CH495361A - Verfahren zur Herstellung neuer 1,2-Dihydro-1-hydroxypyrimidine - Google Patents
Verfahren zur Herstellung neuer 1,2-Dihydro-1-hydroxypyrimidineInfo
- Publication number
- CH495361A CH495361A CH1515366A CH1515366A CH495361A CH 495361 A CH495361 A CH 495361A CH 1515366 A CH1515366 A CH 1515366A CH 1515366 A CH1515366 A CH 1515366A CH 495361 A CH495361 A CH 495361A
- Authority
- CH
- Switzerland
- Prior art keywords
- pyrimidine
- dihydro
- hydroxy
- amino
- formula
- Prior art date
Links
- -1 piperidino, hexahydroazepinyl Chemical group 0.000 claims abstract description 256
- 150000001875 compounds Chemical class 0.000 claims abstract description 57
- 239000002253 acid Substances 0.000 claims abstract description 54
- 150000003839 salts Chemical class 0.000 claims abstract description 43
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 35
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 24
- ZIMGGGWCDYVHOY-UHFFFAOYSA-N 3-hydroxy-2-imino-6-(1-piperidinyl)-4-pyrimidinamine Chemical compound N=C1N(O)C(N)=CC(N2CCCCC2)=N1 ZIMGGGWCDYVHOY-UHFFFAOYSA-N 0.000 claims abstract description 22
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 8
- 125000002877 alkyl aryl group Chemical group 0.000 claims abstract description 5
- 125000000714 pyrimidinyl group Chemical group 0.000 claims abstract description 5
- 125000002393 azetidinyl group Chemical group 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 46
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 33
- 238000006243 chemical reaction Methods 0.000 claims description 32
- 239000004480 active ingredient Substances 0.000 claims description 25
- 239000012458 free base Substances 0.000 claims description 25
- 150000001412 amines Chemical class 0.000 claims description 20
- 239000002775 capsule Substances 0.000 claims description 19
- 239000000460 chlorine Substances 0.000 claims description 19
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 18
- 239000004615 ingredient Substances 0.000 claims description 18
- UUDJBOLWMLTQTE-UHFFFAOYSA-N 1-hydroxy-2h-pyrimidine Chemical class ON1CN=CC=C1 UUDJBOLWMLTQTE-UHFFFAOYSA-N 0.000 claims description 17
- 229910052794 bromium Inorganic materials 0.000 claims description 17
- 229910052801 chlorine Inorganic materials 0.000 claims description 17
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 16
- 239000000454 talc Substances 0.000 claims description 16
- 229910052623 talc Inorganic materials 0.000 claims description 16
- 150000003254 radicals Chemical class 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 13
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 claims description 12
- 239000008116 calcium stearate Substances 0.000 claims description 12
- 235000013539 calcium stearate Nutrition 0.000 claims description 12
- 206010020772 Hypertension Diseases 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 10
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 claims description 10
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 claims description 9
- 229960002003 hydrochlorothiazide Drugs 0.000 claims description 9
- 239000008101 lactose Substances 0.000 claims description 9
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 claims description 8
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 claims description 8
- 239000007903 gelatin capsule Substances 0.000 claims description 8
- 239000008187 granular material Substances 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 8
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 7
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 claims description 7
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 claims description 7
- 229920002472 Starch Polymers 0.000 claims description 7
- 229910052740 iodine Inorganic materials 0.000 claims description 7
- BJOIZNZVOZKDIG-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC(OC)=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 BJOIZNZVOZKDIG-MDEJGZGSSA-N 0.000 claims description 7
- 229960003147 reserpine Drugs 0.000 claims description 7
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 claims description 7
- 239000008107 starch Substances 0.000 claims description 7
- 235000019698 starch Nutrition 0.000 claims description 7
- 229920002261 Corn starch Polymers 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 239000008120 corn starch Substances 0.000 claims description 6
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 claims description 5
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 235000019359 magnesium stearate Nutrition 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000001103 potassium chloride Substances 0.000 claims description 4
- 235000011164 potassium chloride Nutrition 0.000 claims description 4
- NPPQSCRMBWNHMW-UHFFFAOYSA-N Meprobamate Chemical compound NC(=O)OCC(C)(CCC)COC(N)=O NPPQSCRMBWNHMW-UHFFFAOYSA-N 0.000 claims description 3
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 3
- OUZWUKMCLIBBOG-UHFFFAOYSA-N ethoxzolamide Chemical compound CCOC1=CC=C2N=C(S(N)(=O)=O)SC2=C1 OUZWUKMCLIBBOG-UHFFFAOYSA-N 0.000 claims description 3
- 229950005098 ethoxzolamide Drugs 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 229960004815 meprobamate Drugs 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 235000012054 meals Nutrition 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 abstract description 18
- 239000002220 antihypertensive agent Substances 0.000 abstract description 8
- 229940030600 antihypertensive agent Drugs 0.000 abstract description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 abstract description 6
- 229930182555 Penicillin Natural products 0.000 abstract description 6
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 abstract description 6
- 125000003118 aryl group Chemical group 0.000 abstract description 6
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 6
- 125000003710 aryl alkyl group Chemical group 0.000 abstract description 5
- 150000002960 penicillins Chemical class 0.000 abstract description 5
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 4
- 230000036772 blood pressure Effects 0.000 abstract description 3
- 239000003112 inhibitor Substances 0.000 abstract description 3
- 229940049954 penicillin Drugs 0.000 abstract description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract description 3
- 238000000746 purification Methods 0.000 abstract description 3
- 230000035939 shock Effects 0.000 abstract description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract description 2
- 235000019371 penicillin G benzathine Nutrition 0.000 abstract description 2
- 229940056360 penicillin g Drugs 0.000 abstract description 2
- 230000002421 anti-septic effect Effects 0.000 abstract 1
- 229940064004 antiseptic throat preparations Drugs 0.000 abstract 1
- 125000004069 aziridinyl group Chemical group 0.000 abstract 1
- 239000003433 contraceptive agent Substances 0.000 abstract 1
- 230000007797 corrosion Effects 0.000 abstract 1
- 238000005260 corrosion Methods 0.000 abstract 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 abstract 1
- 229920005989 resin Polymers 0.000 abstract 1
- 239000011347 resin Substances 0.000 abstract 1
- 238000000926 separation method Methods 0.000 abstract 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M thiocyanate group Chemical group [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 64
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 63
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 60
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 41
- 239000000243 solution Substances 0.000 description 37
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 25
- 239000003826 tablet Substances 0.000 description 25
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 24
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 24
- 239000003085 diluting agent Substances 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 19
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 17
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 16
- 239000007787 solid Substances 0.000 description 15
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 14
- 239000002585 base Substances 0.000 description 13
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 11
- 229940031826 phenolate Drugs 0.000 description 11
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- 235000012222 talc Nutrition 0.000 description 10
- JCKMRGRBJIGNON-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)pyrimidine-2,4-diamine Chemical compound NC1=NC(N)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=N1 JCKMRGRBJIGNON-UHFFFAOYSA-N 0.000 description 9
- QJIUMVUZDYPQRT-UHFFFAOYSA-N 6-chloro-2,4-pyrimidinediamine Chemical compound NC1=CC(Cl)=NC(N)=N1 QJIUMVUZDYPQRT-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 239000005711 Benzoic acid Substances 0.000 description 8
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 8
- 235000010233 benzoic acid Nutrition 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 239000012065 filter cake Substances 0.000 description 8
- 230000003647 oxidation Effects 0.000 description 8
- 238000007254 oxidation reaction Methods 0.000 description 8
- 235000011007 phosphoric acid Nutrition 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- 150000003230 pyrimidines Chemical class 0.000 description 8
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 7
- DVHZVSASHVEFSE-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-3-hydroxy-2-iminopyrimidin-4-amine Chemical compound N=C1N(O)C(N)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=N1 DVHZVSASHVEFSE-UHFFFAOYSA-N 0.000 description 7
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 7
- 235000011054 acetic acid Nutrition 0.000 description 7
- 125000003277 amino group Chemical group 0.000 description 7
- 235000011167 hydrochloric acid Nutrition 0.000 description 7
- 239000004310 lactic acid Substances 0.000 description 7
- 235000014655 lactic acid Nutrition 0.000 description 7
- 239000002480 mineral oil Substances 0.000 description 7
- 235000010446 mineral oil Nutrition 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- DEFYUEFWOBCOCX-UHFFFAOYSA-N 6-phenoxypyrimidine-2,4-diamine Chemical class NC1=NC(N)=CC(OC=2C=CC=CC=2)=N1 DEFYUEFWOBCOCX-UHFFFAOYSA-N 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 6
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 150000002366 halogen compounds Chemical class 0.000 description 6
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 6
- 239000011976 maleic acid Substances 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 235000011149 sulphuric acid Nutrition 0.000 description 5
- WCFAPJDPAPDDAQ-UHFFFAOYSA-N 1,2-dihydropyrimidine Chemical compound C1NC=CC=N1 WCFAPJDPAPDDAQ-UHFFFAOYSA-N 0.000 description 4
- HHXZUSNLEHDWDY-UHFFFAOYSA-N 1-hydroxy-4-phenoxy-2h-pyrimidine Chemical class C1=CN(O)CN=C1OC1=CC=CC=C1 HHXZUSNLEHDWDY-UHFFFAOYSA-N 0.000 description 4
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 4
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 4
- YTKGAYFHUZTLCI-UHFFFAOYSA-N 3-hydroxy-2-iminopyrimidin-4-amine Chemical group NC1=CC=NC(=N)N1O YTKGAYFHUZTLCI-UHFFFAOYSA-N 0.000 description 4
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 4
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- 238000011049 filling Methods 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000000314 lubricant Substances 0.000 description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 4
- 150000003335 secondary amines Chemical class 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000011877 solvent mixture Substances 0.000 description 4
- 239000006188 syrup Substances 0.000 description 4
- 235000020357 syrup Nutrition 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 125000006040 2-hexenyl group Chemical group 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000003708 ampul Substances 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000002934 diuretic Substances 0.000 description 3
- 229940030606 diuretics Drugs 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- 230000026030 halogenation Effects 0.000 description 3
- 238000005658 halogenation reaction Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910000000 metal hydroxide Inorganic materials 0.000 description 3
- 150000004692 metal hydroxides Chemical class 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 239000001923 methylcellulose Substances 0.000 description 3
- 235000010981 methylcellulose Nutrition 0.000 description 3
- 229960002900 methylcellulose Drugs 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000003472 neutralizing effect Effects 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 239000001384 succinic acid Substances 0.000 description 3
- 230000003253 viricidal effect Effects 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- GELXVDNNZSIRQA-UHFFFAOYSA-N 2,4,6-trimethylpiperidine Chemical compound CC1CC(C)NC(C)C1 GELXVDNNZSIRQA-UHFFFAOYSA-N 0.000 description 2
- FAXWFCTVSHEODL-UHFFFAOYSA-N 2,4-dibromophenol Chemical compound OC1=CC=C(Br)C=C1Br FAXWFCTVSHEODL-UHFFFAOYSA-N 0.000 description 2
- FYXZTVPBFJQFBO-UHFFFAOYSA-N 2-(4-nitrophenyl)acetyl chloride Chemical compound [O-][N+](=O)C1=CC=C(CC(Cl)=O)C=C1 FYXZTVPBFJQFBO-UHFFFAOYSA-N 0.000 description 2
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 2
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 2
- RGNFMQJLAOONTP-UHFFFAOYSA-N 2-ethylmorpholine Chemical compound CCC1CNCCO1 RGNFMQJLAOONTP-UHFFFAOYSA-N 0.000 description 2
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 2
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 2
- GNQSEISTGYFZSL-UHFFFAOYSA-N 3-hydroxy-2-imino-6-phenoxypyrimidin-4-amine Chemical compound N=C1N(O)C(N)=CC(OC=2C=CC=CC=2)=N1 GNQSEISTGYFZSL-UHFFFAOYSA-N 0.000 description 2
- HEMOJUXUGUWYAB-UHFFFAOYSA-N 3-methoxybutanoyl 3-methoxybutanoate Chemical compound COC(CC(=O)OC(CC(C)OC)=O)C HEMOJUXUGUWYAB-UHFFFAOYSA-N 0.000 description 2
- OQOXQGCYFYSFRH-UHFFFAOYSA-N 3-nitrobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC([N+]([O-])=O)=C1 OQOXQGCYFYSFRH-UHFFFAOYSA-N 0.000 description 2
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 2
- IAPQCQCJCOIPGG-UHFFFAOYSA-N 4-methoxybenzenecarboperoxoic acid Chemical compound COC1=CC=C(C(=O)OO)C=C1 IAPQCQCJCOIPGG-UHFFFAOYSA-N 0.000 description 2
- IFDPVSBDNAQBRQ-UHFFFAOYSA-N 4-methylbenzenecarboperoxoic acid Chemical compound CC1=CC=C(C(=O)OO)C=C1 IFDPVSBDNAQBRQ-UHFFFAOYSA-N 0.000 description 2
- QPKSDZYQGFDJIU-UHFFFAOYSA-N 4-tert-butylcyclohexane-1-carbonyl chloride Chemical compound CC(C)(C)C1CCC(C(Cl)=O)CC1 QPKSDZYQGFDJIU-UHFFFAOYSA-N 0.000 description 2
- JQRIVYYJTPGKRJ-UHFFFAOYSA-N 5-benzyl-6-(2,4-dichlorophenoxy)pyrimidine-2,4-diamine Chemical compound NC1=NC(N)=C(CC2=CC=CC=C2)C(OC2=C(Cl)C=C(Cl)C=C2)=N1 JQRIVYYJTPGKRJ-UHFFFAOYSA-N 0.000 description 2
- PZUKNBOKDALSLG-UHFFFAOYSA-N 5-bromo-6-(2,4-dichlorophenoxy)-3-hydroxy-2-iminopyrimidin-4-amine Chemical compound N=C1N(O)C(N)=C(Br)C(OC=2C(=CC(Cl)=CC=2)Cl)=N1 PZUKNBOKDALSLG-UHFFFAOYSA-N 0.000 description 2
- RBCYBYDDMSXMDL-UHFFFAOYSA-N 5-bromo-6-(2,4-dichlorophenoxy)pyrimidine-2,4-diamine Chemical compound BrC=1C(=NC(=NC1OC1=C(C=C(C=C1)Cl)Cl)N)N RBCYBYDDMSXMDL-UHFFFAOYSA-N 0.000 description 2
- PLSGXDWJGNURHP-UHFFFAOYSA-N 5-butyl-6-(2,4-dichlorophenoxy)pyrimidine-2,4-diamine Chemical compound CCCCC1=C(N)N=C(N)N=C1OC1=C(Cl)C=C(Cl)C=C1 PLSGXDWJGNURHP-UHFFFAOYSA-N 0.000 description 2
- XOFNHZHCGBPVGJ-UHFFFAOYSA-N 5-ethyl-2-methylpiperidine Chemical compound CCC1CCC(C)NC1 XOFNHZHCGBPVGJ-UHFFFAOYSA-N 0.000 description 2
- AAGOOIYTFKQHCE-UHFFFAOYSA-N 6-(2,4,6-trichlorophenoxy)pyrimidine-2,4-diamine Chemical compound NC1=NC(=CC(=N1)N)OC1=C(C=C(C=C1Cl)Cl)Cl AAGOOIYTFKQHCE-UHFFFAOYSA-N 0.000 description 2
- HFSSQXJTJZXBCP-UHFFFAOYSA-N 6-(2,4-dibromophenoxy)pyrimidine-2,4-diamine Chemical compound NC1=NC(N)=CC(OC=2C(=CC(Br)=CC=2)Br)=N1 HFSSQXJTJZXBCP-UHFFFAOYSA-N 0.000 description 2
- NLOWTPRRVVZWIZ-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-3-hydroxy-2-imino-5-(2-methoxyethyl)pyrimidin-4-amine Chemical compound NC1=C(C(=NC(N1O)=N)OC1=C(C=C(C=C1)Cl)Cl)CCOC NLOWTPRRVVZWIZ-UHFFFAOYSA-N 0.000 description 2
- LNCXXSIVPLDMBQ-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-3-hydroxy-2-imino-5-(6-methylheptyl)pyrimidin-4-amine Chemical compound NC1=C(C(=NC(N1O)=N)OC1=C(C=C(C=C1)Cl)Cl)CCCCCC(C)C LNCXXSIVPLDMBQ-UHFFFAOYSA-N 0.000 description 2
- XFYKIWQFCNXCLA-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-3-hydroxy-2-imino-5-methylpyrimidin-4-amine Chemical compound NC1=C(C(=NC(N1O)=N)OC1=C(C=C(C=C1)Cl)Cl)C XFYKIWQFCNXCLA-UHFFFAOYSA-N 0.000 description 2
- ZYUIRASBNNVMSM-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-5-(4-phenylbutyl)pyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)CCCCC1=CC=CC=C1)OC1=C(C=C(C=C1)Cl)Cl ZYUIRASBNNVMSM-UHFFFAOYSA-N 0.000 description 2
- RZMSIDNSIOBTSZ-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-5-[(4-methylnaphthalen-1-yl)methyl]pyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)CC1=CC=C(C2=CC=CC=C12)C)OC1=C(C=C(C=C1)Cl)Cl RZMSIDNSIOBTSZ-UHFFFAOYSA-N 0.000 description 2
- PHNIEUGUFHLOEK-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-5-hex-2-enyl-3-hydroxy-2-iminopyrimidin-4-amine Chemical compound NC1=C(C(=NC(N1O)=N)OC1=C(C=C(C=C1)Cl)Cl)CC=CCCC PHNIEUGUFHLOEK-UHFFFAOYSA-N 0.000 description 2
- OYXFAVNVYCHAMO-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-5-phenylpyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)C1=CC=CC=C1)OC1=C(C=C(C=C1)Cl)Cl OYXFAVNVYCHAMO-UHFFFAOYSA-N 0.000 description 2
- QUPISUOATYQHAP-UHFFFAOYSA-N 6-(3-fluorophenoxy)pyrimidine-2,4-diamine Chemical compound NC1=NC(N)=CC(OC=2C=C(F)C=CC=2)=N1 QUPISUOATYQHAP-UHFFFAOYSA-N 0.000 description 2
- YGATYPQZPSBEHI-UHFFFAOYSA-N 6-(4-chlorophenoxy)pyrimidine-2,4-diamine Chemical compound NC1=NC(N)=CC(OC=2C=CC(Cl)=CC=2)=N1 YGATYPQZPSBEHI-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 2
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- RPTUSVTUFVMDQK-UHFFFAOYSA-N Hidralazin Chemical compound C1=CC=C2C(NN)=NN=CC2=C1 RPTUSVTUFVMDQK-UHFFFAOYSA-N 0.000 description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 2
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 2
- KXEFFQFNWZYFSE-UHFFFAOYSA-N NC1=NC(=C(C(=N1)N)C1CCC(CC1)C(C)(C)C)OC1=C(C=C(C=C1)Cl)Cl Chemical compound NC1=NC(=C(C(=N1)N)C1CCC(CC1)C(C)(C)C)OC1=C(C=C(C=C1)Cl)Cl KXEFFQFNWZYFSE-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 239000000219 Sympatholytic Substances 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 2
- VIROVYVQCGLCII-UHFFFAOYSA-N amobarbital Chemical compound CC(C)CCC1(CC)C(=O)NC(=O)NC1=O VIROVYVQCGLCII-UHFFFAOYSA-N 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 2
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 2
- NRHDCQLCSOWVTF-UHFFFAOYSA-N azonane Chemical compound C1CCCCNCCC1 NRHDCQLCSOWVTF-UHFFFAOYSA-N 0.000 description 2
- 239000002981 blocking agent Substances 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 2
- DMEGYFMYUHOHGS-UHFFFAOYSA-N cycloheptane Chemical group C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 2
- IPIVAXLHTVNRBS-UHFFFAOYSA-N decanoyl chloride Chemical compound CCCCCCCCCC(Cl)=O IPIVAXLHTVNRBS-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 238000006735 epoxidation reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 230000035558 fertility Effects 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 210000000609 ganglia Anatomy 0.000 description 2
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 2
- 238000010255 intramuscular injection Methods 0.000 description 2
- 239000007927 intramuscular injection Substances 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- BMFVGAAISNGQNM-UHFFFAOYSA-N isopentylamine Chemical compound CC(C)CCN BMFVGAAISNGQNM-UHFFFAOYSA-N 0.000 description 2
- 125000005394 methallyl group Chemical group 0.000 description 2
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 2
- 229960002216 methylparaben Drugs 0.000 description 2
- 229940035363 muscle relaxants Drugs 0.000 description 2
- 239000003158 myorelaxant agent Substances 0.000 description 2
- GQYMPZZURHKRNX-UHFFFAOYSA-N n-(2-acetylimino-3-hydroxy-6-piperidin-1-ylpyrimidin-4-yl)acetamide Chemical compound CC(=O)N=C1N(O)C(NC(=O)C)=CC(N2CCCCC2)=N1 GQYMPZZURHKRNX-UHFFFAOYSA-N 0.000 description 2
- IOXXVNYDGIXMIP-UHFFFAOYSA-N n-methylprop-2-en-1-amine Chemical compound CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 2
- DYUWTXWIYMHBQS-UHFFFAOYSA-N n-prop-2-enylprop-2-en-1-amine Chemical compound C=CCNCC=C DYUWTXWIYMHBQS-UHFFFAOYSA-N 0.000 description 2
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 239000012454 non-polar solvent Substances 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 2
- ORTFAQDWJHRMNX-UHFFFAOYSA-M oxidooxomethyl Chemical compound [O-][C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-M 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 2
- PGMYKACGEOXYJE-UHFFFAOYSA-N pentyl acetate Chemical compound CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000000810 peripheral vasodilating agent Substances 0.000 description 2
- 229960002116 peripheral vasodilator Drugs 0.000 description 2
- XCRBXWCUXJNEFX-UHFFFAOYSA-N peroxybenzoic acid Chemical class OOC(=O)C1=CC=CC=C1 XCRBXWCUXJNEFX-UHFFFAOYSA-N 0.000 description 2
- 230000002085 persistent effect Effects 0.000 description 2
- 239000008024 pharmaceutical diluent Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 2
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 229960003415 propylparaben Drugs 0.000 description 2
- ATBIAJXSKNPHEI-UHFFFAOYSA-N pyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1 ATBIAJXSKNPHEI-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000000932 sedative agent Substances 0.000 description 2
- 229940125723 sedative agent Drugs 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000008223 sterile water Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- 239000003204 tranquilizing agent Substances 0.000 description 2
- 230000002936 tranquilizing effect Effects 0.000 description 2
- 230000000304 vasodilatating effect Effects 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- NIHKFGMYMWGERR-UHFFFAOYSA-N (3-chlorobenzoyl) 3-chlorobenzoate Chemical compound ClC1=CC=CC(C(=O)OC(=O)C=2C=C(Cl)C=CC=2)=C1 NIHKFGMYMWGERR-UHFFFAOYSA-N 0.000 description 1
- YGMHIBLUWGDWKP-UHFFFAOYSA-N (4-methoxybenzoyl) 4-methoxybenzoate Chemical compound C1=CC(OC)=CC=C1C(=O)OC(=O)C1=CC=C(OC)C=C1 YGMHIBLUWGDWKP-UHFFFAOYSA-N 0.000 description 1
- BQHDZWJTDVDOOP-VOTSOKGWSA-N (E)-oct-2-en-1-amine Chemical compound CCCCC\C=C\CN BQHDZWJTDVDOOP-VOTSOKGWSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ZEHYJZXQEQOSON-AATRIKPKSA-N (e)-1-chloro-3-ethylpent-1-en-4-yn-3-ol Chemical compound CCC(O)(C#C)\C=C\Cl ZEHYJZXQEQOSON-AATRIKPKSA-N 0.000 description 1
- QFUSOYKIDBRREL-NSCUHMNNSA-N (e)-but-2-en-1-amine Chemical compound C\C=C\CN QFUSOYKIDBRREL-NSCUHMNNSA-N 0.000 description 1
- AZJUGPLDDAZZTB-NSCUHMNNSA-N (e)-hex-4-en-1-amine Chemical compound C\C=C\CCCN AZJUGPLDDAZZTB-NSCUHMNNSA-N 0.000 description 1
- QCUPYFTWJOZAOB-HWKANZROSA-N (e)-n-carbamoyl-2-ethylbut-2-enamide Chemical compound CC\C(=C/C)C(=O)NC(N)=O QCUPYFTWJOZAOB-HWKANZROSA-N 0.000 description 1
- VWJYDONMXDIHNY-NSCUHMNNSA-N (e)-pent-3-en-1-amine Chemical compound C\C=C\CCN VWJYDONMXDIHNY-NSCUHMNNSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- 125000006065 1,3-dimethyl-2-butenyl group Chemical group 0.000 description 1
- UOTMYNBWXDUBNX-UHFFFAOYSA-N 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinolin-2-ium;chloride Chemical compound Cl.C1=C(OC)C(OC)=CC=C1CC1=NC=CC2=CC(OC)=C(OC)C=C12 UOTMYNBWXDUBNX-UHFFFAOYSA-N 0.000 description 1
- PBQJFYWCFSNZAL-UHFFFAOYSA-N 1-bromoimidazolidine-2,4-dione Chemical compound BrN1CC(=O)NC1=O PBQJFYWCFSNZAL-UHFFFAOYSA-N 0.000 description 1
- IIUDBWFOJYPWAK-UHFFFAOYSA-N 1-butylazepane Chemical compound CCCCN1CCCCCC1 IIUDBWFOJYPWAK-UHFFFAOYSA-N 0.000 description 1
- 125000006074 1-ethyl-2-butenyl group Chemical group 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- GYMVHPTZRISQID-UHFFFAOYSA-N 1-hydroxy-2h-pyrimidine;hydrochloride Chemical compound Cl.ON1CN=CC=C1 GYMVHPTZRISQID-UHFFFAOYSA-N 0.000 description 1
- FLUYWGLRWSFUGE-UHFFFAOYSA-N 1-hydroxypyrimidin-2-imine Chemical compound ON1C=CC=NC1=N FLUYWGLRWSFUGE-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical compound C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ATTVJWQVBUVDOP-UHFFFAOYSA-N 2,2,4-trimethylazetidine Chemical compound CC1CC(C)(C)N1 ATTVJWQVBUVDOP-UHFFFAOYSA-N 0.000 description 1
- AJMDMNYTTSGFEL-UHFFFAOYSA-N 2,2,4-trimethylpyrrolidine Chemical compound CC1CNC(C)(C)C1 AJMDMNYTTSGFEL-UHFFFAOYSA-N 0.000 description 1
- FGRJGEWVJCCOJJ-UHFFFAOYSA-N 2,2-dimethylaziridine Chemical compound CC1(C)CN1 FGRJGEWVJCCOJJ-UHFFFAOYSA-N 0.000 description 1
- ADZCGFWMBYZOJD-UHFFFAOYSA-N 2,3,4,5,6-pentamethylbenzenecarboperoxoic acid Chemical compound CC1=C(C)C(C)=C(C(=O)OO)C(C)=C1C ADZCGFWMBYZOJD-UHFFFAOYSA-N 0.000 description 1
- KGIUFTPYSZZQET-UHFFFAOYSA-N 2,3,5,6-tetrachlorobenzenecarboperoxoic acid Chemical compound ClC1=C(C=C(C(=C1C(=O)OO)Cl)Cl)Cl KGIUFTPYSZZQET-UHFFFAOYSA-N 0.000 description 1
- 125000006069 2,3-dimethyl-2-butenyl group Chemical group 0.000 description 1
- ZKCLHJUZGZWTNA-UHFFFAOYSA-N 2,3-dimethylpyrrolidine Chemical compound CC1CCNC1C ZKCLHJUZGZWTNA-UHFFFAOYSA-N 0.000 description 1
- VTSWSQGDJQFXHB-UHFFFAOYSA-N 2,4,6-trichloro-5-methylpyrimidine Chemical compound CC1=C(Cl)N=C(Cl)N=C1Cl VTSWSQGDJQFXHB-UHFFFAOYSA-N 0.000 description 1
- YMCHZJBZJNKSHU-UHFFFAOYSA-N 2,4,6-trichloro-5-phenylpyrimidine Chemical compound ClC1=NC(Cl)=NC(Cl)=C1C1=CC=CC=C1 YMCHZJBZJNKSHU-UHFFFAOYSA-N 0.000 description 1
- LINPIYWFGCPVIE-UHFFFAOYSA-N 2,4,6-trichlorophenol Chemical compound OC1=C(Cl)C=C(Cl)C=C1Cl LINPIYWFGCPVIE-UHFFFAOYSA-N 0.000 description 1
- DPVIABCMTHHTGB-UHFFFAOYSA-N 2,4,6-trichloropyrimidine Chemical compound ClC1=CC(Cl)=NC(Cl)=N1 DPVIABCMTHHTGB-UHFFFAOYSA-N 0.000 description 1
- 150000005725 2,4-diamino-6-chloropyrimidines Chemical class 0.000 description 1
- SWELIMKTDYHAOY-UHFFFAOYSA-N 2,4-diamino-6-hydroxypyrimidine Chemical compound NC1=CC(=O)N=C(N)N1 SWELIMKTDYHAOY-UHFFFAOYSA-N 0.000 description 1
- QWQITSDOHAMJJW-UHFFFAOYSA-N 2,4-dichlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(Cl)C=C1Cl QWQITSDOHAMJJW-UHFFFAOYSA-N 0.000 description 1
- RBRBLJFOKNCFRR-UHFFFAOYSA-N 2,4-dinitrobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O RBRBLJFOKNCFRR-UHFFFAOYSA-N 0.000 description 1
- RDZWGZPNDVFBBJ-UHFFFAOYSA-N 2,5-diethylpyrrolidine Chemical compound CCC1CCC(CC)N1 RDZWGZPNDVFBBJ-UHFFFAOYSA-N 0.000 description 1
- ZEBFPAXSQXIPNF-UHFFFAOYSA-N 2,5-dimethylpyrrolidine Chemical compound CC1CCC(C)N1 ZEBFPAXSQXIPNF-UHFFFAOYSA-N 0.000 description 1
- GZVUCCJMRWRHSF-UHFFFAOYSA-N 2,6-diamino-5-benzyl-1h-pyrimidin-4-one Chemical compound OC1=NC(N)=NC(N)=C1CC1=CC=CC=C1 GZVUCCJMRWRHSF-UHFFFAOYSA-N 0.000 description 1
- JCNPMQHGAMNNPG-UHFFFAOYSA-N 2,6-diamino-5-methyl-1h-pyrimidin-4-one Chemical compound CC1=C(N)NC(N)=NC1=O JCNPMQHGAMNNPG-UHFFFAOYSA-N 0.000 description 1
