CH518929A - Verfahren zur Herstellung neuer 5-Aroylpyrrolyl-(2)-alkansäurederivate - Google Patents
Verfahren zur Herstellung neuer 5-Aroylpyrrolyl-(2)-alkansäurederivateInfo
- Publication number
- CH518929A CH518929A CH1116368A CH1116368A CH518929A CH 518929 A CH518929 A CH 518929A CH 1116368 A CH1116368 A CH 1116368A CH 1116368 A CH1116368 A CH 1116368A CH 518929 A CH518929 A CH 518929A
- Authority
- CH
- Switzerland
- Prior art keywords
- methylpyrrole
- chlorobenzoyl
- chloride
- acetic acid
- acetonitrile
- Prior art date
Links
- 230000003110 anti-inflammatory effect Effects 0.000 title abstract description 6
- -1 and R2=CN Chemical group 0.000 claims abstract description 63
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 150000003839 salts Chemical class 0.000 claims abstract description 6
- 239000000243 solution Substances 0.000 claims description 99
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 96
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 74
- 238000000034 method Methods 0.000 claims description 65
- 239000007787 solid Substances 0.000 claims description 51
- 239000000203 mixture Substances 0.000 claims description 37
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 35
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 34
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 30
- 230000008018 melting Effects 0.000 claims description 30
- 238000002844 melting Methods 0.000 claims description 30
- 239000002904 solvent Substances 0.000 claims description 30
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 29
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 26
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 claims description 25
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 19
- 238000001953 recrystallisation Methods 0.000 claims description 18
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 17
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 16
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 claims description 14
- ROSYAUHHRKAPHX-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)acetonitrile Chemical compound CN1C=CC=C1CC#N ROSYAUHHRKAPHX-UHFFFAOYSA-N 0.000 claims description 13
- 239000011541 reaction mixture Substances 0.000 claims description 13
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 claims description 12
- ZWUBGDPUVGOZMR-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(Cl)C=C1 ZWUBGDPUVGOZMR-UHFFFAOYSA-N 0.000 claims description 10
- 238000001704 evaporation Methods 0.000 claims description 10
- 230000004048 modification Effects 0.000 claims description 10
- 238000012986 modification Methods 0.000 claims description 10
- 238000010992 reflux Methods 0.000 claims description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 9
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 claims description 9
- 150000002431 hydrogen Chemical group 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 8
- 150000007513 acids Chemical class 0.000 claims description 7
- 230000008020 evaporation Effects 0.000 claims description 7
- 230000007062 hydrolysis Effects 0.000 claims description 7
- 238000006460 hydrolysis reaction Methods 0.000 claims description 7
- 230000007935 neutral effect Effects 0.000 claims description 7
- 150000002825 nitriles Chemical class 0.000 claims description 7
- UZQLEMLKKBRPQG-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1h-pyrrol-2-yl]acetonitrile Chemical compound C1=CC(Cl)=CC=C1C(=O)C1=CC=C(CC#N)N1 UZQLEMLKKBRPQG-UHFFFAOYSA-N 0.000 claims description 6
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 6
- 239000012267 brine Substances 0.000 claims description 6
- 239000003480 eluent Substances 0.000 claims description 6
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 claims description 6
- NXFODIMCJLQNRQ-UHFFFAOYSA-N 2-[1-benzyl-4-(4-chlorobenzoyl)pyrrol-2-yl]acetonitrile Chemical compound C1=CC(Cl)=CC=C1C(=O)C1=CN(CC=2C=CC=CC=2)C(CC#N)=C1 NXFODIMCJLQNRQ-UHFFFAOYSA-N 0.000 claims description 5
- BKWLJDWIUOFEQK-UHFFFAOYSA-N 2-[5-(2,4-dichlorobenzoyl)-1-methylpyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=C(Cl)C=C1Cl BKWLJDWIUOFEQK-UHFFFAOYSA-N 0.000 claims description 5
- GDRPXPPAYAOCIK-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=C(Cl)C=C1 GDRPXPPAYAOCIK-UHFFFAOYSA-N 0.000 claims description 5
- GANDSBWEBNXLMG-UHFFFAOYSA-N 3-chloro-4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1Cl GANDSBWEBNXLMG-UHFFFAOYSA-N 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- SWVGZFQJXVPIKM-UHFFFAOYSA-N n,n-bis(methylamino)propan-1-amine Chemical compound CCCN(NC)NC SWVGZFQJXVPIKM-UHFFFAOYSA-N 0.000 claims description 5
- GVUURLVADCWORZ-UHFFFAOYSA-N 2-[1-benzyl-5-(4-chlorobenzoyl)pyrrol-2-yl]acetonitrile Chemical compound C1=CC(Cl)=CC=C1C(=O)C1=CC=C(CC#N)N1CC1=CC=CC=C1 GVUURLVADCWORZ-UHFFFAOYSA-N 0.000 claims description 4
- APSWAFZHMYVSMV-UHFFFAOYSA-N 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetonitrile Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC#N)N1C APSWAFZHMYVSMV-UHFFFAOYSA-N 0.000 claims description 4
- LNRUQZRLKRFSGF-UHFFFAOYSA-N 2-[1-methyl-5-(4-nitrobenzoyl)pyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C([N+]([O-])=O)C=C1 LNRUQZRLKRFSGF-UHFFFAOYSA-N 0.000 claims description 4
- HDTFMJOVUJMERP-UHFFFAOYSA-N 2-[5-(3-chlorobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=CC(Cl)=C1 HDTFMJOVUJMERP-UHFFFAOYSA-N 0.000 claims description 4
- IYHCQYYGQKJKMI-UHFFFAOYSA-N 2-[5-(4-aminobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(N)C=C1 IYHCQYYGQKJKMI-UHFFFAOYSA-N 0.000 claims description 4
- VJYBXSPJIFMJQO-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1h-pyrrol-2-yl]acetic acid Chemical compound N1C(CC(=O)O)=CC=C1C(=O)C1=CC=C(Cl)C=C1 VJYBXSPJIFMJQO-UHFFFAOYSA-N 0.000 claims description 4
- LYGQPHXURYMFJT-UHFFFAOYSA-N 2-[5-(4-cyanobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(C#N)C=C1 LYGQPHXURYMFJT-UHFFFAOYSA-N 0.000 claims description 4
- QDZACITZLASKAX-UHFFFAOYSA-N 2-[5-(4-methoxybenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C QDZACITZLASKAX-UHFFFAOYSA-N 0.000 claims description 4
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 claims description 4
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000002841 Lewis acid Substances 0.000 claims description 4
- 150000001558 benzoic acid derivatives Chemical class 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 150000007517 lewis acids Chemical class 0.000 claims description 4
- 125000003232 p-nitrobenzoyl group Chemical group [N+](=O)([O-])C1=CC=C(C(=O)*)C=C1 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- UPSPUYADGBWSHF-UHFFFAOYSA-N tolmetin Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C UPSPUYADGBWSHF-UHFFFAOYSA-N 0.000 claims description 4
- SETWKPWDTMJORY-UHFFFAOYSA-N 2-(1-benzylpyrrol-2-yl)acetonitrile Chemical compound N#CCC1=CC=CN1CC1=CC=CC=C1 SETWKPWDTMJORY-UHFFFAOYSA-N 0.000 claims description 3
- WVKPVCGHCFYVKZ-UHFFFAOYSA-N 2-(5-benzoyl-1-methylpyrrol-2-yl)acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=CC=C1 WVKPVCGHCFYVKZ-UHFFFAOYSA-N 0.000 claims description 3
- RVVJEUOAPMNYLC-UHFFFAOYSA-N 2-[1-benzyl-5-(4-chlorobenzoyl)pyrrol-2-yl]acetic acid Chemical compound C=1C=CC=CC=1CN1C(CC(=O)O)=CC=C1C(=O)C1=CC=C(Cl)C=C1 RVVJEUOAPMNYLC-UHFFFAOYSA-N 0.000 claims description 3
- DCPQSDRGXGSUKZ-UHFFFAOYSA-N 2-[5-(2,4-dichlorobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(Cl)C=C1Cl DCPQSDRGXGSUKZ-UHFFFAOYSA-N 0.000 claims description 3
- SNSQCMKQRKLFLV-UHFFFAOYSA-N 2-[5-(4-bromobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(Br)C=C1 SNSQCMKQRKLFLV-UHFFFAOYSA-N 0.000 claims description 3
- IJORGWGJHZNCNN-UHFFFAOYSA-N 2-[5-(4-fluorobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(F)C=C1 IJORGWGJHZNCNN-UHFFFAOYSA-N 0.000 claims description 3
- RGAKSNQOIIYQRM-UHFFFAOYSA-N 3,4-dimethylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1C RGAKSNQOIIYQRM-UHFFFAOYSA-N 0.000 claims description 3
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 claims description 3
- XLWQUESMILVIPR-UHFFFAOYSA-N 4-ethoxybenzoyl chloride Chemical compound CCOC1=CC=C(C(Cl)=O)C=C1 XLWQUESMILVIPR-UHFFFAOYSA-N 0.000 claims description 3
- AVTLLLZVYYPGFX-UHFFFAOYSA-N 4-ethylbenzoyl chloride Chemical compound CCC1=CC=C(C(Cl)=O)C=C1 AVTLLLZVYYPGFX-UHFFFAOYSA-N 0.000 claims description 3
- NWPBFGWVZQGAHM-UHFFFAOYSA-N 4-methylbenzenecarbothioyl chloride Chemical compound CC1=CC=C(C(Cl)=S)C=C1 NWPBFGWVZQGAHM-UHFFFAOYSA-N 0.000 claims description 3
- 239000005711 Benzoic acid Substances 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- MMEYPSTUCSIDCF-UHFFFAOYSA-N benzene;methylcyclohexane Chemical compound C1=CC=CC=C1.CC1CCCCC1 MMEYPSTUCSIDCF-UHFFFAOYSA-N 0.000 claims description 3
- 235000010233 benzoic acid Nutrition 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000004802 cyanophenyl group Chemical group 0.000 claims description 3
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 3
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 3
- RFQXZWAOEPMHCE-UHFFFAOYSA-N 2,3,5-tribromobenzoyl chloride Chemical compound ClC(=O)C1=CC(Br)=CC(Br)=C1Br RFQXZWAOEPMHCE-UHFFFAOYSA-N 0.000 claims description 2
- VIOBGCWEHLRBEP-UHFFFAOYSA-N 3,4-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1OC VIOBGCWEHLRBEP-UHFFFAOYSA-N 0.000 claims description 2
- CHOSHMAFWKKQQF-UHFFFAOYSA-N 3-bromo-4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C(Br)=C1 CHOSHMAFWKKQQF-UHFFFAOYSA-N 0.000 claims description 2
- SDKUOEOJAXGCLU-UHFFFAOYSA-N 3-chloro-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1Cl SDKUOEOJAXGCLU-UHFFFAOYSA-N 0.000 claims description 2
- 125000002672 4-bromobenzoyl group Chemical group BrC1=CC=C(C(=O)*)C=C1 0.000 claims description 2
- OMIHGPLIXGGMJB-UHFFFAOYSA-N 7-oxabicyclo[4.1.0]hepta-1,3,5-triene Chemical compound C1=CC=C2OC2=C1 OMIHGPLIXGGMJB-UHFFFAOYSA-N 0.000 claims description 2
- 150000001805 chlorine compounds Chemical class 0.000 claims description 2
- 238000004440 column chromatography Methods 0.000 claims description 2
- 238000010828 elution Methods 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 18
- 125000004494 ethyl ester group Chemical group 0.000 claims 4
- WENDCVWGPOVTSZ-UHFFFAOYSA-N 2-(1-ethylpyrrol-2-yl)acetic acid Chemical compound CCN1C=CC=C1CC(O)=O WENDCVWGPOVTSZ-UHFFFAOYSA-N 0.000 claims 1
- OORBYQVSQSXKRG-UHFFFAOYSA-N ethyl 2-(1-methylpyrrol-2-yl)acetate Chemical compound CCOC(=O)CC1=CC=CN1C OORBYQVSQSXKRG-UHFFFAOYSA-N 0.000 claims 1
- 150000007529 inorganic bases Chemical class 0.000 claims 1
- CGYVDYLHQYNGFC-UHFFFAOYSA-N methyl 2-(1-methylpyrrol-2-yl)acetate Chemical compound COC(=O)CC1=CC=CN1C CGYVDYLHQYNGFC-UHFFFAOYSA-N 0.000 claims 1
- 150000007530 organic bases Chemical class 0.000 claims 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-M oxidooxomethyl Chemical compound [O-][C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-M 0.000 claims 1
- 229940121363 anti-inflammatory agent Drugs 0.000 abstract description 3
- 239000002260 anti-inflammatory agent Substances 0.000 abstract description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 97
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 44
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- 239000000047 product Substances 0.000 description 26
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- 239000000725 suspension Substances 0.000 description 21
- 239000002244 precipitate Substances 0.000 description 17
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- 238000004458 analytical method Methods 0.000 description 15
- 238000001914 filtration Methods 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- 206010018691 Granuloma Diseases 0.000 description 6
- 239000012223 aqueous fraction Substances 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 4
- SYYOUHJJSOLSJD-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)acetic acid Chemical class CN1C=CC=C1CC(O)=O SYYOUHJJSOLSJD-UHFFFAOYSA-N 0.000 description 4
- IQMWEUKWCJGKSC-UHFFFAOYSA-N 2-[5-(3-chlorobenzoyl)-1-methylpyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=CC(Cl)=C1 IQMWEUKWCJGKSC-UHFFFAOYSA-N 0.000 description 4
- 239000005995 Aluminium silicate Substances 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 235000012211 aluminium silicate Nutrition 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000002401 inhibitory effect Effects 0.000 description 4
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 4
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- XJXRZWVVELTPCI-UHFFFAOYSA-N 2-[5-(2-chlorobenzoyl)-1-methylpyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=CC=C1Cl XJXRZWVVELTPCI-UHFFFAOYSA-N 0.000 description 3
- OFSSFIWENVBKOB-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1-ethylpyrrol-2-yl]acetic acid Chemical compound CCN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(Cl)C=C1 OFSSFIWENVBKOB-UHFFFAOYSA-N 0.000 description 3
- JSPRLTOHBSHLGB-UHFFFAOYSA-N 2-[5-(4-chlorobenzoyl)-1-ethylpyrrol-2-yl]acetonitrile Chemical compound CCN1C(CC#N)=CC=C1C(=O)C1=CC=C(Cl)C=C1 JSPRLTOHBSHLGB-UHFFFAOYSA-N 0.000 description 3
- KCVJOQCNHSHRDO-UHFFFAOYSA-N ClC1=CC(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C Chemical compound ClC1=CC(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1C KCVJOQCNHSHRDO-UHFFFAOYSA-N 0.000 description 3
- 235000009161 Espostoa lanata Nutrition 0.000 description 3
- 240000001624 Espostoa lanata Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 206010030113 Oedema Diseases 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- MXMOTZIXVICDSD-UHFFFAOYSA-N anisoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1 MXMOTZIXVICDSD-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- CEOCVKWBUWKBKA-UHFFFAOYSA-N 2,4-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1Cl CEOCVKWBUWKBKA-UHFFFAOYSA-N 0.000 description 2
- MKVATVUOVMCHJJ-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetonitrile Chemical compound N#CCC1=CC=CN1 MKVATVUOVMCHJJ-UHFFFAOYSA-N 0.000 description 2
- DKCQAPPCPNUYSG-UHFFFAOYSA-N 2-(5-benzoyl-1-methylpyrrol-2-yl)acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=CC=C1 DKCQAPPCPNUYSG-UHFFFAOYSA-N 0.000 description 2
- FBEUIMIRCUPWKA-UHFFFAOYSA-N 2-[1-methyl-5-(4-nitrobenzoyl)pyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=C([N+]([O-])=O)C=C1 FBEUIMIRCUPWKA-UHFFFAOYSA-N 0.000 description 2
- MBSIGSXFDJMFAI-UHFFFAOYSA-N 2-[5-(2-chloro-4-methylbenzoyl)-1-methylpyrrol-2-yl]acetonitrile Chemical compound ClC1=CC(C)=CC=C1C(=O)C1=CC=C(CC#N)N1C MBSIGSXFDJMFAI-UHFFFAOYSA-N 0.000 description 2
- NXSLAADQLANKHM-UHFFFAOYSA-N 2-[5-(2-chlorobenzoyl)-1-methylpyrrol-2-yl]acetic acid Chemical compound CN1C(CC(O)=O)=CC=C1C(=O)C1=CC=CC=C1Cl NXSLAADQLANKHM-UHFFFAOYSA-N 0.000 description 2
- SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000013583 drug formulation Substances 0.000 description 2
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 2
- NMPIBYHSMUVBGV-UHFFFAOYSA-N ethyl 2-[5-(4-chlorobenzoyl)-1-methylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC=C1C(=O)C1=CC=C(Cl)C=C1 NMPIBYHSMUVBGV-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000004401 m-toluyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C(*)=O 0.000 description 2
- CMFZXKPAZWBTJS-UHFFFAOYSA-N methyl 2-[5-(4-methoxybenzoyl)-1-methylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OC)=CC=C1C(=O)C1=CC=C(OC)C=C1 CMFZXKPAZWBTJS-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 125000005441 o-toluyl group Chemical group [H]C1=C([H])C(C(*)=O)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 229960002895 phenylbutazone Drugs 0.000 description 2
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical class CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- NFKAWBGFIMBUMB-UHFFFAOYSA-N 1-phenylpentan-2-one Chemical compound CCCC(=O)CC1=CC=CC=C1 NFKAWBGFIMBUMB-UHFFFAOYSA-N 0.000 description 1
- GVUHUYQEAGMUNJ-UHFFFAOYSA-N 2-(1h-pyrrol-2-yl)acetic acid Chemical compound OC(=O)CC1=CC=CN1 GVUHUYQEAGMUNJ-UHFFFAOYSA-N 0.000 description 1
- HEBRCPZDEBYUHT-UHFFFAOYSA-N 2-(3-ethyl-1H-pyrrol-2-yl)acetic acid Chemical compound C(C)C1=C(NC=C1)CC(=O)O HEBRCPZDEBYUHT-UHFFFAOYSA-N 0.000 description 1
- XECZDFMVQZVVAY-UHFFFAOYSA-N 2-(5-benzoyl-1-ethylpyrrol-2-yl)acetic acid Chemical compound CCN1C(CC(O)=O)=CC=C1C(=O)C1=CC=CC=C1 XECZDFMVQZVVAY-UHFFFAOYSA-N 0.000 description 1
- WIKBTCSCVFVCER-UHFFFAOYSA-N 2-(5-benzoyl-1h-pyrrol-2-yl)acetic acid Chemical compound N1C(CC(=O)O)=CC=C1C(=O)C1=CC=CC=C1 WIKBTCSCVFVCER-UHFFFAOYSA-N 0.000 description 1
- AWSUOGUECFJUEI-UHFFFAOYSA-N 2-(5-benzoyl-1h-pyrrol-2-yl)acetonitrile Chemical compound C=1C=CC=CC=1C(=O)C1=CC=C(CC#N)N1 AWSUOGUECFJUEI-UHFFFAOYSA-N 0.000 description 1
- KRNWYKFHBIYSGX-UHFFFAOYSA-N 2-[1-benzyl-5-(2,4-dichlorobenzoyl)pyrrol-2-yl]acetonitrile Chemical compound ClC1=CC(Cl)=CC=C1C(=O)C1=CC=C(CC#N)N1CC1=CC=CC=C1 KRNWYKFHBIYSGX-UHFFFAOYSA-N 0.000 description 1
- ZWDSAEITPZXVCF-UHFFFAOYSA-N 2-[1-benzyl-5-(3,4-dimethylbenzoyl)pyrrol-2-yl]acetonitrile Chemical compound C1=C(C)C(C)=CC=C1C(=O)C1=CC=C(CC#N)N1CC1=CC=CC=C1 ZWDSAEITPZXVCF-UHFFFAOYSA-N 0.000 description 1
- XSWBLJJYHHMEPG-UHFFFAOYSA-N 2-[1-benzyl-5-(4-ethoxybenzoyl)pyrrol-2-yl]acetonitrile Chemical compound C1=CC(OCC)=CC=C1C(=O)C1=CC=C(CC#N)N1CC1=CC=CC=C1 XSWBLJJYHHMEPG-UHFFFAOYSA-N 0.000 description 1
- YGLXCGHIHHIKME-UHFFFAOYSA-N 2-[1-butyl-5-(2,4-dichlorobenzoyl)pyrrol-2-yl]acetic acid Chemical compound CCCCN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(Cl)C=C1Cl YGLXCGHIHHIKME-UHFFFAOYSA-N 0.000 description 1
- ORVFIGRTNGAXBH-UHFFFAOYSA-N 2-[1-butyl-5-(2,4-dichlorobenzoyl)pyrrol-2-yl]acetonitrile Chemical compound CCCCN1C(CC#N)=CC=C1C(=O)C1=CC=C(Cl)C=C1Cl ORVFIGRTNGAXBH-UHFFFAOYSA-N 0.000 description 1
- KILWWBNOCSUNJJ-UHFFFAOYSA-N 2-[1-ethyl-5-(4-methoxybenzoyl)pyrrol-2-yl]acetic acid Chemical compound CCN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(OC)C=C1 KILWWBNOCSUNJJ-UHFFFAOYSA-N 0.000 description 1
- YODQHMGXTJJVMC-UHFFFAOYSA-N 2-[1-ethyl-5-(4-methoxybenzoyl)pyrrol-2-yl]acetonitrile Chemical compound CCN1C(CC#N)=CC=C1C(=O)C1=CC=C(OC)C=C1 YODQHMGXTJJVMC-UHFFFAOYSA-N 0.000 description 1
- PTWXTYPLYAYZCK-UHFFFAOYSA-N 2-[1-methyl-5-(4-methylbenzenecarbothioyl)pyrrol-2-yl]acetic acid Chemical compound C1=CC(C)=CC=C1C(=S)C1=CC=C(CC(O)=O)N1C PTWXTYPLYAYZCK-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- FGCJDASREIYKNY-UHFFFAOYSA-N 2-[5-(2,4-dichlorobenzoyl)-1h-pyrrol-2-yl]acetic acid Chemical compound N1C(CC(=O)O)=CC=C1C(=O)C1=CC=C(Cl)C=C1Cl FGCJDASREIYKNY-UHFFFAOYSA-N 0.000 description 1
- HFRYVIWMXXLEKL-UHFFFAOYSA-N 2-[5-(3-chloro-4-methylbenzoyl)-1h-pyrrol-2-yl]acetic acid Chemical compound C1=C(Cl)C(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1 HFRYVIWMXXLEKL-UHFFFAOYSA-N 0.000 description 1
- FTVXAOKKOUQNPG-UHFFFAOYSA-N 2-[5-(4-aminobenzoyl)-1-methylpyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=C(N)C=C1 FTVXAOKKOUQNPG-UHFFFAOYSA-N 0.000 description 1
- DFQCIZKZCBQIKJ-UHFFFAOYSA-N 2-[5-(4-bromobenzoyl)-1-methylpyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=C(Br)C=C1 DFQCIZKZCBQIKJ-UHFFFAOYSA-N 0.000 description 1
- UQVCDIPBQGKJNN-UHFFFAOYSA-N 2-[5-(4-fluorobenzoyl)-1-methylpyrrol-2-yl]acetonitrile Chemical compound CN1C(CC#N)=CC=C1C(=O)C1=CC=C(F)C=C1 UQVCDIPBQGKJNN-UHFFFAOYSA-N 0.000 description 1
- PJCQTYCEENXEBA-UHFFFAOYSA-N 2-[5-(4-fluorobenzoyl)-1h-pyrrol-2-yl]acetic acid Chemical compound N1C(CC(=O)O)=CC=C1C(=O)C1=CC=C(F)C=C1 PJCQTYCEENXEBA-UHFFFAOYSA-N 0.000 description 1
- SWJMUZRSGUYNRK-UHFFFAOYSA-N 2-[5-(4-fluorobenzoyl)-1h-pyrrol-2-yl]acetonitrile Chemical compound C1=CC(F)=CC=C1C(=O)C1=CC=C(CC#N)N1 SWJMUZRSGUYNRK-UHFFFAOYSA-N 0.000 description 1
- QSUOERLSFKUZQS-UHFFFAOYSA-N 2-[5-(4-methoxybenzoyl)-1h-pyrrol-2-yl]acetic acid Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1 QSUOERLSFKUZQS-UHFFFAOYSA-N 0.000 description 1
- JUAQHQWJPNSNSC-UHFFFAOYSA-N 2-[5-(4-methoxybenzoyl)-1h-pyrrol-2-yl]acetonitrile Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=C(CC#N)N1 JUAQHQWJPNSNSC-UHFFFAOYSA-N 0.000 description 1
- QJWCXPPEVWZAFI-UHFFFAOYSA-N 2-[5-(4-methylbenzoyl)-1-propylpyrrol-2-yl]acetic acid Chemical compound CCCN1C(CC(O)=O)=CC=C1C(=O)C1=CC=C(C)C=C1 QJWCXPPEVWZAFI-UHFFFAOYSA-N 0.000 description 1
- WQIPQCBRQGSDTO-UHFFFAOYSA-N 2-[5-(4-methylbenzoyl)-1-propylpyrrol-2-yl]acetonitrile Chemical compound CCCN1C(CC#N)=CC=C1C(=O)C1=CC=C(C)C=C1 WQIPQCBRQGSDTO-UHFFFAOYSA-N 0.000 description 1
- TVXJHRCZODVXET-UHFFFAOYSA-N 2-[5-(4-methylbenzoyl)-1h-pyrrol-2-yl]acetic acid Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC(O)=O)N1 TVXJHRCZODVXET-UHFFFAOYSA-N 0.000 description 1
- OPXUCMOAEHDEKM-UHFFFAOYSA-N 2-[5-(4-methylbenzoyl)-1h-pyrrol-2-yl]acetonitrile Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC=C(CC#N)N1 OPXUCMOAEHDEKM-UHFFFAOYSA-N 0.000 description 1
- RUQIUASLAXJZIE-UHFFFAOYSA-N 3-methoxybenzoyl chloride Chemical compound COC1=CC=CC(C(Cl)=O)=C1 RUQIUASLAXJZIE-UHFFFAOYSA-N 0.000 description 1
- YHOYYHYBFSYOSQ-UHFFFAOYSA-N 3-methylbenzoyl chloride Chemical compound CC1=CC=CC(C(Cl)=O)=C1 YHOYYHYBFSYOSQ-UHFFFAOYSA-N 0.000 description 1
- DENKGPBHLYFNGK-UHFFFAOYSA-N 4-bromobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Br)C=C1 DENKGPBHLYFNGK-UHFFFAOYSA-N 0.000 description 1
- USEDMAWWQDFMFY-UHFFFAOYSA-N 4-cyanobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(C#N)C=C1 USEDMAWWQDFMFY-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- FFKZOUIEAHOBHW-UHFFFAOYSA-N N,4-dimethyl-N-nitrosobenzenesulfonamide Chemical compound O=NN(C)S(=O)(=O)C1=CC=C(C)C=C1 FFKZOUIEAHOBHW-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- YVDWMBAZNAOWHG-UHFFFAOYSA-N acetic acid;1h-pyrrole Chemical class CC(O)=O.C=1C=CNC=1 YVDWMBAZNAOWHG-UHFFFAOYSA-N 0.000 description 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 1
- 239000000061 acid fraction Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- WIRUZQNBHNAMAB-UHFFFAOYSA-N benzene;cyclohexane Chemical compound C1CCCCC1.C1=CC=CC=C1 WIRUZQNBHNAMAB-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229940125890 compound Ia Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 150000002168 ethanoic acid esters Chemical group 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- OTUQQJQFGSEFBK-UHFFFAOYSA-N ethyl 2-[5-(4-cyanobenzoyl)-1-methylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OCC)=CC=C1C(=O)C1=CC=C(C#N)C=C1 OTUQQJQFGSEFBK-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- BTIJJDXEELBZFS-QDUVMHSLSA-K hemin Chemical compound CC1=C(CCC(O)=O)C(C=C2C(CCC(O)=O)=C(C)\C(N2[Fe](Cl)N23)=C\4)=N\C1=C/C2=C(C)C(C=C)=C3\C=C/1C(C)=C(C=C)C/4=N\1 BTIJJDXEELBZFS-QDUVMHSLSA-K 0.000 description 1
- 229940025294 hemin Drugs 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000007972 injectable composition Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- ZDGGJQMSELMHLK-UHFFFAOYSA-N m-Trifluoromethylhippuric acid Chemical compound OC(=O)CNC(=O)C1=CC=CC(C(F)(F)F)=C1 ZDGGJQMSELMHLK-UHFFFAOYSA-N 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- JTWSUFMCYGGTHX-UHFFFAOYSA-N methyl 2-[1-methyl-5-(2,3,5-tribromobenzoyl)pyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OC)=CC=C1C(=O)C1=CC(Br)=CC(Br)=C1Br JTWSUFMCYGGTHX-UHFFFAOYSA-N 0.000 description 1
- DFEDTLZWULDRSZ-UHFFFAOYSA-N methyl 2-[1-methyl-5-(4-methylbenzenecarbothioyl)pyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OC)=CC=C1C(=S)C1=CC=C(C)C=C1 DFEDTLZWULDRSZ-UHFFFAOYSA-N 0.000 description 1
- CRHXDYZOOJKBCT-UHFFFAOYSA-N methyl 2-[5-(3,4-dimethoxybenzoyl)-1-methylpyrrol-2-yl]acetate Chemical compound CN1C(CC(=O)OC)=CC=C1C(=O)C1=CC=C(OC)C(OC)=C1 CRHXDYZOOJKBCT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000002829 nitrogen Chemical group 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000000552 rheumatic effect Effects 0.000 description 1
- KEAYESYHFKHZAL-OUBTZVSYSA-N sodium-24 Chemical compound [24Na] KEAYESYHFKHZAL-OUBTZVSYSA-N 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/337—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/21—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrrole Compounds (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1928470A CH522637A (de) | 1967-07-26 | 1968-07-25 | Verfahren zur Herstellung von 5-Aroyl-pyrrolyl-(2)-alkansäurederivaten |
| CH1928370A CH522636A (de) | 1967-07-26 | 1968-07-25 | Verfahren zur Herstellung von neuen Pyrrolderivaten |
| CH1928270A CH529131A (de) | 1967-07-26 | 1968-07-25 | Verfahren zur Herstellung neuer 5-Aroylpyrrolyl-(2)-propionsäureester |
| CH1937170A CH517092A (de) | 1967-07-26 | 1968-07-25 | Verfahren zur Herstellung neuer 5-Aroylpyrrolyl-(2)-alkansäureamide |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65607467A | 1967-07-26 | 1967-07-26 | |
| US74134868A | 1968-07-01 | 1968-07-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH518929A true CH518929A (de) | 1972-02-15 |
Family
ID=27097103
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1116368A CH518929A (de) | 1967-07-26 | 1968-07-25 | Verfahren zur Herstellung neuer 5-Aroylpyrrolyl-(2)-alkansäurederivate |
Country Status (10)
| Country | Link |
|---|---|
| AT (1) | AT289096B (https=) |
| BE (1) | BE718594A (https=) |
| CH (1) | CH518929A (https=) |
| DK (1) | DK136059B (https=) |
| ES (1) | ES356485A1 (https=) |
| FR (1) | FR1574570A (https=) |
| GB (1) | GB1195628A (https=) |
| IL (1) | IL30426A (https=) |
| NL (1) | NL162638C (https=) |
| SE (1) | SE338993B (https=) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2068425B1 (https=) * | 1969-11-12 | 1973-01-12 | Roussel Uclaf | |
| FR2128205B1 (https=) * | 1971-03-11 | 1974-05-24 | Roussel Uclaf | |
| US3752826A (en) * | 1970-01-26 | 1973-08-14 | Mcneilab Inc | Aroyl substituted pyrroles |
| DE3026402A1 (de) * | 1980-07-11 | 1982-02-04 | Syntex Corp., Palo Alto, Calif. | Die verwendung analgetischer und nicht-hormonaler, entzuendungshemmender mittel bei der behandlung von mikrovaskulaeren erkrankungen |
| US4396626A (en) | 1980-10-09 | 1983-08-02 | Beecham Group Limited | Cyclic compounds and their use |
| US4418074A (en) | 1981-11-23 | 1983-11-29 | Riker Laboratories, Inc. | 2,6 Di(t-butyl)-4-(2'-pyrrol)-phenol and anti-inflammatory use thereof |
| IT1210673B (it) * | 1982-02-26 | 1989-09-20 | Medosan Ind Biochimi | Antinfiammatoria amidi pirrolacetiche ad attivita' |
| YU251283A (en) * | 1983-01-26 | 1986-04-30 | Mcneilab Inc | Process for obtaining pyrrol-2-acetylamino acid derivatives |
| KR970706250A (ko) * | 1994-09-27 | 1997-11-03 | 우에노 도시오 | 5원 헤테로시클릭 화합물(five membered heterocyclic compounds) |
| US5859042A (en) * | 1995-09-27 | 1999-01-12 | Ono Pharmaceutical Co., Ltd. | Five membered heterocyclic compounds |
| IT1288123B1 (it) | 1996-09-04 | 1998-09-10 | Nicox Sa | Uso di nitroderivati per l'incontinenza urinaria |
| IT1308633B1 (it) | 1999-03-02 | 2002-01-09 | Nicox Sa | Nitrossiderivati. |
| RU2356887C2 (ru) | 2003-02-06 | 2009-05-27 | ДОМПЕ ФА.Р.МА.С.п.А. | 2-арилуксусные кислоты, их производные и содержащие их фармацевтические композиции |
-
1968
- 1968-07-24 ES ES356485A patent/ES356485A1/es not_active Expired
- 1968-07-24 SE SE1007068A patent/SE338993B/xx unknown
- 1968-07-24 GB GB3527768A patent/GB1195628A/en not_active Expired
- 1968-07-25 BE BE718594D patent/BE718594A/xx not_active IP Right Cessation
- 1968-07-25 IL IL3042668A patent/IL30426A/en unknown
- 1968-07-25 FR FR1574570D patent/FR1574570A/fr not_active Expired
- 1968-07-25 CH CH1116368A patent/CH518929A/de not_active IP Right Cessation
- 1968-07-26 DK DK361168A patent/DK136059B/da not_active IP Right Cessation
- 1968-07-26 NL NL6810664A patent/NL162638C/xx not_active IP Right Cessation
- 1968-07-26 AT AT730768A patent/AT289096B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IL30426A (en) | 1972-02-29 |
| GB1195628A (en) | 1970-06-17 |
| DE1770984B2 (de) | 1975-05-22 |
| NL162638C (nl) | 1980-06-16 |
| SE338993B (https=) | 1971-09-27 |
| FR1574570A (https=) | 1969-07-11 |
| DK136059C (https=) | 1978-01-09 |
| ES356485A1 (es) | 1970-01-16 |
| AT289096B (de) | 1971-04-13 |
| BE718594A (https=) | 1969-01-27 |
| DK136059B (da) | 1977-08-08 |
| DE1770984A1 (de) | 1972-04-06 |
| NL162638B (nl) | 1980-01-15 |
| NL6810664A (https=) | 1969-01-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1668648C3 (de) | 3-Benzoylphenylessigsäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2102746A1 (de) | 5 Aroylpyrrole | |
| DE1618568B2 (de) | Benzyloxycarbonsaeuren und deren derivate, verfahren zur herstellung derselben und diese verbindungen enthaltende arzneimittel | |
| DE1171931B (de) | Verfahren zur Herstellung antihypertonisch wirkender Phenylalaninderivate | |
| CH518929A (de) | Verfahren zur Herstellung neuer 5-Aroylpyrrolyl-(2)-alkansäurederivate | |
| DE3329628C2 (https=) | ||
| DE2015568C3 (de) | S.e-Dimethoxyindazol-S-carbonsäureamide | |
| DE1695044B2 (de) | Neue p-(l-Pyrryl)-phenylessigsäuren und deren Salze | |
| DE2023000C2 (de) | Neue 5-Cycloalkyl-1-indancarbonsäuren, 6-Cycloalkyltetralin-1-carbonsäuren, Derivate davon und Verfahren zu ihrer Herstellung | |
| DE1618465C3 (de) | Phenylessigsäureester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2307828A1 (de) | (4-benzothiazolyl)-phenylessigsaeuren | |
| DD141827A5 (de) | Verfahren zur herstellung von halogensubstituierten mercaptoacylaminosaeuren | |
| DE2004038A1 (de) | Chemische Verfahren und Produkte | |
| DE1643198B2 (de) | Diary Icy clopropanderivate und Verfahren zu deren Herstellung | |
| DE1944759B2 (de) | 3-Indolylacetamide, ihre Salze und Verfahren zu ihrer Herstellung | |
| DE2640884A1 (de) | Neue entzuendungshemmende l-oxo-isoindolin-derivate und verfahren zu ihrer herstellung | |
| DE1770984C3 (de) | 5 Aroyl-pyrrol-2-essigsäurederivate | |
| DE2540334C2 (de) | Benzylaminoalkansäuren, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende pharmazeutische Zubereitungen | |
| DE2618936B2 (de) | N-Acyl-glutamine, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| CH517092A (de) | Verfahren zur Herstellung neuer 5-Aroylpyrrolyl-(2)-alkansäureamide | |
| DE2302671A1 (de) | 5-acylpyrrole, verfahren zu ihrer herstellung und ihre verwendung in arzneimitteln | |
| AT292685B (de) | Verfahren zur Herstellung von neuen Pyrrolderivaten und ihren Salzen | |
| DE2055264C3 (de) | Thienyl(2) -essigsäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
| DE1795781A1 (de) | Aroyl-substituierte pyrrole | |
| DE2157694C3 (de) | Phenylessigsäurederivate, Verfahren zu ihrer Herstellung und Phenylessigsäurederivate enthaltende pharmazeutische Zubereitungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |