IE42403B1 - Naphthyl derivatives - Google Patents
Naphthyl derivativesInfo
- Publication number
- IE42403B1 IE42403B1 IE99/76A IE9976A IE42403B1 IE 42403 B1 IE42403 B1 IE 42403B1 IE 99/76 A IE99/76 A IE 99/76A IE 9976 A IE9976 A IE 9976A IE 42403 B1 IE42403 B1 IE 42403B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- naphthyl
- group
- compound
- dimethyl
- Prior art date
Links
- 125000001624 naphthyl group Chemical group 0.000 title claims abstract description 10
- 150000001875 compounds Chemical class 0.000 claims abstract description 113
- 150000003839 salts Chemical class 0.000 claims abstract description 48
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 8
- 230000029936 alkylation Effects 0.000 claims abstract description 5
- 238000005804 alkylation reaction Methods 0.000 claims abstract description 5
- 206010061428 decreased appetite Diseases 0.000 claims abstract description 5
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 4
- 238000002360 preparation method Methods 0.000 claims abstract description 4
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 3
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 3
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims description 30
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 27
- -1 benzyloxy, hydroxyl Chemical group 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 13
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 10
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims description 9
- 230000018044 dehydration Effects 0.000 claims description 8
- 238000006297 dehydration reaction Methods 0.000 claims description 8
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 8
- 239000008194 pharmaceutical composition Substances 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 239000002552 dosage form Substances 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- 150000008371 chromenes Chemical class 0.000 claims description 4
- 239000012038 nucleophile Substances 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 208000022531 anorexia Diseases 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- DPYDVZNEHYBCFU-UHFFFAOYSA-N 2-(2,2-dimethyl-4-naphthalen-1-ylchromen-7-yl)oxy-N-methylethanamine Chemical compound CC1(OC2=CC(=CC=C2C(=C1)C1=CC=CC2=CC=CC=C12)OCCNC)C DPYDVZNEHYBCFU-UHFFFAOYSA-N 0.000 claims description 2
- CSHJJVSOVQKZSQ-UHFFFAOYSA-N 2-[(2,2-dimethyl-4-naphthalen-2-yl-3,4-dihydrochromen-7-yl)oxy]-n,n-diethylethanamine Chemical compound C1=CC=CC2=CC(C3C4=CC=C(C=C4OC(C)(C)C3)OCCN(CC)CC)=CC=C21 CSHJJVSOVQKZSQ-UHFFFAOYSA-N 0.000 claims description 2
- VIDWDAYIKMJMGO-UHFFFAOYSA-N 2-naphthalen-2-yl-3,4-dihydro-2H-chromene Chemical compound C1=C(C=CC2=CC=CC=C12)C1OC2=CC=CC=C2CC1 VIDWDAYIKMJMGO-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 2
- 230000001939 inductive effect Effects 0.000 claims description 2
- 229910052987 metal hydride Inorganic materials 0.000 claims description 2
- 150000004681 metal hydrides Chemical class 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- DXROPGXURWBEFE-UHFFFAOYSA-N 2-(2,2-dimethyl-4-naphthalen-1-ylchromen-7-yl)oxy-n,n-dimethylethanamine Chemical compound C1=CC=C2C(C=3C4=CC=C(C=C4OC(C)(C)C=3)OCCN(C)C)=CC=CC2=C1 DXROPGXURWBEFE-UHFFFAOYSA-N 0.000 claims 1
- MJRQPHPUIFKVFA-UHFFFAOYSA-N 2-(2,2-dimethyl-4-naphthalen-2-ylchromen-7-yl)oxy-n,n-dimethylethanamine Chemical compound C1=CC=CC2=CC(C=3C4=CC=C(C=C4OC(C)(C)C=3)OCCN(C)C)=CC=C21 MJRQPHPUIFKVFA-UHFFFAOYSA-N 0.000 claims 1
- IJYRGLAZRIFKAK-UHFFFAOYSA-N 2-[(2,2-dimethyl-4-naphthalen-1-yl-3,4-dihydrochromen-7-yl)oxy]-n,n-dimethylethanamine Chemical compound C1=CC=C2C(C3C4=CC=C(C=C4OC(C)(C)C3)OCCN(C)C)=CC=CC2=C1 IJYRGLAZRIFKAK-UHFFFAOYSA-N 0.000 claims 1
- UHAHVPONPPLHNA-UHFFFAOYSA-N 2-[(2,2-dimethyl-4-naphthalen-2-yl-3,4-dihydrochromen-7-yl)oxy]-n-methylethanamine Chemical compound C1=CC=CC2=CC(C3C4=CC=C(C=C4OC(C)(C)C3)OCCNC)=CC=C21 UHAHVPONPPLHNA-UHFFFAOYSA-N 0.000 claims 1
- HPISQVIDYSNIIJ-UHFFFAOYSA-N 2-[2,2-dimethyl-4-(4-methylnaphthalen-1-yl)chromen-7-yl]oxy-n,n-dimethylethanamine Chemical compound C1=CC=C2C(C=3C4=CC=C(C=C4OC(C)(C)C=3)OCCN(C)C)=CC=C(C)C2=C1 HPISQVIDYSNIIJ-UHFFFAOYSA-N 0.000 claims 1
- UHOUGSYSIOIXLL-UHFFFAOYSA-N 2-[4-(3-chloronaphthalen-1-yl)-2,2-dimethylchromen-7-yl]oxy-N,N-dimethylethanamine Chemical compound ClC=1C=C(C2=CC=CC=C2C=1)C1=CC(OC2=CC(=CC=C12)OCCN(C)C)(C)C UHOUGSYSIOIXLL-UHFFFAOYSA-N 0.000 claims 1
- FIRGRLHXHRNLFU-UHFFFAOYSA-N 2-[4-(4-fluoronaphthalen-1-yl)-2,2-dimethylchromen-7-yl]oxy-n,n-dimethylethanamine Chemical compound C1=CC=C2C(C=3C4=CC=C(C=C4OC(C)(C)C=3)OCCN(C)C)=CC=C(F)C2=C1 FIRGRLHXHRNLFU-UHFFFAOYSA-N 0.000 claims 1
- UYQSPYIUGPTILW-UHFFFAOYSA-N 2-[[4-(6-methoxynaphthalen-2-yl)-2,2-dimethyl-3,4-dihydrochromen-7-yl]oxy]-n,n-dimethylethanamine Chemical compound C1C(C)(C)OC2=CC(OCCN(C)C)=CC=C2C1C1=CC2=CC=C(OC)C=C2C=C1 UYQSPYIUGPTILW-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 1
- MXSIGEYUEDSMOY-UHFFFAOYSA-N n,n-dimethyl-2-[(5-naphthalen-1-yl-7,8-dihydronaphthalen-2-yl)oxy]ethanamine Chemical compound C1=CC=C2C(C=3C4=CC=C(C=C4CCC=3)OCCN(C)C)=CC=CC2=C1 MXSIGEYUEDSMOY-UHFFFAOYSA-N 0.000 claims 1
- NGKCSXNZJUEQSR-UHFFFAOYSA-N 7-hydroxy-4-naphthalen-2-ylchromen-2-one Chemical compound C1=CC=CC2=CC(C=3C4=CC=C(C=C4OC(=O)C=3)O)=CC=C21 NGKCSXNZJUEQSR-UHFFFAOYSA-N 0.000 abstract description 4
- 239000000935 antidepressant agent Substances 0.000 abstract description 2
- 229940005513 antidepressants Drugs 0.000 abstract description 2
- 229910052794 bromium Inorganic materials 0.000 abstract description 2
- UZFMOKQJFYMBGY-UHFFFAOYSA-N 4-hydroxy-TEMPO Chemical compound CC1(C)CC(O)CC(C)(C)N1[O] UZFMOKQJFYMBGY-UHFFFAOYSA-N 0.000 abstract 1
- ZZOCLVONRFEUPJ-UHFFFAOYSA-N 7-hydroxy-4-(6-methoxynaphthalen-2-yl)chromen-2-one Chemical compound C1=C(O)C=CC2=C1OC(=O)C=C2C1=CC2=CC=C(OC)C=C2C=C1 ZZOCLVONRFEUPJ-UHFFFAOYSA-N 0.000 abstract 1
- ZMYVMHIXLOLYNY-UHFFFAOYSA-N 7-hydroxy-4-naphthalen-1-yl-3,4-dihydrochromen-2-one Chemical compound C1=CC=C2C(C3C4=CC=C(C=C4OC(=O)C3)O)=CC=CC2=C1 ZMYVMHIXLOLYNY-UHFFFAOYSA-N 0.000 abstract 1
- 230000001539 anorectic effect Effects 0.000 abstract 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 1
- 230000015572 biosynthetic process Effects 0.000 abstract 1
- 150000002790 naphthalenes Chemical class 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 61
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 239000002904 solvent Substances 0.000 description 17
- 239000003921 oil Substances 0.000 description 16
- 235000019198 oils Nutrition 0.000 description 16
- 239000002253 acid Substances 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 238000010992 reflux Methods 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical compound C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 4
- QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 235000001671 coumarin Nutrition 0.000 description 3
- 229960000956 coumarin Drugs 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 3
- 230000000051 modifying effect Effects 0.000 description 3
- 230000036651 mood Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 230000003389 potentiating effect Effects 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- 150000003624 transition metals Chemical class 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 2
- MSTDXOZUKAQDRL-UHFFFAOYSA-N 4-Chromanone Chemical compound C1=CC=C2C(=O)CCOC2=C1 MSTDXOZUKAQDRL-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- KYNSBQPICQTCGU-UHFFFAOYSA-N Benzopyrane Chemical compound C1=CC=C2C=CCOC2=C1 KYNSBQPICQTCGU-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000001430 anti-depressive effect Effects 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 239000007892 solid unit dosage form Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- 125000000872 2-diethylaminoethoxy group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003635 2-dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- JKHCQUMNIXEDBL-UHFFFAOYSA-N 4-(6-methoxynaphthalen-2-yl)-2,2-dimethylchromen-7-ol Chemical compound OC1=CC=C2C(C3=CC4=CC=C(C=C4C=C3)OC)=CC(C)(C)OC2=C1 JKHCQUMNIXEDBL-UHFFFAOYSA-N 0.000 description 1
- IUDQLJURPDAQQQ-UHFFFAOYSA-N 4-naphthalen-1-ylchromen-2-one Chemical compound C12=CC=CC=C2OC(=O)C=C1C1=CC=CC2=CC=CC=C12 IUDQLJURPDAQQQ-UHFFFAOYSA-N 0.000 description 1
- KQTGCJMBUBYSLL-UHFFFAOYSA-N 4-piperidin-1-ylmorpholine Chemical compound C1CCCCN1N1CCOCC1 KQTGCJMBUBYSLL-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- IJVCBIVNEUVTNW-UHFFFAOYSA-M ClC=1C=C(C2=CC=CC=C2C=1)[Mg]Br Chemical compound ClC=1C=C(C2=CC=CC=C2C=1)[Mg]Br IJVCBIVNEUVTNW-UHFFFAOYSA-M 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 101100230891 Drosophila melanogaster Hen1 gene Proteins 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 208000034972 Sudden Infant Death Diseases 0.000 description 1
- 206010042440 Sudden infant death syndrome Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- HAFKDFYJKIZMCD-UHFFFAOYSA-M [Br-].C1=CC=C2C(F)=CC=C([Mg+])C2=C1 Chemical compound [Br-].C1=CC=C2C(F)=CC=C([Mg+])C2=C1 HAFKDFYJKIZMCD-UHFFFAOYSA-M 0.000 description 1
- PZIIGUMPOSVMSD-UHFFFAOYSA-M [Br-].C1=CC=C2C([Mg+])=CC=CC2=C1 Chemical compound [Br-].C1=CC=C2C([Mg+])=CC=CC2=C1 PZIIGUMPOSVMSD-UHFFFAOYSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 229940008309 acetone / ethanol Drugs 0.000 description 1
- MVHDFUNHBRWPEV-UHFFFAOYSA-N acetyl 1-ethyl-6-methoxynaphthalene-2-carboxylate Chemical compound COC1=CC=C2C(CC)=C(C(=O)OC(C)=O)C=CC2=C1 MVHDFUNHBRWPEV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000000578 anorexic effect Effects 0.000 description 1
- 229940124332 anorexigenic agent Drugs 0.000 description 1
- 230000002891 anorexigenic effect Effects 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 235000019789 appetite Nutrition 0.000 description 1
- 239000002830 appetite depressant Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- BXWPGZLRGRRMPR-UHFFFAOYSA-N ethyl 3-(6-methoxynaphthalen-2-yl)-3-oxopropanoate Chemical compound C1=C(OC)C=CC2=CC(C(=O)CC(=O)OCC)=CC=C21 BXWPGZLRGRRMPR-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000006277 halobenzyl group Chemical group 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/06—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2
- C07D311/08—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring
- C07D311/16—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 2 not hydrogenated in the hetero ring substituted in position 7
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrane Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB30352/75A GB1497161A (en) | 1975-07-19 | 1975-07-19 | Naphthyl derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42403L IE42403L (en) | 1977-01-19 |
| IE42403B1 true IE42403B1 (en) | 1980-07-30 |
Family
ID=10306288
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE99/76A IE42403B1 (en) | 1975-07-19 | 1976-01-19 | Naphthyl derivatives |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4079066A (enExample) |
| JP (1) | JPS5212150A (enExample) |
| AU (1) | AU497409B2 (enExample) |
| BE (1) | BE837950A (enExample) |
| CA (1) | CA1072554A (enExample) |
| CH (1) | CH619208A5 (enExample) |
| DE (1) | DE2603178A1 (enExample) |
| DK (1) | DK34276A (enExample) |
| ES (1) | ES444765A1 (enExample) |
| FR (2) | FR2318628A1 (enExample) |
| GB (1) | GB1497161A (enExample) |
| IE (1) | IE42403B1 (enExample) |
| NL (1) | NL7600846A (enExample) |
| SE (1) | SE422794B (enExample) |
| ZA (1) | ZA761954B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1493998A (en) * | 1975-06-03 | 1977-12-07 | Beecham Group Ltd | Propanolamine derivatives |
| FR2608942B1 (fr) * | 1986-12-31 | 1991-01-11 | Centre Nat Rech Scient | Procede de preparation de systemes colloidaux dispersibles d'une substance, sous forme de nanocapsules |
| EP0549729B1 (en) * | 1990-09-07 | 1997-12-17 | Schering Corporation | Antiviral compounds and antihypertensive compounds |
| JPH06324511A (ja) * | 1993-05-14 | 1994-11-25 | Brother Ind Ltd | 感光性マイクロカプセル型トナー |
| JP3362745B2 (ja) * | 1993-07-28 | 2003-01-07 | ブラザー工業株式会社 | 感光性マイクロカプセル型トナー |
| ATE418980T1 (de) * | 2004-10-22 | 2009-01-15 | Dsm Ip Assets Bv | Neue mittel zur prophylaxe und behandlung von erkrankungen in zusammenhang mit beeinträchtigter neurotransmission |
| CN100393716C (zh) * | 2006-05-18 | 2008-06-11 | 中国药科大学 | 香豆素衍生物、其制备方法及作为α1受体拮抗剂的用途 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB953194A (en) * | 1960-11-08 | 1964-03-25 | Smith Kline French Lab | New benzylindene derivatives and method of preparing the same |
| US3388121A (en) * | 1964-12-16 | 1968-06-11 | Squibb & Sons Inc | Tetrahydrobenzocyclohexene and cycloheptene ethers |
-
1975
- 1975-07-19 GB GB30352/75A patent/GB1497161A/en not_active Expired
-
1976
- 1976-01-19 IE IE99/76A patent/IE42403B1/en unknown
- 1976-01-22 SE SE7600673A patent/SE422794B/xx unknown
- 1976-01-26 US US05/652,134 patent/US4079066A/en not_active Expired - Lifetime
- 1976-01-27 BE BE163838A patent/BE837950A/xx unknown
- 1976-01-28 DE DE19762603178 patent/DE2603178A1/de not_active Withdrawn
- 1976-01-28 FR FR7602247A patent/FR2318628A1/fr active Granted
- 1976-01-28 NL NL7600846A patent/NL7600846A/xx not_active Application Discontinuation
- 1976-01-28 CA CA244,443A patent/CA1072554A/en not_active Expired
- 1976-01-28 DK DK34276A patent/DK34276A/da not_active Application Discontinuation
- 1976-01-29 ES ES444765A patent/ES444765A1/es not_active Expired
- 1976-01-29 JP JP51008860A patent/JPS5212150A/ja active Pending
- 1976-01-29 CH CH112076A patent/CH619208A5/de not_active IP Right Cessation
- 1976-01-29 AU AU10664/76A patent/AU497409B2/en not_active Expired
- 1976-03-31 ZA ZA761954A patent/ZA761954B/xx unknown
- 1976-05-05 FR FR7613359A patent/FR2318624A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CA1072554A (en) | 1980-02-26 |
| NL7600846A (nl) | 1977-01-21 |
| BE837950A (fr) | 1976-07-27 |
| JPS5212150A (en) | 1977-01-29 |
| ES444765A1 (es) | 1977-12-01 |
| US4079066A (en) | 1978-03-14 |
| CH619208A5 (enExample) | 1980-09-15 |
| SE7600673L (sv) | 1977-01-20 |
| DK34276A (da) | 1977-01-20 |
| IE42403L (en) | 1977-01-19 |
| FR2318624B1 (enExample) | 1979-06-29 |
| FR2318624A1 (fr) | 1977-02-18 |
| ZA761954B (en) | 1977-04-27 |
| FR2318628B1 (enExample) | 1979-09-28 |
| GB1497161A (en) | 1978-01-05 |
| AU497409B2 (en) | 1978-12-14 |
| FR2318628A1 (fr) | 1977-02-18 |
| AU1066476A (en) | 1977-08-04 |
| SE422794B (sv) | 1982-03-29 |
| DE2603178A1 (de) | 1977-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4113869A (en) | Tetrahydroisoquinoline basic ethers and pharmaceutical compositions and methods employing them | |
| IE41539B1 (en) | Chroman derivatives | |
| CA1095517A (en) | 3-amino-2-hydroxy-propoxy-chroman derivatives | |
| US6670359B2 (en) | Substituted chroman derivatives | |
| NZ225520A (en) | Benzopyran derivatives and pharmaceutical compositions | |
| WO2011027289A1 (en) | Chromone derivatives, a process for their preparation and their therapeutic applications | |
| EP1025096B1 (en) | Substituted chroman derivatives | |
| JPS6112910B2 (enExample) | ||
| US4080335A (en) | Anorexic chromans | |
| IE45727B1 (en) | Aralkenylaminomethyl-naphthalene derivatives | |
| AU2006275587A1 (en) | Method for enantioselective hydrogenation of chromenes | |
| US4138494A (en) | 3-Phenylindolines | |
| HU202853B (en) | Process for producing 3-aminodihydrobenzo(b)pyran and benzothiopyran derivatives and pharmaceutical compositions comprising same as active ingredient | |
| IE42403B1 (en) | Naphthyl derivatives | |
| US4130646A (en) | 1,2,3,4-Tetrahydro-2-((4-(phenyl)-1-piperazinyl)methyl)-1-naphthalenols and derivatives and analogs thereof | |
| US3506654A (en) | Benzylidene derivatives of chromene,thiochromene,quinoline,and n-alkyl quinoline and corresponding benzyl tertiary carbinol intermediates | |
| USRE30739E (en) | Anorexic chromans | |
| CA1049530A (en) | Diphenylpropylamines | |
| US4146539A (en) | Anorexic chromans | |
| US4303656A (en) | Aminomethyl chromans | |
| US2519863A (en) | Conversion of beta-, gamma-, and delta-tocopherol to alpha-tocopherol by aminoalkylation and reduction | |
| US5641785A (en) | Oxazoloquinolinone derivatives, their preparation and their therapeutic application as inhibitors of monoamine oxidase | |
| US4167515A (en) | Anorexic chromans | |
| Varma et al. | Reduction of α, β‐unsaturated nitroalkenes with borane and borohydrides. A convenient route to 3‐nitro‐, 3‐hydroxylamino‐, and 3‐amino‐2h‐1‐benzopyran derivatives | |
| US3743659A (en) | Substituted isochromans and processes therefor |