- XXXWUVLTYKKMKI-UHFFFAOYSA-N 2,6-diamino-5-phenyl-1h-pyrimidin-4-one Chemical compound OC1=NC(N)=NC(N)=C1C1=CC=CC=C1 XXXWUVLTYKKMKI-UHFFFAOYSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- XXXFZKQPYACQLD-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl acetate Chemical compound CC(=O)OCCOCCO XXXFZKQPYACQLD-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- 125000003163 2-(2-naphthyl)ethyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(C([H])=C([H])C2=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- JCJMJAYVUPKKAO-UHFFFAOYSA-N 2-(4-methylpentyl)pyrrolidine Chemical compound CC(C)CCCC1CCCN1 JCJMJAYVUPKKAO-UHFFFAOYSA-N 0.000 description 1
- OZDGMOYKSFPLSE-UHFFFAOYSA-N 2-Methylaziridine Chemical compound CC1CN1 OZDGMOYKSFPLSE-UHFFFAOYSA-N 0.000 description 1
- NNWUEBIEOFQMSS-UHFFFAOYSA-N 2-Methylpiperidine Chemical compound CC1CCCCN1 NNWUEBIEOFQMSS-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- XQCZBXHVTFVIFE-UHFFFAOYSA-N 2-amino-4-hydroxypyrimidine Chemical class NC1=NC=CC(O)=N1 XQCZBXHVTFVIFE-UHFFFAOYSA-N 0.000 description 1
- XRXMNWGCKISMOH-UHFFFAOYSA-N 2-bromobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Br XRXMNWGCKISMOH-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WDRFYIPWHMGQPN-UHFFFAOYSA-N 2-chloroisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(Cl)C(=O)C2=C1 WDRFYIPWHMGQPN-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- ASNQKEGSBHCDHK-UHFFFAOYSA-N 2-ethylazepane Chemical compound CCC1CCCCCN1 ASNQKEGSBHCDHK-UHFFFAOYSA-N 0.000 description 1
- NZZNMDNKJVUJAL-UHFFFAOYSA-N 2-ethylazetidine Chemical compound CCC1CCN1 NZZNMDNKJVUJAL-UHFFFAOYSA-N 0.000 description 1
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 1
- HXDLWJWIAHWIKI-UHFFFAOYSA-N 2-hydroxyethyl acetate Chemical compound CC(=O)OCCO HXDLWJWIAHWIKI-UHFFFAOYSA-N 0.000 description 1
- JDTUPLBMGDDPJS-UHFFFAOYSA-N 2-methoxy-2-phenylethanol Chemical compound COC(CO)C1=CC=CC=C1 JDTUPLBMGDDPJS-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000006029 2-methyl-2-butenyl group Chemical group 0.000 description 1
- VXDHQYLFEYUMFY-UHFFFAOYSA-N 2-methylprop-2-en-1-amine Chemical compound CC(=C)CN VXDHQYLFEYUMFY-UHFFFAOYSA-N 0.000 description 1
- RGHPCLZJAFCTIK-UHFFFAOYSA-N 2-methylpyrrolidine Chemical compound CC1CCCN1 RGHPCLZJAFCTIK-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- BWWHTIHDQBHTHP-UHFFFAOYSA-N 2-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1C(Cl)=O BWWHTIHDQBHTHP-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- CEBDRQUBQYQBEV-UHFFFAOYSA-N 2-phenoxypyrimidine Chemical compound N=1C=CC=NC=1OC1=CC=CC=C1 CEBDRQUBQYQBEV-UHFFFAOYSA-N 0.000 description 1
- ACSAKRLPJQIBFB-UHFFFAOYSA-N 2-phenyl-n-(2-phenylethyl)ethanamine Chemical compound C=1C=CC=CC=1CCNCCC1=CC=CC=C1 ACSAKRLPJQIBFB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- ICALDHCMXFGLBN-UHFFFAOYSA-N 2-propylpyrrolidine Chemical compound CCCC1CCCN1 ICALDHCMXFGLBN-UHFFFAOYSA-N 0.000 description 1
- MCJWZDIFFOGAJS-UHFFFAOYSA-N 3,3-dimethylazepane Chemical compound CC1(C)CCCCNC1 MCJWZDIFFOGAJS-UHFFFAOYSA-N 0.000 description 1
- HPLBJCPAWPQKDU-UHFFFAOYSA-N 3,4-dimethylbenzenecarboperoxoic acid Chemical compound CC1=CC(=CC=C1C)C(=O)OO HPLBJCPAWPQKDU-UHFFFAOYSA-N 0.000 description 1
- NZXQIKNLFHRWRU-UHFFFAOYSA-N 3,4-dioctylpyrrolidine Chemical compound CCCCCCCCC1CNCC1CCCCCCCC NZXQIKNLFHRWRU-UHFFFAOYSA-N 0.000 description 1
- ULVUGRJTZCWZRN-UHFFFAOYSA-N 3,5-dichlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC(Cl)=CC(Cl)=C1 ULVUGRJTZCWZRN-UHFFFAOYSA-N 0.000 description 1
- GYRSGHQFFPOKHC-UHFFFAOYSA-N 3,5-dipentylpiperidine Chemical compound CCCCCC1CNCC(CCCCC)C1 GYRSGHQFFPOKHC-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- ASVKKRLMJCWVQF-UHFFFAOYSA-N 3-buten-1-amine Chemical compound NCCC=C ASVKKRLMJCWVQF-UHFFFAOYSA-N 0.000 description 1
- KJQYMASXDMSGQU-UHFFFAOYSA-N 3-butylpyrrolidine Chemical compound CCCCC1CCNC1 KJQYMASXDMSGQU-UHFFFAOYSA-N 0.000 description 1
- AFYRKIAHDASULF-UHFFFAOYSA-N 3-chloro-4-methoxybenzenecarboperoxoic acid Chemical compound ClC1=CC(=CC=C1OC)C(=O)OO AFYRKIAHDASULF-UHFFFAOYSA-N 0.000 description 1
- GGLCWCJIZADWQY-UHFFFAOYSA-N 3-chloro-4-nitrobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC(Cl)=C(C=C1)[N+]([O-])=O GGLCWCJIZADWQY-UHFFFAOYSA-N 0.000 description 1
- YLUDSYGJHAQGOD-UHFFFAOYSA-N 3-ethylpiperidine Chemical compound CCC1CCCNC1 YLUDSYGJHAQGOD-UHFFFAOYSA-N 0.000 description 1
- DZFFQSFNUBWNSF-UHFFFAOYSA-N 3-ethylpyrrolidine Chemical compound CCC1CCNC1 DZFFQSFNUBWNSF-UHFFFAOYSA-N 0.000 description 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 description 1
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 description 1
- UFYCTDBUVFSEPU-UHFFFAOYSA-N 3-hydroxy-2-imino-5-(6-methylheptyl)-6-piperidin-1-ylpyrimidin-4-amine Chemical compound NC1=C(C(=NC(N1O)=N)N1CCCCC1)CCCCCC(C)C UFYCTDBUVFSEPU-UHFFFAOYSA-N 0.000 description 1
- ZVKNZHNATYIRMV-UHFFFAOYSA-N 3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine;hydrochloride Chemical compound Cl.N=C1N(O)C(N)=CC(N2CCCCC2)=N1 ZVKNZHNATYIRMV-UHFFFAOYSA-N 0.000 description 1
- FQUYPYSAXHRTGL-UHFFFAOYSA-N 3-octylazetidine Chemical compound CCCCCCCCC1CNC1 FQUYPYSAXHRTGL-UHFFFAOYSA-N 0.000 description 1
- LYUQWQRTDLVQGA-UHFFFAOYSA-N 3-phenylpropylamine Chemical compound NCCCC1=CC=CC=C1 LYUQWQRTDLVQGA-UHFFFAOYSA-N 0.000 description 1
- FKEYLVBZOQMOOV-UHFFFAOYSA-N 3-propan-2-ylpiperidine Chemical compound CC(C)C1CCCNC1 FKEYLVBZOQMOOV-UHFFFAOYSA-N 0.000 description 1
- HLZOYFYFAKWYNH-UHFFFAOYSA-N 4,4-dimethylpent-2-en-1-amine Chemical compound CC(C)(C)C=CCN HLZOYFYFAKWYNH-UHFFFAOYSA-N 0.000 description 1
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- XIQSPCJCAJVNJL-UHFFFAOYSA-N 4-butylpiperidine Chemical compound CCCCC1CCNCC1 XIQSPCJCAJVNJL-UHFFFAOYSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical group OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- DBPKMSBWOKAKLA-UHFFFAOYSA-N 4-chloropyrimidine Chemical compound ClC1=CC=NC=N1 DBPKMSBWOKAKLA-UHFFFAOYSA-N 0.000 description 1
- 125000006051 4-methyl-2-pentenyl group Chemical group 0.000 description 1
- RSFDUEHBYRNVLH-UHFFFAOYSA-N 4-methyl-N-(4-methylhex-3-enyl)hex-3-en-1-amine Chemical compound CC(=CCCNCCC=C(CC)C)CC RSFDUEHBYRNVLH-UHFFFAOYSA-N 0.000 description 1
- MIEJPWILCQAQKT-UHFFFAOYSA-N 4-methylsulfanylbenzoyl chloride Chemical compound CSC1=CC=C(C(Cl)=O)C=C1 MIEJPWILCQAQKT-UHFFFAOYSA-N 0.000 description 1
- YBIYFJLLJFMDFQ-UHFFFAOYSA-N 4-piperidin-1-ylpyrimidine Chemical compound C1CCCCN1C1=CC=NC=N1 YBIYFJLLJFMDFQ-UHFFFAOYSA-N 0.000 description 1
- LAHPNGGYIWAYMX-UHFFFAOYSA-N 4-tert-butylazepane Chemical compound CC(C)(C)C1CCCNCC1 LAHPNGGYIWAYMX-UHFFFAOYSA-N 0.000 description 1
- BGNLXETYTAAURD-UHFFFAOYSA-N 4-tert-butylcyclohexan-1-amine Chemical compound CC(C)(C)C1CCC(N)CC1 BGNLXETYTAAURD-UHFFFAOYSA-N 0.000 description 1
- RJRZUYWILUPZSU-UHFFFAOYSA-N 5-(4-tert-butylcyclohexyl)-6-chloropyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)C1CCC(CC1)C(C)(C)C)Cl RJRZUYWILUPZSU-UHFFFAOYSA-N 0.000 description 1
- LYOBZFWORFCIEG-UHFFFAOYSA-N 5-[(4-bromophenyl)methyl]-6-(2,4-dichlorophenoxy)pyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)CC1=CC=C(C=C1)Br)OC1=C(C=C(C=C1)Cl)Cl LYOBZFWORFCIEG-UHFFFAOYSA-N 0.000 description 1
- VHDCXSQMDGKULE-UHFFFAOYSA-N 5-[(4-bromophenyl)methyl]-6-chloropyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)CC1=CC=C(C=C1)Br)Cl VHDCXSQMDGKULE-UHFFFAOYSA-N 0.000 description 1
- MENIJRPFVLNJIH-UHFFFAOYSA-N 5-benzyl-1,3-diazinane-2,4,6-trione Chemical compound O=C1NC(=O)NC(=O)C1CC1=CC=CC=C1 MENIJRPFVLNJIH-UHFFFAOYSA-N 0.000 description 1
- GDZMMNKXWSTJME-UHFFFAOYSA-N 5-benzyl-6-chloropyrimidine-2,4-diamine Chemical compound ClC1=NC(N)=NC(N)=C1CC1=CC=CC=C1 GDZMMNKXWSTJME-UHFFFAOYSA-N 0.000 description 1
- XUTDAAPPNIQPSJ-UHFFFAOYSA-N 5-bromo-3-hydroxy-2-imino-6-pyrrolidin-1-ylpyrimidin-4-amine Chemical compound NC1=C(C(=NC(N1O)=N)N1CCCC1)Br XUTDAAPPNIQPSJ-UHFFFAOYSA-N 0.000 description 1
- SEJASCXVNQDOEL-UHFFFAOYSA-N 5-but-2-enyl-6-(2,4-dichlorophenoxy)-3-hydroxy-2-iminopyrimidin-4-amine Chemical compound NC1=C(C(=NC(N1O)=N)OC1=C(C=C(C=C1)Cl)Cl)CC=CC SEJASCXVNQDOEL-UHFFFAOYSA-N 0.000 description 1
- BEXRDPYOLGTMOQ-UHFFFAOYSA-N 5-butyl-6-chloropyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)CCCC)Cl BEXRDPYOLGTMOQ-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- 150000005718 5-chloropyrimidines Chemical class 0.000 description 1
- HNYZVEATFIUPCN-UHFFFAOYSA-N 5-cyclopentyl-3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine Chemical compound NC1=C(C(=NC(N1O)=N)N1CCCCC1)C1CCCC1 HNYZVEATFIUPCN-UHFFFAOYSA-N 0.000 description 1
- MNGOCGNQLBTUAX-UHFFFAOYSA-N 5-ethyl-2-methylmorpholine Chemical compound CCC1COC(C)CN1 MNGOCGNQLBTUAX-UHFFFAOYSA-N 0.000 description 1
- QFDABXMMQHNZFG-UHFFFAOYSA-N 5-hex-2-enyl-3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine Chemical compound NC1=C(C(=NC(N1O)=N)N1CCCCC1)CC=CCCC QFDABXMMQHNZFG-UHFFFAOYSA-N 0.000 description 1
- 150000005703 5-iodopyrimidines Chemical class 0.000 description 1
- GOMAEJQBTWAPAN-UHFFFAOYSA-N 5-methylbarbituric acid Chemical compound CC1C(=O)NC(=O)NC1=O GOMAEJQBTWAPAN-UHFFFAOYSA-N 0.000 description 1
- HTEHILLCBQWTLP-UHFFFAOYSA-N 5-phenyl-1,3-diazinane-2,4,6-trione Chemical compound O=C1NC(=O)NC(=O)C1C1=CC=CC=C1 HTEHILLCBQWTLP-UHFFFAOYSA-N 0.000 description 1
- WCAZQSZSGWXKPM-UHFFFAOYSA-N 6-(2,4-dichlorophenoxy)-5-methylpyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)C)OC1=C(C=C(C=C1)Cl)Cl WCAZQSZSGWXKPM-UHFFFAOYSA-N 0.000 description 1
- CKCDXQZZVMZBPO-UHFFFAOYSA-N 6-(4-bromophenoxy)pyrimidine-2,4-diamine Chemical compound NC1=NC(N)=CC(OC=2C=CC(Br)=CC=2)=N1 CKCDXQZZVMZBPO-UHFFFAOYSA-N 0.000 description 1
- OTBJWOCNFYQMBZ-UHFFFAOYSA-N 6-chloro-5-(2-methoxyethyl)pyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)CCOC)Cl OTBJWOCNFYQMBZ-UHFFFAOYSA-N 0.000 description 1
- QPDKXMFPPDZIHS-UHFFFAOYSA-N 6-chloro-5-(4-methylphenyl)pyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)C1=CC=C(C=C1)C)Cl QPDKXMFPPDZIHS-UHFFFAOYSA-N 0.000 description 1
- RZQYTIBFYADUIM-UHFFFAOYSA-N 6-chloro-5-[(2-methylphenyl)methyl]pyrimidine-2,4-diamine Chemical compound CC1=C(CC2=C(N)N=C(N)N=C2Cl)C=CC=C1 RZQYTIBFYADUIM-UHFFFAOYSA-N 0.000 description 1
- WNTDWOSWIOBGFW-UHFFFAOYSA-N 6-chloro-5-methylpyrimidine-2,4-diamine Chemical compound NC1=NC(=C(C(=N1)N)C)Cl WNTDWOSWIOBGFW-UHFFFAOYSA-N 0.000 description 1
- AOCNKBDSGDEXLR-UHFFFAOYSA-N 6-chloro-5-phenylpyrimidine-2,4-diamine Chemical compound ClC1=NC(N)=NC(N)=C1C1=CC=CC=C1 AOCNKBDSGDEXLR-UHFFFAOYSA-N 0.000 description 1
- DUKKRSPKJMHASP-UHFFFAOYSA-N 6-chloropyrimidin-4-amine Chemical group NC1=CC(Cl)=NC=N1 DUKKRSPKJMHASP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- LUFQHUSYACEOFJ-UHFFFAOYSA-N CC1(C)C=[NH+][CH-]1 Chemical compound CC1(C)C=[NH+][CH-]1 LUFQHUSYACEOFJ-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical class [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- UDIPTWFVPPPURJ-UHFFFAOYSA-M Cyclamate Chemical compound [Na+].[O-]S(=O)(=O)NC1CCCCC1 UDIPTWFVPPPURJ-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- CVBMAZKKCSYWQR-BPJCFPRXSA-N Deserpidine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cccc3 CVBMAZKKCSYWQR-BPJCFPRXSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 235000019733 Fish meal Nutrition 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WJYIASZWHGOTOU-UHFFFAOYSA-N Heptylamine Chemical compound CCCCCCCN WJYIASZWHGOTOU-UHFFFAOYSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- LEROTMJVBFSIMP-UHFFFAOYSA-N Mebutamate Chemical compound NC(=O)OCC(C)(C(C)CC)COC(N)=O LEROTMJVBFSIMP-UHFFFAOYSA-N 0.000 description 1
- PKVZBNCYEICAQP-UHFFFAOYSA-N Mecamylamine hydrochloride Chemical compound Cl.C1CC2C(C)(C)C(NC)(C)C1C2 PKVZBNCYEICAQP-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical class CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- NRNBOADJDPKEFD-UHFFFAOYSA-N N-hex-4-enylhex-4-en-1-amine Chemical compound CC=CCCCNCCCC=CC NRNBOADJDPKEFD-UHFFFAOYSA-N 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- BWMZPIPRFFAFNB-UHFFFAOYSA-N NC1=NC(=C(C(=N1)N)CCCCCC(C)C)Cl Chemical compound NC1=NC(=C(C(=N1)N)CCCCCC(C)C)Cl BWMZPIPRFFAFNB-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- ZCDNRPPFBQDQHR-SSYATKPKSA-N Syrosingopine Chemical compound C1=C(OC)C(OC(=O)OCC)=C(OC)C=C1C(=O)O[C@H]1[C@H](OC)[C@@H](C(=O)OC)[C@H]2C[C@@H]3C(NC=4C5=CC=C(OC)C=4)=C5CCN3C[C@H]2C1 ZCDNRPPFBQDQHR-SSYATKPKSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- FNYLWPVRPXGIIP-UHFFFAOYSA-N Triamterene Chemical compound NC1=NC2=NC(N)=NC(N)=C2N=C1C1=CC=CC=C1 FNYLWPVRPXGIIP-UHFFFAOYSA-N 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- VJDDQSBNUHLBTD-GGWOSOGESA-N [(e)-but-2-enoyl] (e)-but-2-enoate Chemical compound C\C=C\C(=O)OC(=O)\C=C\C VJDDQSBNUHLBTD-GGWOSOGESA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- WRYNUJYAXVDTCB-UHFFFAOYSA-M acetyloxymercury Chemical compound CC(=O)O[Hg] WRYNUJYAXVDTCB-UHFFFAOYSA-M 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229940024223 alseroxylon Drugs 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- PECIYKGSSMCNHN-UHFFFAOYSA-N aminophylline Chemical compound NCCN.O=C1N(C)C(=O)N(C)C2=NC=N[C]21.O=C1N(C)C(=O)N(C)C2=NC=N[C]21 PECIYKGSSMCNHN-UHFFFAOYSA-N 0.000 description 1
- 229960003556 aminophylline Drugs 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- FXNYSZHYMGWWEZ-UHFFFAOYSA-N amisometradine Chemical compound CC(=C)CN1C(N)=CC(=O)N(C)C1=O FXNYSZHYMGWWEZ-UHFFFAOYSA-N 0.000 description 1
- 229950008305 amisometradine Drugs 0.000 description 1
- 229960001301 amobarbital Drugs 0.000 description 1
- 239000002269 analeptic agent Substances 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 229940058936 antimalarials diaminopyrimidines Drugs 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- QXNDZONIWRINJR-UHFFFAOYSA-N azocane Chemical compound C1CCCNCCC1 QXNDZONIWRINJR-UHFFFAOYSA-N 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- 150000007656 barbituric acids Chemical class 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- FYXKZNLBZKRYSS-UHFFFAOYSA-N benzene-1,2-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C(Cl)=O FYXKZNLBZKRYSS-UHFFFAOYSA-N 0.000 description 1
- CHIHQLCVLOXUJW-UHFFFAOYSA-N benzoic anhydride Chemical compound C=1C=CC=CC=1C(=O)OC(=O)C1=CC=CC=C1 CHIHQLCVLOXUJW-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- NIVZHWNOUVJHKV-UHFFFAOYSA-N bethanidine Chemical compound CN\C(=N/C)NCC1=CC=CC=C1 NIVZHWNOUVJHKV-UHFFFAOYSA-N 0.000 description 1
- 229940007994 bethanidine sulfate Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- HUTDDBSSHVOYJR-UHFFFAOYSA-H bis[(2-oxo-1,3,2$l^{5},4$l^{2}-dioxaphosphaplumbetan-2-yl)oxy]lead Chemical compound [Pb+2].[Pb+2].[Pb+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O HUTDDBSSHVOYJR-UHFFFAOYSA-H 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- DKSMCEUSSQTGBK-UHFFFAOYSA-N bromous acid Chemical compound OBr=O DKSMCEUSSQTGBK-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- LBAYFEDWGHXMSM-UHFFFAOYSA-N butaneperoxoic acid Chemical compound CCCC(=O)OO LBAYFEDWGHXMSM-UHFFFAOYSA-N 0.000 description 1
- YFNONBGXNFCTMM-UHFFFAOYSA-N butoxybenzene Chemical group CCCCOC1=CC=CC=C1 YFNONBGXNFCTMM-UHFFFAOYSA-N 0.000 description 1
- GUGRBFQNXVKOGR-UHFFFAOYSA-N butyl hypochlorite Chemical compound CCCCOCl GUGRBFQNXVKOGR-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- OFZCIYFFPZCNJE-UHFFFAOYSA-N carisoprodol Chemical compound NC(=O)OCC(C)(CCC)COC(=O)NC(C)C OFZCIYFFPZCNJE-UHFFFAOYSA-N 0.000 description 1
- 229960004587 carisoprodol Drugs 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229960004725 chlordiazepoxide hydrochloride Drugs 0.000 description 1
- DMLFJMQTNDSRFU-UHFFFAOYSA-N chlordiazepoxide hydrochloride Chemical compound Cl.O=N=1CC(NC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 DMLFJMQTNDSRFU-UHFFFAOYSA-N 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- GMRWGQCZJGVHKL-UHFFFAOYSA-N colestipol Chemical compound ClCC1CO1.NCCNCCNCCNCCN GMRWGQCZJGVHKL-UHFFFAOYSA-N 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 239000000625 cyclamic acid and its Na and Ca salt Substances 0.000 description 1
- 150000001925 cycloalkenes Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- CXWMHIRIXVNVQN-UHFFFAOYSA-N cyclohex-3-ene-1-carbonyl chloride Chemical compound ClC(=O)C1CCC=CC1 CXWMHIRIXVNVQN-UHFFFAOYSA-N 0.000 description 1
- JOHUAELJNSBTGS-UHFFFAOYSA-N cyclohexanecarbonyl cyclohexanecarboxylate Chemical compound C1CCCCC1C(=O)OC(=O)C1CCCCC1 JOHUAELJNSBTGS-UHFFFAOYSA-N 0.000 description 1
- ZHGASCUQXLPSDT-UHFFFAOYSA-N cyclohexanesulfonic acid Chemical compound OS(=O)(=O)C1CCCCC1 ZHGASCUQXLPSDT-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- VRLDVERQJMEPIF-UHFFFAOYSA-N dbdmh Chemical compound CC1(C)N(Br)C(=O)N(Br)C1=O VRLDVERQJMEPIF-UHFFFAOYSA-N 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- ISMCNVNDWFIXLM-WCGOZPBSSA-N deserpidine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 ISMCNVNDWFIXLM-WCGOZPBSSA-N 0.000 description 1
- 229960001993 deserpidine Drugs 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 229940028356 diethylene glycol monobutyl ether Drugs 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 229950008272 ectylurea Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 229960004447 ethchlorvynol Drugs 0.000 description 1
- FPIQZBQZKBKLEI-UHFFFAOYSA-N ethyl 1-[[2-chloroethyl(nitroso)carbamoyl]amino]cyclohexane-1-carboxylate Chemical compound ClCCN(N=O)C(=O)NC1(C(=O)OCC)CCCCC1 FPIQZBQZKBKLEI-UHFFFAOYSA-N 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004467 fishmeal Substances 0.000 description 1
- RGUQWGXAYZNLMI-UHFFFAOYSA-N flumethiazide Chemical compound C1=C(C(F)(F)F)C(S(=O)(=O)N)=CC2=C1NC=NS2(=O)=O RGUQWGXAYZNLMI-UHFFFAOYSA-N 0.000 description 1
- 229960003028 flumethiazide Drugs 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- YUFWAVFNITUSHI-UHFFFAOYSA-N guanethidine monosulfate Chemical compound [H+].[H+].[O-]S([O-])(=O)=O.NC(=N)NCCN1CCCCCCC1 YUFWAVFNITUSHI-UHFFFAOYSA-N 0.000 description 1
- 229960004848 guanethidine sulfate Drugs 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960002474 hydralazine Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 230000026045 iodination Effects 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960004119 mebutamate Drugs 0.000 description 1
- 229960001263 mecamylamine hydrochloride Drugs 0.000 description 1
- 229940100892 mercury compound Drugs 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- TXCOOXHLBAXWBP-UHFFFAOYSA-N n-(6-amino-1-hydroxy-4-piperidin-1-ylpyrimidin-2-ylidene)benzamide Chemical compound ON1C(N)=CC(N2CCCCC2)=NC1=NC(=O)C1=CC=CC=C1 TXCOOXHLBAXWBP-UHFFFAOYSA-N 0.000 description 1
- JFVQSRKXAAXZIK-UHFFFAOYSA-N n-(naphthalen-1-ylmethyl)ethanamine Chemical compound C1=CC=C2C(CNCC)=CC=CC2=C1 JFVQSRKXAAXZIK-UHFFFAOYSA-N 0.000 description 1
- HVAAHUDGWQAAOJ-UHFFFAOYSA-N n-benzylethanamine Chemical compound CCNCC1=CC=CC=C1 HVAAHUDGWQAAOJ-UHFFFAOYSA-N 0.000 description 1
- VBTQNRFWXBXZQR-UHFFFAOYSA-N n-bromoacetamide Chemical compound CC(=O)NBr VBTQNRFWXBXZQR-UHFFFAOYSA-N 0.000 description 1
- FLYWSBDBTKARFZ-UHFFFAOYSA-N n-bromobenzamide Chemical compound BrNC(=O)C1=CC=CC=C1 FLYWSBDBTKARFZ-UHFFFAOYSA-N 0.000 description 1
- AEUGPBYLZNGABC-UHFFFAOYSA-N n-but-2-enylbutan-1-amine Chemical compound CCCCNCC=CC AEUGPBYLZNGABC-UHFFFAOYSA-N 0.000 description 1
- OBYVIBDTOCAXSN-UHFFFAOYSA-N n-butan-2-ylbutan-2-amine Chemical compound CCC(C)NC(C)CC OBYVIBDTOCAXSN-UHFFFAOYSA-N 0.000 description 1
- CLZQAQVPPKCQIV-UHFFFAOYSA-N n-chloro-n-(2-chlorophenyl)acetamide Chemical compound CC(=O)N(Cl)C1=CC=CC=C1Cl CLZQAQVPPKCQIV-UHFFFAOYSA-N 0.000 description 1
- QGHZRZYQJSWRKJ-UHFFFAOYSA-N n-chloro-n-(4-nitrophenyl)acetamide Chemical compound CC(=O)N(Cl)C1=CC=C([N+]([O-])=O)C=C1 QGHZRZYQJSWRKJ-UHFFFAOYSA-N 0.000 description 1
- HSPSCWZIJWKZKD-UHFFFAOYSA-N n-chloroacetamide Chemical compound CC(=O)NCl HSPSCWZIJWKZKD-UHFFFAOYSA-N 0.000 description 1
- CHVZPRDGLWBEMJ-UHFFFAOYSA-N n-chlorobenzenesulfonamide Chemical compound ClNS(=O)(=O)C1=CC=CC=C1 CHVZPRDGLWBEMJ-UHFFFAOYSA-N 0.000 description 1
- AXKJSFBBMURBGA-UHFFFAOYSA-N n-ethyl-2,4-dimethylpentan-1-amine Chemical compound CCNCC(C)CC(C)C AXKJSFBBMURBGA-UHFFFAOYSA-N 0.000 description 1
- WSTNFGAKGUERTC-UHFFFAOYSA-N n-ethylhexan-1-amine Chemical compound CCCCCCNCC WSTNFGAKGUERTC-UHFFFAOYSA-N 0.000 description 1
- RIVIDPPYRINTTH-UHFFFAOYSA-N n-ethylpropan-2-amine Chemical compound CCNC(C)C RIVIDPPYRINTTH-UHFFFAOYSA-N 0.000 description 1
- NJWMENBYMFZACG-UHFFFAOYSA-N n-heptylheptan-1-amine Chemical compound CCCCCCCNCCCCCCC NJWMENBYMFZACG-UHFFFAOYSA-N 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- SEGJNMCIMOLEDM-UHFFFAOYSA-N n-methyloctan-1-amine Chemical compound CCCCCCCCNC SEGJNMCIMOLEDM-UHFFFAOYSA-N 0.000 description 1
- JACMPVXHEARCBO-UHFFFAOYSA-N n-pentylpentan-1-amine Chemical compound CCCCCNCCCCC JACMPVXHEARCBO-UHFFFAOYSA-N 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001048 orange dye Substances 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- JCGNDDUYTRNOFT-UHFFFAOYSA-N oxolane-2,4-dione Chemical compound O=C1COC(=O)C1 JCGNDDUYTRNOFT-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229960003207 papaverine hydrochloride Drugs 0.000 description 1
- 239000003182 parenteral nutrition solution Substances 0.000 description 1
- HSMKTIKKPMTUQH-WBPXWQEISA-L pentolinium tartrate Chemical compound OC(=O)[C@H](O)[C@@H](O)C([O-])=O.OC(=O)[C@H](O)[C@@H](O)C([O-])=O.C1CCC[N+]1(C)CCCCC[N+]1(C)CCCC1 HSMKTIKKPMTUQH-WBPXWQEISA-L 0.000 description 1
- 229950008637 pentolonium Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940100684 pentylamine Drugs 0.000 description 1
- HTYIXCKSEQQCJO-UHFFFAOYSA-N phenaglycodol Chemical compound CC(C)(O)C(C)(O)C1=CC=C(Cl)C=C1 HTYIXCKSEQQCJO-UHFFFAOYSA-N 0.000 description 1
- 229950005116 phenaglycodol Drugs 0.000 description 1
- 229940117803 phenethylamine Drugs 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- 229960002695 phenobarbital Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229940057838 polyethylene glycol 4000 Drugs 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229940068968 polysorbate 80 Drugs 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- JIVSXRLRGOICGA-UHFFFAOYSA-N promazine hydrochloride Chemical compound [H+].[Cl-].C1=CC=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 JIVSXRLRGOICGA-UHFFFAOYSA-N 0.000 description 1
- 229960001836 promazine hydrochloride Drugs 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- CZPZWMPYEINMCF-UHFFFAOYSA-N propaneperoxoic acid Chemical compound CCC(=O)OO CZPZWMPYEINMCF-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- PTMBWNZJOQBTBK-UHFFFAOYSA-N pyridin-4-ylmethanol Chemical compound OCC1=CC=NC=C1 PTMBWNZJOQBTBK-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- MISVBCMQSJUHMH-UHFFFAOYSA-N pyrimidine-4,6-diamine Chemical class NC1=CC(N)=NC=N1 MISVBCMQSJUHMH-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 239000012260 resinous material Substances 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229960001462 sodium cyclamate Drugs 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- LXMSZDCAJNLERA-ZHYRCANASA-N spironolactone Chemical compound C([C@@H]1[C@]2(C)CC[C@@H]3[C@@]4(C)CCC(=O)C=C4C[C@H]([C@@H]13)SC(=O)C)C[C@@]21CCC(=O)O1 LXMSZDCAJNLERA-ZHYRCANASA-N 0.000 description 1
- 229960002256 spironolactone Drugs 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 229950006534 syrosingopine Drugs 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- VJDDQSBNUHLBTD-UHFFFAOYSA-N trans-crotonic acid-anhydride Natural products CC=CC(=O)OC(=O)C=CC VJDDQSBNUHLBTD-UHFFFAOYSA-N 0.000 description 1
- 229960001288 triamterene Drugs 0.000 description 1
- LMJSLTNSBFUCMU-UHFFFAOYSA-N trichlormethiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NC(C(Cl)Cl)NS2(=O)=O LMJSLTNSBFUCMU-UHFFFAOYSA-N 0.000 description 1
- 229960004813 trichlormethiazide Drugs 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 238000005550 wet granulation Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 description 1
- 235000016804 zinc Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/535—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one oxygen as the ring hetero atoms, e.g. 1,2-oxazines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/54—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/55—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having seven-membered rings, e.g. azelastine, pentylenetetrazole
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/50—Three nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US50599365A | 1965-11-01 | 1965-11-01 | |
| US505989A US3382247A (en) | 1965-11-01 | 1965-11-01 | 6-amino-1, 2-dihydro-1-hydroxy-2-imino-4-phenoxypyrimidines |
| US505992A US3382248A (en) | 1965-11-01 | 1965-11-01 | 6-amino-4, 5-di(substituted amino)-1, 2-dihydro-1-hydroxy-2-iminopyrimidines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH495361A true CH495361A (de) | 1970-08-31 |
Family
ID=27414311
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1515366A CH495361A (de) | 1965-11-01 | 1966-10-19 | Verfahren zur Herstellung neuer 1,2-Dihydro-1-hydroxypyrimidine |
Country Status (7)
| Country | Link |
|---|---|
| US (3) | US3382248A (index.php) |
| CH (1) | CH495361A (index.php) |
| DE (6) | DE1695939A1 (index.php) |
| FR (2) | FR1510017A (index.php) |
| GB (2) | GB1167735A (index.php) |
| IL (1) | IL26686A (index.php) |
| NL (1) | NL154508B (index.php) |
Families Citing this family (110)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH513181A (de) * | 1969-06-12 | 1971-09-30 | Hoffmann La Roche | Verfahren zur Herstellung von N-Oxyden von Benzylpyrimidinen |
| CA1020558A (en) * | 1971-04-07 | 1977-11-08 | Richard C. Thomas (Jr.) | 6-amino-4-(substituted amino)-1,2-dihydro-1-hydroxy-2-iminopyrimidines |
| US3998827A (en) * | 1971-04-07 | 1976-12-21 | The Upjohn Company | 6-amino-4-(substituted piperidino)-1,2-dihydro-1-hydroxy-2-iminopyrimidines |
| US3926997A (en) * | 1971-05-17 | 1975-12-16 | Ciba Geigy Corp | 2-Alkylthio-4,6-bis(substituted amino)-5-nitropyrimidines |
| US3969101A (en) * | 1971-05-17 | 1976-07-13 | Ciba-Geigy Corporation | Agent for controlling plant growth |
| US3936456A (en) * | 1972-03-24 | 1976-02-03 | Ciby-Geigy Corporation | Substituted piperazine dione oxyls and hydroxides and polymer compositions stabilized thereby |
| US3910928A (en) * | 1974-04-26 | 1975-10-07 | Upjohn Co | 3-(Cyanimino)-propionitriles |
| CH595061A5 (index.php) * | 1974-05-10 | 1978-01-31 | Ciba Geigy Ag | |
| US4182888A (en) * | 1975-12-08 | 1980-01-08 | Mead Johnson & Company | 4-Tertiary-amino-2,6-diaminopyridine 1-oxides |
| US4021562A (en) * | 1975-12-08 | 1977-05-03 | Mead Johnson & Company | 4-Tertiary-amino-2,6-diaminopyridine 1-oxides |
| US4596812A (en) * | 1976-05-24 | 1986-06-24 | The Upjohn Company | Methods and solutions for treating male pattern alopecia |
| US4139619A (en) * | 1976-05-24 | 1979-02-13 | The Upjohn Company | 6-Amino-4-(substituted amino)-1,2-dihydro-1-hydroxy-2-iminopyrimidine, topical compositions and process for hair growth |
| US4182867A (en) * | 1977-02-04 | 1980-01-08 | Hoffmann-La Roche Inc. | 6-[3,6-Dihydro-1(2H)-pyridyl]-pyrimidine-3-oxides |
| CH638216A5 (de) * | 1977-02-04 | 1983-09-15 | Hoffmann La Roche | Oxadiazolopyrimidin-deriate. |
| CH638215A5 (de) * | 1977-02-04 | 1983-09-15 | Hoffmann La Roche | Oxadiazolopyrimidin-derivate. |
| EP0000383B1 (en) * | 1977-07-08 | 1982-10-13 | The Wellcome Foundation Limited | Pyrimido (4,5-c) pyridazines, their use in pharmaceutical preparations, and process for their preparation |
| US4287338A (en) * | 1980-03-10 | 1981-09-01 | The Upjohn Company | Sulfooxy-pyrimidinium, -pyridinium, and -triazinium hydroxide inner salts |
| US4393065A (en) * | 1980-06-23 | 1983-07-12 | The Upjohn Company | Animal feed and process |
| US5183817A (en) * | 1981-02-17 | 1993-02-02 | Bazzano Gail S | Combinations of retinoids and minoxidil-type compounds for hair growth |
| US5514672A (en) * | 1981-02-17 | 1996-05-07 | Bazzano; Gail S. | Use of retinoids and compositions containing same for hair growth |
| CA1179344A (en) * | 1981-07-15 | 1984-12-11 | Jean-Claude Muller | Process for the preparation of 6-¬3,6-dihydro-1(2h)- pyridyl| pyrimidine-3-oxides |
| EP0093770B1 (en) * | 1981-11-09 | 1991-06-19 | BAZZANO, Gail S | The use of retinoids and minoxidil (2,4-diamino-6-piperidino-pyrimidine-3-oxide) to increase the rate of growth of human scalp hair and to treat certain types of alopecias |
| US5693741A (en) * | 1988-03-15 | 1997-12-02 | The Boeing Company | Liquid molding compounds |
| US5512676A (en) * | 1987-09-03 | 1996-04-30 | The Boeing Company | Extended amideimide hub for multidimensional oligomers |
| US5705598A (en) * | 1985-04-23 | 1998-01-06 | The Boeing Company | Polyester sulfone oligomers and blends |
| US5969079A (en) * | 1985-09-05 | 1999-10-19 | The Boeing Company | Oligomers with multiple chemically functional end caps |
| US5714566A (en) * | 1981-11-13 | 1998-02-03 | The Boeing Company | Method for making multiple chemically functional oligomers |
| US5210213A (en) * | 1983-06-17 | 1993-05-11 | The Boeing Company | Dimensional, crosslinkable oligomers |
| US5227461A (en) * | 1983-06-17 | 1993-07-13 | The Boeing Company | Extended difunctional end-cap monomers |
| US5618907A (en) * | 1985-04-23 | 1997-04-08 | The Boeing Company | Thallium catalyzed multidimensional ester oligomers |
| IT1214611B (it) * | 1985-05-22 | 1990-01-18 | Schiena Ricerche | Composti per uso cosmetico dermatologico e relative composizioni. |
| US5723502A (en) * | 1985-07-18 | 1998-03-03 | Proctor; Peter H. | Topical spin trap composition and method |
| US5714482A (en) * | 1985-07-18 | 1998-02-03 | Proctor; Peter H. | Topical spin labels and method |
| US5716947A (en) * | 1985-07-18 | 1998-02-10 | Proctor; Peter H. | Topical doxyl composition and method |
| US5714510A (en) * | 1985-07-18 | 1998-02-03 | Proctor; Peter H. | Topical proxyl composition and method |
| US5472687A (en) * | 1985-07-18 | 1995-12-05 | Proctor; Peter H. | Topical pyridine N-oxides |
| US6150405A (en) * | 1985-07-18 | 2000-11-21 | Proctor; Peter H. | Hair loss treatment with ascorbates |
| US5352442A (en) * | 1985-07-18 | 1994-10-04 | Proctor Peter H | Topical tempo |
| US5470876A (en) * | 1985-07-18 | 1995-11-28 | Proctor; Peter H. | Topical sod for treating hair loss |
| US5728714A (en) * | 1985-07-18 | 1998-03-17 | Proctor; Peter H. | Method for treating hair loss using tempo |
| FR2590897B1 (fr) * | 1985-12-06 | 1988-02-19 | Kemyos Bio Medical Research Sr | Nouveaux derives de 6 amino 1,2-dihydro-1-hydroxy-2-imino-pyrimidine, leur procede de preparation et compositions cosmetiques les renfermant |
| US5041439A (en) * | 1986-06-13 | 1991-08-20 | The Procter & Gamble Company | Penetrating topical pharmaceutical compositions |
| HU196067B (en) * | 1986-07-10 | 1988-09-28 | Richter Gedeon Vegyeszet | Process for production of 6-amin-1,2-dihydro-1-hydroxi-2-imino-4-piperidin-piramidin |
| LU86547A1 (fr) * | 1986-08-07 | 1988-03-02 | Oreal | Suspension pour induire et stimuler la croissance des cheveux et diminuer leur chute a base de derives de la pyrimidine |
| LU86574A1 (fr) * | 1986-09-08 | 1988-04-05 | Oreal | Composition pour induire et stimuler la croissance des cheveux et freiner leur chute,a base d'esters nicotiniques et de derives de pyrimidine |
| US5157036A (en) * | 1986-09-08 | 1992-10-20 | L'oreal | Composition for inducing and stimulating hair growth and retarding its loss, based on nicotinic esters and pyrimidine derivatives |
| IT1212140B (it) * | 1987-05-08 | 1989-11-08 | Sig Gla Pharmaceuticals S P A | Processo per la preparazione del 2,4-diammino-6-(1-piperidinil)-piri mi-din-n-ossido. |
| LU86958A1 (fr) * | 1987-07-31 | 1989-03-08 | Oreal | Sels d'acide thiamorpholinone carboxylique et de derives de diamino-2,4 pyrimidine,leur utilisation en cosmetique et pharmacie |
| LU86959A1 (fr) * | 1987-07-31 | 1989-03-08 | Oreal | Nouveaux derives d'ureylene triamino-2,4,6 pyrimidine oxyde-3,leur preparation et leur utilisation en cosmetique et dermopharmacie |
| LU86960A1 (fr) * | 1987-07-31 | 1989-03-08 | Oreal | Procede de preparation de piperidino-6 diamino-2,4 pyrimidine oxyde-3 et composes nouveaux |
| LU86969A1 (fr) * | 1987-08-12 | 1989-03-08 | Oreal | Association de derives de pyrimidine et de retinoides en composants separes pour induire et stimuler la croissance des cheveux et diminuer leur chute |
| US5817744A (en) * | 1988-03-14 | 1998-10-06 | The Boeing Company | Phenylethynyl capped imides |
| US4927626A (en) * | 1988-10-28 | 1990-05-22 | Devillez Richard L | Method for enhancement of unguis growth |
| JP2814090B2 (ja) * | 1988-12-14 | 1998-10-22 | 株式会社資生堂 | 養毛料 |
| FR2654101B1 (fr) * | 1989-11-08 | 1992-01-31 | Oreal | Nouveaux sels internes des hydroxydes de diamino-2,4 alcoxy-6 sulfooxy-3 pyrimidinium et leur utilisation pour le traitement et la prevention de la chute des cheveux. |
| AU651630B2 (en) * | 1990-11-14 | 1994-07-28 | Pharmacia & Upjohn Company | 5-fluoro-2,4,6-pyrimidinetriamine compounds |
| FR2678929A1 (fr) * | 1991-07-11 | 1993-01-15 | Oreal | Compositions pour freiner la chute des cheveux et pour induire et stimuler leur croissance a base de derives de 2,4-diamino pyrimidine 3-oxyde, nouveaux derives 2,4-diamino pyrimidine 3-oxyde. |
| US5502050A (en) * | 1993-11-29 | 1996-03-26 | Cornell Research Foundation, Inc. | Blocking utilization of tetrahydrobiopterin to block induction of nitric oxide synthesis |
| FR2753378B1 (fr) * | 1996-09-17 | 1998-11-20 | Oreal | Utilisation dans une composition en tant que stimulateur de tyrosinase d'au moins un derive de pyrimidine 3-oxyde, substitue en 6 |
| EP1159266B1 (en) | 1999-03-05 | 2004-11-03 | Duke University | C-16 unsaturated fp-selective prostaglandins analogs |
| US20020146439A1 (en) * | 2000-03-31 | 2002-10-10 | Delong Mitchell Anthony | Compositions and methods for treating hair loss using oximyl and hydroxylamino prostaglandins |
| US20020037914A1 (en) * | 2000-03-31 | 2002-03-28 | Delong Mitchell Anthony | Compositions and methods for treating hair loss using C16-C20 aromatic tetrahydro prostaglandins |
| US20020172693A1 (en) | 2000-03-31 | 2002-11-21 | Delong Michell Anthony | Compositions and methods for treating hair loss using non-naturally occurring prostaglandins |
| US20020013294A1 (en) * | 2000-03-31 | 2002-01-31 | Delong Mitchell Anthony | Cosmetic and pharmaceutical compositions and methods using 2-decarboxy-2-phosphinico derivatives |
| US7442369B1 (en) | 2000-08-09 | 2008-10-28 | Mcneil Ab | Compositions of minoxidil |
| US7351404B2 (en) * | 2002-02-04 | 2008-04-01 | Allergan, Inc. | Method of enhancing hair growth |
| US9216183B2 (en) | 2002-02-04 | 2015-12-22 | Allergan, Inc. | Topical treatment for chemotherapy induced eyelash loss or hypotrichosis using prostamide F2 alpha agonists |
| US8758733B2 (en) | 2002-02-04 | 2014-06-24 | Allergan, Inc. | Topical treatment for chemotherapy induced eyelash loss or hypotrichosis using prostamide F2 alpha agonists |
| US20040142853A1 (en) * | 2002-11-07 | 2004-07-22 | Procyte Corporation | Stimulation of hair growth by compositions containing peptide copper complexes and minoxidil |
| US7326717B2 (en) * | 2003-05-06 | 2008-02-05 | L'oreal | Pyrimidine n-oxide compounds for stimulating the growth of keratin fibers and/or reducing loss thereof |
| US20050163811A1 (en) * | 2004-01-23 | 2005-07-28 | Richard Lee | Topical solutions comprising high concentrations of piperidinopyrimidine derivatives and methods of use thereof |
| WO2006091587A2 (en) * | 2005-02-22 | 2006-08-31 | Cedars-Sinai Medical Center | Use of minoxidil sulfate as an anti-tumor drug |
| US20060193804A1 (en) * | 2005-02-24 | 2006-08-31 | L'oreal | Haircare use of cyclic amine derivatives |
| US20090018204A1 (en) * | 2007-07-13 | 2009-01-15 | Brinkenhoff Michael C | Composition and method for enhancing hair growth |
| FR2920309B1 (fr) | 2007-08-28 | 2010-05-28 | Galderma Res & Dev | Utilisation de travoprost pour traiter la chute des cheveux |
| US8623918B2 (en) | 2008-10-29 | 2014-01-07 | Novaer Holdings, Inc. | Amino acid salts of prostaglandins |
| US8722739B2 (en) * | 2008-10-29 | 2014-05-13 | Novaer Holdings, Inc. | Amino acid salts of prostaglandins |
| US20100204335A1 (en) * | 2008-12-01 | 2010-08-12 | Allergan, Inc. | Kit and composition for eyelash growth |
| US20110293549A1 (en) | 2009-02-03 | 2011-12-01 | Athena Cosmetics, Inc. | Composition, method and kit for enhancing hair |
| CN104922655A (zh) | 2009-02-06 | 2015-09-23 | 加利福尼亚大学董事会 | 钙结合剂诱导毛发生长和/或甲生长 |
| JP5420946B2 (ja) | 2009-03-23 | 2014-02-19 | 富士フイルム株式会社 | 胆汁酸を含むミノキシジル水性組成物 |
| FR2949052B1 (fr) | 2009-08-13 | 2015-03-27 | Oreal | Procede de traitement cosmetique du cuir chevelu. |
| KR20180021919A (ko) | 2009-11-09 | 2018-03-05 | 알러간, 인코포레이티드 | 모발 성장을 촉진하기 위한 조성물 및 방법 |
| US9149484B2 (en) | 2009-11-09 | 2015-10-06 | Allergan, Inc. | Compositions and methods for stimulating hair growth |
| CA2807301C (en) | 2010-08-02 | 2018-11-27 | Athena Cosmetics, Inc. | Composition, method and kit for enhancing hair |
| US8859616B2 (en) | 2011-01-21 | 2014-10-14 | Allergan, Inc. | Compounds and methods for enhancing hair growth |
| EP2510930A1 (en) | 2011-04-15 | 2012-10-17 | Bionanoplus, S.L. | Nanoparticles comprising half esters of poly (methyl vinyl ether-co-maleic anhydride) and uses thereof |
| PL2838533T3 (pl) | 2012-04-16 | 2018-03-30 | Case Western Reserve University | Kompozycje i sposoby modulowania aktywności 15-PGDH |
| WO2014122436A1 (en) | 2013-02-07 | 2014-08-14 | Cipla House | Topical pharmaceutical compositions comprising minoxidil |
| JP6517197B2 (ja) | 2013-10-15 | 2019-05-22 | ケース ウエスタン リザーブ ユニバーシティ | 短鎖デヒドロゲナーゼ活性を調節する組成物および方法 |
| KR101696857B1 (ko) | 2014-11-28 | 2017-01-17 | (주)네오팜 | 두피개선용 조성물 |
| AU2015357489A1 (en) | 2014-12-05 | 2017-07-06 | Case Western Reserve University | Compositions and methods of modulating S-nitrosylation |
| EP3548035A4 (en) | 2016-11-30 | 2020-07-22 | Case Western Reserve University | COMBINATIONS OF 15-PGDH INHIBITORS WITH CORCOSTEROIDS AND / OR TNF INHIBITORS AND THEIR USES |
| KR101706515B1 (ko) | 2016-12-08 | 2017-02-13 | 경희대학교 산학협력단 | 탈모방지 또는 발모촉진용 주사용 조성물 |
| KR101859421B1 (ko) | 2017-01-31 | 2018-05-21 | 주식회사 케라메딕스 | 탈모방지 또는 발모촉진용 주사용 조성물 |
| CN118480009A (zh) | 2017-02-06 | 2024-08-13 | 卡斯西部储备大学 | 调节短链脱氢酶活性的组合物和方法 |
| EP3641747B1 (en) | 2017-06-22 | 2023-09-06 | Cipla Limited | Par-4 secretagogues for the treatment of cancer |
| US10428502B2 (en) | 2017-09-26 | 2019-10-01 | Peter M. Parker | Flush mechanism for toilets |
| KR102111321B1 (ko) | 2017-11-27 | 2020-05-18 | 주식회사 파이안바이오테크놀로지 | 분리된 미토콘드리아를 유효성분으로 포함하는 탈모 예방 및 발모 촉진용 약학 조성물 |
| KR102129409B1 (ko) | 2018-01-18 | 2020-07-02 | 경희대학교 산학협력단 | 탈모 치료 및 발모 촉진용 조성물 |
| JP2021521264A (ja) | 2018-02-28 | 2021-08-26 | マザーズ ファーマシューティカル カンパニー リミテッド | 脱毛治療及び発毛促進用組成物 |
| SG11202105345TA (en) | 2018-11-21 | 2021-06-29 | Univ Case Western Reserve | Compositions and methods of modulating short-chain dehydrogenase activity |
| KR102265433B1 (ko) | 2019-08-20 | 2021-06-15 | 주식회사 케어젠 | 발모 촉진 활성을 갖는 펩타이드 및 이의 용도 |
| KR102265431B1 (ko) | 2019-08-20 | 2021-06-15 | 주식회사 케어젠 | 발모 촉진 활성을 갖는 펩타이드 및 이의 용도 |
| KR20200056363A (ko) | 2020-05-08 | 2020-05-22 | 주식회사 파이안바이오테크놀로지 | 분리된 미토콘드리아를 유효성분으로 포함하는 탈모 예방 및 발모 촉진용 약학 조성물 |
| KR20230053551A (ko) | 2020-05-20 | 2023-04-21 | 로데오 테라퓨틱스 코포레이션 | 단쇄 데히드로게나아제 활성을 조절하는 조성물 및 방법 |
| CN114213340B (zh) | 2022-02-22 | 2022-06-07 | 北京蓝晶微生物科技有限公司 | 2,4-二氨基嘧啶氧化物的制备方法 |
| WO2024106586A1 (ko) | 2022-11-18 | 2024-05-23 | (주)케어젠 | 발모 촉진 및 탈모 억제 활성을 갖는 펩타이드 및 이의 용도 |
| KR20240149488A (ko) | 2023-04-05 | 2024-10-15 | (주)케어젠 | 발모 촉진 또는 탈모 억제능을 갖는 펩타이드 및 이의 용도 |
| KR20240149489A (ko) | 2023-04-05 | 2024-10-15 | (주)케어젠 | 발모 촉진 또는 탈모 억제능을 갖는 펩타이드 및 이의 용도 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3202650A (en) * | 1962-05-03 | 1965-08-24 | Sandoz Ltd | Metal-containing reactive azo dyes |
| US1915334A (en) * | 1930-10-16 | 1933-06-27 | Du Pont | Fluosilicate of organic heterocyclic bases and process of making it |
| US2075359A (en) * | 1930-10-16 | 1937-03-30 | Du Pont | Insecticide |
| US2425320A (en) * | 1942-10-23 | 1947-08-12 | Koppers Co Inc | Cleaning and pickling of metals |
| US2606155A (en) * | 1946-11-26 | 1952-08-05 | Koppers Co Inc | Cleaning and pickling composition for metals |
| BE490235A (index.php) * | 1948-07-21 | |||
| US2577039A (en) * | 1949-06-11 | 1951-12-04 | American Cyanamid Co | Substituted pteridines and method of preparing the same |
| DE1079833B (de) * | 1956-03-12 | 1960-04-14 | Minnesota Mining & Mfg | Verwendung von latenten Haertungsmitteln fuer Epoxyharze |
| US3192216A (en) * | 1961-10-30 | 1965-06-29 | Neisler Lab Inc | Phenylhydroxyalkylpyrimidine compounds |
| GB1053113A (index.php) * | 1963-04-19 | |||
| US3270014A (en) * | 1965-07-01 | 1966-08-30 | Upjohn Co | 1, 2-dihydro-1-hydroxy-1, 3, 5-triazines |
-
1965
- 1965-11-01 US US505992A patent/US3382248A/en not_active Expired - Lifetime
- 1965-11-01 US US505993A patent/US3461461A/en not_active Expired - Lifetime
- 1965-11-01 US US505989A patent/US3382247A/en not_active Expired - Lifetime
-
1966
- 1966-10-13 IL IL26686A patent/IL26686A/en unknown
- 1966-10-19 CH CH1515366A patent/CH495361A/de not_active IP Right Cessation
- 1966-10-28 DE DE19661695939 patent/DE1695939A1/de active Pending
- 1966-10-28 DE DE19661695958 patent/DE1695958A1/de active Pending
- 1966-10-28 GB GB48520/66A patent/GB1167735A/en not_active Expired
- 1966-10-28 GB GB4942/69A patent/GB1167736A/en not_active Expired
- 1966-10-28 DE DE1620649A patent/DE1620649C3/de not_active Expired
- 1966-10-28 DE DE1695959A patent/DE1695959C3/de not_active Expired
- 1966-10-28 DE DE19661795837 patent/DE1795837A1/de active Pending
- 1966-10-28 FR FR82083A patent/FR1510017A/fr not_active Expired
- 1966-10-28 DE DE19661695940 patent/DE1695940A1/de active Pending
- 1966-11-01 NL NL666615385A patent/NL154508B/xx not_active IP Right Cessation
-
1967
- 1967-01-27 FR FR92870A patent/FR6032M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1167736A (en) | 1969-10-22 |
| US3382248A (en) | 1968-05-07 |
| DE1620649C3 (de) | 1979-07-19 |
| IL26686A (en) | 1971-01-28 |
| FR6032M (index.php) | 1968-05-13 |
| DE1695958A1 (de) | 1971-05-19 |
| DE1695959B2 (de) | 1977-07-14 |
| NL6615385A (index.php) | 1967-05-02 |
| DE1695940A1 (de) | 1971-05-06 |
| DE1795837A1 (de) | 1976-05-13 |
| US3382247A (en) | 1968-05-07 |
| GB1167735A (en) | 1969-10-22 |
| DE1620649B2 (de) | 1978-11-09 |
| DE1695959A1 (de) | 1971-05-19 |
| FR1510017A (fr) | 1968-01-19 |
| DE1620649A1 (de) | 1970-05-14 |
| DE1695939A1 (de) | 1971-05-13 |
| DE1695959C3 (de) | 1978-03-09 |
| US3461461A (en) | 1969-08-12 |
| NL154508B (nl) | 1977-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH495361A (de) | Verfahren zur Herstellung neuer 1,2-Dihydro-1-hydroxypyrimidine | |
| DE69015842T2 (de) | Nicotinsäurederivate und diese enthaltende pharmazeutische Zusammensetzungen. | |
| DE2915318A1 (de) | Cycloalkyltriazole, verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
| DE3321969A1 (de) | 2-pyrimidinyl-1-piperazin-derivate, verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
| DE3336024A1 (de) | 4-amino-l-benzyl-pyrrolidinone und ihre saeureadditionssalze, verfahren zu ihrer herstellung und arzneimittel | |
| EP0063381A1 (de) | Neue Pyrazolo(3,4-d)pyrimidine, Verfahren zu deren Herstellung und sie enthaltende Arzneimittel | |
| DE2811780A1 (de) | Neue triazinverbindungen, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3125471C2 (de) | Piperazinderivate, Verfahren zu ihrer Herstellung und Arzneimittel, die diese Verbindungen enthalten | |
| DE1946315C2 (de) | 4,5-Dihydro-5-oxo-s-triazolo-[1,5-a]-pyrimidin-Derivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zusammensetzungen | |
| DE2164058B2 (de) | Basisch substituierte Benzylphthalazinon-Derivate, ihre Salze, Verfahren zu ihrer Herstellung und diese Produkte enthaltende pharmazeutische Präparate | |
| DE2141818A1 (de) | 2-phenylimino-imidazolidine, deren saeureadditionssalze und verfahren zu deren herstellung | |
| DE1695929A1 (de) | Verfahren zur Herstellung neuer 1,2-Dihydro-hydroxy-2-imino-6-alkylpyrimidinen | |
| DE3439450A1 (de) | 1,2,4-triazolo-carbamate und ihre saeureadditionssalze, verfahren zu ihrer herstellung und arzneimittel | |
| DE2733291A1 (de) | (3-amino-5-substituiert-6-fluorpyrazinoyl- oder -pyrazinamido)-guanidine und ihre an den guanidino-stickstoffatomen substituierten derivate | |
| EP0132811A1 (de) | In 1-Stellung substituierte 4-Hydroxymethyl-pyrrolidinone, Verfahren zu ihrer Herstellung, pharmazeutische Zusammensetzungen und Zwischenprodukte | |
| DD150602A5 (de) | Verfahren zur herstellung 6-substituierter 11-alkylen-morphantridine | |
| DE1470089A1 (de) | Verfahren zur Herstellung von 3-Amino-5-subst.-Pyrazinoylguanidinen | |
| CH637391A5 (de) | Therapeutisch wirksame 3-(1-piperazinyl)-1,2,4-benzotriazine und ihre n-oxide. | |
| CH639661A5 (de) | 3-(1-piperazinyl)-pyrido(2.3-b)pyrazine. | |
| DE2831671A1 (de) | Neue substituierte 2-phenylamino-imidazoline-(2), deren saeureadditionssalze, diese enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE2216290A1 (de) | 1,2-Dihydro-l-hydroxypyrimidine und Verfahren zu ihrer Herstellung | |
| DE69303798T2 (de) | Benz[e]inden Derivate, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel und ihre Verwendung | |
| DE1620654A1 (de) | Verfahren zur Herstellung von 1,2-Dihydro-1-hydroxypyrimidinen | |
| US3637697A (en) | 6-amino-1 2-dihydro-1-hydroxy-2-iminopyrimidines | |
| DE2521519A1 (de) | Substituierte 9,10-dihydroanthracen- 9,10-imine und heterocyclische (aza) analoge davon und verfahren zur herstellung dieser verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |