CH619208A5 - - Google Patents
Download PDFInfo
- Publication number
- CH619208A5 CH619208A5 CH112076A CH112076A CH619208A5 CH 619208 A5 CH619208 A5 CH 619208A5 CH 112076 A CH112076 A CH 112076A CH 112076 A CH112076 A CH 112076A CH 619208 A5 CH619208 A5 CH 619208A5
- Authority
- CH
- Switzerland
- Prior art keywords
- naphthyl
- group
- atoms
- formula
- compounds
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 54
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- -1 benzyloxy, hydroxyl Chemical group 0.000 claims description 11
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 239000000460 chlorine Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 239000002253 acid Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 6
- OQAJORFLUPFRMW-UHFFFAOYSA-N 2,2-dimethyl-4-naphthalen-2-ylchromen-7-ol Chemical compound C1=CC=CC2=CC(C=3C4=CC=C(O)C=C4OC(C=3)(C)C)=CC=C21 OQAJORFLUPFRMW-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000000935 antidepressant agent Substances 0.000 description 4
- 229940005513 antidepressants Drugs 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- QUYBTVOGKRECIP-UHFFFAOYSA-N 2-[4-(6-methoxynaphthalen-2-yl)-2,2-dimethylchromen-7-yl]oxy-n,n-dimethylethanamine Chemical compound CN(C)CCOC1=CC=C2C(C3=CC4=CC=C(C=C4C=C3)OC)=CC(C)(C)OC2=C1 QUYBTVOGKRECIP-UHFFFAOYSA-N 0.000 description 3
- JKHCQUMNIXEDBL-UHFFFAOYSA-N 4-(6-methoxynaphthalen-2-yl)-2,2-dimethylchromen-7-ol Chemical compound OC1=CC=C2C(C3=CC4=CC=C(C=C4C=C3)OC)=CC(C)(C)OC2=C1 JKHCQUMNIXEDBL-UHFFFAOYSA-N 0.000 description 3
- ZZOCLVONRFEUPJ-UHFFFAOYSA-N 7-hydroxy-4-(6-methoxynaphthalen-2-yl)chromen-2-one Chemical compound C1=C(O)C=CC2=C1OC(=O)C=C2C1=CC2=CC=C(OC)C=C2C=C1 ZZOCLVONRFEUPJ-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000001430 anti-depressive effect Effects 0.000 description 3
- 150000001843 chromanes Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229960000956 coumarin Drugs 0.000 description 3
- 206010061428 decreased appetite Diseases 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- BXWPGZLRGRRMPR-UHFFFAOYSA-N ethyl 3-(6-methoxynaphthalen-2-yl)-3-oxopropanoate Chemical compound C1=C(OC)C=CC2=CC(C(=O)CC(=O)OCC)=CC=C21 BXWPGZLRGRRMPR-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- XTIJHEBQQREOMY-UHFFFAOYSA-N 2,2-dimethyl-4-naphthalen-1-yl-3,4-dihydrochromen-7-ol Chemical compound C1=CC=C2C(C3CC(OC4=CC(O)=CC=C43)(C)C)=CC=CC2=C1 XTIJHEBQQREOMY-UHFFFAOYSA-N 0.000 description 2
- NGKCSXNZJUEQSR-UHFFFAOYSA-N 7-hydroxy-4-naphthalen-2-ylchromen-2-one Chemical compound C1=CC=CC2=CC(C=3C4=CC=C(C=C4OC(=O)C=3)O)=CC=C21 NGKCSXNZJUEQSR-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 208000022531 anorexia Diseases 0.000 description 2
- 230000002891 anorexigenic effect Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000008371 chromenes Chemical class 0.000 description 2
- 235000001671 coumarin Nutrition 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 230000000269 nucleophilic effect Effects 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- VFLQQZCRHPIGJU-UHFFFAOYSA-N 1-(2-chloroethyl)piperidine;hydron;chloride Chemical compound Cl.ClCCN1CCCCC1 VFLQQZCRHPIGJU-UHFFFAOYSA-N 0.000 description 1
- GGWCZBGAIGGTDA-UHFFFAOYSA-N 1-(6-methoxynaphthalen-2-yl)ethanone Chemical compound C1=C(C(C)=O)C=CC2=CC(OC)=CC=C21 GGWCZBGAIGGTDA-UHFFFAOYSA-N 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- DPYDVZNEHYBCFU-UHFFFAOYSA-N 2-(2,2-dimethyl-4-naphthalen-1-ylchromen-7-yl)oxy-N-methylethanamine Chemical compound CC1(OC2=CC(=CC=C2C(=C1)C1=CC=CC2=CC=CC=C12)OCCNC)C DPYDVZNEHYBCFU-UHFFFAOYSA-N 0.000 description 1
- DXROPGXURWBEFE-UHFFFAOYSA-N 2-(2,2-dimethyl-4-naphthalen-1-ylchromen-7-yl)oxy-n,n-dimethylethanamine Chemical compound C1=CC=C2C(C=3C4=CC=C(C=C4OC(C)(C)C=3)OCCN(C)C)=CC=CC2=C1 DXROPGXURWBEFE-UHFFFAOYSA-N 0.000 description 1
- YUOJPDPMLJHIOO-UHFFFAOYSA-N 2-(2,2-dimethyl-4-naphthalen-2-ylchromen-7-yl)oxy-n,n-diethylethanamine Chemical compound C1=CC=CC2=CC(C=3C4=CC=C(C=C4OC(C)(C)C=3)OCCN(CC)CC)=CC=C21 YUOJPDPMLJHIOO-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- GPESANGJUOXTCD-UHFFFAOYSA-N 2-[(2,2-dimethyl-4-naphthalen-2-yl-3,4-dihydrochromen-7-yl)oxy]-n,n-dimethylethanamine Chemical compound C1=CC=CC2=CC(C3C4=CC=C(C=C4OC(C)(C)C3)OCCN(C)C)=CC=C21 GPESANGJUOXTCD-UHFFFAOYSA-N 0.000 description 1
- YFBQXUGQIFAFMM-UHFFFAOYSA-N 2-chloro-n-methylethanamine Chemical compound CNCCCl YFBQXUGQIFAFMM-UHFFFAOYSA-N 0.000 description 1
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 1
- 125000003635 2-dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- WPXMLUUYWNHQOR-UHFFFAOYSA-N 3-naphthalen-1-ylprop-2-enoic acid Chemical compound C1=CC=C2C(C=CC(=O)O)=CC=CC2=C1 WPXMLUUYWNHQOR-UHFFFAOYSA-N 0.000 description 1
- SUVBZSPHWXZDLL-UHFFFAOYSA-N 4-(3-hydroxy-3-methyl-1-naphthalen-1-ylbutyl)benzene-1,3-diol Chemical compound C=1C=CC2=CC=CC=C2C=1C(CC(C)(O)C)C1=CC=C(O)C=C1O SUVBZSPHWXZDLL-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ZMYVMHIXLOLYNY-UHFFFAOYSA-N 7-hydroxy-4-naphthalen-1-yl-3,4-dihydrochromen-2-one Chemical compound C1=CC=C2C(C3C4=CC=C(C=C4OC(=O)C3)O)=CC=CC2=C1 ZMYVMHIXLOLYNY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 101100532699 Drosophila melanogaster scyl gene Proteins 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 230000000578 anorexic effect Effects 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 235000019789 appetite Nutrition 0.000 description 1
- 239000002830 appetite depressant Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- CMOYIKGRDXXXNU-UHFFFAOYSA-N ethyl 3-naphthalen-2-yl-3-oxopropanoate Chemical compound C1=CC=CC2=CC(C(=O)CC(=O)OCC)=CC=C21 CMOYIKGRDXXXNU-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- NATXCBSLEPEUPF-UHFFFAOYSA-N n-benzyl-2-(2,2-dimethyl-4-naphthalen-2-ylchromen-7-yl)oxy-n-methylethanamine Chemical compound C=1C=C2C(C=3C=C4C=CC=CC4=CC=3)=CC(C)(C)OC2=CC=1OCCN(C)CC1=CC=CC=C1 NATXCBSLEPEUPF-UHFFFAOYSA-N 0.000 description 1
- PYIXYEMKFUOLDQ-UHFFFAOYSA-N n-benzyl-2-chloro-n-methylethanamine;hydrochloride Chemical compound [Cl-].ClCC[NH+](C)CC1=CC=CC=C1 PYIXYEMKFUOLDQ-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/06—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2
- C07D311/08—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring
- C07D311/16—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring substituted in position 7
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrane Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB30352/75A GB1497161A (en) | 1975-07-19 | 1975-07-19 | Naphthyl derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH619208A5 true CH619208A5 (enExample) | 1980-09-15 |
Family
ID=10306288
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH112076A CH619208A5 (enExample) | 1975-07-19 | 1976-01-29 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4079066A (enExample) |
| JP (1) | JPS5212150A (enExample) |
| AU (1) | AU497409B2 (enExample) |
| BE (1) | BE837950A (enExample) |
| CA (1) | CA1072554A (enExample) |
| CH (1) | CH619208A5 (enExample) |
| DE (1) | DE2603178A1 (enExample) |
| DK (1) | DK34276A (enExample) |
| ES (1) | ES444765A1 (enExample) |
| FR (2) | FR2318628A1 (enExample) |
| GB (1) | GB1497161A (enExample) |
| IE (1) | IE42403B1 (enExample) |
| NL (1) | NL7600846A (enExample) |
| SE (1) | SE422794B (enExample) |
| ZA (1) | ZA761954B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1493998A (en) * | 1975-06-03 | 1977-12-07 | Beecham Group Ltd | Propanolamine derivatives |
| FR2608942B1 (fr) * | 1986-12-31 | 1991-01-11 | Centre Nat Rech Scient | Procede de preparation de systemes colloidaux dispersibles d'une substance, sous forme de nanocapsules |
| DE69128481T2 (de) * | 1990-09-07 | 1998-04-09 | Schering Corp | Antivirale und antihypertensive verbindungen |
| JPH06324511A (ja) * | 1993-05-14 | 1994-11-25 | Brother Ind Ltd | 感光性マイクロカプセル型トナー |
| JP3362745B2 (ja) * | 1993-07-28 | 2003-01-07 | ブラザー工業株式会社 | 感光性マイクロカプセル型トナー |
| CN101043886A (zh) * | 2004-10-22 | 2007-09-26 | 帝斯曼知识产权资产管理有限公司 | 用于预防和治疗与受损神经传递相关的失调症的新型试剂 |
| CN100393716C (zh) * | 2006-05-18 | 2008-06-11 | 中国药科大学 | 香豆素衍生物、其制备方法及作为α1受体拮抗剂的用途 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB953194A (en) * | 1960-11-08 | 1964-03-25 | Smith Kline French Lab | New benzylindene derivatives and method of preparing the same |
| US3388121A (en) * | 1964-12-16 | 1968-06-11 | Squibb & Sons Inc | Tetrahydrobenzocyclohexene and cycloheptene ethers |
-
1975
- 1975-07-19 GB GB30352/75A patent/GB1497161A/en not_active Expired
-
1976
- 1976-01-19 IE IE99/76A patent/IE42403B1/en unknown
- 1976-01-22 SE SE7600673A patent/SE422794B/xx unknown
- 1976-01-26 US US05/652,134 patent/US4079066A/en not_active Expired - Lifetime
- 1976-01-27 BE BE163838A patent/BE837950A/xx unknown
- 1976-01-28 NL NL7600846A patent/NL7600846A/xx not_active Application Discontinuation
- 1976-01-28 FR FR7602247A patent/FR2318628A1/fr active Granted
- 1976-01-28 CA CA244,443A patent/CA1072554A/en not_active Expired
- 1976-01-28 DK DK34276A patent/DK34276A/da not_active Application Discontinuation
- 1976-01-28 DE DE19762603178 patent/DE2603178A1/de not_active Withdrawn
- 1976-01-29 ES ES444765A patent/ES444765A1/es not_active Expired
- 1976-01-29 CH CH112076A patent/CH619208A5/de not_active IP Right Cessation
- 1976-01-29 JP JP51008860A patent/JPS5212150A/ja active Pending
- 1976-01-29 AU AU10664/76A patent/AU497409B2/en not_active Expired
- 1976-03-31 ZA ZA761954A patent/ZA761954B/xx unknown
- 1976-05-05 FR FR7613359A patent/FR2318624A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| SE7600673L (sv) | 1977-01-20 |
| GB1497161A (en) | 1978-01-05 |
| SE422794B (sv) | 1982-03-29 |
| BE837950A (fr) | 1976-07-27 |
| AU1066476A (en) | 1977-08-04 |
| IE42403L (en) | 1977-01-19 |
| FR2318624B1 (enExample) | 1979-06-29 |
| JPS5212150A (en) | 1977-01-29 |
| FR2318624A1 (fr) | 1977-02-18 |
| ZA761954B (en) | 1977-04-27 |
| CA1072554A (en) | 1980-02-26 |
| DE2603178A1 (de) | 1977-02-03 |
| NL7600846A (nl) | 1977-01-21 |
| DK34276A (da) | 1977-01-20 |
| ES444765A1 (es) | 1977-12-01 |
| FR2318628A1 (fr) | 1977-02-18 |
| US4079066A (en) | 1978-03-14 |
| IE42403B1 (en) | 1980-07-30 |
| AU497409B2 (en) | 1978-12-14 |
| FR2318628B1 (enExample) | 1979-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1138779B (de) | Verfahren zur Herstellung von in der Aminogruppe substituierten 10-(Aminoalkyl)-trifluormethyl-phenthiazinderivaten. | |
| DE1111642B (de) | Verfahren zur Herstellung von basisch substituierten Diphenylmethan-Derivaten mit Herz- und Kreislaufwirksamkeit | |
| CH622780A5 (enExample) | ||
| CH648553A5 (de) | Neue 3,4-dihydro-5h-2,3-benzodiazepin-derivate und verfahren zur herstellung derselben. | |
| CH632262A5 (de) | Verfahren zur herstellung von aminochromanol-derivaten. | |
| DE2624570A1 (de) | Mehrkernige verbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3402601A1 (de) | Neue pharmazeutisch aktive 1,2,3,4,4a,5,10,10a-octahydrobenzo(g)chinolinderivate, deren herstellung und verwendung | |
| CH619208A5 (enExample) | ||
| DD272648A5 (de) | Chromon-derivate | |
| DE69810560T2 (de) | Indanol-Derivate, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
| EP0030380A1 (de) | 2,3-Indoldionderivate, Verfahren zu ihrer Herstellung, Zwischenprodukte, Arzneimittel enthaltend solche 2,3-Indoldionderivate und ihre pharmazeutische Verwendung | |
| CH624110A5 (en) | Process for the preparation of chromane, thiochromane and tetralin derivatives | |
| CH591415A5 (en) | 3-(Tri-substd. benzoyl) propionic acids - as relaxants or spasmolytics for the gall bladder | |
| DE2061864B2 (de) | Acylderivate von substituierten Bis-Arylalkylaminen | |
| CH666031A5 (de) | Naphthoxazine, ihre herstellung und pharmazeutische zusammensetzungen. | |
| DE2653477A1 (de) | Spiro eckige klammer auf cyclopropan- 1,2'-indolin eckige klammer zu -3'-one | |
| AT345284B (de) | Verfahren zur herstellung von neuen naphthylenen und deren salzen | |
| DE2747987C2 (enExample) | ||
| EP0000013A1 (de) | 4-Phenyl-8-amino-tetrahydroisochinoline, diese enthaltende pharmazeutische Präparate und Verfahren zur Herstellung dieser Präparate | |
| DE2524394A1 (de) | Alpha-aminomethyl-3-aethyl-4-hydroxybenzylalkoholderivate, verfahren zu ihrer herstellung und arzneimittel | |
| DE2606789A1 (de) | Oxoindanylpropionsaeuren und verfahren zu ihrer herstellung | |
| AT347458B (de) | Verfahren zur herstellung von neuen naphthylenen und deren salzen | |
| EP0102929B1 (de) | Propylamin-Derivate, Verfahren zu ihrer Herstellung, pharmazeutische Präparate enthaltend diese Verbindungen, sowie ihre therapeutische Verwendung | |
| CH540900A (de) | Verfahren zur Herstellung von neuen heterocyclischen Carbonsäuren | |
| DE1182237B (de) | Verfahren zur Herstellung von 10-[4'-Hydroxy-4'-hydroxyalkylpiperidinoalkyl]-phenthiazin-derivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |