CH489497A - Verfahren zur Herstellung von neuen Indolderivaten - Google Patents
Verfahren zur Herstellung von neuen IndolderivatenInfo
- Publication number
- CH489497A CH489497A CH1471769A CH1471769A CH489497A CH 489497 A CH489497 A CH 489497A CH 1471769 A CH1471769 A CH 1471769A CH 1471769 A CH1471769 A CH 1471769A CH 489497 A CH489497 A CH 489497A
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- acid
- formula
- lower alkyl
- indole derivatives
- Prior art date
Links
- 150000002475 indoles Chemical class 0.000 title claims description 8
- 229940054051 antipsychotic indole derivative Drugs 0.000 title claims description 6
- 238000000034 method Methods 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 pyrrolidino, piperidino, hexamethyleneimino, morpholino Chemical group 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- WWKSECNRFOBTBJ-UHFFFAOYSA-N Cl.C(C1=CC=CC=C1)(=O)C=1NC2=CC=C(C=C2C1OCCN1CCCC1)O Chemical compound Cl.C(C1=CC=CC=C1)(=O)C=1NC2=CC=C(C=C2C1OCCN1CCCC1)O WWKSECNRFOBTBJ-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 230000002936 tranquilizing effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000002908 adrenolytic effect Effects 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000000954 anitussive effect Effects 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000003501 anti-edematous effect Effects 0.000 description 1
- 229940124584 antitussives Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000036407 pain Effects 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000003836 peripheral circulation Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/32—Oxygen atoms
- C07D209/36—Oxygen atoms in position 3, e.g. adrenochrome
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1471769A CH489497A (de) | 1967-01-25 | 1967-01-25 | Verfahren zur Herstellung von neuen Indolderivaten |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH113167A CH481104A (de) | 1967-01-25 | 1967-01-25 | Verfahren zur Herstellung von neuen Indolderivaten |
| CH1471769A CH489497A (de) | 1967-01-25 | 1967-01-25 | Verfahren zur Herstellung von neuen Indolderivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH489497A true CH489497A (de) | 1970-04-30 |
Family
ID=4203212
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1471769A CH489497A (de) | 1967-01-25 | 1967-01-25 | Verfahren zur Herstellung von neuen Indolderivaten |
| CH113167A CH481104A (de) | 1967-01-25 | 1967-01-25 | Verfahren zur Herstellung von neuen Indolderivaten |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH113167A CH481104A (de) | 1967-01-25 | 1967-01-25 | Verfahren zur Herstellung von neuen Indolderivaten |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US3509163A (en0) |
| JP (1) | JPS4931987B1 (en0) |
| AT (1) | AT273096B (en0) |
| BE (1) | BE709834A (en0) |
| CH (2) | CH489497A (en0) |
| DE (1) | DE1695111B1 (en0) |
| DK (1) | DK118187B (en0) |
| ES (1) | ES349721A1 (en0) |
| FR (5) | FR1568067A (en0) |
| GB (1) | GB1202781A (en0) |
| IE (1) | IE31930B1 (en0) |
| IL (1) | IL29367A (en0) |
| NL (1) | NL6801068A (en0) |
| NO (1) | NO124724B (en0) |
| SE (1) | SE328579B (en0) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH498832A (de) * | 1968-07-23 | 1970-11-15 | Geigy Ag J R | Verfahren zur Herstellung von neuen Indolderivaten |
| US3860608A (en) * | 1969-05-27 | 1975-01-14 | Novo Terapeutisk Labor As | 3-aminoalkyloxyindoles |
| US3860609A (en) * | 1969-05-27 | 1975-01-14 | Novo Terapeutisk Labor As | 3-aminoalkyloxyindoles |
| US3991194A (en) * | 1971-12-27 | 1976-11-09 | Sharps Associates | Heterocyclic esters of benzopyranopyridines |
| US4042694A (en) * | 1972-12-04 | 1977-08-16 | Sharps Associates | Novel heterocyclic esters of benzopyranopyridines |
| DE2337461A1 (de) * | 1973-07-24 | 1975-02-06 | Boehringer Mannheim Gmbh | Neue indolderivate und verfahren zu deren herstellung |
| US4070470A (en) * | 1974-06-24 | 1978-01-24 | Otsuka Pharmaceutical Co., Ltd. | Platelet aggregation inhibiting carbostyrils, their compositions and method of use |
| JPS5314977U (en0) * | 1976-07-17 | 1978-02-07 | ||
| DE2941597A1 (de) * | 1979-10-13 | 1981-04-23 | Basf Ag, 6700 Ludwigshafen | Piperidinderivate von 4,5-dialkyl-3-hydroxy-pyrrol-2-carbonsaeureestern, ihre herstellung und diese enthaltende pharmazeutische zubereitungen |
| NZ540842A (en) * | 2002-11-28 | 2008-05-30 | Suven Life Sciences Ltd | N-arylsulfonyl-3-aminoalkoxyindoles |
| CN103145605A (zh) * | 2013-02-27 | 2013-06-12 | 广东省微生物研究所 | 一种1-乙酰基-卤代吲哚基-3-乙酸酯的合成方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3410857A (en) * | 1964-10-12 | 1968-11-12 | Endo Lab | 2-amino ethyl pyrrol-3-yl ketones |
-
1967
- 1967-01-25 CH CH1471769A patent/CH489497A/de not_active IP Right Cessation
- 1967-01-25 CH CH113167A patent/CH481104A/de not_active IP Right Cessation
-
1968
- 1968-01-22 US US699289A patent/US3509163A/en not_active Expired - Lifetime
- 1968-01-24 DK DK27168AA patent/DK118187B/da unknown
- 1968-01-24 IL IL29367A patent/IL29367A/xx unknown
- 1968-01-24 NO NO0309/68A patent/NO124724B/no unknown
- 1968-01-24 BE BE709834D patent/BE709834A/xx unknown
- 1968-01-24 SE SE00947/68A patent/SE328579B/xx unknown
- 1968-01-24 AT AT72668A patent/AT273096B/de active
- 1968-01-24 ES ES349721A patent/ES349721A1/es not_active Expired
- 1968-01-24 NL NL6801068A patent/NL6801068A/xx unknown
- 1968-01-24 IE IE102/68A patent/IE31930B1/xx unknown
- 1968-01-24 DE DE19681695111 patent/DE1695111B1/de active Pending
- 1968-01-24 FR FR1568067D patent/FR1568067A/fr not_active Expired
- 1968-01-24 GB GB3726/68A patent/GB1202781A/en not_active Expired
- 1968-04-23 FR FR149049A patent/FR7661M/fr not_active Expired
- 1968-04-23 FR FR149047A patent/FR7658M/fr not_active Expired
- 1968-04-23 FR FR149046A patent/FR7657M/fr not_active Expired
- 1968-04-23 FR FR149048A patent/FR7659M/fr not_active Expired
-
1970
- 1970-01-09 JP JP45002663A patent/JPS4931987B1/ja active Pending
- 1970-03-26 US US23047A patent/US3703524A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB1202781A (en) | 1970-08-19 |
| FR7661M (en0) | 1970-02-09 |
| JPS4931987B1 (en0) | 1974-08-27 |
| DE1695111B1 (de) | 1972-05-31 |
| FR7658M (en0) | 1970-02-09 |
| IL29367A (en) | 1971-10-20 |
| FR7657M (en0) | 1970-02-09 |
| FR1568067A (en0) | 1969-05-23 |
| SE328579B (en0) | 1970-09-21 |
| DK118187B (da) | 1970-07-20 |
| US3509163A (en) | 1970-04-28 |
| AT273096B (de) | 1969-07-25 |
| FR7659M (en0) | 1970-02-09 |
| CH481104A (de) | 1969-11-15 |
| US3703524A (en) | 1972-11-21 |
| NL6801068A (en0) | 1968-07-26 |
| ES349721A1 (es) | 1969-05-01 |
| IE31930L (en) | 1968-07-25 |
| BE709834A (en0) | 1968-07-24 |
| NO124724B (en0) | 1972-05-29 |
| IE31930B1 (en) | 1973-02-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2120495A1 (de) | Neue Trialkoxychinazolin-Verbindungen und Verfahren zu ihrer Herstellung | |
| CH489497A (de) | Verfahren zur Herstellung von neuen Indolderivaten | |
| DE1645913A1 (de) | Benzothiophenerivate und Verfahren zu deren Herstellung | |
| DE1770571A1 (de) | Aminocarbonylalkyl-Verbindungen,Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneipraeparate | |
| DE2713441A1 (de) | Amidinoharnstoffe | |
| CH501633A (de) | Verfahren zur Herstellung von 10,5-(Iminomethanol)-10,11-dihydro-5H-dibenzo(a,d)cyclohepten-Derivaten | |
| DE2261506A1 (de) | Basische derivate von phenyl-1 alkanolen, ihre herstellung und diese enthaltende medikamente | |
| DE2512109A1 (de) | Hexahydro-gamma-carbolinderivate, deren salze, verfahren zu ihrer herstellung und arzneipraeparate | |
| DE2006895A1 (de) | Neue Phenacetylguanidine und Verfahren zu ihrer Herstellung | |
| US3024248A (en) | Organic sulfur compounds and method for producing same | |
| DE2438413A1 (de) | Heterocyclische verbindungen und verfahren zur herstellung derselben | |
| DE2522218C3 (de) | Zusammensetzung für die Human- oder Veterinärmedizin, Methylaminderivate und Verfahren zu deren Herstellung | |
| DE2456098C3 (de) | Xanthen- und Thioxanthen-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2359359A1 (de) | Fluor-substituierte thioxanthene und verfahren zu deren herstellung sowie diese enthaltende pharmazeutische mittel | |
| DE2318575A1 (de) | Neue oxazolidinone | |
| DE1445415C3 (de) | Substituierte Imidazolidinone, ihre therapeutisch verträglichen Salze und Verfahren zu ihrer Herstellung | |
| DE1620368A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| DE2423725A1 (de) | 5-phenyl-4-oxo-delta hoch 2,alphathiazolidinessigsaeureester | |
| DE1695111C (de) | Indoldenvate | |
| AT362351B (de) | Verfahren zur herstellung von neuen, hetero- cyclisch substituierten 5-sulfamoylbenzoe- saeurederivaten und ihren salzen | |
| DE1545672B2 (de) | Dikarbonsäureimidderivate und Verfahren zu ihrer Herstellung | |
| DE938017C (de) | Verfahren zur Herstellung von quaternaeren Ammoniumsalzen von 4-Amino-2-(tert.-amino-alkoxy)-benzoesaeurealkylestern | |
| DE2202788A1 (de) | Neue Dibenzocyclohepta-dioxolanderivate und Verfahren zu ihrer Herstellung | |
| DE1168434B (de) | Verfahren zur Herstellung von 10-(3'-Piperazinopropyl)-phenthiazinverbindungen | |
| AT331218B (de) | Verfahren zur herstellung von neuen aminobenzylaminen sowie deren saureadditionssalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |