HU182658B - Electric device with a switch formed for a discharge tube - Google Patents
Electric device with a switch formed for a discharge tube Download PDFInfo
- Publication number
- HU182658B HU182658B HU77PI574A HUPI000574A HU182658B HU 182658 B HU182658 B HU 182658B HU 77PI574 A HU77PI574 A HU 77PI574A HU PI000574 A HUPI000574 A HU PI000574A HU 182658 B HU182658 B HU 182658B
- Authority
- HU
- Hungary
- Prior art keywords
- switch
- discharge tube
- discharge
- getter
- hydrogen
- Prior art date
Links
- 239000001257 hydrogen Substances 0.000 claims abstract description 62
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 62
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 60
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 18
- 230000002441 reversible effect Effects 0.000 claims description 15
- 229910052786 argon Inorganic materials 0.000 claims description 9
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 6
- 229910052753 mercury Inorganic materials 0.000 claims description 4
- 238000005485 electric heating Methods 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 3
- 229910052756 noble gas Inorganic materials 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 abstract description 20
- 238000004804 winding Methods 0.000 abstract description 15
- 239000003990 capacitor Substances 0.000 abstract description 12
- 239000007789 gas Substances 0.000 abstract description 5
- 229910052719 titanium Inorganic materials 0.000 abstract description 2
- 229910052726 zirconium Inorganic materials 0.000 abstract description 2
- 239000007858 starting material Substances 0.000 abstract 1
- 230000008901 benefit Effects 0.000 description 15
- 230000007423 decrease Effects 0.000 description 8
- 230000000087 stabilizing effect Effects 0.000 description 5
- 239000004020 conductor Substances 0.000 description 4
- -1 titanium hydride Chemical compound 0.000 description 4
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 229910052754 neon Inorganic materials 0.000 description 3
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229910000048 titanium hydride Inorganic materials 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- 230000008033 biological extinction Effects 0.000 description 2
- 229910000423 chromium oxide Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000004065 semiconductor Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 101150059976 cap7 gene Proteins 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
- 229910052845 zircon Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/54—Igniting arrangements, e.g. promoting ionisation for starting
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J17/00—Gas-filled discharge tubes with solid cathode
- H01J17/02—Details
- H01J17/22—Means for obtaining or maintaining the desired pressure within the tube
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K17/00—Electronic switching or gating, i.e. not by contact-making and –breaking
- H03K17/51—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used
- H03K17/52—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used by the use, as active elements, of gas-filled tubes
Landscapes
- Discharge Lamp (AREA)
- Circuit Arrangements For Discharge Lamps (AREA)
- Gas-Filled Discharge Tubes (AREA)
- Common Detailed Techniques For Electron Tubes Or Discharge Tubes (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7604759,A NL171755C (nl) | 1976-05-05 | 1976-05-05 | Elektrische inrichting voorzien van een als ontladingsbuis uitgevoerde schakelaar alsmede schakelaar, in het bijzonder geschikt voor een dergelijke elektrische inrichting. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU182658B true HU182658B (en) | 1984-02-28 |
Family
ID=19826128
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU77PI574A HU182658B (en) | 1976-05-05 | 1977-05-02 | Electric device with a switch formed for a discharge tube |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4260934A (enExample) |
| JP (1) | JPS52134372A (enExample) |
| AT (1) | AT375789B (enExample) |
| BE (1) | BE854228A (enExample) |
| BR (1) | BR7702812A (enExample) |
| CA (1) | CA1081307A (enExample) |
| CH (1) | CH617802A5 (enExample) |
| DD (1) | DD129988A5 (enExample) |
| DE (1) | DE2718166C3 (enExample) |
| ES (1) | ES458406A1 (enExample) |
| FR (1) | FR2350681A1 (enExample) |
| GB (1) | GB1533198A (enExample) |
| HU (1) | HU182658B (enExample) |
| IT (1) | IT1085887B (enExample) |
| NL (1) | NL171755C (enExample) |
| SE (1) | SE416169B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU736374A1 (ru) * | 1977-06-06 | 1980-05-25 | Предприятие П/Я Р-6517 | Способ отключени посто нного тока и устройство дл его осуществлени |
| NL8002891A (nl) * | 1980-05-20 | 1981-12-16 | Philips Nv | Glimstarter. |
| US4401869A (en) * | 1981-10-05 | 1983-08-30 | Westinghouse Electric Corp. | Hermetically sealed electrical switch with pressure regulating getter means |
| GB8611660D0 (en) * | 1986-05-13 | 1986-10-29 | British Aerospace | Pulse generating circuits |
| JPH0536459A (ja) * | 1991-07-31 | 1993-02-12 | Okaya Electric Ind Co Ltd | 放電型サージ吸収素子 |
| US5698943A (en) * | 1996-03-22 | 1997-12-16 | Osram Sylvania Inc. | Starting flag for use in mercury discharge lamp and lamp employing same |
| DE602004008259T2 (de) * | 2003-03-18 | 2008-05-15 | Philips Intellectual Property & Standards Gmbh | Gasentladungslampe |
| WO2006067718A2 (en) | 2004-12-21 | 2006-06-29 | Koninklijke Philips Electronics N.V. | Low-pressure mercury vapor discharge lamp |
| DE102013112985A1 (de) * | 2013-11-25 | 2015-05-28 | Von Ardenne Gmbh | Blitzlampe mit Gasfüllung zum Unterdrücken einer Selbstzündung |
| CN113130248B (zh) * | 2019-12-30 | 2022-08-19 | 西安西电高压开关有限责任公司 | 一种组合式旁路开关 |
| GB2605163A (en) * | 2021-03-24 | 2022-09-28 | Leybold Gmbh | Getter pump |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE479688C (de) * | 1920-10-23 | 1929-07-20 | Telefunken Gmbh | Elektrisches Gasentladungsrelais |
| NL31015C (enExample) * | 1929-10-19 | |||
| US2456900A (en) * | 1944-09-02 | 1948-12-21 | Westinghouse Electric Corp | Spark-gap device and electrode therefor |
| GB766064A (en) * | 1953-03-30 | 1957-01-16 | Nat Res Dev | Improvements in electron discharge tubes |
| FR1321392A (fr) * | 1962-05-10 | 1963-03-15 | Thomson Houston Comp Francaise | Commutateur dans le vide |
| US3758803A (en) * | 1972-02-18 | 1973-09-11 | M O Valve Co Ltd | Electric discharge devices |
| NL7315641A (nl) * | 1973-11-15 | 1975-05-20 | Philips Nv | Hogedrukgasontladingslamp. |
-
1976
- 1976-05-05 NL NLAANVRAGE7604759,A patent/NL171755C/xx not_active IP Right Cessation
-
1977
- 1977-04-23 DE DE2718166A patent/DE2718166C3/de not_active Expired
- 1977-04-29 US US05/792,138 patent/US4260934A/en not_active Expired - Lifetime
- 1977-05-02 SE SE7705024A patent/SE416169B/xx not_active IP Right Cessation
- 1977-05-02 IT IT23091/77A patent/IT1085887B/it active
- 1977-05-02 GB GB18214/77A patent/GB1533198A/en not_active Expired
- 1977-05-02 HU HU77PI574A patent/HU182658B/hu unknown
- 1977-05-02 CH CH547377A patent/CH617802A5/de not_active IP Right Cessation
- 1977-05-02 JP JP5006077A patent/JPS52134372A/ja active Granted
- 1977-05-02 BR BR7702812A patent/BR7702812A/pt unknown
- 1977-05-03 FR FR7713330A patent/FR2350681A1/fr active Granted
- 1977-05-03 BE BE177242A patent/BE854228A/xx not_active IP Right Cessation
- 1977-05-03 DD DD7700198729A patent/DD129988A5/xx unknown
- 1977-05-03 ES ES458406A patent/ES458406A1/es not_active Expired
- 1977-05-03 AT AT0313477A patent/AT375789B/de not_active IP Right Cessation
- 1977-05-04 CA CA277,665A patent/CA1081307A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DD129988A5 (de) | 1978-02-22 |
| GB1533198A (en) | 1978-11-22 |
| CA1081307A (en) | 1980-07-08 |
| DE2718166B2 (de) | 1979-05-17 |
| FR2350681A1 (fr) | 1977-12-02 |
| ATA313477A (de) | 1984-01-15 |
| SE7705024L (sv) | 1977-11-06 |
| NL171755C (nl) | 1983-05-02 |
| US4260934A (en) | 1981-04-07 |
| SE416169B (sv) | 1980-12-01 |
| ES458406A1 (es) | 1978-03-16 |
| DE2718166A1 (de) | 1977-11-10 |
| BR7702812A (pt) | 1978-02-21 |
| DE2718166C3 (de) | 1980-01-24 |
| AT375789B (de) | 1984-09-10 |
| IT1085887B (it) | 1985-05-28 |
| JPS52134372A (en) | 1977-11-10 |
| JPS5748820B2 (enExample) | 1982-10-18 |
| CH617802A5 (enExample) | 1980-06-13 |
| NL171755B (nl) | 1982-12-01 |
| NL7604759A (nl) | 1977-11-08 |
| FR2350681B1 (enExample) | 1981-09-18 |
| BE854228A (fr) | 1977-11-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4151445A (en) | Instant light lamp control circuit | |
| US4135114A (en) | Starting device for discharge lamp | |
| US4170744A (en) | Combination discharge-incandescent lamp with thermal switch control | |
| HU182658B (en) | Electric device with a switch formed for a discharge tube | |
| EP0054272B1 (en) | Discharge lamp with integral starter | |
| EP0358502A1 (en) | Ballast circuit | |
| NL7809055A (nl) | Gas- en/of dampontladingslamp. | |
| US2284103A (en) | Thermal switch | |
| US3740609A (en) | Arrangement for the ignition and alternating current supply for a gas-and/or vapor discharge lamp | |
| EP0054271B1 (en) | Discharge lamp starting and operating circuit | |
| US2740861A (en) | Glow type thermal switch | |
| EP1210727A1 (en) | High-pressure discharge lamp | |
| EP0990374B1 (en) | Starter circuit | |
| EP0054270B1 (en) | Starter and discharge lamp starting circuit | |
| JPS61116749A (ja) | 高圧ナトリウム放電灯の起動方法 | |
| US2784347A (en) | Electric high pressure discharge lamps | |
| US2492575A (en) | Safety starter circuit and unit | |
| CA2057271A1 (en) | High pressure discharge lamp | |
| US3749968A (en) | Incandescent-high intensity discharge lamp lighting system | |
| US5317232A (en) | AC/DC-operable glow discharge starter having two bimetals | |
| US5097177A (en) | Glow starter with a faster turn on time for a fluorescent tube | |
| US2398128A (en) | Starting control for electric discharge devices | |
| JPH0629006A (ja) | 高圧放電ランプ | |
| JPS6223438B2 (enExample) | ||
| SU1746432A1 (ru) | Газоразр дна лампа высокого давлени |