CH635839A5 - Verfahren zur herstellung von n-substituierten und quaternierten benzimidazolen und deren verwendung. - Google Patents
Verfahren zur herstellung von n-substituierten und quaternierten benzimidazolen und deren verwendung. Download PDFInfo
- Publication number
- CH635839A5 CH635839A5 CH886477A CH886477A CH635839A5 CH 635839 A5 CH635839 A5 CH 635839A5 CH 886477 A CH886477 A CH 886477A CH 886477 A CH886477 A CH 886477A CH 635839 A5 CH635839 A5 CH 635839A5
- Authority
- CH
- Switzerland
- Prior art keywords
- phenyl
- alkyl
- formula
- carbonyl
- conr6r7
- Prior art date
Links
- 150000001556 benzimidazoles Chemical class 0.000 title description 3
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 41
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 23
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- -1 hydroxy, cyano, phenyl Chemical group 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 230000003287 optical effect Effects 0.000 claims description 14
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 150000001450 anions Chemical class 0.000 claims description 10
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000000758 substrate Substances 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 2
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 2
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 claims description 2
- 125000005605 benzo group Chemical group 0.000 claims description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims 3
- 229910052760 oxygen Inorganic materials 0.000 claims 2
- 229910052717 sulfur Inorganic materials 0.000 claims 2
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 claims 1
- 239000004753 textile Substances 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000012265 solid product Substances 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 10
- 238000005956 quaternization reaction Methods 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 239000002168 alkylating agent Substances 0.000 description 5
- 229940100198 alkylating agent Drugs 0.000 description 5
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 5
- ZVFSYTFFWGYEMM-UHFFFAOYSA-N 2-(trichloromethyl)-1h-benzimidazole Chemical compound C1=CC=C2NC(C(Cl)(Cl)Cl)=NC2=C1 ZVFSYTFFWGYEMM-UHFFFAOYSA-N 0.000 description 4
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 4
- 229940073608 benzyl chloride Drugs 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- 229920002239 polyacrylonitrile Polymers 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- AOWNYDDZDLTCGB-UHFFFAOYSA-N 2-amino-5-methoxyphenol Chemical compound COC1=CC=C(N)C(O)=C1 AOWNYDDZDLTCGB-UHFFFAOYSA-N 0.000 description 3
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 238000005282 brightening Methods 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 3
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 3
- 239000002657 fibrous material Substances 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 2
- 229940008406 diethyl sulfate Drugs 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000000395 magnesium oxide Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 2
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 2
- 235000010262 sodium metabisulphite Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- ZPFAVCIQZKRBGF-UHFFFAOYSA-N 1,3,2-dioxathiolane 2,2-dioxide Chemical compound O=S1(=O)OCCO1 ZPFAVCIQZKRBGF-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- XBPPLECAZBTMMK-UHFFFAOYSA-N 2-chloro-n,n-dimethylacetamide Chemical compound CN(C)C(=O)CCl XBPPLECAZBTMMK-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- OBHJZKBAYGTBSQ-UHFFFAOYSA-N 5,6-dimethyl-2-(trichloromethyl)-1h-benzimidazole Chemical compound C1=C(C)C(C)=CC2=C1NC(C(Cl)(Cl)Cl)=N2 OBHJZKBAYGTBSQ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Substances [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- WQDUMFSSJAZKTM-UHFFFAOYSA-N sodium methoxide Substances [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/614—Optical bleaching or brightening in aqueous solvents
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB32457/76A GB1577127A (en) | 1976-08-04 | 1976-08-04 | Benzotriazole derivatives and their use as optical brightening agents |
| GB798277 | 1977-02-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH635839A5 true CH635839A5 (de) | 1983-04-29 |
Family
ID=26241794
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH886477A CH635839A5 (de) | 1976-08-04 | 1977-07-19 | Verfahren zur herstellung von n-substituierten und quaternierten benzimidazolen und deren verwendung. |
| CH161082A CH635340A5 (de) | 1976-08-04 | 1982-03-15 | Verfahren zur herstellung von benzimidazolverbindungen und deren verwendung. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH161082A CH635340A5 (de) | 1976-08-04 | 1982-03-15 | Verfahren zur herstellung von benzimidazolverbindungen und deren verwendung. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4429133A (OSRAM) |
| JP (1) | JPS5923348B2 (OSRAM) |
| BR (1) | BR7705126A (OSRAM) |
| CH (2) | CH635839A5 (OSRAM) |
| DE (1) | DE2733439A1 (OSRAM) |
| ES (1) | ES461285A1 (OSRAM) |
| FR (1) | FR2360592A1 (OSRAM) |
| HK (1) | HK60784A (OSRAM) |
| IT (1) | IT1079907B (OSRAM) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH645359A5 (de) | 1978-11-20 | 1984-09-28 | Ciba Geigy Ag | Lagerstabile, konzentrierte waessrige loesung von benzimidazolium-aufhellern. |
| DE2939916A1 (de) * | 1979-10-02 | 1981-04-23 | Hoechst Ag, 6000 Frankfurt | Quaternierte, verbrueckte benzimidazolyl-benzimidazole, verfahren zu deren herstellung und deren verwendung |
| CH645941A5 (de) * | 1980-02-05 | 1984-10-31 | Sandoz Ag | Stabile aufhellerloesungen und deren herstellung. |
| FR2524468B1 (fr) * | 1982-04-06 | 1985-10-18 | Sandoz Sa | Nouveaux derives condenses du thiophene, leur preparation et leur utilisation comme azurants optiques |
| DE19648010A1 (de) * | 1996-11-20 | 1998-05-28 | Haarmann & Reimer Gmbh | Verwendung von substituierten Benzazolen als UV-Absorber, neue Benzazole und Verfahren zu ihrer Herstellung |
| US6037473A (en) * | 1997-11-13 | 2000-03-14 | Haarmann & Reimer Gmbh | Use of substituted benzazoles as UV absorbers, new benzazoles and processes for their preparation |
| EP1455352A1 (en) * | 2003-03-05 | 2004-09-08 | Clariant International Ltd. | New dyes for optical data recording |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA578303A (en) | 1959-06-23 | Ackermann Franz | Process for the optical brightening of polyacrylonitrile fibers | |
| US2148920A (en) | 1936-02-28 | 1939-02-28 | Gen Aniline Works Inc | Process for producing compounds of the azole series |
| CH207178A (de) | 1938-11-30 | 1939-09-30 | Escher Wyss Maschf Ag | Vorrichtung zur hydraulischen Verstellung der Flügel von Propellern. |
| FR1228524A (OSRAM) * | 1958-05-23 | 1960-08-31 | ||
| DE1294818B (de) * | 1964-02-21 | 1969-05-08 | Herion Erich | Servosteuerung mit Sicherheitseinrichtung fuer mindestens einen Druckverbraucher, insbesondere Pressensteuerung |
| DE1469227A1 (de) * | 1964-12-31 | 1970-06-04 | Bayer Ag | Furanverbindungen |
| CH476148A (de) * | 1965-05-10 | 1969-07-31 | Ciba Geigy | Verwendung von neuen Benzoxazolyl-1,3,4-oxdiazol-Derivaten als optische Aufhellmittel für textile organische Materialien aus Polyestern |
| CH986369A4 (OSRAM) | 1969-06-27 | 1970-12-31 | ||
| US3767663A (en) | 1970-05-04 | 1973-10-23 | American Cyanamid Co | Bis oxazoles as brighteners for fibers and plastics |
| US3653943A (en) | 1970-05-04 | 1972-04-04 | American Cyanamid Co | Bis oxazoles as brighteners for fibers and plastics |
| CH1825170A4 (OSRAM) * | 1970-12-09 | 1973-04-30 | ||
| BE787580A (fr) | 1971-08-13 | 1973-02-14 | Hoechst Ag | Procede de preparation de derives du furanne |
| DE2204767A1 (de) * | 1972-02-02 | 1973-08-09 | Henkel & Cie Gmbh | Benzoxazol - 2 - yl - substituierte 1.3.4 - thia - und - oxadiazole |
| AU6004073A (en) | 1972-09-09 | 1975-03-06 | Basf Ag | Fluorescent benzofuran compounds |
| CH590965A5 (OSRAM) | 1973-12-19 | 1977-08-31 | Ciba Geigy Ag | |
| DE2436279A1 (de) * | 1974-07-27 | 1976-02-12 | Henkel & Cie Gmbh | Neue benzoxazol-2-yl-substituierte imidazoline und tetrahydropyrimidine, deren herstellung sowie diese enthaltende kosmetische praeparationen |
| CH598307A5 (OSRAM) | 1974-08-14 | 1978-04-28 | Ciba Geigy Ag | |
| FI66893C (fi) | 1975-06-30 | 1984-12-10 | Sandoz Ag | Saosom faergaemnen anvaendbara biskatjoniska azofoereningar forfarande foer deras framstaellning och deras anvaendning |
-
1977
- 1977-07-19 CH CH886477A patent/CH635839A5/de not_active IP Right Cessation
- 1977-07-25 DE DE19772733439 patent/DE2733439A1/de active Granted
- 1977-07-28 US US05/819,937 patent/US4429133A/en not_active Expired - Lifetime
- 1977-08-02 ES ES461285A patent/ES461285A1/es not_active Expired
- 1977-08-02 FR FR7723727A patent/FR2360592A1/fr active Granted
- 1977-08-02 IT IT50529/77A patent/IT1079907B/it active
- 1977-08-02 JP JP52092300A patent/JPS5923348B2/ja not_active Expired
- 1977-08-03 BR BR7705126A patent/BR7705126A/pt unknown
-
1982
- 1982-03-15 CH CH161082A patent/CH635340A5/de not_active IP Right Cessation
-
1984
- 1984-08-02 HK HK607/84A patent/HK60784A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5318629A (en) | 1978-02-21 |
| US4429133A (en) | 1984-01-31 |
| HK60784A (en) | 1984-08-10 |
| BR7705126A (pt) | 1978-06-06 |
| DE2733439C2 (OSRAM) | 1992-07-09 |
| JPS5923348B2 (ja) | 1984-06-01 |
| ES461285A1 (es) | 1978-12-01 |
| DE2733439A1 (de) | 1978-02-09 |
| FR2360592B1 (OSRAM) | 1981-11-06 |
| FR2360592A1 (fr) | 1978-03-03 |
| CH635340A5 (de) | 1983-03-31 |
| IT1079907B (it) | 1985-05-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1619428A1 (de) | Verwendung von quaternaeren Methinverbindungen zum Faerben von Textilgut aus Faeden oder Fasern aus hydrophoben Polymeren | |
| DE2248772C3 (de) | Pyrazolinverbindungen | |
| DE2902470A1 (de) | Cumarin-verbindungen | |
| CH635839A5 (de) | Verfahren zur herstellung von n-substituierten und quaternierten benzimidazolen und deren verwendung. | |
| CH628080A5 (de) | Verfahren zur herstellung von farbstoffen der cumarinreihe. | |
| DE2704825A1 (de) | Fluoreszenzfarbstoffe | |
| US4189589A (en) | Phenyl-benzimidazolyl-furanes | |
| US3158610A (en) | 2-styrylbenzoxazole brighteners | |
| DE2145019A1 (de) | 3-eckige klammer auf 3',4'-dichlor6'alkyl-phenyl eckige klammer zu - delta 2-pyrazolin-derivate, verfahren zu ihrer herstellung und ihre verwendung als optische aufheller | |
| US3644345A (en) | Benzoxazolyl-1 3 4-oxdiazole derivatives | |
| DE2749902A1 (de) | V-triazolyl- eckige klammer auf 4,5-d eckige klammer zu -pyrimidine | |
| EP0027897A1 (de) | Quaternierte, verbrückte Benzimidazolyl-benzimidazole, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1594824A1 (de) | Verwendung von neuen Stilbenyl-1,3,4-oxydiazol-Derivaten | |
| US4148782A (en) | Phosphonic acid derivatives as flameproofing agents | |
| EP0005465B1 (de) | Benzofuranyl-benzimidazole, Verfahren zu ihrer Herstellung sowie ihre Verwendung zum optischen Aufhellen von organischen Materialien | |
| US3598810A (en) | Fluorescent 1-(pyrazolinylphenylsulphonyl)-piperazines | |
| DE2608020A1 (de) | Naphthostyrilfarbstoffe | |
| US3141879A (en) | Chj-chz | |
| DE2159469B2 (de) | Quaternierte 2-(2-Benzofuranyl)-benzimidazole | |
| US3531478A (en) | Methine dyes containing an isoindolobenzimidazolium or a benzopyrroloperimidinium nucleus | |
| DE2217269A1 (de) | Pyrazolinverbindungen als optische Aufheller | |
| DE2147706A1 (de) | Verbindungen der naphthalimidreihe | |
| EP0050263B1 (de) | Kationische Farbstoffe, ihre Herstellung und Verwendung zum Färben kationisch färbbarer Fasern und Papier | |
| DE2029157C3 (de) | Verfahren zur Herstellung von halogenhaltigen v-Triazolverbindungen | |
| DE2055918A1 (de) | Sulfonsauregruppenfreie basische Chmo phthalonfarbstoffe, ihre Herstellung und Verwendung » |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |