CH617802A5 - - Google Patents
Download PDFInfo
- Publication number
- CH617802A5 CH617802A5 CH547377A CH547377A CH617802A5 CH 617802 A5 CH617802 A5 CH 617802A5 CH 547377 A CH547377 A CH 547377A CH 547377 A CH547377 A CH 547377A CH 617802 A5 CH617802 A5 CH 617802A5
- Authority
- CH
- Switzerland
- Prior art keywords
- switch
- lamp
- discharge
- getter
- voltage
- Prior art date
Links
- 239000001257 hydrogen Substances 0.000 claims description 50
- 229910052739 hydrogen Inorganic materials 0.000 claims description 50
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 48
- 238000010438 heat treatment Methods 0.000 claims description 26
- 230000002441 reversible effect Effects 0.000 claims description 13
- 238000004804 winding Methods 0.000 claims description 13
- 239000003990 capacitor Substances 0.000 claims description 9
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 8
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 5
- 229910052756 noble gas Inorganic materials 0.000 claims description 5
- 229910052786 argon Inorganic materials 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 229910052753 mercury Inorganic materials 0.000 claims description 2
- 229910052754 neon Inorganic materials 0.000 claims description 2
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 claims description 2
- 230000011664 signaling Effects 0.000 claims description 2
- 238000001816 cooling Methods 0.000 claims 3
- 230000015556 catabolic process Effects 0.000 claims 1
- 230000007423 decrease Effects 0.000 claims 1
- 230000000694 effects Effects 0.000 claims 1
- 238000005485 electric heating Methods 0.000 claims 1
- 238000012423 maintenance Methods 0.000 claims 1
- 239000000463 material Substances 0.000 claims 1
- 230000001681 protective effect Effects 0.000 claims 1
- 239000004065 semiconductor Substances 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- 230000007704 transition Effects 0.000 claims 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- ORQBXQOJMQIAOY-UHFFFAOYSA-N nobelium Chemical compound [No] ORQBXQOJMQIAOY-UHFFFAOYSA-N 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 241000220317 Rosa Species 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000012217 deletion Methods 0.000 description 1
- 230000037430 deletion Effects 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- -1 titanium hydride Chemical compound 0.000 description 1
- 229910000048 titanium hydride Inorganic materials 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/54—Igniting arrangements, e.g. promoting ionisation for starting
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J17/00—Gas-filled discharge tubes with solid cathode
- H01J17/02—Details
- H01J17/22—Means for obtaining or maintaining the desired pressure within the tube
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K17/00—Electronic switching or gating, i.e. not by contact-making and –breaking
- H03K17/51—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used
- H03K17/52—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used by the use, as active elements, of gas-filled tubes
Landscapes
- Discharge Lamp (AREA)
- Circuit Arrangements For Discharge Lamps (AREA)
- Gas-Filled Discharge Tubes (AREA)
- Common Detailed Techniques For Electron Tubes Or Discharge Tubes (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7604759,A NL171755C (nl) | 1976-05-05 | 1976-05-05 | Elektrische inrichting voorzien van een als ontladingsbuis uitgevoerde schakelaar alsmede schakelaar, in het bijzonder geschikt voor een dergelijke elektrische inrichting. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH617802A5 true CH617802A5 (enExample) | 1980-06-13 |
Family
ID=19826128
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH547377A CH617802A5 (enExample) | 1976-05-05 | 1977-05-02 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4260934A (enExample) |
| JP (1) | JPS52134372A (enExample) |
| AT (1) | AT375789B (enExample) |
| BE (1) | BE854228A (enExample) |
| BR (1) | BR7702812A (enExample) |
| CA (1) | CA1081307A (enExample) |
| CH (1) | CH617802A5 (enExample) |
| DD (1) | DD129988A5 (enExample) |
| DE (1) | DE2718166C3 (enExample) |
| ES (1) | ES458406A1 (enExample) |
| FR (1) | FR2350681A1 (enExample) |
| GB (1) | GB1533198A (enExample) |
| HU (1) | HU182658B (enExample) |
| IT (1) | IT1085887B (enExample) |
| NL (1) | NL171755C (enExample) |
| SE (1) | SE416169B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU736374A1 (ru) * | 1977-06-06 | 1980-05-25 | Предприятие П/Я Р-6517 | Способ отключени посто нного тока и устройство дл его осуществлени |
| NL8002891A (nl) * | 1980-05-20 | 1981-12-16 | Philips Nv | Glimstarter. |
| US4401869A (en) * | 1981-10-05 | 1983-08-30 | Westinghouse Electric Corp. | Hermetically sealed electrical switch with pressure regulating getter means |
| GB8611660D0 (en) * | 1986-05-13 | 1986-10-29 | British Aerospace | Pulse generating circuits |
| JPH0536459A (ja) * | 1991-07-31 | 1993-02-12 | Okaya Electric Ind Co Ltd | 放電型サージ吸収素子 |
| US5698943A (en) * | 1996-03-22 | 1997-12-16 | Osram Sylvania Inc. | Starting flag for use in mercury discharge lamp and lamp employing same |
| CN100538990C (zh) * | 2003-03-18 | 2009-09-09 | 皇家飞利浦电子股份有限公司 | 气体放电灯 |
| EP1831917A2 (en) * | 2004-12-21 | 2007-09-12 | Koninklijke Philips Electronics N.V. | Low-pressure mercury vapor discharge lamp |
| DE102013112985A1 (de) * | 2013-11-25 | 2015-05-28 | Von Ardenne Gmbh | Blitzlampe mit Gasfüllung zum Unterdrücken einer Selbstzündung |
| CN113130248B (zh) * | 2019-12-30 | 2022-08-19 | 西安西电高压开关有限责任公司 | 一种组合式旁路开关 |
| GB2605163A (en) * | 2021-03-24 | 2022-09-28 | Leybold Gmbh | Getter pump |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE479688C (de) * | 1920-10-23 | 1929-07-20 | Telefunken Gmbh | Elektrisches Gasentladungsrelais |
| NL31015C (enExample) * | 1929-10-19 | |||
| US2456900A (en) * | 1944-09-02 | 1948-12-21 | Westinghouse Electric Corp | Spark-gap device and electrode therefor |
| GB766064A (en) * | 1953-03-30 | 1957-01-16 | Nat Res Dev | Improvements in electron discharge tubes |
| FR1321392A (fr) * | 1962-05-10 | 1963-03-15 | Thomson Houston Comp Francaise | Commutateur dans le vide |
| US3758803A (en) * | 1972-02-18 | 1973-09-11 | M O Valve Co Ltd | Electric discharge devices |
| NL7315641A (nl) * | 1973-11-15 | 1975-05-20 | Philips Nv | Hogedrukgasontladingslamp. |
-
1976
- 1976-05-05 NL NLAANVRAGE7604759,A patent/NL171755C/xx not_active IP Right Cessation
-
1977
- 1977-04-23 DE DE2718166A patent/DE2718166C3/de not_active Expired
- 1977-04-29 US US05/792,138 patent/US4260934A/en not_active Expired - Lifetime
- 1977-05-02 JP JP5006077A patent/JPS52134372A/ja active Granted
- 1977-05-02 SE SE7705024A patent/SE416169B/xx not_active IP Right Cessation
- 1977-05-02 GB GB18214/77A patent/GB1533198A/en not_active Expired
- 1977-05-02 BR BR7702812A patent/BR7702812A/pt unknown
- 1977-05-02 CH CH547377A patent/CH617802A5/de not_active IP Right Cessation
- 1977-05-02 IT IT23091/77A patent/IT1085887B/it active
- 1977-05-02 HU HU77PI574A patent/HU182658B/hu unknown
- 1977-05-03 BE BE177242A patent/BE854228A/xx not_active IP Right Cessation
- 1977-05-03 ES ES458406A patent/ES458406A1/es not_active Expired
- 1977-05-03 DD DD7700198729A patent/DD129988A5/xx unknown
- 1977-05-03 AT AT0313477A patent/AT375789B/de not_active IP Right Cessation
- 1977-05-03 FR FR7713330A patent/FR2350681A1/fr active Granted
- 1977-05-04 CA CA277,665A patent/CA1081307A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT375789B (de) | 1984-09-10 |
| ES458406A1 (es) | 1978-03-16 |
| NL7604759A (nl) | 1977-11-08 |
| NL171755B (nl) | 1982-12-01 |
| FR2350681A1 (fr) | 1977-12-02 |
| DE2718166B2 (de) | 1979-05-17 |
| JPS5748820B2 (enExample) | 1982-10-18 |
| US4260934A (en) | 1981-04-07 |
| BR7702812A (pt) | 1978-02-21 |
| ATA313477A (de) | 1984-01-15 |
| HU182658B (en) | 1984-02-28 |
| JPS52134372A (en) | 1977-11-10 |
| CA1081307A (en) | 1980-07-08 |
| DE2718166A1 (de) | 1977-11-10 |
| SE7705024L (sv) | 1977-11-06 |
| GB1533198A (en) | 1978-11-22 |
| DE2718166C3 (de) | 1980-01-24 |
| FR2350681B1 (enExample) | 1981-09-18 |
| BE854228A (fr) | 1977-11-03 |
| NL171755C (nl) | 1983-05-02 |
| DD129988A5 (de) | 1978-02-22 |
| IT1085887B (it) | 1985-05-28 |
| SE416169B (sv) | 1980-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2925691C2 (de) | Schaltungsanordnung zum Zünden und Speisen mindestens einer Gas- und/oder Dampfentladungslampe | |
| DE2718166C3 (de) | Schaltröhre und ihre Verwendung | |
| DE740922C (de) | Anordnung zum Betrieb einer wassergekuehlten Quecksilberhochdruckentladungslampe | |
| DE69007314T2 (de) | Schaltanordnung. | |
| DE2517818A1 (de) | Zuend- und betriebseinrichtung fuer eine hochdruckentladungslampe | |
| EP0178735B1 (de) | Schaltungsanordnung zum Zünden und Betrieb von Gasentladungs-lampen | |
| DE2008803A1 (de) | Schaltung für dauerbrennende Gasentladungslampen | |
| DE3536385C2 (enExample) | ||
| DE2746413C2 (de) | Niederdrucknatriumdampfentladungslampe | |
| DE668589C (de) | UEberspannungskurzschliesser, insbesondere Strombruecke fuer elektrische Reihengluehlampen | |
| DE2610394C2 (de) | Anordnung zum Betrieb einer Metalldampfentladungslampe und Metalldampfentladungslampe für diese Anordnung | |
| DE69303070T2 (de) | Hochdruckentladungslampe | |
| DE906243C (de) | Mit festen Gluehelektroden ausgeruestete elektrische Metalldampf- und Edelgas-Hoechstdruckentladungslampe und Verfahren zu ihrem Betriebe | |
| DE7810591U1 (de) | Gas- und/oder dampfentladungslampe | |
| CH222067A (de) | Einrichtung mit mindestens einer elektrischen Entladungsröhre. | |
| DE693998C (de) | chdruckdampfentladungslampe | |
| DE961123C (de) | Elektrische Hochdruckentladungslampe | |
| DE929917C (de) | Zuendanordnung fuer gas- oder dampfgefuellte elektrische Entladungsgefaesse, insbesondere elektrische Entladungslampen | |
| DE901084C (de) | Zuend- und Betriebseinrichtung fuer elektrische Leuchtstofflampen | |
| DE819122C (de) | Glimmentladungsroehre mit wenigstens einer Bimetallelektrode, insbesondere zum Zuenden von Entladungsroehren | |
| DE679073C (de) | Einrichtung zum Abschalten eines elektrischen Stromkreises bei Unter- oder UEberschreiten von Sollwerten der Stromstaerke | |
| DE1199399B (de) | Schaltungsanordnung zum starterlosen Zuenden von Gasentladungslampen | |
| DE711438C (de) | Elektrische Mischlichtlampe, bestehend aus einer Hochdruckentladungsroehre und einem als Vorschaltwiderstand dienenden Gluehdraht | |
| AT206991B (de) | Zündschalter mit elektrischer Gasentladung | |
| DE871789C (de) | Verfahren zum Betriebe einer elektrischen UEberdruckentladungslampe mit Gluehelektroden und rohrfoermigem Entladungsgefaess |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |