate mutase 4 Proteins 0.000 description 5
- 101000595907 Homo sapiens Procollagen-lysine,2-oxoglutarate 5-dioxygenase 2 Proteins 0.000 description 5
- 101000892338 Homo sapiens Protein AF1q Proteins 0.000 description 5
- 101000804792 Homo sapiens Protein Wnt-5a Proteins 0.000 description 5
- 101001110313 Homo sapiens Ras-related C3 botulinum toxin substrate 2 Proteins 0.000 description 5
- 101000856696 Homo sapiens Rho GDP-dissociation inhibitor 2 Proteins 0.000 description 5
- 101001081189 Homo sapiens Rho GTPase-activating protein 45 Proteins 0.000 description 5
- 101000936917 Homo sapiens Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Proteins 0.000 description 5
- 101000879840 Homo sapiens Serglycin Proteins 0.000 description 5
- 101000826125 Homo sapiens Single-stranded DNA-binding protein 2 Proteins 0.000 description 5
- 101000701440 Homo sapiens Stanniocalcin-1 Proteins 0.000 description 5
- 101000897407 Homo sapiens T-cell surface glycoprotein CD1e, membrane-associated Proteins 0.000 description 5
- 101000801228 Homo sapiens Tumor necrosis factor receptor superfamily member 1A Proteins 0.000 description 5
- 101000818543 Homo sapiens Tyrosine-protein kinase ZAP-70 Proteins 0.000 description 5
- 101000803403 Homo sapiens Vimentin Proteins 0.000 description 5
- 101000823782 Homo sapiens Y-box-binding protein 3 Proteins 0.000 description 5
- 102100025887 Insulin-induced gene 1 protein Human genes 0.000 description 5
- 102100022699 Lymphoid enhancer-binding factor 1 Human genes 0.000 description 5
- 102100021948 Lysyl oxidase homolog 2 Human genes 0.000 description 5
- 108090001040 Microtubule-associated protein 1B Proteins 0.000 description 5
- 102000004866 Microtubule-associated protein 1B Human genes 0.000 description 5
- 229930192392 Mitomycin Natural products 0.000 description 5
- 102100022389 Nucleosome assembly protein 1-like 1 Human genes 0.000 description 5
- 102100037389 Phosphoglycerate mutase 1 Human genes 0.000 description 5
- 102100030368 Phospholipid phosphatase-related protein type 4 Human genes 0.000 description 5
- 102100035198 Procollagen-lysine,2-oxoglutarate 5-dioxygenase 2 Human genes 0.000 description 5
- 102100040665 Protein AF1q Human genes 0.000 description 5
- 102100028208 Raftlin Human genes 0.000 description 5
- 101710159571 Raftlin Proteins 0.000 description 5
- 102100022129 Ras-related C3 botulinum toxin substrate 2 Human genes 0.000 description 5
- 102100025622 Rho GDP-dissociation inhibitor 2 Human genes 0.000 description 5
- 102100027748 Rho GTPase-activating protein 45 Human genes 0.000 description 5
- 102100027733 Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Human genes 0.000 description 5
- 102100023007 Single-stranded DNA-binding protein 2 Human genes 0.000 description 5
- 102100030511 Stanniocalcin-1 Human genes 0.000 description 5
- 102100021989 T-cell surface glycoprotein CD1e, membrane-associated Human genes 0.000 description 5
- 102100033732 Tumor necrosis factor receptor superfamily member 1A Human genes 0.000 description 5
- 102100021125 Tyrosine-protein kinase ZAP-70 Human genes 0.000 description 5
- 102100035071 Vimentin Human genes 0.000 description 5
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 5
- 102000043366 Wnt-5a Human genes 0.000 description 5
- 102100022221 Y-box-binding protein 3 Human genes 0.000 description 5
- 229950004955 adozelesin Drugs 0.000 description 5
- BYRVKDUQDLJUBX-JJCDCTGGSA-N adozelesin Chemical compound C1=CC=C2OC(C(=O)NC=3C=C4C=C(NC4=CC=3)C(=O)N3C[C@H]4C[C@]44C5=C(C(C=C43)=O)NC=C5C)=CC2=C1 BYRVKDUQDLJUBX-JJCDCTGGSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 230000003247 decreasing effect Effects 0.000 description 5
- WVYXNIXAMZOZFK-UHFFFAOYSA-N diaziquone Chemical compound O=C1C(NC(=O)OCC)=C(N2CC2)C(=O)C(NC(=O)OCC)=C1N1CC1 WVYXNIXAMZOZFK-UHFFFAOYSA-N 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 229930182470 glycoside Natural products 0.000 description 5
- 229940088013 hycamtin Drugs 0.000 description 5
- 238000005259 measurement Methods 0.000 description 5
- 229940098779 methanesulfonic acid Drugs 0.000 description 5
- 229960004857 mitomycin Drugs 0.000 description 5
- 235000018102 proteins Nutrition 0.000 description 5
- 102000004169 proteins and genes Human genes 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 5
- 229960001278 teniposide Drugs 0.000 description 5
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 5
- 229960001099 trimetrexate Drugs 0.000 description 5
- NOYPYLRCIDNJJB-UHFFFAOYSA-N trimetrexate Chemical compound COC1=C(OC)C(OC)=CC(NCC=2C(=C3C(N)=NC(N)=NC3=CC=2)C)=C1 NOYPYLRCIDNJJB-UHFFFAOYSA-N 0.000 description 5
- HZSBSRAVNBUZRA-RQDPQJJXSA-J (1r,2r)-cyclohexane-1,2-diamine;tetrachloroplatinum(2+) Chemical compound Cl[Pt+2](Cl)(Cl)Cl.N[C@@H]1CCCC[C@H]1N HZSBSRAVNBUZRA-RQDPQJJXSA-J 0.000 description 4
- FELGMEQIXOGIFQ-CYBMUJFWSA-N (3r)-9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1h-carbazol-4-one Chemical compound CC1=NC=CN1C[C@@H]1C(=O)C(C=2C(=CC=CC=2)N2C)=C2CC1 FELGMEQIXOGIFQ-CYBMUJFWSA-N 0.000 description 4
- PUDHBTGHUJUUFI-SCTWWAJVSA-N (4r,7s,10s,13r,16s,19r)-10-(4-aminobutyl)-n-[(2s,3r)-1-amino-3-hydroxy-1-oxobutan-2-yl]-19-[[(2r)-2-amino-3-naphthalen-2-ylpropanoyl]amino]-16-[(4-hydroxyphenyl)methyl]-13-(1h-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-7-propan-2-yl-1,2-dithia-5,8,11,14,17-p Chemical compound C([C@H]1C(=O)N[C@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(N[C@@H](CSSC[C@@H](C(=O)N1)NC(=O)[C@H](N)CC=1C=C2C=CC=CC2=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(N)=O)=O)C(C)C)C1=CC=C(O)C=C1 PUDHBTGHUJUUFI-SCTWWAJVSA-N 0.000 description 4
- FONKWHRXTPJODV-DNQXCXABSA-N 1,3-bis[2-[(8s)-8-(chloromethyl)-4-hydroxy-1-methyl-7,8-dihydro-3h-pyrrolo[3,2-e]indole-6-carbonyl]-1h-indol-5-yl]urea Chemical compound C1([C@H](CCl)CN2C(=O)C=3NC4=CC=C(C=C4C=3)NC(=O)NC=3C=C4C=C(NC4=CC=3)C(=O)N3C4=CC(O)=C5NC=C(C5=C4[C@H](CCl)C3)C)=C2C=C(O)C2=C1C(C)=CN2 FONKWHRXTPJODV-DNQXCXABSA-N 0.000 description 4
- QXLQZLBNPTZMRK-UHFFFAOYSA-N 2-[(dimethylamino)methyl]-1-(2,4-dimethylphenyl)prop-2-en-1-one Chemical compound CN(C)CC(=C)C(=O)C1=CC=C(C)C=C1C QXLQZLBNPTZMRK-UHFFFAOYSA-N 0.000 description 4
- 102100030799 28S ribosomal protein S2, mitochondrial Human genes 0.000 description 4
- 102100023216 40S ribosomal protein S15 Human genes 0.000 description 4
- 102100034088 40S ribosomal protein S4, X isoform Human genes 0.000 description 4
- KXBCLNRMQPRVTP-UHFFFAOYSA-N 6-amino-1,5-dihydroimidazo[4,5-c]pyridin-4-one Chemical compound O=C1NC(N)=CC2=C1N=CN2 KXBCLNRMQPRVTP-UHFFFAOYSA-N 0.000 description 4
- 102100040881 60S acidic ribosomal protein P0 Human genes 0.000 description 4
- 102100026112 60S acidic ribosomal protein P2 Human genes 0.000 description 4
- 102100021546 60S ribosomal protein L10 Human genes 0.000 description 4
- 102100025643 60S ribosomal protein L12 Human genes 0.000 description 4
- 102100024442 60S ribosomal protein L13 Human genes 0.000 description 4
- 102100022289 60S ribosomal protein L13a Human genes 0.000 description 4
- 102100032411 60S ribosomal protein L18 Human genes 0.000 description 4
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 4
- 102100039602 ARF GTPase-activating protein GIT2 Human genes 0.000 description 4
- 102100023587 ATP synthase F(0) complex subunit C2, mitochondrial Human genes 0.000 description 4
- 102100025976 Adenosine deaminase 2 Human genes 0.000 description 4
- 102100034033 Alpha-adducin Human genes 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical class NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- 102100026437 Branched-chain-amino-acid aminotransferase, cytosolic Human genes 0.000 description 4
- CIUUIPMOFZIWIZ-UHFFFAOYSA-N Bropirimine Chemical compound NC1=NC(O)=C(Br)C(C=2C=CC=CC=2)=N1 CIUUIPMOFZIWIZ-UHFFFAOYSA-N 0.000 description 4
- 102100027154 Butyrophilin subfamily 3 member A3 Human genes 0.000 description 4
- 102100027207 CD27 antigen Human genes 0.000 description 4
- 102100033210 CUGBP Elav-like family member 2 Human genes 0.000 description 4
- FVLVBPDQNARYJU-XAHDHGMMSA-N C[C@H]1CCC(CC1)NC(=O)N(CCCl)N=O Chemical compound C[C@H]1CCC(CC1)NC(=O)N(CCCl)N=O FVLVBPDQNARYJU-XAHDHGMMSA-N 0.000 description 4
- 102100036338 Calmodulin-like protein 4 Human genes 0.000 description 4
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 4
- 102100032616 Caspase-2 Human genes 0.000 description 4
- ZEOWTGPWHLSLOG-UHFFFAOYSA-N Cc1ccc(cc1-c1ccc2c(n[nH]c2c1)-c1cnn(c1)C1CC1)C(=O)Nc1cccc(c1)C(F)(F)F Chemical compound Cc1ccc(cc1-c1ccc2c(n[nH]c2c1)-c1cnn(c1)C1CC1)C(=O)Nc1cccc(c1)C(F)(F)F ZEOWTGPWHLSLOG-UHFFFAOYSA-N 0.000 description 4
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 4
- 102100035594 Cohesin subunit SA-3 Human genes 0.000 description 4
- 102100035432 Complement factor H Human genes 0.000 description 4
- 108010043471 Core Binding Factor Alpha 2 Subunit Proteins 0.000 description 4
- 102100028183 Cytohesin-interacting protein Human genes 0.000 description 4
- 102100028629 Cytoskeleton-associated protein 4 Human genes 0.000 description 4
- 102100034001 DNA replication licensing factor MCM5 Human genes 0.000 description 4
- 102100032881 DNA-binding protein SATB1 Human genes 0.000 description 4
- WEAHRLBPCANXCN-UHFFFAOYSA-N Daunomycin Natural products CCC1(O)CC(OC2CC(N)C(O)C(C)O2)c3cc4C(=O)c5c(OC)cccc5C(=O)c4c(O)c3C1 WEAHRLBPCANXCN-UHFFFAOYSA-N 0.000 description 4
- 102100032501 Death-inducer obliterator 1 Human genes 0.000 description 4
- 102100034690 Delta(14)-sterol reductase LBR Human genes 0.000 description 4
- 102100024425 Dihydropyrimidinase-related protein 3 Human genes 0.000 description 4
- 102100028952 Drebrin Human genes 0.000 description 4
- ZQZFYGIXNQKOAV-OCEACIFDSA-N Droloxifene Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=C(O)C=CC=1)\C1=CC=C(OCCN(C)C)C=C1 ZQZFYGIXNQKOAV-OCEACIFDSA-N 0.000 description 4
- 102100037573 Dual specificity protein phosphatase 12 Human genes 0.000 description 4
- 102100034597 E3 ubiquitin-protein ligase TRIM22 Human genes 0.000 description 4
- 102100032020 EH domain-containing protein 2 Human genes 0.000 description 4
- 102100020865 EKC/KEOPS complex subunit LAGE3 Human genes 0.000 description 4
- 102100029055 Exostosin-1 Human genes 0.000 description 4
- 102100040130 FH1/FH2 domain-containing protein 1 Human genes 0.000 description 4
- 102100023593 Fibroblast growth factor receptor 1 Human genes 0.000 description 4
- 101710182386 Fibroblast growth factor receptor 1 Proteins 0.000 description 4
- 101001067614 Flaveria pringlei Serine hydroxymethyltransferase 2, mitochondrial Proteins 0.000 description 4
- 102100020848 Forkhead box protein F2 Human genes 0.000 description 4
- 102100037488 G2 and S phase-expressed protein 1 Human genes 0.000 description 4
- 102100035391 GATOR complex protein WDR59 Human genes 0.000 description 4
- 102100022898 Galactoside-binding soluble lectin 13 Human genes 0.000 description 4
- 108010001498 Galectin 1 Proteins 0.000 description 4
- 102100021736 Galectin-1 Human genes 0.000 description 4
- 102100021337 Gap junction alpha-1 protein Human genes 0.000 description 4
- 102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 description 4
- 102100025334 Guanine nucleotide-binding protein G(q) subunit alpha Human genes 0.000 description 4
- 102100035621 Heterogeneous nuclear ribonucleoprotein A1 Human genes 0.000 description 4
- 102100033985 Heterogeneous nuclear ribonucleoprotein D0 Human genes 0.000 description 4
- 102100034533 Histone H2AX Human genes 0.000 description 4
- 102100038970 Histone-lysine N-methyltransferase EZH2 Human genes 0.000 description 4
- 101000636137 Homo sapiens 28S ribosomal protein S2, mitochondrial Proteins 0.000 description 4
- 101000691550 Homo sapiens 39S ribosomal protein L13, mitochondrial Proteins 0.000 description 4
- 101000623543 Homo sapiens 40S ribosomal protein S15 Proteins 0.000 description 4
- 101000732165 Homo sapiens 40S ribosomal protein S4, X isoform Proteins 0.000 description 4
- 101000673456 Homo sapiens 60S acidic ribosomal protein P0 Proteins 0.000 description 4
- 101000691878 Homo sapiens 60S acidic ribosomal protein P2 Proteins 0.000 description 4
- 101001108634 Homo sapiens 60S ribosomal protein L10 Proteins 0.000 description 4
- 101000575173 Homo sapiens 60S ribosomal protein L12 Proteins 0.000 description 4
- 101001118201 Homo sapiens 60S ribosomal protein L13 Proteins 0.000 description 4
- 101000681240 Homo sapiens 60S ribosomal protein L13a Proteins 0.000 description 4
- 101001117935 Homo sapiens 60S ribosomal protein L15 Proteins 0.000 description 4
- 101001087985 Homo sapiens 60S ribosomal protein L18 Proteins 0.000 description 4
- 101000888642 Homo sapiens ARF GTPase-activating protein GIT2 Proteins 0.000 description 4
- 101000905797 Homo sapiens ATP synthase F(0) complex subunit C2, mitochondrial Proteins 0.000 description 4
- 101000720051 Homo sapiens Adenosine deaminase 2 Proteins 0.000 description 4
- 101000799076 Homo sapiens Alpha-adducin Proteins 0.000 description 4
- 101000766268 Homo sapiens Branched-chain-amino-acid aminotransferase, cytosolic Proteins 0.000 description 4
- 101000984916 Homo sapiens Butyrophilin subfamily 3 member A3 Proteins 0.000 description 4
- 101000914511 Homo sapiens CD27 antigen Proteins 0.000 description 4
- 101000944442 Homo sapiens CUGBP Elav-like family member 2 Proteins 0.000 description 4
- 101000714684 Homo sapiens Calmodulin-like protein 4 Proteins 0.000 description 4
- 101000867612 Homo sapiens Caspase-2 Proteins 0.000 description 4
- 101000642965 Homo sapiens Cohesin subunit SA-3 Proteins 0.000 description 4
- 101000737574 Homo sapiens Complement factor H Proteins 0.000 description 4
- 101000916686 Homo sapiens Cytohesin-interacting protein Proteins 0.000 description 4
- 101000766853 Homo sapiens Cytoskeleton-associated protein 4 Proteins 0.000 description 4
- 101001017545 Homo sapiens DNA replication licensing factor MCM5 Proteins 0.000 description 4
- 101000655234 Homo sapiens DNA-binding protein SATB1 Proteins 0.000 description 4
- 101000869896 Homo sapiens Death-inducer obliterator 1 Proteins 0.000 description 4
- 101000945982 Homo sapiens Delta(14)-sterol reductase LBR Proteins 0.000 description 4
- 101001053501 Homo sapiens Dihydropyrimidinase-related protein 3 Proteins 0.000 description 4
- 101000838600 Homo sapiens Drebrin Proteins 0.000 description 4
- 101000924017 Homo sapiens Dual specificity protein phosphatase 1 Proteins 0.000 description 4
- 101000881110 Homo sapiens Dual specificity protein phosphatase 12 Proteins 0.000 description 4
- 101000848629 Homo sapiens E3 ubiquitin-protein ligase TRIM22 Proteins 0.000 description 4
- 101000921226 Homo sapiens EH domain-containing protein 2 Proteins 0.000 description 4
- 101001137983 Homo sapiens EKC/KEOPS complex subunit LAGE3 Proteins 0.000 description 4
- 101000918311 Homo sapiens Exostosin-1 Proteins 0.000 description 4
- 101000890761 Homo sapiens FH1/FH2 domain-containing protein 1 Proteins 0.000 description 4
- 101000931482 Homo sapiens Forkhead box protein F2 Proteins 0.000 description 4
- 101001031607 Homo sapiens Four and a half LIM domains protein 1 Proteins 0.000 description 4
- 101001026457 Homo sapiens G2 and S phase-expressed protein 1 Proteins 0.000 description 4
- 101000803767 Homo sapiens GATOR complex protein WDR59 Proteins 0.000 description 4
- 101000620927 Homo sapiens Galactoside-binding soluble lectin 13 Proteins 0.000 description 4
- 101000894966 Homo sapiens Gap junction alpha-1 protein Proteins 0.000 description 4
- 101000857888 Homo sapiens Guanine nucleotide-binding protein G(q) subunit alpha Proteins 0.000 description 4
- 101000854014 Homo sapiens Heterogeneous nuclear ribonucleoprotein A1 Proteins 0.000 description 4
- 101001017535 Homo sapiens Heterogeneous nuclear ribonucleoprotein D0 Proteins 0.000 description 4
- 101001067891 Homo sapiens Histone H2AX Proteins 0.000 description 4
- 101000882127 Homo sapiens Histone-lysine N-methyltransferase EZH2 Proteins 0.000 description 4
- 101000852486 Homo sapiens Inositol 1,4,5-triphosphate receptor associated 2 Proteins 0.000 description 4
- 101000994369 Homo sapiens Integrin alpha-5 Proteins 0.000 description 4
- 101000599858 Homo sapiens Intercellular adhesion molecule 2 Proteins 0.000 description 4
- 101000840293 Homo sapiens Interferon-induced protein 44 Proteins 0.000 description 4
- 101001034842 Homo sapiens Interferon-induced transmembrane protein 2 Proteins 0.000 description 4
- 101000599048 Homo sapiens Interleukin-6 receptor subunit alpha Proteins 0.000 description 4
- 101001010513 Homo sapiens Leukocyte elastase inhibitor Proteins 0.000 description 4
- 101001065658 Homo sapiens Leukocyte-specific transcript 1 protein Proteins 0.000 description 4
- 101000942133 Homo sapiens Leupaxin Proteins 0.000 description 4
- 101000987094 Homo sapiens Moesin Proteins 0.000 description 4
- 101000603202 Homo sapiens Nicotinamide N-methyltransferase Proteins 0.000 description 4
- 101000598100 Homo sapiens Nuclear migration protein nudC Proteins 0.000 description 4
- 101000991533 Homo sapiens Nuclear valosin-containing protein-like Proteins 0.000 description 4
- 101001128732 Homo sapiens Nucleoside diphosphate kinase 7 Proteins 0.000 description 4
- 101001112313 Homo sapiens Nucleoside diphosphate kinase, mitochondrial Proteins 0.000 description 4
- 101000691480 Homo sapiens Placenta-specific gene 8 protein Proteins 0.000 description 4
- 101000915002 Homo sapiens Probable C-mannosyltransferase DPY19L1 Proteins 0.000 description 4
- 101000577619 Homo sapiens Profilin-1 Proteins 0.000 description 4
- 101001098982 Homo sapiens Propionyl-CoA carboxylase beta chain, mitochondrial Proteins 0.000 description 4
- 101001117509 Homo sapiens Prostaglandin E2 receptor EP4 subtype Proteins 0.000 description 4
- 101000705759 Homo sapiens Proteasome activator complex subunit 2 Proteins 0.000 description 4
- 101001136981 Homo sapiens Proteasome subunit beta type-9 Proteins 0.000 description 4
- 101001057166 Homo sapiens Protein EVI2A Proteins 0.000 description 4
- 101000835295 Homo sapiens Protein THEMIS2 Proteins 0.000 description 4
- 101000775749 Homo sapiens Proto-oncogene vav Proteins 0.000 description 4
- 101000979900 Homo sapiens Putative methyltransferase NSUN5C Proteins 0.000 description 4
- 101001074555 Homo sapiens Regulating synaptic membrane exocytosis protein 3 Proteins 0.000 description 4
- 101000575639 Homo sapiens Ribonucleoside-diphosphate reductase subunit M2 Proteins 0.000 description 4
- 101000974043 Homo sapiens Ribosome biogenesis protein NOP53 Proteins 0.000 description 4
- 101001067604 Homo sapiens Serine hydroxymethyltransferase, mitochondrial Proteins 0.000 description 4
- 101000587442 Homo sapiens Serine/arginine-rich splicing factor 6 Proteins 0.000 description 4
- 101000684820 Homo sapiens Sodium channel protein type 3 subunit alpha Proteins 0.000 description 4
- 101000633700 Homo sapiens Src kinase-associated phosphoprotein 1 Proteins 0.000 description 4
- 101000831927 Homo sapiens Stomatin-like protein 2, mitochondrial Proteins 0.000 description 4
- 101000716124 Homo sapiens T-cell surface glycoprotein CD1c Proteins 0.000 description 4
- 101000648534 Homo sapiens Transmembrane 6 superfamily member 1 Proteins 0.000 description 4
- 101000838456 Homo sapiens Tubulin alpha-1B chain Proteins 0.000 description 4
- 101000610604 Homo sapiens Tumor necrosis factor receptor superfamily member 10B Proteins 0.000 description 4
- 101000823316 Homo sapiens Tyrosine-protein kinase ABL1 Proteins 0.000 description 4
- 101001047681 Homo sapiens Tyrosine-protein kinase Lck Proteins 0.000 description 4
- 101000617779 Homo sapiens U1 small nuclear ribonucleoprotein A Proteins 0.000 description 4
- 101000671855 Homo sapiens Ubiquitin-associated and SH3 domain-containing protein A Proteins 0.000 description 4
- 101000841505 Homo sapiens Uridine-cytidine kinase 2 Proteins 0.000 description 4
- 101000916547 Homo sapiens Zinc finger and BTB domain-containing protein 38 Proteins 0.000 description 4
- 101000976443 Homo sapiens Zinc finger protein 593 Proteins 0.000 description 4
- 102000026633 IL6 Human genes 0.000 description 4
- 102100036343 Inositol 1,4,5-triphosphate receptor associated 2 Human genes 0.000 description 4
- 102100032817 Integrin alpha-5 Human genes 0.000 description 4
- 102100037872 Intercellular adhesion molecule 2 Human genes 0.000 description 4
- 102100029607 Interferon-induced protein 44 Human genes 0.000 description 4
- 102100040020 Interferon-induced transmembrane protein 2 Human genes 0.000 description 4
- 102100037792 Interleukin-6 receptor subunit alpha Human genes 0.000 description 4
- 102100030635 Leukocyte elastase inhibitor Human genes 0.000 description 4
- 102100032755 Leupaxin Human genes 0.000 description 4
- 229930126263 Maytansine Natural products 0.000 description 4
- 102100027869 Moesin Human genes 0.000 description 4
- LYPFDBRUNKHDGX-SOGSVHMOSA-N N1C2=CC=C1\C(=C1\C=CC(=N1)\C(=C1\C=C/C(/N1)=C(/C1=N/C(/CC1)=C2/C1=CC(O)=CC=C1)C1=CC(O)=CC=C1)\C1=CC(O)=CC=C1)C1=CC(O)=CC=C1 Chemical compound N1C2=CC=C1\C(=C1\C=CC(=N1)\C(=C1\C=C/C(/N1)=C(/C1=N/C(/CC1)=C2/C1=CC(O)=CC=C1)C1=CC(O)=CC=C1)\C1=CC(O)=CC=C1)C1=CC(O)=CC=C1 LYPFDBRUNKHDGX-SOGSVHMOSA-N 0.000 description 4
- 102100023181 Neurogenic locus notch homolog protein 1 Human genes 0.000 description 4
- 102100038951 Nicotinamide N-methyltransferase Human genes 0.000 description 4
- 108010029755 Notch1 Receptor Proteins 0.000 description 4
- 102100036965 Nuclear migration protein nudC Human genes 0.000 description 4
- 102100030921 Nuclear valosin-containing protein-like Human genes 0.000 description 4
- 102100032115 Nucleoside diphosphate kinase 7 Human genes 0.000 description 4
- 102100023609 Nucleoside diphosphate kinase, mitochondrial Human genes 0.000 description 4
- 240000007594 Oryza sativa Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- 101000921214 Oryza sativa subsp. japonica Protein EARLY HEADING DATE 2 Proteins 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 102000002808 Pituitary adenylate cyclase-activating polypeptide Human genes 0.000 description 4
- 108010004684 Pituitary adenylate cyclase-activating polypeptide Proteins 0.000 description 4
- 102100028693 Probable C-mannosyltransferase DPY19L1 Human genes 0.000 description 4
- 102100028857 Profilin-1 Human genes 0.000 description 4
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 4
- 102100039025 Propionyl-CoA carboxylase beta chain, mitochondrial Human genes 0.000 description 4
- 102100024450 Prostaglandin E2 receptor EP4 subtype Human genes 0.000 description 4
- 102100031299 Proteasome activator complex subunit 2 Human genes 0.000 description 4
- 102100035764 Proteasome subunit beta type-9 Human genes 0.000 description 4
- 102100027246 Protein EVI2A Human genes 0.000 description 4
- 102000003923 Protein Kinase C Human genes 0.000 description 4
- 108090000315 Protein Kinase C Proteins 0.000 description 4
- 102100026110 Protein THEMIS2 Human genes 0.000 description 4
- 102100032190 Proto-oncogene vav Human genes 0.000 description 4
- 102100024551 Putative methyltransferase NSUN5C Human genes 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 101000629598 Rattus norvegicus Sterol regulatory element-binding protein 1 Proteins 0.000 description 4
- 102100036261 Regulating synaptic membrane exocytosis protein 3 Human genes 0.000 description 4
- 102100026006 Ribonucleoside-diphosphate reductase subunit M2 Human genes 0.000 description 4
- 102100022399 Ribosome biogenesis protein NOP53 Human genes 0.000 description 4
- 102100025373 Runt-related transcription factor 1 Human genes 0.000 description 4
- 102100034606 Serine hydroxymethyltransferase, mitochondrial Human genes 0.000 description 4
- 102100029710 Serine/arginine-rich splicing factor 6 Human genes 0.000 description 4
- 102100023720 Sodium channel protein type 3 subunit alpha Human genes 0.000 description 4
- 102100027233 Solute carrier organic anion transporter family member 1B1 Human genes 0.000 description 4
- 102100029208 Src kinase-associated phosphoprotein 1 Human genes 0.000 description 4
- 102100024172 Stomatin-like protein 2, mitochondrial Human genes 0.000 description 4
- 102100025237 T-cell surface antigen CD2 Human genes 0.000 description 4
- 102100036014 T-cell surface glycoprotein CD1c Human genes 0.000 description 4
- 108010032166 TARP Proteins 0.000 description 4
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 4
- 102000036693 Thrombopoietin Human genes 0.000 description 4
- 108010041111 Thrombopoietin Proteins 0.000 description 4
- 102100030951 Tissue factor pathway inhibitor Human genes 0.000 description 4
- 108010068068 Transcription Factor TFIIIA Proteins 0.000 description 4
- 102100028509 Transcription factor IIIA Human genes 0.000 description 4
- 102100028864 Transmembrane 6 superfamily member 1 Human genes 0.000 description 4
- 102100028969 Tubulin alpha-1B chain Human genes 0.000 description 4
- 102100040112 Tumor necrosis factor receptor superfamily member 10B Human genes 0.000 description 4
- 102100022596 Tyrosine-protein kinase ABL1 Human genes 0.000 description 4
- 102100024036 Tyrosine-protein kinase Lck Human genes 0.000 description 4
- 102100022013 U1 small nuclear ribonucleoprotein A Human genes 0.000 description 4
- 102100040337 Ubiquitin-associated and SH3 domain-containing protein A Human genes 0.000 description 4
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 4
- 102100029150 Uridine-cytidine kinase 2 Human genes 0.000 description 4
- 102100028125 Zinc finger and BTB domain-containing protein 38 Human genes 0.000 description 4
- 102100023638 Zinc finger protein 593 Human genes 0.000 description 4
- ODEDPKNSRBCSDO-UHFFFAOYSA-N [2-(hexadecylsulfanylmethyl)-3-methoxypropyl] 2-(trimethylazaniumyl)ethyl phosphate Chemical compound CCCCCCCCCCCCCCCCSCC(COC)COP([O-])(=O)OCC[N+](C)(C)C ODEDPKNSRBCSDO-UHFFFAOYSA-N 0.000 description 4
- 238000002835 absorbance Methods 0.000 description 4
- SMPZPKRDRQOOHT-UHFFFAOYSA-N acronycine Chemical compound CN1C2=CC=CC=C2C(=O)C2=C1C(C=CC(C)(C)O1)=C1C=C2OC SMPZPKRDRQOOHT-UHFFFAOYSA-N 0.000 description 4
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 4
- 108700025316 aldesleukin Proteins 0.000 description 4
- 229960005310 aldesleukin Drugs 0.000 description 4
- 229960000473 altretamine Drugs 0.000 description 4
- 229960002932 anastrozole Drugs 0.000 description 4
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 4
- 229940045985 antineoplastic platinum compound Drugs 0.000 description 4
- XFILPEOLDIKJHX-QYZOEREBSA-N batimastat Chemical compound C([C@@H](C(=O)NC)NC(=O)[C@H](CC(C)C)[C@H](CSC=1SC=CC=1)C(=O)NO)C1=CC=CC=C1 XFILPEOLDIKJHX-QYZOEREBSA-N 0.000 description 4
- 229950001858 batimastat Drugs 0.000 description 4
- 229950008548 bisantrene Drugs 0.000 description 4
- 229950006844 bizelesin Drugs 0.000 description 4
- 229950009494 bropirimine Drugs 0.000 description 4
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 4
- 230000010261 cell growth Effects 0.000 description 4
- 210000002421 cell wall Anatomy 0.000 description 4
- TVFDJXOCXUVLDH-RNFDNDRNSA-N cesium-137 Chemical compound [137Cs] TVFDJXOCXUVLDH-RNFDNDRNSA-N 0.000 description 4
- HZCWPKGYTCJSEB-UHFFFAOYSA-N chembl118841 Chemical compound C12=CC(OC)=CC=C2NC2=C([N+]([O-])=O)C=CC3=C2C1=NN3CCCN(C)C HZCWPKGYTCJSEB-UHFFFAOYSA-N 0.000 description 4
- NQGMIPUYCWIEAW-OVCLIPMQSA-N chembl1834105 Chemical compound O/N=C/C1=C(SC)C(OC)=CC(C=2N=CC=CC=2)=N1 NQGMIPUYCWIEAW-OVCLIPMQSA-N 0.000 description 4
- 229960004630 chlorambucil Drugs 0.000 description 4
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 4
- 229960002436 cladribine Drugs 0.000 description 4
- SBRXTSOCZITGQG-UHFFFAOYSA-N crisnatol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 SBRXTSOCZITGQG-UHFFFAOYSA-N 0.000 description 4
- 229950007258 crisnatol Drugs 0.000 description 4
- PSNOPSMXOBPNNV-VVCTWANISA-N cryptophycin 1 Chemical compound C1=C(Cl)C(OC)=CC=C1C[C@@H]1C(=O)NC[C@@H](C)C(=O)O[C@@H](CC(C)C)C(=O)O[C@H]([C@H](C)[C@@H]2[C@H](O2)C=2C=CC=CC=2)C/C=C/C(=O)N1 PSNOPSMXOBPNNV-VVCTWANISA-N 0.000 description 4
- PSNOPSMXOBPNNV-UHFFFAOYSA-N cryptophycin-327 Natural products C1=C(Cl)C(OC)=CC=C1CC1C(=O)NCC(C)C(=O)OC(CC(C)C)C(=O)OC(C(C)C2C(O2)C=2C=CC=CC=2)CC=CC(=O)N1 PSNOPSMXOBPNNV-UHFFFAOYSA-N 0.000 description 4
- 229960003901 dacarbazine Drugs 0.000 description 4
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 4
- 229950010621 dezaguanine Drugs 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- NOPFSRXAKWQILS-UHFFFAOYSA-N docosan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCO NOPFSRXAKWQILS-UHFFFAOYSA-N 0.000 description 4
- 229950004203 droloxifene Drugs 0.000 description 4
- CTSPAMFJBXKSOY-UHFFFAOYSA-N ellipticine Chemical compound N1=CC=C2C(C)=C(NC=3C4=CC=CC=3)C4=C(C)C2=C1 CTSPAMFJBXKSOY-UHFFFAOYSA-N 0.000 description 4
- FRPJXPJMRWBBIH-RBRWEJTLSA-N estramustine Chemical compound ClCCN(CCCl)C(=O)OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 FRPJXPJMRWBBIH-RBRWEJTLSA-N 0.000 description 4
- 229940011871 estrogen Drugs 0.000 description 4
- 239000000262 estrogen Substances 0.000 description 4
- 229950006566 etanidazole Drugs 0.000 description 4
- WCDWBPCFGJXFJZ-UHFFFAOYSA-N etanidazole Chemical compound OCCNC(=O)CN1C=CN=C1[N+]([O-])=O WCDWBPCFGJXFJZ-UHFFFAOYSA-N 0.000 description 4
- 229960000752 etoposide phosphate Drugs 0.000 description 4
- NMUSYJAQQFHJEW-ARQDHWQXSA-N fazarabine Chemical compound O=C1N=C(N)N=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 NMUSYJAQQFHJEW-ARQDHWQXSA-N 0.000 description 4
- 229950005096 fazarabine Drugs 0.000 description 4
- 229960000390 fludarabine Drugs 0.000 description 4
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 4
- YAKWPXVTIGTRJH-UHFFFAOYSA-N fotemustine Chemical compound CCOP(=O)(OCC)C(C)NC(=O)N(CCCl)N=O YAKWPXVTIGTRJH-UHFFFAOYSA-N 0.000 description 4
- 229960004783 fotemustine Drugs 0.000 description 4
- 150000002338 glycosides Chemical class 0.000 description 4
- UUVWYPNAQBNQJQ-UHFFFAOYSA-N hexamethylmelamine Chemical compound CN(C)C1=NC(N(C)C)=NC(N(C)C)=N1 UUVWYPNAQBNQJQ-UHFFFAOYSA-N 0.000 description 4
- HYFHYPWGAURHIV-UHFFFAOYSA-N homoharringtonine Natural products C1=C2CCN3CCCC43C=C(OC)C(OC(=O)C(O)(CCCC(C)(C)O)CC(=O)OC)C4C2=CC2=C1OCO2 HYFHYPWGAURHIV-UHFFFAOYSA-N 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical compound O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 description 4
- 229950006905 ilmofosine Drugs 0.000 description 4
- 108010021336 lanreotide Proteins 0.000 description 4
- 229960002437 lanreotide Drugs 0.000 description 4
- 229960003881 letrozole Drugs 0.000 description 4
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 description 4
- 229960004338 leuprorelin Drugs 0.000 description 4
- 108010013555 lipoprotein-associated coagulation inhibitor Proteins 0.000 description 4
- YROQEQPFUCPDCP-UHFFFAOYSA-N losoxantrone Chemical compound OCCNCCN1N=C2C3=CC=CC(O)=C3C(=O)C3=C2C1=CC=C3NCCNCCO YROQEQPFUCPDCP-UHFFFAOYSA-N 0.000 description 4
- 229950008745 losoxantrone Drugs 0.000 description 4
- 229950001474 maitansine Drugs 0.000 description 4
- WKPWGQKGSOKKOO-RSFHAFMBSA-N maytansine Chemical compound CO[C@@H]([C@@]1(O)C[C@](OC(=O)N1)([C@H]([C@@H]1O[C@@]1(C)[C@@H](OC(=O)[C@H](C)N(C)C(C)=O)CC(=O)N1C)C)[H])\C=C\C=C(C)\CC2=CC(OC)=C(Cl)C1=C2 WKPWGQKGSOKKOO-RSFHAFMBSA-N 0.000 description 4
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 4
- 229960001924 melphalan Drugs 0.000 description 4
- LWYJUZBXGAFFLP-OCNCTQISSA-N menogaril Chemical compound O1[C@@]2(C)[C@H](O)[C@@H](N(C)C)[C@H](O)[C@@H]1OC1=C3C(=O)C(C=C4C[C@@](C)(O)C[C@H](C4=C4O)OC)=C4C(=O)C3=C(O)C=C12 LWYJUZBXGAFFLP-OCNCTQISSA-N 0.000 description 4
- 229950002676 menogaril Drugs 0.000 description 4
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 4
- CFCUWKMKBJTWLW-BKHRDMLASA-N mithramycin Chemical compound O([C@@H]1C[C@@H](O[C@H](C)[C@H]1O)OC=1C=C2C=C3C[C@H]([C@@H](C(=O)C3=C(O)C2=C(O)C=1C)O[C@@H]1O[C@H](C)[C@@H](O)[C@H](O[C@@H]2O[C@H](C)[C@H](O)[C@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@@](C)(O)C3)C2)C1)[C@H](OC)C(=O)[C@@H](O)[C@@H](C)O)[C@H]1C[C@@H](O)[C@H](O)[C@@H](C)O1 CFCUWKMKBJTWLW-BKHRDMLASA-N 0.000 description 4
- NJSMWLQOCQIOPE-OCHFTUDZSA-N n-[(e)-[10-[(e)-(4,5-dihydro-1h-imidazol-2-ylhydrazinylidene)methyl]anthracen-9-yl]methylideneamino]-4,5-dihydro-1h-imidazol-2-amine Chemical compound N1CCN=C1N\N=C\C(C1=CC=CC=C11)=C(C=CC=C2)C2=C1\C=N\NC1=NCCN1 NJSMWLQOCQIOPE-OCHFTUDZSA-N 0.000 description 4
- NJHLGKJQFKUSEA-UHFFFAOYSA-N n-[2-(4-hydroxyphenyl)ethyl]-n-methylnitrous amide Chemical compound O=NN(C)CCC1=CC=C(O)C=C1 NJHLGKJQFKUSEA-UHFFFAOYSA-N 0.000 description 4
- XBGNERSKEKDZDS-UHFFFAOYSA-N n-[2-(dimethylamino)ethyl]acridine-4-carboxamide Chemical compound C1=CC=C2N=C3C(C(=O)NCCN(C)C)=CC=CC3=CC2=C1 XBGNERSKEKDZDS-UHFFFAOYSA-N 0.000 description 4
- 229960002230 omacetaxine mepesuccinate Drugs 0.000 description 4
- HYFHYPWGAURHIV-JFIAXGOJSA-N omacetaxine mepesuccinate Chemical compound C1=C2CCN3CCC[C@]43C=C(OC)[C@@H](OC(=O)[C@@](O)(CCCC(C)(C)O)CC(=O)OC)[C@H]4C2=CC2=C1OCO2 HYFHYPWGAURHIV-JFIAXGOJSA-N 0.000 description 4
- 229960005343 ondansetron Drugs 0.000 description 4
- 229950008017 ormaplatin Drugs 0.000 description 4
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 4
- 229960001756 oxaliplatin Drugs 0.000 description 4
- 229960001744 pegaspargase Drugs 0.000 description 4
- 108010001564 pegaspargase Proteins 0.000 description 4
- VPAWVRUHMJVRHU-VGDKGRGNSA-N perfosfamide Chemical compound OO[C@@H]1CCO[P@@](=O)(N(CCCl)CCCl)N1 VPAWVRUHMJVRHU-VGDKGRGNSA-N 0.000 description 4
- 229950009351 perfosfamide Drugs 0.000 description 4
- NDTYTMIUWGWIMO-UHFFFAOYSA-N perillyl alcohol Chemical compound CC(=C)C1CCC(CO)=CC1 NDTYTMIUWGWIMO-UHFFFAOYSA-N 0.000 description 4
- 150000003058 platinum compounds Chemical class 0.000 description 4
- 229960003171 plicamycin Drugs 0.000 description 4
- RXWNCPJZOCPEPQ-NVWDDTSBSA-N puromycin Chemical compound C1=CC(OC)=CC=C1C[C@H](N)C(=O)N[C@H]1[C@@H](O)[C@H](N2C3=NC=NC(=C3N=C2)N(C)C)O[C@@H]1CO RXWNCPJZOCPEPQ-NVWDDTSBSA-N 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- QXKJWHWUDVQATH-UHFFFAOYSA-N rogletimide Chemical compound C=1C=NC=CC=1C1(CC)CCC(=O)NC1=O QXKJWHWUDVQATH-UHFFFAOYSA-N 0.000 description 4
- 229950005230 rogletimide Drugs 0.000 description 4
- MOCVYVBNJQIVOV-TVQRCGJNSA-N rohitukine Chemical compound O[C@@H]1CN(C)CC[C@@H]1C1=C(O)C=C(O)C2=C1OC(C)=CC2=O MOCVYVBNJQIVOV-TVQRCGJNSA-N 0.000 description 4
- CGFVUVWMYIHGHS-UHFFFAOYSA-N saintopin Chemical compound C1=C(O)C=C2C=C(C(=O)C=3C(=C(O)C=C(C=3)O)C3=O)C3=C(O)C2=C1O CGFVUVWMYIHGHS-UHFFFAOYSA-N 0.000 description 4
- 229960003440 semustine Drugs 0.000 description 4
- 230000019491 signal transduction Effects 0.000 description 4
- XBUIKNRVGYFSHL-IAVQPKKASA-M sodium;[(1e,3r,4r,6r,7z,9z,11e)-3,6,13-trihydroxy-3-methyl-1-[(2r)-6-oxo-2,3-dihydropyran-2-yl]trideca-1,7,9,11-tetraen-4-yl] hydrogen phosphate Chemical compound [Na+].OC/C=C/C=C\C=C/[C@H](O)C[C@@H](OP(O)([O-])=O)[C@@](O)(C)\C=C\[C@H]1CC=CC(=O)O1 XBUIKNRVGYFSHL-IAVQPKKASA-M 0.000 description 4
- PFNFFQXMRSDOHW-UHFFFAOYSA-N spermine Chemical compound NCCCNCCCCNCCCN PFNFFQXMRSDOHW-UHFFFAOYSA-N 0.000 description 4
- 229960001052 streptozocin Drugs 0.000 description 4
- ZSJLQEPLLKMAKR-GKHCUFPYSA-N streptozocin Chemical compound O=NN(C)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O ZSJLQEPLLKMAKR-GKHCUFPYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 229940056501 technetium 99m Drugs 0.000 description 4
- 229960001674 tegafur Drugs 0.000 description 4
- WFWLQNSHRPWKFK-ZCFIWIBFSA-N tegafur Chemical compound O=C1NC(=O)C(F)=CN1[C@@H]1OCCC1 WFWLQNSHRPWKFK-ZCFIWIBFSA-N 0.000 description 4
- 229960002197 temoporfin Drugs 0.000 description 4
- 238000002560 therapeutic procedure Methods 0.000 description 4
- 229960001196 thiotepa Drugs 0.000 description 4
- LKJPYSCBVHEWIU-KRWDZBQOSA-N (R)-bicalutamide Chemical compound C([C@@](O)(C)C(=O)NC=1C=C(C(C#N)=CC=1)C(F)(F)F)S(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-KRWDZBQOSA-N 0.000 description 3
- SVJQCVOKYJWUBC-OWOJBTEDSA-N (e)-3-(2,3,4,5-tetrabromophenyl)prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC(Br)=C(Br)C(Br)=C1Br SVJQCVOKYJWUBC-OWOJBTEDSA-N 0.000 description 3
- PJOHVEQSYPOERL-SHEAVXILSA-N (e)-n-[(4r,4as,7ar,12br)-3-(cyclopropylmethyl)-9-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1h-4,12-methanobenzofuro[3,2-e]isoquinoline-4a-yl]-3-(4-methylphenyl)prop-2-enamide Chemical compound C1=CC(C)=CC=C1\C=C\C(=O)N[C@]1(CCC(=O)[C@@H]2O3)[C@H]4CC5=CC=C(O)C3=C5[C@]12CCN4CC1CC1 PJOHVEQSYPOERL-SHEAVXILSA-N 0.000 description 3
- CDKIEBFIMCSCBB-UHFFFAOYSA-N 1-(6,7-dimethoxy-3,4-dihydro-1h-isoquinolin-2-yl)-3-(1-methyl-2-phenylpyrrolo[2,3-b]pyridin-3-yl)prop-2-en-1-one;hydrochloride Chemical compound Cl.C1C=2C=C(OC)C(OC)=CC=2CCN1C(=O)C=CC(C1=CC=CN=C1N1C)=C1C1=CC=CC=C1 CDKIEBFIMCSCBB-UHFFFAOYSA-N 0.000 description 3
- 102100030390 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Human genes 0.000 description 3
- 102100040458 2',3'-cyclic-nucleotide 3'-phosphodiesterase Human genes 0.000 description 3
- 102100029510 26S proteasome regulatory subunit 6A Human genes 0.000 description 3
- 102100021565 28S rRNA (cytosine-C(5))-methyltransferase Human genes 0.000 description 3
- CLPFFLWZZBQMAO-UHFFFAOYSA-N 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)benzonitrile Chemical compound C1=CC(C#N)=CC=C1C1N2C=NC=C2CCC1 CLPFFLWZZBQMAO-UHFFFAOYSA-N 0.000 description 3
- AKJHMTWEGVYYSE-AIRMAKDCSA-N 4-HPR Chemical compound C=1C=C(O)C=CC=1NC(=O)/C=C(\C)/C=C/C=C(C)C=CC1=C(C)CCCC1(C)C AKJHMTWEGVYYSE-AIRMAKDCSA-N 0.000 description 3
- CBVRSAWYUWTDDH-UHFFFAOYSA-N 4-bicyclo[2.2.1]hept-2-enyl(trimethoxy)silane Chemical compound C1CC2C=CC1([Si](OC)(OC)OC)C2 CBVRSAWYUWTDDH-UHFFFAOYSA-N 0.000 description 3
- 102100033051 40S ribosomal protein S19 Human genes 0.000 description 3
- 102100028550 40S ribosomal protein S4, Y isoform 1 Human genes 0.000 description 3
- NMUSYJAQQFHJEW-KVTDHHQDSA-N 5-azacytidine Chemical compound O=C1N=C(N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NMUSYJAQQFHJEW-KVTDHHQDSA-N 0.000 description 3
- WYWHKKSPHMUBEB-UHFFFAOYSA-N 6-Mercaptoguanine Natural products N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 3
- 102100022406 60S ribosomal protein L10a Human genes 0.000 description 3
- 102100023990 60S ribosomal protein L17 Human genes 0.000 description 3
- 102100031002 60S ribosomal protein L36a Human genes 0.000 description 3
- PQMIPLRIRFVQJZ-QBYYVRQOSA-N 7-[2-[(2s,4s)-4-[(2r,3r,4r,5s,6s)-3-fluoro-4,5-dihydroxy-6-methyloxan-2-yl]oxy-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1h-tetracen-2-yl]-2-oxoethoxy]-7-oxoheptanoic acid Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)COC(=O)CCCCCC(O)=O)[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]1F PQMIPLRIRFVQJZ-QBYYVRQOSA-N 0.000 description 3
- FUXVKZWTXQUGMW-FQEVSTJZSA-N 9-Aminocamptothecin Chemical compound C1=CC(N)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 FUXVKZWTXQUGMW-FQEVSTJZSA-N 0.000 description 3
- 102100031912 A-kinase anchor protein 1, mitochondrial Human genes 0.000 description 3
- 102100024049 A-kinase anchor protein 13 Human genes 0.000 description 3
- 102100022886 ADP-ribosylation factor-like protein 4C Human genes 0.000 description 3
- 102100026396 ADP/ATP translocase 2 Human genes 0.000 description 3
- 102100032897 AMP deaminase 2 Human genes 0.000 description 3
- 102100032898 AMP deaminase 3 Human genes 0.000 description 3
- 101150060590 ANAPC5 gene Proteins 0.000 description 3
- 102100034527 AP-1 complex subunit gamma-like 2 Human genes 0.000 description 3
- 102100025581 ATP synthase subunit delta, mitochondrial Human genes 0.000 description 3
- 102100021407 ATP-dependent RNA helicase DDX18 Human genes 0.000 description 3
- 102100024005 Acid ceramidase Human genes 0.000 description 3
- 102100022997 Acidic leucine-rich nuclear phosphoprotein 32 family member A Human genes 0.000 description 3
- 102100033408 Acidic leucine-rich nuclear phosphoprotein 32 family member B Human genes 0.000 description 3
- 102100022734 Acyl carrier protein, mitochondrial Human genes 0.000 description 3
- 102100029374 Adapter molecule crk Human genes 0.000 description 3
- 102100029457 Adenine phosphoribosyltransferase Human genes 0.000 description 3
- 108010024223 Adenine phosphoribosyltransferase Proteins 0.000 description 3
- 102100036791 Adhesion G protein-coupled receptor L2 Human genes 0.000 description 3
- 102100028264 Alanyl-tRNA editing protein Aarsd1 Human genes 0.000 description 3
- 102100033816 Aldehyde dehydrogenase, mitochondrial Human genes 0.000 description 3
- 102100026446 Aldo-keto reductase family 1 member C1 Human genes 0.000 description 3
- 102100022712 Alpha-1-antitrypsin Human genes 0.000 description 3
- 102100034163 Alpha-actinin-1 Human genes 0.000 description 3
- 102100032959 Alpha-actinin-4 Human genes 0.000 description 3
- 102100032360 Alstrom syndrome protein 1 Human genes 0.000 description 3
- 102100034452 Alternative prion protein Human genes 0.000 description 3
- 102100032040 Amphoterin-induced protein 2 Human genes 0.000 description 3
- 102100021697 Anamorsin Human genes 0.000 description 3
- 102000052588 Anaphase-Promoting Complex-Cyclosome Apc5 Subunit Human genes 0.000 description 3
- 108700004604 Anaphase-Promoting Complex-Cyclosome Apc5 Subunit Proteins 0.000 description 3
- 102100040006 Annexin A1 Human genes 0.000 description 3
- 102100030346 Antigen peptide transporter 1 Human genes 0.000 description 3
- 102100036013 Antigen-presenting glycoprotein CD1d Human genes 0.000 description 3
- 102100036783 Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 1 Human genes 0.000 description 3
- 102100034193 Aspartate aminotransferase, mitochondrial Human genes 0.000 description 3
- 102100022108 Aspartyl/asparaginyl beta-hydroxylase Human genes 0.000 description 3
- 102100022718 Atypical chemokine receptor 2 Human genes 0.000 description 3
- 102100022983 B-cell lymphoma/leukemia 11B Human genes 0.000 description 3
- 102100035656 BCL2/adenovirus E1B 19 kDa protein-interacting protein 3 Human genes 0.000 description 3
- 101150050047 BHLHE40 gene Proteins 0.000 description 3
- 102100023051 Band 4.1-like protein 4B Human genes 0.000 description 3
- 102100029945 Beta-galactoside alpha-2,6-sialyltransferase 1 Human genes 0.000 description 3
- 102100022549 Beta-hexosaminidase subunit beta Human genes 0.000 description 3
- 102100027058 Bleomycin hydrolase Human genes 0.000 description 3
- 102100028252 Brain acid soluble protein 1 Human genes 0.000 description 3
- 102000004219 Brain-derived neurotrophic factor Human genes 0.000 description 3
- 108090000715 Brain-derived neurotrophic factor Proteins 0.000 description 3
- 102100029894 Bromodomain testis-specific protein Human genes 0.000 description 3
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 3
- 102100027155 Butyrophilin subfamily 3 member A2 Human genes 0.000 description 3
- 102100021390 C-terminal-binding protein 1 Human genes 0.000 description 3
- 102000014837 CACNA1G Human genes 0.000 description 3
- 102100024217 CAMPATH-1 antigen Human genes 0.000 description 3
- 102100031171 CCN family member 1 Human genes 0.000 description 3
- 102100032912 CD44 antigen Human genes 0.000 description 3
- 102100022002 CD59 glycoprotein Human genes 0.000 description 3
- 102100025222 CD63 antigen Human genes 0.000 description 3
- 102100029930 CST complex subunit STN1 Human genes 0.000 description 3
- 102100024155 Cadherin-11 Human genes 0.000 description 3
- 102100036364 Cadherin-2 Human genes 0.000 description 3
- 102100025580 Calmodulin-1 Human genes 0.000 description 3
- 102100025593 Calmodulin-regulated spectrin-associated protein 2 Human genes 0.000 description 3
- 102100038918 Caspase-6 Human genes 0.000 description 3
- 102100038902 Caspase-7 Human genes 0.000 description 3
- 102100032230 Caveolae-associated protein 1 Human genes 0.000 description 3
- 108010072135 Cell Adhesion Molecule-1 Proteins 0.000 description 3
- 102100024649 Cell adhesion molecule 1 Human genes 0.000 description 3
- 102100023126 Cell surface glycoprotein MUC18 Human genes 0.000 description 3
- 102100037677 Cell surface hyaluronidase Human genes 0.000 description 3
- 102100038503 Cellular retinoic acid-binding protein 1 Human genes 0.000 description 3
- 102100035366 Centromere protein M Human genes 0.000 description 3
- 102100035696 Centrosome-associated protein 350 Human genes 0.000 description 3
- 102000006786 Chloride-Bicarbonate Antiporters Human genes 0.000 description 3
- 102100032404 Cholinesterase Human genes 0.000 description 3
- 102100026191 Class E basic helix-loop-helix protein 40 Human genes 0.000 description 3
- 102100033601 Collagen alpha-1(I) chain Human genes 0.000 description 3
- 102100022145 Collagen alpha-1(IV) chain Human genes 0.000 description 3
- 102100031519 Collagen alpha-1(VI) chain Human genes 0.000 description 3
- 102100033781 Collagen alpha-2(IV) chain Human genes 0.000 description 3
- 102100031518 Collagen alpha-2(VI) chain Human genes 0.000 description 3
- 102100025877 Complement component C1q receptor Human genes 0.000 description 3
- 102100032951 Condensin complex subunit 2 Human genes 0.000 description 3
- 102100031397 Copper homeostasis protein cutC homolog Human genes 0.000 description 3
- 108010079362 Core Binding Factor Alpha 3 Subunit Proteins 0.000 description 3
- 102100041022 Coronin-1C Human genes 0.000 description 3
- 102100029376 Cryptochrome-1 Human genes 0.000 description 3
- 102100025191 Cyclin-A2 Human genes 0.000 description 3
- 108010009392 Cyclin-Dependent Kinase Inhibitor p16 Proteins 0.000 description 3
- 102100024458 Cyclin-dependent kinase inhibitor 2A Human genes 0.000 description 3
- 102100034746 Cyclin-dependent kinase-like 5 Human genes 0.000 description 3
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 3
- 108010019961 Cysteine-Rich Protein 61 Proteins 0.000 description 3
- 102100035300 Cystine/glutamate transporter Human genes 0.000 description 3
- 102100021009 Cytochrome b-c1 complex subunit Rieske, mitochondrial Human genes 0.000 description 3
- 102100038418 Cytoplasmic FMR1-interacting protein 2 Human genes 0.000 description 3
- 102100036318 Cytoplasmic phosphatidylinositol transfer protein 1 Human genes 0.000 description 3
- 102100033673 DAZ-associated protein 1 Human genes 0.000 description 3
- 102100025282 DENN domain-containing protein 2D Human genes 0.000 description 3
- 102100040262 DNA dC->dU-editing enzyme APOBEC-3B Human genes 0.000 description 3
- 102100033711 DNA replication licensing factor MCM7 Human genes 0.000 description 3
- 102100032263 DNA-directed RNA polymerase I subunit RPA49 Human genes 0.000 description 3
- 102100023348 DNA-directed RNA polymerases I, II, and III subunit RPABC2 Human genes 0.000 description 3
- 101001001794 Danio rerio Pleckstrin homology domain-containing family O member 1-A Proteins 0.000 description 3
- 102100036910 Deubiquitinase DESI2 Human genes 0.000 description 3
- 108010086291 Deubiquitinating Enzyme CYLD Proteins 0.000 description 3
- 102100022735 Diacylglycerol kinase alpha Human genes 0.000 description 3
- 101100226017 Dictyostelium discoideum repD gene Proteins 0.000 description 3
- 102100029858 Dipeptidase 2 Human genes 0.000 description 3
- 102100029921 Dipeptidyl peptidase 1 Human genes 0.000 description 3
- 102100024361 Disintegrin and metalloproteinase domain-containing protein 9 Human genes 0.000 description 3
- 102100023317 DnaJ homolog subfamily C member 10 Human genes 0.000 description 3
- 102100027189 Dolichyl-phosphate beta-glucosyltransferase Human genes 0.000 description 3
- 102100025699 Dual specificity protein phosphatase CDC14B Human genes 0.000 description 3
- 102100036654 Dynactin subunit 1 Human genes 0.000 description 3
- 102100035273 E3 ubiquitin-protein ligase CBL-B Human genes 0.000 description 3
- 102100037038 E3 ubiquitin-protein ligase CCNB1IP1 Human genes 0.000 description 3
- 102100021766 E3 ubiquitin-protein ligase RNF138 Human genes 0.000 description 3
- 102100031534 E3 ubiquitin-protein ligase RNF144A Human genes 0.000 description 3
- 101150105460 ERCC2 gene Proteins 0.000 description 3
- 102100023794 ETS domain-containing protein Elk-3 Human genes 0.000 description 3
- 102100040465 Elongation factor 1-beta Human genes 0.000 description 3
- 102100024240 Endophilin-A3 Human genes 0.000 description 3
- 108700041152 Endoplasmic Reticulum Chaperone BiP Proteins 0.000 description 3
- 102100021451 Endoplasmic reticulum chaperone BiP Human genes 0.000 description 3
- 102100036448 Endothelial PAS domain-containing protein 1 Human genes 0.000 description 3
- 102100031785 Endothelial transcription factor GATA-2 Human genes 0.000 description 3
- 102100023721 Ephrin-B2 Human genes 0.000 description 3
- 102100037255 Equilibrative nucleobase transporter 1 Human genes 0.000 description 3
- 101000823089 Equus caballus Alpha-1-antiproteinase 1 Proteins 0.000 description 3
- 102100026761 Eukaryotic translation initiation factor 5A-1 Human genes 0.000 description 3
- 101710191461 F420-dependent glucose-6-phosphate dehydrogenase Proteins 0.000 description 3
- 102100028166 FACT complex subunit SSRP1 Human genes 0.000 description 3
- 102100036089 Fascin Human genes 0.000 description 3
- 102100030421 Fatty acid-binding protein 5 Human genes 0.000 description 3
- 102100040684 Fermitin family homolog 2 Human genes 0.000 description 3
- 102100037362 Fibronectin Human genes 0.000 description 3
- 102100026545 Fibronectin type III domain-containing protein 3B Human genes 0.000 description 3
- 102100032790 Flotillin-1 Human genes 0.000 description 3
- 102100040680 Formin-binding protein 1 Human genes 0.000 description 3
- 102100028930 Formin-like protein 1 Human genes 0.000 description 3
- 102100027269 Fructose-bisphosphate aldolase C Human genes 0.000 description 3
- 102100036001 G-protein coupled receptor-associated sorting protein 1 Human genes 0.000 description 3
- 102100023942 G-protein-signaling modulator 3 Human genes 0.000 description 3
- 102100040861 G0/G1 switch protein 2 Human genes 0.000 description 3
- 102100037859 G1/S-specific cyclin-D3 Human genes 0.000 description 3
- 108010062427 GDP-mannose 4,6-dehydratase Proteins 0.000 description 3
- 102000002312 GDPmannose 4,6-dehydratase Human genes 0.000 description 3
- 102100024413 GTPase IMAP family member 5 Human genes 0.000 description 3
- 102100039558 Galectin-3 Human genes 0.000 description 3
- 102100031351 Galectin-9 Human genes 0.000 description 3
- 102100028652 Gamma-enolase Human genes 0.000 description 3
- 102100039718 Gamma-secretase-activating protein Human genes 0.000 description 3
- 102100028592 Gamma-tubulin complex component 3 Human genes 0.000 description 3
- 102100035184 General transcription and DNA repair factor IIH helicase subunit XPD Human genes 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- 102100035172 Glucose-6-phosphate 1-dehydrogenase Human genes 0.000 description 3
- 101710155861 Glucose-6-phosphate 1-dehydrogenase Proteins 0.000 description 3
- 101710174622 Glucose-6-phosphate 1-dehydrogenase, chloroplastic Proteins 0.000 description 3
- 101710137456 Glucose-6-phosphate 1-dehydrogenase, cytoplasmic isoform Proteins 0.000 description 3
- 108090000369 Glutamate Carboxypeptidase II Proteins 0.000 description 3
- 102100041003 Glutamate carboxypeptidase 2 Human genes 0.000 description 3
- 102100039611 Glutamine synthetase Human genes 0.000 description 3
- 102100033429 Glutamine-fructose-6-phosphate aminotransferase [isomerizing] 1 Human genes 0.000 description 3
- 102100036533 Glutathione S-transferase Mu 2 Human genes 0.000 description 3
- 102100033958 Glycine receptor subunit beta Human genes 0.000 description 3
- 102100029481 Glycogen phosphorylase, liver form Human genes 0.000 description 3
- 102100033505 Granule associated Rac and RHOG effector protein 1 Human genes 0.000 description 3
- 102100039619 Granulocyte colony-stimulating factor Human genes 0.000 description 3
- 102100030386 Granzyme A Human genes 0.000 description 3
- 102100034221 Growth-regulated alpha protein Human genes 0.000 description 3
- 102100035341 Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Human genes 0.000 description 3
- 102100023281 Guanine nucleotide-binding protein subunit beta-5 Human genes 0.000 description 3
- 102100031249 H/ACA ribonucleoprotein complex subunit DKC1 Human genes 0.000 description 3
- 108091059596 H3F3A Proteins 0.000 description 3
- 102100039333 HAUS augmin-like complex subunit 2 Human genes 0.000 description 3
- 102100028784 HIV Tat-specific factor 1 Human genes 0.000 description 3
- 102100028976 HLA class I histocompatibility antigen, B alpha chain Human genes 0.000 description 3
- 108010058607 HLA-B Antigens Proteins 0.000 description 3
- 108010067802 HLA-DR alpha-Chains Proteins 0.000 description 3
- 101150112743 HSPA5 gene Proteins 0.000 description 3
- 101800000637 Hemokinin Proteins 0.000 description 3
- 102100028895 Heterogeneous nuclear ribonucleoprotein M Human genes 0.000 description 3
- 102100029009 High mobility group protein HMG-I/HMG-Y Human genes 0.000 description 3
- 102100037487 Histone H1.0 Human genes 0.000 description 3
- 102100023917 Histone H1.10 Human genes 0.000 description 3
- 102100039236 Histone H3.3 Human genes 0.000 description 3
- 102100034523 Histone H4 Human genes 0.000 description 3
- 102100029234 Histone-lysine N-methyltransferase NSD2 Human genes 0.000 description 3
- 102100021090 Homeobox protein Hox-A9 Human genes 0.000 description 3
- 101000583063 Homo sapiens 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Proteins 0.000 description 3
- 101001125540 Homo sapiens 26S proteasome regulatory subunit 6A Proteins 0.000 description 3
- 101001108583 Homo sapiens 28S rRNA (cytosine-C(5))-methyltransferase Proteins 0.000 description 3
- 101000733040 Homo sapiens 40S ribosomal protein S19 Proteins 0.000 description 3
- 101000696103 Homo sapiens 40S ribosomal protein S4, Y isoform 1 Proteins 0.000 description 3
- 101000755323 Homo sapiens 60S ribosomal protein L10a Proteins 0.000 description 3
- 101000682512 Homo sapiens 60S ribosomal protein L17 Proteins 0.000 description 3
- 101001127203 Homo sapiens 60S ribosomal protein L36a Proteins 0.000 description 3
- 101001127258 Homo sapiens 60S ribosomal protein L36a-like Proteins 0.000 description 3
- 101000774717 Homo sapiens A-kinase anchor protein 1, mitochondrial Proteins 0.000 description 3
- 101000833679 Homo sapiens A-kinase anchor protein 13 Proteins 0.000 description 3
- 101000974390 Homo sapiens ADP-ribosylation factor-like protein 4C Proteins 0.000 description 3
- 101000797458 Homo sapiens AMP deaminase 2 Proteins 0.000 description 3
- 101000797462 Homo sapiens AMP deaminase 3 Proteins 0.000 description 3
- 101000924648 Homo sapiens AP-1 complex subunit gamma-like 2 Proteins 0.000 description 3
- 101000766510 Homo sapiens ATP synthase subunit delta, mitochondrial Proteins 0.000 description 3
- 101001041703 Homo sapiens ATP-dependent RNA helicase DDX18 Proteins 0.000 description 3
- 101000975753 Homo sapiens Acid ceramidase Proteins 0.000 description 3
- 101000757200 Homo sapiens Acidic leucine-rich nuclear phosphoprotein 32 family member A Proteins 0.000 description 3
- 101000732653 Homo sapiens Acidic leucine-rich nuclear phosphoprotein 32 family member B Proteins 0.000 description 3
- 101000756632 Homo sapiens Actin, cytoplasmic 1 Proteins 0.000 description 3
- 101000678845 Homo sapiens Acyl carrier protein, mitochondrial Proteins 0.000 description 3
- 101000928189 Homo sapiens Adhesion G protein-coupled receptor L2 Proteins 0.000 description 3
- 101000724444 Homo sapiens Alanyl-tRNA editing protein Aarsd1 Proteins 0.000 description 3
- 101000718028 Homo sapiens Aldo-keto reductase family 1 member C1 Proteins 0.000 description 3
- 101000823116 Homo sapiens Alpha-1-antitrypsin Proteins 0.000 description 3
- 101000799406 Homo sapiens Alpha-actinin-1 Proteins 0.000 description 3
- 101000797282 Homo sapiens Alpha-actinin-4 Proteins 0.000 description 3
- 101000797795 Homo sapiens Alstrom syndrome protein 1 Proteins 0.000 description 3
- 101000924727 Homo sapiens Alternative prion protein Proteins 0.000 description 3
- 101000776165 Homo sapiens Amphoterin-induced protein 2 Proteins 0.000 description 3
- 101000896743 Homo sapiens Anamorsin Proteins 0.000 description 3
- 101000959738 Homo sapiens Annexin A1 Proteins 0.000 description 3
- 101000716121 Homo sapiens Antigen-presenting glycoprotein CD1d Proteins 0.000 description 3
- 101000928218 Homo sapiens Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 1 Proteins 0.000 description 3
- 101000799549 Homo sapiens Aspartate aminotransferase, mitochondrial Proteins 0.000 description 3
- 101000901030 Homo sapiens Aspartyl/asparaginyl beta-hydroxylase Proteins 0.000 description 3
- 101000678892 Homo sapiens Atypical chemokine receptor 2 Proteins 0.000 description 3
- 101000903697 Homo sapiens B-cell lymphoma/leukemia 11B Proteins 0.000 description 3
- 101000803294 Homo sapiens BCL2/adenovirus E1B 19 kDa protein-interacting protein 3 Proteins 0.000 description 3
- 101001049962 Homo sapiens Band 4.1-like protein 4B Proteins 0.000 description 3
- 101000863864 Homo sapiens Beta-galactoside alpha-2,6-sialyltransferase 1 Proteins 0.000 description 3
- 101001045433 Homo sapiens Beta-hexosaminidase subunit beta Proteins 0.000 description 3
- 101000984541 Homo sapiens Bleomycin hydrolase Proteins 0.000 description 3
- 101000935689 Homo sapiens Brain acid soluble protein 1 Proteins 0.000 description 3
- 101000794028 Homo sapiens Bromodomain testis-specific protein Proteins 0.000 description 3
- 101000984917 Homo sapiens Butyrophilin subfamily 3 member A2 Proteins 0.000 description 3
- 101000716070 Homo sapiens C-C chemokine receptor type 9 Proteins 0.000 description 3
- 101000980814 Homo sapiens CAMPATH-1 antigen Proteins 0.000 description 3
- 101000868273 Homo sapiens CD44 antigen Proteins 0.000 description 3
- 101000897400 Homo sapiens CD59 glycoprotein Proteins 0.000 description 3
- 101000934368 Homo sapiens CD63 antigen Proteins 0.000 description 3
- 101000585157 Homo sapiens CST complex subunit STN1 Proteins 0.000 description 3
- 101000762236 Homo sapiens Cadherin-11 Proteins 0.000 description 3
- 101000714537 Homo sapiens Cadherin-2 Proteins 0.000 description 3
- 101000984164 Homo sapiens Calmodulin-1 Proteins 0.000 description 3
- 101000932961 Homo sapiens Calmodulin-regulated spectrin-associated protein 2 Proteins 0.000 description 3
- 101000741087 Homo sapiens Caspase-6 Proteins 0.000 description 3
- 101000741014 Homo sapiens Caspase-7 Proteins 0.000 description 3
- 101000869049 Homo sapiens Caveolae-associated protein 1 Proteins 0.000 description 3
- 101000623903 Homo sapiens Cell surface glycoprotein MUC18 Proteins 0.000 description 3
- 101000880605 Homo sapiens Cell surface hyaluronidase Proteins 0.000 description 3
- 101001099865 Homo sapiens Cellular retinoic acid-binding protein 1 Proteins 0.000 description 3
- 101000737696 Homo sapiens Centromere protein M Proteins 0.000 description 3
- 101000715657 Homo sapiens Centrosome-associated protein 350 Proteins 0.000 description 3
- 101000943274 Homo sapiens Cholinesterase Proteins 0.000 description 3
- 101000901150 Homo sapiens Collagen alpha-1(IV) chain Proteins 0.000 description 3
- 101000941581 Homo sapiens Collagen alpha-1(VI) chain Proteins 0.000 description 3
- 101000710876 Homo sapiens Collagen alpha-2(IV) chain Proteins 0.000 description 3
- 101000941585 Homo sapiens Collagen alpha-2(VI) chain Proteins 0.000 description 3
- 101000933665 Homo sapiens Complement component C1q receptor Proteins 0.000 description 3
- 101000942617 Homo sapiens Condensin complex subunit 2 Proteins 0.000 description 3
- 101000941325 Homo sapiens Copper homeostasis protein cutC homolog Proteins 0.000 description 3
- 101000748856 Homo sapiens Coronin-1C Proteins 0.000 description 3
- 101000919351 Homo sapiens Cryptochrome-1 Proteins 0.000 description 3
- 101000934320 Homo sapiens Cyclin-A2 Proteins 0.000 description 3
- 101000945692 Homo sapiens Cyclin-dependent kinase-like 5 Proteins 0.000 description 3
- 101000643956 Homo sapiens Cytochrome b-c1 complex subunit Rieske, mitochondrial Proteins 0.000 description 3
- 101000956870 Homo sapiens Cytoplasmic FMR1-interacting protein 2 Proteins 0.000 description 3
- 101001074657 Homo sapiens Cytoplasmic phosphatidylinositol transfer protein 1 Proteins 0.000 description 3
- 101000871284 Homo sapiens DAZ-associated protein 1 Proteins 0.000 description 3
- 101000722280 Homo sapiens DENN domain-containing protein 2D Proteins 0.000 description 3
- 101000964385 Homo sapiens DNA dC->dU-editing enzyme APOBEC-3B Proteins 0.000 description 3
- 101001018431 Homo sapiens DNA replication licensing factor MCM7 Proteins 0.000 description 3
- 101001088155 Homo sapiens DNA-directed RNA polymerase I subunit RPA49 Proteins 0.000 description 3
- 101000686009 Homo sapiens DNA-directed RNA polymerases I, II, and III subunit RPABC2 Proteins 0.000 description 3
- 101000928060 Homo sapiens Deubiquitinase DESI2 Proteins 0.000 description 3
- 101001044817 Homo sapiens Diacylglycerol kinase alpha Proteins 0.000 description 3
- 101000864123 Homo sapiens Dipeptidase 2 Proteins 0.000 description 3
- 101000793922 Homo sapiens Dipeptidyl peptidase 1 Proteins 0.000 description 3
- 101000832769 Homo sapiens Disintegrin and metalloproteinase domain-containing protein 9 Proteins 0.000 description 3
- 101000908042 Homo sapiens DnaJ homolog subfamily C member 10 Proteins 0.000 description 3
- 101000694130 Homo sapiens Dolichyl-phosphate beta-glucosyltransferase Proteins 0.000 description 3
- 101000932592 Homo sapiens Dual specificity protein phosphatase CDC14B Proteins 0.000 description 3
- 101000929626 Homo sapiens Dynactin subunit 1 Proteins 0.000 description 3
- 101000737265 Homo sapiens E3 ubiquitin-protein ligase CBL-B Proteins 0.000 description 3
- 101000737896 Homo sapiens E3 ubiquitin-protein ligase CCNB1IP1 Proteins 0.000 description 3
- 101001106980 Homo sapiens E3 ubiquitin-protein ligase RNF138 Proteins 0.000 description 3
- 101001130270 Homo sapiens E3 ubiquitin-protein ligase RNF144A Proteins 0.000 description 3
- 101000967447 Homo sapiens Elongation factor 1-beta Proteins 0.000 description 3
- 101000688572 Homo sapiens Endophilin-A3 Proteins 0.000 description 3
- 101000812663 Homo sapiens Endoplasmin Proteins 0.000 description 3
- 101001066265 Homo sapiens Endothelial transcription factor GATA-2 Proteins 0.000 description 3
- 101001049392 Homo sapiens Ephrin-B2 Proteins 0.000 description 3
- 101001054354 Homo sapiens Eukaryotic translation initiation factor 5A-1 Proteins 0.000 description 3
- 101000697353 Homo sapiens FACT complex subunit SSRP1 Proteins 0.000 description 3
- 101000732045 Homo sapiens FAU ubiquitin-like and ribosomal protein S30 Proteins 0.000 description 3
- 101001021925 Homo sapiens Fascin Proteins 0.000 description 3
- 101001062855 Homo sapiens Fatty acid-binding protein 5 Proteins 0.000 description 3
- 101000892677 Homo sapiens Fermitin family homolog 2 Proteins 0.000 description 3
- 101001027128 Homo sapiens Fibronectin Proteins 0.000 description 3
- 101000913642 Homo sapiens Fibronectin type III domain-containing protein 3B Proteins 0.000 description 3
- 101000913557 Homo sapiens Filamin-C Proteins 0.000 description 3
- 101000847538 Homo sapiens Flotillin-1 Proteins 0.000 description 3
- 101000892722 Homo sapiens Formin-binding protein 1 Proteins 0.000 description 3
- 101001059386 Homo sapiens Formin-like protein 1 Proteins 0.000 description 3
- 101000836545 Homo sapiens Fructose-bisphosphate aldolase C Proteins 0.000 description 3
- 101001021410 Homo sapiens G-protein coupled receptor-associated sorting protein 1 Proteins 0.000 description 3
- 101000904749 Homo sapiens G-protein-signaling modulator 3 Proteins 0.000 description 3
- 101000893656 Homo sapiens G0/G1 switch protein 2 Proteins 0.000 description 3
- 101000738559 Homo sapiens G1/S-specific cyclin-D3 Proteins 0.000 description 3
- 101000833376 Homo sapiens GTPase IMAP family member 5 Proteins 0.000 description 3
- 101000608757 Homo sapiens Galectin-3 Proteins 0.000 description 3
- 101001130151 Homo sapiens Galectin-9 Proteins 0.000 description 3
- 101001058231 Homo sapiens Gamma-enolase Proteins 0.000 description 3
- 101001034753 Homo sapiens Gamma-secretase-activating protein Proteins 0.000 description 3
- 101001058968 Homo sapiens Gamma-tubulin complex component 3 Proteins 0.000 description 3
- 101000888841 Homo sapiens Glutamine synthetase Proteins 0.000 description 3
- 101000997929 Homo sapiens Glutamine-fructose-6-phosphate aminotransferase [isomerizing] 1 Proteins 0.000 description 3
- 101001071691 Homo sapiens Glutathione S-transferase Mu 2 Proteins 0.000 description 3
- 101000996225 Homo sapiens Glycine receptor subunit beta Proteins 0.000 description 3
- 101000700616 Homo sapiens Glycogen phosphorylase, liver form Proteins 0.000 description 3
- 101000870788 Homo sapiens Granule associated Rac and RHOG effector protein 1 Proteins 0.000 description 3
- 101001009599 Homo sapiens Granzyme A Proteins 0.000 description 3
- 101001069921 Homo sapiens Growth-regulated alpha protein Proteins 0.000 description 3
- 101001024278 Homo sapiens Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Proteins 0.000 description 3
- 101000829985 Homo sapiens Guanine nucleotide-binding protein subunit beta-5 Proteins 0.000 description 3
- 101000844866 Homo sapiens H/ACA ribonucleoprotein complex subunit DKC1 Proteins 0.000 description 3
- 101001035826 Homo sapiens HAUS augmin-like complex subunit 2 Proteins 0.000 description 3
- 101001078805 Homo sapiens HIV Tat-specific factor 1 Proteins 0.000 description 3
- 101000839073 Homo sapiens Heterogeneous nuclear ribonucleoprotein M Proteins 0.000 description 3
- 101000986380 Homo sapiens High mobility group protein HMG-I/HMG-Y Proteins 0.000 description 3
- 101001026554 Homo sapiens Histone H1.0 Proteins 0.000 description 3
- 101000905024 Homo sapiens Histone H1.10 Proteins 0.000 description 3
- 101001067880 Homo sapiens Histone H4 Proteins 0.000 description 3
- 101000634048 Homo sapiens Histone-lysine N-methyltransferase NSD2 Proteins 0.000 description 3
- 101001081176 Homo sapiens Hyaluronan mediated motility receptor Proteins 0.000 description 3
- 101001056180 Homo sapiens Induced myeloid leukemia cell differentiation protein Mcl-1 Proteins 0.000 description 3
- 101001076642 Homo sapiens Inosine-5'-monophosphate dehydrogenase 2 Proteins 0.000 description 3
- 101000982538 Homo sapiens Inositol polyphosphate 5-phosphatase OCRL Proteins 0.000 description 3
- 101001077600 Homo sapiens Insulin receptor substrate 2 Proteins 0.000 description 3
- 101001044940 Homo sapiens Insulin-like growth factor-binding protein 2 Proteins 0.000 description 3
- 101000599852 Homo sapiens Intercellular adhesion molecule 1 Proteins 0.000 description 3
- 101000959664 Homo sapiens Interferon-induced protein 44-like Proteins 0.000 description 3
- 101001034846 Homo sapiens Interferon-induced transmembrane protein 3 Proteins 0.000 description 3
- 101001035448 Homo sapiens Interferon-induced very large GTPase 1 Proteins 0.000 description 3
- 101001003132 Homo sapiens Interleukin-13 receptor subunit alpha-2 Proteins 0.000 description 3
- 101001033312 Homo sapiens Interleukin-4 receptor subunit alpha Proteins 0.000 description 3
- 101000599056 Homo sapiens Interleukin-6 receptor subunit beta Proteins 0.000 description 3
- 101001044432 Homo sapiens Intraflagellar transport protein 46 homolog Proteins 0.000 description 3
- 101001050616 Homo sapiens KH domain-containing, RNA-binding, signal transduction-associated protein 1 Proteins 0.000 description 3
- 101001006776 Homo sapiens Kinesin-like protein KIFC1 Proteins 0.000 description 3
- 101001018097 Homo sapiens L-selectin Proteins 0.000 description 3
- 101001008568 Homo sapiens Laminin subunit beta-1 Proteins 0.000 description 3
- 101000941865 Homo sapiens Leucine-rich repeat neuronal protein 3 Proteins 0.000 description 3
- 101000984848 Homo sapiens Leucine-rich repeat-containing protein 41 Proteins 0.000 description 3
- 101000868279 Homo sapiens Leukocyte surface antigen CD47 Proteins 0.000 description 3
- 101000917826 Homo sapiens Low affinity immunoglobulin gamma Fc region receptor II-a Proteins 0.000 description 3
- 101000917821 Homo sapiens Low affinity immunoglobulin gamma Fc region receptor II-c Proteins 0.000 description 3
- 101000984626 Homo sapiens Low-density lipoprotein receptor-related protein 12 Proteins 0.000 description 3
- 101001018064 Homo sapiens Lysosomal-trafficking regulator Proteins 0.000 description 3
- 101000577058 Homo sapiens M-phase phosphoprotein 6 Proteins 0.000 description 3
- 101000634835 Homo sapiens M1-specific T cell receptor alpha chain Proteins 0.000 description 3
- 101000578949 Homo sapiens MAP7 domain-containing protein 1 Proteins 0.000 description 3
- 101000578266 Homo sapiens Magnesium transporter NIPA2 Proteins 0.000 description 3
- 101000914251 Homo sapiens Major centromere autoantigen B Proteins 0.000 description 3
- 101000573901 Homo sapiens Major prion protein Proteins 0.000 description 3
- 101001033820 Homo sapiens Malate dehydrogenase, mitochondrial Proteins 0.000 description 3
- 101000636210 Homo sapiens Matrix-remodeling-associated protein 7 Proteins 0.000 description 3
- 101001036686 Homo sapiens Melanoma-associated antigen B2 Proteins 0.000 description 3
- 101001055386 Homo sapiens Melanophilin Proteins 0.000 description 3
- 101000669513 Homo sapiens Metalloproteinase inhibitor 1 Proteins 0.000 description 3
- 101001027945 Homo sapiens Metallothionein-1E Proteins 0.000 description 3
- 101001027938 Homo sapiens Metallothionein-1G Proteins 0.000 description 3
- 101001013796 Homo sapiens Metallothionein-1M Proteins 0.000 description 3
- 101000990528 Homo sapiens Methyltransferase-like protein 17, mitochondrial Proteins 0.000 description 3
- 101001013999 Homo sapiens Microtubule cross-linking factor 1 Proteins 0.000 description 3
- 101001016777 Homo sapiens Microtubule-associated protein 9 Proteins 0.000 description 3
- 101001052512 Homo sapiens Microtubule-associated proteins 1A/1B light chain 3B Proteins 0.000 description 3
- 101000581272 Homo sapiens Midasin Proteins 0.000 description 3
- 101000598416 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim17-A Proteins 0.000 description 3
- 101000798951 Homo sapiens Mitochondrial import receptor subunit TOM20 homolog Proteins 0.000 description 3
- 101001098460 Homo sapiens Mitochondrial inner membrane protein OXA1L Proteins 0.000 description 3
- 101001052493 Homo sapiens Mitogen-activated protein kinase 1 Proteins 0.000 description 3
- 101001012646 Homo sapiens Monoglyceride lipase Proteins 0.000 description 3
- 101000957351 Homo sapiens Myc-associated zinc finger protein Proteins 0.000 description 3
- 101000969763 Homo sapiens Myelin protein zero-like protein 1 Proteins 0.000 description 3
- 101001023037 Homo sapiens Myoferlin Proteins 0.000 description 3
- 101001128456 Homo sapiens Myosin regulatory light polypeptide 9 Proteins 0.000 description 3
- 101000973778 Homo sapiens NAD(P)H dehydrogenase [quinone] 1 Proteins 0.000 description 3
- 101000979243 Homo sapiens NADH dehydrogenase [ubiquinone] iron-sulfur protein 6, mitochondrial Proteins 0.000 description 3
- 101000961071 Homo sapiens NF-kappa-B inhibitor alpha Proteins 0.000 description 3
- 101001124388 Homo sapiens NPC intracellular cholesterol transporter 1 Proteins 0.000 description 3
- 101000624960 Homo sapiens Nesprin-3 Proteins 0.000 description 3
- 101001024598 Homo sapiens Neuroblastoma breakpoint family member 15 Proteins 0.000 description 3
- 101000745163 Homo sapiens Neuronal acetylcholine receptor subunit alpha-3 Proteins 0.000 description 3
- 101000655246 Homo sapiens Neutral amino acid transporter A Proteins 0.000 description 3
- 101000601048 Homo sapiens Nidogen-2 Proteins 0.000 description 3
- 101000578353 Homo sapiens Nodal modulator 2 Proteins 0.000 description 3
- 101000866805 Homo sapiens Non-histone chromosomal protein HMG-17 Proteins 0.000 description 3
- 101000597417 Homo sapiens Nuclear RNA export factor 1 Proteins 0.000 description 3
- 101000836112 Homo sapiens Nuclear body protein SP140 Proteins 0.000 description 3
- 101000973177 Homo sapiens Nuclear factor interleukin-3-regulated protein Proteins 0.000 description 3
- 101001007901 Homo sapiens Nuclear pore complex protein Nup88 Proteins 0.000 description 3
- 101000961846 Homo sapiens Nuclear prelamin A recognition factor Proteins 0.000 description 3
- 101000582254 Homo sapiens Nuclear receptor corepressor 2 Proteins 0.000 description 3
- 101000634679 Homo sapiens Nucleolar complex protein 2 homolog Proteins 0.000 description 3
- 101000603068 Homo sapiens Nucleolar protein 56 Proteins 0.000 description 3
- 101001109602 Homo sapiens Nucleolar protein 8 Proteins 0.000 description 3
- 101000974005 Homo sapiens Nucleosome assembly protein 1-like 2 Proteins 0.000 description 3
- 101000807596 Homo sapiens Orotidine 5'-phosphate decarboxylase Proteins 0.000 description 3
- 101001098172 Homo sapiens P2X purinoceptor 5 Proteins 0.000 description 3
- 101001098930 Homo sapiens Pachytene checkpoint protein 2 homolog Proteins 0.000 description 3
- 101001094820 Homo sapiens Paraneoplastic antigen Ma2 Proteins 0.000 description 3
- 101001060744 Homo sapiens Peptidyl-prolyl cis-trans isomerase FKBP1A Proteins 0.000 description 3
- 101001060736 Homo sapiens Peptidyl-prolyl cis-trans isomerase FKBP1B Proteins 0.000 description 3
- 101001031398 Homo sapiens Peptidyl-prolyl cis-trans isomerase FKBP9 Proteins 0.000 description 3
- 101000616502 Homo sapiens Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 1 Proteins 0.000 description 3
- 101000609532 Homo sapiens Phosphoinositide-3-kinase-interacting protein 1 Proteins 0.000 description 3
- 101001126234 Homo sapiens Phospholipid phosphatase 3 Proteins 0.000 description 3
- 101001067396 Homo sapiens Phospholipid scramblase 1 Proteins 0.000 description 3
- 101000689394 Homo sapiens Phospholipid scramblase 4 Proteins 0.000 description 3
- 101000609363 Homo sapiens Platelet-activating factor acetylhydrolase IB subunit alpha1 Proteins 0.000 description 3
- 101001001793 Homo sapiens Pleckstrin homology domain-containing family O member 1 Proteins 0.000 description 3
- 101000583692 Homo sapiens Pleckstrin homology-like domain family A member 1 Proteins 0.000 description 3
- 101001126466 Homo sapiens Pleckstrin-2 Proteins 0.000 description 3
- 101000735358 Homo sapiens Poly(rC)-binding protein 2 Proteins 0.000 description 3
- 101000872170 Homo sapiens Polycomb complex protein BMI-1 Proteins 0.000 description 3
- 101000886231 Homo sapiens Polypeptide N-acetylgalactosaminyltransferase 6 Proteins 0.000 description 3
- 101000662049 Homo sapiens Polyubiquitin-C Proteins 0.000 description 3
- 101000578474 Homo sapiens Polyunsaturated fatty acid lipoxygenase ALOX15B Proteins 0.000 description 3
- 101001125496 Homo sapiens Pre-mRNA-processing factor 19 Proteins 0.000 description 3
- 101001105683 Homo sapiens Pre-mRNA-processing-splicing factor 8 Proteins 0.000 description 3
- 101000693750 Homo sapiens Prefoldin subunit 5 Proteins 0.000 description 3
- 101000952113 Homo sapiens Probable ATP-dependent RNA helicase DDX5 Proteins 0.000 description 3
- 101000951118 Homo sapiens Probable dimethyladenosine transferase Proteins 0.000 description 3
- 101000983583 Homo sapiens Procathepsin L Proteins 0.000 description 3
- 101000619345 Homo sapiens Profilin-2 Proteins 0.000 description 3
- 101001133941 Homo sapiens Prolyl 3-hydroxylase 1 Proteins 0.000 description 3
- 101000614345 Homo sapiens Prolyl 4-hydroxylase subunit alpha-1 Proteins 0.000 description 3
- 101001102318 Homo sapiens Prostate tumor-overexpressed gene 1 protein Proteins 0.000 description 3
- 101000911517 Homo sapiens Protein FAM216A Proteins 0.000 description 3
- 101001056567 Homo sapiens Protein Jumonji Proteins 0.000 description 3
- 101000979460 Homo sapiens Protein Niban 1 Proteins 0.000 description 3
- 101000707269 Homo sapiens Protein SHQ1 homolog Proteins 0.000 description 3
- 101000764357 Homo sapiens Protein Tob1 Proteins 0.000 description 3
- 101000915575 Homo sapiens Protein ZNRD2 Proteins 0.000 description 3
- 101000757232 Homo sapiens Protein arginine N-methyltransferase 2 Proteins 0.000 description 3
- 101000924530 Homo sapiens Protein arginine N-methyltransferase 5 Proteins 0.000 description 3
- 101000928791 Homo sapiens Protein diaphanous homolog 1 Proteins 0.000 description 3
- 101001098802 Homo sapiens Protein disulfide-isomerase A3 Proteins 0.000 description 3
- 101000971400 Homo sapiens Protein kinase C eta type Proteins 0.000 description 3
- 101001093143 Homo sapiens Protein transport protein Sec61 subunit gamma Proteins 0.000 description 3
- 101000830689 Homo sapiens Protein tyrosine phosphatase type IVA 3 Proteins 0.000 description 3
- 101000738322 Homo sapiens Prothymosin alpha Proteins 0.000 description 3
- 101000779418 Homo sapiens RAC-alpha serine/threonine-protein kinase Proteins 0.000 description 3
- 101000905936 Homo sapiens RAS guanyl-releasing protein 2 Proteins 0.000 description 3
- 101001024635 Homo sapiens RNA cytidine acetyltransferase Proteins 0.000 description 3
- 101000685886 Homo sapiens RNA-binding protein RO60 Proteins 0.000 description 3
- 101001077488 Homo sapiens RNA-binding protein Raly Proteins 0.000 description 3
- 101000712899 Homo sapiens RNA-binding protein with multiple splicing Proteins 0.000 description 3
- 101000669667 Homo sapiens RNA-binding protein with serine-rich domain 1 Proteins 0.000 description 3
- 101001061915 Homo sapiens Rab3 GTPase-activating protein catalytic subunit Proteins 0.000 description 3
- 101001130279 Homo sapiens Rab9 effector protein with kelch motifs Proteins 0.000 description 3
- 101000994790 Homo sapiens Ras GTPase-activating-like protein IQGAP2 Proteins 0.000 description 3
- 101000686246 Homo sapiens Ras-related protein R-Ras Proteins 0.000 description 3
- 101000686227 Homo sapiens Ras-related protein R-Ras2 Proteins 0.000 description 3
- 101001060862 Homo sapiens Ras-related protein Rab-31 Proteins 0.000 description 3
- 101000712725 Homo sapiens Ras-related protein Rab-7L1 Proteins 0.000 description 3
- 101000584600 Homo sapiens Ras-related protein Rap-1b Proteins 0.000 description 3
- 101000635777 Homo sapiens Receptor-transporting protein 4 Proteins 0.000 description 3
- 101001092185 Homo sapiens Regulator of cell cycle RGCC Proteins 0.000 description 3
- 101001096355 Homo sapiens Replication factor C subunit 3 Proteins 0.000 description 3
- 101000582412 Homo sapiens Replication factor C subunit 5 Proteins 0.000 description 3
- 101001078093 Homo sapiens Reticulocalbin-1 Proteins 0.000 description 3
- 101001091991 Homo sapiens Rho GTPase-activating protein 25 Proteins 0.000 description 3
- 101000704874 Homo sapiens Rho family-interacting cell polarization regulator 2 Proteins 0.000 description 3
- 101000667821 Homo sapiens Rho-related GTP-binding protein RhoE Proteins 0.000 description 3
- 101000692943 Homo sapiens Ribonuclease K6 Proteins 0.000 description 3
- 101001094519 Homo sapiens Ribosomal protein 63, mitochondrial Proteins 0.000 description 3
- 101000683584 Homo sapiens Ribosome-binding protein 1 Proteins 0.000 description 3
- 101000869503 Homo sapiens SAC3 domain-containing protein 1 Proteins 0.000 description 3
- 101000637798 Homo sapiens SH3 domain and tetratricopeptide repeat-containing protein 1 Proteins 0.000 description 3
- 101000828739 Homo sapiens SPATS2-like protein Proteins 0.000 description 3
- 101000936922 Homo sapiens Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Proteins 0.000 description 3
- 101000654696 Homo sapiens Semaphorin-4G Proteins 0.000 description 3
- 101000632319 Homo sapiens Septin-7 Proteins 0.000 description 3
- 101001069710 Homo sapiens Serine protease 23 Proteins 0.000 description 3
- 101000868090 Homo sapiens Serine-rich coiled-coil domain-containing protein 2 Proteins 0.000 description 3
- 101000587438 Homo sapiens Serine/arginine-rich splicing factor 5 Proteins 0.000 description 3
- 101000700735 Homo sapiens Serine/arginine-rich splicing factor 7 Proteins 0.000 description 3
- 101000754911 Homo sapiens Serine/threonine-protein kinase RIO3 Proteins 0.000 description 3
- 101000607332 Homo sapiens Serine/threonine-protein kinase ULK2 Proteins 0.000 description 3
- 101001001648 Homo sapiens Serine/threonine-protein kinase pim-2 Proteins 0.000 description 3
- 101000836066 Homo sapiens Serpin B6 Proteins 0.000 description 3
- 101000657845 Homo sapiens Small nuclear ribonucleoprotein-associated proteins B and B' Proteins 0.000 description 3
- 101000637770 Homo sapiens Solute carrier family 35 member G2 Proteins 0.000 description 3
- 101000825248 Homo sapiens Sperm protein associated with the nucleus on the X chromosome C Proteins 0.000 description 3
- 101000701815 Homo sapiens Spermidine synthase Proteins 0.000 description 3
- 101000708620 Homo sapiens Spermine oxidase Proteins 0.000 description 3
- 101000873927 Homo sapiens Squamous cell carcinoma antigen recognized by T-cells 3 Proteins 0.000 description 3
- 101000701446 Homo sapiens Stanniocalcin-2 Proteins 0.000 description 3
- 101000740275 Homo sapiens Store-operated calcium entry-associated regulatory factor Proteins 0.000 description 3
- 101000634836 Homo sapiens T cell receptor alpha chain MC.7.G5 Proteins 0.000 description 3
- 101000891113 Homo sapiens T-cell acute lymphocytic leukemia protein 1 Proteins 0.000 description 3
- 101000946860 Homo sapiens T-cell surface glycoprotein CD3 epsilon chain Proteins 0.000 description 3
- 101000946843 Homo sapiens T-cell surface glycoprotein CD8 alpha chain Proteins 0.000 description 3
- 101000946833 Homo sapiens T-cell surface glycoprotein CD8 beta chain Proteins 0.000 description 3
- 101000914514 Homo sapiens T-cell-specific surface glycoprotein CD28 Proteins 0.000 description 3
- 101000788535 Homo sapiens TBC1 domain family member 31 Proteins 0.000 description 3
- 101000662997 Homo sapiens TRAF2 and NCK-interacting protein kinase Proteins 0.000 description 3
- 101000890836 Homo sapiens TRAF3-interacting JNK-activating modulator Proteins 0.000 description 3
- 101000596277 Homo sapiens TSC22 domain family protein 3 Proteins 0.000 description 3
- 101000666416 Homo sapiens Terminal nucleotidyltransferase 5A Proteins 0.000 description 3
- 101000612990 Homo sapiens Tetraspanin-3 Proteins 0.000 description 3
- 101000658608 Homo sapiens Tetraspanin-32 Proteins 0.000 description 3
- 101000612838 Homo sapiens Tetraspanin-7 Proteins 0.000 description 3
- 101000852559 Homo sapiens Thioredoxin Proteins 0.000 description 3
- 101000773122 Homo sapiens Thioredoxin domain-containing protein 5 Proteins 0.000 description 3
- 101000658138 Homo sapiens Thymosin beta-10 Proteins 0.000 description 3
- 101000625739 Homo sapiens Thymosin beta-15A Proteins 0.000 description 3
- 101000802356 Homo sapiens Tight junction protein ZO-1 Proteins 0.000 description 3
- 101001041525 Homo sapiens Transcription factor 12 Proteins 0.000 description 3
- 101000976959 Homo sapiens Transcription factor 4 Proteins 0.000 description 3
- 101000596771 Homo sapiens Transcription factor 7-like 2 Proteins 0.000 description 3
- 101000666385 Homo sapiens Transcription factor Dp-2 Proteins 0.000 description 3
- 101001028730 Homo sapiens Transcription factor JunB Proteins 0.000 description 3
- 101000651211 Homo sapiens Transcription factor PU.1 Proteins 0.000 description 3
- 101000642514 Homo sapiens Transcription factor SOX-4 Proteins 0.000 description 3
- 101000674742 Homo sapiens Transcription initiation factor TFIID subunit 5 Proteins 0.000 description 3
- 101001137337 Homo sapiens Transcriptional activator protein Pur-alpha Proteins 0.000 description 3
- 101000796673 Homo sapiens Transformation/transcription domain-associated protein Proteins 0.000 description 3
- 101000836154 Homo sapiens Transforming acidic coiled-coil-containing protein 1 Proteins 0.000 description 3
- 101000836150 Homo sapiens Transforming acidic coiled-coil-containing protein 3 Proteins 0.000 description 3
- 101000649120 Homo sapiens Translocating chain-associated membrane protein 2 Proteins 0.000 description 3
- 101000658574 Homo sapiens Transmembrane 4 L6 family member 1 Proteins 0.000 description 3
- 101000851627 Homo sapiens Transmembrane channel-like protein 6 Proteins 0.000 description 3
- 101000640723 Homo sapiens Transmembrane protein 131-like Proteins 0.000 description 3
- 101000655155 Homo sapiens Transmembrane protein 158 Proteins 0.000 description 3
- 101000597830 Homo sapiens Transmembrane protein 87A Proteins 0.000 description 3
- 101000648491 Homo sapiens Transportin-1 Proteins 0.000 description 3
- 101000680652 Homo sapiens Tripartite motif-containing protein 14 Proteins 0.000 description 3
- 101000851892 Homo sapiens Tropomyosin beta chain Proteins 0.000 description 3
- 101000652472 Homo sapiens Tubulin beta-6 chain Proteins 0.000 description 3
- 101000830744 Homo sapiens Tubulin polyglutamylase complex subunit 2 Proteins 0.000 description 3
- 101000835622 Homo sapiens Tubulin-specific chaperone A Proteins 0.000 description 3
- 101000800807 Homo sapiens Tumor necrosis factor alpha-induced protein 8 Proteins 0.000 description 3
- 101000762128 Homo sapiens Tumor suppressor candidate 3 Proteins 0.000 description 3
- 101000587313 Homo sapiens Tyrosine-protein kinase Srms Proteins 0.000 description 3
- 101000863873 Homo sapiens Tyrosine-protein phosphatase non-receptor type substrate 1 Proteins 0.000 description 3
- 101000939529 Homo sapiens UDP-glucose 6-dehydrogenase Proteins 0.000 description 3
- 101000748161 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 34 Proteins 0.000 description 3
- 101000809257 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 4 Proteins 0.000 description 3
- 101000809513 Homo sapiens Ubiquitin recognition factor in ER-associated degradation protein 1 Proteins 0.000 description 3
- 101000807344 Homo sapiens Ubiquitin-conjugating enzyme E2 A Proteins 0.000 description 3
- 101000837565 Homo sapiens Ubiquitin-conjugating enzyme E2 S Proteins 0.000 description 3
- 101000761740 Homo sapiens Ubiquitin/ISG15-conjugating enzyme E2 L6 Proteins 0.000 description 3
- 101000982054 Homo sapiens Unconventional myosin-Ib Proteins 0.000 description 3
- 101000760337 Homo sapiens Urokinase plasminogen activator surface receptor Proteins 0.000 description 3
- 101001061851 Homo sapiens V(D)J recombination-activating protein 2 Proteins 0.000 description 3
- 101000850434 Homo sapiens V-type proton ATPase subunit B, brain isoform Proteins 0.000 description 3
- 101000667110 Homo sapiens Vacuolar protein sorting-associated protein 13B Proteins 0.000 description 3
- 101000955962 Homo sapiens Vacuolar protein sorting-associated protein 51 homolog Proteins 0.000 description 3
- 101000860430 Homo sapiens Versican core protein Proteins 0.000 description 3
- 101000666934 Homo sapiens Very low-density lipoprotein receptor Proteins 0.000 description 3
- 101000953818 Homo sapiens Vesicular, overexpressed in cancer, prosurvival protein 1 Proteins 0.000 description 3
- 101000983936 Homo sapiens Voltage-dependent L-type calcium channel subunit beta-3 Proteins 0.000 description 3
- 101000867850 Homo sapiens Voltage-dependent T-type calcium channel subunit alpha-1G Proteins 0.000 description 3
- 101000965705 Homo sapiens Volume-regulated anion channel subunit LRRC8D Proteins 0.000 description 3
- 101000650141 Homo sapiens WAS/WASL-interacting protein family member 1 Proteins 0.000 description 3
- 101000954798 Homo sapiens WD repeat domain phosphoinositide-interacting protein 2 Proteins 0.000 description 3
- 101000760284 Homo sapiens Zinc finger protein 32 Proteins 0.000 description 3
- 101000760227 Homo sapiens Zinc finger protein 335 Proteins 0.000 description 3
- 101000730643 Homo sapiens Zinc finger protein PLAGL1 Proteins 0.000 description 3
- 101000976393 Homo sapiens Zyxin Proteins 0.000 description 3
- 101000802094 Homo sapiens mRNA decay activator protein ZFP36L1 Proteins 0.000 description 3
- 101000766035 Homo sapiens tRNA (guanine(37)-N1)-methyltransferase Proteins 0.000 description 3
- 102100027735 Hyaluronan mediated motility receptor Human genes 0.000 description 3
- 108010007666 IMP cyclohydrolase Proteins 0.000 description 3
- 108010050332 IQ motif containing GTPase activating protein 1 Proteins 0.000 description 3
- 102100026539 Induced myeloid leukemia cell differentiation protein Mcl-1 Human genes 0.000 description 3
- 102100020796 Inosine 5'-monophosphate cyclohydrolase Human genes 0.000 description 3
- 102100025891 Inosine-5'-monophosphate dehydrogenase 2 Human genes 0.000 description 3
- 102100026724 Inositol polyphosphate 5-phosphatase OCRL Human genes 0.000 description 3
- 102100025092 Insulin receptor substrate 2 Human genes 0.000 description 3
- 102100022710 Insulin-like growth factor-binding protein 2 Human genes 0.000 description 3
- 102100037877 Intercellular adhesion molecule 1 Human genes 0.000 description 3
- 102100039953 Interferon-induced protein 44-like Human genes 0.000 description 3
- 102100040035 Interferon-induced transmembrane protein 3 Human genes 0.000 description 3
- 102100039850 Interferon-induced very large GTPase 1 Human genes 0.000 description 3
- 102100020793 Interleukin-13 receptor subunit alpha-2 Human genes 0.000 description 3
- 108010017411 Interleukin-21 Receptors Proteins 0.000 description 3
- 102100030699 Interleukin-21 receptor Human genes 0.000 description 3
- 102100039078 Interleukin-4 receptor subunit alpha Human genes 0.000 description 3
- 102100037795 Interleukin-6 receptor subunit beta Human genes 0.000 description 3
- 102100022489 Intraflagellar transport protein 46 homolog Human genes 0.000 description 3
- 102100023408 KH domain-containing, RNA-binding, signal transduction-associated protein 1 Human genes 0.000 description 3
- 102100037691 Kinesin-like protein KIF20B Human genes 0.000 description 3
- 108050007394 Kinesin-like protein KIF20B Proteins 0.000 description 3
- 102100027942 Kinesin-like protein KIFC1 Human genes 0.000 description 3
- 102100033467 L-selectin Human genes 0.000 description 3
- 102100027448 Laminin subunit beta-1 Human genes 0.000 description 3
- 102100024629 Laminin subunit beta-3 Human genes 0.000 description 3
- 102100032657 Leucine-rich repeat neuronal protein 3 Human genes 0.000 description 3
- 102100027168 Leucine-rich repeat-containing protein 41 Human genes 0.000 description 3
- 102100032913 Leukocyte surface antigen CD47 Human genes 0.000 description 3
- 102100025889 Lon protease homolog 2, peroxisomal Human genes 0.000 description 3
- 101710167388 Lon protease homolog, mitochondrial Proteins 0.000 description 3
- 102100029204 Low affinity immunoglobulin gamma Fc region receptor II-a Human genes 0.000 description 3
- 102100029206 Low affinity immunoglobulin gamma Fc region receptor II-c Human genes 0.000 description 3
- 102100027120 Low-density lipoprotein receptor-related protein 12 Human genes 0.000 description 3
- 108010066789 Lymphocyte Antigen 96 Proteins 0.000 description 3
- 102000018671 Lymphocyte Antigen 96 Human genes 0.000 description 3
- 102100033472 Lysosomal-trafficking regulator Human genes 0.000 description 3
- 102100025307 M-phase phosphoprotein 6 Human genes 0.000 description 3
- 102100028241 MAP7 domain-containing protein 1 Human genes 0.000 description 3
- 108010018650 MEF2 Transcription Factors Proteins 0.000 description 3
- 102100028111 Magnesium transporter NIPA2 Human genes 0.000 description 3
- 102100025833 Major centromere autoantigen B Human genes 0.000 description 3
- 102100038884 Major vault protein Human genes 0.000 description 3
- 102100039742 Malate dehydrogenase, mitochondrial Human genes 0.000 description 3
- 102100030775 Matrix-remodeling-associated protein 7 Human genes 0.000 description 3
- 102100039479 Melanoma-associated antigen B2 Human genes 0.000 description 3
- 102100026158 Melanophilin Human genes 0.000 description 3
- 108010023335 Member 2 Subfamily B ATP Binding Cassette Transporter Proteins 0.000 description 3
- 102100032280 Metal cation symporter ZIP14 Human genes 0.000 description 3
- 102100039364 Metalloproteinase inhibitor 1 Human genes 0.000 description 3
- 102100037510 Metallothionein-1E Human genes 0.000 description 3
- 102100031783 Metallothionein-1M Human genes 0.000 description 3
- 102100030508 Methyltransferase-like protein 17, mitochondrial Human genes 0.000 description 3
- 102100031339 Microtubule cross-linking factor 1 Human genes 0.000 description 3
- 102100032485 Microtubule-associated protein 9 Human genes 0.000 description 3
- 102100024177 Microtubule-associated proteins 1A/1B light chain 3B Human genes 0.000 description 3
- 102100027666 Midasin Human genes 0.000 description 3
- 108010009513 Mitochondrial Aldehyde Dehydrogenase Proteins 0.000 description 3
- 102100037824 Mitochondrial import inner membrane translocase subunit Tim17-A Human genes 0.000 description 3
- 102100034007 Mitochondrial import receptor subunit TOM20 homolog Human genes 0.000 description 3
- 102100037148 Mitochondrial inner membrane protein OXA1L Human genes 0.000 description 3
- 102100030108 Mitochondrial ornithine transporter 1 Human genes 0.000 description 3
- 102100040200 Mitochondrial uncoupling protein 2 Human genes 0.000 description 3
- 102100024193 Mitogen-activated protein kinase 1 Human genes 0.000 description 3
- 102100029814 Monoglyceride lipase Human genes 0.000 description 3
- 102100025748 Mothers against decapentaplegic homolog 3 Human genes 0.000 description 3
- 101710143111 Mothers against decapentaplegic homolog 3 Proteins 0.000 description 3
- 101001067395 Mus musculus Phospholipid scramblase 1 Proteins 0.000 description 3
- 102100038750 Myc-associated zinc finger protein Human genes 0.000 description 3
- 101001033610 Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) Inosine-5'-monophosphate dehydrogenase Proteins 0.000 description 3
- 102100021270 Myelin protein zero-like protein 1 Human genes 0.000 description 3
- 102100039229 Myocyte-specific enhancer factor 2C Human genes 0.000 description 3
- 102100035083 Myoferlin Human genes 0.000 description 3
- 102100031787 Myosin regulatory light polypeptide 9 Human genes 0.000 description 3
- 108010063737 Myristoylated Alanine-Rich C Kinase Substrate Proteins 0.000 description 3
- 102000015695 Myristoylated Alanine-Rich C Kinase Substrate Human genes 0.000 description 3
- 102100022365 NAD(P)H dehydrogenase [quinone] 1 Human genes 0.000 description 3
- 102100023214 NADH dehydrogenase [ubiquinone] iron-sulfur protein 6, mitochondrial Human genes 0.000 description 3
- 102100039337 NF-kappa-B inhibitor alpha Human genes 0.000 description 3
- 102100029565 NPC intracellular cholesterol transporter 1 Human genes 0.000 description 3
- 101710104492 NUP210 Proteins 0.000 description 3
- 102000003729 Neprilysin Human genes 0.000 description 3
- 108090000028 Neprilysin Proteins 0.000 description 3
- 102100023307 Nesprin-3 Human genes 0.000 description 3
- 102100037031 Neuroblastoma breakpoint family member 15 Human genes 0.000 description 3
- 102100039908 Neuronal acetylcholine receptor subunit alpha-3 Human genes 0.000 description 3
- 102100037371 Nidogen-2 Human genes 0.000 description 3
- 102100027967 Nodal modulator 2 Human genes 0.000 description 3
- 102100031346 Non-histone chromosomal protein HMG-17 Human genes 0.000 description 3
- 102100035402 Nuclear RNA export factor 1 Human genes 0.000 description 3
- 102100023904 Nuclear autoantigenic sperm protein Human genes 0.000 description 3
- 101710149564 Nuclear autoantigenic sperm protein Proteins 0.000 description 3
- 102100025638 Nuclear body protein SP140 Human genes 0.000 description 3
- 102100022163 Nuclear factor interleukin-3-regulated protein Human genes 0.000 description 3
- 102100027586 Nuclear pore complex protein Nup88 Human genes 0.000 description 3
- 102100035570 Nuclear pore membrane glycoprotein 210 Human genes 0.000 description 3
- 102100030569 Nuclear receptor corepressor 2 Human genes 0.000 description 3
- 102100023171 Nuclear receptor subfamily 1 group D member 2 Human genes 0.000 description 3
- 102100029101 Nucleolar complex protein 2 homolog Human genes 0.000 description 3
- 102100037052 Nucleolar protein 56 Human genes 0.000 description 3
- 102100022740 Nucleolar protein 8 Human genes 0.000 description 3
- 102100022395 Nucleosome assembly protein 1-like 2 Human genes 0.000 description 3
- 102100037214 Orotidine 5'-phosphate decarboxylase Human genes 0.000 description 3
- 102100037603 P2X purinoceptor 5 Human genes 0.000 description 3
- 108010032788 PAX6 Transcription Factor Proteins 0.000 description 3
- 101150099424 PDIA4 gene Proteins 0.000 description 3
- 101700020768 PWP1 Proteins 0.000 description 3
- 102100038993 Pachytene checkpoint protein 2 homolog Human genes 0.000 description 3
- 102100037506 Paired box protein Pax-6 Human genes 0.000 description 3
- 102100035467 Paraneoplastic antigen Ma2 Human genes 0.000 description 3
- 102100027913 Peptidyl-prolyl cis-trans isomerase FKBP1A Human genes 0.000 description 3
- 102100038809 Peptidyl-prolyl cis-trans isomerase FKBP9 Human genes 0.000 description 3
- 102100029734 Periodic tryptophan protein 1 homolog Human genes 0.000 description 3
- 102100021797 Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 1 Human genes 0.000 description 3
- 102100039472 Phosphoinositide-3-kinase-interacting protein 1 Human genes 0.000 description 3
- 102100030450 Phospholipid phosphatase 3 Human genes 0.000 description 3
- 102100034627 Phospholipid scramblase 1 Human genes 0.000 description 3
- 102100024494 Phospholipid scramblase 4 Human genes 0.000 description 3
- 102100039446 Platelet-activating factor acetylhydrolase IB subunit alpha1 Human genes 0.000 description 3
- 102100036265 Pleckstrin homology domain-containing family O member 1 Human genes 0.000 description 3
- 102100030887 Pleckstrin homology-like domain family A member 1 Human genes 0.000 description 3
- 102100030470 Pleckstrin-2 Human genes 0.000 description 3
- 102100034961 Poly(rC)-binding protein 2 Human genes 0.000 description 3
- 102100033566 Polycomb complex protein BMI-1 Human genes 0.000 description 3
- 102100039695 Polypeptide N-acetylgalactosaminyltransferase 6 Human genes 0.000 description 3
- 102100037935 Polyubiquitin-C Human genes 0.000 description 3
- 102100027921 Polyunsaturated fatty acid lipoxygenase ALOX15B Human genes 0.000 description 3
- 101710163348 Potassium voltage-gated channel subfamily H member 8 Proteins 0.000 description 3
- 102100029522 Pre-mRNA-processing factor 19 Human genes 0.000 description 3
- 102100021231 Pre-mRNA-processing-splicing factor 8 Human genes 0.000 description 3
- 102100025513 Prefoldin subunit 5 Human genes 0.000 description 3
- 102100037434 Probable ATP-dependent RNA helicase DDX5 Human genes 0.000 description 3
- 102100038011 Probable dimethyladenosine transferase Human genes 0.000 description 3
- 102100026534 Procathepsin L Human genes 0.000 description 3
- 102100022555 Profilin-2 Human genes 0.000 description 3
- 102100034144 Prolyl 3-hydroxylase 1 Human genes 0.000 description 3
- 102100040477 Prolyl 4-hydroxylase subunit alpha-1 Human genes 0.000 description 3
- 102100030484 Prostaglandin E synthase 2 Human genes 0.000 description 3
- 108090000748 Prostaglandin-E Synthases Proteins 0.000 description 3
- 102100039279 Prostate tumor-overexpressed gene 1 protein Human genes 0.000 description 3
- 102100026729 Protein FAM216A Human genes 0.000 description 3
- 102100023602 Protein Hook homolog 1 Human genes 0.000 description 3
- 102100025733 Protein Jumonji Human genes 0.000 description 3
- 108010003506 Protein Kinase D2 Proteins 0.000 description 3
- 102100023076 Protein Niban 1 Human genes 0.000 description 3
- 102100023087 Protein S100-A4 Human genes 0.000 description 3
- 102100031751 Protein SHQ1 homolog Human genes 0.000 description 3
- 102100028588 Protein ZNRD2 Human genes 0.000 description 3
- 102100022988 Protein arginine N-methyltransferase 2 Human genes 0.000 description 3
- 102100034607 Protein arginine N-methyltransferase 5 Human genes 0.000 description 3
- 102100036490 Protein diaphanous homolog 1 Human genes 0.000 description 3
- 102100037097 Protein disulfide-isomerase A3 Human genes 0.000 description 3
- 102100037089 Protein disulfide-isomerase A4 Human genes 0.000 description 3
- 102100021556 Protein kinase C eta type Human genes 0.000 description 3
- 102100038669 Protein quaking Human genes 0.000 description 3
- 102100036306 Protein transport protein Sec61 subunit gamma Human genes 0.000 description 3
- 102100024601 Protein tyrosine phosphatase type IVA 3 Human genes 0.000 description 3
- 102100037925 Prothymosin alpha Human genes 0.000 description 3
- 102100033810 RAC-alpha serine/threonine-protein kinase Human genes 0.000 description 3
- 102100023488 RAS guanyl-releasing protein 2 Human genes 0.000 description 3
- 102100037011 RNA cytidine acetyltransferase Human genes 0.000 description 3
- 102100023433 RNA-binding protein RO60 Human genes 0.000 description 3
- 102100025052 RNA-binding protein Raly Human genes 0.000 description 3
- 102100033135 RNA-binding protein with multiple splicing Human genes 0.000 description 3
- 102100039323 RNA-binding protein with serine-rich domain 1 Human genes 0.000 description 3
- 102100029548 Rab3 GTPase-activating protein catalytic subunit Human genes 0.000 description 3
- 102100031543 Rab9 effector protein with kelch motifs Human genes 0.000 description 3
- 102100036900 Radiation-inducible immediate-early gene IEX-1 Human genes 0.000 description 3
- 102100034419 Ras GTPase-activating-like protein IQGAP1 Human genes 0.000 description 3
- 102100034418 Ras GTPase-activating-like protein IQGAP2 Human genes 0.000 description 3
- 102100024683 Ras-related protein R-Ras Human genes 0.000 description 3
- 102100025003 Ras-related protein R-Ras2 Human genes 0.000 description 3
- 102100027838 Ras-related protein Rab-31 Human genes 0.000 description 3
- 102100033100 Ras-related protein Rab-7L1 Human genes 0.000 description 3
- 102100030705 Ras-related protein Rap-1b Human genes 0.000 description 3
- 108010079933 Receptor-Interacting Protein Serine-Threonine Kinase 2 Proteins 0.000 description 3
- 102100022502 Receptor-interacting serine/threonine-protein kinase 2 Human genes 0.000 description 3
- 102100030854 Receptor-transporting protein 4 Human genes 0.000 description 3
- 102100037415 Regulator of G-protein signaling 3 Human genes 0.000 description 3
- 101710140411 Regulator of G-protein signaling 3 Proteins 0.000 description 3
- 102100035542 Regulator of cell cycle RGCC Human genes 0.000 description 3
- 102100037855 Replication factor C subunit 3 Human genes 0.000 description 3
- 102100030541 Replication factor C subunit 5 Human genes 0.000 description 3
- 102100025335 Reticulocalbin-1 Human genes 0.000 description 3
- 108091008770 Rev-ErbAß Proteins 0.000 description 3
- 102100035759 Rho GTPase-activating protein 25 Human genes 0.000 description 3
- 102100032023 Rho family-interacting cell polarization regulator 2 Human genes 0.000 description 3
- 102100039640 Rho-related GTP-binding protein RhoE Human genes 0.000 description 3
- 102100026386 Ribonuclease K6 Human genes 0.000 description 3
- 102100035127 Ribosomal protein 63, mitochondrial Human genes 0.000 description 3
- 102100023542 Ribosome-binding protein 1 Human genes 0.000 description 3
- 102100025369 Runt-related transcription factor 3 Human genes 0.000 description 3
- 108010055623 S-Phase Kinase-Associated Proteins Proteins 0.000 description 3
- 102100034374 S-phase kinase-associated protein 2 Human genes 0.000 description 3
- 108010085149 S100 Calcium-Binding Protein A4 Proteins 0.000 description 3
- 102100032278 SAC3 domain-containing protein 1 Human genes 0.000 description 3
- 108091005487 SCARB1 Proteins 0.000 description 3
- 102100021778 SH2B adapter protein 3 Human genes 0.000 description 3
- 102100032027 SH3 domain and tetratricopeptide repeat-containing protein 1 Human genes 0.000 description 3
- 102000012978 SLC1A4 Human genes 0.000 description 3
- 108091006788 SLC20A1 Proteins 0.000 description 3
- 108091006411 SLC25A15 Proteins 0.000 description 3
- 108091006715 SLC25A5 Proteins 0.000 description 3
- 108091006944 SLC39A14 Proteins 0.000 description 3
- 108091006938 SLC39A6 Proteins 0.000 description 3
- 108091006995 SLC43A3 Proteins 0.000 description 3
- 108091006260 SLC4A2 Proteins 0.000 description 3
- 108091006241 SLC7A11 Proteins 0.000 description 3
- 108091006237 SLC7A6 Proteins 0.000 description 3
- 102100023521 SPATS2-like protein Human genes 0.000 description 3
- 108010044012 STAT1 Transcription Factor Proteins 0.000 description 3
- 108010019992 STAT4 Transcription Factor Proteins 0.000 description 3
- 102000005886 STAT4 Transcription Factor Human genes 0.000 description 3
- 101150058731 STAT5A gene Proteins 0.000 description 3
- 102100027732 Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Human genes 0.000 description 3
- 102100037118 Scavenger receptor class B member 1 Human genes 0.000 description 3
- 101000702553 Schistosoma mansoni Antigen Sm21.7 Proteins 0.000 description 3
- 101000714192 Schistosoma mansoni Tegument antigen Proteins 0.000 description 3
- 102100032781 Semaphorin-4G Human genes 0.000 description 3
- 102100027981 Septin-7 Human genes 0.000 description 3
- 102100033835 Serine protease 23 Human genes 0.000 description 3
- 102100032895 Serine-rich coiled-coil domain-containing protein 2 Human genes 0.000 description 3
- 102100029703 Serine/arginine-rich splicing factor 5 Human genes 0.000 description 3
- 102100029287 Serine/arginine-rich splicing factor 7 Human genes 0.000 description 3
- 102100037312 Serine/threonine-protein kinase D2 Human genes 0.000 description 3
- 102100022109 Serine/threonine-protein kinase RIO3 Human genes 0.000 description 3
- 102100039987 Serine/threonine-protein kinase ULK2 Human genes 0.000 description 3
- 102100036120 Serine/threonine-protein kinase pim-2 Human genes 0.000 description 3
- 102100025512 Serpin B6 Human genes 0.000 description 3
- 102100022056 Serum response factor Human genes 0.000 description 3
- 102100029904 Signal transducer and activator of transcription 1-alpha/beta Human genes 0.000 description 3
- 102100024481 Signal transducer and activator of transcription 5A Human genes 0.000 description 3
- 102100034683 Small nuclear ribonucleoprotein-associated proteins B and B' Human genes 0.000 description 3
- 102100029797 Sodium-dependent phosphate transporter 1 Human genes 0.000 description 3
- 102100032207 Solute carrier family 35 member G2 Human genes 0.000 description 3
- 102100022322 Sperm protein associated with the nucleus on the X chromosome C Human genes 0.000 description 3
- 102100032800 Spermine oxidase Human genes 0.000 description 3
- 102100035748 Squamous cell carcinoma antigen recognized by T-cells 3 Human genes 0.000 description 3
- 102100030510 Stanniocalcin-2 Human genes 0.000 description 3
- 102100037172 Store-operated calcium entry-associated regulatory factor Human genes 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 102100032891 Superoxide dismutase [Mn], mitochondrial Human genes 0.000 description 3
- 102100029454 T cell receptor alpha chain MC.7.G5 Human genes 0.000 description 3
- 102100040365 T-cell acute lymphocytic leukemia protein 1 Human genes 0.000 description 3
- 102100035794 T-cell surface glycoprotein CD3 epsilon chain Human genes 0.000 description 3
- 102100034928 T-cell surface glycoprotein CD8 beta chain Human genes 0.000 description 3
- 102100027213 T-cell-specific surface glycoprotein CD28 Human genes 0.000 description 3
- 102100033447 T-lymphocyte surface antigen Ly-9 Human genes 0.000 description 3
- 102100025223 TBC1 domain family member 31 Human genes 0.000 description 3
- 102100037671 TRAF2 and NCK-interacting protein kinase Human genes 0.000 description 3
- 102100040128 TRAF3-interacting JNK-activating modulator Human genes 0.000 description 3
- 102000003565 TRPV2 Human genes 0.000 description 3
- 102100035260 TSC22 domain family protein 3 Human genes 0.000 description 3
- 102100038311 Terminal nucleotidyltransferase 5A Human genes 0.000 description 3
- 102100040874 Tetraspanin-3 Human genes 0.000 description 3
- 102100034915 Tetraspanin-32 Human genes 0.000 description 3
- 102100040952 Tetraspanin-7 Human genes 0.000 description 3
- 102100037495 Thiamin pyrophosphokinase 1 Human genes 0.000 description 3
- 101710203399 Thiamin pyrophosphokinase 1 Proteins 0.000 description 3
- 102100036407 Thioredoxin Human genes 0.000 description 3
- 102100030269 Thioredoxin domain-containing protein 5 Human genes 0.000 description 3
- 102100027624 Thymidine kinase 2, mitochondrial Human genes 0.000 description 3
- 102100034998 Thymosin beta-10 Human genes 0.000 description 3
- 102100024702 Thymosin beta-15A Human genes 0.000 description 3
- 102100034686 Tight junction protein ZO-1 Human genes 0.000 description 3
- 102000019347 Tob1 Human genes 0.000 description 3
- 102100021123 Transcription factor 12 Human genes 0.000 description 3
- 102100023489 Transcription factor 4 Human genes 0.000 description 3
- 102100038312 Transcription factor Dp-2 Human genes 0.000 description 3
- 102100037168 Transcription factor JunB Human genes 0.000 description 3
- 102100027654 Transcription factor PU.1 Human genes 0.000 description 3
- 102100036693 Transcription factor SOX-4 Human genes 0.000 description 3
- 102100021230 Transcription initiation factor TFIID subunit 5 Human genes 0.000 description 3
- 102100022012 Transcription intermediary factor 1-beta Human genes 0.000 description 3
- 101710177718 Transcription intermediary factor 1-beta Proteins 0.000 description 3
- 102100035715 Transcriptional activator protein Pur-alpha Human genes 0.000 description 3
- 102100027049 Transforming acidic coiled-coil-containing protein 1 Human genes 0.000 description 3
- 102100027048 Transforming acidic coiled-coil-containing protein 3 Human genes 0.000 description 3
- 102100027957 Translocating chain-associated membrane protein 2 Human genes 0.000 description 3
- 102100034902 Transmembrane 4 L6 family member 1 Human genes 0.000 description 3
- 102100036810 Transmembrane channel-like protein 6 Human genes 0.000 description 3
- 102100033853 Transmembrane protein 131-like Human genes 0.000 description 3
- 102100035303 Transmembrane protein 87A Human genes 0.000 description 3
- 102100028748 Transportin-1 Human genes 0.000 description 3
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 description 3
- 102000011408 Tripartite Motif Proteins Human genes 0.000 description 3
- 108010023649 Tripartite Motif Proteins Proteins 0.000 description 3
- 102100022350 Tripartite motif-containing protein 14 Human genes 0.000 description 3
- 108010050144 Triptorelin Pamoate Proteins 0.000 description 3
- 102100036471 Tropomyosin beta chain Human genes 0.000 description 3
- 101150077905 Trpv2 gene Proteins 0.000 description 3
- 102100030303 Tubulin beta-6 chain Human genes 0.000 description 3
- 102100024969 Tubulin polyglutamylase complex subunit 2 Human genes 0.000 description 3
- 102100026477 Tubulin-specific chaperone A Human genes 0.000 description 3
- 108010047933 Tumor Necrosis Factor alpha-Induced Protein 3 Proteins 0.000 description 3
- 102100024596 Tumor necrosis factor alpha-induced protein 3 Human genes 0.000 description 3
- 102100033649 Tumor necrosis factor alpha-induced protein 8 Human genes 0.000 description 3
- 102100024248 Tumor suppressor candidate 3 Human genes 0.000 description 3
- 102100035221 Tyrosine-protein kinase Fyn Human genes 0.000 description 3
- 102100029654 Tyrosine-protein kinase Srms Human genes 0.000 description 3
- 102100029948 Tyrosine-protein phosphatase non-receptor type substrate 1 Human genes 0.000 description 3
- 102100038413 UDP-N-acetylglucosamine-dolichyl-phosphate N-acetylglucosaminephosphotransferase Human genes 0.000 description 3
- 102100029640 UDP-glucose 6-dehydrogenase Human genes 0.000 description 3
- 108010005656 Ubiquitin Thiolesterase Proteins 0.000 description 3
- 102100040096 Ubiquitin carboxyl-terminal hydrolase 34 Human genes 0.000 description 3
- 102100038463 Ubiquitin carboxyl-terminal hydrolase 4 Human genes 0.000 description 3
- 102100024250 Ubiquitin carboxyl-terminal hydrolase CYLD Human genes 0.000 description 3
- 102100025038 Ubiquitin carboxyl-terminal hydrolase isozyme L1 Human genes 0.000 description 3
- 102100038833 Ubiquitin recognition factor in ER-associated degradation protein 1 Human genes 0.000 description 3
- 102100037261 Ubiquitin-conjugating enzyme E2 A Human genes 0.000 description 3
- 102100028718 Ubiquitin-conjugating enzyme E2 S Human genes 0.000 description 3
- 102100024843 Ubiquitin/ISG15-conjugating enzyme E2 L6 Human genes 0.000 description 3
- 102100026776 Unconventional myosin-Ib Human genes 0.000 description 3
- 108010021111 Uncoupling Protein 2 Proteins 0.000 description 3
- 102100024689 Urokinase plasminogen activator surface receptor Human genes 0.000 description 3
- 102100029591 V(D)J recombination-activating protein 2 Human genes 0.000 description 3
- 102100033476 V-type proton ATPase subunit B, brain isoform Human genes 0.000 description 3
- 101150045640 VWF gene Proteins 0.000 description 3
- 102100021164 Vasodilator-stimulated phosphoprotein Human genes 0.000 description 3
- 102100028437 Versican core protein Human genes 0.000 description 3
- 102100039066 Very low-density lipoprotein receptor Human genes 0.000 description 3
- 102100037582 Vesicular, overexpressed in cancer, prosurvival protein 1 Human genes 0.000 description 3
- 102100025838 Voltage-dependent L-type calcium channel subunit beta-3 Human genes 0.000 description 3
- 102100040987 Volume-regulated anion channel subunit LRRC8D Human genes 0.000 description 3
- 102100027538 WAS/WASL-interacting protein family member 1 Human genes 0.000 description 3
- 102100037050 WD repeat domain phosphoinositide-interacting protein 2 Human genes 0.000 description 3
- 108700031763 Xeroderma Pigmentosum Group D Proteins 0.000 description 3
- 102100032803 Y+L amino acid transporter 2 Human genes 0.000 description 3
- 102100024703 Zinc finger protein 32 Human genes 0.000 description 3
- 102100024773 Zinc finger protein 335 Human genes 0.000 description 3
- 102100032570 Zinc finger protein PLAGL1 Human genes 0.000 description 3
- 102100023144 Zinc transporter ZIP6 Human genes 0.000 description 3
- 102100023895 Zyxin Human genes 0.000 description 3
- ZUPXXZAVUHFCNV-UHFFFAOYSA-N [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [5-(3-carbamoyl-4h-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;potassium Chemical compound [K].C1=CCC(C(=O)N)=CN1C1C(O)C(O)C(COP(O)(=O)OP(O)(=O)OCC2C(C(O)C(O2)N2C3=NC=NC(N)=C3N=C2)O)O1 ZUPXXZAVUHFCNV-UHFFFAOYSA-N 0.000 description 3
- 239000000556 agonist Substances 0.000 description 3
- SHGAZHPCJJPHSC-YCNIQYBTSA-N all-trans-retinoic acid Chemical compound OC(=O)\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-YCNIQYBTSA-N 0.000 description 3
- 108010029483 alpha 1 Chain Collagen Type I Proteins 0.000 description 3
- 229960002756 azacitidine Drugs 0.000 description 3
- 150000003851 azoles Chemical class 0.000 description 3
- 229960000997 bicalutamide Drugs 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- BBZDXMBRAFTCAA-AREMUKBSSA-N carzelesin Chemical compound C1=2NC=C(C)C=2C([C@H](CCl)CN2C(=O)C=3NC4=CC=C(C=C4C=3)NC(=O)C3=CC4=CC=C(C=C4O3)N(CC)CC)=C2C=C1OC(=O)NC1=CC=CC=C1 BBZDXMBRAFTCAA-AREMUKBSSA-N 0.000 description 3
- 229950007509 carzelesin Drugs 0.000 description 3
- 239000013068 control sample Substances 0.000 description 3
- 101150118453 ctbp-1 gene Proteins 0.000 description 3
- 229960004397 cyclophosphamide Drugs 0.000 description 3
- 238000003745 diagnosis Methods 0.000 description 3
- 229950002389 diaziquone Drugs 0.000 description 3
- 108010043113 dolichyl-phosphate alpha-N-acetylglucosaminyltransferase Proteins 0.000 description 3
- 108010018033 endothelial PAS domain-containing protein 1 Proteins 0.000 description 3
- HCZKYJDFEPMADG-UHFFFAOYSA-N erythro-nordihydroguaiaretic acid Natural products C=1C=C(O)C(O)=CC=1CC(C)C(C)CC1=CC=C(O)C(O)=C1 HCZKYJDFEPMADG-UHFFFAOYSA-N 0.000 description 3
- 239000000328 estrogen antagonist Substances 0.000 description 3
- GXHVDDBBWDCOTF-UHFFFAOYSA-N ever-1 Natural products CCC(C)C(=O)OC1C(CC(C)C23OC(C)(C)C(CC(OC(=O)c4cccnc4)C12COC(=O)C)C3OC(=O)C)OC(=O)C GXHVDDBBWDCOTF-UHFFFAOYSA-N 0.000 description 3
- 229950011548 fadrozole Drugs 0.000 description 3
- 229950003662 fenretinide Drugs 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- 108010027263 homeobox protein HOXA9 Proteins 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 108010028309 kalinin Proteins 0.000 description 3
- UGFHIPBXIWJXNA-UHFFFAOYSA-N liarozole Chemical compound ClC1=CC=CC(C(C=2C=C3NC=NC3=CC=2)N2C=NC=C2)=C1 UGFHIPBXIWJXNA-UHFFFAOYSA-N 0.000 description 3
- 229950007056 liarozole Drugs 0.000 description 3
- 102100034702 mRNA decay activator protein ZFP36L1 Human genes 0.000 description 3
- 229960003951 masoprocol Drugs 0.000 description 3
- HCZKYJDFEPMADG-TXEJJXNPSA-N masoprocol Chemical compound C([C@H](C)[C@H](C)CC=1C=C(O)C(O)=CC=1)C1=CC=C(O)C(O)=C1 HCZKYJDFEPMADG-TXEJJXNPSA-N 0.000 description 3
- BMGQWWVMWDBQGC-IIFHNQTCSA-N midostaurin Chemical compound CN([C@H]1[C@H]([C@]2(C)O[C@@H](N3C4=CC=CC=C4C4=C5C(=O)NCC5=C5C6=CC=CC=C6N2C5=C43)C1)OC)C(=O)C1=CC=CC=C1 BMGQWWVMWDBQGC-IIFHNQTCSA-N 0.000 description 3
- 239000003226 mitogen Substances 0.000 description 3
- 201000001514 prostate carcinoma Diseases 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 210000000130 stem cell Anatomy 0.000 description 3
- 108010045815 superoxide dismutase 2 Proteins 0.000 description 3
- 238000012706 support-vector machine Methods 0.000 description 3
- 102100026250 tRNA (guanine(37)-N1)-methyltransferase Human genes 0.000 description 3
- 229960003087 tioguanine Drugs 0.000 description 3
- MNRILEROXIRVNJ-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=NC=N[C]21 MNRILEROXIRVNJ-UHFFFAOYSA-N 0.000 description 3
- 229950002376 tirapazamine Drugs 0.000 description 3
- QVMPZNRFXAKISM-UHFFFAOYSA-N tirapazamine Chemical compound C1=CC=C2[N+]([O-])=NC(=N)N(O)C2=C1 QVMPZNRFXAKISM-UHFFFAOYSA-N 0.000 description 3
- XFCLJVABOIYOMF-QPLCGJKRSA-N toremifene Chemical compound C1=CC(OCCN(C)C)=CC=C1C(\C=1C=CC=CC=1)=C(\CCCl)C1=CC=CC=C1 XFCLJVABOIYOMF-QPLCGJKRSA-N 0.000 description 3
- 229960005026 toremifene Drugs 0.000 description 3
- 229950003873 triciribine Drugs 0.000 description 3
- HOGVTUZUJGHKPL-HTVVRFAVSA-N triciribine Chemical compound C=12C3=NC=NC=1N(C)N=C(N)C2=CN3[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O HOGVTUZUJGHKPL-HTVVRFAVSA-N 0.000 description 3
- 229960004824 triptorelin Drugs 0.000 description 3
- VXKHXGOKWPXYNA-PGBVPBMZSA-N triptorelin Chemical compound C([C@@H](C(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)NCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 VXKHXGOKWPXYNA-PGBVPBMZSA-N 0.000 description 3
- 229940035893 uracil Drugs 0.000 description 3
- 108010054220 vasodilator-stimulated phosphoprotein Proteins 0.000 description 3
- 229960003895 verteporfin Drugs 0.000 description 3
- ZQFGRJWRSLZCSQ-ZSFNYQMMSA-N verteporfin Chemical compound C=1C([C@@]2([C@H](C(=O)OC)C(=CC=C22)C(=O)OC)C)=NC2=CC(C(=C2C=C)C)=NC2=CC(C(=C2CCC(O)=O)C)=NC2=CC2=NC=1C(C)=C2CCC(=O)OC ZQFGRJWRSLZCSQ-ZSFNYQMMSA-N 0.000 description 3
- 102100036537 von Willebrand factor Human genes 0.000 description 3
- 229960001771 vorozole Drugs 0.000 description 3
- XLMPPFTZALNBFS-INIZCTEOSA-N vorozole Chemical compound C1([C@@H](C2=CC=C3N=NN(C3=C2)C)N2N=CN=C2)=CC=C(Cl)C=C1 XLMPPFTZALNBFS-INIZCTEOSA-N 0.000 description 3
- AADVCYNFEREWOS-UHFFFAOYSA-N (+)-DDM Natural products C=CC=CC(C)C(OC(N)=O)C(C)C(O)C(C)CC(C)=CC(C)C(O)C(C)C=CC(O)CC1OC(=O)C(C)C(O)C1C AADVCYNFEREWOS-UHFFFAOYSA-N 0.000 description 2
- QCHFTSOMWOSFHM-WPRPVWTQSA-N (+)-Pilocarpine Chemical compound C1OC(=O)[C@@H](CC)[C@H]1CC1=CN=CN1C QCHFTSOMWOSFHM-WPRPVWTQSA-N 0.000 description 2
- OPFTUNCRGUEPRZ-UHFFFAOYSA-N (+)-beta-Elemen Natural products CC(=C)C1CCC(C)(C=C)C(C(C)=C)C1 OPFTUNCRGUEPRZ-UHFFFAOYSA-N 0.000 description 2
- BMKDZUISNHGIBY-ZETCQYMHSA-N (+)-dexrazoxane Chemical compound C([C@H](C)N1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 BMKDZUISNHGIBY-ZETCQYMHSA-N 0.000 description 2
- OPFTUNCRGUEPRZ-QLFBSQMISA-N (-)-beta-elemene Chemical compound CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 2
- 229930007631 (-)-perillyl alcohol Natural products 0.000 description 2
- GCPUVEMWOWMALU-HZMBPMFUSA-N (1s,3s)-1-hydroxy-8-methoxy-3-methyl-1,2,3,4-tetrahydrobenzo[a]anthracene-7,12-dione Chemical compound C1[C@H](C)C[C@H](O)C2=C1C=CC1=C2C(=O)C(C=CC=C2OC)=C2C1=O GCPUVEMWOWMALU-HZMBPMFUSA-N 0.000 description 2
- MXABZXILAJGOTL-AUYMZICSSA-N (2S)-N-[(2S)-1-[(2S)-1-[(2S,3S)-1-[(2S)-1-[2-[(2S)-1,3-dihydroxy-1-[(E)-1-hydroxy-1-[(2S,3S)-1-hydroxy-3-methyl-1-[[(2Z,6S,9S,12R)-5,8,11-trihydroxy-9-(2-methylpropyl)-6-propan-2-yl-1-thia-4,7,10-triazacyclotrideca-2,4,7,10-tetraen-12-yl]imino]pentan-2-yl]iminobut-2-en-2-yl]iminopropan-2-yl]imino-2-hydroxyethyl]imino-1,5-dihydroxy-5-iminopentan-2-yl]imino-1-hydroxy-3-methylpentan-2-yl]imino-1-hydroxy-3-methylbutan-2-yl]imino-1-hydroxy-3-phenylpropan-2-yl]-2-[[(2S)-2-[[(2S)-2-[[(Z)-2-[[(2S)-2-[[(Z)-2-[[(2S)-2-[[[(2S)-1-[(Z)-2-[[(2S)-2-(dimethylamino)-1-hydroxypropylidene]amino]but-2-enoyl]pyrrolidin-2-yl]-hydroxymethylidene]amino]-1-hydroxypropylidene]amino]-1-hydroxybut-2-enylidene]amino]-1-hydroxy-3-phenylpropylidene]amino]-1-hydroxybut-2-enylidene]amino]-1-hydroxy-3-methylbutylidene]amino]-1-hydroxypropylidene]amino]pentanediimidic acid Chemical compound CC[C@H](C)[C@H](\N=C(/O)[C@@H](\N=C(/O)[C@H](Cc1ccccc1)\N=C(/O)[C@H](CCC(O)=N)\N=C(/O)[C@H](C)\N=C(/O)[C@@H](\N=C(/O)\C(=C\C)\N=C(/O)[C@H](Cc1ccccc1)\N=C(/O)\C(=C\C)\N=C(/O)[C@H](C)\N=C(/O)[C@@H]1CCCN1C(=O)\C(=C\C)\N=C(/O)[C@H](C)N(C)C)C(C)C)C(C)C)C(\O)=N\[C@@H](CCC(O)=N)C(\O)=N\C\C(O)=N\[C@@H](CO)C(\O)=N\C(=C\C)\C(\O)=N\[C@@H]([C@@H](C)CC)C(\O)=N\[C@H]1CS\C=C/N=C(O)\[C@@H](\N=C(O)/[C@H](CC(C)C)\N=C1\O)C(C)C MXABZXILAJGOTL-AUYMZICSSA-N 0.000 description 2
- DQJCDTNMLBYVAY-ZXXIYAEKSA-N (2S,5R,10R,13R)-16-{[(2R,3S,4R,5R)-3-{[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-5-(ethylamino)-6-hydroxy-2-(hydroxymethyl)oxan-4-yl]oxy}-5-(4-aminobutyl)-10-carbamoyl-2,13-dimethyl-4,7,12,15-tetraoxo-3,6,11,14-tetraazaheptadecan-1-oic acid Chemical compound NCCCC[C@H](C(=O)N[C@@H](C)C(O)=O)NC(=O)CC[C@H](C(N)=O)NC(=O)[C@@H](C)NC(=O)C(C)O[C@@H]1[C@@H](NCC)C(O)O[C@H](CO)[C@H]1O[C@H]1[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O1 DQJCDTNMLBYVAY-ZXXIYAEKSA-N 0.000 description 2
- BUSGWUFLNHIBPT-XYBORKQMSA-N (2e,4e,6e)-7-[(1r,5r,6s)-3-[[(2e,4e)-5-cyclohexylpenta-2,4-dienoyl]amino]-5-hydroxy-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-5-yl]hepta-2,4,6-trienoic acid Chemical compound C([C@]([C@H]1O[C@H]1C1=O)(O)/C=C/C=C/C=C/C(=O)O)=C1NC(=O)\C=C\C=C\C1CCCCC1 BUSGWUFLNHIBPT-XYBORKQMSA-N 0.000 description 2
- LCADVYTXPLBAGB-AUQKUMLUSA-N (2e,4e,6z,8e,10e,14e)-13-hydroxy-n-(1-hydroxypropan-2-yl)-2,10,12,14,16-pentamethyl-18-phenyloctadeca-2,4,6,8,10,14-hexaenamide Chemical compound OCC(C)NC(=O)C(\C)=C\C=C\C=C/C=C/C(/C)=C/C(C)C(O)C(\C)=C\C(C)CCC1=CC=CC=C1 LCADVYTXPLBAGB-AUQKUMLUSA-N 0.000 description 2
- FKHUGQZRBPETJR-RXSRXONKSA-N (2r)-2-[[(4r)-4-[[(2s)-2-[[(2r)-2-[(3r,4r,5s,6r)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoyl]amino]-6-(octadecanoylamino)hexanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(=O)NCCCC[C@H](C(O)=O)NC(=O)CC[C@H](C(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](C)O[C@H]1[C@H](O)[C@@H](CO)OC(O)[C@@H]1NC(C)=O FKHUGQZRBPETJR-RXSRXONKSA-N 0.000 description 2
- RCGXNDQKCXNWLO-WLEIXIPESA-N (2r)-n-[(2s)-5-amino-1-[[(2r,3r)-1-[[(3s,6z,9s,12r,15r,18r,19s)-9-benzyl-15-[(2r)-butan-2-yl]-6-ethylidene-19-methyl-2,5,8,11,14,17-hexaoxo-3,12-di(propan-2-yl)-1-oxa-4,7,10,13,16-pentazacyclononadec-18-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-1-oxopent Chemical compound N([C@@H](CCCN)C(=O)N[C@H]([C@H](C)CC)C(=O)N[C@H]1C(N[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)NC(/C(=O)N[C@H](C(=O)O[C@H]1C)C(C)C)=C\C)C(C)C)[C@H](C)CC)=O)C(=O)[C@H]1CCCN1C(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)CCCC(C)C)C(C)C)[C@@H](C)O)C(C)C)C(C)C RCGXNDQKCXNWLO-WLEIXIPESA-N 0.000 description 2
- WDQLRUYAYXDIFW-RWKIJVEZSA-N (2r,3r,4s,5r,6r)-4-[(2s,3r,4s,5r,6r)-3,5-dihydroxy-4-[(2r,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2r,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-6-(hydroxymethyl)oxane-2,3,5-triol Chemical compound O[C@@H]1[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)[C@H](O)[C@@H](CO[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)O1 WDQLRUYAYXDIFW-RWKIJVEZSA-N 0.000 description 2
- JIRRPAZFOGASCY-ZTNVNUCQSA-N (2r,3s,5s)-5-(6-aminopurin-9-yl)-5-chloro-2-(hydroxymethyl)oxolan-3-ol Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@]1(Cl)C[C@H](O)[C@@H](CO)O1 JIRRPAZFOGASCY-ZTNVNUCQSA-N 0.000 description 2
- NOENHWMKHNSHGX-IZOOSHNJSA-N (2s)-1-[(2s)-2-[[(2s)-2-[[(2r)-2-[[(2r)-2-[[(2s)-2-[[(2r)-2-[[(2s)-2-[[(2r)-2-acetamido-3-naphthalen-2-ylpropanoyl]amino]-3-(4-chlorophenyl)propanoyl]amino]-3-pyridin-3-ylpropanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-6-(ca Chemical compound C([C@H](C(=O)N[C@H](CCCCNC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCNC(C)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@H](C)C(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](CC=1C=NC=CC=1)NC(=O)[C@H](CC=1C=CC(Cl)=CC=1)NC(=O)[C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(C)=O)C1=CC=C(O)C=C1 NOENHWMKHNSHGX-IZOOSHNJSA-N 0.000 description 2
- ZZKNRXZVGOYGJT-VKHMYHEASA-N (2s)-2-[(2-phosphonoacetyl)amino]butanedioic acid Chemical compound OC(=O)C[C@@H](C(O)=O)NC(=O)CP(O)(O)=O ZZKNRXZVGOYGJT-VKHMYHEASA-N 0.000 description 2
- CUCSSYAUKKIDJV-FAXBSAIASA-N (2s)-2-[[(2r)-2-[[(2s)-2-[[(2r)-2-[[(2s)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1h-indol-3-yl)propanoyl]-methylamino]-3-phenylpropanoyl]amino]-3-(1h-indol-3-yl)propanoyl]amino]-n-[(2s)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]-4-methylpent Chemical compound C([C@@H](C(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(N)=O)N(C)C(=O)[C@@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](N)CCCN=C(N)N)C1=CC=CC=C1 CUCSSYAUKKIDJV-FAXBSAIASA-N 0.000 description 2
- ZUQBAQVRAURMCL-DOMZBBRYSA-N (2s)-2-[[4-[2-[(6r)-2-amino-4-oxo-5,6,7,8-tetrahydro-1h-pyrido[2,3-d]pyrimidin-6-yl]ethyl]benzoyl]amino]pentanedioic acid Chemical compound C([C@@H]1CC=2C(=O)N=C(NC=2NC1)N)CC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 ZUQBAQVRAURMCL-DOMZBBRYSA-N 0.000 description 2
- JRBXPUUAYKCCLQ-QMMMGPOBSA-N (2s)-2-amino-2-[3-hydroxy-4-(hydroxymethyl)phenyl]acetic acid Chemical compound OC(=O)[C@@H](N)C1=CC=C(CO)C(O)=C1 JRBXPUUAYKCCLQ-QMMMGPOBSA-N 0.000 description 2
- RPEPXOHTYVXVMA-CIUDSAMLSA-N (2s)-2-amino-5-[[(2s)-1-[[(1s)-1-carboxy-4-(3h-diazirin-3-yl)-4-oxobutyl]amino]-5-(3h-diazirin-3-yl)-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid Chemical compound C([C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)N[C@@H](CCC(=O)C1N=N1)C(O)=O)CC(=O)C1N=N1 RPEPXOHTYVXVMA-CIUDSAMLSA-N 0.000 description 2
- DWNBOPVKNPVNQG-LURJTMIESA-N (2s)-4-hydroxy-2-(propylamino)butanoic acid Chemical compound CCCN[C@H](C(O)=O)CCO DWNBOPVKNPVNQG-LURJTMIESA-N 0.000 description 2
- HJNZCKLMRAOTMA-BRBGIFQRSA-N (2s)-n-[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2r)-1-[[(2s)-1-[[(2s)-5-(diaminomethylideneamino)-1-[(2s)-2-(ethylcarbamoyl)pyrrolidin-1-yl]-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(2-methyl-1h-indol-3-yl)-1-oxopropan-2-yl]amino]-3-(4-hydr Chemical compound CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)CC1=C(C)NC2=CC=CC=C12 HJNZCKLMRAOTMA-BRBGIFQRSA-N 0.000 description 2
- HWMMBHOXHRVLCU-QOUANJGESA-N (2s,4s,5s)-4-[(1e,3e,5e)-7-[(2r,6r)-6-[(2r,3s,4ar,12bs)-2,3,4a,8,12b-pentahydroxy-3-methyl-1,7,12-trioxo-2,4-dihydrobenzo[a]anthracen-9-yl]-2-methyloxan-3-yl]oxy-7-oxohepta-1,3,5-trienyl]-2,5-dimethyl-1,3-dioxolane-2-carboxylic acid Chemical compound C[C@@H]1O[C@](C)(C(O)=O)O[C@H]1\C=C\C=C\C=C\C(=O)OC1[C@@H](C)O[C@@H](C=2C(=C3C(=O)C4=C([C@]5(C(=O)[C@H](O)[C@@](C)(O)C[C@@]5(O)C=C4)O)C(=O)C3=CC=2)O)CC1 HWMMBHOXHRVLCU-QOUANJGESA-N 0.000 description 2
- NAALWFYYHHJEFQ-ZASNTINBSA-N (2s,5r,6r)-6-[[(2r)-2-[[6-[4-[bis(2-hydroxyethyl)sulfamoyl]phenyl]-2-oxo-1h-pyridine-3-carbonyl]amino]-2-(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound N([C@@H](C(=O)N[C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C=1C=CC(O)=CC=1)C(=O)C(C(N1)=O)=CC=C1C1=CC=C(S(=O)(=O)N(CCO)CCO)C=C1 NAALWFYYHHJEFQ-ZASNTINBSA-N 0.000 description 2
- FRCJDPPXHQGEKS-BCHFMIIMSA-N (4S,5R)-N-[4-[(2,3-dihydroxybenzoyl)amino]butyl]-N-[3-[(2,3-dihydroxybenzoyl)amino]propyl]-2-(2-hydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxamide Chemical compound C[C@H]1OC(=N[C@@H]1C(=O)N(CCCCNC(=O)c1cccc(O)c1O)CCCNC(=O)c1cccc(O)c1O)c1ccccc1O FRCJDPPXHQGEKS-BCHFMIIMSA-N 0.000 description 2
- GTEXXGIEZVKSLH-YPMHNXCESA-N (4as,12br)-8,10-dihydroxy-2,5,5,9-tetramethyl-3,4,4a,12b-tetrahydronaphtho[2,3-c]isochromene-7,12-dione Chemical compound O=C1C2=CC(O)=C(C)C(O)=C2C(=O)C2=C1[C@@H]1C=C(C)CC[C@@H]1C(C)(C)O2 GTEXXGIEZVKSLH-YPMHNXCESA-N 0.000 description 2
- DEQANNDTNATYII-OULOTJBUSA-N (4r,7s,10s,13r,16s,19r)-10-(4-aminobutyl)-19-[[(2r)-2-amino-3-phenylpropanoyl]amino]-16-benzyl-n-[(2r,3r)-1,3-dihydroxybutan-2-yl]-7-[(1r)-1-hydroxyethyl]-13-(1h-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxa Chemical compound C([C@@H](N)C(=O)N[C@H]1CSSC[C@H](NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC=2C3=CC=CC=C3NC=2)NC(=O)[C@H](CC=2C=CC=CC=2)NC1=O)C(=O)N[C@H](CO)[C@H](O)C)C1=CC=CC=C1 DEQANNDTNATYII-OULOTJBUSA-N 0.000 description 2
- SWXOGPJRIDTIRL-DOUNNPEJSA-N (4r,7s,10s,13r,16s,19r)-10-(4-aminobutyl)-n-[(2s)-1-amino-3-(1h-indol-3-yl)-1-oxopropan-2-yl]-19-[[(2r)-2-amino-3-phenylpropanoyl]amino]-16-[(4-hydroxyphenyl)methyl]-13-(1h-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-7-propan-2-yl-1,2-dithia-5,8,11,14,17-pent Chemical compound C([C@H]1C(=O)N[C@H](CC=2C3=CC=CC=C3NC=2)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(N[C@@H](CSSC[C@@H](C(=O)N1)NC(=O)[C@H](N)CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(N)=O)=O)C(C)C)C1=CC=C(O)C=C1 SWXOGPJRIDTIRL-DOUNNPEJSA-N 0.000 description 2
- DLWOTOMWYCRPLK-UVTDQMKNSA-N (4z)-5-amino-6-(7-amino-6-methoxy-5,8-dioxoquinolin-2-yl)-4-(4,5-dimethoxy-6-oxocyclohexa-2,4-dien-1-ylidene)-3-methyl-1h-pyridine-2-carboxylic acid Chemical compound C1=CC(OC)=C(OC)C(=O)\C1=C\1C(N)=C(C=2N=C3C(=O)C(N)=C(OC)C(=O)C3=CC=2)NC(C(O)=O)=C/1C DLWOTOMWYCRPLK-UVTDQMKNSA-N 0.000 description 2
- WTSKMKRYHATLLL-UHFFFAOYSA-N (6-benzoyloxy-3-cyanopyridin-2-yl) 3-[3-(ethoxymethyl)-5-fluoro-2,6-dioxopyrimidine-1-carbonyl]benzoate Chemical compound O=C1N(COCC)C=C(F)C(=O)N1C(=O)C1=CC=CC(C(=O)OC=2C(=CC=C(OC(=O)C=3C=CC=CC=3)N=2)C#N)=C1 WTSKMKRYHATLLL-UHFFFAOYSA-N 0.000 description 2
- YSGQGNQWBLYHPE-CFUSNLFHSA-N (7r,8r,9s,10r,13s,14s,17s)-17-hydroxy-7,13-dimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1h-cyclopenta[a]phenanthren-3-one Chemical compound C1C[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]2[C@H](C)CC3=CC(=O)CC[C@@H]3[C@H]21 YSGQGNQWBLYHPE-CFUSNLFHSA-N 0.000 description 2
- LKBBOPGQDRPCDS-YAOXHJNESA-N (7s,9r,10r)-7-[(2r,4s,5s,6s)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-9-ethyl-4,6,9,10,11-pentahydroxy-8,10-dihydro-7h-tetracene-5,12-dione Chemical compound O([C@H]1C[C@]([C@@H](C2=C(O)C=3C(=O)C4=CC=CC(O)=C4C(=O)C=3C(O)=C21)O)(O)CC)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 LKBBOPGQDRPCDS-YAOXHJNESA-N 0.000 description 2
- MWWSFMDVAYGXBV-FGBSZODSSA-N (7s,9s)-7-[(2r,4s,5r,6s)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7h-tetracene-5,12-dione;hydron;chloride Chemical compound Cl.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 MWWSFMDVAYGXBV-FGBSZODSSA-N 0.000 description 2
- GYPCWHHQAVLMKO-XXKQIVDLSA-N (7s,9s)-7-[(2r,4s,5s,6s)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-[(e)-n-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ylidene)amino]-c-methylcarbonimidoyl]-4-methoxy-8,10-dihydro-7h-tetracene-5,12-dione;hydrochloride Chemical group Cl.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(\C)=N\N=C1CC(C)(C)N(O)C(C)(C)C1)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 GYPCWHHQAVLMKO-XXKQIVDLSA-N 0.000 description 2
- FPVKHBSQESCIEP-UHFFFAOYSA-N (8S)-3-(2-deoxy-beta-D-erythro-pentofuranosyl)-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol Natural products C1C(O)C(CO)OC1N1C(NC=NCC2O)=C2N=C1 FPVKHBSQESCIEP-UHFFFAOYSA-N 0.000 description 2
- VHZXNQKVFDBFIK-NBBHSKLNSA-N (8r,9s,10r,13s,14s,16r)-16-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one Chemical compound C1CCC[C@]2(C)[C@H]3CC[C@](C)(C([C@H](F)C4)=O)[C@@H]4[C@@H]3CC=C21 VHZXNQKVFDBFIK-NBBHSKLNSA-N 0.000 description 2
- IEXUMDBQLIVNHZ-YOUGDJEHSA-N (8s,11r,13r,14s,17s)-11-[4-(dimethylamino)phenyl]-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one Chemical compound C1=CC(N(C)C)=CC=C1[C@@H]1C2=C3CCC(=O)C=C3CC[C@H]2[C@H](CC[C@]2(O)CCCO)[C@@]2(C)C1 IEXUMDBQLIVNHZ-YOUGDJEHSA-N 0.000 description 2
- MHFRGQHAERHWKZ-HHHXNRCGSA-N (R)-edelfosine Chemical compound CCCCCCCCCCCCCCCCCCOC[C@@H](OC)COP([O-])(=O)OCC[N+](C)(C)C MHFRGQHAERHWKZ-HHHXNRCGSA-N 0.000 description 2
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 2
- 102000040650 (ribonucleotides)n+m Human genes 0.000 description 2
- OJRZEKJECRTBPJ-NGAMADIESA-N (z,5s)-5-acetamido-1-diazonio-6-hydroxy-6-oxohex-1-en-2-olate Chemical compound CC(=O)N[C@H](C(O)=O)CC\C([O-])=C\[N+]#N OJRZEKJECRTBPJ-NGAMADIESA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- OUPZKGBUJRBPGC-HLTSFMKQSA-N 1,5-bis[[(2r)-oxiran-2-yl]methyl]-3-[[(2s)-oxiran-2-yl]methyl]-1,3,5-triazinane-2,4,6-trione Chemical compound O=C1N(C[C@H]2OC2)C(=O)N(C[C@H]2OC2)C(=O)N1C[C@H]1CO1 OUPZKGBUJRBPGC-HLTSFMKQSA-N 0.000 description 2
- UOAFGUOASVSLPK-UHFFFAOYSA-N 1-(2-chloroethyl)-3-(2,2-dimethylpropyl)-1-nitrosourea Chemical compound CC(C)(C)CNC(=O)N(N=O)CCCl UOAFGUOASVSLPK-UHFFFAOYSA-N 0.000 description 2
- YQYBWJPESSJLTK-HXFLIBJXSA-N 1-(2-chloroethyl)-3-[(2r,3s,4r,6s)-3-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-4-yl]-1-nitrosourea Chemical compound CO[C@@H]1C[C@@H](NC(=O)N(CCCl)N=O)[C@H](O)[C@@H](CO)O1 YQYBWJPESSJLTK-HXFLIBJXSA-N 0.000 description 2
- RCLLNBVPCJDIPX-UHFFFAOYSA-N 1-(2-chloroethyl)-3-[2-(dimethylsulfamoyl)ethyl]-1-nitrosourea Chemical compound CN(C)S(=O)(=O)CCNC(=O)N(N=O)CCCl RCLLNBVPCJDIPX-UHFFFAOYSA-N 0.000 description 2
- JQJSFAJISYZPER-UHFFFAOYSA-N 1-(4-chlorophenyl)-3-(2,3-dihydro-1h-inden-5-ylsulfonyl)urea Chemical compound C1=CC(Cl)=CC=C1NC(=O)NS(=O)(=O)C1=CC=C(CCC2)C2=C1 JQJSFAJISYZPER-UHFFFAOYSA-N 0.000 description 2
- HAWSQZCWOQZXHI-FQEVSTJZSA-N 10-Hydroxycamptothecin Chemical compound C1=C(O)C=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 HAWSQZCWOQZXHI-FQEVSTJZSA-N 0.000 description 2
- PNDPGZBMCMUPRI-HVTJNCQCSA-N 10043-66-0 Chemical compound [131I][131I] PNDPGZBMCMUPRI-HVTJNCQCSA-N 0.000 description 2
- OOMDVERDMZLRFX-UHFFFAOYSA-N 2,2-bis(aminomethyl)propane-1,3-diol;cyclobutane-1,1-dicarboxylic acid;platinum Chemical compound [Pt].NCC(CN)(CO)CO.OC(=O)C1(C(O)=O)CCC1 OOMDVERDMZLRFX-UHFFFAOYSA-N 0.000 description 2
- UEJJHQNACJXSKW-UHFFFAOYSA-N 2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione Chemical compound O=C1C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O UEJJHQNACJXSKW-UHFFFAOYSA-N 0.000 description 2
- PDWUPXJEEYOOTR-UHFFFAOYSA-N 2-[(3-iodophenyl)methyl]guanidine Chemical compound NC(=N)NCC1=CC=CC(I)=C1 PDWUPXJEEYOOTR-UHFFFAOYSA-N 0.000 description 2
- KPRFMAZESAKTEJ-UHFFFAOYSA-N 2-[1-amino-4-[2,5-dioxo-4-(1-phenylethyl)pyrrolidin-3-yl]-1-oxobutan-2-yl]-5-carbamoylheptanedioic acid;azane Chemical compound [NH4+].[NH4+].C=1C=CC=CC=1C(C)C1C(CCC(C(CCC(CC([O-])=O)C(N)=O)C([O-])=O)C(N)=O)C(=O)NC1=O KPRFMAZESAKTEJ-UHFFFAOYSA-N 0.000 description 2
- XXVLKDRPHSFIIB-UHFFFAOYSA-N 2-[2-(dimethylamino)ethyl]-5-nitrobenzo[de]isoquinoline-1,3-dione Chemical compound [O-][N+](=O)C1=CC(C(N(CCN(C)C)C2=O)=O)=C3C2=CC=CC3=C1 XXVLKDRPHSFIIB-UHFFFAOYSA-N 0.000 description 2
- MHXVDXXARZCVRK-WCWDXBQESA-N 2-[2-[4-[(e)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethylamino]ethanol Chemical compound C1=CC(OCCNCCO)=CC=C1C(\C=1C=CC=CC=1)=C(C(F)(F)F)/C1=CC=CC=C1 MHXVDXXARZCVRK-WCWDXBQESA-N 0.000 description 2
- PXJJOGITBQXZEQ-JTHROIFXSA-M 2-[4-[(z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-trimethylazanium;iodide Chemical compound [I-].C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCC[N+](C)(C)C)=CC=1)/C1=CC=CC=C1 PXJJOGITBQXZEQ-JTHROIFXSA-M 0.000 description 2
- HYHJFNXFVPGMBI-UHFFFAOYSA-N 2-[[2-chloroethyl(nitroso)carbamoyl]-methylamino]acetamide Chemical compound NC(=O)CN(C)C(=O)N(CCCl)N=O HYHJFNXFVPGMBI-UHFFFAOYSA-N 0.000 description 2
- PJKVJJYMWOCLIJ-UHFFFAOYSA-N 2-amino-6-methyl-5-pyridin-4-ylsulfanyl-1h-quinazolin-4-one;hydron;dichloride Chemical compound Cl.Cl.CC1=CC=C2NC(N)=NC(=O)C2=C1SC1=CC=NC=C1 PJKVJJYMWOCLIJ-UHFFFAOYSA-N 0.000 description 2
- VDCRFBBZFHHYGT-IOSLPCCCSA-N 2-amino-9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enyl-3h-purine-6,8-dione Chemical compound O=C1N(CC=C)C=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O VDCRFBBZFHHYGT-IOSLPCCCSA-N 0.000 description 2
- NIXVOFULDIFBLB-QVRNUERCSA-N 2-amino-9-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-sulfinamide Chemical compound C12=NC(N)=NC(S(N)=O)=C2N=CN1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NIXVOFULDIFBLB-QVRNUERCSA-N 0.000 description 2
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- GNIDUJTWLLFYKT-UHFFFAOYSA-N 2-hydroxy-2-[[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methoxy]acetic acid;[3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate Chemical compound CC1=NC=C(COC(O)C(O)=O)C(CO)=C1O.[O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O GNIDUJTWLLFYKT-UHFFFAOYSA-N 0.000 description 2
- 102100036563 26S proteasome regulatory subunit 8 Human genes 0.000 description 2
- GRLUHXSUZYFZCW-UHFFFAOYSA-N 3-(8,8-diethyl-2-aza-8-germaspiro[4.5]decan-2-yl)-n,n-dimethylpropan-1-amine;dihydrochloride Chemical compound Cl.Cl.C1C[Ge](CC)(CC)CCC11CN(CCCN(C)C)CC1 GRLUHXSUZYFZCW-UHFFFAOYSA-N 0.000 description 2
- QGJZLNKBHJESQX-UHFFFAOYSA-N 3-Epi-Betulin-Saeure Natural products C1CC(O)C(C)(C)C2CCC3(C)C4(C)CCC5(C(O)=O)CCC(C(=C)C)C5C4CCC3C21C QGJZLNKBHJESQX-UHFFFAOYSA-N 0.000 description 2
- GTJXPMSTODOYNP-BTKVJIOYSA-N 3-[(e)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol;2-hydroxypropane-1,2,3-tricarboxylic acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C=1C=CC=CC=1C(/CC)=C(C=1C=C(O)C=CC=1)\C1=CC=C(OCCN(C)C)C=C1 GTJXPMSTODOYNP-BTKVJIOYSA-N 0.000 description 2
- UZFPOOOQHWICKY-UHFFFAOYSA-N 3-[13-[1-[1-[8,12-bis(2-carboxyethyl)-17-(1-hydroxyethyl)-3,7,13,18-tetramethyl-21,24-dihydroporphyrin-2-yl]ethoxy]ethyl]-18-(2-carboxyethyl)-8-(1-hydroxyethyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid Chemical compound N1C(C=C2C(=C(CCC(O)=O)C(C=C3C(=C(C)C(C=C4N5)=N3)CCC(O)=O)=N2)C)=C(C)C(C(C)O)=C1C=C5C(C)=C4C(C)OC(C)C1=C(N2)C=C(N3)C(C)=C(C(O)C)C3=CC(C(C)=C3CCC(O)=O)=NC3=CC(C(CCC(O)=O)=C3C)=NC3=CC2=C1C UZFPOOOQHWICKY-UHFFFAOYSA-N 0.000 description 2
- WUIABRMSWOKTOF-OYALTWQYSA-O 3-[[2-[2-[2-[[(2s,3r)-2-[[(2s,3s,4r)-4-[[(2s,3r)-2-[[6-amino-2-[(1s)-3-amino-1-[[(2s)-2,3-diamino-3-oxopropyl]amino]-3-oxopropyl]-5-methylpyrimidine-4-carbonyl]amino]-3-[(2r,3s,4s,5s,6s)-3-[(2r,3s,4s,5r,6r)-4-carbamoyloxy-3,5-dihydroxy-6-(hydroxymethyl)ox Chemical compound OS(O)(=O)=O.N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C WUIABRMSWOKTOF-OYALTWQYSA-O 0.000 description 2
- WELIVEBWRWAGOM-UHFFFAOYSA-N 3-amino-n-[2-[2-(3-aminopropanoylamino)ethyldisulfanyl]ethyl]propanamide Chemical compound NCCC(=O)NCCSSCCNC(=O)CCN WELIVEBWRWAGOM-UHFFFAOYSA-N 0.000 description 2
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 2
- LIETVYHJBSLSSW-UHFFFAOYSA-N 4,6,9-trihydroxy-8-methyl-3,4-dihydro-2h-anthracen-1-one Chemical compound OC1CCC(=O)C2=C1C=C1C=C(O)C=C(C)C1=C2O LIETVYHJBSLSSW-UHFFFAOYSA-N 0.000 description 2
- HQFSNUYUXXPVKL-UHFFFAOYSA-N 4-[(4-fluorophenyl)methyl]-2-[1-(2-phenylethyl)azepan-4-yl]phthalazin-1-one Chemical compound C1=CC(F)=CC=C1CC(C1=CC=CC=C1C1=O)=NN1C1CCN(CCC=2C=CC=CC=2)CCC1 HQFSNUYUXXPVKL-UHFFFAOYSA-N 0.000 description 2
- OUQPTBCOEKUHBH-LSDHQDQOSA-N 4-[2-[4-[(e)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-1-enyl]phenoxy]ethyl]morpholine Chemical compound C=1C=C(C(CCC2(C)C)(C)C)C2=CC=1C(/C)=C/C(C=C1)=CC=C1OCCN1CCOCC1 OUQPTBCOEKUHBH-LSDHQDQOSA-N 0.000 description 2
- SGOOQMRIPALTEL-UHFFFAOYSA-N 4-hydroxy-N,1-dimethyl-2-oxo-N-phenyl-3-quinolinecarboxamide Chemical compound OC=1C2=CC=CC=C2N(C)C(=O)C=1C(=O)N(C)C1=CC=CC=C1 SGOOQMRIPALTEL-UHFFFAOYSA-N 0.000 description 2
- 102100033714 40S ribosomal protein S6 Human genes 0.000 description 2
- 102100033731 40S ribosomal protein S9 Human genes 0.000 description 2
- APNRZHLOPQFNMR-WEIUTZTHSA-N 5-[(e)-5-[(1s)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-2-enyl]phenazin-1-one Chemical compound C12=CC=CC=C2N=C(C(C=CC=2)=O)C=2N1C\C=C(/C)CC[C@@H]1C(=C)CCCC1(C)C APNRZHLOPQFNMR-WEIUTZTHSA-N 0.000 description 2
- PXBZKHOQHTVCSQ-QZTJIDSGSA-N 5-nitro-2-[(2r)-1-[2-[[(2r)-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)propyl]amino]ethylamino]propan-2-yl]benzo[de]isoquinoline-1,3-dione Chemical compound [O-][N+](=O)C1=CC(C(N([C@@H](CNCCNC[C@@H](C)N2C(C=3C=C(C=C4C=CC=C(C=34)C2=O)[N+]([O-])=O)=O)C)C2=O)=O)=C3C2=CC=CC3=C1 PXBZKHOQHTVCSQ-QZTJIDSGSA-N 0.000 description 2
- MMRCWWRFYLZGAE-ZBZRSYSASA-N 533u947v6q Chemical compound O([C@]12[C@H](OC(C)=O)[C@]3(CC)C=CCN4CC[C@@]5([C@H]34)[C@H]1N(C)C1=C5C=C(C(=C1)OC)[C@]1(C(=O)OC)C3=C(C4=CC=CC=C4N3)CCN3C[C@H](C1)C[C@@](C3)(O)CC)C(=O)N(CCCl)C2=O MMRCWWRFYLZGAE-ZBZRSYSASA-N 0.000 description 2
- ATCGGEJZONJOCL-UHFFFAOYSA-N 6-(2,5-dichlorophenyl)-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(N)=NC(C=2C(=CC=C(Cl)C=2)Cl)=N1 ATCGGEJZONJOCL-UHFFFAOYSA-N 0.000 description 2
- VJXSSYDSOJBUAV-UHFFFAOYSA-N 6-(2,5-dimethoxy-benzyl)-5-methyl-pyrido[2,3-d]pyrimidine-2,4-diamine Chemical compound COC1=CC=C(OC)C(CC=2C(=C3C(N)=NC(N)=NC3=NC=2)C)=C1 VJXSSYDSOJBUAV-UHFFFAOYSA-N 0.000 description 2
- LRHPCRBOMKRVOA-UHFFFAOYSA-N 6-[2-(2-hydroxyethylamino)ethyl]indeno[1,2-c]isoquinoline-5,11-dione Chemical compound C12=CC=CC=C2C(=O)N(CCNCCO)C2=C1C(=O)C1=CC=CC=C12 LRHPCRBOMKRVOA-UHFFFAOYSA-N 0.000 description 2
- LJIRBXZDQGQUOO-KVTDHHQDSA-N 6-amino-3-[(2r,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one Chemical compound C1NC(N)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 LJIRBXZDQGQUOO-KVTDHHQDSA-N 0.000 description 2
- 102100040540 60S ribosomal protein L3 Human genes 0.000 description 2
- GOYNNCPGHOBFCK-UHFFFAOYSA-N 7-[4-(dimethylamino)-5-[(2,9-dimethyl-3-oxo-4,4a,5a,6,7,9,9a,10a-octahydrodipyrano[4,2-a:4',3'-e][1,4]dioxin-7-yl)oxy]-6-methyloxan-2-yl]oxy-9-ethyl-4,6,9,10,11-pentahydroxy-8,10-dihydro-7h-tetracene-5,12-dione Chemical compound O=C1C2=C(O)C=CC=C2C(=O)C2=C1C(O)=C1C(OC3OC(C)C(OC4OC(C)C5OC6OC(C)C(=O)CC6OC5C4)C(C3)N(C)C)CC(CC)(O)C(O)C1=C2O GOYNNCPGHOBFCK-UHFFFAOYSA-N 0.000 description 2
- KABRXLINDSPGDF-UHFFFAOYSA-N 7-bromoisoquinoline Chemical compound C1=CN=CC2=CC(Br)=CC=C21 KABRXLINDSPGDF-UHFFFAOYSA-N 0.000 description 2
- GOJJWDOZNKBUSR-UHFFFAOYSA-N 7-sulfamoyloxyheptyl sulfamate Chemical compound NS(=O)(=O)OCCCCCCCOS(N)(=O)=O GOJJWDOZNKBUSR-UHFFFAOYSA-N 0.000 description 2
- ZGXJTSGNIOSYLO-UHFFFAOYSA-N 88755TAZ87 Chemical compound NCC(=O)CCC(O)=O ZGXJTSGNIOSYLO-UHFFFAOYSA-N 0.000 description 2
- RTHKPHCVZVYDFN-UHFFFAOYSA-N 9-amino-5-(2-aminopyrimidin-4-yl)pyrido[3',2':4,5]pyrrolo[1,2-c]pyrimidin-4-ol Chemical compound NC1=NC=CC(C=2C3=C(O)C=CN=C3N3C(N)=NC=CC3=2)=N1 RTHKPHCVZVYDFN-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 102000004373 Actin-related protein 2 Human genes 0.000 description 2
- 108090000963 Actin-related protein 2 Proteins 0.000 description 2
- 102100027265 Aldo-keto reductase family 1 member B1 Human genes 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 2
- ITPDYQOUSLNIHG-UHFFFAOYSA-N Amiodarone hydrochloride Chemical compound [Cl-].CCCCC=1OC2=CC=CC=C2C=1C(=O)C1=CC(I)=C(OCC[NH+](CC)CC)C(I)=C1 ITPDYQOUSLNIHG-UHFFFAOYSA-N 0.000 description 2
- BOJKULTULYSRAS-OTESTREVSA-N Andrographolide Chemical compound C([C@H]1[C@]2(C)CC[C@@H](O)[C@]([C@H]2CCC1=C)(CO)C)\C=C1/[C@H](O)COC1=O BOJKULTULYSRAS-OTESTREVSA-N 0.000 description 2
- 102100034613 Annexin A2 Human genes 0.000 description 2
- NQGMIPUYCWIEAW-UHFFFAOYSA-N Antibiotic SF 2738 Natural products COc1cc(nc(C=NO)c1SC)-c1ccccn1 NQGMIPUYCWIEAW-UHFFFAOYSA-N 0.000 description 2
- 102100027308 Apoptosis regulator BAX Human genes 0.000 description 2
- 108050006685 Apoptosis regulator BAX Proteins 0.000 description 2
- 108700028932 Arg(129)- prolactin Proteins 0.000 description 2
- MJINRRBEMOLJAK-DCAQKATOSA-N Arg-Lys-Asp Chemical compound OC(=O)C[C@@H](C(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCN=C(N)N MJINRRBEMOLJAK-DCAQKATOSA-N 0.000 description 2
- 239000004475 Arginine Substances 0.000 description 2
- BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 description 2
- 108010024976 Asparaginase Proteins 0.000 description 2
- 102000015790 Asparaginase Human genes 0.000 description 2
- 108700032558 Aspergillus restrictus MITF Proteins 0.000 description 2
- YOZSEGPJAXTSFZ-ZETCQYMHSA-N Azatyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=N1 YOZSEGPJAXTSFZ-ZETCQYMHSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 102100027314 Beta-2-microglobulin Human genes 0.000 description 2
- 102100021943 C-C motif chemokine 2 Human genes 0.000 description 2
- 102100027221 CD81 antigen Human genes 0.000 description 2
- HAWSQZCWOQZXHI-UHFFFAOYSA-N CPT-OH Natural products C1=C(O)C=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 HAWSQZCWOQZXHI-UHFFFAOYSA-N 0.000 description 2
- 102100032537 Calpain-2 catalytic subunit Human genes 0.000 description 2
- 102100032539 Calpain-3 Human genes 0.000 description 2
- 102100033592 Calponin-3 Human genes 0.000 description 2
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 2
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 2
- 102000052052 Casein Kinase II Human genes 0.000 description 2
- 108010010919 Casein Kinase II Proteins 0.000 description 2
- JDVVGAQPNNXQDW-WCMLQCRESA-N Castanospermine Natural products O[C@H]1[C@@H](O)[C@H]2[C@@H](O)CCN2C[C@H]1O JDVVGAQPNNXQDW-WCMLQCRESA-N 0.000 description 2
- JDVVGAQPNNXQDW-TVNFTVLESA-N Castinospermine Chemical compound C1[C@H](O)[C@@H](O)[C@H](O)[C@H]2[C@@H](O)CCN21 JDVVGAQPNNXQDW-TVNFTVLESA-N 0.000 description 2
- 108090000994 Catalytic RNA Proteins 0.000 description 2
- 102000053642 Catalytic RNA Human genes 0.000 description 2
- 102100028003 Catenin alpha-1 Human genes 0.000 description 2
- 102100021633 Cathepsin B Human genes 0.000 description 2
- JWBOIMRXGHLCPP-UHFFFAOYSA-N Chloditan Chemical compound C=1C=CC=C(Cl)C=1C(C(Cl)Cl)C1=CC=C(Cl)C=C1 JWBOIMRXGHLCPP-UHFFFAOYSA-N 0.000 description 2
- 108010062540 Chorionic Gonadotropin Proteins 0.000 description 2
- 102000011022 Chorionic Gonadotropin Human genes 0.000 description 2
- 102100038641 Cleavage and polyadenylation specificity factor subunit 1 Human genes 0.000 description 2
- GUTLYIVDDKVIGB-AHCXROLUSA-N Cobalt-55 Chemical compound [55Co] GUTLYIVDDKVIGB-AHCXROLUSA-N 0.000 description 2
- HVXBOLULGPECHP-WAYWQWQTSA-N Combretastatin A4 Chemical compound C1=C(O)C(OC)=CC=C1\C=C/C1=CC(OC)=C(OC)C(OC)=C1 HVXBOLULGPECHP-WAYWQWQTSA-N 0.000 description 2
- DFDTZECTHJFPHE-UHFFFAOYSA-N Crambescidin 816 Natural products C1CC=CC(CC)OC11NC(N23)=NC4(OC(C)CCC4)C(C(=O)OCCCCCCCCCCCCCCCC(=O)N(CCCN)CC(O)CCN)C3(O)CCC2C1 DFDTZECTHJFPHE-UHFFFAOYSA-N 0.000 description 2
- 229930188224 Cryptophycin Natural products 0.000 description 2
- 102000004127 Cytokines Human genes 0.000 description 2
- 108090000695 Cytokines Proteins 0.000 description 2
- SPKNARKFCOPTSY-UHFFFAOYSA-N D-asperlin Natural products CC1OC1C1C(OC(C)=O)C=CC(=O)O1 SPKNARKFCOPTSY-UHFFFAOYSA-N 0.000 description 2
- 238000000018 DNA microarray Methods 0.000 description 2
- GJKXGJCSJWBJEZ-XRSSZCMZSA-N Deslorelin Chemical compound CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)CC1=CNC2=CC=CC=C12 GJKXGJCSJWBJEZ-XRSSZCMZSA-N 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 2
- HWMMBHOXHRVLCU-UHFFFAOYSA-N Dioxamycin Natural products CC1OC(C)(C(O)=O)OC1C=CC=CC=CC(=O)OC1C(C)OC(C=2C(=C3C(=O)C4=C(C5(C(=O)C(O)C(C)(O)CC5(O)C=C4)O)C(=O)C3=CC=2)O)CC1 HWMMBHOXHRVLCU-UHFFFAOYSA-N 0.000 description 2
- AADVCYNFEREWOS-OBRABYBLSA-N Discodermolide Chemical compound C=C\C=C/[C@H](C)[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)C\C(C)=C/[C@H](C)[C@@H](O)[C@@H](C)\C=C/[C@@H](O)C[C@@H]1OC(=O)[C@H](C)[C@@H](O)[C@H]1C AADVCYNFEREWOS-OBRABYBLSA-N 0.000 description 2
- 102100022840 DnaJ homolog subfamily C member 7 Human genes 0.000 description 2
- CYQFCXCEBYINGO-DLBZAZTESA-N Dronabinol Natural products C1=C(C)CC[C@H]2C(C)(C)OC3=CC(CCCCC)=CC(O)=C3[C@H]21 CYQFCXCEBYINGO-DLBZAZTESA-N 0.000 description 2
- 102100023115 Dual specificity tyrosine-phosphorylation-regulated kinase 2 Human genes 0.000 description 2
- 102100023362 Elongation factor 1-gamma Human genes 0.000 description 2
- NBEALWAVEGMZQY-UHFFFAOYSA-N Enpromate Chemical compound C=1C=CC=CC=1C(C#C)(C=1C=CC=CC=1)OC(=O)NC1CCCCC1 NBEALWAVEGMZQY-UHFFFAOYSA-N 0.000 description 2
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 2
- 102100030146 Epithelial membrane protein 3 Human genes 0.000 description 2
- VAPSMQAHNAZRKC-PQWRYPMOSA-N Epristeride Chemical compound C1C=C2C=C(C(O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)NC(C)(C)C)[C@@]1(C)CC2 VAPSMQAHNAZRKC-PQWRYPMOSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 2
- ITIONVBQFUNVJV-UHFFFAOYSA-N Etomidoline Chemical compound C12=CC=CC=C2C(=O)N(CC)C1NC(C=C1)=CC=C1OCCN1CCCCC1 ITIONVBQFUNVJV-UHFFFAOYSA-N 0.000 description 2
- 102100029775 Eukaryotic translation initiation factor 1 Human genes 0.000 description 2
- 102100040022 Eukaryotic translation initiation factor 4 gamma 3 Human genes 0.000 description 2
- 108010029961 Filgrastim Proteins 0.000 description 2
- 241000628997 Flos Species 0.000 description 2
- PGTKVMVZBBZCKQ-UHFFFAOYSA-N Fulvene Chemical compound C=C1C=CC=C1 PGTKVMVZBBZCKQ-UHFFFAOYSA-N 0.000 description 2
- 229940121800 Gelatinase inhibitor Drugs 0.000 description 2
- 108010015899 Glycopeptides Proteins 0.000 description 2
- 102000002068 Glycopeptides Human genes 0.000 description 2
- 102100031493 Growth arrest-specific protein 7 Human genes 0.000 description 2
- ZIXGXMMUKPLXBB-UHFFFAOYSA-N Guatambuinine Natural products N1C2=CC=CC=C2C2=C1C(C)=C1C=CN=C(C)C1=C2 ZIXGXMMUKPLXBB-UHFFFAOYSA-N 0.000 description 2
- 102100028972 HLA class I histocompatibility antigen, A alpha chain Human genes 0.000 description 2
- 102100040505 HLA class II histocompatibility antigen, DR alpha chain Human genes 0.000 description 2
- 108010075704 HLA-A Antigens Proteins 0.000 description 2
- 108010054147 Hemoglobins Proteins 0.000 description 2
- 102000001554 Hemoglobins Human genes 0.000 description 2
- 101001136753 Homo sapiens 26S proteasome regulatory subunit 8 Proteins 0.000 description 2
- 101000656896 Homo sapiens 40S ribosomal protein S6 Proteins 0.000 description 2
- 101000657066 Homo sapiens 40S ribosomal protein S9 Proteins 0.000 description 2
- 101000673985 Homo sapiens 60S ribosomal protein L3 Proteins 0.000 description 2
- 101000836540 Homo sapiens Aldo-keto reductase family 1 member B1 Proteins 0.000 description 2
- 101000924474 Homo sapiens Annexin A2 Proteins 0.000 description 2
- 101000937544 Homo sapiens Beta-2-microglobulin Proteins 0.000 description 2
- 101000897480 Homo sapiens C-C motif chemokine 2 Proteins 0.000 description 2
- 101000914479 Homo sapiens CD81 antigen Proteins 0.000 description 2
- 101000867692 Homo sapiens Calpain-2 catalytic subunit Proteins 0.000 description 2
- 101000867715 Homo sapiens Calpain-3 Proteins 0.000 description 2
- 101000945410 Homo sapiens Calponin-3 Proteins 0.000 description 2
- 101000859063 Homo sapiens Catenin alpha-1 Proteins 0.000 description 2
- 101000898449 Homo sapiens Cathepsin B Proteins 0.000 description 2
- 101000957603 Homo sapiens Cleavage and polyadenylation specificity factor subunit 1 Proteins 0.000 description 2
- 101000903053 Homo sapiens DnaJ homolog subfamily C member 7 Proteins 0.000 description 2
- 101001049990 Homo sapiens Dual specificity tyrosine-phosphorylation-regulated kinase 2 Proteins 0.000 description 2
- 101001050451 Homo sapiens Elongation factor 1-gamma Proteins 0.000 description 2
- 101001011788 Homo sapiens Epithelial membrane protein 3 Proteins 0.000 description 2
- 101001012787 Homo sapiens Eukaryotic translation initiation factor 1 Proteins 0.000 description 2
- 101001034840 Homo sapiens Eukaryotic translation initiation factor 4 gamma 3 Proteins 0.000 description 2
- 101000923044 Homo sapiens Growth arrest-specific protein 7 Proteins 0.000 description 2
- 101000998629 Homo sapiens Importin subunit beta-1 Proteins 0.000 description 2
- 101001044927 Homo sapiens Insulin-like growth factor-binding protein 3 Proteins 0.000 description 2
- 101000994378 Homo sapiens Integrin alpha-3 Proteins 0.000 description 2
- 101000998139 Homo sapiens Interleukin-32 Proteins 0.000 description 2
- 101001004313 Homo sapiens LHFPL tetraspan subfamily member 2 protein Proteins 0.000 description 2
- 101000760817 Homo sapiens Macrophage-capping protein Proteins 0.000 description 2
- 101000958390 Homo sapiens Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Proteins 0.000 description 2
- 101000990990 Homo sapiens Midkine Proteins 0.000 description 2
- 101001128460 Homo sapiens Myosin light polypeptide 6 Proteins 0.000 description 2
- 101001008429 Homo sapiens Nucleobindin-2 Proteins 0.000 description 2
- 101000992283 Homo sapiens Optineurin Proteins 0.000 description 2
- 101001096054 Homo sapiens Perilipin-3 Proteins 0.000 description 2
- 101000876782 Homo sapiens Phenylalanine-tRNA ligase alpha subunit Proteins 0.000 description 2
- 101000582950 Homo sapiens Platelet factor 4 Proteins 0.000 description 2
- 101000772905 Homo sapiens Polyubiquitin-B Proteins 0.000 description 2
- 101001051777 Homo sapiens Protein kinase C alpha type Proteins 0.000 description 2
- 101001091538 Homo sapiens Pyruvate kinase PKM Proteins 0.000 description 2
- 101000687317 Homo sapiens RNA-binding motif protein, X chromosome Proteins 0.000 description 2
- 101000836650 Homo sapiens Selenoprotein W Proteins 0.000 description 2
- 101000707983 Homo sapiens Septin-10 Proteins 0.000 description 2
- 101001068019 Homo sapiens Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Proteins 0.000 description 2
- 101000831940 Homo sapiens Stathmin Proteins 0.000 description 2
- 101000617738 Homo sapiens Survival motor neuron protein Proteins 0.000 description 2
- 101000895882 Homo sapiens Transcription factor E2F4 Proteins 0.000 description 2
- 101000835093 Homo sapiens Transferrin receptor protein 1 Proteins 0.000 description 2
- 101000635938 Homo sapiens Transforming growth factor beta-1 proprotein Proteins 0.000 description 2
- 101000640976 Homo sapiens Tryptophan-tRNA ligase, cytoplasmic Proteins 0.000 description 2
- 101000997835 Homo sapiens Tyrosine-protein kinase JAK1 Proteins 0.000 description 2
- 101000638886 Homo sapiens Urokinase-type plasminogen activator Proteins 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical class ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- UGQMRVRMYYASKQ-UHFFFAOYSA-N Hypoxanthine nucleoside Natural products OC1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 UGQMRVRMYYASKQ-UHFFFAOYSA-N 0.000 description 2
- JJKOTMDDZAJTGQ-DQSJHHFOSA-N Idoxifene Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN2CCCC2)=CC=1)/C1=CC=C(I)C=C1 JJKOTMDDZAJTGQ-DQSJHHFOSA-N 0.000 description 2
- 102100033258 Importin subunit beta-1 Human genes 0.000 description 2
- 108090000191 Inhibitor of growth protein 1 Proteins 0.000 description 2
- 102000003781 Inhibitor of growth protein 1 Human genes 0.000 description 2
- 229930010555 Inosine Natural products 0.000 description 2
- UGQMRVRMYYASKQ-KQYNXXCUSA-N Inosine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(O)=C2N=C1 UGQMRVRMYYASKQ-KQYNXXCUSA-N 0.000 description 2
- 108700022013 Insecta cecropin B Proteins 0.000 description 2
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 description 2
- 102100022708 Insulin-like growth factor-binding protein 3 Human genes 0.000 description 2
- 102100032819 Integrin alpha-3 Human genes 0.000 description 2
- 108010047761 Interferon-alpha Proteins 0.000 description 2
- 102000006992 Interferon-alpha Human genes 0.000 description 2
- 108010002350 Interleukin-2 Proteins 0.000 description 2
- 102100033501 Interleukin-32 Human genes 0.000 description 2
- 102000015696 Interleukins Human genes 0.000 description 2
- 108010063738 Interleukins Proteins 0.000 description 2
- SHGAZHPCJJPHSC-NUEINMDLSA-N Isotretinoin Chemical compound OC(=O)C=C(C)/C=C/C=C(C)C=CC1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-NUEINMDLSA-N 0.000 description 2
- KJQFBVYMGADDTQ-CVSPRKDYSA-N L-buthionine-(S,R)-sulfoximine Chemical compound CCCCS(=N)(=O)CC[C@H](N)C(O)=O KJQFBVYMGADDTQ-CVSPRKDYSA-N 0.000 description 2
- 108010043135 L-methionine gamma-lyase Proteins 0.000 description 2
- 102100025687 LHFPL tetraspan subfamily member 2 protein Human genes 0.000 description 2
- ZHTRILQJTPJGNK-FYBAATNNSA-N Leinamycin Chemical compound N([C@@H](C=1SC=C(N=1)\C=C/C=C/C(=O)[C@H](O)/C=C(C)/CC1)C)C(=O)C[C@@]21S(=O)SC(=O)[C@]2(C)O ZHTRILQJTPJGNK-FYBAATNNSA-N 0.000 description 2
- ZHTRILQJTPJGNK-UHFFFAOYSA-N Leinamycin Natural products C1CC(C)=CC(O)C(=O)C=CC=CC(N=2)=CSC=2C(C)NC(=O)CC21S(=O)SC(=O)C2(C)O ZHTRILQJTPJGNK-UHFFFAOYSA-N 0.000 description 2
- 229920001491 Lentinan Polymers 0.000 description 2
- LMVRPBWWHMVLPC-KBPJCXPTSA-N Leptolstatin Natural products CC(CC=CC(=CC(C)C(=O)C(C)C(O)C(C)CC(=CCO)C)C)C=C(C)/C=C/C1CC=CC(=O)O1 LMVRPBWWHMVLPC-KBPJCXPTSA-N 0.000 description 2
- HLFSDGLLUJUHTE-SNVBAGLBSA-N Levamisole Chemical compound C1([C@H]2CN3CCSC3=N2)=CC=CC=C1 HLFSDGLLUJUHTE-SNVBAGLBSA-N 0.000 description 2
- 241000243684 Lumbricus Species 0.000 description 2
- 108700041567 MDR Genes Proteins 0.000 description 2
- 108060004872 MIF Proteins 0.000 description 2
- 102100024573 Macrophage-capping protein Human genes 0.000 description 2
- BLOFGONIVNXZME-UHFFFAOYSA-N Mannostatin A Natural products CSC1C(N)C(O)C(O)C1O BLOFGONIVNXZME-UHFFFAOYSA-N 0.000 description 2
- 102100038245 Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Human genes 0.000 description 2
- 229940124183 Matrilysin inhibitor Drugs 0.000 description 2
- UDKABVSQKJNZBH-DWNQPYOZSA-N Melengestrol acetate Chemical compound C1=C(C)C2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC(=C)[C@](OC(=O)C)(C(C)=O)[C@@]1(C)CC2 UDKABVSQKJNZBH-DWNQPYOZSA-N 0.000 description 2
- 102100030335 Midkine Human genes 0.000 description 2
- HRHKSTOGXBBQCB-UHFFFAOYSA-N Mitomycin E Natural products O=C1C(N)=C(C)C(=O)C2=C1C(COC(N)=O)C1(OC)C3N(C)C3CN12 HRHKSTOGXBBQCB-UHFFFAOYSA-N 0.000 description 2
- PCZOHLXUXFIOCF-UHFFFAOYSA-N Monacolin X Natural products C12C(OC(=O)C(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 PCZOHLXUXFIOCF-UHFFFAOYSA-N 0.000 description 2
- 102100031829 Myosin light polypeptide 6 Human genes 0.000 description 2
- USVMJSALORZVDV-SDBHATRESA-N N(6)-(Delta(2)-isopentenyl)adenosine Chemical compound C1=NC=2C(NCC=C(C)C)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O USVMJSALORZVDV-SDBHATRESA-N 0.000 description 2
- WUKZPHOXUVCQOR-UHFFFAOYSA-N N-(1-azabicyclo[2.2.2]octan-3-yl)-6-chloro-4-methyl-3-oxo-1,4-benzoxazine-8-carboxamide Chemical compound C1N(CC2)CCC2C1NC(=O)C1=CC(Cl)=CC2=C1OCC(=O)N2C WUKZPHOXUVCQOR-UHFFFAOYSA-N 0.000 description 2
- QJMCKEPOKRERLN-UHFFFAOYSA-N N-3,4-tridhydroxybenzamide Chemical compound ONC(=O)C1=CC=C(O)C(O)=C1 QJMCKEPOKRERLN-UHFFFAOYSA-N 0.000 description 2
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 2
- 108010021717 Nafarelin Chemical class 0.000 description 2
- GTEXXGIEZVKSLH-UHFFFAOYSA-N Naphterpin Natural products O=C1C2=CC(O)=C(C)C(O)=C2C(=O)C2=C1C1C=C(C)CCC1C(C)(C)O2 GTEXXGIEZVKSLH-UHFFFAOYSA-N 0.000 description 2
- 102400000058 Neuregulin-1 Human genes 0.000 description 2
- 108090000556 Neuregulin-1 Proteins 0.000 description 2
- BUSGWUFLNHIBPT-UHFFFAOYSA-N Nisamycin Natural products O=C1C2OC2C(C=CC=CC=CC(=O)O)(O)C=C1NC(=O)C=CC=CC1CCCCC1 BUSGWUFLNHIBPT-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-BJUDXGSMSA-N Nitrogen-13 Chemical compound [13N] QJGQUHMNIGDVPM-BJUDXGSMSA-N 0.000 description 2
- KYRVNWMVYQXFEU-UHFFFAOYSA-N Nocodazole Chemical compound C1=C2NC(NC(=O)OC)=NC2=CC=C1C(=O)C1=CC=CS1 KYRVNWMVYQXFEU-UHFFFAOYSA-N 0.000 description 2
- KGTDRFCXGRULNK-UHFFFAOYSA-N Nogalamycin Natural products COC1C(OC)(C)C(OC)C(C)OC1OC1C2=C(O)C(C(=O)C3=C(O)C=C4C5(C)OC(C(C(C5O)N(C)C)O)OC4=C3C3=O)=C3C=C2C(C(=O)OC)C(C)(O)C1 KGTDRFCXGRULNK-UHFFFAOYSA-N 0.000 description 2
- 102100027441 Nucleobindin-2 Human genes 0.000 description 2
- 108010016076 Octreotide Proteins 0.000 description 2
- VTAZRSXSBIHBMH-UHFFFAOYSA-N Ophiocordin Natural products OC1=CC(C(=O)O)=CC(O)=C1C(=O)C1=C(O)C=CC=C1C(=O)NC1C(OC(=O)C=2C=CC(O)=CC=2)CCCNC1 VTAZRSXSBIHBMH-UHFFFAOYSA-N 0.000 description 2
- 102100031822 Optineurin Human genes 0.000 description 2
- LKBBOPGQDRPCDS-UHFFFAOYSA-N Oxaunomycin Natural products C12=C(O)C=3C(=O)C4=C(O)C=CC=C4C(=O)C=3C(O)=C2C(O)C(CC)(O)CC1OC1CC(N)C(O)C(C)O1 LKBBOPGQDRPCDS-UHFFFAOYSA-N 0.000 description 2
- VYOQBYCIIJYKJA-UHFFFAOYSA-N Palauamine Natural products C1N2C(=O)C3=CC=CN3C3N=C(N)NC32C2C1C(CN)C(Cl)C12NC(N)=NC1O VYOQBYCIIJYKJA-UHFFFAOYSA-N 0.000 description 2
- QFJUYMMIBFBOJY-UXZRXANASA-N Panaxatriol Chemical compound C[C@]1([C@H]2CC[C@@]3([C@@H]2[C@H](O)C[C@H]2[C@]3(C[C@@H](O)[C@H]3C(C)(C)[C@@H](O)CC[C@@]32C)C)C)CCCC(C)(C)O1 QFJUYMMIBFBOJY-UXZRXANASA-N 0.000 description 2
- VIXIMKLMEZTTTC-UHFFFAOYSA-N Panaxatriol Natural products CC1(C)CCCC(O1)C2CCC3(C)C2C(O)CC4C5(C)CCC(O)C(C)(C)C5C(O)CC34C VIXIMKLMEZTTTC-UHFFFAOYSA-N 0.000 description 2
- FRCJDPPXHQGEKS-UHFFFAOYSA-N Parabactin Natural products CC1OC(=NC1C(=O)N(CCCCNC(=O)c1cccc(O)c1O)CCCNC(=O)c1cccc(O)c1O)c1ccccc1O FRCJDPPXHQGEKS-UHFFFAOYSA-N 0.000 description 2
- 102100037895 Perilipin-3 Human genes 0.000 description 2
- APNRZHLOPQFNMR-UHFFFAOYSA-N Phenazinomycin Natural products C12=CC=CC=C2N=C(C(C=CC=2)=O)C=2N1CC=C(C)CCC1C(=C)CCCC1(C)C APNRZHLOPQFNMR-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 102100035215 Phenylalanine-tRNA ligase alpha subunit Human genes 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- KMSKQZKKOZQFFG-HSUXVGOQSA-N Pirarubicin Chemical compound O([C@H]1[C@@H](N)C[C@@H](O[C@H]1C)O[C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1CCCCO1 KMSKQZKKOZQFFG-HSUXVGOQSA-N 0.000 description 2
- 102000010752 Plasminogen Inactivators Human genes 0.000 description 2
- 108010077971 Plasminogen Inactivators Proteins 0.000 description 2
- 102100030304 Platelet factor 4 Human genes 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 102100030432 Polyubiquitin-B Human genes 0.000 description 2
- HFVNWDWLWUCIHC-GUPDPFMOSA-N Prednimustine Chemical compound O=C([C@@]1(O)CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)[C@@H](O)C[C@@]21C)COC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 HFVNWDWLWUCIHC-GUPDPFMOSA-N 0.000 description 2
- 229940079156 Proteasome inhibitor Drugs 0.000 description 2
- 102100032420 Protein S100-A9 Human genes 0.000 description 2
- 102100024924 Protein kinase C alpha type Human genes 0.000 description 2
- PICZCWCKOLHDOJ-UHFFFAOYSA-N Pseudoaxinellin Natural products N1C(=O)C2CCCN2C(=O)C(CC(N)=O)NC(=O)C(C(C)C)NC(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C(C(C)C)NC(=O)C1CC1=CC=CC=C1 PICZCWCKOLHDOJ-UHFFFAOYSA-N 0.000 description 2
- 229940123827 Purine nucleoside phosphorylase inhibitor Drugs 0.000 description 2
- 102100034911 Pyruvate kinase PKM Human genes 0.000 description 2
- 102100024939 RNA-binding motif protein, X chromosome Human genes 0.000 description 2
- 108090000231 Ras GTPase-activating proteins Proteins 0.000 description 2
- 102000003901 Ras GTPase-activating proteins Human genes 0.000 description 2
- 229940078123 Ras inhibitor Drugs 0.000 description 2
- IGLNJRXAVVLDKE-OIOBTWANSA-N Rubidium-82 Chemical compound [82Rb] IGLNJRXAVVLDKE-OIOBTWANSA-N 0.000 description 2
- GCPUVEMWOWMALU-UHFFFAOYSA-N Rubiginone B1 Natural products C1C(C)CC(O)C2=C1C=CC1=C2C(=O)C(C=CC=C2OC)=C2C1=O GCPUVEMWOWMALU-UHFFFAOYSA-N 0.000 description 2
- 108010005173 SERPIN-B5 Proteins 0.000 description 2
- QCHFTSOMWOSFHM-UHFFFAOYSA-N SJ000285536 Natural products C1OC(=O)C(CC)C1CC1=CN=CN1C QCHFTSOMWOSFHM-UHFFFAOYSA-N 0.000 description 2
- SUYXJDLXGFPMCQ-INIZCTEOSA-N SJ000287331 Natural products CC1=c2cnccc2=C(C)C2=Nc3ccccc3[C@H]12 SUYXJDLXGFPMCQ-INIZCTEOSA-N 0.000 description 2
- YADVRLOQIWILGX-MIWLTHJTSA-N Sarcophytol A Chemical compound CC(C)C/1=C/C=C(C)/CC\C=C(C)\CC\C=C(C)\C[C@@H]\1O YADVRLOQIWILGX-MIWLTHJTSA-N 0.000 description 2
- 102100027054 Selenoprotein W Human genes 0.000 description 2
- 102100031402 Septin-10 Human genes 0.000 description 2
- 102100034470 Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Human genes 0.000 description 2
- 241000287219 Serinus canaria Species 0.000 description 2
- 102100030333 Serpin B5 Human genes 0.000 description 2
- 229920000519 Sizofiran Polymers 0.000 description 2
- OCOKWVBYZHBHLU-UHFFFAOYSA-N Sobuzoxane Chemical compound C1C(=O)N(COC(=O)OCC(C)C)C(=O)CN1CCN1CC(=O)N(COC(=O)OCC(C)C)C(=O)C1 OCOKWVBYZHBHLU-UHFFFAOYSA-N 0.000 description 2
- 102000013275 Somatomedins Human genes 0.000 description 2
- 102100024237 Stathmin Human genes 0.000 description 2
- ZSJLQEPLLKMAKR-UHFFFAOYSA-N Streptozotocin Natural products O=NN(C)C(=O)NC1C(O)OC(CO)C(O)C1O ZSJLQEPLLKMAKR-UHFFFAOYSA-N 0.000 description 2
- CIOAGBVUUVVLOB-NJFSPNSNSA-N Strontium-90 Chemical compound [90Sr] CIOAGBVUUVVLOB-NJFSPNSNSA-N 0.000 description 2
- 102100021947 Survival motor neuron protein Human genes 0.000 description 2
- CYQFCXCEBYINGO-UHFFFAOYSA-N THC Natural products C1=C(C)CCC2C(C)(C)OC3=CC(CCCCC)=CC(O)=C3C21 CYQFCXCEBYINGO-UHFFFAOYSA-N 0.000 description 2
- KLCCMMSKRMSMKI-QVNMXXJYSA-N TOP-53 Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](CCN(C)CCN(C)C)[C@@H]3[C@@H]2C(OC3)=O)=C1 KLCCMMSKRMSMKI-QVNMXXJYSA-N 0.000 description 2
- NAVMQTYZDKMPEU-UHFFFAOYSA-N Targretin Chemical compound CC1=CC(C(CCC2(C)C)(C)C)=C2C=C1C(=C)C1=CC=C(C(O)=O)C=C1 NAVMQTYZDKMPEU-UHFFFAOYSA-N 0.000 description 2
- 229940123237 Taxane Drugs 0.000 description 2
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 2
- WXZSUBHBYQYTNM-UHFFFAOYSA-N Tetrazomine Natural products C1=CC=2CC(N34)C(N5C)C(CO)CC5C4OCC3C=2C(OC)=C1NC(=O)C1NCCCC1O WXZSUBHBYQYTNM-UHFFFAOYSA-N 0.000 description 2
- UPGGKUQISSWRJJ-XLTUSUNSSA-N Thiocoraline Chemical compound O=C([C@H]1CSSC[C@@H](N(C(=O)CNC2=O)C)C(=O)N(C)[C@@H](C(SC[C@@H](C(=O)NCC(=O)N1C)NC(=O)C=1C(=CC3=CC=CC=C3N=1)O)=O)CSC)N(C)[C@H](CSC)C(=O)SC[C@@H]2NC(=O)C1=NC2=CC=CC=C2C=C1O UPGGKUQISSWRJJ-XLTUSUNSSA-N 0.000 description 2
- 108010078233 Thymalfasin Proteins 0.000 description 2
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 2
- 102000011923 Thyrotropin Human genes 0.000 description 2
- 108010061174 Thyrotropin Proteins 0.000 description 2
- 102100021783 Transcription factor E2F4 Human genes 0.000 description 2
- 102100026144 Transferrin receptor protein 1 Human genes 0.000 description 2
- 102100030742 Transforming growth factor beta-1 proprotein Human genes 0.000 description 2
- 102100034300 Tryptophan-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 102100033438 Tyrosine-protein kinase JAK1 Human genes 0.000 description 2
- VGQOVCHZGQWAOI-UHFFFAOYSA-N UNPD55612 Natural products N1C(O)C2CC(C=CC(N)=O)=CN2C(=O)C2=CC=C(C)C(O)=C12 VGQOVCHZGQWAOI-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 102100031358 Urokinase-type plasminogen activator Human genes 0.000 description 2
- MHGVSUAAUXQULX-UHFFFAOYSA-N Vinepidine Natural products CCC1CC2CN(CCC3C(=Nc4ccccc34)C(C2)(C(=O)OC)c5cc6c(cc5OC)N(C=O)C7C(O)(C(OC(=O)C)C8(CC)C=CCN9CCC67C89)C(=O)OC)C1 MHGVSUAAUXQULX-UHFFFAOYSA-N 0.000 description 2
- VWQVUPCCIRVNHF-OIOBTWANSA-N Yttrium-86 Chemical compound [86Y] VWQVUPCCIRVNHF-OIOBTWANSA-N 0.000 description 2
- OGQICQVSFDPSEI-UHFFFAOYSA-N Zorac Chemical compound N1=CC(C(=O)OCC)=CC=C1C#CC1=CC=C(SCCC2(C)C)C2=C1 OGQICQVSFDPSEI-UHFFFAOYSA-N 0.000 description 2
- ZZWKZQDOSJAGGF-VRSYWUPDSA-N [(1s,2e,7s,10e,12r,13r,15s)-12-hydroxy-7-methyl-9-oxo-8-oxabicyclo[11.3.0]hexadeca-2,10-dien-15-yl] 2-(dimethylamino)acetate Chemical compound O[C@@H]1\C=C\C(=O)O[C@@H](C)CCC\C=C\[C@@H]2C[C@H](OC(=O)CN(C)C)C[C@H]21 ZZWKZQDOSJAGGF-VRSYWUPDSA-N 0.000 description 2
- VUPBDWQPEOWRQP-RTUCOMKBSA-N [(2R,3S,4S,5R,6R)-2-[(2R,3S,4S,5S,6S)-2-[(1S,2S)-3-[[(2R,3S)-5-[[(2S,3R)-1-[[2-[4-[4-[[4-amino-6-[3-(4-aminobutylamino)propylamino]-6-oxohexyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]-1-[(2S,3R,4R,5S,6S)-5-amino-3,4-dihydroxy-6-methyloxan-2-yl]oxy-2-hydroxyethyl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-3-hydroxy-5-oxopentan-2-yl]amino]-2-[[6-amino-2-[(1S)-3-amino-1-[[(2S)-2,3-diamino-3-oxopropyl]amino]-3-oxopropyl]-5-methylpyrimidine-4-carbonyl]amino]-1-(1H-imidazol-5-yl)-3-oxopropoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] carbamate Chemical compound C[C@@H](O)[C@H](NC(=O)C[C@H](O)[C@@H](C)NC(=O)[C@@H](NC(=O)c1nc(nc(N)c1C)[C@H](CC(N)=O)NC[C@H](N)C(N)=O)[C@H](O[C@@H]1O[C@@H](CO)[C@@H](O)[C@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](OC(N)=O)[C@@H]1O)c1cnc[nH]1)C(=O)NC(O[C@@H]1O[C@@H](C)[C@@H](N)[C@@H](O)[C@H]1O)C(O)c1nc(cs1)-c1nc(cs1)C(=O)NCCCC(N)CC(=O)NCCCNCCCCN VUPBDWQPEOWRQP-RTUCOMKBSA-N 0.000 description 2
- SPKNARKFCOPTSY-XWPZMVOTSA-N [(2r,3s)-2-[(2s,3r)-3-methyloxiran-2-yl]-6-oxo-2,3-dihydropyran-3-yl] acetate Chemical compound C[C@H]1O[C@@H]1[C@H]1[C@@H](OC(C)=O)C=CC(=O)O1 SPKNARKFCOPTSY-XWPZMVOTSA-N 0.000 description 2
- IFJUINDAXYAPTO-UUBSBJJBSA-N [(8r,9s,13s,14s,17s)-17-[2-[4-[4-[bis(2-chloroethyl)amino]phenyl]butanoyloxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate Chemical compound C([C@@H]1[C@@H](C2=CC=3)CC[C@]4([C@H]1CC[C@@H]4OC(=O)COC(=O)CCCC=1C=CC(=CC=1)N(CCCl)CCCl)C)CC2=CC=3OC(=O)C1=CC=CC=C1 IFJUINDAXYAPTO-UUBSBJJBSA-N 0.000 description 2
- KMLCRELJHYKIIL-UHFFFAOYSA-N [1-(azanidylmethyl)cyclohexyl]methylazanide;platinum(2+);sulfuric acid Chemical compound [Pt+2].OS(O)(=O)=O.[NH-]CC1(C[NH-])CCCCC1 KMLCRELJHYKIIL-UHFFFAOYSA-N 0.000 description 2
- JJULHOZRTCDZOH-JGJFOBQESA-N [1-[[[(2r,3s,4s,5r)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-3-octadecylsulfanylpropan-2-yl] hexadecanoate Chemical compound O[C@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OCC(CSCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)O[C@H]1N1C(=O)N=C(N)C=C1 JJULHOZRTCDZOH-JGJFOBQESA-N 0.000 description 2
- PNDPGZBMCMUPRI-XXSWNUTMSA-N [125I][125I] Chemical compound [125I][125I] PNDPGZBMCMUPRI-XXSWNUTMSA-N 0.000 description 2
- XSMVECZRZBFTIZ-UHFFFAOYSA-M [2-(aminomethyl)cyclobutyl]methanamine;2-oxidopropanoate;platinum(4+) Chemical compound [Pt+4].CC([O-])C([O-])=O.NCC1CCC1CN XSMVECZRZBFTIZ-UHFFFAOYSA-M 0.000 description 2
- NAFFDQVVNWTDJD-UHFFFAOYSA-L [4-(azanidylmethyl)oxan-4-yl]methylazanide;cyclobutane-1,1-dicarboxylate;platinum(4+) Chemical compound [Pt+4].[NH-]CC1(C[NH-])CCOCC1.[O-]C(=O)C1(C([O-])=O)CCC1 NAFFDQVVNWTDJD-UHFFFAOYSA-L 0.000 description 2
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 2
- 229950008427 acivicin Drugs 0.000 description 2
- QAWIHIJWNYOLBE-OKKQSCSOSA-N acivicin Chemical compound OC(=O)[C@@H](N)[C@@H]1CC(Cl)=NO1 QAWIHIJWNYOLBE-OKKQSCSOSA-N 0.000 description 2
- 229950003478 acodazole Drugs 0.000 description 2
- 229950000616 acronine Drugs 0.000 description 2
- 229940125666 actinium-225 Drugs 0.000 description 2
- QQINRWTZWGJFDB-YPZZEJLDSA-N actinium-225 Chemical compound [225Ac] QQINRWTZWGJFDB-YPZZEJLDSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229950009084 adecatumumab Drugs 0.000 description 2
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
- 229940060516 alferon n Drugs 0.000 description 2
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 229950010817 alvocidib Drugs 0.000 description 2
- BIIVYFLTOXDAOV-YVEFUNNKSA-N alvocidib Chemical compound O[C@@H]1CN(C)CC[C@@H]1C1=C(O)C=C(O)C2=C1OC(C=1C(=CC=CC=1)Cl)=CC2=O BIIVYFLTOXDAOV-YVEFUNNKSA-N 0.000 description 2
- 229950004821 ambomycin Drugs 0.000 description 2
- 229960001097 amifostine Drugs 0.000 description 2
- JKOQGQFVAUAYPM-UHFFFAOYSA-N amifostine Chemical compound NCCCNCCSP(O)(O)=O JKOQGQFVAUAYPM-UHFFFAOYSA-N 0.000 description 2
- 229960003437 aminoglutethimide Drugs 0.000 description 2
- ROBVIMPUHSLWNV-UHFFFAOYSA-N aminoglutethimide Chemical compound C=1C=C(N)C=CC=1C1(CC)CCC(=O)NC1=O ROBVIMPUHSLWNV-UHFFFAOYSA-N 0.000 description 2
- 229960002749 aminolevulinic acid Drugs 0.000 description 2
- 229960000510 ammonia Drugs 0.000 description 2
- 229960002550 amrubicin Drugs 0.000 description 2
- VJZITPJGSQKZMX-XDPRQOKASA-N amrubicin Chemical compound O([C@H]1C[C@](CC2=C(O)C=3C(=O)C4=CC=CC=C4C(=O)C=3C(O)=C21)(N)C(=O)C)[C@H]1C[C@H](O)[C@H](O)CO1 VJZITPJGSQKZMX-XDPRQOKASA-N 0.000 description 2
- 239000002269 analeptic agent Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- ASLUCFFROXVMFL-UHFFFAOYSA-N andrographolide Natural products CC1(CO)C(O)CCC2(C)C(CC=C3/C(O)OCC3=O)C(=C)CCC12 ASLUCFFROXVMFL-UHFFFAOYSA-N 0.000 description 2
- 108010070670 antarelix Proteins 0.000 description 2
- VGQOVCHZGQWAOI-HYUHUPJXSA-N anthramycin Chemical compound N1[C@@H](O)[C@@H]2CC(\C=C\C(N)=O)=CN2C(=O)C2=CC=C(C)C(O)=C12 VGQOVCHZGQWAOI-HYUHUPJXSA-N 0.000 description 2
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 2
- 150000004056 anthraquinones Chemical class 0.000 description 2
- 239000000051 antiandrogen Substances 0.000 description 2
- 239000003005 anticarcinogenic agent Substances 0.000 description 2
- 102000025171 antigen binding proteins Human genes 0.000 description 2
- 108091000831 antigen binding proteins Proteins 0.000 description 2
- 239000002246 antineoplastic agent Substances 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- 239000000074 antisense oligonucleotide Substances 0.000 description 2
- 238000012230 antisense oligonucleotides Methods 0.000 description 2
- 230000006907 apoptotic process Effects 0.000 description 2
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 2
- 108010055530 arginyl-tryptophyl-N-methylphenylalanyl-tryptophyl-leucyl-methioninamide Proteins 0.000 description 2
- RQNWIZPPADIBDY-FTXFMUIASA-N arsenic-70 Chemical compound [70As] RQNWIZPPADIBDY-FTXFMUIASA-N 0.000 description 2
- RQNWIZPPADIBDY-AHCXROLUSA-N arsenic-71 Chemical compound [71As] RQNWIZPPADIBDY-AHCXROLUSA-N 0.000 description 2
- RQNWIZPPADIBDY-BJUDXGSMSA-N arsenic-74 Chemical compound [74As] RQNWIZPPADIBDY-BJUDXGSMSA-N 0.000 description 2
- 229960003272 asparaginase Drugs 0.000 description 2
- DCXYFEDJOCDNAF-UHFFFAOYSA-M asparaginate Chemical compound [O-]C(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-M 0.000 description 2
- RYXHOMYVWAEKHL-OUBTZVSYSA-N astatine-211 Chemical compound [211At] RYXHOMYVWAEKHL-OUBTZVSYSA-N 0.000 description 2
- 229950011088 asulacrine Drugs 0.000 description 2
- TWHSQQYCDVSBRK-UHFFFAOYSA-N asulacrine Chemical compound C12=CC=CC(C)=C2N=C2C(C(=O)NC)=CC=CC2=C1NC1=CC=C(NS(C)(=O)=O)C=C1OC TWHSQQYCDVSBRK-UHFFFAOYSA-N 0.000 description 2
- 229950004810 atamestane Drugs 0.000 description 2
- PEPMWUSGRKINHX-TXTPUJOMSA-N atamestane Chemical compound C1C[C@@H]2[C@@]3(C)C(C)=CC(=O)C=C3CC[C@H]2[C@@H]2CCC(=O)[C@]21C PEPMWUSGRKINHX-TXTPUJOMSA-N 0.000 description 2
- 229950006933 atrimustine Drugs 0.000 description 2
- 229940120638 avastin Drugs 0.000 description 2
- 108010093161 axinastatin 1 Proteins 0.000 description 2
- PICZCWCKOLHDOJ-GHTSNYPWSA-N axinastatin 1 Chemical compound C([C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@H](C(N[C@@H](CC(N)=O)C(=O)N2CCC[C@H]2C(=O)N1)=O)C(C)C)C(C)C)C(C)C)C1=CC=CC=C1 PICZCWCKOLHDOJ-GHTSNYPWSA-N 0.000 description 2
- 108010093000 axinastatin 2 Proteins 0.000 description 2
- OXNAATCTZCSVKR-AVGVIDKOSA-N axinastatin 2 Chemical compound C([C@H]1C(=O)N[C@H](C(=O)N[C@H](C(N2CCC[C@H]2C(=O)N[C@@H](C(=O)N[C@@H](CC(N)=O)C(=O)N2CCC[C@H]2C(=O)N1)C(C)C)=O)CC(C)C)C(C)C)C1=CC=CC=C1 OXNAATCTZCSVKR-AVGVIDKOSA-N 0.000 description 2
- UZCPCRPHNVHKKP-UHFFFAOYSA-N axinastatin 2 Natural products CC(C)CC1NC(=O)C2CCCN2C(=O)C(NC(=O)C(CC(=O)N)NC(=O)C3CCCN3C(=O)C(Cc4ccccc4)NC(=O)C(NC1=O)C(C)C)C(C)C UZCPCRPHNVHKKP-UHFFFAOYSA-N 0.000 description 2
- 108010092978 axinastatin 3 Proteins 0.000 description 2
- ANLDPEXRVVIABH-WUUSPZRJSA-N axinastatin 3 Chemical compound C([C@H]1C(=O)N[C@H](C(N[C@@H](CC(C)C)C(=O)N2CCC[C@H]2C(=O)N[C@@H](C(=O)N[C@@H](CC(N)=O)C(=O)N2CCC[C@H]2C(=O)N1)C(C)C)=O)[C@@H](C)CC)C1=CC=CC=C1 ANLDPEXRVVIABH-WUUSPZRJSA-N 0.000 description 2
- RTGMQVUKARGBNM-UHFFFAOYSA-N axinastatin 3 Natural products CCC(C)C1NC(=O)C(CC(C)C)NC(=O)C2CCCN2C(=O)C(NC(=O)C(CC(=O)N)NC(=O)C3CCCN3C(=O)C(Cc4ccccc4)NC1=O)C(C)C RTGMQVUKARGBNM-UHFFFAOYSA-N 0.000 description 2
- OPWOOOGFNULJAQ-UHFFFAOYSA-L azane;cyclopentanamine;2-hydroxybutanedioate;platinum(2+) Chemical compound N.[Pt+2].NC1CCCC1.[O-]C(=O)C(O)CC([O-])=O OPWOOOGFNULJAQ-UHFFFAOYSA-L 0.000 description 2
- KLNFSAOEKUDMFA-UHFFFAOYSA-N azanide;2-hydroxyacetic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OCC(O)=O KLNFSAOEKUDMFA-UHFFFAOYSA-N 0.000 description 2
- 229950005951 azasetron Drugs 0.000 description 2
- HRXVDDOKERXBEY-UHFFFAOYSA-N azatepa Chemical compound C1CN1P(=O)(N1CC1)N(CC)C1=NN=CS1 HRXVDDOKERXBEY-UHFFFAOYSA-N 0.000 description 2
- 229960002170 azathioprine Drugs 0.000 description 2
- LMEKQMALGUDUQG-UHFFFAOYSA-N azathioprine Chemical compound CN1C=NC([N+]([O-])=O)=C1SC1=NC=NC2=C1NC=N2 LMEKQMALGUDUQG-UHFFFAOYSA-N 0.000 description 2
- 229950004295 azotomycin Drugs 0.000 description 2
- XYUFCXJZFZPEJD-PGRDOPGGSA-N balanol Chemical compound OC(=O)C1=CC=CC(O)=C1C(=O)C1=C(O)C=C(C(=O)O[C@H]2[C@H](CNCCC2)NC(=O)C=2C=CC(O)=CC=2)C=C1O XYUFCXJZFZPEJD-PGRDOPGGSA-N 0.000 description 2
- 229950005567 benzodepa Drugs 0.000 description 2
- VFIUCBTYGKMLCM-UHFFFAOYSA-N benzyl n-[bis(aziridin-1-yl)phosphoryl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NP(=O)(N1CC1)N1CC1 VFIUCBTYGKMLCM-UHFFFAOYSA-N 0.000 description 2
- QGJZLNKBHJESQX-FZFNOLFKSA-N betulinic acid Chemical compound C1C[C@H](O)C(C)(C)[C@@H]2CC[C@@]3(C)[C@]4(C)CC[C@@]5(C(O)=O)CC[C@@H](C(=C)C)[C@@H]5[C@H]4CC[C@@H]3[C@]21C QGJZLNKBHJESQX-FZFNOLFKSA-N 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- JCXGWMGPZLAOME-AKLPVKDBSA-N bismuth-212 Chemical compound [212Bi] JCXGWMGPZLAOME-AKLPVKDBSA-N 0.000 description 2
- JCXGWMGPZLAOME-RNFDNDRNSA-N bismuth-213 Chemical compound [213Bi] JCXGWMGPZLAOME-RNFDNDRNSA-N 0.000 description 2
- 229950002370 bisnafide Drugs 0.000 description 2
- 229960003008 blinatumomab Drugs 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- PZOHOALJQOFNTB-UHFFFAOYSA-M brequinar sodium Chemical compound [Na+].N1=C2C=CC(F)=CC2=C(C([O-])=O)C(C)=C1C(C=C1)=CC=C1C1=CC=CC=C1F PZOHOALJQOFNTB-UHFFFAOYSA-M 0.000 description 2
- 229950002361 budotitane Drugs 0.000 description 2
- LWQQLNNNIPYSNX-UROSTWAQSA-N calcipotriol Chemical compound C1([C@H](O)/C=C/[C@@H](C)[C@@H]2[C@]3(CCCC(/[C@@H]3CC2)=C\C=C\2C([C@@H](O)C[C@H](O)C/2)=C)C)CC1 LWQQLNNNIPYSNX-UROSTWAQSA-N 0.000 description 2
- 229960002882 calcipotriol Drugs 0.000 description 2
- IVFYLRMMHVYGJH-PVPPCFLZSA-N calusterone Chemical compound C1C[C@]2(C)[C@](O)(C)CC[C@H]2[C@@H]2[C@@H](C)CC3=CC(=O)CC[C@]3(C)[C@H]21 IVFYLRMMHVYGJH-PVPPCFLZSA-N 0.000 description 2
- 229950009823 calusterone Drugs 0.000 description 2
- 229960004117 capecitabine Drugs 0.000 description 2
- 125000000609 carbazolyl group Chemical class C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 2
- 229950005155 carbetimer Drugs 0.000 description 2
- OKTJSMMVPCPJKN-BJUDXGSMSA-N carbon-11 Chemical compound [11C] OKTJSMMVPCPJKN-BJUDXGSMSA-N 0.000 description 2
- WNRZHQBJSXRYJK-UHFFFAOYSA-N carboxyamidotriazole Chemical compound NC1=C(C(=O)N)N=NN1CC(C=C1Cl)=CC(Cl)=C1C(=O)C1=CC=C(Cl)C=C1 WNRZHQBJSXRYJK-UHFFFAOYSA-N 0.000 description 2
- XREUEWVEMYWFFA-CSKJXFQVSA-N carminomycin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=C(O)C=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XREUEWVEMYWFFA-CSKJXFQVSA-N 0.000 description 2
- 229960005243 carmustine Drugs 0.000 description 2
- 210000000845 cartilage Anatomy 0.000 description 2
- 229950001725 carubicin Drugs 0.000 description 2
- 229950010667 cedefingol Drugs 0.000 description 2
- NMMGUHANGUWNBN-OGLOGDKOSA-N cep-751 Chemical compound C12=C3N4C5=CC=CC=C5C3=C3CNC(=O)C3=C2C2=CC=CC=C2N1C1C[C@](OC)(CO)[C@]4(C)O1 NMMGUHANGUWNBN-OGLOGDKOSA-N 0.000 description 2
- QEWPVAOWLNMLRI-UHFFFAOYSA-N chembl203666 Chemical compound OCCNCCN1N=C2C3=C(O)C=CC(O)=C3C(=O)C3=C2C1=CC=C3NCCCN QEWPVAOWLNMLRI-UHFFFAOYSA-N 0.000 description 2
- OWSKEUBOCMEJMI-KPXOXKRLSA-N chembl2105946 Chemical compound [N-]=[N+]=CC(=O)CC[C@H](NC(=O)[C@@H](N)C)C(=O)N[C@H](CCC(=O)C=[N+]=[N-])C(O)=O OWSKEUBOCMEJMI-KPXOXKRLSA-N 0.000 description 2
- UKTAZPQNNNJVKR-KJGYPYNMSA-N chembl2368925 Chemical compound C1=CC=C2C(C(O[C@@H]3C[C@@H]4C[C@H]5C[C@@H](N4CC5=O)C3)=O)=CNC2=C1 UKTAZPQNNNJVKR-KJGYPYNMSA-N 0.000 description 2
- DCKFXSZUWVWFEU-JECTWPLRSA-N chembl499423 Chemical compound O1[C@@H](CC)CCCC[C@]11NC(N23)=N[C@]4(O[C@H](C)CCC4)[C@@H](C(=O)OCCCCCCCCCCCCCCCC(=O)N(CCCN)C[C@@H](O)CCN)[C@@]3(O)CC[C@H]2C1 DCKFXSZUWVWFEU-JECTWPLRSA-N 0.000 description 2
- SURLGNKAQXKNSP-DBLYXWCISA-N chlorin Chemical compound C\1=C/2\N/C(=C\C3=N/C(=C\C=4NC(/C=C\5/C=CC/1=N/5)=CC=4)/C=C3)/CC\2 SURLGNKAQXKNSP-DBLYXWCISA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 229940015047 chorionic gonadotropin Drugs 0.000 description 2
- ARUGKOZUKWAXDS-SEWALLKFSA-N cicaprost Chemical compound C1\C(=C/COCC(O)=O)C[C@@H]2[C@@H](C#C[C@@H](O)[C@@H](C)CC#CCC)[C@H](O)C[C@@H]21 ARUGKOZUKWAXDS-SEWALLKFSA-N 0.000 description 2
- 229950000634 cicaprost Drugs 0.000 description 2
- 229950011359 cirolemycin Drugs 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- GKIRPKYJQBWNGO-OCEACIFDSA-N clomifene Chemical class C1=CC(OCCN(CC)CC)=CC=C1C(\C=1C=CC=CC=1)=C(\Cl)C1=CC=CC=C1 GKIRPKYJQBWNGO-OCEACIFDSA-N 0.000 description 2
- 229960005537 combretastatin A-4 Drugs 0.000 description 2
- HVXBOLULGPECHP-UHFFFAOYSA-N combretastatin A4 Natural products C1=C(O)C(OC)=CC=C1C=CC1=CC(OC)=C(OC)C(OC)=C1 HVXBOLULGPECHP-UHFFFAOYSA-N 0.000 description 2
- 150000004814 combretastatins Chemical class 0.000 description 2
- GLESHRYLRAOJPS-DHCFDGJBSA-N conagenin Chemical compound C[C@@H](O)[C@H](C)[C@@H](O)C(=O)N[C@@](C)(CO)C(O)=O GLESHRYLRAOJPS-DHCFDGJBSA-N 0.000 description 2
- RYGMFSIKBFXOCR-OIOBTWANSA-N copper-61 Chemical compound [61Cu] RYGMFSIKBFXOCR-OIOBTWANSA-N 0.000 description 2
- RYGMFSIKBFXOCR-YPZZEJLDSA-N copper-62 Chemical compound [62Cu] RYGMFSIKBFXOCR-YPZZEJLDSA-N 0.000 description 2
- RYGMFSIKBFXOCR-IGMARMGPSA-N copper-64 Chemical compound [64Cu] RYGMFSIKBFXOCR-IGMARMGPSA-N 0.000 description 2
- 108010006226 cryptophycin Proteins 0.000 description 2
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 2
- 108010041566 cypemycin Proteins 0.000 description 2
- 230000001461 cytolytic effect Effects 0.000 description 2
- OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical compound NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 2
- 229940127089 cytotoxic agent Drugs 0.000 description 2
- YCWXIQRLONXJLF-PFFGJIDWSA-N d06307 Chemical compound OS(O)(=O)=O.C([C@]1([C@@H]2O1)CC)N(CCC=1C3=CC=CC=C3NC=11)C[C@H]2C[C@]1(C(=O)OC)C1=CC([C@]23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC.C([C@]1([C@@H]2O1)CC)N(CCC=1C3=CC=CC=C3NC=11)C[C@H]2C[C@]1(C(=O)OC)C1=CC([C@]23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC YCWXIQRLONXJLF-PFFGJIDWSA-N 0.000 description 2
- 229960003109 daunorubicin hydrochloride Drugs 0.000 description 2
- CYQFCXCEBYINGO-IAGOWNOFSA-N delta1-THC Chemical compound C1=C(C)CC[C@H]2C(C)(C)OC3=CC(CCCCC)=CC(O)=C3[C@@H]21 CYQFCXCEBYINGO-IAGOWNOFSA-N 0.000 description 2
- 230000017858 demethylation Effects 0.000 description 2
- 238000010520 demethylation reaction Methods 0.000 description 2
- 108700025485 deslorelin Proteins 0.000 description 2
- 229960005408 deslorelin Drugs 0.000 description 2
- 229910052805 deuterium Inorganic materials 0.000 description 2
- VPOCYEOOFRNHNL-RQDPQJJXSA-J dexormaplatin Chemical compound Cl[Pt](Cl)(Cl)Cl.N[C@@H]1CCCC[C@H]1N VPOCYEOOFRNHNL-RQDPQJJXSA-J 0.000 description 2
- 229950001640 dexormaplatin Drugs 0.000 description 2
- 229960000605 dexrazoxane Drugs 0.000 description 2
- 229950005878 dexverapamil Drugs 0.000 description 2
- SGTNSNPWRIOYBX-HHHXNRCGSA-N dexverapamil Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCC[C@@](C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-HHHXNRCGSA-N 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- CZLKTMHQYXYHOO-QTNFYWBSSA-L disodium;(2s)-2-[(2-phosphonatoacetyl)amino]butanedioic acid Chemical compound [Na+].[Na+].OC(=O)C[C@@H](C(O)=O)NC(=O)CP([O-])([O-])=O CZLKTMHQYXYHOO-QTNFYWBSSA-L 0.000 description 2
- SVJSWELRJWVPQD-KJWOGLQMSA-L disodium;(2s)-2-[[4-[2-[(6r)-2-amino-4-oxo-5,6,7,8-tetrahydro-1h-pyrido[2,3-d]pyrimidin-6-yl]ethyl]benzoyl]amino]pentanedioate Chemical compound [Na+].[Na+].C([C@@H]1CC=2C(=O)N=C(NC=2NC1)N)CC1=CC=C(C(=O)N[C@@H](CCC([O-])=O)C([O-])=O)C=C1 SVJSWELRJWVPQD-KJWOGLQMSA-L 0.000 description 2
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 description 2
- 229960000735 docosanol Drugs 0.000 description 2
- 229960003413 dolasetron Drugs 0.000 description 2
- ZWAOHEXOSAUJHY-ZIYNGMLESA-N doxifluridine Chemical compound O[C@@H]1[C@H](O)[C@@H](C)O[C@H]1N1C(=O)NC(=O)C(F)=C1 ZWAOHEXOSAUJHY-ZIYNGMLESA-N 0.000 description 2
- 229950005454 doxifluridine Drugs 0.000 description 2
- NOTIQUSPUUHHEH-UXOVVSIBSA-N dromostanolone propionate Chemical compound C([C@@H]1CC2)C(=O)[C@H](C)C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](OC(=O)CC)[C@@]2(C)CC1 NOTIQUSPUUHHEH-UXOVVSIBSA-N 0.000 description 2
- 229960004242 dronabinol Drugs 0.000 description 2
- 229950004683 drostanolone propionate Drugs 0.000 description 2
- 229950005133 duazomycin Drugs 0.000 description 2
- 229930192837 duazomycin Natural products 0.000 description 2
- 229950005678 ecomustine Drugs 0.000 description 2
- FSIRXIHZBIXHKT-MHTVFEQDSA-N edatrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CC(CC)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FSIRXIHZBIXHKT-MHTVFEQDSA-N 0.000 description 2
- 229950006700 edatrexate Drugs 0.000 description 2
- 229950011461 edelfosine Drugs 0.000 description 2
- 229960002759 eflornithine Drugs 0.000 description 2
- VLCYCQAOQCDTCN-UHFFFAOYSA-N eflornithine Chemical compound NCCCC(N)(C(F)F)C(O)=O VLCYCQAOQCDTCN-UHFFFAOYSA-N 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- MGQRRMONVLMKJL-KWJIQSIXSA-N elsamitrucin Chemical compound O1[C@H](C)[C@H](O)[C@H](OC)[C@@H](N)[C@H]1O[C@@H]1[C@](O)(C)[C@@H](O)[C@@H](C)O[C@H]1OC1=CC=CC2=C(O)C(C(O3)=O)=C4C5=C3C=CC(C)=C5C(=O)OC4=C12 MGQRRMONVLMKJL-KWJIQSIXSA-N 0.000 description 2
- 229950002339 elsamitrucin Drugs 0.000 description 2
- 229950005450 emitefur Drugs 0.000 description 2
- 229950010625 enloplatin Drugs 0.000 description 2
- 229950001022 enpromate Drugs 0.000 description 2
- 239000002532 enzyme inhibitor Substances 0.000 description 2
- 229940125532 enzyme inhibitor Drugs 0.000 description 2
- YJGVMLPVUAXIQN-UHFFFAOYSA-N epipodophyllotoxin Natural products COC1=C(OC)C(OC)=CC(C2C3=CC=4OCOC=4C=C3C(O)C3C2C(OC3)=O)=C1 YJGVMLPVUAXIQN-UHFFFAOYSA-N 0.000 description 2
- 229960001904 epirubicin Drugs 0.000 description 2
- 229960003265 epirubicin hydrochloride Drugs 0.000 description 2
- 229950009760 epratuzumab Drugs 0.000 description 2
- 229950009537 epristeride Drugs 0.000 description 2
- 229950001426 erbulozole Drugs 0.000 description 2
- KLEPCGBEXOCIGS-QPPBQGQZSA-N erbulozole Chemical compound C1=CC(NC(=O)OCC)=CC=C1SC[C@@H]1O[C@@](CN2C=NC=C2)(C=2C=CC(OC)=CC=2)OC1 KLEPCGBEXOCIGS-QPPBQGQZSA-N 0.000 description 2
- 229960001842 estramustine Drugs 0.000 description 2
- 229960001766 estramustine phosphate sodium Drugs 0.000 description 2
- IIUMCNJTGSMNRO-VVSKJQCTSA-L estramustine sodium phosphate Chemical compound [Na+].[Na+].ClCCN(CCCl)C(=O)OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)OP([O-])([O-])=O)[C@@H]4[C@@H]3CCC2=C1 IIUMCNJTGSMNRO-VVSKJQCTSA-L 0.000 description 2
- HYSIJEPDMLSIQJ-UHFFFAOYSA-N ethanolate;1-phenylbutane-1,3-dione;titanium(4+) Chemical compound [Ti+4].CC[O-].CC[O-].CC(=O)[CH-]C(=O)C1=CC=CC=C1.CC(=O)[CH-]C(=O)C1=CC=CC=C1 HYSIJEPDMLSIQJ-UHFFFAOYSA-N 0.000 description 2
- 229940011957 ethiodized oil Drugs 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- HZQPPNNARUQMJA-IMIWJGOWSA-N ethyl n-[4-[[(2r,4r)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methylsulfanyl]phenyl]carbamate;hydrochloride Chemical compound Cl.C1=CC(NC(=O)OCC)=CC=C1SC[C@@H]1O[C@@](CN2C=NC=C2)(C=2C(=CC(Cl)=CC=2)Cl)OC1 HZQPPNNARUQMJA-IMIWJGOWSA-N 0.000 description 2
- 229960000255 exemestane Drugs 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 210000002950 fibroblast Anatomy 0.000 description 2
- 229960004177 filgrastim Drugs 0.000 description 2
- 229960004039 finasteride Drugs 0.000 description 2
- DBEPLOCGEIEOCV-WSBQPABSSA-N finasteride Chemical compound N([C@@H]1CC2)C(=O)C=C[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](C(=O)NC(C)(C)C)[C@@]2(C)CC1 DBEPLOCGEIEOCV-WSBQPABSSA-N 0.000 description 2
- 229950006000 flezelastine Drugs 0.000 description 2
- 229960000304 folic acid Drugs 0.000 description 2
- 235000019152 folic acid Nutrition 0.000 description 2
- 239000011724 folic acid Substances 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 229950004217 forfenimex Drugs 0.000 description 2
- OSVMTWJCGUFAOD-KZQROQTASA-N formestane Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1O OSVMTWJCGUFAOD-KZQROQTASA-N 0.000 description 2
- 229960004421 formestane Drugs 0.000 description 2
- UXTSQCOOUJTIAC-UHFFFAOYSA-N fosquidone Chemical compound C=1N2CC3=CC=CC=C3C(C)C2=C(C(C2=CC=C3)=O)C=1C(=O)C2=C3OP(O)(=O)OCC1=CC=CC=C1 UXTSQCOOUJTIAC-UHFFFAOYSA-N 0.000 description 2
- 229950005611 fosquidone Drugs 0.000 description 2
- 229950010404 fostriecin Drugs 0.000 description 2
- 230000006870 function Effects 0.000 description 2
- CHPZKNULDCNCBW-UHFFFAOYSA-N gallium nitrate Inorganic materials [Ga+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O CHPZKNULDCNCBW-UHFFFAOYSA-N 0.000 description 2
- 229950004410 galocitabine Drugs 0.000 description 2
- 229960003794 ganirelix Drugs 0.000 description 2
- 108700032141 ganirelix Proteins 0.000 description 2
- GJNXBNATEDXMAK-PFLSVRRQSA-N ganirelix Chemical compound C([C@@H](C(=O)N[C@H](CCCCN=C(NCC)NCC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN=C(NCC)NCC)C(=O)N1[C@@H](CCC1)C(=O)N[C@H](C)C(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](CC=1C=NC=CC=1)NC(=O)[C@@H](CC=1C=CC(Cl)=CC=1)NC(=O)[C@@H](CC=1C=C2C=CC=CC2=CC=1)NC(C)=O)C1=CC=C(O)C=C1 GJNXBNATEDXMAK-PFLSVRRQSA-N 0.000 description 2
- 229940084478 ganite Drugs 0.000 description 2
- 239000002406 gelatinase inhibitor Substances 0.000 description 2
- 229960005144 gemcitabine hydrochloride Drugs 0.000 description 2
- 210000004907 gland Anatomy 0.000 description 2
- RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 2
- 229960003180 glutathione Drugs 0.000 description 2
- 235000003969 glutathione Nutrition 0.000 description 2
- PCHJSUWPFVWCPO-OUBTZVSYSA-N gold-198 Chemical compound [198Au] PCHJSUWPFVWCPO-OUBTZVSYSA-N 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 229940022353 herceptin Drugs 0.000 description 2
- MPGWGYQTRSNGDD-UHFFFAOYSA-N hypericin Chemical compound OC1=CC(O)=C(C2=O)C3=C1C1C(O)=CC(=O)C(C4=O)=C1C1=C3C3=C2C(O)=CC(C)=C3C2=C1C4=C(O)C=C2C MPGWGYQTRSNGDD-UHFFFAOYSA-N 0.000 description 2
- 229940005608 hypericin Drugs 0.000 description 2
- PHOKTTKFQUYZPI-UHFFFAOYSA-N hypericin Natural products Cc1cc(O)c2c3C(=O)C(=Cc4c(O)c5c(O)cc(O)c6c7C(=O)C(=Cc8c(C)c1c2c(c78)c(c34)c56)O)O PHOKTTKFQUYZPI-UHFFFAOYSA-N 0.000 description 2
- 229950002248 idoxifene Drugs 0.000 description 2
- TZBDEVBNMSLVKT-UHFFFAOYSA-N idramantone Chemical compound C1C(C2)CC3CC1(O)CC2C3=O TZBDEVBNMSLVKT-UHFFFAOYSA-N 0.000 description 2
- 229950009926 idramantone Drugs 0.000 description 2
- NITYDPDXAAFEIT-DYVFJYSZSA-N ilomastat Chemical compound C1=CC=C2C(C[C@@H](C(=O)NC)NC(=O)[C@H](CC(C)C)CC(=O)NO)=CNC2=C1 NITYDPDXAAFEIT-DYVFJYSZSA-N 0.000 description 2
- 229960003696 ilomastat Drugs 0.000 description 2
- DOUYETYNHWVLEO-UHFFFAOYSA-N imiquimod Chemical compound C1=CC=CC2=C3N(CC(C)C)C=NC3=C(N)N=C21 DOUYETYNHWVLEO-UHFFFAOYSA-N 0.000 description 2
- 229960002751 imiquimod Drugs 0.000 description 2
- 239000002955 immunomodulating agent Substances 0.000 description 2
- 229940121354 immunomodulator Drugs 0.000 description 2
- 230000002584 immunomodulator Effects 0.000 description 2
- 230000003308 immunostimulating effect Effects 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- APFVFJFRJDLVQX-FTXFMUIASA-N indium-110 Chemical compound [110In] APFVFJFRJDLVQX-FTXFMUIASA-N 0.000 description 2
- 239000000411 inducer Substances 0.000 description 2
- 229960003786 inosine Drugs 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- 229960003795 iobenguane (123i) Drugs 0.000 description 2
- 229940044173 iodine-125 Drugs 0.000 description 2
- 229960005386 ipilimumab Drugs 0.000 description 2
- 229950010897 iproplatin Drugs 0.000 description 2
- 229960004768 irinotecan Drugs 0.000 description 2
- 229960000779 irinotecan hydrochloride Drugs 0.000 description 2
- 229950000855 iroplact Drugs 0.000 description 2
- 229950010984 irsogladine Drugs 0.000 description 2
- 229960005280 isotretinoin Drugs 0.000 description 2
- GQWYWHOHRVVHAP-DHKPLNAMSA-N jaspamide Chemical compound C1([C@@H]2NC(=O)[C@@H](CC=3C4=CC=CC=C4NC=3Br)N(C)C(=O)[C@H](C)NC(=O)[C@@H](C)C/C(C)=C/[C@H](C)C[C@@H](OC(=O)C2)C)=CC=C(O)C=C1 GQWYWHOHRVVHAP-DHKPLNAMSA-N 0.000 description 2
- 108010052440 jasplakinolide Proteins 0.000 description 2
- GQWYWHOHRVVHAP-UHFFFAOYSA-N jasplakinolide Natural products C1C(=O)OC(C)CC(C)C=C(C)CC(C)C(=O)NC(C)C(=O)N(C)C(CC=2C3=CC=CC=C3NC=2Br)C(=O)NC1C1=CC=C(O)C=C1 GQWYWHOHRVVHAP-UHFFFAOYSA-N 0.000 description 2
- 108010091711 kahalalide F Proteins 0.000 description 2
- WABPQHHGFIMREM-BKFZFHPZSA-N lead-212 Chemical compound [212Pb] WABPQHHGFIMREM-BKFZFHPZSA-N 0.000 description 2
- 229940115286 lentinan Drugs 0.000 description 2
- 208000032839 leukemia Diseases 0.000 description 2
- 210000000265 leukocyte Anatomy 0.000 description 2
- 229960001614 levamisole Drugs 0.000 description 2
- RBBBWKUBQVARPL-SWQMWMPHSA-N lissoclinamide 7 Chemical compound C([C@H]1C(=O)N2CCC[C@H]2C2=N[C@@H]([C@H](O2)C)C(=O)N[C@@H](C=2SC[C@H](N=2)C(=O)N[C@H](CC=2C=CC=CC=2)C=2SC[C@H](N=2)C(=O)N1)C(C)C)C1=CC=CC=C1 RBBBWKUBQVARPL-SWQMWMPHSA-N 0.000 description 2
- 108010020270 lissoclinamide 7 Proteins 0.000 description 2
- RBBBWKUBQVARPL-UHFFFAOYSA-N lissoclinamide 7 Natural products N1C(=O)C(N=2)CSC=2C(CC=2C=CC=CC=2)NC(=O)C(N=2)CSC=2C(C(C)C)NC(=O)C(C(O2)C)N=C2C2CCCN2C(=O)C1CC1=CC=CC=C1 RBBBWKUBQVARPL-UHFFFAOYSA-N 0.000 description 2
- 229950008991 lobaplatin Drugs 0.000 description 2
- 229950000909 lometrexol Drugs 0.000 description 2
- XDMHALQMTPSGEA-UHFFFAOYSA-N losoxantrone hydrochloride Chemical compound Cl.Cl.OCCNCCN1N=C2C3=CC=CC(O)=C3C(=O)C3=C2C1=CC=C3NCCNCCO XDMHALQMTPSGEA-UHFFFAOYSA-N 0.000 description 2
- PCZOHLXUXFIOCF-BXMDZJJMSA-N lovastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 PCZOHLXUXFIOCF-BXMDZJJMSA-N 0.000 description 2
- 229960004844 lovastatin Drugs 0.000 description 2
- QLJODMDSTUBWDW-UHFFFAOYSA-N lovastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(C)C=C21 QLJODMDSTUBWDW-UHFFFAOYSA-N 0.000 description 2
- 229950005634 loxoribine Drugs 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- RVFGKBWWUQOIOU-NDEPHWFRSA-N lurtotecan Chemical compound O=C([C@]1(O)CC)OCC(C(N2CC3=4)=O)=C1C=C2C3=NC1=CC=2OCCOC=2C=C1C=4CN1CCN(C)CC1 RVFGKBWWUQOIOU-NDEPHWFRSA-N 0.000 description 2
- 229950002654 lurtotecan Drugs 0.000 description 2
- 229940121386 matrix metalloproteinase inhibitor Drugs 0.000 description 2
- 239000003771 matrix metalloproteinase inhibitor Substances 0.000 description 2
- 229950008001 matuzumab Drugs 0.000 description 2
- 229960004805 melengestrol Drugs 0.000 description 2
- 108700025096 meterelin Proteins 0.000 description 2
- BKBBTCORRZMASO-ZOWNYOTGSA-M methotrexate monosodium Chemical compound [Na+].C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C([O-])=O)C=C1 BKBBTCORRZMASO-ZOWNYOTGSA-M 0.000 description 2
- 229960003058 methotrexate sodium Drugs 0.000 description 2
- HRHKSTOGXBBQCB-VFWICMBZSA-N methylmitomycin Chemical compound O=C1C(N)=C(C)C(=O)C2=C1[C@@H](COC(N)=O)[C@@]1(OC)[C@H]3N(C)[C@H]3CN12 HRHKSTOGXBBQCB-VFWICMBZSA-N 0.000 description 2
- 229960004503 metoclopramide Drugs 0.000 description 2
- TTWJBBZEZQICBI-UHFFFAOYSA-N metoclopramide Chemical compound CCN(CC)CCNC(=O)C1=CC(Cl)=C(N)C=C1OC TTWJBBZEZQICBI-UHFFFAOYSA-N 0.000 description 2
- VQJHOPSWBGJHQS-UHFFFAOYSA-N metoprine, methodichlorophen Chemical compound CC1=NC(N)=NC(N)=C1C1=CC=C(Cl)C(Cl)=C1 VQJHOPSWBGJHQS-UHFFFAOYSA-N 0.000 description 2
- HPNSFSBZBAHARI-UHFFFAOYSA-N micophenolic acid Natural products OC1=C(CC=C(C)CCC(O)=O)C(OC)=C(C)C2=C1C(=O)OC2 HPNSFSBZBAHARI-UHFFFAOYSA-N 0.000 description 2
- 229960003248 mifepristone Drugs 0.000 description 2
- VKHAHZOOUSRJNA-GCNJZUOMSA-N mifepristone Chemical compound C1([C@@H]2C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]3CC[C@@]([C@]3(C2)C)(O)C#CC)=CC=C(N(C)C)C=C1 VKHAHZOOUSRJNA-GCNJZUOMSA-N 0.000 description 2
- 229960003775 miltefosine Drugs 0.000 description 2
- PQLXHQMOHUQAKB-UHFFFAOYSA-N miltefosine Chemical compound CCCCCCCCCCCCCCCCOP([O-])(=O)OCC[N+](C)(C)C PQLXHQMOHUQAKB-UHFFFAOYSA-N 0.000 description 2
- DRCJGCOYHLTVNR-ZUIZSQJWSA-N mitindomide Chemical compound C1=C[C@@H]2[C@@H]3[C@H]4C(=O)NC(=O)[C@H]4[C@@H]3[C@H]1[C@@H]1C(=O)NC(=O)[C@H]21 DRCJGCOYHLTVNR-ZUIZSQJWSA-N 0.000 description 2
- 229950001314 mitindomide Drugs 0.000 description 2
- 229950000911 mitogillin Drugs 0.000 description 2
- VFKZTMPDYBFSTM-GUCUJZIJSA-N mitolactol Chemical compound BrC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CBr VFKZTMPDYBFSTM-GUCUJZIJSA-N 0.000 description 2
- 229950010913 mitolactol Drugs 0.000 description 2
- 229950001745 mitonafide Drugs 0.000 description 2
- 229950005715 mitosper Drugs 0.000 description 2
- 229960000350 mitotane Drugs 0.000 description 2
- QXYYYPFGTSJXNS-UHFFFAOYSA-N mitozolomide Chemical compound N1=NN(CCCl)C(=O)N2C1=C(C(=O)N)N=C2 QXYYYPFGTSJXNS-UHFFFAOYSA-N 0.000 description 2
- 229950005967 mitozolomide Drugs 0.000 description 2
- 229950003063 mitumomab Drugs 0.000 description 2
- 229950008012 mofarotene Drugs 0.000 description 2
- VOWOEBADKMXUBU-UHFFFAOYSA-J molecular oxygen;tetrachlorite;hydrate Chemical compound O.O=O.[O-]Cl=O.[O-]Cl=O.[O-]Cl=O.[O-]Cl=O VOWOEBADKMXUBU-UHFFFAOYSA-J 0.000 description 2
- 229960003063 molgramostim Drugs 0.000 description 2
- 108010032806 molgramostim Proteins 0.000 description 2
- 229940035032 monophosphoryl lipid a Drugs 0.000 description 2
- FOYWNSCCNCUEPU-UHFFFAOYSA-N mopidamol Chemical compound C12=NC(N(CCO)CCO)=NC=C2N=C(N(CCO)CCO)N=C1N1CCCCC1 FOYWNSCCNCUEPU-UHFFFAOYSA-N 0.000 description 2
- 229950010718 mopidamol Drugs 0.000 description 2
- AARXZCZYLAFQQU-UHFFFAOYSA-N motexafin gadolinium Chemical compound [Gd].CC(O)=O.CC(O)=O.C1=C([N-]2)C(CC)=C(CC)C2=CC(C(=C2C)CCCO)=NC2=CN=C2C=C(OCCOCCOCCOC)C(OCCOCCOCCOC)=CC2=NC=C2C(C)=C(CCCO)C1=N2 AARXZCZYLAFQQU-UHFFFAOYSA-N 0.000 description 2
- WIQKYZYFTAEWBF-UHFFFAOYSA-L motexafin lutetium hydrate Chemical compound O.[Lu+3].CC([O-])=O.CC([O-])=O.C1=C([N-]2)C(CC)=C(CC)C2=CC(C(=C2C)CCCO)=NC2=CN=C2C=C(OCCOCCOCCOC)C(OCCOCCOCCOC)=CC2=NC=C2C(C)=C(CCCO)C1=N2 WIQKYZYFTAEWBF-UHFFFAOYSA-L 0.000 description 2
- 229960000951 mycophenolic acid Drugs 0.000 description 2
- HPNSFSBZBAHARI-RUDMXATFSA-N mycophenolic acid Chemical compound OC1=C(C\C=C(/C)CCC(O)=O)C(OC)=C(C)C2=C1C(=O)OC2 HPNSFSBZBAHARI-RUDMXATFSA-N 0.000 description 2
- CRJGESKKUOMBCT-PMACEKPBSA-N n-[(2s,3s)-1,3-dihydroxyoctadecan-2-yl]acetamide Chemical compound CCCCCCCCCCCCCCC[C@H](O)[C@H](CO)NC(C)=O CRJGESKKUOMBCT-PMACEKPBSA-N 0.000 description 2
- NKFHKYQGZDAKMX-PPRKPIOESA-N n-[(e)-1-[(2s,4s)-4-[(2r,4s,5s,6s)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-3,4-dihydro-1h-tetracen-2-yl]ethylideneamino]benzamide;hydrochloride Chemical compound Cl.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(\C)=N\NC(=O)C=1C=CC=CC=1)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 NKFHKYQGZDAKMX-PPRKPIOESA-N 0.000 description 2
- TVYPSLDUBVTDIS-FUOMVGGVSA-N n-[1-[(2r,3r,4s,5r)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-fluoro-2-oxopyrimidin-4-yl]-3,4,5-trimethoxybenzamide Chemical compound COC1=C(OC)C(OC)=CC(C(=O)NC=2C(=CN(C(=O)N=2)[C@H]2[C@@H]([C@H](O)[C@@H](C)O2)O)F)=C1 TVYPSLDUBVTDIS-FUOMVGGVSA-N 0.000 description 2
- ARKYUICTMUZVEW-UHFFFAOYSA-N n-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-[bis(2-chloroethyl)amino]benzoyl]amino]-1-methylpyrrole-2-carboxamide Chemical compound C1=C(C(=O)NCCC(N)=N)N(C)C=C1NC(=O)C1=CC(NC(=O)C=2N(C=C(NC(=O)C=3C=CC(=CC=3)N(CCCl)CCCl)C=2)C)=CN1C ARKYUICTMUZVEW-UHFFFAOYSA-N 0.000 description 2
- WRINSSLBPNLASA-FOCLMDBBSA-N n-methyl-n-[(e)-(n-methylanilino)diazenyl]aniline Chemical compound C=1C=CC=CC=1N(C)\N=N\N(C)C1=CC=CC=C1 WRINSSLBPNLASA-FOCLMDBBSA-N 0.000 description 2
- RWHUEXWOYVBUCI-ITQXDASVSA-N nafarelin Chemical class C([C@@H](C(=O)N[C@H](CC=1C=C2C=CC=CC2=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1[C@@H](CCC1)C(=O)NCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 RWHUEXWOYVBUCI-ITQXDASVSA-N 0.000 description 2
- 229960002333 nafarelin Drugs 0.000 description 2
- UZHSEJADLWPNLE-GRGSLBFTSA-N naloxone Chemical compound O=C([C@@H]1O2)CC[C@@]3(O)[C@H]4CC5=CC=C(O)C2=C5[C@@]13CCN4CC=C UZHSEJADLWPNLE-GRGSLBFTSA-N 0.000 description 2
- 229960004127 naloxone Drugs 0.000 description 2
- JZGDNMXSOCDEFQ-UHFFFAOYSA-N napavin Chemical compound C1C(CC)(O)CC(C2)CN1CCC(C1=CC=CC=C1N1)=C1C2(C(=O)OC)C(C(=C1)OC)=CC2=C1N(C)C1C2(C23)CCN3CC=CC2(CC)C(O)C1(O)C(=O)NCCNC1=CC=C(N=[N+]=[N-])C=C1[N+]([O-])=O JZGDNMXSOCDEFQ-UHFFFAOYSA-N 0.000 description 2
- 229950010676 nartograstim Drugs 0.000 description 2
- 108010032539 nartograstim Proteins 0.000 description 2
- 229950007221 nedaplatin Drugs 0.000 description 2
- CTMCWCONSULRHO-UHQPFXKFSA-N nemorubicin Chemical compound C1CO[C@H](OC)CN1[C@@H]1[C@H](O)[C@H](C)O[C@@H](O[C@@H]2C3=C(O)C=4C(=O)C5=C(OC)C=CC=C5C(=O)C=4C(O)=C3C[C@](O)(C2)C(=O)CO)C1 CTMCWCONSULRHO-UHQPFXKFSA-N 0.000 description 2
- 229950010159 nemorubicin Drugs 0.000 description 2
- QZGIWPZCWHMVQL-UIYAJPBUSA-N neocarzinostatin chromophore Chemical compound O1[C@H](C)[C@H](O)[C@H](O)[C@@H](NC)[C@H]1O[C@@H]1C/2=C/C#C[C@H]3O[C@@]3([C@@H]3OC(=O)OC3)C#CC\2=C[C@H]1OC(=O)C1=C(O)C=CC2=C(C)C=C(OC)C=C12 QZGIWPZCWHMVQL-UIYAJPBUSA-N 0.000 description 2
- 229950010733 neridronic acid Drugs 0.000 description 2
- PUUSSSIBPPTKTP-UHFFFAOYSA-N neridronic acid Chemical compound NCCCCCC(O)(P(O)(O)=O)P(O)(O)=O PUUSSSIBPPTKTP-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229940125745 nitric oxide modulator Drugs 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229950006344 nocodazole Drugs 0.000 description 2
- KGTDRFCXGRULNK-JYOBTZKQSA-N nogalamycin Chemical compound CO[C@@H]1[C@@](OC)(C)[C@@H](OC)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=C(O)C=C4[C@@]5(C)O[C@H]([C@H]([C@@H]([C@H]5O)N(C)C)O)OC4=C3C3=O)=C3C=C2[C@@H](C(=O)OC)[C@@](C)(O)C1 KGTDRFCXGRULNK-JYOBTZKQSA-N 0.000 description 2
- 229950009266 nogalamycin Drugs 0.000 description 2
- 229960002700 octreotide Drugs 0.000 description 2
- 229950011093 onapristone Drugs 0.000 description 2
- ZLLOIFNEEWYATC-XMUHMHRVSA-N osaterone Chemical compound C1=C(Cl)C2=CC(=O)OC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)C)(O)[C@@]1(C)CC2 ZLLOIFNEEWYATC-XMUHMHRVSA-N 0.000 description 2
- 229950006466 osaterone Drugs 0.000 description 2
- QVGXLLKOCUKJST-BJUDXGSMSA-N oxygen-15 atom Chemical compound [15O] QVGXLLKOCUKJST-BJUDXGSMSA-N 0.000 description 2
- VYOQBYCIIJYKJA-VORKOXQSSA-N palau'amine Chemical compound N([C@@]12[C@@H](Cl)[C@@H]([C@@H]3[C@@H]2[C@]24N=C(N)N[C@H]2N2C=CC=C2C(=O)N4C3)CN)C(N)=N[C@H]1O VYOQBYCIIJYKJA-VORKOXQSSA-N 0.000 description 2
- ZFYKZAKRJRNXGF-XRZRNGJYSA-N palmitoyl rhizoxin Chemical compound O1C(=O)C2OC2CC(CC(=O)O2)CC2C(C)\C=C\C2OC2(C)C(OC(=O)CCCCCCCCCCCCCCC)CC1C(C)C(OC)C(\C)=C\C=C\C(\C)=C\C1=COC(C)=N1 ZFYKZAKRJRNXGF-XRZRNGJYSA-N 0.000 description 2
- WRUUGTRCQOWXEG-UHFFFAOYSA-N pamidronate Chemical compound NCCC(O)(P(O)(O)=O)P(O)(O)=O WRUUGTRCQOWXEG-UHFFFAOYSA-N 0.000 description 2
- 229960003978 pamidronic acid Drugs 0.000 description 2
- 229960001972 panitumumab Drugs 0.000 description 2
- 229950003440 panomifene Drugs 0.000 description 2
- 229950006361 pazelliptine Drugs 0.000 description 2
- LPHSYQSMAGVYNT-UHFFFAOYSA-N pazelliptine Chemical compound N1C2=CC=NC=C2C2=C1C(C)=C1C=CN=C(NCCCN(CC)CC)C1=C2 LPHSYQSMAGVYNT-UHFFFAOYSA-N 0.000 description 2
- 229950006960 peliomycin Drugs 0.000 description 2
- VOKSWYLNZZRQPF-GDIGMMSISA-N pentazocine Chemical compound C1C2=CC=C(O)C=C2[C@@]2(C)[C@@H](C)[C@@H]1N(CC=C(C)C)CC2 VOKSWYLNZZRQPF-GDIGMMSISA-N 0.000 description 2
- 229960005301 pentazocine Drugs 0.000 description 2
- 229960003820 pentosan polysulfate sodium Drugs 0.000 description 2
- 229960002340 pentostatin Drugs 0.000 description 2
- FPVKHBSQESCIEP-JQCXWYLXSA-N pentostatin Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(N=CNC[C@H]2O)=C2N=C1 FPVKHBSQESCIEP-JQCXWYLXSA-N 0.000 description 2
- WTWWXOGTJWMJHI-UHFFFAOYSA-N perflubron Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br WTWWXOGTJWMJHI-UHFFFAOYSA-N 0.000 description 2
- 229960001217 perflubron Drugs 0.000 description 2
- 235000005693 perillyl alcohol Nutrition 0.000 description 2
- LCADVYTXPLBAGB-GNCBHIOISA-N phenalamide A1 Natural products CC(CO)NC(=O)C(=CC=CC=C/C=C/C(=C/C(C)C(O)C(=CC(C)CCc1ccccc1)C)/C)C LCADVYTXPLBAGB-GNCBHIOISA-N 0.000 description 2
- 229940049953 phenylacetate Drugs 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- 229960001416 pilocarpine Drugs 0.000 description 2
- NJBFOOCLYDNZJN-UHFFFAOYSA-N pipobroman Chemical compound BrCCC(=O)N1CCN(C(=O)CCBr)CC1 NJBFOOCLYDNZJN-UHFFFAOYSA-N 0.000 description 2
- 229960000952 pipobroman Drugs 0.000 description 2
- 229960001221 pirarubicin Drugs 0.000 description 2
- 229950001030 piritrexim Drugs 0.000 description 2
- 229950001746 piroxantrone Drugs 0.000 description 2
- 239000002797 plasminogen activator inhibitor Substances 0.000 description 2
- 229960001237 podophyllotoxin Drugs 0.000 description 2
- YJGVMLPVUAXIQN-XVVDYKMHSA-N podophyllotoxin Chemical compound COC1=C(OC)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@H](O)[C@@H]3[C@@H]2C(OC3)=O)=C1 YJGVMLPVUAXIQN-XVVDYKMHSA-N 0.000 description 2
- YVCVYCSAAZQOJI-UHFFFAOYSA-N podophyllotoxin Natural products COC1=C(O)C(OC)=CC(C2C3=CC=4OCOC=4C=C3C(O)C3C2C(OC3)=O)=C1 YVCVYCSAAZQOJI-UHFFFAOYSA-N 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 229960004293 porfimer sodium Drugs 0.000 description 2
- 229950004406 porfiromycin Drugs 0.000 description 2
- RKCAIXNGYQCCAL-UHFFFAOYSA-N porphin Chemical compound N1C(C=C2N=C(C=C3NC(=C4)C=C3)C=C2)=CC=C1C=C1C=CC4=N1 RKCAIXNGYQCCAL-UHFFFAOYSA-N 0.000 description 2
- 150000004032 porphyrins Chemical class 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 229960004694 prednimustine Drugs 0.000 description 2
- 229960003387 progesterone Drugs 0.000 description 2
- 239000000186 progesterone Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UQOQENZZLBSFKO-POPPZSFYSA-N prostaglandin J2 Chemical compound CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](C\C=C/CCCC(O)=O)C=CC1=O UQOQENZZLBSFKO-POPPZSFYSA-N 0.000 description 2
- 239000003207 proteasome inhibitor Substances 0.000 description 2
- 239000003528 protein farnesyltransferase inhibitor Substances 0.000 description 2
- 229940126731 protein tyrosine phosphatase inhibitor Drugs 0.000 description 2
- 239000003806 protein tyrosine phosphatase inhibitor Substances 0.000 description 2
- SSKVDVBQSWQEGJ-UHFFFAOYSA-N pseudohypericin Natural products C12=C(O)C=C(O)C(C(C=3C(O)=CC(O)=C4C=33)=O)=C2C3=C2C3=C4C(C)=CC(O)=C3C(=O)C3=C(O)C=C(O)C1=C32 SSKVDVBQSWQEGJ-UHFFFAOYSA-N 0.000 description 2
- 239000000784 purine nucleoside phosphorylase inhibitor Substances 0.000 description 2
- 229940117820 purinethol Drugs 0.000 description 2
- 229950010131 puromycin Drugs 0.000 description 2
- MKSVFGKWZLUTTO-FZFAUISWSA-N puromycin dihydrochloride Chemical compound Cl.Cl.C1=CC(OC)=CC=C1C[C@H](N)C(=O)N[C@H]1[C@@H](O)[C@H](N2C3=NC=NC(=C3N=C2)N(C)C)O[C@@H]1CO MKSVFGKWZLUTTO-FZFAUISWSA-N 0.000 description 2
- BBNQQADTFFCFGB-UHFFFAOYSA-N purpurin Chemical compound C1=CC=C2C(=O)C3=C(O)C(O)=CC(O)=C3C(=O)C2=C1 BBNQQADTFFCFGB-UHFFFAOYSA-N 0.000 description 2
- 229960005562 radium-223 Drugs 0.000 description 2
- HCWPIIXVSYCSAN-OIOBTWANSA-N radium-223 Chemical compound [223Ra] HCWPIIXVSYCSAN-OIOBTWANSA-N 0.000 description 2
- NTHPAPBPFQJABD-LLVKDONJSA-N ramosetron Chemical compound C12=CC=CC=C2N(C)C=C1C(=O)[C@H]1CC(NC=N2)=C2CC1 NTHPAPBPFQJABD-LLVKDONJSA-N 0.000 description 2
- 229950001588 ramosetron Drugs 0.000 description 2
- 102000016914 ras Proteins Human genes 0.000 description 2
- 108010014186 ras Proteins Proteins 0.000 description 2
- 229930002330 retinoic acid Natural products 0.000 description 2
- WUAPFZMCVAUBPE-IGMARMGPSA-N rhenium-186 Chemical compound [186Re] WUAPFZMCVAUBPE-IGMARMGPSA-N 0.000 description 2
- 229960004356 riboprine Drugs 0.000 description 2
- 108091092562 ribozyme Proteins 0.000 description 2
- 108700033545 romurtide Proteins 0.000 description 2
- 229950003733 romurtide Drugs 0.000 description 2
- 229960003522 roquinimex Drugs 0.000 description 2
- 229950006216 rufocromomycin Drugs 0.000 description 2
- YADVRLOQIWILGX-UHFFFAOYSA-N sarcophytol N Natural products CC(C)C1=CC=C(C)CCC=C(C)CCC=C(C)CC1O YADVRLOQIWILGX-UHFFFAOYSA-N 0.000 description 2
- 229960002530 sargramostim Drugs 0.000 description 2
- 108010038379 sargramostim Proteins 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 235000015170 shellfish Nutrition 0.000 description 2
- 229950009089 simtrazene Drugs 0.000 description 2
- 229950001403 sizofiran Drugs 0.000 description 2
- 229950010372 sobuzoxane Drugs 0.000 description 2
- 229940006198 sodium phenylacetate Drugs 0.000 description 2
- QUCDWLYKDRVKMI-UHFFFAOYSA-M sodium;3,4-dimethylbenzenesulfonate Chemical compound [Na+].CC1=CC=C(S([O-])(=O)=O)C=C1C QUCDWLYKDRVKMI-UHFFFAOYSA-M 0.000 description 2
- 229950004225 sonermin Drugs 0.000 description 2
- 229950004796 sparfosic acid Drugs 0.000 description 2
- 229950009641 sparsomycin Drugs 0.000 description 2
- XKLZIVIOZDNKEQ-CLQLPEFOSA-N sparsomycin Chemical compound CSC[S@](=O)C[C@H](CO)NC(=O)\C=C\C1=C(C)NC(=O)NC1=O XKLZIVIOZDNKEQ-CLQLPEFOSA-N 0.000 description 2
- XKLZIVIOZDNKEQ-UHFFFAOYSA-N sparsomycin Natural products CSCS(=O)CC(CO)NC(=O)C=CC1=C(C)NC(=O)NC1=O XKLZIVIOZDNKEQ-UHFFFAOYSA-N 0.000 description 2
- 229940063675 spermine Drugs 0.000 description 2
- YBZRLMLGUBIIDN-NZSGCTDASA-N spicamycin Chemical compound O1[C@@H](C(O)CO)[C@H](NC(=O)CNC(=O)CCCCCCCCCCCCC(C)C)[C@@H](O)[C@@H](O)[C@H]1NC1=NC=NC2=C1N=CN2 YBZRLMLGUBIIDN-NZSGCTDASA-N 0.000 description 2
- YBZRLMLGUBIIDN-UHFFFAOYSA-N spicamycin Natural products O1C(C(O)CO)C(NC(=O)CNC(=O)CCCCCCCCCCCCC(C)C)C(O)C(O)C1NC1=NC=NC2=C1NC=N2 YBZRLMLGUBIIDN-UHFFFAOYSA-N 0.000 description 2
- 229950004330 spiroplatin Drugs 0.000 description 2
- 210000000952 spleen Anatomy 0.000 description 2
- ICXJVZHDZFXYQC-UHFFFAOYSA-N spongistatin 1 Natural products OC1C(O2)(O)CC(O)C(C)C2CCCC=CC(O2)CC(O)CC2(O2)CC(OC)CC2CC(=O)C(C)C(OC(C)=O)C(C)C(=C)CC(O2)CC(C)(O)CC2(O2)CC(OC(C)=O)CC2CC(=O)OC2C(O)C(CC(=C)CC(O)C=CC(Cl)=C)OC1C2C ICXJVZHDZFXYQC-UHFFFAOYSA-N 0.000 description 2
- HAOCRCFHEPRQOY-JKTUOYIXSA-N spongistatin-1 Chemical compound C([C@@H]1C[C@@H](C[C@@]2(C[C@@H](O)C[C@@H](C2)\C=C/CCC[C@@H]2[C@H](C)[C@@H](O)C[C@](O2)(O)[C@H]2O)O1)OC)C(=O)[C@@H](C)[C@@H](OC(C)=O)[C@H](C)C(=C)C[C@H](O1)C[C@](C)(O)C[C@@]1(O1)C[C@@H](OC(C)=O)C[C@@H]1CC(=O)O[C@H]1[C@H](O)[C@@H](CC(=C)C(C)[C@H](O)\C=C\C(Cl)=C)O[C@@H]2[C@@H]1C HAOCRCFHEPRQOY-JKTUOYIXSA-N 0.000 description 2
- 230000024642 stem cell division Effects 0.000 description 2
- AHBGXTDRMVNFER-FCHARDOESA-L strontium-89(2+);dichloride Chemical compound [Cl-].[Cl-].[89Sr+2] AHBGXTDRMVNFER-FCHARDOESA-L 0.000 description 2
- 229950007841 sulofenur Drugs 0.000 description 2
- FIAFUQMPZJWCLV-UHFFFAOYSA-N suramin Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=C2C(NC(=O)C3=CC=C(C(=C3)NC(=O)C=3C=C(NC(=O)NC=4C=C(C=CC=4)C(=O)NC=4C(=CC=C(C=4)C(=O)NC=4C5=C(C=C(C=C5C(=CC=4)S(O)(=O)=O)S(O)(=O)=O)S(O)(=O)=O)C)C=CC=3)C)=CC=C(S(O)(=O)=O)C2=C1 FIAFUQMPZJWCLV-UHFFFAOYSA-N 0.000 description 2
- 229960005314 suramin Drugs 0.000 description 2
- 229960005566 swainsonine Drugs 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229950011110 tacedinaline Drugs 0.000 description 2
- 229950002687 talisomycin Drugs 0.000 description 2
- 108700003774 talisomycin Proteins 0.000 description 2
- 108010021891 tallimustine Proteins 0.000 description 2
- 229950005667 tallimustine Drugs 0.000 description 2
- 229950010168 tauromustine Drugs 0.000 description 2
- DKPFODGZWDEEBT-QFIAKTPHSA-N taxane Chemical class C([C@]1(C)CCC[C@@H](C)[C@H]1C1)C[C@H]2[C@H](C)CC[C@@H]1C2(C)C DKPFODGZWDEEBT-QFIAKTPHSA-N 0.000 description 2
- 229960000565 tazarotene Drugs 0.000 description 2
- GKLVYJBZJHMRIY-AHCXROLUSA-N technetium-94 Chemical compound [94Tc] GKLVYJBZJHMRIY-AHCXROLUSA-N 0.000 description 2
- 229960004964 temozolomide Drugs 0.000 description 2
- 229950008703 teroxirone Drugs 0.000 description 2
- 229960005353 testolactone Drugs 0.000 description 2
- BPEWUONYVDABNZ-DZBHQSCQSA-N testolactone Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(OC(=O)CC4)[C@@H]4[C@@H]3CCC2=C1 BPEWUONYVDABNZ-DZBHQSCQSA-N 0.000 description 2
- WXZSUBHBYQYTNM-WMDJANBXSA-N tetrazomine Chemical compound C=1([C@@H]2CO[C@@H]3[C@H]4C[C@@H](CO)[C@H](N4C)[C@@H](N23)CC=1C=C1)C(OC)=C1NC(=O)C1NCCC[C@H]1O WXZSUBHBYQYTNM-WMDJANBXSA-N 0.000 description 2
- ZCTJIMXXSXQXRI-UHFFFAOYSA-N thaliblastine Natural products CN1CCC2=CC(OC)=C(OC)C3=C2C1CC1=C3C=C(OC)C(OC2=C(CC3C4=CC(OC)=C(OC)C=C4CCN3C)C=C(C(=C2)OC)OC)=C1 ZCTJIMXXSXQXRI-UHFFFAOYSA-N 0.000 description 2
- ZCTJIMXXSXQXRI-KYJUHHDHSA-N thalicarpine Chemical compound CN1CCC2=CC(OC)=C(OC)C3=C2[C@@H]1CC1=C3C=C(OC)C(OC2=C(C[C@H]3C4=CC(OC)=C(OC)C=C4CCN3C)C=C(C(=C2)OC)OC)=C1 ZCTJIMXXSXQXRI-KYJUHHDHSA-N 0.000 description 2
- 229960003433 thalidomide Drugs 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 108010062880 thiocoraline Proteins 0.000 description 2
- UPGGKUQISSWRJJ-UHFFFAOYSA-N thiocoraline Natural products CN1C(=O)CNC(=O)C(NC(=O)C=2C(=CC3=CC=CC=C3N=2)O)CSC(=O)C(CSC)N(C)C(=O)C(N(C(=O)CNC2=O)C)CSSCC1C(=O)N(C)C(CSC)C(=O)SCC2NC(=O)C1=NC2=CC=CC=C2C=C1O UPGGKUQISSWRJJ-UHFFFAOYSA-N 0.000 description 2
- ZSLUVFAKFWKJRC-FTXFMUIASA-N thorium-227 Chemical compound [227Th] ZSLUVFAKFWKJRC-FTXFMUIASA-N 0.000 description 2
- NZVYCXVTEHPMHE-ZSUJOUNUSA-N thymalfasin Chemical compound CC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(O)=O NZVYCXVTEHPMHE-ZSUJOUNUSA-N 0.000 description 2
- 229960004231 thymalfasin Drugs 0.000 description 2
- 229950010183 thymotrinan Drugs 0.000 description 2
- 229960000874 thyrotropin Drugs 0.000 description 2
- 230000001748 thyrotropin Effects 0.000 description 2
- 229960003723 tiazofurine Drugs 0.000 description 2
- FVRDYQYEVDDKCR-DBRKOABJSA-N tiazofurine Chemical compound NC(=O)C1=CSC([C@H]2[C@@H]([C@H](O)[C@@H](CO)O2)O)=N1 FVRDYQYEVDDKCR-DBRKOABJSA-N 0.000 description 2
- TVPNFKRGOFJQOO-UHFFFAOYSA-N topsentin b1 Chemical compound C1=CC=C2C(C3=CN=C(N3)C(=O)C=3C4=CC=C(C=C4NC=3)O)=CNC2=C1 TVPNFKRGOFJQOO-UHFFFAOYSA-N 0.000 description 2
- 238000012549 training Methods 0.000 description 2
- 229960000575 trastuzumab Drugs 0.000 description 2
- 229950005609 trestolone Drugs 0.000 description 2
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 2
- SPDZFJLQFWSJGA-UHFFFAOYSA-N uredepa Chemical compound C1CN1P(=O)(NC(=O)OCC)N1CC1 SPDZFJLQFWSJGA-UHFFFAOYSA-N 0.000 description 2
- 229950006929 uredepa Drugs 0.000 description 2
- 229960002730 vapreotide Drugs 0.000 description 2
- 108700029852 vapreotide Proteins 0.000 description 2
- 229960003048 vinblastine Drugs 0.000 description 2
- KDQAABAKXDWYSZ-PNYVAJAMSA-N vinblastine sulfate Chemical compound OS(O)(=O)=O.C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 KDQAABAKXDWYSZ-PNYVAJAMSA-N 0.000 description 2
- 229960004982 vinblastine sulfate Drugs 0.000 description 2
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 2
- 229960002110 vincristine sulfate Drugs 0.000 description 2
- AQTQHPDCURKLKT-JKDPCDLQSA-N vincristine sulfate Chemical compound OS(O)(=O)=O.C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C=O)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 AQTQHPDCURKLKT-JKDPCDLQSA-N 0.000 description 2
- 229960005212 vindesine sulfate Drugs 0.000 description 2
- KLFUUCHXSFIPMH-YBFGSCICSA-N vinepidine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C=O)C=2)OC)C[C@@H](C2)CC)N2CCC2=C1NC1=CC=CC=C21 KLFUUCHXSFIPMH-YBFGSCICSA-N 0.000 description 2
- 229950001270 vinepidine Drugs 0.000 description 2
- YNSIUGHLISOIRQ-SWSODSCOSA-N vinglycinate Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(=O)CN(C)C)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 YNSIUGHLISOIRQ-SWSODSCOSA-N 0.000 description 2
- 229950008883 vinglycinate Drugs 0.000 description 2
- 229960002166 vinorelbine tartrate Drugs 0.000 description 2
- GBABOYUKABKIAF-IWWDSPBFSA-N vinorelbinetartrate Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC(C23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-IWWDSPBFSA-N 0.000 description 2
- 229950005839 vinzolidine Drugs 0.000 description 2
- FHNFHKCVQCLJFQ-DBXDQKISSA-N xenon-122 Chemical compound [122Xe] FHNFHKCVQCLJFQ-DBXDQKISSA-N 0.000 description 2
- 229950003017 zeniplatin Drugs 0.000 description 2
- HCHKCACWOHOZIP-OIOBTWANSA-N zinc-62 Chemical compound [62Zn] HCHKCACWOHOZIP-OIOBTWANSA-N 0.000 description 2
- HCHKCACWOHOZIP-YPZZEJLDSA-N zinc-63 Chemical compound [63Zn] HCHKCACWOHOZIP-YPZZEJLDSA-N 0.000 description 2
- 229950009268 zinostatin Drugs 0.000 description 2
- QCWXUUIWCKQGHC-YPZZEJLDSA-N zirconium-89 Chemical compound [89Zr] QCWXUUIWCKQGHC-YPZZEJLDSA-N 0.000 description 2
- YKJYKKNCCRKFSL-RDBSUJKOSA-N (-)-anisomycin Chemical compound C1=CC(OC)=CC=C1C[C@@H]1[C@H](OC(C)=O)[C@@H](O)CN1 YKJYKKNCCRKFSL-RDBSUJKOSA-N 0.000 description 1
- SWTGJCNCBUCXSS-ISUZDFFFSA-N (2r)-3,4-dihydroxy-2-[(4s)-2-phenyl-1,3-dioxolan-4-yl]-2h-furan-5-one Chemical compound OC1=C(O)C(=O)O[C@@H]1[C@H]1OC(C=2C=CC=CC=2)OC1 SWTGJCNCBUCXSS-ISUZDFFFSA-N 0.000 description 1
- PAYBYKKERMGTSS-MNCSTQPFSA-N (2r,3r,3as,9ar)-7-fluoro-2-(hydroxymethyl)-6-imino-2,3,3a,9a-tetrahydrofuro[1,2][1,3]oxazolo[3,4-a]pyrimidin-3-ol Chemical compound N=C1C(F)=CN2[C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3OC2=N1 PAYBYKKERMGTSS-MNCSTQPFSA-N 0.000 description 1
- XDZGQQRZJDKPTG-HBNQUELISA-N (2s)-2-[(3s,6s)-6-[2-[(1r,2r,4as,8as)-1-hydroxy-2,4a,5,5,8a-pentamethyl-2,3,4,6,7,8-hexahydronaphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid Chemical compound O1O[C@H]([C@H](C)C(O)=O)CC[C@@]1(C)CC[C@]1(O)[C@@]2(C)CCCC(C)(C)[C@]2(C)CC[C@H]1C XDZGQQRZJDKPTG-HBNQUELISA-N 0.000 description 1
- KYHUYMLIVQFXRI-XYUQHQMCSA-N (2s)-n-[(2r)-1-[[(3s,6s,8s,12s,13r,16s,17r,20s,23s)-13-[(2s)-butan-2-yl]-12-hydroxy-20-[(4-methoxyphenyl)methyl]-6,17,21-trimethyl-3-(2-methylpropyl)-2,5,7,10,15,19,22-heptaoxo-8-propan-2-yl-9,18-dioxa-1,4,14,21-tetrazabicyclo[21.3.0]hexacosan-16-yl]amino Chemical compound CN([C@H](CC(C)C)C(=O)N[C@@H]1C(=O)N[C@@H]([C@H](CC(=O)O[C@H](C(=O)[C@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N2CCC[C@H]2C(=O)N(C)[C@@H](CC=2C=CC(OC)=CC=2)C(=O)O[C@@H]1C)C(C)C)O)[C@@H](C)CC)C(=O)[C@@H]1CCCN1C(=O)C(C)O KYHUYMLIVQFXRI-XYUQHQMCSA-N 0.000 description 1
- VEEGZPWAAPPXRB-BJMVGYQFSA-N (3e)-3-(1h-imidazol-5-ylmethylidene)-1h-indol-2-one Chemical compound O=C1NC2=CC=CC=C2\C1=C/C1=CN=CN1 VEEGZPWAAPPXRB-BJMVGYQFSA-N 0.000 description 1
- TVIRNGFXQVMMGB-OFWIHYRESA-N (3s,6r,10r,13e,16s)-16-[(2r,3r,4s)-4-chloro-3-hydroxy-4-phenylbutan-2-yl]-10-[(3-chloro-4-methoxyphenyl)methyl]-6-methyl-3-(2-methylpropyl)-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone Chemical compound C1=C(Cl)C(OC)=CC=C1C[C@@H]1C(=O)NC[C@@H](C)C(=O)O[C@@H](CC(C)C)C(=O)O[C@H]([C@H](C)[C@@H](O)[C@@H](Cl)C=2C=CC=CC=2)C/C=C/C(=O)N1 TVIRNGFXQVMMGB-OFWIHYRESA-N 0.000 description 1
- ANVAOWXLWRTKGA-NTXLUARGSA-N (6'R)-beta,epsilon-carotene Chemical compound CC=1CCCC(C)(C)C=1\C=C\C(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\[C@H]1C(C)=CCCC1(C)C ANVAOWXLWRTKGA-NTXLUARGSA-N 0.000 description 1
- RCFNNLSZHVHCEK-YGCMNLPTSA-N (7s,9s)-7-[(2s,4r,6s)-4-amino-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7h-tetracene-5,12-dione;hydrochloride Chemical compound Cl.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)C[C@H](C)O1 RCFNNLSZHVHCEK-YGCMNLPTSA-N 0.000 description 1
- PAEZRCINULFAGO-OAQYLSRUSA-N (R)-homocamptothecin Chemical compound CC[C@@]1(O)CC(=O)OCC(C2=O)=C1C=C1N2CC2=CC3=CC=CC=C3N=C21 PAEZRCINULFAGO-OAQYLSRUSA-N 0.000 description 1
- SNYUHPPZINRDSG-UHFFFAOYSA-N 1-(oxiran-2-ylmethyl)-4-[1-(oxiran-2-ylmethyl)piperidin-4-yl]piperidine Chemical compound C1CC(C2CCN(CC3OC3)CC2)CCN1CC1CO1 SNYUHPPZINRDSG-UHFFFAOYSA-N 0.000 description 1
- UHDGCWIWMRVCDJ-UHFFFAOYSA-N 1-beta-D-Xylofuranosyl-NH-Cytosine Natural products O=C1N=C(N)C=CN1C1C(O)C(O)C(CO)O1 UHDGCWIWMRVCDJ-UHFFFAOYSA-N 0.000 description 1
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 1
- VKDGNNYJFSHYKD-UHFFFAOYSA-N 2,5-diamino-2-(difluoromethyl)pentanoic acid;hydron;chloride Chemical compound Cl.NCCCC(N)(C(F)F)C(O)=O VKDGNNYJFSHYKD-UHFFFAOYSA-N 0.000 description 1
- AQQSXKSWTNWXKR-UHFFFAOYSA-N 2-(2-phenylphenanthro[9,10-d]imidazol-3-yl)acetic acid Chemical compound C1(=CC=CC=C1)C1=NC2=C(N1CC(=O)O)C1=CC=CC=C1C=1C=CC=CC=12 AQQSXKSWTNWXKR-UHFFFAOYSA-N 0.000 description 1
- RTQWWZBSTRGEAV-PKHIMPSTSA-N 2-[[(2s)-2-[bis(carboxymethyl)amino]-3-[4-(methylcarbamoylamino)phenyl]propyl]-[2-[bis(carboxymethyl)amino]propyl]amino]acetic acid Chemical compound CNC(=O)NC1=CC=C(C[C@@H](CN(CC(C)N(CC(O)=O)CC(O)=O)CC(O)=O)N(CC(O)=O)CC(O)=O)C=C1 RTQWWZBSTRGEAV-PKHIMPSTSA-N 0.000 description 1
- XQCZBXHVTFVIFE-UHFFFAOYSA-N 2-amino-4-hydroxypyrimidine Chemical compound NC1=NC=CC(O)=N1 XQCZBXHVTFVIFE-UHFFFAOYSA-N 0.000 description 1
- DSWLRNLRVBAVFC-UHFFFAOYSA-N 2-methylsulfinyl-1-pyridin-2-ylethanone Chemical compound CS(=O)CC(=O)C1=CC=CC=N1 DSWLRNLRVBAVFC-UHFFFAOYSA-N 0.000 description 1
- NDMPLJNOPCLANR-UHFFFAOYSA-N 3,4-dihydroxy-15-(4-hydroxy-18-methoxycarbonyl-5,18-seco-ibogamin-18-yl)-16-methoxy-1-methyl-6,7-didehydro-aspidospermidine-3-carboxylic acid methyl ester Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 NDMPLJNOPCLANR-UHFFFAOYSA-N 0.000 description 1
- 102100026163 39S ribosomal protein L12, mitochondrial Human genes 0.000 description 1
- PDQGEKGUTOTUNV-TZSSRYMLSA-N 4'-deoxy-4'-iododoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](I)[C@H](C)O1 PDQGEKGUTOTUNV-TZSSRYMLSA-N 0.000 description 1
- VUTBELPREDJDDH-UHFFFAOYSA-N 4-amino-5-hydroxymethyl-2-methylpyrimidine Chemical compound CC1=NC=C(CO)C(N)=N1 VUTBELPREDJDDH-UHFFFAOYSA-N 0.000 description 1
- BBCKSBCZMDNUNM-UHFFFAOYSA-N 4-aminobenzenesulfonamide 2-chloroquinoxaline Chemical compound S(=O)(C1=CC=C(C=C1)N)(=O)N.ClC1=NC2=CC=CC=C2N=C1 BBCKSBCZMDNUNM-UHFFFAOYSA-N 0.000 description 1
- 102100026726 40S ribosomal protein S11 Human genes 0.000 description 1
- 102100024113 40S ribosomal protein S15a Human genes 0.000 description 1
- 102100037513 40S ribosomal protein S23 Human genes 0.000 description 1
- 102100033449 40S ribosomal protein S24 Human genes 0.000 description 1
- 102100022721 40S ribosomal protein S25 Human genes 0.000 description 1
- 102100022681 40S ribosomal protein S27 Human genes 0.000 description 1
- 102100023679 40S ribosomal protein S28 Human genes 0.000 description 1
- 102100024088 40S ribosomal protein S7 Human genes 0.000 description 1
- 102100027271 40S ribosomal protein SA Human genes 0.000 description 1
- NSUDGNLOXMLAEB-UHFFFAOYSA-N 5-(2-formyl-3-hydroxyphenoxy)pentanoic acid Chemical compound OC(=O)CCCCOC1=CC=CC(O)=C1C=O NSUDGNLOXMLAEB-UHFFFAOYSA-N 0.000 description 1
- PXLPCZJACKUXGP-UHFFFAOYSA-N 5-(3,4-dichlorophenyl)-6-ethylpyrimidine-2,4-diamine Chemical compound CCC1=NC(N)=NC(N)=C1C1=CC=C(Cl)C(Cl)=C1 PXLPCZJACKUXGP-UHFFFAOYSA-N 0.000 description 1
- XESARGFCSKSFID-UHFFFAOYSA-N 5-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxy-1h-pyrazole-3-carboxamide Chemical compound OC1=C(C(=O)N)NN=C1C1C(O)C(O)C(CO)O1 XESARGFCSKSFID-UHFFFAOYSA-N 0.000 description 1
- IDPUKCWIGUEADI-UHFFFAOYSA-N 5-[bis(2-chloroethyl)amino]uracil Chemical compound ClCCN(CCCl)C1=CNC(=O)NC1=O IDPUKCWIGUEADI-UHFFFAOYSA-N 0.000 description 1
- OTSZCHORPMQCBZ-UHFFFAOYSA-N 6-[(3-chlorophenyl)-imidazol-1-ylmethyl]-1h-benzimidazole;hydron;chloride Chemical compound Cl.ClC1=CC=CC(C(C=2C=C3NC=NC3=CC=2)N2C=NC=C2)=C1 OTSZCHORPMQCBZ-UHFFFAOYSA-N 0.000 description 1
- 102100035916 60S ribosomal protein L11 Human genes 0.000 description 1
- 102100021690 60S ribosomal protein L18a Human genes 0.000 description 1
- 102100035322 60S ribosomal protein L24 Human genes 0.000 description 1
- 102100035988 60S ribosomal protein L39 Human genes 0.000 description 1
- 102100035841 60S ribosomal protein L7 Human genes 0.000 description 1
- 102100041029 60S ribosomal protein L9 Human genes 0.000 description 1
- LOSIULRWFAEMFL-UHFFFAOYSA-N 7-deazaguanine Chemical compound O=C1NC(N)=NC2=C1CC=N2 LOSIULRWFAEMFL-UHFFFAOYSA-N 0.000 description 1
- 102100026802 72 kDa type IV collagenase Human genes 0.000 description 1
- VKKXEIQIGGPMHT-UHFFFAOYSA-N 7h-purine-2,8-diamine Chemical compound NC1=NC=C2NC(N)=NC2=N1 VKKXEIQIGGPMHT-UHFFFAOYSA-N 0.000 description 1
- JPASRFGVACYSJG-UHFFFAOYSA-N 8,10-dihydroimidazo[4,5-a]acridin-9-one Chemical class N1=C2C=CC3=NC=NC3=C2C=C2C1=CCC(=O)C2 JPASRFGVACYSJG-UHFFFAOYSA-N 0.000 description 1
- 102100031901 A-kinase anchor protein 2 Human genes 0.000 description 1
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 1
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 1
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 1
- 102100025851 Acyl-coenzyme A thioesterase 2, mitochondrial Human genes 0.000 description 1
- 102100026605 Aldehyde dehydrogenase, dimeric NADP-preferring Human genes 0.000 description 1
- YKJYKKNCCRKFSL-UHFFFAOYSA-N Anisomycin Natural products C1=CC(OC)=CC=C1CC1C(OC(C)=O)C(O)CN1 YKJYKKNCCRKFSL-UHFFFAOYSA-N 0.000 description 1
- 108020005544 Antisense RNA Proteins 0.000 description 1
- 101000686547 Arabidopsis thaliana 30S ribosomal protein S1, chloroplastic Proteins 0.000 description 1
- 101000693933 Arabidopsis thaliana Fructose-bisphosphate aldolase 8, cytosolic Proteins 0.000 description 1
- DRCNRVYVCHHIJP-AQBORDMYSA-N Arg-Lys-Glu-Val-Tyr Chemical compound NC(N)=NCCC[C@H](N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(O)=O)CC1=CC=C(O)C=C1 DRCNRVYVCHHIJP-AQBORDMYSA-N 0.000 description 1
- 102100023245 Asparagine-tRNA ligase, cytoplasmic Human genes 0.000 description 1
- 102100034691 Astrocytic phosphoprotein PEA-15 Human genes 0.000 description 1
- 241001263178 Auriparus Species 0.000 description 1
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 description 1
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 1
- 206010004146 Basal cell carcinoma Diseases 0.000 description 1
- VGGGPCQERPFHOB-MCIONIFRSA-N Bestatin Chemical compound CC(C)C[C@H](C(O)=O)NC(=O)[C@@H](O)[C@H](N)CC1=CC=CC=C1 VGGGPCQERPFHOB-MCIONIFRSA-N 0.000 description 1
- DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 1
- 102100035752 Biliverdin reductase A Human genes 0.000 description 1
- 208000019838 Blood disease Diseases 0.000 description 1
- 208000003174 Brain Neoplasms Diseases 0.000 description 1
- 102100036846 C-C motif chemokine 21 Human genes 0.000 description 1
- 102100031168 CCN family member 2 Human genes 0.000 description 1
- 102100035893 CD151 antigen Human genes 0.000 description 1
- 102100024436 Caldesmon Human genes 0.000 description 1
- 102100021973 Carbonyl reductase [NADPH] 1 Human genes 0.000 description 1
- 206010007275 Carcinoid tumour Diseases 0.000 description 1
- 102100032219 Cathepsin D Human genes 0.000 description 1
- 102100024502 Ceramide glucosyltransferase Human genes 0.000 description 1
- 102100032902 Chromobox protein homolog 3 Human genes 0.000 description 1
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 description 1
- 102100023338 Chymotrypsin-like elastase family member 2B Human genes 0.000 description 1
- KKDBZWZRJNRBGA-UHFFFAOYSA-L Cl[Ti]Cl.[CH]1C=CC=C1 Chemical compound Cl[Ti]Cl.[CH]1C=CC=C1 KKDBZWZRJNRBGA-UHFFFAOYSA-L 0.000 description 1
- 102100029269 Coatomer subunit alpha Human genes 0.000 description 1
- 102100032373 Coiled-coil domain-containing protein 85B Human genes 0.000 description 1
- 241000761389 Copa Species 0.000 description 1
- 102100029767 Copper transport protein ATOX1 Human genes 0.000 description 1
- 108010060313 Core Binding Factor beta Subunit Proteins 0.000 description 1
- 102000008147 Core Binding Factor beta Subunit Human genes 0.000 description 1
- LUEYTMPPCOCKBX-UHFFFAOYSA-N Curacin A Natural products C=CCC(OC)CCC(C)=CC=CCCC=CC1CSC(C2C(C2)C)=N1 LUEYTMPPCOCKBX-UHFFFAOYSA-N 0.000 description 1
- LUEYTMPPCOCKBX-KWYHTCOPSA-N Curacin A Chemical compound C=CC[C@H](OC)CC\C(C)=C\C=C\CC\C=C/[C@@H]1CSC([C@H]2[C@H](C2)C)=N1 LUEYTMPPCOCKBX-KWYHTCOPSA-N 0.000 description 1
- 102100026897 Cystatin-C Human genes 0.000 description 1
- 102100031051 Cysteine and glycine-rich protein 1 Human genes 0.000 description 1
- 102100032757 Cysteine-rich protein 2 Human genes 0.000 description 1
- UHDGCWIWMRVCDJ-PSQAKQOGSA-N Cytidine Natural products O=C1N=C(N)C=CN1[C@@H]1[C@@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-PSQAKQOGSA-N 0.000 description 1
- 102100038835 Cytochrome c oxidase subunit 7B, mitochondrial Human genes 0.000 description 1
- PQNNIEWMPIULRS-UHFFFAOYSA-N Cytostatin Natural products CC=CC=CC=CC(O)C(C)C(OP(O)(O)=O)CCC(C)C1OC(=O)C=CC1C PQNNIEWMPIULRS-UHFFFAOYSA-N 0.000 description 1
- 102100033587 DNA topoisomerase 2-alpha Human genes 0.000 description 1
- 102100031477 Dolichyl-diphosphooligosaccharide-protein glycosyltransferase 48 kDa subunit Human genes 0.000 description 1
- MWWSFMDVAYGXBV-RUELKSSGSA-N Doxorubicin hydrochloride Chemical compound Cl.O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 MWWSFMDVAYGXBV-RUELKSSGSA-N 0.000 description 1
- 102100024673 Dual specificity protein phosphatase 3 Human genes 0.000 description 1
- 102100038744 E3 ubiquitin-protein ligase PPP1R11 Human genes 0.000 description 1
- DYEFUKCXAQOFHX-UHFFFAOYSA-N Ebselen Chemical compound [se]1C2=CC=CC=C2C(=O)N1C1=CC=CC=C1 DYEFUKCXAQOFHX-UHFFFAOYSA-N 0.000 description 1
- 102100030801 Elongation factor 1-alpha 1 Human genes 0.000 description 1
- 102100033238 Elongation factor Tu, mitochondrial Human genes 0.000 description 1
- 102100029112 Endothelin-converting enzyme 1 Human genes 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102100027327 Eukaryotic translation initiation factor 2 subunit 2 Human genes 0.000 description 1
- 102100029782 Eukaryotic translation initiation factor 3 subunit I Human genes 0.000 description 1
- 102100029602 Eukaryotic translation initiation factor 4B Human genes 0.000 description 1
- 102100029095 Exportin-1 Human genes 0.000 description 1
- 102100031758 Extracellular matrix protein 1 Human genes 0.000 description 1
- 102100034003 FAU ubiquitin-like and ribosomal protein S30 Human genes 0.000 description 1
- 102100020760 Ferritin heavy chain Human genes 0.000 description 1
- 102100024785 Fibroblast growth factor 2 Human genes 0.000 description 1
- 108090000379 Fibroblast growth factor 2 Proteins 0.000 description 1
- 102100029378 Follistatin-related protein 1 Human genes 0.000 description 1
- 229930191892 Formycin Natural products 0.000 description 1
- KBHMEHLJSZMEMI-UHFFFAOYSA-N Formycin A Natural products N1N=C2C(N)=NC=NC2=C1C1OC(CO)C(O)C1O KBHMEHLJSZMEMI-UHFFFAOYSA-N 0.000 description 1
- 206010064571 Gene mutation Diseases 0.000 description 1
- 102100023849 Glycophorin-C Human genes 0.000 description 1
- 229920002683 Glycosaminoglycan Polymers 0.000 description 1
- 102000001398 Granzyme Human genes 0.000 description 1
- 108060005986 Granzyme Proteins 0.000 description 1
- 102100034154 Guanine nucleotide-binding protein G(i) subunit alpha-2 Human genes 0.000 description 1
- 102100022128 High mobility group protein B2 Human genes 0.000 description 1
- 208000017604 Hodgkin disease Diseases 0.000 description 1
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 1
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 1
- 101000684297 Homo sapiens 26S proteasome complex subunit SEM1 Proteins 0.000 description 1
- 101000691538 Homo sapiens 39S ribosomal protein L12, mitochondrial Proteins 0.000 description 1
- 101001119215 Homo sapiens 40S ribosomal protein S11 Proteins 0.000 description 1
- 101001118566 Homo sapiens 40S ribosomal protein S15a Proteins 0.000 description 1
- 101001097953 Homo sapiens 40S ribosomal protein S23 Proteins 0.000 description 1
- 101000656669 Homo sapiens 40S ribosomal protein S24 Proteins 0.000 description 1
- 101000678929 Homo sapiens 40S ribosomal protein S25 Proteins 0.000 description 1
- 101000678466 Homo sapiens 40S ribosomal protein S27 Proteins 0.000 description 1
- 101000623076 Homo sapiens 40S ribosomal protein S28 Proteins 0.000 description 1
- 101000690200 Homo sapiens 40S ribosomal protein S7 Proteins 0.000 description 1
- 101000694288 Homo sapiens 40S ribosomal protein SA Proteins 0.000 description 1
- 101001073740 Homo sapiens 60S ribosomal protein L11 Proteins 0.000 description 1
- 101000752293 Homo sapiens 60S ribosomal protein L18a Proteins 0.000 description 1
- 101000660926 Homo sapiens 60S ribosomal protein L24 Proteins 0.000 description 1
- 101000716179 Homo sapiens 60S ribosomal protein L39 Proteins 0.000 description 1
- 101000853617 Homo sapiens 60S ribosomal protein L7 Proteins 0.000 description 1
- 101000672886 Homo sapiens 60S ribosomal protein L9 Proteins 0.000 description 1
- 101000627872 Homo sapiens 72 kDa type IV collagenase Proteins 0.000 description 1
- 101000774738 Homo sapiens A-kinase anchor protein 2 Proteins 0.000 description 1
- 101000720371 Homo sapiens Acyl-coenzyme A thioesterase 2, mitochondrial Proteins 0.000 description 1
- 101000717964 Homo sapiens Aldehyde dehydrogenase, dimeric NADP-preferring Proteins 0.000 description 1
- 101000624939 Homo sapiens Asparagine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101000734668 Homo sapiens Astrocytic phosphoprotein PEA-15 Proteins 0.000 description 1
- 101000802825 Homo sapiens Biliverdin reductase A Proteins 0.000 description 1
- 101000713085 Homo sapiens C-C motif chemokine 21 Proteins 0.000 description 1
- 101000777550 Homo sapiens CCN family member 2 Proteins 0.000 description 1
- 101000910297 Homo sapiens Caldesmon Proteins 0.000 description 1
- 101000896985 Homo sapiens Carbonyl reductase [NADPH] 1 Proteins 0.000 description 1
- 101000869010 Homo sapiens Cathepsin D Proteins 0.000 description 1
- 101000981050 Homo sapiens Ceramide glucosyltransferase Proteins 0.000 description 1
- 101000797578 Homo sapiens Chromobox protein homolog 3 Proteins 0.000 description 1
- 101000907961 Homo sapiens Chymotrypsin-like elastase family member 2B Proteins 0.000 description 1
- 101000770458 Homo sapiens Coatomer subunit alpha Proteins 0.000 description 1
- 101000868814 Homo sapiens Coiled-coil domain-containing protein 85B Proteins 0.000 description 1
- 101000727865 Homo sapiens Copper transport protein ATOX1 Proteins 0.000 description 1
- 101000912205 Homo sapiens Cystatin-C Proteins 0.000 description 1
- 101000922020 Homo sapiens Cysteine and glycine-rich protein 1 Proteins 0.000 description 1
- 101000942088 Homo sapiens Cysteine-rich protein 2 Proteins 0.000 description 1
- 101000957492 Homo sapiens Cytochrome c oxidase subunit 7B, mitochondrial Proteins 0.000 description 1
- 101001130785 Homo sapiens Dolichyl-diphosphooligosaccharide-protein glycosyltransferase 48 kDa subunit Proteins 0.000 description 1
- 101000908482 Homo sapiens Dual specificity protein phosphatase 3 Proteins 0.000 description 1
- 101000741914 Homo sapiens E3 ubiquitin-protein ligase PPP1R11 Proteins 0.000 description 1
- 101000920078 Homo sapiens Elongation factor 1-alpha 1 Proteins 0.000 description 1
- 101000841259 Homo sapiens Endothelin-converting enzyme 1 Proteins 0.000 description 1
- 101001081893 Homo sapiens Eukaryotic translation initiation factor 2 subunit 2 Proteins 0.000 description 1
- 101000896557 Homo sapiens Eukaryotic translation initiation factor 3 subunit B Proteins 0.000 description 1
- 101001012704 Homo sapiens Eukaryotic translation initiation factor 3 subunit I Proteins 0.000 description 1
- 101000840282 Homo sapiens Eukaryotic translation initiation factor 4B Proteins 0.000 description 1
- 101000866526 Homo sapiens Extracellular matrix protein 1 Proteins 0.000 description 1
- 101001002987 Homo sapiens Ferritin heavy chain Proteins 0.000 description 1
- 101001062535 Homo sapiens Follistatin-related protein 1 Proteins 0.000 description 1
- 101000905336 Homo sapiens Glycophorin-C Proteins 0.000 description 1
- 101001070508 Homo sapiens Guanine nucleotide-binding protein G(i) subunit alpha-2 Proteins 0.000 description 1
- 101001045791 Homo sapiens High mobility group protein B2 Proteins 0.000 description 1
- 101000988834 Homo sapiens Hypoxanthine-guanine phosphoribosyltransferase Proteins 0.000 description 1
- 101001051207 Homo sapiens L-lactate dehydrogenase B chain Proteins 0.000 description 1
- 101001003581 Homo sapiens Lamin-B1 Proteins 0.000 description 1
- 101000957257 Homo sapiens MAD2L1-binding protein Proteins 0.000 description 1
- 101000962664 Homo sapiens Microtubule-associated protein RP/EB family member 1 Proteins 0.000 description 1
- 101000602237 Homo sapiens Neuroblastoma suppressor of tumorigenicity 1 Proteins 0.000 description 1
- 101000577541 Homo sapiens Neuronal regeneration-related protein Proteins 0.000 description 1
- 101000998855 Homo sapiens Nicotinamide phosphoribosyltransferase Proteins 0.000 description 1
- 101000603425 Homo sapiens Nuclear pore complex-interacting protein family member B3 Proteins 0.000 description 1
- 101001067833 Homo sapiens Peptidyl-prolyl cis-trans isomerase A Proteins 0.000 description 1
- 101001091191 Homo sapiens Peptidyl-prolyl cis-trans isomerase F, mitochondrial Proteins 0.000 description 1
- 101000579123 Homo sapiens Phosphoglycerate kinase 1 Proteins 0.000 description 1
- 101000711369 Homo sapiens Probable ribosome biogenesis protein RLP24 Proteins 0.000 description 1
- 101001129654 Homo sapiens Prohibitin-2 Proteins 0.000 description 1
- 101000693054 Homo sapiens Protein S100-A13 Proteins 0.000 description 1
- 101000873438 Homo sapiens Putative protein SEM1, isoform 2 Proteins 0.000 description 1
- 101000584785 Homo sapiens Ras-related protein Rab-7a Proteins 0.000 description 1
- 101001099922 Homo sapiens Retinoic acid-induced protein 1 Proteins 0.000 description 1
- 101000581118 Homo sapiens Rho-related GTP-binding protein RhoC Proteins 0.000 description 1
- 101001125551 Homo sapiens Ribose-phosphate pyrophosphokinase 1 Proteins 0.000 description 1
- 101000687634 Homo sapiens SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 3 Proteins 0.000 description 1
- 101000631701 Homo sapiens Secretin receptor Proteins 0.000 description 1
- 101001041393 Homo sapiens Serine protease HTRA1 Proteins 0.000 description 1
- 101000587434 Homo sapiens Serine/arginine-rich splicing factor 3 Proteins 0.000 description 1
- 101000621061 Homo sapiens Serum paraoxonase/arylesterase 2 Proteins 0.000 description 1
- 101000653812 Homo sapiens Small nuclear ribonucleoprotein E Proteins 0.000 description 1
- 101000713494 Homo sapiens Small nuclear ribonucleoprotein F Proteins 0.000 description 1
- 101000974834 Homo sapiens Sodium/potassium-transporting ATPase subunit beta-3 Proteins 0.000 description 1
- 101000617805 Homo sapiens Staphylococcal nuclease domain-containing protein 1 Proteins 0.000 description 1
- 101000653663 Homo sapiens T-complex protein 1 subunit epsilon Proteins 0.000 description 1
- 101000652736 Homo sapiens Transgelin Proteins 0.000 description 1
- 101000904724 Homo sapiens Transmembrane glycoprotein NMB Proteins 0.000 description 1
- 101000838463 Homo sapiens Tubulin alpha-1A chain Proteins 0.000 description 1
- 101000639802 Homo sapiens U2 small nuclear ribonucleoprotein B'' Proteins 0.000 description 1
- 101000910482 Homo sapiens Uroporphyrinogen decarboxylase Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 1
- 102100029098 Hypoxanthine-guanine phosphoribosyltransferase Human genes 0.000 description 1
- MPBVHIBUJCELCL-UHFFFAOYSA-N Ibandronate Chemical compound CCCCCN(C)CCC(O)(P(O)(O)=O)P(O)(O)=O MPBVHIBUJCELCL-UHFFFAOYSA-N 0.000 description 1
- 102100040018 Interferon alpha-2 Human genes 0.000 description 1
- 108010079944 Interferon-alpha2b Proteins 0.000 description 1
- 244000017020 Ipomoea batatas Species 0.000 description 1
- 235000002678 Ipomoea batatas Nutrition 0.000 description 1
- 108020003285 Isocitrate lyase Proteins 0.000 description 1
- 102100020679 Krueppel-like factor 6 Human genes 0.000 description 1
- 108010049058 Kruppel-Like Factor 6 Proteins 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- 102100024580 L-lactate dehydrogenase B chain Human genes 0.000 description 1
- 102100026517 Lamin-B1 Human genes 0.000 description 1
- 108010062867 Lenograstim Proteins 0.000 description 1
- JXLYSJRDGCGARV-PJXZDTQASA-N Leurosidine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-PJXZDTQASA-N 0.000 description 1
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 description 1
- 206010025323 Lymphomas Diseases 0.000 description 1
- 102100020983 Lysosome membrane protein 2 Human genes 0.000 description 1
- 102100038793 MAD2L1-binding protein Human genes 0.000 description 1
- 102100030301 MHC class I polypeptide-related sequence A Human genes 0.000 description 1
- 102000000422 Matrix Metalloproteinase 3 Human genes 0.000 description 1
- 102100022185 Melanoma-derived growth regulatory protein Human genes 0.000 description 1
- 102100039560 Microtubule-associated protein RP/EB family member 1 Human genes 0.000 description 1
- 208000034578 Multiple myelomas Diseases 0.000 description 1
- HFPXYDFQVINJBV-UHFFFAOYSA-N Mycaperoxide B Natural products O1OC(C(C)C(O)=O)CCC1(C)CCC1(O)C2(C)CCCC(C)(C)C2CCC1C HFPXYDFQVINJBV-UHFFFAOYSA-N 0.000 description 1
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 1
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 1
- MMJUQWVRWXOYBH-UHFFFAOYSA-N NC=1N=NNC1.C(=O)N Chemical compound NC=1N=NNC1.C(=O)N MMJUQWVRWXOYBH-UHFFFAOYSA-N 0.000 description 1
- 206010029260 Neuroblastoma Diseases 0.000 description 1
- 102100037142 Neuroblastoma suppressor of tumorigenicity 1 Human genes 0.000 description 1
- 102100028745 Neuronal regeneration-related protein Human genes 0.000 description 1
- 102100033223 Nicotinamide phosphoribosyltransferase Human genes 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- 102100038856 Nuclear pore complex-interacting protein family member B3 Human genes 0.000 description 1
- KJWZYMMLVHIVSU-IYCNHOCDSA-N PGK1 Chemical compound CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](CCCCCCC(O)=O)C(=O)CC1=O KJWZYMMLVHIVSU-IYCNHOCDSA-N 0.000 description 1
- 244000131316 Panax pseudoginseng Species 0.000 description 1
- 235000005035 Panax pseudoginseng ssp. pseudoginseng Nutrition 0.000 description 1
- 235000003140 Panax quinquefolius Nutrition 0.000 description 1
- 102100034539 Peptidyl-prolyl cis-trans isomerase A Human genes 0.000 description 1
- 102100034943 Peptidyl-prolyl cis-trans isomerase F, mitochondrial Human genes 0.000 description 1
- 102100028251 Phosphoglycerate kinase 1 Human genes 0.000 description 1
- 108700019535 Phosphoprotein Phosphatases Proteins 0.000 description 1
- 102000045595 Phosphoprotein Phosphatases Human genes 0.000 description 1
- 102000004160 Phosphoric Monoester Hydrolases Human genes 0.000 description 1
- 108090000608 Phosphoric Monoester Hydrolases Proteins 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010035226 Plasma cell myeloma Diseases 0.000 description 1
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 1
- 102100031156 Prohibitin-2 Human genes 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 102100025670 Protein S100-A13 Human genes 0.000 description 1
- 102100034920 Putative protein SEM1, isoform 2 Human genes 0.000 description 1
- 102100030019 Ras-related protein Rab-7a Human genes 0.000 description 1
- 201000000582 Retinoblastoma Diseases 0.000 description 1
- 102100038470 Retinoic acid-induced protein 1 Human genes 0.000 description 1
- 102100027610 Rho-related GTP-binding protein RhoC Human genes 0.000 description 1
- 102100029508 Ribose-phosphate pyrophosphokinase 1 Human genes 0.000 description 1
- 108091005488 SCARB2 Proteins 0.000 description 1
- 102100024837 SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 3 Human genes 0.000 description 1
- 101100485284 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) CRM1 gene Proteins 0.000 description 1
- 101100501116 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) TUF1 gene Proteins 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 102100028927 Secretin receptor Human genes 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 102100021119 Serine protease HTRA1 Human genes 0.000 description 1
- 102100029665 Serine/arginine-rich splicing factor 3 Human genes 0.000 description 1
- 102100022824 Serum paraoxonase/arylesterase 2 Human genes 0.000 description 1
- 102100029809 Small nuclear ribonucleoprotein E Human genes 0.000 description 1
- 102100036758 Small nuclear ribonucleoprotein F Human genes 0.000 description 1
- 102100022792 Sodium/potassium-transporting ATPase subunit beta-3 Human genes 0.000 description 1
- 208000021712 Soft tissue sarcoma Diseases 0.000 description 1
- UIRKNQLZZXALBI-MSVGPLKSSA-N Squalamine Chemical compound C([C@@H]1C[C@H]2O)[C@@H](NCCCNCCCCN)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@H](C)CC[C@H](C(C)C)OS(O)(=O)=O)[C@@]2(C)CC1 UIRKNQLZZXALBI-MSVGPLKSSA-N 0.000 description 1
- UIRKNQLZZXALBI-UHFFFAOYSA-N Squalamine Natural products OC1CC2CC(NCCCNCCCCN)CCC2(C)C2C1C1CCC(C(C)CCC(C(C)C)OS(O)(=O)=O)C1(C)CC2 UIRKNQLZZXALBI-UHFFFAOYSA-N 0.000 description 1
- 241000251778 Squalus acanthias Species 0.000 description 1
- 102100021996 Staphylococcal nuclease domain-containing protein 1 Human genes 0.000 description 1
- 229940122743 Stromelysin inhibitor Drugs 0.000 description 1
- 102100029886 T-complex protein 1 subunit epsilon Human genes 0.000 description 1
- 108091008003 TRAIL-RI Proteins 0.000 description 1
- 101150026786 TUFM gene Proteins 0.000 description 1
- 229940123582 Telomerase inhibitor Drugs 0.000 description 1
- 102100031013 Transgelin Human genes 0.000 description 1
- 102100023935 Transmembrane glycoprotein NMB Human genes 0.000 description 1
- 102100028968 Tubulin alpha-1A chain Human genes 0.000 description 1
- 108010046308 Type II DNA Topoisomerases Proteins 0.000 description 1
- 102100034461 U2 small nuclear ribonucleoprotein B'' Human genes 0.000 description 1
- 101150020913 USP7 gene Proteins 0.000 description 1
- 102100021013 Ubiquitin carboxyl-terminal hydrolase 7 Human genes 0.000 description 1
- 108700011958 Ubiquitin-Specific Peptidase 7 Proteins 0.000 description 1
- 229940126752 Ubiquitin-specific protease 7 inhibitor Drugs 0.000 description 1
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 description 1
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 description 1
- 102100024118 Uroporphyrinogen decarboxylase Human genes 0.000 description 1
- 108010003205 Vasoactive Intestinal Peptide Proteins 0.000 description 1
- 102400000015 Vasoactive intestinal peptide Human genes 0.000 description 1
- MALFODICFSIXPO-UHFFFAOYSA-N Veratramin Natural products C=1C=C2C3CC=C4CC(O)CCC4(C)C3CC2=C(C)C=1C(C)C1NCC(C)CC1O MALFODICFSIXPO-UHFFFAOYSA-N 0.000 description 1
- 101150094313 XPO1 gene Proteins 0.000 description 1
- MHDDZDPNIDVLNK-ZGIWMXSJSA-N Zanoterone Chemical compound C1C2=NN(S(C)(=O)=O)C=C2C[C@]2(C)[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CC[C@H]21 MHDDZDPNIDVLNK-ZGIWMXSJSA-N 0.000 description 1
- PQNNIEWMPIULRS-SUTYWZMXSA-N [(8e,10e,12e)-7-hydroxy-6-methyl-2-(3-methyl-6-oxo-2,3-dihydropyran-2-yl)tetradeca-8,10,12-trien-5-yl] dihydrogen phosphate Chemical compound C\C=C\C=C\C=C\C(O)C(C)C(OP(O)(O)=O)CCC(C)C1OC(=O)C=CC1C PQNNIEWMPIULRS-SUTYWZMXSA-N 0.000 description 1
- JURAJLFHWXNPHG-UHFFFAOYSA-N [acetyl(methylcarbamoyl)amino] n-methylcarbamate Chemical compound CNC(=O)ON(C(C)=O)C(=O)NC JURAJLFHWXNPHG-UHFFFAOYSA-N 0.000 description 1
- GZOSMCIZMLWJML-VJLLXTKPSA-N abiraterone Chemical compound C([C@H]1[C@H]2[C@@H]([C@]3(CC[C@H](O)CC3=CC2)C)CC[C@@]11C)C=C1C1=CC=CN=C1 GZOSMCIZMLWJML-VJLLXTKPSA-N 0.000 description 1
- 229960000853 abiraterone Drugs 0.000 description 1
- JXLYSJRDGCGARV-KSNABSRWSA-N ac1l29ym Chemical compound C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-KSNABSRWSA-N 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229940100609 all-trans-retinol Drugs 0.000 description 1
- 235000019169 all-trans-retinol Nutrition 0.000 description 1
- 239000011717 all-trans-retinol Substances 0.000 description 1
- 229950010949 ambamustine Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229960001694 anagrelide Drugs 0.000 description 1
- OTBXOEAOVRKTNQ-UHFFFAOYSA-N anagrelide Chemical compound N1=C2NC(=O)CN2CC2=C(Cl)C(Cl)=CC=C21 OTBXOEAOVRKTNQ-UHFFFAOYSA-N 0.000 description 1
- 210000002255 anal canal Anatomy 0.000 description 1
- HUTDUHSNJYTCAR-UHFFFAOYSA-N ancymidol Chemical compound C1=CC(OC)=CC=C1C(O)(C=1C=NC=NC=1)C1CC1 HUTDUHSNJYTCAR-UHFFFAOYSA-N 0.000 description 1
- 239000004037 angiogenesis inhibitor Substances 0.000 description 1
- 229940121369 angiogenesis inhibitor Drugs 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 210000000436 anus Anatomy 0.000 description 1
- 150000004200 baccatin III derivatives Chemical class 0.000 description 1
- MMIMIFULGMZVPO-UHFFFAOYSA-N benzyl 3-bromo-2,6-dinitro-5-phenylmethoxybenzoate Chemical compound [O-][N+](=O)C1=C(C(=O)OCC=2C=CC=CC=2)C([N+](=O)[O-])=C(Br)C=C1OCC1=CC=CC=C1 MMIMIFULGMZVPO-UHFFFAOYSA-N 0.000 description 1
- 235000021028 berry Nutrition 0.000 description 1
- IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- NPSOIFAWYAHWOH-UHFFFAOYSA-N bistratene A Natural products O1C(CC(=O)C=CC)CCC(O2)(O)CC(C)C2CCCNC(=O)C(C)C2OC(CCC(C)C=C(C)C(C)O)CCCCC(C)C1CC(=O)NC2 NPSOIFAWYAHWOH-UHFFFAOYSA-N 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 229960002092 busulfan Drugs 0.000 description 1
- 230000005907 cancer growth Effects 0.000 description 1
- 229950009338 caracemide Drugs 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 208000002458 carcinoid tumor Diseases 0.000 description 1
- 210000003679 cervix uteri Anatomy 0.000 description 1
- 229960005395 cetuximab Drugs 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 239000012829 chemotherapy agent Substances 0.000 description 1
- 208000032852 chronic lymphocytic leukemia Diseases 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 239000003184 complementary RNA Substances 0.000 description 1
- 230000002508 compound effect Effects 0.000 description 1
- 238000002790 cross-validation Methods 0.000 description 1
- 108010090203 cryptophycin 8 Proteins 0.000 description 1
- UHDGCWIWMRVCDJ-ZAKLUEHWSA-N cytidine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-ZAKLUEHWSA-N 0.000 description 1
- 229940104302 cytosine Drugs 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 229930189582 didemnin Natural products 0.000 description 1
- LVTYICIALWPMFW-UHFFFAOYSA-N diisopropanolamine Chemical compound CC(O)CNCC(C)O LVTYICIALWPMFW-UHFFFAOYSA-N 0.000 description 1
- 229960003668 docetaxel Drugs 0.000 description 1
- 229960002918 doxorubicin hydrochloride Drugs 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 210000000959 ear middle Anatomy 0.000 description 1
- 229950010033 ebselen Drugs 0.000 description 1
- 229960002046 eflornithine hydrochloride Drugs 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 229950004926 epipropidine Drugs 0.000 description 1
- 229930013356 epothilone Natural products 0.000 description 1
- HESCAJZNRMSMJG-KKQRBIROSA-N epothilone A Chemical class C/C([C@@H]1C[C@@H]2O[C@@H]2CCC[C@@H]([C@@H]([C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1)O)C)=C\C1=CSC(C)=N1 HESCAJZNRMSMJG-KKQRBIROSA-N 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- ITSGNOIFAJAQHJ-BMFNZSJVSA-N esorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)C[C@H](C)O1 ITSGNOIFAJAQHJ-BMFNZSJVSA-N 0.000 description 1
- 229950002017 esorubicin Drugs 0.000 description 1
- XPGDODOEEWLHOI-GSDHBNRESA-N ethyl (2s)-2-[[(2s)-2-[[(2s)-2-amino-3-(4-fluorophenyl)propanoyl]amino]-3-[3-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound C([C@@H](C(=O)N[C@@H](CCSC)C(=O)OCC)NC(=O)[C@@H](N)CC=1C=CC(F)=CC=1)C1=CC=CC(N(CCCl)CCCl)=C1 XPGDODOEEWLHOI-GSDHBNRESA-N 0.000 description 1
- 108700002148 exportin 1 Proteins 0.000 description 1
- 210000001508 eye Anatomy 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- FVTCRASFADXXNN-SCRDCRAPSA-N flavin mononucleotide Chemical compound OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O FVTCRASFADXXNN-SCRDCRAPSA-N 0.000 description 1
- 229960005304 fludarabine phosphate Drugs 0.000 description 1
- 229950005682 flurocitabine Drugs 0.000 description 1
- VEPYXRRTOARCQD-IGPDFVGCSA-N formycin Chemical compound N1=N[C]2C(N)=NC=NC2=C1[C@@H]1O[C@@H](CO)[C@H](O)[C@H]1O VEPYXRRTOARCQD-IGPDFVGCSA-N 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 210000000232 gallbladder Anatomy 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 238000001415 gene therapy Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 235000008434 ginseng Nutrition 0.000 description 1
- 108020004445 glyceraldehyde-3-phosphate dehydrogenase Proteins 0.000 description 1
- 102000006602 glyceraldehyde-3-phosphate dehydrogenase Human genes 0.000 description 1
- 210000002216 heart Anatomy 0.000 description 1
- 208000014951 hematologic disease Diseases 0.000 description 1
- 208000018706 hematopoietic system disease Diseases 0.000 description 1
- 238000009396 hybridization Methods 0.000 description 1
- 229960000443 hydrochloric acid Drugs 0.000 description 1
- 229960001330 hydroxycarbamide Drugs 0.000 description 1
- 210000003026 hypopharynx Anatomy 0.000 description 1
- 229960005236 ibandronic acid Drugs 0.000 description 1
- 229960001001 ibritumomab tiuxetan Drugs 0.000 description 1
- 230000001976 improved effect Effects 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000012880 independent component analysis Methods 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 210000003228 intrahepatic bile duct Anatomy 0.000 description 1
- VBUWHHLIZKOSMS-RIWXPGAOSA-N invicorp Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)C(C)C)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=C(O)C=C1 VBUWHHLIZKOSMS-RIWXPGAOSA-N 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- RWXRJSRJIITQAK-ZSBIGDGJSA-N itasetron Chemical compound C12=CC=CC=C2NC(=O)N1C(=O)N[C@H](C1)C[C@H]2CC[C@@H]1N2C RWXRJSRJIITQAK-ZSBIGDGJSA-N 0.000 description 1
- 229950007654 itasetron Drugs 0.000 description 1
- 239000010977 jade Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 210000002429 large intestine Anatomy 0.000 description 1
- 210000000867 larynx Anatomy 0.000 description 1
- 229960002618 lenograstim Drugs 0.000 description 1
- KDQAABAKXDWYSZ-SDCRJXSCSA-N leurosidine sulfate Chemical compound OS(O)(=O)=O.C([C@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 KDQAABAKXDWYSZ-SDCRJXSCSA-N 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229950002950 lintuzumab Drugs 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 210000005075 mammary gland Anatomy 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- RQZAXGRLVPAYTJ-GQFGMJRRSA-N megestrol acetate Chemical compound C1=C(C)C2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(C)=O)(OC(=O)C)[C@@]1(C)CC2 RQZAXGRLVPAYTJ-GQFGMJRRSA-N 0.000 description 1
- 229960004296 megestrol acetate Drugs 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 210000000713 mesentery Anatomy 0.000 description 1
- FBOZXECLQNJBKD-UHFFFAOYSA-N methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-UHFFFAOYSA-N 0.000 description 1
- QTFKTBRIGWJQQL-UHFFFAOYSA-N meturedepa Chemical compound C1C(C)(C)N1P(=O)(NC(=O)OCC)N1CC1(C)C QTFKTBRIGWJQQL-UHFFFAOYSA-N 0.000 description 1
- 229950009847 meturedepa Drugs 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 108010026677 mitomalcin Proteins 0.000 description 1
- 229950007612 mitomalcin Drugs 0.000 description 1
- ZAHQPTJLOCWVPG-UHFFFAOYSA-N mitoxantrone dihydrochloride Chemical compound Cl.Cl.O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO ZAHQPTJLOCWVPG-UHFFFAOYSA-N 0.000 description 1
- 229960004169 mitoxantrone hydrochloride Drugs 0.000 description 1
- 230000001002 morphogenetic effect Effects 0.000 description 1
- 210000000214 mouth Anatomy 0.000 description 1
- 210000003928 nasal cavity Anatomy 0.000 description 1
- 210000001989 nasopharynx Anatomy 0.000 description 1
- CMUOJBJRZUHRMU-UHFFFAOYSA-N nitrourea Chemical compound NC(=O)N[N+]([O-])=O CMUOJBJRZUHRMU-UHFFFAOYSA-N 0.000 description 1
- 210000001331 nose Anatomy 0.000 description 1
- 238000007899 nucleic acid hybridization Methods 0.000 description 1
- 210000004279 orbit Anatomy 0.000 description 1
- 210000001672 ovary Anatomy 0.000 description 1
- 229950000370 oxisuran Drugs 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- 210000002990 parathyroid gland Anatomy 0.000 description 1
- 210000004303 peritoneum Anatomy 0.000 description 1
- 210000003800 pharynx Anatomy 0.000 description 1
- 229960003742 phenol Drugs 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 229960005141 piperazine Drugs 0.000 description 1
- ZTRPYTHOEREHEN-UHFFFAOYSA-N piperazine pyridine Chemical compound N1CCNCC1.N1=CC=CC=C1.N1=CC=CC=C1 ZTRPYTHOEREHEN-UHFFFAOYSA-N 0.000 description 1
- NUKCGLDCWQXYOQ-UHFFFAOYSA-N piposulfan Chemical compound CS(=O)(=O)OCCC(=O)N1CCN(C(=O)CCOS(C)(=O)=O)CC1 NUKCGLDCWQXYOQ-UHFFFAOYSA-N 0.000 description 1
- 229950001100 piposulfan Drugs 0.000 description 1
- 210000004224 pleura Anatomy 0.000 description 1
- JKPDEYAOCSQBSZ-OEUJLIAZSA-N plomestane Chemical compound O=C1CC[C@]2(CC#C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1 JKPDEYAOCSQBSZ-OEUJLIAZSA-N 0.000 description 1
- 229950004541 plomestane Drugs 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000003234 polygenic effect Effects 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 238000000513 principal component analysis Methods 0.000 description 1
- 229960001586 procarbazine hydrochloride Drugs 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 150000003217 pyrazoles Chemical class 0.000 description 1
- 238000012797 qualification Methods 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000003757 reverse transcription PCR Methods 0.000 description 1
- 229920002477 rna polymer Polymers 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229940091258 selenium supplement Drugs 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 108010032486 splenopentin Proteins 0.000 description 1
- 229950001248 squalamine Drugs 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 108091007196 stromelysin Proteins 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003277 telomerase inhibitor Substances 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- 229940104230 thymidine Drugs 0.000 description 1
- 108010013515 thymopoietin receptor Proteins 0.000 description 1
- 210000001541 thymus gland Anatomy 0.000 description 1
- 210000001685 thyroid gland Anatomy 0.000 description 1
- ONYVJPZNVCOAFF-UHFFFAOYSA-N topsentin Natural products Oc1ccc2cc([nH]c2c1)C(=O)c3ncc([nH]3)c4c[nH]c5ccccc45 ONYVJPZNVCOAFF-UHFFFAOYSA-N 0.000 description 1
- 229960005267 tositumomab Drugs 0.000 description 1
- PKVRCIRHQMSYJX-AIFWHQITSA-N trabectedin Chemical compound C([C@@]1(C(OC2)=O)NCCC3=C1C=C(C(=C3)O)OC)S[C@@H]1C3=C(OC(C)=O)C(C)=C4OCOC4=C3[C@H]2N2[C@@H](O)[C@H](CC=3C4=C(O)C(OC)=C(C)C=3)N(C)[C@H]4[C@@H]21 PKVRCIRHQMSYJX-AIFWHQITSA-N 0.000 description 1
- 229960000977 trabectedin Drugs 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- 229960001727 tretinoin Drugs 0.000 description 1
- 229960003688 tropisetron Drugs 0.000 description 1
- ZNRGQMMCGHDTEI-ITGUQSILSA-N tropisetron Chemical compound C1=CC=C2C(C(=O)O[C@H]3C[C@H]4CC[C@@H](C3)N4C)=CNC2=C1 ZNRGQMMCGHDTEI-ITGUQSILSA-N 0.000 description 1
- WMPQMBUXZHMEFZ-YJPJVVPASA-N turosteride Chemical compound CN([C@@H]1CC2)C(=O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H](C(=O)N(C(C)C)C(=O)NC(C)C)[C@@]2(C)CC1 WMPQMBUXZHMEFZ-YJPJVVPASA-N 0.000 description 1
- 229950007816 turosteride Drugs 0.000 description 1
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 1
- 150000004917 tyrosine kinase inhibitor derivatives Chemical class 0.000 description 1
- 229950009811 ubenimex Drugs 0.000 description 1
- 229960001055 uracil mustard Drugs 0.000 description 1
- 210000000626 ureter Anatomy 0.000 description 1
- 210000003932 urinary bladder Anatomy 0.000 description 1
- 229960005356 urokinase Drugs 0.000 description 1
- 229950008261 velaresol Drugs 0.000 description 1
- MALFODICFSIXPO-KFKQDBFTSA-N veratramine Chemical compound N([C@H]1[C@@H](C)C=2C(=C3C[C@@H]4[C@@]5(C)CC[C@H](O)CC5=CC[C@H]4C3=CC=2)C)C[C@@H](C)C[C@H]1O MALFODICFSIXPO-KFKQDBFTSA-N 0.000 description 1
- 229960004355 vindesine Drugs 0.000 description 1
- UGGWPQSBPIFKDZ-KOTLKJBCSA-N vindesine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(N)=O)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1N=C1[C]2C=CC=C1 UGGWPQSBPIFKDZ-KOTLKJBCSA-N 0.000 description 1
- 229950005561 zanoterone Drugs 0.000 description 1
- FYQZGCBXYVWXSP-STTFAQHVSA-N zinostatin stimalamer Chemical compound O1[C@H](C)[C@H](O)[C@H](O)[C@@H](NC)[C@H]1OC1C/2=C/C#C[C@H]3O[C@@]3([C@H]3OC(=O)OC3)C#CC\2=C[C@H]1OC(=O)C1=C(C)C=CC2=C(C)C=C(OC)C=C12 FYQZGCBXYVWXSP-STTFAQHVSA-N 0.000 description 1
- 229950009233 zinostatin stimalamer Drugs 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Q—MEASURING OR TESTING PROCESSES INVOLVING ENZYMES, NUCLEIC ACIDS OR MICROORGANISMS; COMPOSITIONS OR TEST PAPERS THEREFOR; PROCESSES OF PREPARING SUCH COMPOSITIONS; CONDITION-RESPONSIVE CONTROL IN MICROBIOLOGICAL OR ENZYMOLOGICAL PROCESSES
- C12Q1/00—Measuring or testing processes involving enzymes, nucleic acids or microorganisms; Compositions therefor; Processes of preparing such compositions
- C12Q1/68—Measuring or testing processes involving enzymes, nucleic acids or microorganisms; Compositions therefor; Processes of preparing such compositions involving nucleic acids
- C12Q1/6876—Nucleic acid products used in the analysis of nucleic acids, e.g. primers or probes
- C12Q1/6883—Nucleic acid products used in the analysis of nucleic acids, e.g. primers or probes for diseases caused by alterations of genetic material
- C12Q1/6886—Nucleic acid products used in the analysis of nucleic acids, e.g. primers or probes for diseases caused by alterations of genetic material for cancer
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Q—MEASURING OR TESTING PROCESSES INVOLVING ENZYMES, NUCLEIC ACIDS OR MICROORGANISMS; COMPOSITIONS OR TEST PAPERS THEREFOR; PROCESSES OF PREPARING SUCH COMPOSITIONS; CONDITION-RESPONSIVE CONTROL IN MICROBIOLOGICAL OR ENZYMOLOGICAL PROCESSES
- C12Q2600/00—Oligonucleotides characterized by their use
- C12Q2600/106—Pharmacogenomics, i.e. genetic variability in individual responses to drugs and drug metabolism
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Q—MEASURING OR TESTING PROCESSES INVOLVING ENZYMES, NUCLEIC ACIDS OR MICROORGANISMS; COMPOSITIONS OR TEST PAPERS THEREFOR; PROCESSES OF PREPARING SUCH COMPOSITIONS; CONDITION-RESPONSIVE CONTROL IN MICROBIOLOGICAL OR ENZYMOLOGICAL PROCESSES
- C12Q2600/00—Oligonucleotides characterized by their use
- C12Q2600/158—Expression markers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Zoology (AREA)
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Analytical Chemistry (AREA)
- Genetics & Genomics (AREA)
- General Health & Medical Sciences (AREA)
- Pathology (AREA)
- Immunology (AREA)
- Molecular Biology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- Biophysics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Biotechnology (AREA)
- Microbiology (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Hospice & Palliative Care (AREA)
- Biochemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Engineering & Computer Science (AREA)
- Measuring Or Testing Involving Enzymes Or Micro-Organisms (AREA)
- Investigating Or Analysing Biological Materials (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Apparatus Associated With Microorganisms And Enzymes (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DKPA200501696 | 2005-12-01 | ||
| DKPA200501696 | 2005-12-01 | ||
| PCT/IB2006/004048 WO2007072225A2 (fr) | 2005-12-01 | 2006-12-01 | Méthodes et appareils pour identifier des biomarqueurs de réponse à un traitement et leur utilisation pour prédire l'efficacité d’un traitement |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CN101365806A CN101365806A (zh) | 2009-02-11 |
| CN101365806B true CN101365806B (zh) | 2016-11-16 |
Family
ID=38189039
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CN200680052220.2A Active CN101365806B (zh) | 2005-12-01 | 2006-12-01 | 用于鉴定治疗反应的生物标记的方法和装置及其预测疗效的用途 |
Country Status (5)
| Country | Link |
|---|---|
| EP (1) | EP1960551A2 (fr) |
| JP (3) | JP5984324B2 (fr) |
| CN (1) | CN101365806B (fr) |
| CA (1) | CA2631236C (fr) |
| WO (1) | WO2007072225A2 (fr) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN110331200A (zh) * | 2019-06-28 | 2019-10-15 | 中山大学附属第六医院 | Cd47检测试剂在制备结直肠癌对抗egfr单抗耐药诊断剂方面的应用 |
Families Citing this family (82)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU2008286408A1 (en) * | 2007-08-14 | 2009-02-19 | F. Hoffmann-La Roche Ag | Predictive marker for EGFR inhibitor treatment |
| PL2198042T3 (pl) | 2007-09-17 | 2017-05-31 | Mdxhealth Sa | Nowe markery do wykrywania raka pęcherza moczowego |
| WO2010024374A1 (fr) * | 2008-08-29 | 2010-03-04 | 学校法人北里研究所 | Méthode de détection des effets sur des médicaments des inhibiteurs de méthylation de l'adn |
| GB0816867D0 (en) * | 2008-09-15 | 2008-10-22 | Glaxosmithkline Biolog Sa | Method |
| KR20120088555A (ko) | 2009-05-11 | 2012-08-08 | 버그 바이오시스템즈, 엘엘씨 | 환경대사적 전환인자, 다차원 세포내 분자 또는 환경적 영향인자를 사용한 대사적 장애의 진단 방법 |
| DK177532B1 (en) | 2009-09-17 | 2013-09-08 | Bio Bedst Aps | Medical use of sPLA2 hydrolysable liposomes |
| TW201136604A (en) * | 2009-12-14 | 2011-11-01 | Oncotherapy Science Inc | TMEM22 peptides and vaccines including the same |
| JP6083735B2 (ja) * | 2009-12-31 | 2017-02-22 | カッパーアールエヌエー，インコーポレイテッド | インスリン受容体基質２（ｉｒｓ２）および転写因子３（ｔｆｅ３）に対する天然アンチセンス転写物の阻害によるインスリン受容体基質２（ｉｒｓ２）関連疾患の治療 |
| NZ600268A (en) | 2010-01-11 | 2014-08-29 | Genomic Health Inc | Method to use gene expression to determine likelihood of clinical outcome of renal cancer |
| CA2800557A1 (fr) | 2010-04-29 | 2011-11-03 | Medical Prognosis Institute A/S | Methodes et dispositifs permettant de predire l'efficacite d'un traitement |
| KR101869413B1 (ko) | 2010-06-14 | 2018-06-20 | 리케라 바이오메드 에스에이 | Ｓ100ａ4 항체들 및 이들의 치료 용도 |
| US20130102477A1 (en) | 2010-06-23 | 2013-04-25 | Ryan D. Morin | Biomarkers for non-hodgkin lymphomas and uses thereof |
| EP2913405B1 (fr) | 2010-07-27 | 2016-11-09 | Genomic Health, Inc. | Procédé d'utilisation de l'expression génique pour déterminer le pronostic du cancer de la prostate |
| US9175331B2 (en) | 2010-09-10 | 2015-11-03 | Epizyme, Inc. | Inhibitors of human EZH2, and methods of use thereof |
| CA3176977A1 (fr) | 2010-09-10 | 2012-03-15 | Epizyme, Inc. | Inhibiteurs de l'ezh2 humaine, et leurs procedes d'utilisation |
| CN102408478A (zh) * | 2010-09-21 | 2012-04-11 | 复旦大学 | 一种人少突神经胶质瘤标志物map2蛋白及其用途 |
| JP2014502606A (ja) * | 2010-12-15 | 2014-02-03 | メディミューン，エルエルシー | 黒色腫の処置 |
| DK2666015T3 (en) * | 2011-01-21 | 2017-03-27 | Basilea Pharmaceutica Ag | USE OF STATHMIN AS A BIOMARKETER FOR PHARMACEUTICAL RESPONSE TO FURAZANOBENZIMIDAZOLES |
| JP6092844B2 (ja) | 2011-04-04 | 2017-03-08 | バーグ エルエルシー | 中枢神経系腫瘍の治療方法 |
| JO3438B1 (ar) | 2011-04-13 | 2019-10-20 | Epizyme Inc | مركبات بنزين مستبدلة بأريل أو أريل غير متجانس |
| KR101439856B1 (ko) * | 2011-06-02 | 2014-09-17 | 한국생명공학연구원 | 항-ａｔｉｃ 자가면역항체를 포함하는 간암 진단 마커 및 이의 항원을 포함하는 간암 진단용 조성물 |
| CN104024851A (zh) * | 2011-11-28 | 2014-09-03 | 加拿大国家研究委员会 | 针对癌症的紫杉醇反应标志物 |
| US8725426B2 (en) | 2012-01-31 | 2014-05-13 | Genomic Health, Inc. | Gene expression profile algorithm and test for determining prognosis of prostate cancer |
| US9663825B2 (en) | 2012-04-19 | 2017-05-30 | Acetylon Pharmaceuticals, Inc. | Biomarkers to identify patients that will respond to treatment and treating such patients |
| CA2871995A1 (fr) * | 2012-05-04 | 2013-11-07 | Novartis Ag | Biomarqueurs pour therapie par inhibiteur de iap |
| DK2872646T3 (en) * | 2012-07-12 | 2017-12-04 | Université Paris Descartes | PROCEDURES FOR PREDICTING SURVIVAL TIME AND TREATMENT RESPONSE OF A PATIENT, SUFFERING A FAST CANCER WITH A SIGNATURE OF AT LEAST 7 GENES |
| PE20150887A1 (es) | 2012-10-15 | 2015-06-04 | Epizyme Inc | Compuestos de benceno sustituidos |
| CN105338973A (zh) | 2013-04-08 | 2016-02-17 | 博格有限责任公司 | 使用辅酶q10联合疗法治疗癌症 |
| AU2014274135B2 (en) | 2013-05-30 | 2020-04-09 | Genomic Health, Inc. | Gene expression profile algorithm for calculating a recurrence score for a patient with kidney cancer |
| SG11201601583TA (en) | 2013-09-04 | 2016-04-28 | Berg Llc | Methods of treatment of cancer by continuous infusion of coenzyme q10 |
| JP2017508469A (ja) * | 2014-03-11 | 2017-03-30 | ザ・カウンシル・オヴ・ザ・クイーンズランド・インスティテュート・オヴ・メディカル・リサーチ | 癌悪性度、予後及び治療に対する反応性の決定 |
| CN103923212A (zh) * | 2014-03-31 | 2014-07-16 | 天津市应世博科技发展有限公司 | Ehd2抗体及其在制备乳腺癌免疫组化检测试剂中的应用 |
| CN104945496B (zh) * | 2014-03-31 | 2019-05-03 | 天津市应世博科技发展有限公司 | 一种多肽及其在制备与纯化对ehd2特异的抗体中的应用 |
| FR3025028A1 (fr) * | 2014-08-22 | 2016-02-26 | Acobiom | Procede pour determiner le pronostic de survie d'un patient atteint d'un cancer du pancreas |
| WO2016046640A2 (fr) | 2014-09-26 | 2016-03-31 | Medical Prognosis Institute A/S | Procédés de prédiction de la réactivité à un médicament |
| KR101674874B1 (ko) * | 2014-10-21 | 2016-11-22 | 한국원자력의학원 | 항암제 내성 예측용 바이오마커로서의 ｉｃａｍ－３ 및 이의 용도 |
| CN105777901B (zh) * | 2014-12-25 | 2019-07-09 | 中国科学院上海生命科学研究院 | 一种抗qki-5单克隆抗体及其制备与应用 |
| WO2016121715A1 (fr) * | 2015-01-26 | 2016-08-04 | 国立大学法人名古屋大学 | Procédé de fourniture d'informations pour évaluer le pronostic d'un patient atteint de cancer du poumon, procédé de prédiction de pronostic de patient atteint de cancer du poumon, standard interne, anticorps, dispositif pour prédire le pronostic d'un patient atteint de cancer du poumon, programme pour dispositif de prédiction de pronostic, et support d'enregistrement |
| GB201503371D0 (en) * | 2015-02-27 | 2015-04-15 | Mission Therapeutics Ltd | Methods of screening and treatment |
| CN104749381B (zh) * | 2015-03-30 | 2017-03-15 | 石河子大学 | 组装抑制蛋白pfn2在制备食管癌诊断试剂中的用途 |
| CN105132415A (zh) * | 2015-08-19 | 2015-12-09 | 天津市康婷生物工程有限公司 | 锰超氧化物歧化酶sod2的体外分子检测方法及引物 |
| CN105132429A (zh) * | 2015-10-10 | 2015-12-09 | 华东理工大学 | 靶向人KPNB1基因的siRNA及其应用 |
| CN105424935B (zh) * | 2015-11-09 | 2017-08-25 | 吉林大学 | 多聚谷氨酰化dnajc7的新应用 |
| CN105506107A (zh) * | 2015-12-30 | 2016-04-20 | 杭州艾迪康医学检验中心有限公司 | 检测dock2基因多态热点突变情况的引物和方法 |
| CA3234176A1 (fr) * | 2016-02-05 | 2017-08-10 | Antje Margret Wengner | Composes, compositions et methodes pour la stratification de patients cancereux et le traitement d'un cancer |
| CN105787297A (zh) * | 2016-03-12 | 2016-07-20 | 云南圣清环境监测科技有限公司 | 一种微生物修复系统活性评价的方法 |
| WO2017167788A1 (fr) * | 2016-03-29 | 2017-10-05 | Universite Paris Diderot Paris 7 | Compositions comprenant des vésicules extracellulaires sécrétées de cellules exprimant nfatc4 utiles pour le traitement du cancer |
| WO2018039490A1 (fr) * | 2016-08-24 | 2018-03-01 | Genomedx Biosciences, Inc. | Utilisation de signatures génomiques en vue d'une prédiction de la réactivité de patients atteints d'un cancer de la prostate à une radiothérapie postopératoire |
| JP6779517B2 (ja) * | 2016-09-02 | 2020-11-04 | 国立大学法人 鹿児島大学 | 抗癌剤の感受性及び癌の予後に対する診断マーカー |
| US9725769B1 (en) | 2016-10-07 | 2017-08-08 | Oncology Venture ApS | Methods for predicting drug responsiveness in cancer patients |
| CN106399582B (zh) * | 2016-12-20 | 2019-12-24 | 上海杏园瑞民生物工程有限公司 | 一种检测与结直肠癌靶向用药西妥昔单抗治疗敏感性相关基因的多态性的试剂盒及其应用 |
| AU2017258901A1 (en) * | 2016-12-30 | 2018-07-19 | Allarity Therapeutics Europe ApS | Methods for predicting drug responsiveness in cancer patients |
| AU2018202878A1 (en) | 2017-05-16 | 2018-12-06 | Allarity Therapeutics Europe ApS | Methods for predicting drug responsiveness in cancer patients |
| CN107266567B (zh) * | 2017-06-05 | 2021-06-04 | 高新 | Lcrmp4单克隆抗体及其制备方法与应用 |
| CN109207589A (zh) * | 2017-07-05 | 2019-01-15 | 安徽普元生物科技股份有限公司 | 一步法实时荧光定量逆转录聚合酶链反应检测人细胞角蛋白7的试剂盒 |
| WO2019018451A2 (fr) * | 2017-07-17 | 2019-01-24 | The Regents Of The University Of Colorado | Compositions et méthodes de prévention et de traitement d'effets de proximité induits par rayonnement provoqués par un rayonnement ou une radiothérapie |
| CN109387630A (zh) * | 2017-08-14 | 2019-02-26 | 杭州源昶医药科技有限公司 | 用于预测吉西他滨药物敏感性的生物标记物及其用途 |
| CN109470854B (zh) * | 2017-09-08 | 2022-02-11 | 广州市丹蓝生物科技有限公司 | 肺癌诊断用蛋白芯片及试剂盒 |
| JP7357921B2 (ja) * | 2017-09-29 | 2023-10-10 | 国立大学法人九州大学 | びまん性大細胞型ｂ細胞リンパ腫患者における化学療法に対する治療効果を予測するための方法及びキット |
| EP3792363B1 (fr) * | 2018-01-23 | 2024-06-26 | Excellen Medical Technology Co., Ltd. | Méthode et kit pour identifier l'état d'un cancer du poumon |
| US20220324835A1 (en) * | 2018-01-26 | 2022-10-13 | Nurix Therapeutics, Inc. | Inhibitors of cbl-b and methods of use thereof |
| CN108796077B (zh) * | 2018-05-30 | 2021-11-09 | 朱运峰 | 在cfDNA中检测胞嘧啶脱氨酶及相关分子基因修饰差异的引物对组及试剂盒 |
| WO2020047604A1 (fr) * | 2018-09-06 | 2020-03-12 | The Council Of The Queensland Institute Of Medical Research | Biomarqueurs pour la cancérothérapie |
| BR122023024103A2 (pt) | 2018-10-15 | 2024-02-20 | Nurix Therapeutics, Inc. | Compostos bifuncionais para degradação de btk por meio da via de proteossoma de ubiquitina, composição farmacêutica compreendendo os mesmos, e seus usos |
| US20220002815A1 (en) * | 2018-11-04 | 2022-01-06 | Pfs Genomics, Inc. | Methods and genomic classifiers for prognosis of breast cancer and predicting benefit from adjuvant radiotherapy |
| CN109402260A (zh) * | 2018-11-28 | 2019-03-01 | 陕西中医药大学 | Rims3基因作为肝癌检测的生物标志物及应用 |
| US20220081727A1 (en) * | 2019-01-17 | 2022-03-17 | Geninus Inc. | Biomarker for predicting response to anticancer agent and use thereof |
| IL287049B2 (en) | 2019-04-09 | 2025-01-01 | Nurix Therapeutics Inc | Trisubstituted piperidine compounds for inhibiting CBL-B, and use of a CBL-B inhibitor in combination with a cancer vaccine and/or oncolytic virus |
| WO2020236654A1 (fr) | 2019-05-17 | 2020-11-26 | Nurix Therapeutics, Inc. | Composés cyano-cyclobutyle pour l'inhibition de cbl-b et leurs utilisations |
| KR20220026581A (ko) | 2019-06-26 | 2022-03-04 | 누릭스 테라퓨틱스 인코포레이티드 | Cbl-b 억제를 위한 치환된 벤질-트리아졸 화합물, 및 이의 추가의 용도 |
| WO2021050490A1 (fr) * | 2019-09-13 | 2021-03-18 | The Trustees Of Columbia University In The City Of New York | Procédés d'amélioration de la radiothérapie au moyen d'inducteurs de ferroptose en tant que radiosensibilisateurs |
| EP4034141A1 (fr) | 2019-09-24 | 2022-08-03 | Nurix Therapeutics, Inc. | Inhibiteurs de cbl et compositions pour l'expansion de cellules immunitaires |
| US11820781B2 (en) | 2019-12-04 | 2023-11-21 | Nurix Therapeutics, Inc. | Bifunctional compounds for degrading BTK via ubiquitin proteosome pathway |
| CN110951876A (zh) * | 2019-12-17 | 2020-04-03 | 蔡清清 | 一种淋巴瘤预后试剂盒 |
| CN111321228B (zh) * | 2020-03-13 | 2021-03-05 | 中国医学科学院肿瘤医院 | 抗pd-1治疗敏感性相关基因及其应用 |
| KR102363980B1 (ko) * | 2020-04-13 | 2022-02-15 | 전남대학교산학협력단 | 전이성 뇌종양의 진단 또는 예후 분석용 바이오마커 및 이를 이용한 진단방법 |
| JP2024514836A (ja) | 2021-04-08 | 2024-04-03 | ニューリックス セラピューティクス，インコーポレイテッド | Ｃｂｌ－ｂ阻害化合物との組み合わせ療法 |
| TW202307203A (zh) * | 2021-07-15 | 2023-02-16 | 日商富士軟片股份有限公司 | 特定細胞的品質管理方法及製造特定細胞之方法 |
| CN113593700B (zh) * | 2021-08-06 | 2024-02-27 | 江苏师范大学 | 分析肺癌进展的方法、装置、设备、介质及程序产品 |
| CN113493840A (zh) * | 2021-09-07 | 2021-10-12 | 北京泱深生物信息技术有限公司 | 子宫内膜癌诊断用标志物及其衍生产品和应用 |
| GB202117299D0 (en) * | 2021-11-30 | 2022-01-12 | Queens Univ Of Belfast | Method of prognosis |
| KR102701566B1 (ko) * | 2021-12-29 | 2024-09-04 | 인하대학교 산학협력단 | Ifi44의 발현 또는 활성 억제제를 유효성분으로 포함하는 방사선 민감성 증진용 약학 조성물 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20040072722A1 (en) * | 2002-10-10 | 2004-04-15 | Kornblith Paul L. | Methods for assessing efficacy of chemotherapeutic agents |
| JP2002531066A (ja) * | 1998-11-05 | 2002-09-24 | パーカー ヒューズ インスティテュート | イカロス（ｉｋａｒｏｓ）アイソフォームおよび突然変異体 |
| WO2000034788A1 (fr) * | 1998-12-08 | 2000-06-15 | Board Of Regents, The University Of Texas System | Procedes de detection du cancer du sein resistant aux anti-oestrogenes |
| US6647341B1 (en) * | 1999-04-09 | 2003-11-11 | Whitehead Institute For Biomedical Research | Methods for classifying samples and ascertaining previously unknown classes |
| US7324926B2 (en) * | 1999-04-09 | 2008-01-29 | Whitehead Institute For Biomedical Research | Methods for predicting chemosensitivity or chemoresistance |
| JP2006506945A (ja) * | 2002-03-28 | 2006-03-02 | メディカル・カレッジ・オブ・オハイオ | 遺伝子発現プロフィールを使用する非小細胞肺癌の診断および処置のための方法および組成物 |
| JP2004043446A (ja) * | 2002-05-15 | 2004-02-12 | Schering Ag | ヒストンデアセチラーゼ抑制剤及びその使用 |
| CN102342938B (zh) * | 2002-05-17 | 2014-08-20 | 细胞基因公司 | 用于治疗和控制实体瘤的方法及组合物 |
| JP2007501608A (ja) * | 2003-08-08 | 2007-02-01 | 株式会社 キャンバス | 抗癌治療の効力を推定するための感受性試験 |
| WO2005047534A2 (fr) * | 2003-10-28 | 2005-05-26 | Bayer Healthcare Ag | Procedes et compositions de prediction de reponse de la neoplasie maligne a un traitement |
| US20050147978A1 (en) * | 2003-12-30 | 2005-07-07 | Jose Remacle | Method for quantitative determination of multi-drug resistance in tumors |
| ES2394799T3 (es) * | 2003-12-31 | 2013-02-05 | The Penn State Research Foundation | Métodos para predecir y superar la resistencia a quimioterapia en cáncer de ovario |
| US20070270488A1 (en) * | 2004-03-12 | 2007-11-22 | The Queen's University Of Belfast | Treatment and Assays |
| CN1972703A (zh) * | 2004-03-30 | 2007-05-30 | 丹麦皇家兽医和农业学院 | 通过阻断和检测蛋白酶抑制剂改进癌症的治疗和癌症治疗效率的预测 |
| ES2550614T3 (es) * | 2004-04-09 | 2015-11-11 | Genomic Health, Inc. | Marcadores de expresión génica para predecir la respuesta a la quimioterapia |
-
2006
- 2006-12-01 JP JP2008542865A patent/JP5984324B2/ja active Active
- 2006-12-01 WO PCT/IB2006/004048 patent/WO2007072225A2/fr active Application Filing
- 2006-12-01 CN CN200680052220.2A patent/CN101365806B/zh active Active
- 2006-12-01 EP EP06848658A patent/EP1960551A2/fr not_active Withdrawn
- 2006-12-01 CA CA2631236A patent/CA2631236C/fr active Active
-
2014
- 2014-02-19 JP JP2014029461A patent/JP2014147386A/ja active Pending
-
2015
- 2015-09-17 JP JP2015183600A patent/JP2016026496A/ja active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN110331200A (zh) * | 2019-06-28 | 2019-10-15 | 中山大学附属第六医院 | Cd47检测试剂在制备结直肠癌对抗egfr单抗耐药诊断剂方面的应用 |
Also Published As
| Publication number | Publication date |
|---|---|
| WO2007072225A2 (fr) | 2007-06-28 |
| JP2016026496A (ja) | 2016-02-18 |
| CA2631236C (fr) | 2019-10-29 |
| EP1960551A2 (fr) | 2008-08-27 |
| WO2007072225A3 (fr) | 2008-07-10 |
| JP2009523011A (ja) | 2009-06-18 |
| JP2014147386A (ja) | 2014-08-21 |
| CA2631236A1 (fr) | 2007-06-28 |
| CN101365806A (zh) | 2009-02-11 |
| WO2007072225A8 (fr) | 2008-11-06 |
| JP5984324B2 (ja) | 2016-09-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN101365806B (zh) | 用于鉴定治疗反应的生物标记的方法和装置及其预测疗效的用途 | |
| US8445198B2 (en) | Methods, kits and devices for identifying biomarkers of treatment response and use thereof to predict treatment efficacy | |
| WO2008138578A2 (fr) | Procédés, coffrets et dispositifs pour identifier des biomarqueurs de réponse à un traitement et utilisation de ceux-ci pour prédire l'efficacité du traitement | |
| US10570457B2 (en) | Methods for predicting drug responsiveness | |
| US8877445B2 (en) | Methods for identification of tumor phenotype and treatment | |
| EP2563936B1 (fr) | Méthodes et dispositifs permettant de prédire l'efficacité d'un traitement | |
| US11866787B2 (en) | Methods for identifying androgen receptor splice variants in subjects having castration resistant prostate cancer | |
| US20150301055A1 (en) | Circulating biomarkers for disease | |
| CN103492590A (zh) | 循环生物标志物 | |
| EP4428157A2 (fr) | Utilisation de l'expression génique spécifique de cellules immunitaires pour le pronostic du cancer de la prostate et la prédiction de la réactivité à une radiothérapie | |
| WO2009029266A2 (fr) | Outil de diagnostic pour diagnostiquer des lésions de la thyroïde bénignes versus malignes | |
| US10900089B2 (en) | Methods for predicting drug responsiveness in cancer patients | |
| US20210164056A1 (en) | Use of metastases-specific signatures for treatment of cancer | |
| Ma et al. | Polymorphisms of key chemokine genes and survival of non-small cell lung cancer in Chinese | |
| US20240318258A1 (en) | Biomarkers for breast cancer detection | |
| US20100055686A1 (en) | Methods for diagnosis of pediatric common acute lymphoblastic leukemia by determining the level of gene expression | |
| US20240344132A1 (en) | Method of Treating Liver Cancer, Predicting Response to Treatment, and Predicting Adverse Effects During the Treatment Thereof | |
| US20240254565A1 (en) | Unique cancer associated fibroblast subsets predict response to immunotherapy | |
| US12104210B2 (en) | Blood RNA biomarkers of coronary artery disease | |
| US20200340995A1 (en) | A New Approach For Universal Monitoring Of Minimal Residual Disease In Acute Myeloid Leukemia | |
| WO2023102193A1 (fr) | Méthodes et compositions associées à un panel de gènes inflammatoires | |
| Pizzini et al. | An integrative approach for the identification of prognostic and predictive biomarkers in rectal cancer | |
| AU2014200767A1 (en) | Methods for identifying, diagnosing, and predicting survival of lymphomas |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C06 | Publication | ||
| PB01 | Publication | ||
| C10 | Entry into substantive examination | ||
| SE01 | Entry into force of request for substantive examination | ||
| REG | Reference to a national code |
Ref country code: HK Ref legal event code: DE Ref document number: 1128496 Country of ref document: HK |
|
| C14 | Grant of patent or utility model | ||
| GR01 | Patent grant | ||
| REG | Reference to a national code |
Ref country code: HK Ref legal event code: WD Ref document number: 1128496 Country of ref document: HK |
|
| CP01 | Change in the name or title of a patent holder | ||
| CP01 | Change in the name or title of a patent holder |
Address after: Dane Hess Holm Patentee after: Alaretti Treatment Co. Address before: Dane Hess Holm Patentee before: Oncology Venture APS Address after: Dane Hess Holm Patentee after: Oncology Venture APS Address before: Dane Hess Holm Patentee before: MEDICAL PROGNOSIS INSTITUTE A/S Address after: Dane Hess Holm Patentee after: Alaretti Therapeutics Europe Pte. Ltd. Address before: Dane Hess Holm Patentee before: Oncology Risk Product Development Co. |
|
| TR01 | Transfer of patent right | ||
| TR01 | Transfer of patent right |
Effective date of registration: 20221129 Address after: Dane Hess Holm Patentee after: Oncology Risk Product Development Co. Address before: Dane Hess Holm Patentee before: Alaretti Treatment Co. |