CA1307296C - Hydroformylation using low volatile phosphine ligands - Google Patents
Hydroformylation using low volatile phosphine ligandsInfo
- Publication number
- CA1307296C CA1307296C CA000552143A CA552143A CA1307296C CA 1307296 C CA1307296 C CA 1307296C CA 000552143 A CA000552143 A CA 000552143A CA 552143 A CA552143 A CA 552143A CA 1307296 C CA1307296 C CA 1307296C
- Authority
- CA
- Canada
- Prior art keywords
- group
- ligand
- organic
- hydroformylation
- solubilizing agent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000003446 ligand Substances 0.000 title claims abstract description 245
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 title claims abstract description 196
- 238000007037 hydroformylation reaction Methods 0.000 title claims abstract description 169
- 229910000073 phosphorus hydride Inorganic materials 0.000 title claims abstract description 97
- 238000000034 method Methods 0.000 claims abstract description 157
- 229910052751 metal Inorganic materials 0.000 claims abstract description 137
- 239000002184 metal Substances 0.000 claims abstract description 137
- 230000008569 process Effects 0.000 claims abstract description 135
- 239000003054 catalyst Substances 0.000 claims abstract description 118
- 150000003839 salts Chemical class 0.000 claims abstract description 108
- 239000002904 solvent Substances 0.000 claims abstract description 98
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 59
- 239000011574 phosphorus Substances 0.000 claims abstract description 59
- 239000012429 reaction media Substances 0.000 claims abstract description 56
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 48
- 150000002894 organic compounds Chemical class 0.000 claims abstract description 43
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 39
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 38
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 36
- 239000001257 hydrogen Substances 0.000 claims abstract description 36
- 230000007704 transition Effects 0.000 claims abstract description 29
- 230000006872 improvement Effects 0.000 claims abstract description 7
- 238000009877 rendering Methods 0.000 claims abstract description 5
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims abstract 13
- 239000010948 rhodium Substances 0.000 claims description 105
- 229910052703 rhodium Inorganic materials 0.000 claims description 99
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 93
- -1 cycloalkyl radicals Chemical class 0.000 claims description 91
- 239000000203 mixture Substances 0.000 claims description 81
- 239000000047 product Substances 0.000 claims description 81
- 238000006243 chemical reaction Methods 0.000 claims description 73
- 239000007788 liquid Substances 0.000 claims description 53
- 125000002947 alkylene group Chemical group 0.000 claims description 41
- 239000011734 sodium Substances 0.000 claims description 41
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 39
- 150000001875 compounds Chemical class 0.000 claims description 39
- 239000002736 nonionic surfactant Substances 0.000 claims description 30
- 239000007789 gas Substances 0.000 claims description 28
- 239000006227 byproduct Substances 0.000 claims description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 22
- 238000009833 condensation Methods 0.000 claims description 22
- 230000005494 condensation Effects 0.000 claims description 22
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 238000009835 boiling Methods 0.000 claims description 17
- 229910052723 transition metal Inorganic materials 0.000 claims description 17
- 150000003624 transition metals Chemical class 0.000 claims description 17
- 239000004711 α-olefin Substances 0.000 claims description 16
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical class OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 14
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 14
- 150000001768 cations Chemical class 0.000 claims description 14
- 150000002431 hydrogen Chemical class 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 229910052708 sodium Inorganic materials 0.000 claims description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 12
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 12
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 12
- 150000003254 radicals Chemical class 0.000 claims description 12
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 claims description 11
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 8
- 239000011575 calcium Substances 0.000 claims description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 7
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 6
- 229910052744 lithium Inorganic materials 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- 229910052701 rubidium Inorganic materials 0.000 claims description 6
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 claims description 6
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 4
- 239000011777 magnesium Substances 0.000 claims description 4
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229910052788 barium Inorganic materials 0.000 claims description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052792 caesium Inorganic materials 0.000 claims description 3
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 229910052712 strontium Inorganic materials 0.000 claims description 3
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 claims 6
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 4
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract 1
- 150000001299 aldehydes Chemical class 0.000 description 141
- 239000000243 solution Substances 0.000 description 50
- 150000001336 alkenes Chemical class 0.000 description 38
- FVEFRICMTUKAML-UHFFFAOYSA-M sodium tetradecyl sulfate Chemical compound [Na+].CCCCC(CC)CCC(CC(C)C)OS([O-])(=O)=O FVEFRICMTUKAML-UHFFFAOYSA-M 0.000 description 30
- GYHFUZHODSMOHU-UHFFFAOYSA-N nonanal Chemical compound CCCCCCCCC=O GYHFUZHODSMOHU-UHFFFAOYSA-N 0.000 description 26
- 229920001223 polyethylene glycol Polymers 0.000 description 25
- DAFHKNAQFPVRKR-UHFFFAOYSA-N (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate Chemical compound CC(C)C(O)C(C)(C)COC(=O)C(C)C DAFHKNAQFPVRKR-UHFFFAOYSA-N 0.000 description 20
- 239000002243 precursor Substances 0.000 description 17
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 16
- 230000003197 catalytic effect Effects 0.000 description 16
- 239000007858 starting material Substances 0.000 description 16
- GGRQQHADVSXBQN-FGSKAQBVSA-N carbon monoxide;(z)-4-hydroxypent-3-en-2-one;rhodium Chemical compound [Rh].[O+]#[C-].[O+]#[C-].C\C(O)=C\C(C)=O GGRQQHADVSXBQN-FGSKAQBVSA-N 0.000 description 15
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 15
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 15
- 229920002582 Polyethylene Glycol 600 Polymers 0.000 description 14
- 239000012018 catalyst precursor Substances 0.000 description 14
- 150000002500 ions Chemical class 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 12
- VYFPSYVVFFFYBF-UHFFFAOYSA-N sodium;triphenylphosphane Chemical class [Na].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 VYFPSYVVFFFYBF-UHFFFAOYSA-N 0.000 description 11
- 239000010410 layer Substances 0.000 description 10
- 238000000926 separation method Methods 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- BYGQBDHUGHBGMD-UHFFFAOYSA-N 2-methylbutanal Chemical compound CCC(C)C=O BYGQBDHUGHBGMD-UHFFFAOYSA-N 0.000 description 8
- 230000008859 change Effects 0.000 description 8
- 150000003983 crown ethers Chemical class 0.000 description 8
- 239000003085 diluting agent Substances 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 230000002411 adverse Effects 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- 238000010924 continuous production Methods 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 7
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 7
- 238000012545 processing Methods 0.000 description 7
- 241000894007 species Species 0.000 description 7
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- 150000002334 glycols Chemical class 0.000 description 6
- FXHGMKSSBGDXIY-UHFFFAOYSA-N heptanal Chemical compound CCCCCCC=O FXHGMKSSBGDXIY-UHFFFAOYSA-N 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 150000003003 phosphines Chemical group 0.000 description 6
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 6
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- 101100412856 Mus musculus Rhod gene Proteins 0.000 description 5
- 101100242191 Tetraodon nigroviridis rho gene Proteins 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 229920005862 polyol Polymers 0.000 description 5
- 150000003077 polyols Chemical class 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 239000006200 vaporizer Substances 0.000 description 5
- 239000001893 (2R)-2-methylbutanal Substances 0.000 description 4
- ILPBINAXDRFYPL-UHFFFAOYSA-N 2-octene Chemical compound CCCCCC=CC ILPBINAXDRFYPL-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 235000011187 glycerol Nutrition 0.000 description 4
- 239000012456 homogeneous solution Substances 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 125000004430 oxygen atom Chemical group O* 0.000 description 4
- BGEHHAVMRVXCGR-UHFFFAOYSA-N tridecanal Chemical compound CCCCCCCCCCCCC=O BGEHHAVMRVXCGR-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 3
- 238000010952 in-situ formation Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- NBBJYMSMWIIQGU-UHFFFAOYSA-N propionic aldehyde Natural products CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 238000005063 solubilization Methods 0.000 description 3
- 230000003381 solubilizing effect Effects 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- 239000013638 trimer Substances 0.000 description 3
- GGQQNYXPYWCUHG-RMTFUQJTSA-N (3e,6e)-deca-3,6-diene Chemical compound CCC\C=C\C\C=C\CC GGQQNYXPYWCUHG-RMTFUQJTSA-N 0.000 description 2
- XWJBRBSPAODJER-UHFFFAOYSA-N 1,7-octadiene Chemical compound C=CCCCCC=C XWJBRBSPAODJER-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- SJNALLRHIVGIBI-UHFFFAOYSA-N allyl cyanide Chemical compound C=CCC#N SJNALLRHIVGIBI-UHFFFAOYSA-N 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- XDFCIPNJCBUZJN-UHFFFAOYSA-N barium(2+) Chemical compound [Ba+2] XDFCIPNJCBUZJN-UHFFFAOYSA-N 0.000 description 2
- MFKOEEYDBYQGCC-UHFFFAOYSA-N barium;triphenylphosphane Chemical class [Ba].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 MFKOEEYDBYQGCC-UHFFFAOYSA-N 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- 230000009849 deactivation Effects 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- YDAYYLHVAGHNGE-UHFFFAOYSA-N dicyclohexyl(phenyl)phosphane;sodium Chemical class [Na].C1CCCCC1P(C=1C=CC=CC=1)C1CCCCC1 YDAYYLHVAGHNGE-UHFFFAOYSA-N 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- UEMSXAXBVXSKSZ-UHFFFAOYSA-N lithium;triphenylphosphane Chemical class [Li].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 UEMSXAXBVXSKSZ-UHFFFAOYSA-N 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000013110 organic ligand Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 2
- 239000002574 poison Substances 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 206010063401 primary progressive multiple sclerosis Diseases 0.000 description 2
- 238000005086 pumping Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- CPRMKOQKXYSDML-UHFFFAOYSA-M rubidium hydroxide Chemical compound [OH-].[Rb+] CPRMKOQKXYSDML-UHFFFAOYSA-M 0.000 description 2
- ZQKDSMSPOMGWOF-UHFFFAOYSA-N rubidium;triphenylphosphane Chemical compound [Rb].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 ZQKDSMSPOMGWOF-UHFFFAOYSA-N 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 230000007928 solubilization Effects 0.000 description 2
- PWYYWQHXAPXYMF-UHFFFAOYSA-N strontium(2+) Chemical compound [Sr+2] PWYYWQHXAPXYMF-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 238000009834 vaporization Methods 0.000 description 2
- 230000008016 vaporization Effects 0.000 description 2
- PRBHEGAFLDMLAL-GQCTYLIASA-N (4e)-hexa-1,4-diene Chemical compound C\C=C\CC=C PRBHEGAFLDMLAL-GQCTYLIASA-N 0.000 description 1
- MAUMSNABMVEOGP-UHFFFAOYSA-N (methyl-$l^{2}-azanyl)methane Chemical compound C[N]C MAUMSNABMVEOGP-UHFFFAOYSA-N 0.000 description 1
- CRSBERNSMYQZNG-UHFFFAOYSA-N 1 -dodecene Natural products CCCCCCCCCCC=C CRSBERNSMYQZNG-UHFFFAOYSA-N 0.000 description 1
- WHBCCYZKPFWPLU-UHFFFAOYSA-N 1,1-diphenylpropylbenzene Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(CC)C1=CC=CC=C1 WHBCCYZKPFWPLU-UHFFFAOYSA-N 0.000 description 1
- VFTFKUDGYRBSAL-UHFFFAOYSA-N 15-crown-5 Chemical compound C1COCCOCCOCCOCCO1 VFTFKUDGYRBSAL-UHFFFAOYSA-N 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- ZKPFRIDJMMOODR-UHFFFAOYSA-N 2-Methyloctanal Chemical compound CCCCCCC(C)C=O ZKPFRIDJMMOODR-UHFFFAOYSA-N 0.000 description 1
- CYIFVRUOHKNECG-UHFFFAOYSA-N 2-Tridecanone Natural products CCCCCCCCCCCC(C)=O CYIFVRUOHKNECG-UHFFFAOYSA-N 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- PJISLFCKHOHLLP-UHFFFAOYSA-N 2-diethoxyphosphorylsulfanyl-n,n-diethylethanamine Chemical compound CCOP(=O)(OCC)SCCN(CC)CC PJISLFCKHOHLLP-UHFFFAOYSA-N 0.000 description 1
- ISZREKMLQKLUDD-UHFFFAOYSA-N 2-methyldodecanal Chemical compound CCCCCCCCCCC(C)C=O ISZREKMLQKLUDD-UHFFFAOYSA-N 0.000 description 1
- ITPOKAFWZBFZCV-UHFFFAOYSA-N 3-diphenylphosphanylbenzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 ITPOKAFWZBFZCV-UHFFFAOYSA-N 0.000 description 1
- JSDZSLGMRRSAHD-UHFFFAOYSA-N 3-methylbutan-2-ylcyclopropane Chemical compound CC(C)C(C)C1CC1 JSDZSLGMRRSAHD-UHFFFAOYSA-N 0.000 description 1
- BWRRWBIBNBVHQF-UHFFFAOYSA-N 4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butanoic acid Chemical compound O1C(CCCC(=O)O)=NC(C=2N=CC=CC=2)=N1 BWRRWBIBNBVHQF-UHFFFAOYSA-N 0.000 description 1
- RMZIOVJHUJAAEY-UHFFFAOYSA-N Allyl butyrate Chemical compound CCCC(=O)OCC=C RMZIOVJHUJAAEY-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- NUJGJRNETVAIRJ-UHFFFAOYSA-N Caprylic Aldehyde Natural products CCCCCCCC=O NUJGJRNETVAIRJ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 101100134929 Gallus gallus COR9 gene Proteins 0.000 description 1
- 235000010650 Hyssopus officinalis Nutrition 0.000 description 1
- 240000001812 Hyssopus officinalis Species 0.000 description 1
- HFJRKMMYBMWEAD-UHFFFAOYSA-N Lauraldehyde Natural products CCCCCCCCCCCC=O HFJRKMMYBMWEAD-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- QZUPHAGRBBOLTB-UHFFFAOYSA-N NSC 244302 Chemical compound C=1C=CC=CC=1P(C(C)(C)C)C1=CC=CC=C1 QZUPHAGRBBOLTB-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 229910006065 SO3 Li Inorganic materials 0.000 description 1
- 229910006145 SO3Li Inorganic materials 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- CBXOEWNRYOSZTE-UHFFFAOYSA-N [Na].P Chemical class [Na].P CBXOEWNRYOSZTE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005233 alkylalcohol group Chemical group 0.000 description 1
- HFDVRLIODXPAHB-UHFFFAOYSA-N alpha-tetradecene Natural products CCCCCCCCCCCCC=C HFDVRLIODXPAHB-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- VNBGVYNPGOMPHX-UHFFFAOYSA-N but-3-en-2-ylcyclohexane Chemical compound C=CC(C)C1CCCCC1 VNBGVYNPGOMPHX-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Inorganic materials [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- KITFLYYHMCUKKF-UHFFFAOYSA-N calcium;triphenylphosphane Chemical class [Ca].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 KITFLYYHMCUKKF-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical group S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000007805 chemical reaction reactant Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- ZXKWUYWWVSKKQZ-UHFFFAOYSA-N cyclohexyl(diphenyl)phosphane Chemical compound C1CCCCC1P(C=1C=CC=CC=1)C1=CC=CC=C1 ZXKWUYWWVSKKQZ-UHFFFAOYSA-N 0.000 description 1
- CBUPAVABKPEYSP-UHFFFAOYSA-N cyclohexyl(diphenyl)phosphane;sodium Chemical class [Na].C1CCCCC1P(C=1C=CC=CC=1)C1=CC=CC=C1 CBUPAVABKPEYSP-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004989 dicarbonyl group Chemical group 0.000 description 1
- VPLLTGLLUHLIHA-UHFFFAOYSA-N dicyclohexyl(phenyl)phosphane Chemical compound C1CCCCC1P(C=1C=CC=CC=1)C1CCCCC1 VPLLTGLLUHLIHA-UHFFFAOYSA-N 0.000 description 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 1
- LLZAIAIZAVMQIG-UHFFFAOYSA-N diphenyl(propan-2-yl)phosphane Chemical compound C=1C=CC=CC=1P(C(C)C)C1=CC=CC=C1 LLZAIAIZAVMQIG-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- UOGFCIYBLKSQHL-UHFFFAOYSA-N hex-5-en-3-ol Chemical compound CCC(O)CC=C UOGFCIYBLKSQHL-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910000000 metal hydroxide Chemical group 0.000 description 1
- 150000004692 metal hydroxides Chemical group 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- JFZUABNDWZQLIJ-UHFFFAOYSA-N methyl 2-[(2-chloroacetyl)amino]benzoate Chemical compound COC(=O)C1=CC=CC=C1NC(=O)CCl JFZUABNDWZQLIJ-UHFFFAOYSA-N 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N methyl heptene Natural products CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- AFFLGGQVNFXPEV-UHFFFAOYSA-N n-decene Natural products CCCCCCCCC=C AFFLGGQVNFXPEV-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UZGCMRVEDHLBGY-UHFFFAOYSA-N oct-1-en-4-ol Chemical compound CCCCC(O)CC=C UZGCMRVEDHLBGY-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 125000005702 oxyalkylene group Chemical group 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- AIFSJAIZLCBORN-UHFFFAOYSA-N phenyl-di(propan-2-yl)phosphane Chemical compound CC(C)P(C(C)C)C1=CC=CC=C1 AIFSJAIZLCBORN-UHFFFAOYSA-N 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- CIBMHJPPKCXONB-UHFFFAOYSA-N propane-2,2-diol Chemical compound CC(C)(O)O CIBMHJPPKCXONB-UHFFFAOYSA-N 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- KJBRZWADVLEUIE-UHFFFAOYSA-N propyl oct-7-enoate Chemical compound CCCOC(=O)CCCCCC=C KJBRZWADVLEUIE-UHFFFAOYSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- NCCSSGKUIKYAJD-UHFFFAOYSA-N rubidium(1+) Chemical compound [Rb+] NCCSSGKUIKYAJD-UHFFFAOYSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- NTUROZDXWLPVHB-UHFFFAOYSA-M sodium;3-diphenylphosphanylbenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NTUROZDXWLPVHB-UHFFFAOYSA-M 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- UUCCCPNEFXQJEL-UHFFFAOYSA-L strontium dihydroxide Chemical compound [OH-].[OH-].[Sr+2] UUCCCPNEFXQJEL-UHFFFAOYSA-L 0.000 description 1
- 229910001866 strontium hydroxide Inorganic materials 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 230000009469 supplementation Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/55—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
- C07C45/50—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide by oxo-reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/02—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US932,002 | 1986-11-18 | ||
| US06/932,002 US4731486A (en) | 1986-11-18 | 1986-11-18 | Hydroformylation using low volatile phosphine ligands |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1307296C true CA1307296C (en) | 1992-09-08 |
Family
ID=25461633
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000552143A Expired - Lifetime CA1307296C (en) | 1986-11-18 | 1987-11-18 | Hydroformylation using low volatile phosphine ligands |
Country Status (28)
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1024186C (zh) * | 1988-07-14 | 1994-04-13 | 联合碳化化学品及塑料有限公司 | 催化剂醛产物的分离方法 |
| ZA895346B (en) * | 1988-07-14 | 1990-10-31 | Union Carbide Chem Plastic | Process for producing alcohols and aldehydes |
| US5180854A (en) * | 1988-07-14 | 1993-01-19 | Union Carbide Chemicals & Plastics Technology Corporation | Process for catalyst aldehyde product separation |
| US5059710A (en) * | 1988-08-05 | 1991-10-22 | Union Carbide Chemicals And Plastics Technology Corporation | Ionic phosphites and their use in homogeneous transition metal catalyzed processes |
| US5113022A (en) * | 1988-08-05 | 1992-05-12 | Union Carbide Chemicals & Plastics Technology Corporation | Ionic phosphites used in homogeneous transition metal catalyzed processes |
| US4965404A (en) * | 1989-03-09 | 1990-10-23 | Kuraray Company, Ltd. | Process for the preparation of lithium diphenylphosphinobenzene-m-monosulfonate |
| DE3942954A1 (de) * | 1989-12-23 | 1991-06-27 | Hoechst Ag | Verfahren zur herstellung von aldehyden |
| AU8431391A (en) * | 1990-08-31 | 1992-03-30 | Governors Of The University Of Alberta, The | Carbonylation of methanol using a novel transition metal catalyst precursor |
| US5087763A (en) * | 1990-11-09 | 1992-02-11 | Union Carbide Chemicals & Plastics Technology Corporation | Hydroformylation process |
| US5215667A (en) * | 1991-08-20 | 1993-06-01 | Exxon Chemical Patents Inc. | Method for separating water soluble noble metal catalyst from a noble metal catalyzed hydroformylation reaction |
| US5288818A (en) * | 1991-08-20 | 1994-02-22 | Exxon Chemical Patents Inc. | Method for separating a water soluble noble metal catalyst from a noble metal catalyzed hydroformylation reaction |
| US5196596A (en) * | 1991-12-26 | 1993-03-23 | Union Carbide Chemicals & Plastics Technology Corporation | Higher aldehyde separation process |
| US5300617A (en) * | 1993-01-21 | 1994-04-05 | Exxon Chemical Patents Inc. | Potassium para-diphenyl phosphino benzene sulfonate ligand |
| DE4400837A1 (de) * | 1994-01-14 | 1995-07-20 | Basf Ag | Verfahren zur Herstellung von n-Butyraldehyd und/oder n-Butanol |
| US6143211A (en) * | 1995-07-21 | 2000-11-07 | Brown University Foundation | Process for preparing microparticles through phase inversion phenomena |
| DE19532393A1 (de) * | 1995-09-02 | 1997-03-06 | Hoechst Ag | Verfahren zur Hydroformylierung olefinisch ungesättigter Verbindungen |
| ATE192133T1 (de) * | 1995-09-26 | 2000-05-15 | Kuraray Co | Hydroformylierungsverfahren |
| DE19700804C1 (de) * | 1997-01-13 | 1998-08-06 | Hoechst Ag | Verfahren zur Herstellung von Aldehyden durch Hydroformylierung olefinischer Verbindungen mit 6 bis 16 Kohlenstoffatomen in Anwesenheit einer Rhodium und sulfonierte Triarylphosphine als Katalysator enthaltenden wäßrigen Phase |
| DE19700805C1 (de) * | 1997-01-13 | 1998-08-06 | Hoechst Ag | Verfahren zur Herstellung von Aldehyden durch Hydroformylierung olefinischer Verbindungen mit 3 bis 5 Kohlenstoffatomen in Anwesenheit einer Rhodium und sulfonierte Triarylphosphine als Katalysator enthhaltenden wäßrigen Phase |
| DE19742305A1 (de) * | 1997-09-25 | 1999-04-01 | Hoechst Ag | Verfahren zur Herstellung von Aldehyden durch Hydroformylierung in Gegenwart von Kronenether |
| DE10034360A1 (de) * | 2000-07-14 | 2002-01-24 | Oxeno Olefinchemie Gmbh | Mehrstufiges Verfahren zur Herstellung von Oxo-Aldehyden und/oder Alkoholen |
| FI20002807A0 (fi) * | 2000-09-05 | 2000-12-20 | Neste Chemicals Oy | Menetelmä alkeenien hydroformyloimiseksi |
| CA2447730A1 (en) * | 2001-06-07 | 2002-12-19 | Kuraray Co., Ltd. | Lithium p-diarylphosphinobenzenesulfonates, process for preparation of the same and use thereof |
| WO2003013683A1 (en) * | 2001-08-08 | 2003-02-20 | Brown University Research Foundation | Methods for micronization of hydrophobic drugs |
| AU2002360549A1 (en) * | 2001-12-10 | 2003-06-23 | Spherics, Inc. | Methods and products useful in the formation and isolation of microparticles |
| CA2523433C (en) * | 2003-04-25 | 2012-03-20 | Zenon Lysenko | Aldehyde and alcohol compositions derived from seed oils |
| KR100547587B1 (ko) * | 2004-06-12 | 2006-01-31 | 주식회사 엘지화학 | 인을 포함하는 촉매 조성물 및 이를 이용한히드로포르밀화 방법 |
| CN101039977B (zh) * | 2004-10-25 | 2011-10-12 | 陶氏环球技术有限责任公司 | 由含羟甲基的脂肪酸或这种脂肪酸的烷基酯制成的聚氨酯 |
| MY147769A (en) * | 2004-10-25 | 2013-01-31 | Dow Global Technologies Inc | Prepolymers made from hydroxymethyl-containing polyester polyols derived from fatty acids |
| DE602005023759D1 (de) * | 2004-10-25 | 2010-11-04 | Dow Global Technologies Inc | Polymerpolyole und polymerdispersionen aus hydroxylhaltigen materialien auf pflanzenölbasis |
| US7053253B1 (en) * | 2005-05-02 | 2006-05-30 | 3M Innovative Properties Company | Process for purifying hexafluoropropene dimers |
| MY144337A (en) * | 2005-09-15 | 2011-08-29 | Dow Global Technologies Inc | Process for the monosulfonation of aromatic phosphines, and zwitterionic product derived therefrom |
| CN100526279C (zh) * | 2006-04-11 | 2009-08-12 | 中国科学院兰州化学物理研究所 | 连续制备正戊醛的工艺过程 |
| CA2652016C (en) * | 2006-05-15 | 2015-02-03 | Dow Global Technologies Inc. | Hydroformylation process and product separation with improved recovery of rhodium |
| CN101573392B (zh) * | 2006-09-21 | 2012-06-20 | 陶氏环球技术有限责任公司 | 具有高气流量的粘弹性泡沫 |
| EP1918247A1 (en) * | 2006-10-18 | 2008-05-07 | Ecole Polytechnique Fédérale de Lausanne (EPFL) | Hydrogen production from formic acid |
| US20100087350A1 (en) * | 2007-04-09 | 2010-04-08 | Sonnenschein Mark F | Capped polyester polyol lubricant composition |
| US8486526B2 (en) * | 2007-04-27 | 2013-07-16 | Dow Global Technologies Llc | Low volatiles coatings, sealants and binders from renewable oils |
| BRPI0810266A2 (pt) * | 2007-05-15 | 2014-12-30 | Dow Global Technologies Inc | "espuma de poliuretano de alta resiliência, processo para produzir uma espuma de alta resiliência e artigo". |
| US8134031B2 (en) * | 2007-06-13 | 2012-03-13 | Dow Global Technologies Llc | Extraction process for aldehyde product separation and catalyst recovery |
| EP2167561A1 (en) * | 2007-07-12 | 2010-03-31 | Dow Global Technologies Inc. | Prepolymers and polymers for elastomers |
| BRPI0812635A2 (pt) * | 2007-07-12 | 2015-02-24 | Dow Global Technologies Inc | "poliol de mhms, prepolímero de alcoxissilano de mhms, composição de mhms, polímero de mhms sililado, composição de mhms sililado, processo para preparar um poliol de mhms, processo para preparar pelo menos um prepolímero de alcoxissilanode mhms, processo para preparar pelo menos um polímero de mhms sililado e artigo" |
| BRPI0813064A2 (pt) * | 2007-08-01 | 2018-07-10 | Dow Brasil Sudeste Ind Ltda | "processo para produzir um laminado ou estrutura composta, laminado ou estrutura composta e artigo" processo para produzir um laminado ou estrutura composta, laminado ou estrutura composta e artigo |
| BRPI0905699A2 (pt) * | 2008-01-15 | 2015-07-14 | Dow Global Technologies Inc | Composição, catalisador complexo ou composição de precursor de catalisador complexo, solução de catalisador complexo ou solução de percursor de catalisador complexo e processo de hidroformilação |
| EP2242760B1 (en) * | 2008-01-15 | 2014-03-05 | Dow Global Technologies LLC | Sulfonated organophosphine compounds and use in hydroformylation processes |
| WO2009091670A1 (en) * | 2008-01-15 | 2009-07-23 | Dow Global Technologies Inc. | Sulfonated organophosphine compounds and use thereof in hydroformylation processes |
| BRPI0908697A2 (pt) * | 2008-05-09 | 2019-02-26 | Dow Global Technologies Inc | mistura de poliol à base de óleo natural, espuma de poliuretano flexível e método para produzir uma espuma de poliuretano |
| US20120123005A1 (en) | 2009-07-22 | 2012-05-17 | Dow Brasil Sudeste Industrial Ltda. | Natural oil based polyurethane foams |
| WO2011068664A1 (en) | 2009-12-03 | 2011-06-09 | Dow Global Technologies Llc | Decolorization of polyols |
| EP2510031B1 (en) | 2009-12-08 | 2013-10-30 | Dow Global Technologies LLC | Process to prepare open cell foams made with natural oil based polyols and poly(propylene oxide) polyols |
| CN102770502A (zh) | 2009-12-21 | 2012-11-07 | 陶氏环球技术有限责任公司 | 用于绝缘玻璃单元的基于聚氨酯的密封剂 |
| CA2784943C (en) * | 2009-12-22 | 2016-09-06 | Dow Technology Investments Llc | Controlling the normal:iso aldehyde ratio in a mixed ligand hydroformylation process by controlling the syngas partial pressure |
| EP2545091A1 (en) | 2010-03-12 | 2013-01-16 | Dow Global Technologies LLC | Gels and soft polyurethane elastomers made with natural oil based polyols |
| WO2011112813A1 (en) | 2010-03-12 | 2011-09-15 | Dow Global Technologies Llc | Elastomer binding materials made with natural oil based polyols |
| US20130018147A1 (en) | 2010-03-31 | 2013-01-17 | Dow Global Technologies Llc | Polyurethane/polyurea spray elastomers |
| BR112012026146A2 (pt) | 2010-04-14 | 2016-06-28 | Dow Global Technologies Llc | policarbonato poliol e produto de poliuretano |
| BR112012032975A2 (pt) | 2010-06-22 | 2019-09-24 | Dow Global Technologies Llc | método para produzir um polímero de silila, polímero de silila e artigo |
| CN103080173B (zh) | 2010-06-30 | 2015-05-27 | 陶氏环球技术有限责任公司 | 甲硅烷基封端的聚合物 |
| ITMI20101380A1 (it) | 2010-07-27 | 2012-01-28 | Dow Global Technologies Inc | Pannello composito poliuretanico a basso impatto ambientale |
| DK2638090T3 (da) | 2010-11-11 | 2015-05-04 | Dow Global Technologies Llc | Polyurethanbaseret tætningsmiddel til isoleret glas |
| US20140088245A1 (en) | 2011-03-31 | 2014-03-27 | Dow Global Technologies Llc | Hydrophobic polyester polycarbonate polyols for use in polyurethane applications |
| CN102826974B (zh) * | 2011-06-17 | 2015-11-25 | 中国石油化工股份有限公司 | 一种丙烯氢甲酰化反应制备丁醛的方法 |
| WO2013003051A2 (en) | 2011-06-30 | 2013-01-03 | Dow Global Technologies Llc | Silane terminated polycarbonate-polyester copolymers for coating, adhesives, sealant and elastomer applications |
| US9284387B2 (en) | 2012-09-24 | 2016-03-15 | Exxonmobil Chemical Patents Inc. | Hydroamination of aldehyde-containing macromonomers |
| WO2014047256A1 (en) * | 2012-09-24 | 2014-03-27 | Exxonmobil Chemical Patents Inc. | Catalytic hydroformylation of vinyl terminated polyolefins |
| RU2015115714A (ru) | 2012-09-26 | 2016-11-20 | ДАУ ГЛОБАЛ ТЕКНОЛОДЖИЗ ЭлЭлСи | Герметик на основе полиуретана для изоляционного стеклопакета |
| CN104045532B (zh) | 2013-03-15 | 2018-05-25 | 陶氏技术投资有限责任公司 | 加氢甲酰化方法 |
| EP3063117B1 (en) | 2013-10-28 | 2020-01-08 | Rohm and Haas Company | Process for preparing methyl methacrylate |
| RU2561171C1 (ru) * | 2014-09-12 | 2015-08-27 | Открытое акционерное общество "Нефтяная компания "Роснефть" | Способ непрерывного двухступенчатого гидроформилирования олефинов с3, с4 и технологическая установка для его осуществления |
| MX2018010980A (es) | 2016-03-18 | 2018-11-15 | Dow Technology Investments Llc | Proceso de hidroformilacion. |
| CN110678439B (zh) | 2017-05-25 | 2022-11-01 | 罗门哈斯公司 | 用于制备甲基丙烯醛的方法 |
| WO2018217962A1 (en) | 2017-05-25 | 2018-11-29 | Rohm And Haas Company | Process for preparing methacrolein |
| CA3233794A1 (en) | 2021-10-08 | 2023-04-13 | Rohm And Haas Company | Process for methyl methacrylate production |
| WO2023059674A1 (en) | 2021-10-08 | 2023-04-13 | Dow Global Technologies Llc | Process for low byproduct formation from an oxidative esterification reactor with base addition |
| EP4412982A1 (en) | 2021-10-08 | 2024-08-14 | Rohm and Haas Company | Process for methyl methacrylate production from ethanol |
| CA3233803A1 (en) | 2021-10-08 | 2023-04-13 | Kirk W. Limbach | Process for low byproduct formation of methyl methacrylate from an oxidative esterification reactor |
| KR20240089248A (ko) | 2021-10-08 | 2024-06-20 | 롬 앤드 하스 캄파니 | 알킬 메타크릴레이트의 생산 방법 |
| US20240327327A1 (en) | 2021-10-08 | 2024-10-03 | Dow Global Technologies Llc | Process for methacrylic acid production |
| CA3233792A1 (en) | 2021-10-08 | 2023-04-13 | Kirk W. Limbach | Process for methyl methacrylate production |
| US20250250222A1 (en) | 2021-10-08 | 2025-08-07 | Rohm And Haas Company | Process for an oxidative esterification reactor |
| EP4605366A1 (en) | 2022-12-08 | 2025-08-27 | Dow Global Technologies LLC | Process for preparing alkyl methacrylates |
| EP4605365A1 (en) | 2022-12-08 | 2025-08-27 | Rohm and Haas Company | Process for concurrent methyl methacrylate and methacrylic acid production |
| GB202307175D0 (en) | 2023-05-15 | 2023-06-28 | Johnson Matthey Davy Technologies Ltd | Process for hydrogenating a substrate |
| CN116606197B (zh) * | 2023-05-29 | 2025-05-06 | 国家能源集团宁夏煤业有限责任公司 | 费托油氢甲酰化反应制备醛的方法和产品 |
| GB202404300D0 (en) | 2024-03-26 | 2024-05-08 | Johnson Matthey Davy Technologies Ltd | Process for the production of 2-alkylalkanol |
Family Cites Families (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US31812A (en) * | 1861-03-26 | Stump-extractor | ||
| US3527809A (en) * | 1967-08-03 | 1970-09-08 | Union Carbide Corp | Hydroformylation process |
| BE758502A (fr) * | 1969-11-06 | 1971-05-05 | Basf Ag | Preparation d'alcools et d'aldehydes |
| NL7106084A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1970-05-06 | 1971-11-09 | ||
| US3968136A (en) * | 1974-07-12 | 1976-07-06 | Union Carbide Corporation | Catalytic process for polyhydric alcohols and derivatives |
| US4159999A (en) * | 1974-11-22 | 1979-07-03 | Celanese Corporation | Hydroformylation of olefins |
| US4148830A (en) * | 1975-03-07 | 1979-04-10 | Union Carbide Corporation | Hydroformylation of olefins |
| US3984478A (en) * | 1975-05-27 | 1976-10-05 | Universal Oil Products Company | Hydroformylation process |
| US4248802A (en) | 1975-06-20 | 1981-02-03 | Rhone-Poulenc Industries | Catalytic hydroformylation of olefins |
| US4247486A (en) * | 1977-03-11 | 1981-01-27 | Union Carbide Corporation | Cyclic hydroformylation process |
| FR2351077A1 (fr) * | 1976-05-13 | 1977-12-09 | Celanese Corp | Procede perfectionne d'hydroformylation des olefines avec un catalyseur complexe au rhodium |
| US4162261A (en) * | 1976-09-29 | 1979-07-24 | Union Carbide Corporation | Novel solvents for the catalytic process for making polyhydric alcohols |
| ZA78146B (en) * | 1977-01-25 | 1978-12-27 | Union Carbide Corp | Improved hydroformylation process |
| US4211719A (en) * | 1978-02-13 | 1980-07-08 | Union Carbide Corporation | Catalytic process for polyhydric alcohols and derivatives |
| US4306084A (en) * | 1978-12-06 | 1981-12-15 | The University Of Texas | Alcohol and aldehyde production using ruthenium carbonyl catalysts |
| DE3022025A1 (de) * | 1979-06-18 | 1981-01-08 | Celanese Corp | Verfahren zur hydroformylierung von olefinen |
| US4329511A (en) * | 1979-06-18 | 1982-05-11 | Celanese Corporation | Hydroformylation process improved by choice of reaction solvent and control of product stripping parameters |
| US4283562A (en) * | 1979-10-26 | 1981-08-11 | Union Carbide Corporation | Hydroformylation process using stable rhodium catalyst |
| FR2478078A2 (fr) * | 1980-03-12 | 1981-09-18 | Rhone Poulenc Ind | Procede d'hydroformylation des olefines |
| US4302547A (en) * | 1980-06-30 | 1981-11-24 | Union Carbide Corporation | Novel solvents for the catalytic process for producing polyhydric alcohols |
| GB2085874B (en) * | 1980-09-04 | 1984-08-08 | Johnson Matthey Plc | Hydroformylation of olefins |
| DE3046355A1 (de) * | 1980-12-09 | 1982-07-15 | Basf Ag, 6700 Ludwigshafen | Verfahren zur hydroformylierung von olefinisch ungesaettigten verbindungen |
| US4400548A (en) * | 1981-08-17 | 1983-08-23 | Union Carbide Corporation | Hydroformylation process using bisphosphine monooxide ligands |
| JPS58157739A (ja) * | 1982-03-12 | 1983-09-19 | Kuraray Co Ltd | 1,9−ノナンジア−ルの製造方法 |
| US4453022A (en) * | 1982-04-21 | 1984-06-05 | Union Carbide Corporation | Process for preparing nonionic surfactants-oxyalkylation with calcium and/or strontium catalysts |
| FR2532318B1 (fr) * | 1982-08-31 | 1985-06-14 | Rhone Poulenc Chim Base | Procede de preparation de triarylphosphines sulfonees |
| DE3234701A1 (de) * | 1982-09-18 | 1984-04-05 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3235030A1 (de) * | 1982-09-22 | 1984-03-22 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von sulfonierten arylphosphinen |
| DE3235029A1 (de) * | 1982-09-22 | 1984-03-22 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur rueckgewinnung von wasserloeslichen, rhodium enthaltenden hydroformylierungskatalysatoren |
| US4480138A (en) * | 1982-10-12 | 1984-10-30 | Celanese Corporation | Hydroformylation process |
| DE3245883A1 (de) * | 1982-12-11 | 1984-06-14 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur hydroformylierung von olefinen |
| FR2550202B1 (fr) * | 1983-08-03 | 1986-03-21 | Rhone Poulenc Rech | Procede de preparation de tri(m-sulfophenyl) phosphine |
| DE3341035A1 (de) * | 1983-11-12 | 1985-05-23 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3347406A1 (de) * | 1983-12-29 | 1985-07-11 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur abtrennung und wiedergewinnung von rhodium aus den produkten der oxosynthese |
| FR2561650B1 (fr) * | 1984-03-26 | 1987-10-23 | Rhone Poulenc Rech | Perfectionnement au procede de preparation de tri(m-sulfophenyl)phosphine par hydrolyse et dilution controlees du sulfonat |
| DE3411034A1 (de) * | 1984-03-26 | 1985-09-26 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur rueckgewinnung von rhodium aus reaktionsprodukten der oxosynthese |
| DE3412335A1 (de) * | 1984-04-03 | 1985-10-10 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3413427A1 (de) * | 1984-04-10 | 1985-10-17 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3415968A1 (de) * | 1984-04-28 | 1985-10-31 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3420491A1 (de) * | 1984-06-01 | 1985-12-05 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3420493A1 (de) * | 1984-06-01 | 1985-12-05 | Ruhrchemie Ag, 4200 Oberhausen | Quartaere ammoniumsalze sulfonierter triarylphosphine |
| US4578523A (en) * | 1985-05-29 | 1986-03-25 | Ruhrchemie Aktiengesellschaft | Process for the preparation of aldehydes |
| DE3534314A1 (de) * | 1985-09-26 | 1987-04-02 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| US4633021A (en) * | 1985-11-29 | 1986-12-30 | National Distillers And Chemical Corporation | Olefin hydroformylation |
| US4716250A (en) * | 1986-07-10 | 1987-12-29 | Union Carbide Corporation | Hydroformylation using low volatile/organic soluble phosphine ligands |
-
1986
- 1986-11-18 US US06/932,002 patent/US4731486A/en not_active Expired - Lifetime
-
1987
- 1987-11-17 RU SU874203758A patent/RU2002728C1/ru active
- 1987-11-17 DE DE8787116971T patent/DE3779725D1/de not_active Expired - Lifetime
- 1987-11-17 BE BE8701298A patent/BE1000619A5/fr not_active IP Right Cessation
- 1987-11-17 DE DE19873739064 patent/DE3739064A1/de active Granted
- 1987-11-17 AU AU81280/87A patent/AU611867B2/en not_active Ceased
- 1987-11-17 EP EP87116971A patent/EP0268268B1/en not_active Expired - Lifetime
- 1987-11-17 AT AT87116971T patent/ATE77075T1/de active
- 1987-11-17 MX MX009383A patent/MX166784B/es unknown
- 1987-11-18 FI FI875087A patent/FI90858C/fi not_active IP Right Cessation
- 1987-11-18 YU YU2091/87A patent/YU45074B/xx unknown
- 1987-11-18 FR FR878715930A patent/FR2606771B1/fr not_active Expired
- 1987-11-18 PL PL1987268876A patent/PL153062B1/pl unknown
- 1987-11-18 BR BR8706223A patent/BR8706223A/pt not_active Application Discontinuation
- 1987-11-18 CN CN87101178A patent/CN1017145B/zh not_active Expired
- 1987-11-18 SE SE8704533A patent/SE8704533L/ not_active Application Discontinuation
- 1987-11-18 DK DK605887A patent/DK605887A/da not_active Application Discontinuation
- 1987-11-18 JP JP62289666A patent/JPH0667868B2/ja not_active Expired - Fee Related
- 1987-11-18 IT IT22675/87A patent/IT1223147B/it active
- 1987-11-18 CA CA000552143A patent/CA1307296C/en not_active Expired - Lifetime
- 1987-11-18 KR KR1019870012952A patent/KR920003556B1/ko not_active Expired
- 1987-11-18 NO NO874810A patent/NO166440C/no unknown
- 1987-11-18 AR AR87309326A patent/AR248390A1/es active
- 1987-11-18 GB GB8727013A patent/GB2197867B/en not_active Expired - Lifetime
- 1987-11-18 ES ES8703288A patent/ES2009221A6/es not_active Expired
- 1987-11-18 HU HU875125A patent/HU202177B/hu not_active IP Right Cessation
- 1987-11-18 NL NL8702752A patent/NL8702752A/nl not_active Application Discontinuation
- 1987-11-18 IN IN834/MAS/87A patent/IN170369B/en unknown
- 1987-11-18 ZA ZA878638A patent/ZA878638B/xx unknown
-
1989
- 1989-04-24 ES ES8901417A patent/ES2012718A6/es not_active Expired - Lifetime
- 1989-04-24 ES ES8901418A patent/ES2012719A6/es not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1307296C (en) | Hydroformylation using low volatile phosphine ligands | |
| CA1307006C (en) | Hydroformylation using low volatile/organic soluble phosphine ligands | |
| EP0353770B1 (en) | Ionic phosphites and their use in homogeneous transition metal catalyzed processes | |
| US5113022A (en) | Ionic phosphites used in homogeneous transition metal catalyzed processes | |
| CA1281704C (en) | Transition metal complex catalyzed processes | |
| US5756855A (en) | Stabilization of phosphite ligands in hydroformylation process | |
| EP0073961A1 (en) | Hydroformylation process using a rhodium complex catalyst with biphosphine monoxide ligands | |
| CA1183123A (en) | Hydroformylation process using triarylphosphine and bisphosphine monooxide ligands | |
| EP0599885A1 (en) | METHOD FOR SEPARATING A WATER SOLUBLE PRECIOUS METAL CATALYST FROM A PRECIOUS METAL CATALYZED HYDROFORMULATION REACTION. | |
| HU204249B (en) | Process for producing aldehydes withcatalytic hydroformilizing olephines | |
| CA1267657A (en) | Hydroformylation process | |
| US6339174B1 (en) | Method for preparing aldehydes by hydroformylation | |
| US6211414B1 (en) | Process for preparing aldehydes by hydroformylation | |
| US4522933A (en) | Hydroformylation catalyst containing bisphosphine monooxide ligands | |
| JP3291421B2 (ja) | ヒドロホルミル化方法におけるホスフィットリガンドの安定化 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |