CH621780A5 - - Google Patents
Download PDFInfo
- Publication number
- CH621780A5 CH621780A5 CH1019375A CH1019375A CH621780A5 CH 621780 A5 CH621780 A5 CH 621780A5 CH 1019375 A CH1019375 A CH 1019375A CH 1019375 A CH1019375 A CH 1019375A CH 621780 A5 CH621780 A5 CH 621780A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- diphenyloxazol
- thiol
- pharmaceutically acceptable
- amino
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 32
- 238000000034 method Methods 0.000 claims description 27
- 150000003839 salts Chemical class 0.000 claims description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- -1 heterocyclic amino Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 6
- BNQUKRAPHUREMZ-UHFFFAOYSA-O OC=[S+]C1=NC(C2=CC=CC=C2)=C(C2=CC=CC=C2)O1 Chemical class OC=[S+]C1=NC(C2=CC=CC=C2)=C(C2=CC=CC=C2)O1 BNQUKRAPHUREMZ-UHFFFAOYSA-O 0.000 claims description 5
- 150000001447 alkali salts Chemical class 0.000 claims description 5
- 125000003282 alkyl amino group Chemical group 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000006413 ring segment Chemical group 0.000 claims description 3
- 125000003418 alkyl amino alkoxy group Chemical group 0.000 claims description 2
- 125000002431 aminoalkoxy group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 150000003566 thiocarboxylic acids Chemical class 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 239000000243 solution Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- STVVIBPFTMJJIZ-UHFFFAOYSA-N 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetic acid Chemical compound O1C(SCC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 STVVIBPFTMJJIZ-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 6
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical class CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 5
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical class CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 5
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 150000003573 thiols Chemical class 0.000 description 4
- QEYMMOKECZBKAC-UHFFFAOYSA-N 3-chloropropanoic acid Chemical compound OC(=O)CCCl QEYMMOKECZBKAC-UHFFFAOYSA-N 0.000 description 3
- NYQSTRUSYDZNHC-UHFFFAOYSA-N 4,5-diphenyl-3h-1,3-oxazole-2-thione Chemical compound O1C(S)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 NYQSTRUSYDZNHC-UHFFFAOYSA-N 0.000 description 3
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 3
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 102000008186 Collagen Human genes 0.000 description 3
- 108010035532 Collagen Proteins 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229920001436 collagen Polymers 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- HSUCJZWQZLSLMR-UHFFFAOYSA-N 2-morpholin-4-ylethyl 2-chloroacetate;hydrochloride Chemical compound Cl.ClCC(=O)OCCN1CCOCC1 HSUCJZWQZLSLMR-UHFFFAOYSA-N 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- ABJSOROVZZKJGI-OCYUSGCXSA-N (1r,2r,4r)-2-(4-bromophenyl)-n-[(4-chlorophenyl)-(2-fluoropyridin-4-yl)methyl]-4-morpholin-4-ylcyclohexane-1-carboxamide Chemical compound C1=NC(F)=CC(C(NC(=O)[C@H]2[C@@H](C[C@@H](CC2)N2CCOCC2)C=2C=CC(Br)=CC=2)C=2C=CC(Cl)=CC=2)=C1 ABJSOROVZZKJGI-OCYUSGCXSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- KKFDCBRMNNSAAW-UHFFFAOYSA-N 2-(morpholin-4-yl)ethanol Chemical compound OCCN1CCOCC1 KKFDCBRMNNSAAW-UHFFFAOYSA-N 0.000 description 1
- MDLNHSYXCATEOV-UHFFFAOYSA-N 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]propanoic acid Chemical compound O1C(SC(C)C(O)=O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 MDLNHSYXCATEOV-UHFFFAOYSA-N 0.000 description 1
- PWIGIOHIMSKJFG-UHFFFAOYSA-N 2-morpholin-4-ylethyl 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetate Chemical compound C1COCCN1CCOC(=O)CSC(O1)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 PWIGIOHIMSKJFG-UHFFFAOYSA-N 0.000 description 1
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 1
- JQDXZJYAUSVHDH-UHFFFAOYSA-N 3-chloropropanamide Chemical compound NC(=O)CCCl JQDXZJYAUSVHDH-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- LPFNYZLGCZCARW-UHFFFAOYSA-N ethyl 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetate Chemical compound O1C(SCC(=O)OCC)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 LPFNYZLGCZCARW-UHFFFAOYSA-N 0.000 description 1
- VYGYKYFGCVRZGN-UHFFFAOYSA-N ethyl 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]propanoate Chemical compound O1C(SC(C)C(=O)OCC)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 VYGYKYFGCVRZGN-UHFFFAOYSA-N 0.000 description 1
- FQTIYMRSUOADDK-UHFFFAOYSA-N ethyl 3-bromopropanoate Chemical compound CCOC(=O)CCBr FQTIYMRSUOADDK-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- CWERGRDVMFNCDR-UHFFFAOYSA-M thioglycolate(1-) Chemical compound [O-]C(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-M 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/46—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB34673/74A GB1507032A (en) | 1974-08-06 | 1974-08-06 | 2-thiol-4,5-diphenyloxazole s-derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH621780A5 true CH621780A5 (enExample) | 1981-02-27 |
Family
ID=10368553
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1019375A CH621780A5 (enExample) | 1974-08-06 | 1975-08-05 |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4001228A (enExample) |
| JP (1) | JPS5143756A (enExample) |
| AR (1) | AR205653A1 (enExample) |
| AT (1) | AT348518B (enExample) |
| BE (1) | BE832188A (enExample) |
| CA (1) | CA1036599A (enExample) |
| CH (1) | CH621780A5 (enExample) |
| DE (1) | DE2535147A1 (enExample) |
| DK (1) | DK356375A (enExample) |
| ES (1) | ES439909A1 (enExample) |
| FR (1) | FR2281115A1 (enExample) |
| GB (1) | GB1507032A (enExample) |
| IL (1) | IL47878A (enExample) |
| NL (1) | NL7509013A (enExample) |
| NO (1) | NO752752L (enExample) |
| SE (1) | SE7508724L (enExample) |
| ZA (1) | ZA754630B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1099996B (it) * | 1978-10-17 | 1985-09-28 | Anic Spa | Derivati del 4,5-difenil-ossazolo 2-ammino o 2-tio sostituiti e procedimento per il loro ottenimento |
| DE2946524A1 (de) * | 1979-11-17 | 1981-06-11 | Bayer Ag, 5090 Leverkusen | Azolyloxy-carbonsaeure-n-oxy-amide, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| IL90192A0 (en) * | 1988-05-13 | 1989-12-15 | Schering Ag | Azole ether derivatives and pesticidal compositions containing the same |
| NZ236474A (en) * | 1989-12-20 | 1993-07-27 | Bristol Myers Squibb Co | 4,5-diphenyl-2-oxazole octanoic, nonanoic and decanoic acid and ester derivatives, preparation and pharmaceutical compositions thereof |
| US5380738A (en) * | 1993-05-21 | 1995-01-10 | Monsanto Company | 2-substituted oxazoles further substituted by 4-fluorophenyl and 4-methylsulfonylphenyl as antiinflammatory agents |
| FR2753449B1 (fr) * | 1996-09-13 | 1998-12-04 | Union Pharma Scient Appl | Nouveaux derives 3,4-diaryloxazolone, leurs procedes de preparation, et leurs utilisations en therapeutique |
| CZ2001965A3 (cs) | 1998-09-17 | 2002-02-13 | Bristol-Myers Squibb Company | Lék pro oąetřování atherosklerózy nebo diabetes typu II, farmaceutická kombinace a její pouľití |
| US7358254B2 (en) | 2001-07-13 | 2008-04-15 | Bristol-Myers Squibb Company | Method for treating atherosclerosis employing an aP2 inhibitor and combination |
| US7390824B1 (en) | 1999-09-07 | 2008-06-24 | Bristol-Myers Squibb Company | Method for treating diabetes employing an aP2 inhibitor and combination |
| WO2023143741A1 (de) * | 2022-01-28 | 2023-08-03 | Symrise Ag | Neue kühlstoffe und zubereitungen, die diese enthalten |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2129012A1 (de) * | 1971-06-11 | 1973-01-04 | Merck Patent Gmbh | Azol-derivate |
| FR2156486A1 (en) * | 1971-10-22 | 1973-06-01 | Roussel Uclaf | Oxazolyl oxy or thio acetic acids - analgesics antipyretics and anti-inflammatories |
-
1974
- 1974-08-06 GB GB34673/74A patent/GB1507032A/en not_active Expired
-
1975
- 1975-01-01 AR AR259879A patent/AR205653A1/es active
- 1975-07-18 ZA ZA00754630A patent/ZA754630B/xx unknown
- 1975-07-23 US US05/598,186 patent/US4001228A/en not_active Expired - Lifetime
- 1975-07-24 AT AT575475A patent/AT348518B/de not_active IP Right Cessation
- 1975-07-29 NL NL7509013A patent/NL7509013A/xx not_active Application Discontinuation
- 1975-07-29 CA CA232,493A patent/CA1036599A/en not_active Expired
- 1975-07-31 ES ES439909A patent/ES439909A1/es not_active Expired
- 1975-08-01 SE SE7508724A patent/SE7508724L/xx unknown
- 1975-08-05 FR FR7524383A patent/FR2281115A1/fr active Granted
- 1975-08-05 CH CH1019375A patent/CH621780A5/de not_active IP Right Cessation
- 1975-08-05 NO NO752752A patent/NO752752L/no unknown
- 1975-08-05 IL IL7547878A patent/IL47878A/xx unknown
- 1975-08-05 DK DK356375A patent/DK356375A/da unknown
- 1975-08-06 JP JP50095094A patent/JPS5143756A/ja active Pending
- 1975-08-06 BE BE158995A patent/BE832188A/xx not_active IP Right Cessation
- 1975-08-06 DE DE19752535147 patent/DE2535147A1/de not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| DE2535147A1 (de) | 1976-02-19 |
| US4001228A (en) | 1977-01-04 |
| GB1507032A (en) | 1978-04-12 |
| BE832188A (fr) | 1975-12-01 |
| ZA754630B (en) | 1976-07-28 |
| AU8367075A (en) | 1977-02-10 |
| NL7509013A (nl) | 1976-02-10 |
| NO752752L (enExample) | 1976-02-09 |
| FR2281115B1 (enExample) | 1978-11-10 |
| AT348518B (de) | 1979-02-26 |
| SE7508724L (sv) | 1976-02-09 |
| AR205653A1 (es) | 1976-05-21 |
| ATA575475A (de) | 1978-07-15 |
| FR2281115A1 (fr) | 1976-03-05 |
| IL47878A (en) | 1979-01-31 |
| DK356375A (da) | 1976-02-07 |
| IL47878A0 (en) | 1975-11-25 |
| CA1036599A (en) | 1978-08-15 |
| ES439909A1 (es) | 1977-08-16 |
| JPS5143756A (en) | 1976-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69409525T2 (de) | Acetamidderivate und ihre verwendung als modifizierungsmittel des verhaltens der verdauung | |
| DE2714263A1 (de) | Pharmazeutische zubereitungen, enthaltend triazolopyrimidine | |
| DD129442B3 (de) | Verfahren zur herstellung von captopril und vertraeglichen salzen | |
| DD235450B1 (de) | Verfahren zur herstellung neuer 1-(2-hydroxyaryl)-alkan-1-on-oxime | |
| CH621780A5 (enExample) | ||
| DE2704989A1 (de) | Arzneimittel, in diesen enthaltene neue verbindungen und verfahren zu ihrer herstellung | |
| DE69708130T2 (de) | A-oxo-butansäuren enthaltende pharmazeutische zusammensetzung | |
| CH631172A5 (de) | Verfahren zur herstellung von neuen 1,2-benzisothiazolinonen-3. | |
| DE2938571C2 (enExample) | ||
| DE2307828A1 (de) | (4-benzothiazolyl)-phenylessigsaeuren | |
| DE2818879A1 (de) | Neue cyclohexancarbonsaeure und deren derivate | |
| DE2557145C3 (de) | Tyrosinderivate, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE2535599A1 (de) | Substituierte zimtsaeureamide, verfahren zu ihrer herstellung und diese verbindungen enthaltende zubereitungen | |
| DE2318784A1 (de) | N-(2,4-dihydroxybenzoyl)-4-aminosalizylsaeure | |
| DD150060A5 (de) | Verfahren zur herstellung von neuen phenthiazin-derivaten | |
| DE69623656T2 (de) | Trans apovincaminsäure-esterderivate als arzneimittel | |
| DE1620747C3 (de) | Carbothiamin sowie dessen nichttoxische organische oder anorganische Säureadditionssalze sowie Verfahren zur Herstellung dieser Verbindungen | |
| DE2440381A1 (de) | Substituierte phenoxyalkancarbonsaeuren, salze hiervon sowie verfahren zu ihrer herstellung | |
| EP0007347B1 (de) | Lipidsenkende Alkylenglykolderivate und Verfahren zu ihrer Herstellung | |
| DE2711149B2 (enExample) | ||
| DE3586150T2 (de) | Amidderivate der 2-(p-aminobenzyl)-buttersaeure und ihrer ester mit blutfettgehaltsenkender wirkung. | |
| DE1801312A1 (de) | Verfahren zur Herstellung einer neuen Aryloxyalkansaeure und ihrer Salze | |
| DE2559928C2 (de) | N-Aroyl-L-phenylalanyl-L-tyrosine, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0371342A1 (de) | 2-Halogensubstituierte N-Indolylethyl-sulfonsäureamide, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| AT362353B (de) | Verfahren zur herstellung von neuen in 4- -stellung substituierten 3-sulfamoyl-5-pyrrolyl - oder -5-pyrrolylalkylbenzoesaeuren und ihren salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |