CA1036599A - 2-thiol-4,5-diphenyloxazole s-derivatives - Google Patents
2-thiol-4,5-diphenyloxazole s-derivativesInfo
- Publication number
- CA1036599A CA1036599A CA232,493A CA232493A CA1036599A CA 1036599 A CA1036599 A CA 1036599A CA 232493 A CA232493 A CA 232493A CA 1036599 A CA1036599 A CA 1036599A
- Authority
- CA
- Canada
- Prior art keywords
- diphenyloxazole
- thiol
- amino
- formula
- diphenyloxazol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 claims abstract description 20
- 150000003839 salts Chemical class 0.000 claims abstract description 15
- -1 heterocyclic amino Chemical group 0.000 claims abstract description 12
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 125000002431 aminoalkoxy group Chemical group 0.000 claims abstract description 5
- 125000003418 alkyl amino alkoxy group Chemical group 0.000 claims abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 4
- 238000004519 manufacturing process Methods 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 239000012429 reaction media Substances 0.000 claims description 2
- 239000002585 base Substances 0.000 claims 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 abstract description 6
- 239000008280 blood Substances 0.000 abstract description 3
- 210000004369 blood Anatomy 0.000 abstract description 3
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 3
- 230000002401 inhibitory effect Effects 0.000 abstract description 2
- 125000000033 alkoxyamino group Chemical group 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 239000000047 product Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 239000012153 distilled water Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical class CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- STVVIBPFTMJJIZ-UHFFFAOYSA-N 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetic acid Chemical compound O1C(SCC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 STVVIBPFTMJJIZ-UHFFFAOYSA-N 0.000 description 5
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical class CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 102000008186 Collagen Human genes 0.000 description 4
- 108010035532 Collagen Proteins 0.000 description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 4
- 229920001436 collagen Polymers 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 150000003573 thiols Chemical class 0.000 description 4
- KKFDCBRMNNSAAW-UHFFFAOYSA-N 2-(morpholin-4-yl)ethanol Chemical compound OCCN1CCOCC1 KKFDCBRMNNSAAW-UHFFFAOYSA-N 0.000 description 3
- PAVIHTWMLRILFC-UHFFFAOYSA-N 2-chloro-4,5-diphenyl-1,3-oxazole Chemical compound O1C(Cl)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 PAVIHTWMLRILFC-UHFFFAOYSA-N 0.000 description 3
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 229960001138 acetylsalicylic acid Drugs 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 2
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- HSUCJZWQZLSLMR-UHFFFAOYSA-N 2-morpholin-4-ylethyl 2-chloroacetate;hydrochloride Chemical compound Cl.ClCC(=O)OCCN1CCOCC1 HSUCJZWQZLSLMR-UHFFFAOYSA-N 0.000 description 2
- NYQSTRUSYDZNHC-UHFFFAOYSA-N 4,5-diphenyl-3h-1,3-oxazole-2-thione Chemical compound O1C(S)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 NYQSTRUSYDZNHC-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 241001061127 Thione Species 0.000 description 2
- 230000004931 aggregating effect Effects 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical class C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- KPJPHPFMCOKUMW-UHFFFAOYSA-N iodomethane Chemical compound I[CH2] KPJPHPFMCOKUMW-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 2
- ZOMUCVSKCXNYGL-UHFFFAOYSA-N (4,5-diphenyl-1,3-oxazol-2-yl)sulfanylformic acid Chemical class O1C(SC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 ZOMUCVSKCXNYGL-UHFFFAOYSA-N 0.000 description 1
- YASGHQZDINUWBR-UHFFFAOYSA-N 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]-n,n-diethylacetamide Chemical compound O1C(SCC(=O)N(CC)CC)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 YASGHQZDINUWBR-UHFFFAOYSA-N 0.000 description 1
- SSXYKBHZZRYLLY-UHFFFAOYSA-N 2-chloro-1,3-oxazole Chemical compound ClC1=NC=CO1 SSXYKBHZZRYLLY-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 1
- PWIGIOHIMSKJFG-UHFFFAOYSA-N 2-morpholin-4-ylethyl 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetate Chemical compound C1COCCN1CCOC(=O)CSC(O1)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 PWIGIOHIMSKJFG-UHFFFAOYSA-N 0.000 description 1
- PMNLUUOXGOOLSP-UHFFFAOYSA-M 2-sulfanylpropanoate Chemical compound CC(S)C([O-])=O PMNLUUOXGOOLSP-UHFFFAOYSA-M 0.000 description 1
- RQFUZUMFPRMVDX-UHFFFAOYSA-N 3-Bromo-1-propanol Chemical compound OCCCBr RQFUZUMFPRMVDX-UHFFFAOYSA-N 0.000 description 1
- CLEJZSNZYFJMKD-UHFFFAOYSA-N 3h-1,3-oxazole-2-thione Chemical compound SC1=NC=CO1 CLEJZSNZYFJMKD-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000002744 anti-aggregatory effect Effects 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 108010057108 condensin complexes Proteins 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000001177 diphosphate Substances 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- LPFNYZLGCZCARW-UHFFFAOYSA-N ethyl 2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetate Chemical compound O1C(SCC(=O)OCC)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 LPFNYZLGCZCARW-UHFFFAOYSA-N 0.000 description 1
- FQTIYMRSUOADDK-UHFFFAOYSA-N ethyl 3-bromopropanoate Chemical compound CCOC(=O)CCBr FQTIYMRSUOADDK-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229940041476 lactose 100 mg Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- VOVZXURTCKPRDQ-CQSZACIVSA-N n-[4-[chloro(difluoro)methoxy]phenyl]-6-[(3r)-3-hydroxypyrrolidin-1-yl]-5-(1h-pyrazol-5-yl)pyridine-3-carboxamide Chemical compound C1[C@H](O)CCN1C1=NC=C(C(=O)NC=2C=CC(OC(F)(F)Cl)=CC=2)C=C1C1=CC=NN1 VOVZXURTCKPRDQ-CQSZACIVSA-N 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/46—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB34673/74A GB1507032A (en) | 1974-08-06 | 1974-08-06 | 2-thiol-4,5-diphenyloxazole s-derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1036599A true CA1036599A (en) | 1978-08-15 |
Family
ID=10368553
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA232,493A Expired CA1036599A (en) | 1974-08-06 | 1975-07-29 | 2-thiol-4,5-diphenyloxazole s-derivatives |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4001228A (enExample) |
| JP (1) | JPS5143756A (enExample) |
| AR (1) | AR205653A1 (enExample) |
| AT (1) | AT348518B (enExample) |
| BE (1) | BE832188A (enExample) |
| CA (1) | CA1036599A (enExample) |
| CH (1) | CH621780A5 (enExample) |
| DE (1) | DE2535147A1 (enExample) |
| DK (1) | DK356375A (enExample) |
| ES (1) | ES439909A1 (enExample) |
| FR (1) | FR2281115A1 (enExample) |
| GB (1) | GB1507032A (enExample) |
| IL (1) | IL47878A (enExample) |
| NL (1) | NL7509013A (enExample) |
| NO (1) | NO752752L (enExample) |
| SE (1) | SE7508724L (enExample) |
| ZA (1) | ZA754630B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1099996B (it) * | 1978-10-17 | 1985-09-28 | Anic Spa | Derivati del 4,5-difenil-ossazolo 2-ammino o 2-tio sostituiti e procedimento per il loro ottenimento |
| DE2946524A1 (de) * | 1979-11-17 | 1981-06-11 | Bayer Ag, 5090 Leverkusen | Azolyloxy-carbonsaeure-n-oxy-amide, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| IL90192A0 (en) * | 1988-05-13 | 1989-12-15 | Schering Ag | Azole ether derivatives and pesticidal compositions containing the same |
| NZ236474A (en) * | 1989-12-20 | 1993-07-27 | Bristol Myers Squibb Co | 4,5-diphenyl-2-oxazole octanoic, nonanoic and decanoic acid and ester derivatives, preparation and pharmaceutical compositions thereof |
| US5380738A (en) * | 1993-05-21 | 1995-01-10 | Monsanto Company | 2-substituted oxazoles further substituted by 4-fluorophenyl and 4-methylsulfonylphenyl as antiinflammatory agents |
| FR2753449B1 (fr) * | 1996-09-13 | 1998-12-04 | Union Pharma Scient Appl | Nouveaux derives 3,4-diaryloxazolone, leurs procedes de preparation, et leurs utilisations en therapeutique |
| BR9913833A (pt) | 1998-09-17 | 2001-05-29 | Bristol Myers Squibb Co | Método para tratar diabetes, empregando em inibidor de ap2 e combinação |
| US7358254B2 (en) | 2001-07-13 | 2008-04-15 | Bristol-Myers Squibb Company | Method for treating atherosclerosis employing an aP2 inhibitor and combination |
| US7390824B1 (en) | 1999-09-07 | 2008-06-24 | Bristol-Myers Squibb Company | Method for treating diabetes employing an aP2 inhibitor and combination |
| WO2023143741A1 (de) * | 2022-01-28 | 2023-08-03 | Symrise Ag | Neue kühlstoffe und zubereitungen, die diese enthalten |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2129012A1 (de) * | 1971-06-11 | 1973-01-04 | Merck Patent Gmbh | Azol-derivate |
| FR2156486A1 (en) * | 1971-10-22 | 1973-06-01 | Roussel Uclaf | Oxazolyl oxy or thio acetic acids - analgesics antipyretics and anti-inflammatories |
-
1974
- 1974-08-06 GB GB34673/74A patent/GB1507032A/en not_active Expired
-
1975
- 1975-01-01 AR AR259879A patent/AR205653A1/es active
- 1975-07-18 ZA ZA00754630A patent/ZA754630B/xx unknown
- 1975-07-23 US US05/598,186 patent/US4001228A/en not_active Expired - Lifetime
- 1975-07-24 AT AT575475A patent/AT348518B/de not_active IP Right Cessation
- 1975-07-29 CA CA232,493A patent/CA1036599A/en not_active Expired
- 1975-07-29 NL NL7509013A patent/NL7509013A/xx not_active Application Discontinuation
- 1975-07-31 ES ES439909A patent/ES439909A1/es not_active Expired
- 1975-08-01 SE SE7508724A patent/SE7508724L/xx unknown
- 1975-08-05 FR FR7524383A patent/FR2281115A1/fr active Granted
- 1975-08-05 IL IL7547878A patent/IL47878A/xx unknown
- 1975-08-05 CH CH1019375A patent/CH621780A5/de not_active IP Right Cessation
- 1975-08-05 NO NO752752A patent/NO752752L/no unknown
- 1975-08-05 DK DK356375A patent/DK356375A/da unknown
- 1975-08-06 JP JP50095094A patent/JPS5143756A/ja active Pending
- 1975-08-06 BE BE158995A patent/BE832188A/xx not_active IP Right Cessation
- 1975-08-06 DE DE19752535147 patent/DE2535147A1/de not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| AT348518B (de) | 1979-02-26 |
| GB1507032A (en) | 1978-04-12 |
| BE832188A (fr) | 1975-12-01 |
| AR205653A1 (es) | 1976-05-21 |
| DE2535147A1 (de) | 1976-02-19 |
| CH621780A5 (enExample) | 1981-02-27 |
| DK356375A (da) | 1976-02-07 |
| AU8367075A (en) | 1977-02-10 |
| SE7508724L (sv) | 1976-02-09 |
| IL47878A (en) | 1979-01-31 |
| ZA754630B (en) | 1976-07-28 |
| NL7509013A (nl) | 1976-02-10 |
| FR2281115A1 (fr) | 1976-03-05 |
| FR2281115B1 (enExample) | 1978-11-10 |
| ES439909A1 (es) | 1977-08-16 |
| IL47878A0 (en) | 1975-11-25 |
| ATA575475A (de) | 1978-07-15 |
| JPS5143756A (en) | 1976-04-14 |
| US4001228A (en) | 1977-01-04 |
| NO752752L (enExample) | 1976-02-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1162924A (en) | Therapeutically active substituted piperidine carboxyllic amides | |
| Delaunay et al. | Reactivity of. beta.-amino alcohols with carbon disulfide study on the synthesis of 2-oxazolidinethiones and 2-thiazolidinethiones | |
| CA1036599A (en) | 2-thiol-4,5-diphenyloxazole s-derivatives | |
| US5059614A (en) | Novel isoxazole and isoxazoline compounds with anticonvulsant activity process for their preparation and therapeutic composition containing them | |
| CA1269982A (en) | Process for producing heterocyclic compounds | |
| US3962261A (en) | 2,3,4,5-tetra hydro-5-oxo-1-benzothiepi n-4-carboxamide 1,1-dioxides | |
| US4029673A (en) | N-(1-benzyl pyrrolidinyl 2-alkyl) substituted benzamides and derivatives thereof | |
| US3072653A (en) | 5-amino derivatives of 4-thiazolidinones and process therefor | |
| CZ315198A3 (cs) | Nové substituované [2-(1-piperazinyl)ethoxy]methylové sloučeniny | |
| CA2053477C (en) | Heterocyclic amine derivatives, their production and use | |
| CA2039258A1 (en) | 4-phenylphthalazine derivatives | |
| IL91377A (en) | Derivatives of botinylamine glycolate | |
| CA1096870A (en) | 4-quinolylamino-benzamide compounds | |
| CA1110628A (en) | N-phenethylacetamide compounds and process for preparation thereof | |
| US5344842A (en) | Thiosemicarbazone derivatives | |
| EP1036075A1 (en) | Substituted thiazolidinedione and oxazolidinedione having antidiabetic, hypolipidemia and antihypertensive properties | |
| CA1071626A (en) | Imidazolylquinazoline derivatives | |
| CA1276639C (en) | Aminobenzamide derivatives | |
| CA1047504A (en) | N-(2-pyrrolidinyl alkyl) substitutes and derivatives thereof | |
| CA2050492C (en) | Piperazine compounds, processes for preparation thereof and medical uses thereof | |
| US3767665A (en) | Isoxazolinone compounds process for the preparation thereof and theiruse as agricultural chemicals | |
| CA2179679A1 (en) | Substituted benzothiazine derivative | |
| US4568690A (en) | 1-Methyl-5-p-methylbenzoylpyrrole-2-acetamidoacetanilides with antiinflammatory, analgesic, antipyretic and anti-platelet aggregant activity | |
| CA1101858A (en) | Naphthalene derivatives | |
| CA1076112A (en) | Benzamides |