CH575375A5 - - Google Patents
Info
- Publication number
- CH575375A5 CH575375A5 CH774072A CH774072A CH575375A5 CH 575375 A5 CH575375 A5 CH 575375A5 CH 774072 A CH774072 A CH 774072A CH 774072 A CH774072 A CH 774072A CH 575375 A5 CH575375 A5 CH 575375A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- group
- stands
- compounds
- compound
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 44
- 238000000034 method Methods 0.000 claims description 15
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000001302 tertiary amino group Chemical group 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 17
- -1 piperazinyl radical Chemical class 0.000 description 12
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 11
- 239000002904 solvent Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- OBUUFWIMEGVAQS-UHFFFAOYSA-N Pleuromutenol Natural products CC1C(O)C(C)(C=C)CC(O)C2(C)C(C)CCC31C2C(=O)CC3 OBUUFWIMEGVAQS-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229960002771 retapamulin Drugs 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- HYSZWUPCSXTPSX-UHFFFAOYSA-N 2-(4-ethylpiperazin-1-yl)ethanol Chemical compound CCN1CCN(CCO)CC1 HYSZWUPCSXTPSX-UHFFFAOYSA-N 0.000 description 1
- WEPLMSNXIMBXSO-UHFFFAOYSA-N 2-[4-(1-sulfanylethyl)piperazin-1-yl]ethanol Chemical compound CC(S)N1CCN(CCO)CC1 WEPLMSNXIMBXSO-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- XMBZUNHETOKKBH-UHFFFAOYSA-N Dihydro-Mutilin Natural products CC1C(O)C(CC)(C)CC(O)C2(C)C(C)CCC31CCC(=O)C32 XMBZUNHETOKKBH-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000204031 Mycoplasma Species 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 229940093495 ethanethiol Drugs 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethyl mercaptane Natural products CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- STZYTFJPGGDRJD-NHUWBDDWSA-N retapamulin Chemical compound C([C@H]([C@@]1(C)[C@@H](C[C@@](C)(C=C)[C@@H](O)[C@@H]2C)OC(=O)CS[C@@H]3C[C@H]4CC[C@H](N4C)C3)C)C[C@]32[C@H]1C(=O)CC3 STZYTFJPGGDRJD-NHUWBDDWSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- VOVUARRWDCVURC-UHFFFAOYSA-N thiirane Chemical compound C1CS1 VOVUARRWDCVURC-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 229940086542 triethylamine Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/51—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/57—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
- C07C323/58—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups with amino groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (41)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE789629D BE789629A (fr) | 1971-10-05 | Nouveaux derives de la pleuromutiline, leur preparation et leurapplication en therapeutique | |
| CH774072A CH575375A5 (OSRAM) | 1972-05-25 | 1972-05-25 | |
| CH1019772A CH593911A5 (en) | 1972-05-25 | 1972-07-07 | Pleuromutilin derivs. - prepd. by benzoylating derivs. contg. a (4)-hydroxyalkyl-(1)-piperazinyl gp. |
| FI2645/72A FI58635C (fi) | 1971-10-05 | 1972-09-26 | Foerfarande foer framstaellning av nya antimikrobiska pleuromutiliner |
| DK475372AA DK139720B (da) | 1971-10-05 | 1972-09-26 | Analogifremgangsmåde til fremstilling af pleuromutiliner. |
| SE7212374A SE398348B (sv) | 1971-10-05 | 1972-09-26 | Forfarande for framstellning av substituerade pleuromutiliner |
| NO3453/72A NO136459C (no) | 1971-10-05 | 1972-09-27 | Analogifremgangsm}te for fremstilling av antimikrobielt virksomme pleuromutiliner. |
| NLAANVRAGE7213254,A NL177403C (nl) | 1971-10-05 | 1972-09-29 | Werkwijze voor het vervaardigen van een farmaceutisch preparaat met antimicrobiele werking op basis van een 14-desoxy-14-acetoxymutilinederivaat en werkwijze voor het bereiden van een verbinding geschikt voor toepassing bij voornoemde werkwijze. |
| PH13949A PH11870A (en) | 1971-10-05 | 1972-09-29 | 14-desoxy-14-(substituted acetoxy)mutilins,their pharmaceutical compositions and method inhibiting bacterial infection |
| DE2248237A DE2248237C2 (de) | 1971-10-05 | 1972-10-02 | Pleuromutilin-Derivate, deren Herstellung und pharmazeutische Zubereitung |
| DE2265666A DE2265666C2 (de) | 1971-10-05 | 1972-10-02 | Pleuromutilin-Derivate, deren Herstellung und pharmazeutische Zubereitung |
| GB4525972A GB1410505A (en) | 1971-10-05 | 1972-10-02 | Pleuromutilins |
| RO7281505A RO67478A (ro) | 1971-10-05 | 1972-10-03 | Procedeu pentru prepararea unor pleuromutiline |
| IE1339/72A IE37699B1 (en) | 1971-10-05 | 1972-10-03 | Novel pleuromutilins |
| RO7281506A RO67479A (ro) | 1971-10-05 | 1972-10-03 | Procedeu pentru prepararea unor pleuromutiline |
| CA153,116A CA979447A (en) | 1971-10-05 | 1972-10-03 | Pleuro mutilins |
| HUSA2407A HU168436B (OSRAM) | 1971-10-05 | 1972-10-03 | |
| BG023482A BG20773A3 (bg) | 1971-10-05 | 1972-10-04 | Метод за получаване на плевромутилини |
| JP9913872A JPS577147B2 (OSRAM) | 1971-10-05 | 1972-10-04 | |
| IL40494A IL40494A (en) | 1971-10-05 | 1972-10-04 | Pleuromutilins,their production and pharmaceutical compositions containing them |
| OA54711A OA04192A (fr) | 1971-10-05 | 1972-10-04 | Procédé de préparation de nouveaux dérivés de la pleuromutiline. |
| BG023481A BG21386A3 (bg) | 1971-10-05 | 1972-10-04 | Метод за получаване на плевромутилини |
| FR7235340A FR2157828B1 (OSRAM) | 1971-10-05 | 1972-10-05 | |
| DD166051A DD100706A5 (OSRAM) | 1971-10-05 | 1972-10-05 | |
| NO4618/73A NO137440C (no) | 1971-10-05 | 1973-12-04 | Analogifremgangsmaate for fremstilling av terapeutisk aktive pleuromutiliner |
| NO4617/73A NO136837C (no) | 1971-10-05 | 1973-12-04 | Analogifremgangsm}te for fremstilling av terapeutisk aktive pleuromutiliner |
| SU1989476A SU520047A3 (ru) | 1972-05-25 | 1974-01-25 | Способ получени производных плевромутилина или их солей, или их четвертичных солей |
| AT736074A AT341666B (de) | 1972-05-25 | 1974-09-12 | Verfahren zur herstellung neuer pleuromutiline |
| ES432501A ES432501A1 (es) | 1972-05-25 | 1974-12-02 | Procedimiento para la obtencion de pleuromutilinas. |
| US05/606,430 US4032530A (en) | 1971-10-05 | 1975-08-21 | Certain pleuromutilins |
| SE7509457A SE419984B (sv) | 1971-10-05 | 1975-08-26 | Forfarande for framstellning av nya pleuromutiliner |
| SE7509456A SE424074B (sv) | 1971-10-05 | 1975-08-26 | Forfarande for framstellning av substituerade pleuromutiliner |
| CS76193A CS219308B2 (cs) | 1972-05-25 | 1976-01-12 | Způsob výroby nových pleuromutilinů |
| DK498176A DK142700B (da) | 1971-10-05 | 1976-11-03 | Analogifremgangsmåde til fremstilling af pleuromutiliner. |
| DK498076A DK140592B (da) | 1971-10-05 | 1976-11-03 | Analogifremgangsmåde til fremstilling af pleuromutiliner eller syreadditionssalte eller kvaternære salte deraf. |
| US05/758,133 US4107164A (en) | 1971-10-05 | 1977-01-10 | Certain pleuromulilin ester derivatives |
| US05/912,497 US4208326A (en) | 1971-10-05 | 1978-06-05 | Pleuromutilin esters |
| YU173879A YU37127B (en) | 1972-05-25 | 1979-07-16 | Process for preparing new pleuromutilins |
| US06/098,333 US4278674A (en) | 1971-10-05 | 1979-11-29 | Substituted 14-desoxy-mutilin compositions |
| FI794060A FI60198C (fi) | 1971-10-05 | 1979-12-27 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara pleuromutiliner |
| FI794061A FI60204C (fi) | 1971-10-05 | 1979-12-27 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara pleuromutiliner |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH774072A CH575375A5 (OSRAM) | 1972-05-25 | 1972-05-25 | |
| CH1019772A CH593911A5 (en) | 1972-05-25 | 1972-07-07 | Pleuromutilin derivs. - prepd. by benzoylating derivs. contg. a (4)-hydroxyalkyl-(1)-piperazinyl gp. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH575375A5 true CH575375A5 (OSRAM) | 1976-05-14 |
Family
ID=32870070
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH774072A CH575375A5 (OSRAM) | 1971-10-05 | 1972-05-25 | |
| CH1019772A CH593911A5 (en) | 1972-05-25 | 1972-07-07 | Pleuromutilin derivs. - prepd. by benzoylating derivs. contg. a (4)-hydroxyalkyl-(1)-piperazinyl gp. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1019772A CH593911A5 (en) | 1972-05-25 | 1972-07-07 | Pleuromutilin derivs. - prepd. by benzoylating derivs. contg. a (4)-hydroxyalkyl-(1)-piperazinyl gp. |
Country Status (1)
| Country | Link |
|---|---|
| CH (2) | CH575375A5 (OSRAM) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| UY25225A1 (es) | 1997-10-29 | 2000-12-29 | Smithkline Beecham Plc | Derivados de pleuromutilina utiles como agentes antimicrobianos |
-
1972
- 1972-05-25 CH CH774072A patent/CH575375A5/de not_active IP Right Cessation
- 1972-07-07 CH CH1019772A patent/CH593911A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH593911A5 (en) | 1977-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2248237C2 (de) | Pleuromutilin-Derivate, deren Herstellung und pharmazeutische Zubereitung | |
| DE3852288T2 (de) | K-252-Derivate mit Antitumorwirkung und diese enthaltende Arzneimittel. | |
| EP0026848B1 (de) | Tetralinderivate, ihre Herstellung und Heilmittel, welche diese Verbindungen enthalten | |
| CH632481A5 (de) | Verfahren zur herstellung eines optisch aktiven norpinens. | |
| DE2802023A1 (de) | Neue ergotderivate, ihre herstellung und verwendung | |
| CH380746A (de) | Verfahren zur Herstellung neuer sekundärer Amine | |
| DE2724478C2 (de) | 5,11-Dihydro-6H-pyrido[2,3-b][1,4]benzodiazepin-6-on-derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| CH575375A5 (OSRAM) | ||
| DE2713586A1 (de) | Neue organische verbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| EP0226173A1 (de) | Neue Anthracycline und diese enthaltende Arzneimittel | |
| DE1618317A1 (de) | Verfahren zur Herstellung von neuen Naphthyl bzw. Tetrahydronaphthyl-Formamidinen | |
| DE2409675B2 (de) | 5-Hydroxytryptophan-Derivate und Verfahren zu ihrer Herstellung | |
| DE2525962A1 (de) | Neue heterocyclische verbindungen, ihre herstellung und verwendung | |
| DD292256A5 (de) | Verfahren zur herstellung von benzoxazolinonen | |
| DE2050092C3 (de) | Chinazolondiurethane, Verfahren zu ihrer Herstellung sowie Arzneimittel, die diese Verbindungen enthalten | |
| CH560180A5 (en) | Pleuromutilin derivs - with antibacterial activity | |
| DE1620325B2 (de) | Disubstituierte Isoxazolverbindungen | |
| CH568272A5 (en) | (Para-substd phenoxy- or phenylthio-acetoxy)-pleuromutilin deriv - prepd by reacting para-hydroxy or-mercapto cpds with e.g. aminoalkyl halides | |
| DE2259979A1 (de) | Benzomorphan-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| AT240373B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| CH535235A (de) | Verfahren zur Herstellung neuer reaktionsträger Lysergsäurederivate | |
| AT266838B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT205980B (de) | Verfahren zur Herstellung von neuen, in 3-Stellung mit einer einwertigen Schwefelfunktion substituierten Phenothiazin-Derivaten | |
| DE2200204A1 (de) | Verfahren zur Herstellung neuer heterozyklischer Verbindungen | |
| DD204917A1 (de) | Verfahren zur herstellung phenylsubstituierter und benzkondensierter cycloalkylaminoacetanilide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |