CH619450A5 - - Google Patents
Download PDFInfo
- Publication number
- CH619450A5 CH619450A5 CH45076A CH45076A CH619450A5 CH 619450 A5 CH619450 A5 CH 619450A5 CH 45076 A CH45076 A CH 45076A CH 45076 A CH45076 A CH 45076A CH 619450 A5 CH619450 A5 CH 619450A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- compounds
- carbon atoms
- alkyl
- deoxy
- Prior art date
Links
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 150000001875 compounds Chemical class 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 238000000034 method Methods 0.000 description 9
- 239000000243 solution Substances 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- -1 acetoxy mutilin derivatives Chemical class 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229960002771 retapamulin Drugs 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- KUBKXMIPSJEXGM-UHFFFAOYSA-N 14-Acetylmutilin Natural products CC1C(O)C(C)(C=C)CC(OC(C)=O)C2(C)C(C)CCC31C2C(=O)CC3 KUBKXMIPSJEXGM-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- OBUUFWIMEGVAQS-UHFFFAOYSA-N Pleuromutenol Natural products CC1C(O)C(C)(C=C)CC(O)C2(C)C(C)CCC31C2C(=O)CC3 OBUUFWIMEGVAQS-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- UDYGXWPMSJPFDG-UHFFFAOYSA-M benzyl(tributyl)azanium;bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1 UDYGXWPMSJPFDG-UHFFFAOYSA-M 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003444 phase transfer catalyst Substances 0.000 description 2
- STZYTFJPGGDRJD-NHUWBDDWSA-N retapamulin Chemical compound C([C@H]([C@@]1(C)[C@@H](C[C@@](C)(C=C)[C@@H](O)[C@@H]2C)OC(=O)CS[C@@H]3C[C@H]4CC[C@H](N4C)C3)C)C[C@]32[C@H]1C(=O)CC3 STZYTFJPGGDRJD-NHUWBDDWSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- YBDSNEVSFQMCTL-UHFFFAOYSA-N 2-(diethylamino)ethanethiol Chemical compound CCN(CC)CCS YBDSNEVSFQMCTL-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000003113 alkalizing effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- YXQXDXAHCSEVSD-GCYNEOGWSA-N dynamutilin Chemical compound OC(=O)\C=C\C(O)=O.CCN(CC)CCSCC(=O)O[C@@H]1C[C@@](C)(C=C)[C@@H](O)[C@H](C)[C@@]23CC[C@@H](C)[C@]1(C)[C@@H]2C(=O)CC3 YXQXDXAHCSEVSD-GCYNEOGWSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH45076A CH619450A5 (enExample) | 1976-01-15 | 1976-01-15 | |
| US05/757,858 US4107434A (en) | 1976-01-15 | 1977-01-10 | Process for making pleuromutilins |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH45076A CH619450A5 (enExample) | 1976-01-15 | 1976-01-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH619450A5 true CH619450A5 (enExample) | 1980-09-30 |
Family
ID=4187305
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH45076A CH619450A5 (enExample) | 1976-01-15 | 1976-01-15 |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US4107434A (enExample) |
| CH (1) | CH619450A5 (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3560511D1 (en) * | 1984-02-17 | 1987-10-01 | Sandoz Ag | Pleuromutilin derivatives, process for their preparation and their use |
| HU208115B (en) * | 1989-10-03 | 1993-08-30 | Biochemie Gmbh | New process for producting pleuromutilin derivatives |
| UY25225A1 (es) | 1997-10-29 | 2000-12-29 | Smithkline Beecham Plc | Derivados de pleuromutilina utiles como agentes antimicrobianos |
| US6265579B1 (en) * | 1999-10-29 | 2001-07-24 | Salsbury Chemicals, Inc. | Process for preparing piperazine-substituted aliphatic carboxylates |
| GB0218578D0 (en) * | 2002-08-09 | 2002-09-18 | Glaxo Group Ltd | Novel method |
| GB0308114D0 (en) * | 2003-04-08 | 2003-05-14 | Glaxo Group Ltd | Novel compounds |
| CN101319234B (zh) * | 2008-07-04 | 2011-02-16 | 江苏赛奥生化有限公司 | 截短侧耳素的发酵方法 |
| CN102675172A (zh) * | 2012-04-27 | 2012-09-19 | 宁夏泰瑞制药股份有限公司 | 一种泰妙菌素碱的制备方法 |
| CN104892476B (zh) * | 2015-05-07 | 2017-05-17 | 陕西师范大学 | 泰妙菌素的合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3919290A (en) * | 1972-10-03 | 1975-11-11 | Sandoz Ltd | Substituted 14-desoxy-mutilins |
| US3972887A (en) * | 1972-12-11 | 1976-08-03 | The Dow Chemical Company | Process for preparing phosphorothioates and phenylphosponothioates |
-
1976
- 1976-01-15 CH CH45076A patent/CH619450A5/de not_active IP Right Cessation
-
1977
- 1977-01-10 US US05/757,858 patent/US4107434A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4107434A (en) | 1978-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH619450A5 (enExample) | ||
| DE1493781A1 (de) | Verfahren zum Umwandeln von Ammoniak oder primaeren oder sekundaeren Aminen in das jeweils naechst hoeher substituierte Amin | |
| CH633249A5 (de) | Verfahren zur herstellung von neuen polyprenylderivaten. | |
| DE2823712C2 (de) | Verfahren zur Herstellung von Pleuromutilin-Derivaten | |
| DE664789C (de) | Verfahren zur Herstellung von 4-Methyl-5-ª‰-oxyaethylthiazolen | |
| DE2521088A1 (de) | Diterpensaeureanilide und verfahren zu ihrer herstellung | |
| DE1543288A1 (de) | Verfahren zur Herstellung von Dibenzocycloheptenylaminen | |
| DE1929138C3 (de) | Verfahren zur Herstellung von N hoch 1 -Benzoylphenyläthylendiaminen und ihren Salzen | |
| DE1770848A1 (de) | Verfahren zur Herstellung von 3-Methansulfonylphenthiazinen | |
| DE1242603B (de) | Verfahren zur Herstellung von 5-Hydroxy-5-aminoalkyl-di-benzo-[a, d]-cycloheptanen | |
| DE932675C (de) | Verfahren zur Herstellung von Estern des Penicillins mit eine sekundaere Aminogruppe aufweisenden Alkoholen und von Salzen dieser Ester | |
| DE2262912A1 (de) | Pyrido eckige klammer auf 3,4-d eckige klammer zu pyridazinderivate und verfahren zu ihrer herstellung | |
| AT266838B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT211822B (de) | Verfahren zur Herstellung von neuen Aryloxyessigsäureamiden | |
| AT270647B (de) | Verfahren zur Herstellung neuer substituierter Aminopyridine, von deren Salzen und optisch aktiven Isomeren | |
| DE825548C (de) | Verfahren zur Herstellung von neuen diquartaeren Salzen von Pyrimidylaminocinnolinen | |
| AT203015B (de) | Verfahren zur Herstellung von neuen 1-(p-Butoxyphenyl)-3-(p-pyridylphenyl)-2-thioharnstoffen | |
| AT219605B (de) | Verfahren zur Herstellung von neuen Thioxanthen-Derivaten | |
| DE859892C (de) | Verfahren zur Herstellung von substituierten Piperidinoessigsaeureestern | |
| AT222650B (de) | Verfahren zur Herstellung von neuen Äthern | |
| DE1468199A1 (de) | Verfahren zur Herstellung von Thioamiden | |
| AT233013B (de) | Verfahren zur Herstellung von neuen Iminodibenzylderivaten | |
| AT267533B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT233579B (de) | Verfahren zur Herstellung von neuen Iminodibenzylderivaten | |
| AT367394B (de) | Verfahren zur herstellung neuer indanderivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |