CH624251A5 - - Google Patents
Download PDFInfo
- Publication number
- CH624251A5 CH624251A5 CH1303677A CH1303677A CH624251A5 CH 624251 A5 CH624251 A5 CH 624251A5 CH 1303677 A CH1303677 A CH 1303677A CH 1303677 A CH1303677 A CH 1303677A CH 624251 A5 CH624251 A5 CH 624251A5
- Authority
- CH
- Switzerland
- Prior art keywords
- flip
- gate
- signal
- input
- data
- Prior art date
Links
- 230000006870 function Effects 0.000 claims description 24
- 230000008859 change Effects 0.000 claims description 8
- 230000008878 coupling Effects 0.000 claims description 7
- 238000010168 coupling process Methods 0.000 claims description 7
- 238000005859 coupling reaction Methods 0.000 claims description 7
- 230000004044 response Effects 0.000 claims description 6
- 230000010355 oscillation Effects 0.000 claims description 5
- 230000007704 transition Effects 0.000 claims description 2
- 241000272186 Falco columbarius Species 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000003086 colorant Substances 0.000 claims 1
- 238000001514 detection method Methods 0.000 claims 1
- 230000005284 excitation Effects 0.000 claims 1
- 238000003786 synthesis reaction Methods 0.000 claims 1
- 230000002194 synthesizing effect Effects 0.000 claims 1
- 230000005540 biological transmission Effects 0.000 description 18
- 239000003990 capacitor Substances 0.000 description 14
- 238000010586 diagram Methods 0.000 description 13
- 101100481019 Nicotiana tabacum TGA1A gene Proteins 0.000 description 10
- 101150092207 TGA1 gene Proteins 0.000 description 10
- 230000011664 signaling Effects 0.000 description 6
- 101150108864 Ffar1 gene Proteins 0.000 description 4
- 101100264077 Xenopus laevis wrn gene Proteins 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- TVZRAEYQIKYCPH-UHFFFAOYSA-N 3-(trimethylsilyl)propane-1-sulfonic acid Chemical compound C[Si](C)(C)CCCS(O)(=O)=O TVZRAEYQIKYCPH-UHFFFAOYSA-N 0.000 description 2
- 101100420776 Arabidopsis thaliana SYN1 gene Proteins 0.000 description 2
- VUDQSRFCCHQIIU-UHFFFAOYSA-N DIF1 Natural products CCCCCC(=O)C1=C(O)C(Cl)=C(OC)C(Cl)=C1O VUDQSRFCCHQIIU-UHFFFAOYSA-N 0.000 description 2
- 101150001108 DIF1 gene Proteins 0.000 description 2
- 101100396286 Homo sapiens IER3 gene Proteins 0.000 description 2
- 101100491257 Oryza sativa subsp. japonica AP2-1 gene Proteins 0.000 description 2
- 101150033582 RSR1 gene Proteins 0.000 description 2
- 102100036900 Radiation-inducible immediate-early gene IEX-1 Human genes 0.000 description 2
- 230000027455 binding Effects 0.000 description 2
- 238000009739 binding Methods 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 238000005070 sampling Methods 0.000 description 2
- 101100091496 Oryza sativa subsp. japonica ROS1A gene Proteins 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000009131 signaling function Effects 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04M—TELEPHONIC COMMUNICATION
- H04M9/00—Arrangements for interconnection not involving centralised switching
- H04M9/002—Arrangements for interconnection not involving centralised switching with subscriber controlled access to a line, i.e. key telephone systems
- H04M9/005—Arrangements for interconnection not involving centralised switching with subscriber controlled access to a line, i.e. key telephone systems with subscriber controlled access to an exchange line
- H04M9/007—Arrangements for interconnection not involving centralised switching with subscriber controlled access to a line, i.e. key telephone systems with subscriber controlled access to an exchange line wherein the key telephone sets are star-connected to a central unit by a limited number of lines
Landscapes
- Engineering & Computer Science (AREA)
- Signal Processing (AREA)
- Sub-Exchange Stations And Push- Button Telephones (AREA)
- Interface Circuits In Exchanges (AREA)
- Telephonic Communication Services (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/735,991 US4046972A (en) | 1976-10-27 | 1976-10-27 | Key telephone station set circuit |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH624251A5 true CH624251A5 (enExample) | 1981-07-15 |
Family
ID=24958034
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1303677A CH624251A5 (enExample) | 1976-10-27 | 1977-10-26 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4046972A (enExample) |
| JP (1) | JPS5354402A (enExample) |
| BE (1) | BE860182A (enExample) |
| CA (1) | CA1096521A (enExample) |
| CH (1) | CH624251A5 (enExample) |
| DE (1) | DE2747854C2 (enExample) |
| GB (1) | GB1534459A (enExample) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4184054A (en) * | 1977-03-28 | 1980-01-15 | Tokyo Shibaura Electric Co., Ltd. | Key telephone system |
| US4173714A (en) * | 1977-06-03 | 1979-11-06 | Tie/Communications, Inc. | Communication circuit with combined power feed and data transmission over a phantom channel |
| US4150259A (en) * | 1977-10-31 | 1979-04-17 | Bell Telephone Laboratories, Incorporated | Communication system conferencing arrangement |
| US4109113A (en) * | 1977-10-31 | 1978-08-22 | Bell Telephone Laboratories, Incorporated | Communication system optimized pooled line arrangement |
| US4125748A (en) * | 1977-10-31 | 1978-11-14 | Bell Telephone Laboratories, Incorporated | Communication system call transfer arrangement |
| US4150257A (en) * | 1977-10-31 | 1979-04-17 | Bell Telephone Laboratories, Incorporated | Communication system call coverage arrangements |
| US4166199A (en) * | 1977-11-25 | 1979-08-28 | Stromberg-Carlson Corporation | Attendant console complex |
| US4203011A (en) * | 1978-01-17 | 1980-05-13 | Tie/Communications, Inc. | Computer controlled key telephone station set |
| US4229815A (en) * | 1978-11-20 | 1980-10-21 | Bell Telephone Laboratories, Incorporated | Full duplex bit synchronous data rate buffer |
| US4220827A (en) * | 1979-02-21 | 1980-09-02 | Bell Telephone Laboratories, Incorporated | Telephone signaling circuit |
| US4216356A (en) * | 1979-02-21 | 1980-08-05 | Bell Telephone Laboratories, Incorporated | Telephone having separate voice and signaling pairs |
| US4291199A (en) * | 1979-03-28 | 1981-09-22 | Bell Telephone Laboratories, Incorporated | Communication system tracking arrangement |
| US4292474A (en) * | 1979-08-13 | 1981-09-29 | Oki Electronics Of America, Inc. | Electronic key telephone system with bi-directional serial data stream station control |
| US4309755A (en) * | 1979-08-22 | 1982-01-05 | Bell Telephone Laboratories, Incorporated | Computer input/output arrangement for enabling a simultaneous read/write data transfer |
| US4382163A (en) * | 1979-10-03 | 1983-05-03 | Gte Automatic Electric Labs Inc. | Microcomputer controlled key telephone line circuit |
| DE2949499C2 (de) * | 1979-12-08 | 1982-06-03 | Krone Gmbh, 1000 Berlin | Anzeigeeinrichtung für Symbole der Fernsprechtechnik |
| FR2481031B1 (fr) * | 1980-04-22 | 1988-06-10 | Telephonie Ind Commerciale | Terminal d'intercommunication universel |
| US4315110A (en) * | 1980-04-28 | 1982-02-09 | International Telephone And Telegraph Corporation | Multiple line telephone instrument |
| US4296282A (en) * | 1980-06-30 | 1981-10-20 | Bell Telephone Laboratories, Incorporated | Incoming call identification arrangement |
| JPS5721150A (en) * | 1980-07-14 | 1982-02-03 | Fujitsu Ltd | Extension callout system |
| DE3036182C2 (de) * | 1980-09-25 | 1983-12-01 | Siemens AG, 1000 Berlin und 8000 München | Verfahren zur wechselseitigen Übertragung von binären Digitalsignalen zwischen einer zentralen Einrichtung und mit ihr verbundenen Fernsprechteilnehmerstellen |
| US4374308A (en) * | 1981-04-30 | 1983-02-15 | Siemens Corporation | I-Use indication in a telephone keyset |
| USD275195S (en) | 1981-07-30 | 1984-08-21 | Telecommunications Radioelectriques & Telephoniques | Telephone |
| DE3131360A1 (de) * | 1981-08-07 | 1983-04-28 | Siemens AG, 1000 Berlin und 8000 München | Schaltungsanordnung fuer kleine nebenstellenanlagen mit einer den teilnehmerstellen gemeinsamen und mit hilfe einer steuerrechnereinheit vermittlungsvorgaenge abwickelnden einrichtung |
| DE3131298A1 (de) * | 1981-08-07 | 1983-02-24 | Siemens AG, 1000 Berlin und 8000 München | Schaltungsanordnung fuer kleine nebenstellenanlagen mit einer den teilnehmerstellen gemeinsamen und mit hilfe einer steuerrechnereinheit vermittlungsvorgaenge abwickelnden einrichtung |
| DE3131343A1 (de) * | 1981-08-07 | 1983-03-03 | Siemens AG, 1000 Berlin und 8000 München | Schaltungsanordnung fuer kleine nebenstellenanlagen mit einer den teilnehmerstellen gemeinsamen u. mit hilfe einer steuerrechnereinheit vermittlungsvorgaenge abwickelnden einrichtung |
| DE3132971A1 (de) * | 1981-08-20 | 1983-03-03 | Siemens AG, 1000 Berlin und 8000 München | Schaltungsanordnung fuer fernsprechvermittlungsanlagen, insbesondere kleine nebenstellenanlagen, bei denen zwischen den teilnehmerstellen und einer ihnen gemeinsamen einrichtung eine signalisierung vorgenommen wird |
| USD286042S (en) | 1981-11-07 | 1986-10-07 | Tokyo Shibaura Denki Kabushiki Kaisha | Telephone |
| JPS58195393A (ja) * | 1982-05-10 | 1983-11-14 | Nec Corp | ボタン電話装置 |
| US4449017A (en) * | 1982-05-28 | 1984-05-15 | Bell Telephone Laboratories, Incorporated | ACD Combined handset and headset arrangement |
| US4451705A (en) * | 1982-05-28 | 1984-05-29 | Bell Telephone Laboratories, Incorporated | Call completion circuit and method |
| USD288810S (en) | 1982-10-04 | 1987-03-17 | KabushikiKaisha Taikodenki Seisakusho | Telephone |
| CA1188831A (en) * | 1982-12-14 | 1985-06-11 | Mitel Corporation | Telephone indicator |
| JPS59160397A (ja) * | 1983-03-03 | 1984-09-11 | Toshiba Corp | ボタン電話装置におけるボタン電話機の機能割当て方式 |
| USD282258S (en) | 1983-07-18 | 1986-01-21 | Tie/Communications, Inc. | Base for a telephone set |
| USD282168S (en) | 1983-07-18 | 1986-01-14 | Tie/Communications, Inc. | Base for a telephone set |
| USD282167S (en) | 1983-07-18 | 1986-01-14 | Tie/Communications, Inc. | Base for a telephone set |
| GB8413208D0 (en) * | 1984-05-23 | 1984-06-27 | Plessey Co Plc | Telecommunication systems |
| US4644106A (en) * | 1985-01-10 | 1987-02-17 | Inventa Electronics Co., Ltd. | Apparatus for timely controlling the sound characteristic of a signaling means of a voice communication device |
| JPS61212990A (ja) * | 1985-03-18 | 1986-09-20 | Nitsuko Ltd | 内線電話機呼出方式 |
| EP0195635B1 (en) * | 1985-03-20 | 1993-05-26 | Nec Corporation | Key telephone system |
| USD300931S (en) | 1985-08-26 | 1989-05-02 | Stierwalt Harry M | Face panel for a telephone stand |
| USD293441S (en) | 1986-06-19 | 1987-12-29 | American Telephone And Telegraph Company | Telephone stand |
| USD293321S (en) | 1986-06-19 | 1987-12-22 | American Telephone & Telegraph Company, At&T Information Systems Inc. | Telephone stand |
| US4800438A (en) * | 1987-12-08 | 1989-01-24 | Yuter Seymour C | Telephone console for restaurant tables |
| USD320797S (en) | 1989-07-13 | 1991-10-15 | Meisei Electric Co., Ltd. | Telephone instrument set |
| USD318661S (en) | 1990-07-16 | 1991-07-30 | International Telecommunication Corp. | Telephone base |
| USD326263S (en) | 1990-07-16 | 1992-05-19 | International Telecommunication Corp. | Telephone base with display |
| USD328295S (en) | 1991-05-23 | 1992-07-28 | Northern Telecom Limited | Base for a telephone set |
| USD330028S (en) | 1991-05-23 | 1992-10-06 | Northern Telecom Limited | Base for a telephone set |
| WO1998056155A1 (en) * | 1997-06-05 | 1998-12-10 | Noach Uziel Malimovka | System and method to set up a communication based on identification cards |
| WO1999053627A1 (en) | 1998-04-10 | 1999-10-21 | Chrimar Systems, Inc. Doing Business As Cms Technologies | System for communicating with electronic equipment on a network |
| USD452489S1 (en) | 2000-12-20 | 2001-12-25 | Kabushiki Kaisha Toshiba | Telephone |
| USD552589S1 (en) * | 2005-10-28 | 2007-10-09 | Kabushiki Kaisha Toshiba | Telephone set |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3146314A (en) * | 1961-09-25 | 1964-08-25 | Gen Dynamics Corp | Means for generating warbling tone ringing signals in a time division multiplex communication system |
| US3385935A (en) * | 1964-10-19 | 1968-05-28 | Bell Telephone Labor Inc | Key telephone system |
| US3519757A (en) * | 1968-02-27 | 1970-07-07 | Bell Telephone Labor Inc | Electronic key telephone system |
| US3763326A (en) * | 1972-05-22 | 1973-10-02 | Bell Canada Northern Electric | Telephone audio signalling arrangement |
| CA1018270A (en) * | 1972-05-23 | 1977-09-27 | Federico R. Laliccia | Key telephone system using time division and space division control |
| US3843845A (en) * | 1972-09-11 | 1974-10-22 | Northern Electric Co | Electronic key telephone system |
| US3906168A (en) * | 1973-12-12 | 1975-09-16 | Bell Telephone Labor Inc | Visual status indicator circuit |
| US3973085A (en) * | 1974-09-26 | 1976-08-03 | The Anaconda Company | Key telephone system with directly associated station cards and sets |
| US3991282A (en) * | 1974-12-27 | 1976-11-09 | Feil Thomas E | Multi station telephone switching system |
| US3946146A (en) * | 1975-01-17 | 1976-03-23 | Gte Automatic Electric Laboratories Incorporated | Discrete ringing detector for use in key telephone systems |
-
1976
- 1976-10-27 US US05/735,991 patent/US4046972A/en not_active Expired - Lifetime
-
1977
- 1977-10-25 CA CA289,404A patent/CA1096521A/en not_active Expired
- 1977-10-26 GB GB44521/77A patent/GB1534459A/en not_active Expired
- 1977-10-26 DE DE2747854A patent/DE2747854C2/de not_active Expired
- 1977-10-26 CH CH1303677A patent/CH624251A5/de not_active IP Right Cessation
- 1977-10-27 JP JP12821877A patent/JPS5354402A/ja active Granted
- 1977-10-27 BE BE182121A patent/BE860182A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2747854A1 (de) | 1978-05-03 |
| GB1534459A (en) | 1978-12-06 |
| JPS5354402A (en) | 1978-05-17 |
| DE2747854C2 (de) | 1986-01-30 |
| CA1096521A (en) | 1981-02-24 |
| US4046972A (en) | 1977-09-06 |
| BE860182A (fr) | 1978-02-15 |
| JPS6160640B2 (enExample) | 1986-12-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH624251A5 (enExample) | ||
| DE1283918B (de) | Schaltungsanordnung mit einer Vielzahl von Teilnehmerleitungsschaltungen, Registerschaltungen und einer gemeinsamen Steueranordnung fuer Fernmelde-, insbesondere Fernsprechvermittlungsanlagen | |
| DE2857137C1 (de) | Anrufumlegeanordnung fuer eine Nachrichtenanlage | |
| DE2036815C3 (de) | Schaltungsanordnung für eine Nebenstellenanlage mit einer beschränkten Anzahl von Nebenstellen | |
| DE2709641B2 (de) | Vermittlungssystem | |
| DE1226163B (de) | Elektronische Fernsprechvermittlungsanlage | |
| DE2513695C2 (de) | Schaltungsanordnung für eine Tastenfernsprechanlage | |
| DE1215217B (de) | Schaltungsanordnung fuer Nachrichten-vermittlungsanlagen mit Haupt- und Unteraemtern | |
| DE1275152B (de) | Schaltungsanordnung zum Anlegen von Vermittlungssignalen an eine Zeitmultiplexleitung in Fernmeldeanlagen | |
| DE2753776C2 (de) | Schaltungsanordnung für eine Fernsprechvermittlunganlage mit Registern für Mehrfrequenzcode-Signalgebung | |
| EP0477627B1 (de) | Verfahren zum Verbinden von Kommunikationsendgeräten in diensteintegrierenden Kommunikationsnetzen | |
| DE4124977C1 (enExample) | ||
| DE1269672B (de) | Schaltungsanordnung fuer eine Fernsprechvermittlungsanlage mit Sonderbedienungs-Teilnehmerleitungen, deren Teilnehmerstellen bei einem von einem weiteren Teilnehmer ankommenden Anruf waehrend einer bestehenden Verbindung ein Anruf-wartet-Signal erhalten | |
| DE1462399B2 (de) | Schaltungsanordnung fuer fernsprechanlagen insbesondere fernsprechnebenstellenanlagen oder linienwaehleranlagen | |
| DE1512062A1 (de) | Nachrichtenuebertragungssystem | |
| DE2458298A1 (de) | Fernsprechteilnehmerstelle | |
| DE2122737A1 (de) | Leitungszustandssteuerung für ein elektronisches Tastentelefonsystem | |
| DE3014420C2 (de) | Schaltungsanordnung zur Erzeugung eines akustischen Signals an Teilnehmerstellen in Fernsprech-, insbesondere Fernsprechnebenstellenanlagen | |
| DE2604069C2 (enExample) | ||
| DE1257866B (de) | Schaltungsanordnung fuer selbsttaetige Fernmeldevermittlungsanlagen zum Suchen, Auswaehlen, Herstellen und Halten von Verbindungswegen | |
| EP0352735B1 (de) | Verfahren zur Durchführung einer leistungsmerkmalsspezifischen Steuerprozedur in einem rechnergesteuerten Kommmunikationssystem insbesondere einem Key-Kommunikationssystem, mit der Möglichkeit des sogenannten "Anklopfens" | |
| DE947247C (de) | Stromstosssender fuer Teilnehmerstellen in Fernmelde-, insbesondere Fernsprechanlagen zur Auswahl einer beschraenkten Zahl von mehrstelligen Rufnummern | |
| DE2341971B2 (de) | Einrichtung zur nachrichtenuebermittlung zwischen einer personenrufanlage und einer drahtgebundenen sprechanlage | |
| DE2732532C2 (de) | Fernsprechapparateschaltung für einfach und zweifach genutzte Teilnehmeranschlußleitungen | |
| EP0749654A1 (de) | Kompakt-fernsprechendgerät |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |