CH527893A - Anaerob erhärtendes, flüssiges Bindemittel - Google Patents
Anaerob erhärtendes, flüssiges BindemittelInfo
- Publication number
- CH527893A CH527893A CH1113166A CH1113166A CH527893A CH 527893 A CH527893 A CH 527893A CH 1113166 A CH1113166 A CH 1113166A CH 1113166 A CH1113166 A CH 1113166A CH 527893 A CH527893 A CH 527893A
- Authority
- CH
- Switzerland
- Prior art keywords
- methacrylate
- hours
- composition
- mkg
- bolts
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 48
- 239000007767 bonding agent Substances 0.000 title 1
- 239000000178 monomer Substances 0.000 claims abstract description 28
- 239000003054 catalyst Substances 0.000 claims abstract description 21
- 239000007788 liquid Substances 0.000 claims abstract description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 18
- 239000001257 hydrogen Substances 0.000 claims abstract description 18
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 16
- 239000007787 solid Substances 0.000 claims abstract description 10
- 150000002148 esters Chemical class 0.000 claims abstract description 9
- 150000003512 tertiary amines Chemical class 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 4
- 150000002367 halogens Chemical class 0.000 claims abstract description 4
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 4
- 239000011230 binding agent Substances 0.000 claims description 33
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 22
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 12
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- OIWOHHBRDFKZNC-UHFFFAOYSA-N cyclohexyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC1CCCCC1 OIWOHHBRDFKZNC-UHFFFAOYSA-N 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 229910000831 Steel Inorganic materials 0.000 claims description 6
- 239000010959 steel Substances 0.000 claims description 6
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 claims description 5
- BEWCNXNIQCLWHP-UHFFFAOYSA-N 2-(tert-butylamino)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCNC(C)(C)C BEWCNXNIQCLWHP-UHFFFAOYSA-N 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- VOZRXNHHFUQHIL-UHFFFAOYSA-N glycidyl methacrylate Chemical compound CC(=C)C(=O)OCC1CO1 VOZRXNHHFUQHIL-UHFFFAOYSA-N 0.000 claims description 5
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 claims description 4
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 claims description 4
- LCXXNKZQVOXMEH-UHFFFAOYSA-N Tetrahydrofurfuryl methacrylate Chemical compound CC(=C)C(=O)OCC1CCCO1 LCXXNKZQVOXMEH-UHFFFAOYSA-N 0.000 claims description 4
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- GYVGXEWAOAAJEU-UHFFFAOYSA-N n,n,4-trimethylaniline Chemical compound CN(C)C1=CC=C(C)C=C1 GYVGXEWAOAAJEU-UHFFFAOYSA-N 0.000 claims description 4
- VKNASXZDGZNEDA-UHFFFAOYSA-N 2-cyanoethyl 2-methylprop-2-enoate Chemical group CC(=C)C(=O)OCCC#N VKNASXZDGZNEDA-UHFFFAOYSA-N 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 125000004185 ester group Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 238000005304 joining Methods 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 150000002976 peresters Chemical class 0.000 claims description 3
- QLZINFDMOXMCCJ-UHFFFAOYSA-N 7-(7-hydroxyheptylperoxy)heptan-1-ol Chemical compound OCCCCCCCOOCCCCCCCO QLZINFDMOXMCCJ-UHFFFAOYSA-N 0.000 claims description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 2
- 210000000941 bile Anatomy 0.000 claims description 2
- 230000000052 comparative effect Effects 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims description 2
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 claims description 2
- SWAXTRYEYUTSAP-UHFFFAOYSA-N tert-butyl ethaneperoxoate Chemical compound CC(=O)OOC(C)(C)C SWAXTRYEYUTSAP-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 8
- 229910052760 oxygen Inorganic materials 0.000 abstract description 8
- 239000001301 oxygen Substances 0.000 abstract description 8
- 230000001476 alcoholic effect Effects 0.000 abstract 1
- 230000001747 exhibiting effect Effects 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 238000006116 polymerization reaction Methods 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- 150000002432 hydroperoxides Chemical class 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 6
- 230000007717 exclusion Effects 0.000 description 4
- 229910021645 metal ion Inorganic materials 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- -1 Acrylic ester Chemical class 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical class OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- IXJPGVLRLBAGGW-UHFFFAOYSA-N [chloro(phenyl)methyl] prop-2-enoate Chemical compound C=CC(=O)OC(Cl)C1=CC=CC=C1 IXJPGVLRLBAGGW-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- JDEJGVSZUIJWBM-UHFFFAOYSA-N n,n,2-trimethylaniline Chemical compound CN(C)C1=CC=CC=C1C JDEJGVSZUIJWBM-UHFFFAOYSA-N 0.000 description 1
- OOHAUGDGCWURIT-UHFFFAOYSA-N n,n-dipentylpentan-1-amine Chemical compound CCCCCN(CCCCC)CCCCC OOHAUGDGCWURIT-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09J—ADHESIVES; NON-MECHANICAL ASPECTS OF ADHESIVE PROCESSES IN GENERAL; ADHESIVE PROCESSES NOT PROVIDED FOR ELSEWHERE; USE OF MATERIALS AS ADHESIVES
- C09J4/00—Adhesives based on organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond ; adhesives, based on monomers of macromolecular compounds of groups C09J183/00 - C09J183/16
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Sealing Material Composition (AREA)
- Adhesives Or Adhesive Processes (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US48450765A | 1965-08-02 | 1965-08-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH527893A true CH527893A (de) | 1972-09-15 |
Family
ID=23924430
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1113166A CH527893A (de) | 1965-08-02 | 1966-08-02 | Anaerob erhärtendes, flüssiges Bindemittel |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3435012A (en:Method) |
| BE (1) | BE708803A (en:Method) |
| CH (1) | CH527893A (en:Method) |
| FR (1) | FR1549092A (en:Method) |
| GB (1) | GB1151916A (en:Method) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4001939A (en) * | 1967-08-19 | 1977-01-11 | Kulzer & Co. Gmbh | Tooth-filling material based on synthetic plastics material |
| US4262106A (en) * | 1969-02-04 | 1981-04-14 | Loctite Corporation | Highly stable anaerobic compositions and process for preparing them |
| US3658624A (en) * | 1969-09-29 | 1972-04-25 | Borden Inc | Bonding method employing a two part anaerobically curing adhesive composition |
| US3901858A (en) * | 1970-12-04 | 1975-08-26 | Matsumoto Seiyaku Kogyo Kk | Two-component composition |
| GB1412940A (en) * | 1971-12-30 | 1975-11-05 | Rocol Ltd | Anaerobic adhesives |
| GB1444770A (en) * | 1973-10-30 | 1976-08-04 | Rocol Ltd | Diacrylate ester/anaerobic adhesives |
| JPS5338110B2 (en:Method) * | 1975-02-24 | 1978-10-13 | ||
| US4054480A (en) * | 1975-05-22 | 1977-10-18 | National Starch And Chemical Corporation | Anaerobic adhesive and sealant compositions containing alpha-hydroxysulfone |
| US3957561A (en) * | 1975-05-22 | 1976-05-18 | National Starch And Chemical Corporation | Anaerobic adhesive and sealant compositions employing a two component catalyst system of diazosulfone and o-sulfobenzimide |
| US4056670A (en) * | 1975-11-03 | 1977-11-01 | National Starch And Chemical Corporation | Anaerobic adhesive and sealant compositions employing as a catalyst α- |
| USRE32240E (en) * | 1976-06-17 | 1986-09-02 | Loctite Corporation | Self-emulsifying anaerobic composition |
| US4112022A (en) * | 1977-03-31 | 1978-09-05 | Borg-Warner Corporation | Nitrile resins stabilized against discoloration and method for producing the same |
| US4410644A (en) * | 1980-04-11 | 1983-10-18 | Cajon Company | Flowable anaerobic sealant composition |
| US4331580A (en) * | 1980-04-11 | 1982-05-25 | Cajon Company | Flowable anaerobic sealant composition |
| JPS63500247A (ja) * | 1985-05-17 | 1988-01-28 | レイザ−,ウオレン グレゴリ− | シアノアクリレ−ト接着剤の硬化を抑制するための組成物および方法ならびに硬化抑制されたシアノアクリレ−ト接着剤組成物 |
| JPH0667812B2 (ja) * | 1988-07-13 | 1994-08-31 | 株式会社クラレ | 歯科用接着性組成物 |
| IE882227L (en) * | 1988-07-21 | 1990-01-21 | Loctite Ireland Ltd | Sealant composition |
| US5256450A (en) * | 1990-08-29 | 1993-10-26 | National Starch And Chemical Investment Holding Corporation | Process for impregnating porous metal articles using water miscible anaerobic sealants |
| US5083975A (en) * | 1990-11-28 | 1992-01-28 | Oscar Mayer Foods Corp | Method for reducing fecal leakage and contamination during meat and poultry processing |
| US5502087A (en) * | 1993-06-23 | 1996-03-26 | Dentsply Research & Development Corp. | Dental composition, prosthesis, and method for making dental prosthesis |
| US5489236A (en) * | 1994-09-30 | 1996-02-06 | Oscar Mayer Foods Corporation | Fecal leakage and contamination control during poultry processing |
| US7138450B2 (en) * | 2002-05-09 | 2006-11-21 | Cph Innovations Corp. | Vulcanized rubber composition with a liquid adhesion promoter containing an adhesive resin and ester |
| US20030220427A1 (en) | 2002-05-09 | 2003-11-27 | Gary Wentworth | Adhesion promoter for cord-reinforced rubber and metal or polymer substrate/rubber composites |
| US6884832B2 (en) * | 2002-05-09 | 2005-04-26 | The C.P. Hall Company | Adhesion promoter for cord-reinforced rubber and metal or polymer substrate/rubber composites |
| US7144937B2 (en) * | 2002-05-09 | 2006-12-05 | Cph Innovations Corp. | Adhesion promoters for sealants |
| US7122592B2 (en) * | 2002-05-09 | 2006-10-17 | Cph Innovations Corp. | Adhesion promoters for cord-reinforced thermoplastic polymeric materials and substrate/thermoplastic polymeric material composites |
| US7422791B2 (en) * | 2003-11-19 | 2008-09-09 | Hallstar Innovations Corp. | Joint assemblies, methods for installing joint assemblies, and jointing compositions |
| US8071698B2 (en) | 2008-05-23 | 2011-12-06 | Loctite (R&D) Limited | Surface-promoted cure of cationically curable compositions comprising vinyl ethers |
| US8399099B1 (en) * | 2008-05-23 | 2013-03-19 | Henkel Ireland Limited | Coating compositions |
| US20090288770A1 (en) * | 2008-05-23 | 2009-11-26 | Loctite (R&D) Limited | Surface-promoted cure of one-part cationically curable compositions |
| US20090288771A1 (en) * | 2008-05-23 | 2009-11-26 | Loctite (R&D) Limited | Surface-promoted cure of one-part radically curable compositions |
| WO2010094634A1 (en) | 2009-02-17 | 2010-08-26 | Loctite (R & D) Limited | Cationically curable compositions and a primer therefor |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3041322A (en) * | 1959-07-20 | 1962-06-26 | Vernon K Krieble | Anaerobic curing compositions containing acrylic acid diesters |
| FR1372368A (fr) * | 1962-11-13 | 1964-09-11 | Roehm & Haas Gmbh | Mélange pour collage durcissant à l'abri de l'air |
| US3180777A (en) * | 1964-06-11 | 1965-04-27 | Borden Co | Method of bonding metal to metal and to other surfaces using a formamide starter for glycol acrylate adhesives |
-
1965
- 1965-08-02 US US484507A patent/US3435012A/en not_active Expired - Lifetime
-
1966
- 1966-08-02 GB GB34567/66A patent/GB1151916A/en not_active Expired
- 1966-08-02 CH CH1113166A patent/CH527893A/de not_active IP Right Cessation
-
1967
- 1967-12-28 FR FR134012A patent/FR1549092A/fr not_active Expired
- 1967-12-29 BE BE708803D patent/BE708803A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US3435012A (en) | 1969-03-25 |
| FR1549092A (en:Method) | 1968-12-06 |
| BE708803A (en:Method) | 1968-07-01 |
| GB1151916A (en) | 1969-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH527893A (de) | Anaerob erhärtendes, flüssiges Bindemittel | |
| DE1594087C3 (de) | Unter Sauerstoffausschluß erhärtende Klebemittel | |
| DE1295122C2 (de) | Unter Luftabschluss haertendes Klebemittel | |
| DE3008258C2 (de) | Verfahren zur Herstellung einer anaerob härtenden chemischen Zusammensetzung | |
| DE1569862C3 (de) | Unter Sauerstoffausschluß erhärtende Klebmittel auf Basis von Acrylsäureestern mehrwertiger Alkohole | |
| DE1900126C3 (de) | Anaerob härtende Klebstoffmasse und Verfahren zu ihrer Herstellung | |
| DE2849965C3 (de) | Klebstoff auf der Basis von Cyanacrylsäureestern | |
| DE3444186C2 (en:Method) | ||
| DE2201549A1 (de) | Cyanoacrylat-klebstoffmassen mit verbesserter waermebestaendigkeit | |
| DE1109891B (de) | Unter Luftausschluss polymerisierende fluessige Gemische | |
| DE2261261A1 (de) | Cyanoacrylsaeureesterklebstoffe | |
| DE2749975A1 (de) | Haertbares kleb- und versiegelungsmittel | |
| DE2151633B2 (de) | Anaerob härtbare Mischung | |
| DE3012478A1 (de) | Verfahren zur herstellung eines lagerbestaendigen klebstoffs | |
| DE2049744B2 (de) | Plastifizierter Cyanoacrylatklebstoff | |
| DE2833842A1 (de) | Verbesserte klebstoffzubereitung auf basis von 2-cyanacrylaten und verfahren zur verbesserung der klebstoffeigenschaften derartiger zubereitungen | |
| DE2136337A1 (de) | Klebstoff | |
| DE2048610C3 (de) | Anaerob härtende Kleb- und Haftmittel | |
| DE2711748C2 (de) | Anaerob härtender Klebstoff und Verfahren zum Verbinden von Oberflächen unter Verwendung dieses Klebstoffes | |
| CH628081A5 (de) | Anaerob haertbare kleb- und versiegelungszusammensetzung. | |
| DE2607137B2 (de) | Anaerob aushärtbare Dichtungsund Klebemasse | |
| DE2649372C3 (de) | Anaerob härtende an der Luft stabile Massen und Verwendung derselben als Klebe- und Dichtungsmittel | |
| DE2006630C3 (de) | Anaerob härtbare Polyesterpolyacrylat-Massen | |
| CH544124A (de) | Anaerob härtende Masse | |
| DE1769934C3 (de) | Flüssiger Kitt |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |