CH447147A - Verfahren zur Herstellung von 5-(3-Hydroxypropyl)-5H-dibenzo(a,d)cycloheptenen - Google Patents
Verfahren zur Herstellung von 5-(3-Hydroxypropyl)-5H-dibenzo(a,d)cycloheptenenInfo
- Publication number
- CH447147A CH447147A CH858363A CH858363A CH447147A CH 447147 A CH447147 A CH 447147A CH 858363 A CH858363 A CH 858363A CH 858363 A CH858363 A CH 858363A CH 447147 A CH447147 A CH 447147A
- Authority
- CH
- Switzerland
- Prior art keywords
- dibenzo
- sep
- preparation
- propionic acid
- hydroxypropyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 title claims description 9
- OLKUTMBZOHLAFL-UHFFFAOYSA-N 3-(11h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)propan-1-ol Chemical class C1=CC2=CC=CC=C2C(CCCO)C2=CC=CC=C21 OLKUTMBZOHLAFL-UHFFFAOYSA-N 0.000 title claims description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 235000019260 propionic acid Nutrition 0.000 claims description 7
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 6
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 4
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 claims description 3
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- ZXIJMRYMVAMXQP-UHFFFAOYSA-N cycloheptene Chemical compound C1CCC=CCC1 ZXIJMRYMVAMXQP-UHFFFAOYSA-N 0.000 claims description 2
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- -1 3-methylaminopropyl Chemical group 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- OFAYTPAKMNCPFP-UHFFFAOYSA-N 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propanoic acid Chemical compound C1=CC=CC=2C(C3=C(C=CC21)C=CC=C3)CCC(=O)O OFAYTPAKMNCPFP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 2
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 2
- FSERQGKGFHNRTM-UHFFFAOYSA-N 3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)propanenitrile Chemical compound C1=CC=CC=2C(C3=C(C=CC21)C=CC=C3)CCC#N FSERQGKGFHNRTM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001933 cycloheptenes Chemical class 0.000 description 1
- QPJORFLSOJAUNL-UHFFFAOYSA-N dibenzo[a,d][7]annulene Chemical compound C1=CC2=CC=CC=C2CC2=CC=CC=C21 QPJORFLSOJAUNL-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/46—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings and other rings, e.g. cyclohexylphenylacetic acid
- C07C57/50—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings and other rings, e.g. cyclohexylphenylacetic acid containing condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/45—Carboxylic acid nitriles having cyano groups bound to carbon atoms of rings other than six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US210832A US3317582A (en) | 1962-07-18 | 1962-07-18 | Dibenzocycloheptene compounds and processes for preparing the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH447147A true CH447147A (de) | 1967-11-30 |
Family
ID=22784433
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH858363A CH447147A (de) | 1962-07-18 | 1963-07-10 | Verfahren zur Herstellung von 5-(3-Hydroxypropyl)-5H-dibenzo(a,d)cycloheptenen |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3317582A (member.php) |
| AT (1) | AT258265B (member.php) |
| BE (1) | BE635014A (member.php) |
| CH (1) | CH447147A (member.php) |
| DE (1) | DE1232956B (member.php) |
| DK (1) | DK122655B (member.php) |
| ES (1) | ES290184A1 (member.php) |
| FR (1) | FR1531324A (member.php) |
| GB (2) | GB1044421A (member.php) |
| NL (1) | NL295433A (member.php) |
| SE (4) | SE303285B (member.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3366660A (en) * | 1966-05-23 | 1968-01-30 | American Home Prod | Dibenzo cycloheptene thioiminoesters |
| US3742000A (en) * | 1969-06-03 | 1973-06-26 | Grace W R & Co | Imidoether and amidine derivatives of substituted fatty amides |
| JPS5541227B2 (member.php) * | 1972-10-24 | 1980-10-22 | ||
| US3979430A (en) * | 1975-09-08 | 1976-09-07 | Syntex (U.S.A.) Inc. | Solvolytic process for the preparation of 2-(5H-dibenzo[a,d]cyclohepten-5-on-2-yl)acetic, propionic and butyric acids |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2185141A (en) * | 1937-12-06 | 1939-12-26 | Dow Chemical Co | Preparation of beta-phenylethyl alcohol |
| US2151517A (en) * | 1938-07-21 | 1939-03-21 | Kamlet Jonas | Preparation of arylnitroalkanols |
| US2607794A (en) * | 1949-04-09 | 1952-08-19 | Merck & Co Inc | Process of preparing 2, 2-diphenyl-3-methyl-4-dimethylamino-butyronitrile |
| US2642455A (en) * | 1949-07-08 | 1953-06-16 | Socony Vacuum Oil Co Inc | 2-ethyl-hexanol-1 esters of the friedel-crafts maleic anhydride-aromatic hydrocarbon adducts and process |
| US2610979A (en) * | 1949-10-29 | 1952-09-16 | Gen Aniline & Film Corp | Process for preparing amino aroyl acetonitriles |
| US2726262A (en) * | 1950-08-24 | 1955-12-06 | Bergwerksverband Gmbh | Process for the preparation and purification of monocyclic aromatic polycarboxylic acids or mixtures thereof |
| US2748162A (en) * | 1952-03-31 | 1956-05-29 | Dow Chemical Co | Preparation of phthalaldehydic acid from pentachloroxylene |
| US2788365A (en) * | 1953-01-15 | 1957-04-09 | Searle & Co | Quaternary ammonium salts of dialkylaminoalkyl esters of 9, 10-dihydroanthracene-9-carboxylic acid and the preparation thereof |
-
1962
- 1962-07-18 US US210832A patent/US3317582A/en not_active Expired - Lifetime
-
1963
- 1963-07-04 GB GB26548/63A patent/GB1044421A/en not_active Expired
- 1963-07-04 GB GB35024/65A patent/GB1044422A/en not_active Expired
- 1963-07-08 SE SE7579/63A patent/SE303285B/xx unknown
- 1963-07-08 SE SE7381/65A patent/SE303288B/xx unknown
- 1963-07-08 SE SE7380/65A patent/SE302962B/xx unknown
- 1963-07-08 SE SE7379/65A patent/SE303287B/xx unknown
- 1963-07-10 CH CH858363A patent/CH447147A/de unknown
- 1963-07-13 ES ES290184A patent/ES290184A1/es not_active Expired
- 1963-07-16 AT AT569963A patent/AT258265B/de active
- 1963-07-16 BE BE635014D patent/BE635014A/xx unknown
- 1963-07-16 DE DEM57517A patent/DE1232956B/de active Pending
- 1963-07-17 NL NL295433D patent/NL295433A/xx unknown
- 1963-07-17 DK DK342163AA patent/DK122655B/da unknown
- 1963-07-17 FR FR941795A patent/FR1531324A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE303285B (member.php) | 1968-08-26 |
| ES290184A1 (es) | 1963-08-16 |
| GB1044421A (en) | 1966-09-28 |
| AT258265B (de) | 1967-11-10 |
| NL295433A (member.php) | 1965-04-26 |
| SE303287B (member.php) | 1968-08-26 |
| DE1232956B (de) | 1967-01-26 |
| SE303288B (member.php) | 1968-08-26 |
| US3317582A (en) | 1967-05-02 |
| DK122655B (da) | 1972-03-27 |
| FR1531324A (fr) | 1968-07-05 |
| GB1044422A (en) | 1966-09-28 |
| BE635014A (member.php) | 1964-01-16 |
| SE302962B (member.php) | 1968-08-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1543427C3 (member.php) | ||
| DE2404160C3 (de) | Verfahren zur Herstellung von 2-(4-Alkylphenyl)-propionsäuren | |
| DE1793679B2 (de) | S-d'-R-r-X-S'-Oxo-cyclopentyl)propionsSuren und deren Allylester | |
| CH447147A (de) | Verfahren zur Herstellung von 5-(3-Hydroxypropyl)-5H-dibenzo(a,d)cycloheptenen | |
| DE1301313B (de) | Verfahren zur Herstellung von Pyrryl-(2)-essigsaeureestern | |
| DE855992C (de) | Verfahren zur Herstellung von Vitamin-A-wirksamen Polyencarbon-saeuren, ihren Estern, Vitamin-A-Alkoholen bzw. ihren Estern | |
| DE3401913A1 (de) | Verfahren zur herstellung von 8-hydroxyoctansaeure und deren salze sowie deren verwendung | |
| DE1290937B (de) | Verfahren zur Herstellung von 3, 5-Dioxo-17ª‰-hydroxy-4, 5-seco-delta 9-oestren bzw. -17ª‰-acylaten | |
| DE1793175C3 (de) | Verfahren zur Herstellung von 5-Benzyl-3-furancarbonsäure | |
| AT203474B (de) | Verfahren zur Herstellung von α,β-ungesättigten Aldehyden | |
| DE2260447C3 (de) | Verfahren zur Herstellung von Methyljasmonat | |
| DE934103C (de) | Verfahren zur Herstellung von cyclooctylierten Alkylessigsaeuren mit stark gallentreibender Wirkung | |
| DE2621832A1 (de) | Verfahren zur herstellung organischer saeuren | |
| AT214437B (de) | Verfahren zur Herstellung von teilhydrierten Anthrazenderivaten | |
| DE956508C (de) | Verfahren zur Herstellung von Dihydrosantoninabkoemmlingen | |
| DE705434C (de) | Verfahren zur Herstellung von halogenierten Tetrahydrofuranabkoemmlingen | |
| CH227069A (de) | Verfahren zur Herstellung einer Cyclopentano-dimethyl-polyhydrophenanthren-carbonsäure. | |
| DE1793032A1 (de) | Verfahren zur Herstellung von Homophthalsaeure | |
| DE946442C (de) | Verfahren zur Herstellung von Kondensationsprodukten aus Phthalsaeureanhydriden und hydroaromatischen Kohlenwasserstoffen | |
| DE2440745C3 (de) | Verfahren zur Abtrennung von cis-Chrysanthemummonocarbonsäure | |
| AT210419B (de) | Verfahren zur Herstellung von Pyridincarbonsäurealkylestern | |
| AT226692B (de) | Verfahren zur Herstellung von neuen α-Pyrrolidino-valerophenonen | |
| DE2912052A1 (de) | Verfahren zur herstellung von 2eckige klammer auf 4-(thienylcarbonyl)phenyl eckige klammer zu -propionsaeure | |
| CH362404A (de) | Verfahren zur Herstellung von a,B-ungesättigten Aldehyden | |
| DE2260447A1 (de) | Verfahren zur herstellung eines ketons |