CA1289956C - Naphthyridine- and quinolonecarboxylic acids as antibacterial agents - Google Patents
Naphthyridine- and quinolonecarboxylic acids as antibacterial agentsInfo
- Publication number
- CA1289956C CA1289956C CA000473502A CA473502A CA1289956C CA 1289956 C CA1289956 C CA 1289956C CA 000473502 A CA000473502 A CA 000473502A CA 473502 A CA473502 A CA 473502A CA 1289956 C CA1289956 C CA 1289956C
- Authority
- CA
- Canada
- Prior art keywords
- oxo
- dihydro
- ethyl
- methyl
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000002253 acid Substances 0.000 title claims description 38
- 239000003242 anti bacterial agent Substances 0.000 title abstract 3
- 150000007513 acids Chemical class 0.000 title description 2
- 150000003839 salts Chemical class 0.000 claims description 32
- ITOFRIWHUYCDAO-UHFFFAOYSA-N 1-cyclopropyl-7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C(C(=C1)F)=NC2=C1C(=O)C(C(O)=O)=CN2C1CC1 ITOFRIWHUYCDAO-UHFFFAOYSA-N 0.000 claims description 2
- UHBXZNXCIZHGFF-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1F UHBXZNXCIZHGFF-UHFFFAOYSA-N 0.000 claims description 2
- ZJMPXMSYPYIIPQ-UHFFFAOYSA-N 7-[3-(aminomethyl)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1C(CN)CCN1C(C(=C1)F)=NC2=C1C(=O)C(C(O)=O)=CN2C1CC1 ZJMPXMSYPYIIPQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims 8
- LTFFMJFDHJMONV-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-4-oxo-7-[3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]quinoline-3-carboxylic acid Chemical compound C1C(CNC(C)C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1F LTFFMJFDHJMONV-UHFFFAOYSA-N 0.000 claims 1
- XKGVOPJHIWQLRX-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-7-[3-(methylaminomethyl)pyrrolidin-1-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CNC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1F XKGVOPJHIWQLRX-UHFFFAOYSA-N 0.000 claims 1
- QUBWLGORDNPCIB-UHFFFAOYSA-N 1-cyclopropyl-7-[3-(ethylamino)pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1F QUBWLGORDNPCIB-UHFFFAOYSA-N 0.000 claims 1
- WDBGUJBLPRXPIX-UHFFFAOYSA-N 1-cyclopropyl-7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1F WDBGUJBLPRXPIX-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 138
- 238000000034 method Methods 0.000 abstract description 32
- 239000000543 intermediate Substances 0.000 abstract description 5
- 238000004519 manufacturing process Methods 0.000 abstract description 5
- 208000035143 Bacterial infection Diseases 0.000 abstract description 3
- 208000022362 bacterial infectious disease Diseases 0.000 abstract description 3
- 238000009472 formulation Methods 0.000 abstract description 2
- CSAYVSRENVQAPV-UHFFFAOYSA-N N1=CC=CC2=CC=CC=C21.C1=CC=C2ONC(C(=O)O)=CC2=C1 Chemical class N1=CC=CC2=CC=CC=C21.C1=CC=C2ONC(C(=O)O)=CC2=C1 CSAYVSRENVQAPV-UHFFFAOYSA-N 0.000 abstract 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 250
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 185
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 157
- 150000001875 compounds Chemical class 0.000 description 150
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 141
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 123
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 120
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 112
- 239000000243 solution Substances 0.000 description 108
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 88
- 238000006243 chemical reaction Methods 0.000 description 88
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 86
- 239000007787 solid Substances 0.000 description 74
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 72
- 239000002904 solvent Substances 0.000 description 72
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 63
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 62
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 61
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 54
- 235000019441 ethanol Nutrition 0.000 description 52
- 238000001914 filtration Methods 0.000 description 51
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 49
- 239000002244 precipitate Substances 0.000 description 49
- 239000001257 hydrogen Substances 0.000 description 47
- 229910052739 hydrogen Inorganic materials 0.000 description 47
- -1 amine salt Chemical class 0.000 description 45
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 44
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 42
- 239000000725 suspension Substances 0.000 description 41
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 37
- 235000019341 magnesium sulphate Nutrition 0.000 description 36
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 34
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 34
- 229960000443 hydrochloric acid Drugs 0.000 description 34
- 235000011167 hydrochloric acid Nutrition 0.000 description 34
- 239000000706 filtrate Substances 0.000 description 33
- 229960003390 magnesium sulfate Drugs 0.000 description 33
- 238000004458 analytical method Methods 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 30
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 28
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 28
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 27
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 26
- 239000000460 chlorine Chemical group 0.000 description 26
- 239000003921 oil Substances 0.000 description 26
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 25
- 125000000217 alkyl group Chemical group 0.000 description 25
- 125000004432 carbon atom Chemical group C* 0.000 description 25
- 239000000047 product Substances 0.000 description 25
- 238000000746 purification Methods 0.000 description 21
- 238000010992 reflux Methods 0.000 description 21
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 20
- 239000003054 catalyst Substances 0.000 description 19
- 239000000463 material Substances 0.000 description 19
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Natural products C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 19
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- 229960000583 acetic acid Drugs 0.000 description 18
- 239000012280 lithium aluminium hydride Substances 0.000 description 18
- 239000010410 layer Substances 0.000 description 17
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 16
- BUQMHUKZYMREQT-UHFFFAOYSA-N n-(pyrrolidin-3-ylmethyl)ethanamine Chemical group CCNCC1CCNC1 BUQMHUKZYMREQT-UHFFFAOYSA-N 0.000 description 16
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 16
- 239000002585 base Substances 0.000 description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 15
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 15
- 239000012298 atmosphere Substances 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- 239000006188 syrup Substances 0.000 description 14
- 235000020357 syrup Nutrition 0.000 description 14
- 238000003756 stirring Methods 0.000 description 13
- 239000012044 organic layer Substances 0.000 description 12
- LJYJAEQCLXAHFQ-UHFFFAOYSA-N 7-chloro-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound FC1=C(Cl)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 LJYJAEQCLXAHFQ-UHFFFAOYSA-N 0.000 description 11
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 11
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 10
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 230000000875 corresponding effect Effects 0.000 description 10
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 9
- 229940093499 ethyl acetate Drugs 0.000 description 9
- 235000019439 ethyl acetate Nutrition 0.000 description 9
- 239000011152 fibreglass Substances 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical class S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 229940086542 triethylamine Drugs 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 8
- JVODWNWKCOVKTO-UHFFFAOYSA-N n-methyl-1-pyrrolidin-3-ylmethanamine Chemical compound CNCC1CCNC1 JVODWNWKCOVKTO-UHFFFAOYSA-N 0.000 description 8
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 8
- OQCUGPQOZNYIMV-UHFFFAOYSA-N pyrrolidin-3-ylmethanamine Chemical class NCC1CCNC1 OQCUGPQOZNYIMV-UHFFFAOYSA-N 0.000 description 8
- FKKUVCHFRDLBHN-UHFFFAOYSA-N 1-ethyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 FKKUVCHFRDLBHN-UHFFFAOYSA-N 0.000 description 7
- 239000000908 ammonium hydroxide Substances 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 239000000306 component Substances 0.000 description 6
- IVYCRGVEVVOQBH-UHFFFAOYSA-N ethyl 7-(2-bromoacetyl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound BrCC(=O)C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1 IVYCRGVEVVOQBH-UHFFFAOYSA-N 0.000 description 6
- 239000011737 fluorine Chemical group 0.000 description 6
- 229910052731 fluorine Inorganic materials 0.000 description 6
- 239000012458 free base Substances 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- OXNZWNNMJBOZQO-UHFFFAOYSA-N 7-chloro-1-cyclopropyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C12=NC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 OXNZWNNMJBOZQO-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 125000000753 cycloalkyl group Chemical group 0.000 description 5
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 5
- 125000004494 ethyl ester group Chemical group 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- VJPYEYRKXXVWNA-UHFFFAOYSA-N n-(pyrrolidin-3-ylmethyl)propan-2-amine Chemical compound CC(C)NCC1CCNC1 VJPYEYRKXXVWNA-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- SUNMBRGCANLOEG-UHFFFAOYSA-N 1,3-dichloroacetone Chemical compound ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 4
- VYKQDWPBYULGPF-UHFFFAOYSA-N 1-benzyl-5-oxopyrrolidine-3-carboxylic acid Chemical compound O=C1CC(C(=O)O)CN1CC1=CC=CC=C1 VYKQDWPBYULGPF-UHFFFAOYSA-N 0.000 description 4
- NSCCOUBDHCHVHL-UHFFFAOYSA-N 2-(pyrrolidin-3-ylmethylamino)ethanol Chemical compound OCCNCC1CCNC1 NSCCOUBDHCHVHL-UHFFFAOYSA-N 0.000 description 4
- KTWQBDFIDPFQKG-UHFFFAOYSA-N 2-methyl-2,7-diazaspiro[4.4]nonane;dihydrochloride Chemical compound Cl.Cl.C1N(C)CCC11CNCC1 KTWQBDFIDPFQKG-UHFFFAOYSA-N 0.000 description 4
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 4
- GYBQCPUKLCVGRD-UHFFFAOYSA-N 6,7,8-trifluoro-1-(2-methylcyclopropyl)-4-oxoquinoline-3-carboxylic acid Chemical compound CC1CC1N1C2=C(F)C(F)=C(F)C=C2C(=O)C(C(O)=O)=C1 GYBQCPUKLCVGRD-UHFFFAOYSA-N 0.000 description 4
- 229910014033 C-OH Inorganic materials 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 4
- 229910014570 C—OH Inorganic materials 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- 229910052774 Proactinium Inorganic materials 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- ZVOXTNWGAARBIH-UHFFFAOYSA-N ethyl 7-[3-(dimethylamino)prop-2-enoyl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylate Chemical compound CN(C)C=CC(=O)C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1F ZVOXTNWGAARBIH-UHFFFAOYSA-N 0.000 description 4
- LXGFTHLQXSMNMB-UHFFFAOYSA-N ethyl 7-[3-(dimethylamino)prop-2-enoyl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound CN(C)C=CC(=O)C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1 LXGFTHLQXSMNMB-UHFFFAOYSA-N 0.000 description 4
- RNLLUMSVUFEPMR-UHFFFAOYSA-N ethyl 7-acetyl-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound CC(=O)C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1 RNLLUMSVUFEPMR-UHFFFAOYSA-N 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- KYOLWTXOYMKDRP-UHFFFAOYSA-N n-(pyrrolidin-3-ylmethyl)propan-1-amine Chemical compound CCCNCC1CCNC1 KYOLWTXOYMKDRP-UHFFFAOYSA-N 0.000 description 4
- HOIFYAYAOLSLBR-UHFFFAOYSA-N n-ethyl-n-(pyrrolidin-3-ylmethyl)ethanamine Chemical compound CCN(CC)CC1CCNC1 HOIFYAYAOLSLBR-UHFFFAOYSA-N 0.000 description 4
- 239000002674 ointment Substances 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 150000003141 primary amines Chemical group 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000010561 standard procedure Methods 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- FMCAFXHLMUOIGG-JTJHWIPRSA-N (2s)-2-[[(2r)-2-[[(2s)-2-[[(2r)-2-formamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,5-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound O=CN[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(=O)N[C@@H](CCSC)C(O)=O)CC1=CC(C)=C(O)C=C1C FMCAFXHLMUOIGG-JTJHWIPRSA-N 0.000 description 3
- VGIIILXIQLXVLC-UHFFFAOYSA-N 1-(2,6-difluorophenyl)ethanone Chemical compound CC(=O)C1=C(F)C=CC=C1F VGIIILXIQLXVLC-UHFFFAOYSA-N 0.000 description 3
- BLZVPYLBVJENNU-UHFFFAOYSA-N 1-benzyl-n-methyl-5-oxopyrrolidine-3-carboxamide Chemical compound O=C1CC(C(=O)NC)CN1CC1=CC=CC=C1 BLZVPYLBVJENNU-UHFFFAOYSA-N 0.000 description 3
- NMASXYCNDJMMFR-UHFFFAOYSA-N 1-cyclopropyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 NMASXYCNDJMMFR-UHFFFAOYSA-N 0.000 description 3
- QHMPADKXXHRBCB-UHFFFAOYSA-N 2,2,2-trifluoro-n-(pyrrolidin-3-ylmethyl)ethanamine Chemical compound FC(F)(F)CNCC1CCNC1 QHMPADKXXHRBCB-UHFFFAOYSA-N 0.000 description 3
- SFKRXQKJTIYUAG-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C(F)=C1F SFKRXQKJTIYUAG-UHFFFAOYSA-N 0.000 description 3
- CCNVWYREYGBKHQ-UHFFFAOYSA-N 2-ethyl-2,7-diazaspiro[4.4]nonane;dihydrochloride Chemical compound Cl.Cl.C1N(CC)CCC11CNCC1 CCNVWYREYGBKHQ-UHFFFAOYSA-N 0.000 description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- XWNSFEAWWGGSKJ-UHFFFAOYSA-N 4-acetyl-4-methylheptanedinitrile Chemical compound N#CCCC(C)(C(=O)C)CCC#N XWNSFEAWWGGSKJ-UHFFFAOYSA-N 0.000 description 3
- RIHCUVVLOGHVOQ-UHFFFAOYSA-N 6,7,8-trifluoro-4-oxo-1-(2,2,2-trifluoroethyl)quinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(CC(F)(F)F)C2=C1F RIHCUVVLOGHVOQ-UHFFFAOYSA-N 0.000 description 3
- APNMPSWZQQNDQP-UHFFFAOYSA-N 6,7,8-trifluoro-4-oxo-1-propan-2-ylquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(C(C)C)C=C(C(O)=O)C(=O)C2=C1 APNMPSWZQQNDQP-UHFFFAOYSA-N 0.000 description 3
- VGZMCLVFNZOQGR-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(N)C1 VGZMCLVFNZOQGR-UHFFFAOYSA-N 0.000 description 3
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- IVRMZWNICZWHMI-UHFFFAOYSA-N Azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 239000004153 Potassium bromate Substances 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 229960004132 diethyl ether Drugs 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- GKONDLRZGSAWIZ-UHFFFAOYSA-N ethyl 3-(2-ethoxy-2-oxoethyl)-5-oxopyrrolidine-3-carboxylate Chemical compound CCOC(=O)CC1(C(=O)OCC)CNC(=O)C1 GKONDLRZGSAWIZ-UHFFFAOYSA-N 0.000 description 3
- KBCCDAIEBVQPMW-UHFFFAOYSA-N ethyl 7-acetyl-6,8-difluoro-4-oxo-1h-quinoline-3-carboxylate Chemical compound CC(=O)C1=C(F)C=C2C(=O)C(C(=O)OCC)=CNC2=C1F KBCCDAIEBVQPMW-UHFFFAOYSA-N 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 229910001385 heavy metal Inorganic materials 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 235000001055 magnesium Nutrition 0.000 description 3
- 229940091250 magnesium supplement Drugs 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 238000009740 moulding (composite fabrication) Methods 0.000 description 3
- VGAMVQMWRXDPQL-UHFFFAOYSA-N n-(azetidin-3-ylmethyl)ethanamine Chemical compound CCNCC1CNC1 VGAMVQMWRXDPQL-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- 229940094037 potassium bromate Drugs 0.000 description 3
- 235000019396 potassium bromate Nutrition 0.000 description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- JABYJIQOLGWMQW-UHFFFAOYSA-N undec-4-ene Chemical compound CCCCCCC=CCCC JABYJIQOLGWMQW-UHFFFAOYSA-N 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- KISVATOISQDZJU-UHFFFAOYSA-N (1-benzhydrylazetidin-3-yl)methanamine Chemical compound C1C(CN)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 KISVATOISQDZJU-UHFFFAOYSA-N 0.000 description 2
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical compound C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 2
- GIFITQJIBGFTGK-UHFFFAOYSA-N 1-(1-benzhydrylazetidin-3-yl)-n-methylmethanamine Chemical compound C1C(CNC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 GIFITQJIBGFTGK-UHFFFAOYSA-N 0.000 description 2
- FOSNQWWFKGJNOZ-UHFFFAOYSA-N 1-(1-benzylpyrrolidin-3-yl)-n,n-dimethylmethanamine Chemical compound C1C(CN(C)C)CCN1CC1=CC=CC=C1 FOSNQWWFKGJNOZ-UHFFFAOYSA-N 0.000 description 2
- ZSYALYBRMVKYAS-UHFFFAOYSA-N 1-(1-benzylpyrrolidin-3-yl)-n-methylmethanamine Chemical compound C1C(CNC)CCN1CC1=CC=CC=C1 ZSYALYBRMVKYAS-UHFFFAOYSA-N 0.000 description 2
- NAAVJKHFIJUTKO-UHFFFAOYSA-N 1-(2-acetyl-3-fluoro-6-nitrophenoxy)propan-2-one Chemical compound CC(=O)COC1=C(C(C)=O)C(F)=CC=C1[N+]([O-])=O NAAVJKHFIJUTKO-UHFFFAOYSA-N 0.000 description 2
- RYCSLYUQCKATHV-UHFFFAOYSA-N 1-(7-fluoro-3-methyl-3,4-dihydro-2h-1,4-benzoxazin-8-yl)ethanone Chemical compound C1=CC(F)=C(C(C)=O)C2=C1NC(C)CO2 RYCSLYUQCKATHV-UHFFFAOYSA-N 0.000 description 2
- RUZHGFVEMQGCAW-UHFFFAOYSA-N 1-(azetidin-3-yl)-n-methylmethanamine Chemical compound CNCC1CNC1 RUZHGFVEMQGCAW-UHFFFAOYSA-N 0.000 description 2
- XLELHJBEEQQISD-UHFFFAOYSA-N 1-benzyl-5-oxo-n-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide Chemical compound O=C1CC(C(=O)NCC(F)(F)F)CN1CC1=CC=CC=C1 XLELHJBEEQQISD-UHFFFAOYSA-N 0.000 description 2
- DVLUEKBTCGGHDR-UHFFFAOYSA-N 1-benzyl-5-oxo-n-propan-2-ylpyrrolidine-3-carboxamide Chemical compound O=C1CC(C(=O)NC(C)C)CN1CC1=CC=CC=C1 DVLUEKBTCGGHDR-UHFFFAOYSA-N 0.000 description 2
- GHXAYOVKQMHCAF-UHFFFAOYSA-N 1-benzyl-5-oxo-n-propylpyrrolidine-3-carboxamide Chemical compound O=C1CC(C(=O)NCCC)CN1CC1=CC=CC=C1 GHXAYOVKQMHCAF-UHFFFAOYSA-N 0.000 description 2
- YEWJYJMMDPUHFY-UHFFFAOYSA-N 1-benzyl-n-cyclopropyl-5-oxopyrrolidine-3-carboxamide Chemical compound C1N(CC=2C=CC=CC=2)C(=O)CC1C(=O)NC1CC1 YEWJYJMMDPUHFY-UHFFFAOYSA-N 0.000 description 2
- HBVNLKQGRZPGRP-UHFFFAOYSA-N 1-benzylpyrrolidin-3-amine Chemical compound C1C(N)CCN1CC1=CC=CC=C1 HBVNLKQGRZPGRP-UHFFFAOYSA-N 0.000 description 2
- NCMBXLMTKXKLGM-UHFFFAOYSA-N 1-cyclohexyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CCCCC1 NCMBXLMTKXKLGM-UHFFFAOYSA-N 0.000 description 2
- GVMAZDKTZFZXAX-UHFFFAOYSA-N 1-cyclopentyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CCCC1 GVMAZDKTZFZXAX-UHFFFAOYSA-N 0.000 description 2
- MHFJYVWFBPABTI-UHFFFAOYSA-N 1-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHFJYVWFBPABTI-UHFFFAOYSA-N 0.000 description 2
- KPHGHPFKPODXOI-UHFFFAOYSA-N 1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound FC1=CN=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 KPHGHPFKPODXOI-UHFFFAOYSA-N 0.000 description 2
- XWCKIXLTBNGIHV-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoyl chloride Chemical compound FC1=CC(C(Cl)=O)=C(F)C(F)=C1F XWCKIXLTBNGIHV-UHFFFAOYSA-N 0.000 description 2
- DDVRNOMZDQTUNS-UHFFFAOYSA-N 2,7-diazaspiro[4.4]nonane Chemical compound C1NCCC11CNCC1 DDVRNOMZDQTUNS-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- DRWFKAPKNFAIDU-UHFFFAOYSA-N 2-[(3-acetyl-2,4-difluoroanilino)methylidene]propanedioic acid Chemical compound CC(=O)C1=C(F)C=CC(NC=C(C(O)=O)C(O)=O)=C1F DRWFKAPKNFAIDU-UHFFFAOYSA-N 0.000 description 2
- ARNYJGRNEYORLE-UHFFFAOYSA-N 2-benzyl-7-methyl-2,7-diazaspiro[4.4]nonane;dihydrochloride Chemical compound Cl.Cl.C1N(C)CCC11CN(CC=2C=CC=CC=2)CC1 ARNYJGRNEYORLE-UHFFFAOYSA-N 0.000 description 2
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 2
- OQHQOOLVQDEIGL-UHFFFAOYSA-N 2-methyl-2,7-diazaspiro[4.4]nonane Chemical group C1N(C)CCC11CNCC1 OQHQOOLVQDEIGL-UHFFFAOYSA-N 0.000 description 2
- QPHSKVXBAPEFFT-UHFFFAOYSA-N 2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione Chemical compound O=C1N(C)C(=O)CC11CC(=O)NC1 QPHSKVXBAPEFFT-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 2
- OMAISPXKCBPCDQ-UHFFFAOYSA-N 6,7,8-trifluoro-1-(1-methylcyclopropyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C(C(O)=O)C(=O)C2=CC(F)=C(F)C(F)=C2N1C1(C)CC1 OMAISPXKCBPCDQ-UHFFFAOYSA-N 0.000 description 2
- KRBQJNAQTNYREQ-UHFFFAOYSA-N 6,7,8-trifluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(CCF)C2=C1F KRBQJNAQTNYREQ-UHFFFAOYSA-N 0.000 description 2
- SUJKVJSPRDGSJX-UHFFFAOYSA-N 6,8-difluoro-4-oxo-1h-quinoline-3-carboxylic acid Chemical compound C1=C(F)C=C2C(=O)C(C(=O)O)=CNC2=C1F SUJKVJSPRDGSJX-UHFFFAOYSA-N 0.000 description 2
- KVZSDKRWVWERGT-UHFFFAOYSA-N 7-(2-aminopyrimidin-4-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CC=NC(N)=N1 KVZSDKRWVWERGT-UHFFFAOYSA-N 0.000 description 2
- KQDFNAVCJOVBJP-UHFFFAOYSA-N 7-(2-bromoacetyl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(C(=O)CBr)C(F)=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 KQDFNAVCJOVBJP-UHFFFAOYSA-N 0.000 description 2
- BQDVLIDLHOSQHC-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical class N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(N)C1 BQDVLIDLHOSQHC-UHFFFAOYSA-N 0.000 description 2
- UYJBMRZZJOAHGZ-UHFFFAOYSA-N 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CSC(CN)=N1 UYJBMRZZJOAHGZ-UHFFFAOYSA-N 0.000 description 2
- BIZWBTRMZYNGNF-UHFFFAOYSA-N 7-[2-(aminomethyl)pyrimidin-4-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CC=NC(CN)=N1 BIZWBTRMZYNGNF-UHFFFAOYSA-N 0.000 description 2
- JETYYTBACCSUFO-UHFFFAOYSA-N 7-[3-(aminomethyl)pyrrolidin-1-yl]-1-ethenyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CN)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=C)C2=C1F JETYYTBACCSUFO-UHFFFAOYSA-N 0.000 description 2
- KFBDAMQESLTGCT-UHFFFAOYSA-N 7-[3-(aminomethyl)pyrrolidin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(CN)C1 KFBDAMQESLTGCT-UHFFFAOYSA-N 0.000 description 2
- WHHWUSWZJOTGTC-UHFFFAOYSA-N 7-acetyl-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(C(C)=O)C(F)=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 WHHWUSWZJOTGTC-UHFFFAOYSA-N 0.000 description 2
- SKPDEKKDGGSLTL-UHFFFAOYSA-N 7-acetyl-6,8-difluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FCCN1C=C(C(O)=O)C(=O)C=2C1=C(F)C(C(=O)C)=C(F)C=2 SKPDEKKDGGSLTL-UHFFFAOYSA-N 0.000 description 2
- ISPVACVJFUIDPD-UHFFFAOYSA-N 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(Cl)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1 ISPVACVJFUIDPD-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical group C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001409 amidines Chemical class 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- BWCYATPNFPMMPS-UHFFFAOYSA-N azetidin-3-yl(tert-butyl)carbamic acid Chemical compound CC(C)(C)N(C(O)=O)C1CNC1 BWCYATPNFPMMPS-UHFFFAOYSA-N 0.000 description 2
- GFZWHAAOIVMHOI-UHFFFAOYSA-N azetidine-3-carboxylic acid Chemical compound OC(=O)C1CNC1 GFZWHAAOIVMHOI-UHFFFAOYSA-N 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- ZOJBILVANJHEDC-UHFFFAOYSA-N benzyl n-[(z)-1-aminoethylideneamino]carbamate;hydrochloride Chemical compound Cl.CC(N)=NNC(=O)OCC1=CC=CC=C1 ZOJBILVANJHEDC-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Chemical group 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- AKMFLNXSGUYKJX-UHFFFAOYSA-N ethyl 4-(6-chloro-3-nitropyridin-2-yl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(Cl)=CC=C1[N+]([O-])=O AKMFLNXSGUYKJX-UHFFFAOYSA-N 0.000 description 2
- HISNMGFYFJXXJW-UHFFFAOYSA-N ethyl 4-[6-(cyclopropylamino)-3-fluoropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(NC2CC2)=CC=C1F HISNMGFYFJXXJW-UHFFFAOYSA-N 0.000 description 2
- ONQDAESGZUODFI-UHFFFAOYSA-N ethyl 6,7,8-trifluoro-4-oxo-1h-quinoline-3-carboxylate Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)OCC)=CNC2=C1F ONQDAESGZUODFI-UHFFFAOYSA-N 0.000 description 2
- MXEUIOKSQAFQHK-UHFFFAOYSA-N ethyl 7-[4-(aminomethyl)-1,3-thiazol-2-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound FC=1C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=CC=1C1=NC(CN)=CS1 MXEUIOKSQAFQHK-UHFFFAOYSA-N 0.000 description 2
- KBCZBCXRVNMKOM-UHFFFAOYSA-N ethyl 7-acetyl-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylate Chemical compound CC(=O)C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1F KBCZBCXRVNMKOM-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 239000000295 fuel oil Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229960000789 guanidine hydrochloride Drugs 0.000 description 2
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 229910003480 inorganic solid Inorganic materials 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- WTRWSSDZHQOPJI-UHFFFAOYSA-N methyl 1-benzyl-5-oxopyrrolidine-3-carboxylate Chemical compound O=C1CC(C(=O)OC)CN1CC1=CC=CC=C1 WTRWSSDZHQOPJI-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- DBNQIOANXZVWIP-UHFFFAOYSA-N n,n-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine Chemical compound CC(C)(C)OC(N(C)C)OC(C)(C)C DBNQIOANXZVWIP-UHFFFAOYSA-N 0.000 description 2
- DDROADVTQNAKPF-UHFFFAOYSA-N n,n-dimethyl-1-pyrrolidin-3-ylmethanamine Chemical compound CN(C)CC1CCNC1 DDROADVTQNAKPF-UHFFFAOYSA-N 0.000 description 2
- ODXGUKYYNHKQBC-UHFFFAOYSA-N n-(pyrrolidin-3-ylmethyl)cyclopropanamine Chemical compound C1CNCC1CNC1CC1 ODXGUKYYNHKQBC-UHFFFAOYSA-N 0.000 description 2
- QEQZMENUJMGNGU-UHFFFAOYSA-N n-[(1-benzylpyrrolidin-3-yl)methyl]-n-ethylethanamine Chemical compound C1C(CN(CC)CC)CCN1CC1=CC=CC=C1 QEQZMENUJMGNGU-UHFFFAOYSA-N 0.000 description 2
- AMRNWWPARHIDHZ-UHFFFAOYSA-N n-[(1-benzylpyrrolidin-3-yl)methyl]ethanamine Chemical compound C1C(CNCC)CCN1CC1=CC=CC=C1 AMRNWWPARHIDHZ-UHFFFAOYSA-N 0.000 description 2
- FJYAGSRZOYKZCA-UHFFFAOYSA-N n-[(1-benzylpyrrolidin-3-yl)methyl]propan-1-amine Chemical compound C1C(CNCCC)CCN1CC1=CC=CC=C1 FJYAGSRZOYKZCA-UHFFFAOYSA-N 0.000 description 2
- OPCPWFHLFKAUEA-UHFFFAOYSA-N n-ethylpyrrolidin-3-amine Chemical compound CCNC1CCNC1 OPCPWFHLFKAUEA-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- ZCYXXKJEDCHMGH-UHFFFAOYSA-N nonane Chemical compound CCCC[CH]CCCC ZCYXXKJEDCHMGH-UHFFFAOYSA-N 0.000 description 2
- BKIMMITUMNQMOS-UHFFFAOYSA-N normal nonane Natural products CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 2
- 239000012053 oil suspension Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 125000006308 propyl amino group Chemical group 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- KFTZCNLLRKFMQH-UHFFFAOYSA-N pyrrolidin-3-ylcarbamic acid Chemical compound OC(=O)NC1CCNC1 KFTZCNLLRKFMQH-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- KEAYESYHFKHZAL-OUBTZVSYSA-N sodium-24 Chemical compound [24Na] KEAYESYHFKHZAL-OUBTZVSYSA-N 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- QMZBFSZZEGSSPH-UHFFFAOYSA-N tert-butyl n-(azetidin-2-ylmethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCC1CCN1 QMZBFSZZEGSSPH-UHFFFAOYSA-N 0.000 description 2
- DQQJBEAXSOOCPG-UHFFFAOYSA-N tert-butyl n-pyrrolidin-3-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1CCNC1 DQQJBEAXSOOCPG-UHFFFAOYSA-N 0.000 description 2
- 150000003556 thioamides Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- SEWUODUTOWYMCK-UHFFFAOYSA-N (1-cyclopropylpyrrolidin-3-yl)methanamine Chemical compound C1C(CN)CCN1C1CC1 SEWUODUTOWYMCK-UHFFFAOYSA-N 0.000 description 1
- AHQLLEIQWZZXGP-UHFFFAOYSA-N (2-methyl-1,3-dioxolan-2-yl)methanol Chemical compound OCC1(C)OCCO1 AHQLLEIQWZZXGP-UHFFFAOYSA-N 0.000 description 1
- JSSXHAMIXJGYCS-BYPYZUCNSA-N (S)-piperazine-2-carboxylic acid Chemical compound [O-]C(=O)[C@@H]1CNCC[NH2+]1 JSSXHAMIXJGYCS-BYPYZUCNSA-N 0.000 description 1
- APQIUTYORBAGEZ-UHFFFAOYSA-N 1,1-dibromoethane Chemical compound CC(Br)Br APQIUTYORBAGEZ-UHFFFAOYSA-N 0.000 description 1
- VOYADQIFGGIKAT-UHFFFAOYSA-N 1,3-dibutyl-4-hydroxy-2,6-dioxopyrimidine-5-carboximidamide Chemical compound CCCCn1c(O)c(C(N)=N)c(=O)n(CCCC)c1=O VOYADQIFGGIKAT-UHFFFAOYSA-N 0.000 description 1
- SNLMOXFUCILIPL-UHFFFAOYSA-N 1,8-naphthyridine-2-carboxylic acid Chemical compound C1=CC=NC2=NC(C(=O)O)=CC=C21 SNLMOXFUCILIPL-UHFFFAOYSA-N 0.000 description 1
- CGXLVFZJJOXEDF-UHFFFAOYSA-N 1,8-naphthyridine-3-carboxylic acid Chemical compound N1=CC=CC2=CC(C(=O)O)=CN=C21 CGXLVFZJJOXEDF-UHFFFAOYSA-N 0.000 description 1
- WYTBQTMYNBKLHE-UHFFFAOYSA-N 1-(5-amino-2-fluorophenyl)ethanone Chemical compound CC(=O)C1=CC(N)=CC=C1F WYTBQTMYNBKLHE-UHFFFAOYSA-N 0.000 description 1
- XDJDGGVOVQTSOL-UHFFFAOYSA-N 1-benzhydryl-n-ethylazetidine-3-carboxamide Chemical compound C1C(C(=O)NCC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 XDJDGGVOVQTSOL-UHFFFAOYSA-N 0.000 description 1
- IXMOEAHDRKNAAG-UHFFFAOYSA-N 1-benzhydrylazetidine-3-carbonitrile Chemical compound C1C(C#N)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 IXMOEAHDRKNAAG-UHFFFAOYSA-N 0.000 description 1
- ZIXOQDPKIPYCEF-UHFFFAOYSA-N 1-benzyl-4-[(2,2,2-trifluoroethylamino)methyl]pyrrolidin-2-one Chemical compound O=C1CC(CNCC(F)(F)F)CN1CC1=CC=CC=C1 ZIXOQDPKIPYCEF-UHFFFAOYSA-N 0.000 description 1
- KLWNBSRHTUVUQR-UHFFFAOYSA-N 1-benzyl-N,N-dimethyl-5-oxopyrrolidine-3-carboxamide N,N-dimethyl-1-pyrrolidin-3-ylmethanamine Chemical compound CN(C(=O)C1CN(C(C1)=O)CC1=CC=CC=C1)C.CN(CC1CNCC1)C KLWNBSRHTUVUQR-UHFFFAOYSA-N 0.000 description 1
- WANFRLYOGJMQLZ-UHFFFAOYSA-N 1-benzyl-N-ethyl-5-oxopyrrolidine-3-carboxamide N-(pyrrolidin-3-ylmethyl)ethanamine Chemical compound C(C)NC(=O)C1CN(C(C1)=O)CC1=CC=CC=C1.C(C)NCC1CNCC1 WANFRLYOGJMQLZ-UHFFFAOYSA-N 0.000 description 1
- DBILQXKHJKWNLN-UHFFFAOYSA-N 1-benzyl-n,n-dimethyl-5-oxopyrrolidine-3-carboxamide Chemical compound O=C1CC(C(=O)N(C)C)CN1CC1=CC=CC=C1 DBILQXKHJKWNLN-UHFFFAOYSA-N 0.000 description 1
- ZSIUSRJKSLXIJH-UHFFFAOYSA-N 1-benzyl-n-ethylpyrrolidin-3-amine Chemical compound C1C(NCC)CCN1CC1=CC=CC=C1 ZSIUSRJKSLXIJH-UHFFFAOYSA-N 0.000 description 1
- JBTBTXSCVPGWII-UHFFFAOYSA-N 1-cyclobutyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CCC1 JBTBTXSCVPGWII-UHFFFAOYSA-N 0.000 description 1
- VFHLGYSGLIALFL-UHFFFAOYSA-N 1-cyclobutyl-7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CCC3)C2=C1F VFHLGYSGLIALFL-UHFFFAOYSA-N 0.000 description 1
- YTFLEBJQRSWDNB-UHFFFAOYSA-N 1-cyclopentyl-7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CCCC3)C2=C1F YTFLEBJQRSWDNB-UHFFFAOYSA-N 0.000 description 1
- JZOGAALDCRGVFD-UHFFFAOYSA-N 1-cyclopropyl-6,8-difluoro-7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC(=O)OC(C)(C)C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1F JZOGAALDCRGVFD-UHFFFAOYSA-N 0.000 description 1
- OXNJPSZQVRRXPL-UHFFFAOYSA-N 1-ethenyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(C=C)C2=C1F OXNJPSZQVRRXPL-UHFFFAOYSA-N 0.000 description 1
- QZZDVLJCMSIKAS-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-4-oxo-7-[2-(phenylmethoxycarbonylaminomethyl)pyrimidin-4-yl]quinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C(N=1)=CC=NC=1CNC(=O)OCC1=CC=CC=C1 QZZDVLJCMSIKAS-UHFFFAOYSA-N 0.000 description 1
- OZVAPLKMUZWYCP-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-4-oxo-7-[3-[(propan-2-ylamino)methyl]pyrrolidin-1-yl]quinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(CNC(C)C)C1 OZVAPLKMUZWYCP-UHFFFAOYSA-N 0.000 description 1
- GCDRHQXDOFPHAI-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N(C1)CCC21CCN(C)C2 GCDRHQXDOFPHAI-UHFFFAOYSA-N 0.000 description 1
- UCYCTYDOGPVPRT-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-[2-(methylaminomethyl)-1,3-thiazol-4-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CSC(CNC)=N1 UCYCTYDOGPVPRT-UHFFFAOYSA-N 0.000 description 1
- UNYJFWJUNLPQBU-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-[2-(methylaminomethyl)-1,3-thiazol-4-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CSC(CNC)=N1 UNYJFWJUNLPQBU-UHFFFAOYSA-N 0.000 description 1
- XCNQAVKDYDUMRV-UHFFFAOYSA-N 1-ethyl-6-fluoro-7-[3-(methylaminomethyl)pyrrolidin-1-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(CNC)C1 XCNQAVKDYDUMRV-UHFFFAOYSA-N 0.000 description 1
- HDMOOPABPUTJOM-UHFFFAOYSA-N 1-ethyl-6-fluoro-8-hydroxy-7-[2-(methylaminomethyl)-1,3-thiazol-4-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound OC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CSC(CNC)=N1 HDMOOPABPUTJOM-UHFFFAOYSA-N 0.000 description 1
- ROFPZBOHTGWZDG-UHFFFAOYSA-N 1-ethyl-6-fluoro-8-methoxy-7-[2-(methylaminomethyl)-1,3-thiazol-4-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound COC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CSC(CNC)=N1 ROFPZBOHTGWZDG-UHFFFAOYSA-N 0.000 description 1
- BAYYCLWCHFVRLV-LLVKDONJSA-N 1-ethyl-7-[(3r)-3-(ethylaminomethyl)pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1[C@@H](CNCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F BAYYCLWCHFVRLV-LLVKDONJSA-N 0.000 description 1
- BAYYCLWCHFVRLV-NSHDSACASA-N 1-ethyl-7-[(3s)-3-(ethylaminomethyl)pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1[C@H](CNCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F BAYYCLWCHFVRLV-NSHDSACASA-N 0.000 description 1
- FRUCGCLEQPABDP-UHFFFAOYSA-N 1-ethyl-7-[2-(ethylaminomethyl)-1,3-thiazol-4-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound S1C(CNCC)=NC(C=2C(=C3C(C(C(C(O)=O)=CN3CC)=O)=CC=2F)F)=C1 FRUCGCLEQPABDP-UHFFFAOYSA-N 0.000 description 1
- VTTFAWYEXARGBZ-UHFFFAOYSA-N 1-ethyl-7-[3-(ethylamino)pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F VTTFAWYEXARGBZ-UHFFFAOYSA-N 0.000 description 1
- BAYYCLWCHFVRLV-UHFFFAOYSA-N 1-ethyl-7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F BAYYCLWCHFVRLV-UHFFFAOYSA-N 0.000 description 1
- FLUKWNOQCRPLGK-UHFFFAOYSA-N 1-ethyl-7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C(C(=C1)F)=NC2=C1C(=O)C(C(O)=O)=CN2CC FLUKWNOQCRPLGK-UHFFFAOYSA-N 0.000 description 1
- VDLUURWHKGLOHH-UHFFFAOYSA-N 1-ethyl-7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C(C(=C1)F)=CC2=C1C(=O)C(C(O)=O)=CN2CC VDLUURWHKGLOHH-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- FCSQLCVDYRKHPR-UHFFFAOYSA-N 10-[2-(aminomethyl)-4-thiazolyl]-9-fluoro-2,3-dihydro-3-methyl-7-oxo-7h-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=C2)=O)=C3N2C(C)COC3=C1C1=CSC(CN)=N1 FCSQLCVDYRKHPR-UHFFFAOYSA-N 0.000 description 1
- KIPSRYDSZQRPEA-UHFFFAOYSA-N 2,2,2-trifluoroethanamine Chemical compound NCC(F)(F)F KIPSRYDSZQRPEA-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- RIZUCYSQUWMQLX-UHFFFAOYSA-N 2,3-dimethylbenzoic acid Chemical compound CC1=CC=CC(C(O)=O)=C1C RIZUCYSQUWMQLX-UHFFFAOYSA-N 0.000 description 1
- BNBRIFIJRKJGEI-UHFFFAOYSA-N 2,6-difluorobenzonitrile Chemical compound FC1=CC=CC(F)=C1C#N BNBRIFIJRKJGEI-UHFFFAOYSA-N 0.000 description 1
- KJCCLEFCCVOPFE-UHFFFAOYSA-N 2,8-diazaspiro[5.5]undecane;dihydrochloride Chemical compound Cl.Cl.C1CCNCC21CNCCC2 KJCCLEFCCVOPFE-UHFFFAOYSA-N 0.000 description 1
- KSVBKXHCGJFMES-UHFFFAOYSA-N 2-(3-acetyl-2,4-difluoroanilino)-1,3-dioxane-4,6-dione Chemical compound CC(=O)C1=C(F)C=CC(NC2OC(=O)CC(=O)O2)=C1F KSVBKXHCGJFMES-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- OBTZDIRUQWFRFZ-UHFFFAOYSA-N 2-(5-methylfuran-2-yl)-n-(4-methylphenyl)quinoline-4-carboxamide Chemical compound O1C(C)=CC=C1C1=CC(C(=O)NC=2C=CC(C)=CC=2)=C(C=CC=C2)C2=N1 OBTZDIRUQWFRFZ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- RSYLQCKFGPZJEZ-UHFFFAOYSA-N 2-[acetyl-(2-amino-2-sulfanylideneethyl)amino]ethyl acetate Chemical compound CC(=O)OCCN(C(C)=O)CC(N)=S RSYLQCKFGPZJEZ-UHFFFAOYSA-N 0.000 description 1
- HFCQQLLYVUSCRE-UHFFFAOYSA-N 2-aminoethanethioamide Chemical compound NCC(N)=S HFCQQLLYVUSCRE-UHFFFAOYSA-N 0.000 description 1
- VVPKORLFIKZPMK-UHFFFAOYSA-N 2-benzyl-7-ethyl-2,7-diazaspiro[4.4]nonane;dihydrochloride Chemical compound Cl.Cl.C1N(CC)CCC11CN(CC=2C=CC=CC=2)CC1 VVPKORLFIKZPMK-UHFFFAOYSA-N 0.000 description 1
- FVEVSWYCVCEOMY-UHFFFAOYSA-N 2-benzyl-n-(2-hydroxyethyl)-5-oxopyrrolidine-3-carboxamide Chemical compound OCCNC(=O)C1CC(=O)NC1CC1=CC=CC=C1 FVEVSWYCVCEOMY-UHFFFAOYSA-N 0.000 description 1
- CIMLWLBBMAKGIU-UHFFFAOYSA-N 2-ethyl-2,7-diazaspiro[4.4]nonane Chemical compound C1N(CC)CCC11CNCC1 CIMLWLBBMAKGIU-UHFFFAOYSA-N 0.000 description 1
- PYTANBUURZFYHD-UHFFFAOYSA-N 2-methylcyclopropan-1-amine Chemical compound CC1CC1N PYTANBUURZFYHD-UHFFFAOYSA-N 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- HRXYPWIYNHBKJK-UHFFFAOYSA-N 3-(carboxymethyl)-5-oxopyrrolidine-3-carboxylic acid Chemical compound OC(=O)CC1(C(O)=O)CNC(=O)C1 HRXYPWIYNHBKJK-UHFFFAOYSA-N 0.000 description 1
- LVRRWUPWBBHWFO-UHFFFAOYSA-N 4-[6-[acetyl(cyclopropyl)amino]-3-fluoropyridin-2-yl]piperazine-1-carboxylic acid Chemical compound C=1C=C(F)C(N2CCN(CC2)C(O)=O)=NC=1N(C(=O)C)C1CC1 LVRRWUPWBBHWFO-UHFFFAOYSA-N 0.000 description 1
- UCTMLGSAALHUTB-UHFFFAOYSA-N 4-[6-[acetyl(cyclopropyl)amino]-3-nitropyridin-2-yl]piperazine-1-carboxylic acid Chemical compound C=1C=C([N+]([O-])=O)C(N2CCN(CC2)C(O)=O)=NC=1N(C(=O)C)C1CC1 UCTMLGSAALHUTB-UHFFFAOYSA-N 0.000 description 1
- ZZTCMDYPJIUKHU-UHFFFAOYSA-N 4-fluoro-3-(2-methyl-1,3-dithian-2-yl)aniline Chemical compound C=1C(N)=CC=C(F)C=1C1(C)SCCCS1 ZZTCMDYPJIUKHU-UHFFFAOYSA-N 0.000 description 1
- YCAZALSUJDPQPP-UHFFFAOYSA-N 4-oxo-3h-quinoline-3-carboxylic acid Chemical compound C1=CC=C2C(=O)C(C(=O)O)C=NC2=C1 YCAZALSUJDPQPP-UHFFFAOYSA-N 0.000 description 1
- DVLSQHLXPRYYRC-UHFFFAOYSA-N 5-(methoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione Chemical compound COC=C1C(=O)OC(C)(C)OC1=O DVLSQHLXPRYYRC-UHFFFAOYSA-N 0.000 description 1
- UWPIHPWWKBJENR-UHFFFAOYSA-N 6,7,8-trifluoro-4-oxo-1-propylquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(CCC)C=C(C(O)=O)C(=O)C2=C1 UWPIHPWWKBJENR-UHFFFAOYSA-N 0.000 description 1
- SWLHSVRCVQLMBJ-UHFFFAOYSA-N 6,7-dichloro-1-cyclopropyl-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(Cl)=C(Cl)C=C2C(=O)C(C(=O)O)=CN1C1CC1 SWLHSVRCVQLMBJ-UHFFFAOYSA-N 0.000 description 1
- FSWUQFPNZWPHFJ-UHFFFAOYSA-N 6-acetyl-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid Chemical compound O1CC(C)N2C=C(C(O)=O)C(=O)C3=C2C1=C(C(C)=O)C(F)=C3 FSWUQFPNZWPHFJ-UHFFFAOYSA-N 0.000 description 1
- GUWQUGPRVLSIEE-UHFFFAOYSA-N 6-chloro-1-cyclopropyl-7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C(C(=C1)Cl)=CC2=C1C(=O)C(C(O)=O)=CN2C1CC1 GUWQUGPRVLSIEE-UHFFFAOYSA-N 0.000 description 1
- VLYKBZNVQLULKB-UHFFFAOYSA-N 6-fluoro-4-oxo-7-piperazin-1-yl-1h-1,8-naphthyridine-3-carboxylic acid Chemical compound FC=1C=C2C(=O)C(C(=O)O)=CNC2=NC=1N1CCNCC1 VLYKBZNVQLULKB-UHFFFAOYSA-N 0.000 description 1
- NCVJSCUMMZSMMH-UHFFFAOYSA-N 7-(1,3,3a,4,5,6,7,7a-octahydropyrrolo[3,4-c]pyridin-2-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound C1C2CCNCC2CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=N1 NCVJSCUMMZSMMH-UHFFFAOYSA-N 0.000 description 1
- WPTPIEOFHDEISK-UHFFFAOYSA-N 7-(2,3,3a,4,6,6a-hexahydro-1h-pyrrolo[3,4-c]pyrrol-5-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CC2CNCC2C1 WPTPIEOFHDEISK-UHFFFAOYSA-N 0.000 description 1
- YEDDGWDYQAPQOT-UHFFFAOYSA-N 7-(2-aminopyrimidin-4-yl)-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CC=NC(N)=N1 YEDDGWDYQAPQOT-UHFFFAOYSA-N 0.000 description 1
- REXWYLGHPWIAPX-UHFFFAOYSA-N 7-(2-bromoacetyl)-1,2-diethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(C(=O)CBr)C=C2N(CC)C(CC)=C(C(O)=O)C(=O)C2=C1 REXWYLGHPWIAPX-UHFFFAOYSA-N 0.000 description 1
- MOSUGPZHRCUMJE-UHFFFAOYSA-N 7-(3-aminoazetidin-1-yl)-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CC(N)C1 MOSUGPZHRCUMJE-UHFFFAOYSA-N 0.000 description 1
- VUMRNUPUQAZDBX-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N)CCN1C(C(=C1)F)=CC2=C1C(=O)C(C(O)=O)=CN2C1CC1 VUMRNUPUQAZDBX-UHFFFAOYSA-N 0.000 description 1
- BUUZHYXJGKWUNM-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-6,8-difluoro-1-(2-methylcyclopropyl)-4-oxoquinoline-3-carboxylic acid Chemical compound CC1CC1N1C2=C(F)C(N3CC(N)CC3)=C(F)C=C2C(=O)C(C(O)=O)=C1 BUUZHYXJGKWUNM-UHFFFAOYSA-N 0.000 description 1
- QHAOIJJWKQXAMT-UHFFFAOYSA-N 7-(4-chloro-5-methyl-1,3-thiazol-2-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=NC(Cl)=C(C)S1 QHAOIJJWKQXAMT-UHFFFAOYSA-N 0.000 description 1
- YHQYJAXLQDWMLO-UHFFFAOYSA-N 7-[2-(1-aminoethyl)-1,3-thiazol-4-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CSC(C(C)N)=N1 YHQYJAXLQDWMLO-UHFFFAOYSA-N 0.000 description 1
- ITMKVCYQLCHFIL-UHFFFAOYSA-N 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-ethyl-6-fluoro-8-(methylamino)-4-oxoquinoline-3-carboxylic acid Chemical compound CNC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CSC(CN)=N1 ITMKVCYQLCHFIL-UHFFFAOYSA-N 0.000 description 1
- IOPUFWXWWGUEDL-UHFFFAOYSA-N 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-ethyl-6-fluoro-8-hydroxy-4-oxoquinoline-3-carboxylic acid Chemical compound OC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CSC(CN)=N1 IOPUFWXWWGUEDL-UHFFFAOYSA-N 0.000 description 1
- NFMQYOWYOGZWRP-UHFFFAOYSA-N 7-[2-(aminomethyl)-1,3-thiazol-4-yl]-1-ethyl-6-fluoro-8-methoxy-4-oxoquinoline-3-carboxylic acid Chemical compound COC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CSC(CN)=N1 NFMQYOWYOGZWRP-UHFFFAOYSA-N 0.000 description 1
- SBQRNBNGOGRRHE-UHFFFAOYSA-N 7-[2-(aminomethyl)azetidin-1-yl]-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC1CN SBQRNBNGOGRRHE-UHFFFAOYSA-N 0.000 description 1
- GGXUISLOCNSVQI-UHFFFAOYSA-N 7-[2-(aminomethyl)pyrimidin-4-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=CC=NC(CN)=N1 GGXUISLOCNSVQI-UHFFFAOYSA-N 0.000 description 1
- AZURXMGITRDFMD-UHFFFAOYSA-N 7-[3-(aminomethyl)pyrrolidin-1-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CN)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1F AZURXMGITRDFMD-UHFFFAOYSA-N 0.000 description 1
- LHOBGVLPYWZLNJ-UHFFFAOYSA-N 7-[3-(aminomethyl)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CN)CCN1C(C(=C1)F)=CC2=C1C(=O)C(C(O)=O)=CN2C1CC1 LHOBGVLPYWZLNJ-UHFFFAOYSA-N 0.000 description 1
- BAWJTQWTEJOBTP-UHFFFAOYSA-N 7-[3-(aminomethyl)pyrrolidin-1-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(CN)C1 BAWJTQWTEJOBTP-UHFFFAOYSA-N 0.000 description 1
- UDRVIUPLBFPNPO-UHFFFAOYSA-N 7-[3-(aminomethyl)pyrrolidin-1-yl]-6,8-difluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CN)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CCF)C2=C1F UDRVIUPLBFPNPO-UHFFFAOYSA-N 0.000 description 1
- GNVRJCVBCILUBF-UHFFFAOYSA-N 7-[3-(diethylaminomethyl)pyrrolidin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CN(CC)CC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F GNVRJCVBCILUBF-UHFFFAOYSA-N 0.000 description 1
- IPQMSQPETCRJAK-UHFFFAOYSA-N 7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-6,8-difluoro-1-(1-methylcyclopropyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3(C)CC3)C2=C1F IPQMSQPETCRJAK-UHFFFAOYSA-N 0.000 description 1
- KFWYAAXUXJDYKD-UHFFFAOYSA-N 7-[3-[(cyclopropylamino)methyl]pyrrolidin-1-yl]-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N(C1)CCC1CNC1CC1 KFWYAAXUXJDYKD-UHFFFAOYSA-N 0.000 description 1
- XGQWUZSMEPGJPG-UHFFFAOYSA-N 7-[4-(aminomethyl)-1,3-thiazol-2-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=NC(CN)=CS1 XGQWUZSMEPGJPG-UHFFFAOYSA-N 0.000 description 1
- LWJQCGJFFGOFHD-UHFFFAOYSA-N 7-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1C1=NC(CCl)=CS1 LWJQCGJFFGOFHD-UHFFFAOYSA-N 0.000 description 1
- BUTAOLSBUJKPHF-UHFFFAOYSA-N 7-benzyl-2-ethyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione Chemical compound O=C1N(CC)C(=O)CC11CC(=O)N(CC=2C=CC=CC=2)C1 BUTAOLSBUJKPHF-UHFFFAOYSA-N 0.000 description 1
- BJXWKDYLCKBAMS-UHFFFAOYSA-N 7-benzyl-2-methyl-2,7-diazaspiro[4.4]nonane-1,3,8-trione Chemical compound O=C1N(C)C(=O)CC11CC(=O)N(CC=2C=CC=CC=2)C1 BJXWKDYLCKBAMS-UHFFFAOYSA-N 0.000 description 1
- WNNSMMJBBOPPOT-UHFFFAOYSA-N 7-chloro-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(Cl)C=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 WNNSMMJBBOPPOT-UHFFFAOYSA-N 0.000 description 1
- VTTPHBIBXCPVID-UHFFFAOYSA-N 7-pyridin-2-ylquinoline Chemical class N1=CC=CC=C1C1=CC=C(C=CC=N2)C2=C1 VTTPHBIBXCPVID-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NVKWWNNJFKZNJO-UHFFFAOYSA-N 82419-35-0 Chemical compound O1CC(C)N2C=C(C(O)=O)C(=O)C3=C2C1=C(F)C(F)=C3 NVKWWNNJFKZNJO-UHFFFAOYSA-N 0.000 description 1
- DHQPKBZHHIDWLS-UHFFFAOYSA-N 9-fluoro-2,3-dihydro-3-methyl-10-(7-methyl-2,7-diazaspiro[4.4]non-2-yl)-7-oxo-7h-pyrido[1,2,3-de]1,4-benzoxazine-6-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=C2)=O)=C3N2C(C)COC3=C1N(C1)CCC21CCN(C)C2 DHQPKBZHHIDWLS-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical group N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 101000913968 Ipomoea purpurea Chalcone synthase C Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- CRYIRCLLUHFZLF-XCUBXKJBSA-N N-[[(3R)-pyrrolidin-3-yl]methyl]ethanamine dihydrochloride Chemical compound Cl.Cl.CCNC[C@H]1CCNC1 CRYIRCLLUHFZLF-XCUBXKJBSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 101000907988 Petunia hybrida Chalcone-flavanone isomerase C Proteins 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- SJSWRKNSCWKNIR-UHFFFAOYSA-N azane;dihydrochloride Chemical compound N.Cl.Cl SJSWRKNSCWKNIR-UHFFFAOYSA-N 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 150000005130 benzoxazines Chemical class 0.000 description 1
- YJJVLPYACCEKOI-UHFFFAOYSA-N benzyl 2-[(2z)-2-(1-aminoethylidene)hydrazinyl]acetate;hydrochloride Chemical compound Cl.CC(N)=NNCC(=O)OCC1=CC=CC=C1 YJJVLPYACCEKOI-UHFFFAOYSA-N 0.000 description 1
- 238000005574 benzylation reaction Methods 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000006317 cyclopropyl amino group Chemical group 0.000 description 1
- IGSKHXTUVXSOMB-UHFFFAOYSA-N cyclopropylmethanamine Chemical compound NCC1CC1 IGSKHXTUVXSOMB-UHFFFAOYSA-N 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- YDVNLQGCLLPHAH-UHFFFAOYSA-N dichloromethane;hydrate Chemical compound O.ClCCl YDVNLQGCLLPHAH-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- LVLFHLBQYMBRDC-UHFFFAOYSA-N diethyl 2-[[cyclopropyl-[6-(4-ethoxycarbonylpiperazin-1-yl)-5-fluoropyridin-2-yl]amino]methylidene]propanedioate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(N(C=C(C(=O)OCC)C(=O)OCC)C2CC2)=CC=C1F LVLFHLBQYMBRDC-UHFFFAOYSA-N 0.000 description 1
- BQHDXNZNSPVVKB-UHFFFAOYSA-N diethyl 2-methylidenepropanedioate Chemical compound CCOC(=O)C(=C)C(=O)OCC BQHDXNZNSPVVKB-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- XWBDWHCCBGMXKG-UHFFFAOYSA-N ethanamine;hydron;chloride Chemical compound Cl.CCN XWBDWHCCBGMXKG-UHFFFAOYSA-N 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229940052303 ethers for general anesthesia Drugs 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- KWDVJYLIAJHEOW-UHFFFAOYSA-N ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate Chemical compound CCOC(=O)CC(=O)C1=CC(F)=C(F)C(F)=C1F KWDVJYLIAJHEOW-UHFFFAOYSA-N 0.000 description 1
- YYHMZHRWVGIDPJ-UHFFFAOYSA-N ethyl 4-[6-(cyclopropylamino)-3-nitropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(NC2CC2)=CC=C1[N+]([O-])=O YYHMZHRWVGIDPJ-UHFFFAOYSA-N 0.000 description 1
- FMUAAGABYQFTGO-UHFFFAOYSA-N ethyl 4-[6-[acetyl(cyclopropyl)amino]-3-aminopyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(N(C2CC2)C(C)=O)=CC=C1N FMUAAGABYQFTGO-UHFFFAOYSA-N 0.000 description 1
- OQLZLQOQVVLZGK-UHFFFAOYSA-N ethyl 4-[6-[acetyl(cyclopropyl)amino]-3-fluoropyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=NC(N(C2CC2)C(C)=O)=CC=C1F OQLZLQOQVVLZGK-UHFFFAOYSA-N 0.000 description 1
- SXABVNNALUVGGI-UHFFFAOYSA-N ethyl 6-fluoro-7-(2-methyl-1,3-dithian-2-yl)-4-oxo-1h-quinoline-3-carboxylate Chemical compound FC=1C=C2C(=O)C(C(=O)OCC)=CNC2=CC=1C1(C)SCCCS1 SXABVNNALUVGGI-UHFFFAOYSA-N 0.000 description 1
- NHFCSKYBLWPCEF-UHFFFAOYSA-N ethyl 7-(4-chloro-5-methyl-1,3-thiazol-2-yl)-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound C(C)OC(=O)C1=CN(C2=CC(=C(C=C2C1=O)F)C=1SC(=C(N=1)Cl)C)CC NHFCSKYBLWPCEF-UHFFFAOYSA-N 0.000 description 1
- DLRKUKFBQOZMJV-UHFFFAOYSA-N ethyl 7-[2-(acetamidomethyl)-1,3-thiazol-4-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound FC=1C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=CC=1C1=CSC(CNC(C)=O)=N1 DLRKUKFBQOZMJV-UHFFFAOYSA-N 0.000 description 1
- NBKXDFNBDPCUBK-UHFFFAOYSA-N ethyl 7-[4-(azidomethyl)-1,3-thiazol-2-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound FC=1C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=CC=1C1=NC(CN=[N+]=[N-])=CS1 NBKXDFNBDPCUBK-UHFFFAOYSA-N 0.000 description 1
- QIBBUPLIXPNTCV-UHFFFAOYSA-N ethyl 7-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound FC=1C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=CC=1C1=NC(CCl)=CS1 QIBBUPLIXPNTCV-UHFFFAOYSA-N 0.000 description 1
- YZKOXQVKHYSDNI-UHFFFAOYSA-N ethyl 7-acetyl-6,8-difluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylate Chemical compound CC(=O)C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CCF)C2=C1F YZKOXQVKHYSDNI-UHFFFAOYSA-N 0.000 description 1
- QLNBLZQKVLCQSO-UHFFFAOYSA-N ethyl 7-amino-1-ethyl-6-fluoro-4h-quinoline-3-carboxylate Chemical compound NC1=C(F)C=C2CC(C(=O)OCC)=CN(CC)C2=C1 QLNBLZQKVLCQSO-UHFFFAOYSA-N 0.000 description 1
- JQWHWPOPTBYMDT-UHFFFAOYSA-N ethyl 7-carbamothioyl-1-ethyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound NC(=S)C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(CC)C2=C1 JQWHWPOPTBYMDT-UHFFFAOYSA-N 0.000 description 1
- QVDYYQXUNAQSNI-UHFFFAOYSA-N ethyl acetate;pentane Chemical compound CCCCC.CCOC(C)=O QVDYYQXUNAQSNI-UHFFFAOYSA-N 0.000 description 1
- HMPKHDPBYZSACF-UHFFFAOYSA-N ethyl n-(pyrrolidin-3-ylmethyl)carbamate Chemical compound CCOC(=O)NCC1CCNC1 HMPKHDPBYZSACF-UHFFFAOYSA-N 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- ZTUJDPKOHPKRMO-UHFFFAOYSA-N hydron;2,2,2-trifluoroethanamine;chloride Chemical compound Cl.NCC(F)(F)F ZTUJDPKOHPKRMO-UHFFFAOYSA-N 0.000 description 1
- 239000012052 hydrophilic carrier Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229960002523 mercuric chloride Drugs 0.000 description 1
- 229940101209 mercuric oxide Drugs 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical class [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- AGJSNMGHAVDLRQ-IWFBPKFRSA-N methyl (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-amino-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,3-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound SC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)OC)CC1=CC=C(O)C(C)=C1C AGJSNMGHAVDLRQ-IWFBPKFRSA-N 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 238000005497 microtitration Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- HXRAMSFGUAOAJR-UHFFFAOYSA-N n,n,n',n'-tetramethyl-1-[(2-methylpropan-2-yl)oxy]methanediamine Chemical compound CN(C)C(N(C)C)OC(C)(C)C HXRAMSFGUAOAJR-UHFFFAOYSA-N 0.000 description 1
- QVIOERRWGWONDE-UHFFFAOYSA-N n-(1-amino-1-sulfanylidenepropan-2-yl)acetamide Chemical compound NC(=S)C(C)NC(C)=O QVIOERRWGWONDE-UHFFFAOYSA-N 0.000 description 1
- KDLOHZMKNXLBOV-UHFFFAOYSA-N n-(2-amino-2-sulfanylideneethyl)-n-ethylacetamide Chemical compound CCN(C(C)=O)CC(N)=S KDLOHZMKNXLBOV-UHFFFAOYSA-N 0.000 description 1
- UOJLBQJCZUNGDS-UHFFFAOYSA-N n-(2-amino-2-sulfanylideneethyl)-n-methylacetamide Chemical compound CC(=O)N(C)CC(N)=S UOJLBQJCZUNGDS-UHFFFAOYSA-N 0.000 description 1
- BOSZVWXMCNBHPJ-UHFFFAOYSA-N n-(2-amino-2-sulfanylideneethyl)acetamide Chemical compound CC(=O)NCC(S)=N BOSZVWXMCNBHPJ-UHFFFAOYSA-N 0.000 description 1
- GNYXTBROIXBEMG-UHFFFAOYSA-N n-[(1-benzhydrylazetidin-3-yl)methyl]ethanamine Chemical compound C1C(CNCC)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 GNYXTBROIXBEMG-UHFFFAOYSA-N 0.000 description 1
- BMFDRCPVKBNLAA-UHFFFAOYSA-N n-[(1-benzylpyrrolidin-3-yl)methyl]cyclopropanamine Chemical compound C1CN(CC=2C=CC=CC=2)CC1CNC1CC1 BMFDRCPVKBNLAA-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- CRYIRCLLUHFZLF-KLXURFKVSA-N n-[[(3s)-pyrrolidin-3-yl]methyl]ethanamine;dihydrochloride Chemical compound Cl.Cl.CCNC[C@@H]1CCNC1 CRYIRCLLUHFZLF-KLXURFKVSA-N 0.000 description 1
- WSVFANOWQHGVOH-UHFFFAOYSA-N n-benzyl-1,2,5-trimethylpiperidin-4-amine Chemical compound CC1CN(C)C(C)CC1NCC1=CC=CC=C1 WSVFANOWQHGVOH-UHFFFAOYSA-N 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000006201 parenteral dosage form Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- IPOVLZSJBYKHHU-UHFFFAOYSA-N piperidin-3-ylmethanamine Chemical compound NCC1CCCNC1 IPOVLZSJBYKHHU-UHFFFAOYSA-N 0.000 description 1
- LTEKQAPRXFBRNN-UHFFFAOYSA-N piperidin-4-ylmethanamine Chemical compound NCC1CCNCC1 LTEKQAPRXFBRNN-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- ALDITMKAAPLVJK-UHFFFAOYSA-N prop-1-ene;hydrate Chemical group O.CC=C ALDITMKAAPLVJK-UHFFFAOYSA-N 0.000 description 1
- ZJLMKPKYJBQJNH-UHFFFAOYSA-N propane-1,3-dithiol Chemical compound SCCCS ZJLMKPKYJBQJNH-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N propylene glycol Substances CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- VMPYTOIPVPQDNX-UHFFFAOYSA-N pyrrolidin-1-ylmethanamine Chemical compound NCN1CCCC1 VMPYTOIPVPQDNX-UHFFFAOYSA-N 0.000 description 1
- LCDCPQHFCOBUEF-UHFFFAOYSA-N pyrrolidine-1-carboxamide Chemical compound NC(=O)N1CCCC1 LCDCPQHFCOBUEF-UHFFFAOYSA-N 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical compound C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical class C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- HUFJBECCXBEKAE-UHFFFAOYSA-N tert-butyl n-[(1-benzylazetidin-2-yl)methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1CCN1CC1=CC=CC=C1 HUFJBECCXBEKAE-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000006208 topical dosage form Substances 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- RNDDKMRAODNQIM-UHFFFAOYSA-N undecane;dihydrochloride Chemical compound Cl.Cl.CCCCCCCCCCC RNDDKMRAODNQIM-UHFFFAOYSA-N 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
- C07D207/09—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/14—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/34—1,4-Oxazines; Hydrogenated 1,4-oxazines condensed with carbocyclic rings
- C07D265/36—1,4-Oxazines; Hydrogenated 1,4-oxazines condensed with carbocyclic rings condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/10—Spiro-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US58115784A | 1984-02-17 | 1984-02-17 | |
| US581,157 | 1984-02-17 | ||
| US692,820 | 1985-01-23 | ||
| US06/692,820 US4665079A (en) | 1984-02-17 | 1985-01-23 | Antibacterial agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1289956C true CA1289956C (en) | 1991-10-01 |
Family
ID=27078238
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000473502A Expired - Lifetime CA1289956C (en) | 1984-02-17 | 1985-02-04 | Naphthyridine- and quinolonecarboxylic acids as antibacterial agents |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4665079A (index.php) |
| EP (1) | EP0153163B1 (index.php) |
| JP (2) | JPH0755945B2 (index.php) |
| KR (1) | KR900004995B1 (index.php) |
| AU (1) | AU568004B2 (index.php) |
| CA (1) | CA1289956C (index.php) |
| DE (1) | DE3574972D1 (index.php) |
| DK (1) | DK161889C (index.php) |
| ES (1) | ES8705422A1 (index.php) |
| FI (1) | FI83312C (index.php) |
| GR (1) | GR850396B (index.php) |
| HU (1) | HUT37149A (index.php) |
| IE (1) | IE58098B1 (index.php) |
| NO (1) | NO161370C (index.php) |
| NZ (1) | NZ211137A (index.php) |
| OA (1) | OA08300A (index.php) |
| PH (1) | PH20942A (index.php) |
| PT (1) | PT79971B (index.php) |
| ZA (1) | ZA85854B (index.php) |
Families Citing this family (105)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3574380D1 (en) * | 1984-02-17 | 1989-12-28 | Daiichi Seiyaku Co | 1,8-naphthyridine derivatives |
| DE3426483A1 (de) * | 1984-07-18 | 1986-01-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von halogenierten chinoloncarbonsaeuren |
| US5097032A (en) * | 1984-07-20 | 1992-03-17 | Warner-Lambert Company | Antibacterial agents - II |
| IE58742B1 (en) * | 1984-07-20 | 1993-11-05 | Warner Lambert Co | Substituted-9-fluoro-3-methyl-7-oxo-2,3-dihydro-7h-pyrido[1,2,3-de] [1,4]benzoxauine-6-carboxylic acids; sibstituted-5-amino-6-6fluoro-4-oxo.1,4-dihydroquinoline-3 carboxylic acids; substituted-5-amino-6-fluoro-1,4-dihydro-4-oxo-1.8-naphthyridine-3-carboxylic acids; derivatives thereof; pharmaceutical compositions comprising the compounds; and processes for producing the compounds |
| US4822801A (en) * | 1984-07-20 | 1989-04-18 | Warner-Lambert Company | 4-oxo-1,4-dihydroquinoline-3-carboxylic acid derivative as antibacterial agents |
| IN162769B (index.php) * | 1984-11-13 | 1988-07-09 | Kyorin Seiyaku Kk | |
| AU576272B2 (en) * | 1984-11-13 | 1988-08-18 | Kyorin Pharmaceutical Co. Ltd. | Quinolone carboxylic acid derivates |
| JPH0670032B2 (ja) * | 1984-11-22 | 1994-09-07 | 大日本製薬株式会社 | アミノピロリジン誘導体、そのエステルおよびその塩 |
| DE3508816A1 (de) * | 1985-01-10 | 1986-07-10 | Bayer Ag, 5090 Leverkusen | 6,7-disubstituierte 1-cyclopropyl-1,4-dihydro-4-oxo-1,8-naphtyridin-3-carbonsaeuren |
| AU576657B2 (en) * | 1985-01-23 | 1988-09-01 | Toyama Chemical Co. Ltd. | Naphthyridine and pyridine derivatives |
| AU577473B2 (en) * | 1985-01-30 | 1988-09-22 | Kyorin Pharmaceutical Co. Ltd. | Quinolonecarboxylic acid derivative |
| AU578793B2 (en) * | 1985-02-15 | 1988-11-03 | Dainippon Pharmaceutical Co. Ltd. | Novel 1,8-naphthyridine derivatives and processes for preparation thereof |
| AU5427286A (en) * | 1985-03-08 | 1986-09-11 | Kyorin Pharmaceutical Co. Ltd. | 7-(1-pyrrolidinyl)-3-quinolinecarboxylic acid derivatives |
| DE3509546A1 (de) * | 1985-03-16 | 1986-09-25 | Bayer Ag, 5090 Leverkusen | 7-amino-1-(subst.cyclopropyl)-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| ATE75740T1 (de) * | 1985-06-26 | 1992-05-15 | Daiichi Seiyaku Co | Pyridoncarbonsaeurederivate. |
| JPH0635457B2 (ja) * | 1985-06-28 | 1994-05-11 | 杏林製薬株式会社 | ピリドンカルボン酸誘導体およびその製造方法 |
| JPS6236377A (ja) * | 1985-07-03 | 1987-02-17 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| JPS6259263A (ja) * | 1985-09-10 | 1987-03-14 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| IN166416B (index.php) * | 1985-09-18 | 1990-05-05 | Pfizer | |
| JPH0637489B2 (ja) * | 1985-09-21 | 1994-05-18 | 杏林製薬株式会社 | キノロンカルボン酸誘導体およびその製造方法 |
| JPH0615526B2 (ja) * | 1985-09-27 | 1994-03-02 | 大日本製薬株式会社 | 3―アミノメチルピロリジン誘導体およびその塩 |
| JPS62108878A (ja) * | 1985-11-05 | 1987-05-20 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体およびその製造方法 |
| DE3543513A1 (de) * | 1985-12-10 | 1987-06-11 | Bayer Ag | Enantiomerenreine 1,8-verbrueckte 4-chinolon-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende arzneimittel und ihre verwendung zur herstellung von arzneimitteln |
| JPH0633256B2 (ja) * | 1985-12-20 | 1994-05-02 | 大塚製薬株式会社 | キノリンカルボン酸誘導体 |
| JPS62228063A (ja) * | 1985-12-27 | 1987-10-06 | Sankyo Co Ltd | キノリンカルボン酸誘導体 |
| JPH089597B2 (ja) * | 1986-01-21 | 1996-01-31 | 杏林製薬株式会社 | 選択毒性に優れた8‐アルコキシキノロンカルボン酸およびその塩並びにその製造方法 |
| JP2598737B2 (ja) * | 1986-01-21 | 1997-04-09 | 杏林製薬 株式会社 | 選択毒性に優れた8−アルコキシキノロンカルボン酸およびその塩並びにその製造方法 |
| US4692454A (en) * | 1986-02-03 | 1987-09-08 | Warner-Lambert Company | Opthalmic use of quinolone antibiotics |
| US4840956A (en) * | 1986-02-18 | 1989-06-20 | Warner-Lambert Company | Novel disubstituted-7-pyrrolidinoquinoline antibacterial agents |
| DE3705621C2 (de) * | 1986-02-25 | 1997-01-09 | Otsuka Pharma Co Ltd | Heterocyclisch substituierte Chinoloncarbonsäurederivate |
| JPS62215572A (ja) * | 1986-03-17 | 1987-09-22 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| JPS63198664A (ja) * | 1986-03-31 | 1988-08-17 | Sankyo Co Ltd | キノロンカルボン酸誘導体 |
| EP0242789A3 (en) * | 1986-04-25 | 1990-09-05 | Dainippon Pharmaceutical Co., Ltd. | Novel quinoline derivates and processes for preparation thereof |
| DE3615767A1 (de) * | 1986-05-10 | 1987-11-12 | Bayer Ag | Verfahren zur herstellung von 4-hydroxy-chinolin-3-carbonsaeuren |
| US4771055A (en) * | 1986-07-28 | 1988-09-13 | Warner-Lambert Company | 7-[[3-(aminomethyl)-3-alkyl]-1-pyrrolidinyl]-quinoline-carboxylic acids |
| ZA877471B (en) * | 1986-10-08 | 1988-04-05 | Bristol-Myers Company | 1-tertiary-alkyl-substituted naphthyridine-and quinoline-carboxylic acid antibacterial agents |
| NZ222047A (en) * | 1986-10-08 | 1991-01-29 | Bristol Myers Co | Quinoline - or naphthyridine - carboxylic acid anti-bacterial agents |
| US4965273A (en) * | 1986-10-08 | 1990-10-23 | Bristol-Myers Company | Certain 1-tertiary-butyl-naphthyridone carboxylic acid derivatives anti-bacterial agents |
| US4954507A (en) * | 1986-10-08 | 1990-09-04 | Bristol-Myers Company | 1-tertiary-alkyl-substituted naphthyridine carboxylic acid antibacterial agents |
| WO1989000158A1 (en) * | 1987-07-02 | 1989-01-12 | Pfizer Inc. | Bridged-diazabicycloalkyl quinolone carboxylic acids and esters |
| US4780468A (en) * | 1987-08-07 | 1988-10-25 | Warner-Lambert Company | 8-trifluoromethyl quinolones as antibacterial agents |
| US4803205A (en) * | 1987-08-07 | 1989-02-07 | Warner-Lambert Company | Quinolones as antibacterial agents |
| US4851418A (en) * | 1987-08-21 | 1989-07-25 | Warner-Lambert Company | Naphthyridine antibacterial agents containing an α-amino acid in the side chain of the 7-substituent |
| JPH0676400B2 (ja) * | 1987-08-25 | 1994-09-28 | 大日本製薬株式会社 | 新規ピリドンカルボン酸誘導体、そのエステルおよびその塩 |
| US4929613A (en) * | 1987-08-26 | 1990-05-29 | Warner-Lambert Company | Antibacterial agents |
| US4839355A (en) * | 1987-09-09 | 1989-06-13 | Sterling Drug Inc. | Tricyclic-pyridinylquinoline compounds, their preparation and use |
| JPH02138278A (ja) * | 1987-10-12 | 1990-05-28 | Yoshitomi Pharmaceut Ind Ltd | キノロンカルボン酸化合物 |
| US4889857A (en) * | 1987-10-12 | 1989-12-26 | Yoshitomi Pharmaceutical Industries, Ltd. | Quinolonecarboxylic acid compounds and pharmaceutical use thereof |
| HU205105B (en) * | 1987-10-26 | 1992-03-30 | Pfizer | Process for producing azetidinyl quinoline carboxylic acids and pharmaceutical compositions comprising same |
| WO1989005643A1 (en) * | 1987-12-18 | 1989-06-29 | Pfizer Inc. | Heterocyclic-substituted quinoline-carboxylic acids |
| FR2634483B2 (fr) * | 1987-12-29 | 1994-03-04 | Esteve Labor Dr | Derives des acides 7-(1-azetidinyl)-1,4-dihydro-4-oxoquinoleine-3-carboxyliques, leur preparation et leur application en tant que medicaments |
| US5173484A (en) * | 1988-02-05 | 1992-12-22 | Bayer Aktiengesellschaft | Quinolone- and naphthyridone carboxylic acid derivatives, process for their production, antibacterial compositions and feed additives containing them |
| US5103040A (en) * | 1988-06-21 | 1992-04-07 | Pfizer Inc. | 6-fluoro-1,4-dihydroquinol-4-one-3-carboxylic acid derivatives and intermediates therefor |
| US5233091A (en) * | 1988-06-21 | 1993-08-03 | Pfizer Inc. | 6-fluoro-1,4-dihydroquinol-4-one-3-carboxylic acid derivatives and intermediates therefor |
| US5039682A (en) * | 1988-06-21 | 1991-08-13 | Pfizer Inc. | 6-fluoro-1,4-dihydroquinol-4-one-3-carboxylic acid derivatives and intermediates therefor |
| US5104868A (en) * | 1988-06-21 | 1992-04-14 | Pfizer Inc. | Tricyclic derivatives of 7-substituted-6-fluoro-1,4-dihydroquinol-4-one-3-carboxylic acids and esters |
| DE3906365A1 (de) * | 1988-07-15 | 1990-01-18 | Bayer Ag | 7-(1-pyrrolidinyl)-3-chinolon- und -naphthyridoncarbonsaeure-derivate, verfahren sowie substituierte (oxa)diazabicyclooctane und -nonane als zwischenprodukte zu ihrer herstellung, und sie enthaltende antibakterielle mittel und futterzusatzstoffe |
| US5286723A (en) * | 1988-08-31 | 1994-02-15 | Daiichi Seiyaku Co., Ltd. | Spiro compound |
| CA1336090C (en) * | 1988-08-31 | 1995-06-27 | Isao Hayakawa | Spiro-substituted cyclic amines of quinolone derivatives |
| US4945160A (en) * | 1988-11-22 | 1990-07-31 | Warner-Lambert Company | Preparation of certain 7-substituted quinolones |
| US5262417A (en) * | 1988-12-06 | 1993-11-16 | The Upjohn Company | Antibacterial quinolone compounds |
| NO177302C (no) * | 1989-03-16 | 1995-08-23 | Esteve Labor Dr | Analogifremgangsmåte til fremstilling av terapeutisk aktive substituerte azetidinylkinolon(naftyridon)karboksylsyrederivater |
| CA2012681A1 (en) * | 1989-03-31 | 1990-09-30 | Masayasu Okuhira | Quinolone derivatives, preparation processes thereof, and antibacterial agents containing the same |
| FR2649100B1 (fr) * | 1989-06-29 | 1994-03-04 | Laboratorios Dr Esteve Sa | Nouvelles azetidines, leur preparation et leur application comme intermediaires pour la preparation de composes avec activite antimicrobienne |
| US5214051A (en) * | 1989-08-01 | 1993-05-25 | Pfizer Inc. | Thiazolyl and oxazolyl[5,4-c]piperidyl-substituted quinolone-carboxylic acid and related analogs thereof having antibacterial properties are disclosed |
| US5364861A (en) * | 1990-11-30 | 1994-11-15 | Warner-Lambert Company | Optical isomers of 7-[3-(1,1-dialkylmethyl-1-amino-1-pyrrolidinyl]-quinolones and naphthyridones as antibacterial agents |
| US5157128A (en) * | 1990-11-30 | 1992-10-20 | Warner-Lambert Company | Certain optically active substituted α,α-dialkyl-pyrrolidine-3-methamines useful as intermediates |
| US5072001A (en) * | 1990-11-30 | 1991-12-10 | Warner-Lambert Company | Certain optically active substituted 3-pyrraidine acetic acid derivatives useful as intermediates |
| US5258528A (en) * | 1990-11-30 | 1993-11-02 | Warner-Lambert Company | Individual stereoisomers of pyrrolidine methanamines substituted on the ring nitrogen by a 1-phenylethyl group |
| US5342846A (en) * | 1990-12-05 | 1994-08-30 | Synphar Laboratories, Inc. | 7-substituted-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid compounds and 7-(substituted triazolyl pyrrolidin-1-yl) 4-oxoquinoline-3-carboxylic acid derivatives useful as antibacterial agents |
| FR2673426B1 (fr) * | 1991-03-01 | 1993-07-16 | Bouchara Sa | Nouvelles quinolones, leur procede de preparation et les compositions en refermant. |
| WO1993013101A1 (fr) * | 1991-12-27 | 1993-07-08 | Yoshitomi Pharmaceutical Industries, Ltd. | Compose de pyridonecarboxylate, son utilisation pharmaceutique et compose spiro |
| FR2690161B1 (fr) * | 1992-04-16 | 1995-06-30 | Esteve Labor Dr | Derives de pyridone azetidinyl substitues avec activite antimicrobienne. |
| FR2692577B1 (fr) * | 1992-05-26 | 1996-02-02 | Bouchara Sa | Nouvelles quinolones fluorees, leur procede de preparation et les compositions pharmaceutiques en renfermant. |
| US5646163A (en) * | 1992-10-30 | 1997-07-08 | The Procter & Gamble Company | Quinolone 5-(N-heterosubstituted amino) antimicrobials |
| TW252107B (index.php) * | 1993-08-27 | 1995-07-21 | Hokuriku Pharmacetical Co Ltd | |
| JPH072783A (ja) * | 1993-11-26 | 1995-01-06 | Sankyo Co Ltd | キノリンカルボン酸誘導体の製造中間体 |
| US5859026A (en) * | 1995-01-24 | 1999-01-12 | Hokuriku Seiyaku Co., Ltd. | Quinoline carboxylic acid |
| JP2716952B2 (ja) * | 1995-09-08 | 1998-02-18 | 三共株式会社 | 8−メトキシキノロンカルボン酸誘導体の製造中間体 |
| JPH08208617A (ja) * | 1995-11-02 | 1996-08-13 | Sankyo Co Ltd | キノリンカルボン酸誘導体の製造中間体 |
| US5929086A (en) | 1996-05-10 | 1999-07-27 | Pharmacia & Upjohn Company | Topical administration of antimicrobial agents for the treatment of systemic bacterial diseases |
| US6387928B1 (en) | 1997-09-15 | 2002-05-14 | The Procter & Gamble Co. | Antimicrobial quinolones, their compositions and uses |
| AR013493A1 (es) * | 1997-09-15 | 2000-12-27 | Procter & Gamble | COMPUESTO DE QUINOLONA, SU USO PARA LA FABRICACIoN DE UN MEDICAMENTO Y COMPOSICIoN FARMACEUTICA QUE LO COMPRENDE |
| HK1048114A1 (en) * | 1999-10-28 | 2003-03-21 | 基本治疗公司 | Drug discharge pump inhibitors |
| AR030537A1 (es) * | 1999-11-05 | 2003-08-27 | Abbott Lab | Acidos quinolincarboxilicos y naftiridincarboxilico antibacterianos |
| ATE289607T1 (de) | 1999-12-14 | 2005-03-15 | Neurosearch As | Neue heteroaryl-diazabizykloalkane |
| US7098219B2 (en) | 2000-08-01 | 2006-08-29 | Wockhart Limited | Inhibitors of cellular efflux pumps of microbes |
| US6878713B2 (en) * | 2001-04-25 | 2005-04-12 | Wockhardt Limited | Generation triple-targeting, chiral, broad-spectrum antimicrobial 7-substituted piperidino-quinolone carboxylic acid derivatives, their preparation, compositions and use as medicaments |
| US6964966B2 (en) | 2001-04-25 | 2005-11-15 | Wockhardt Limited | Generation triple-targeting, chiral, broad-spectrum antimicrobial 7-substituted piperidino-quinolone carboxylic acid derivatives, their preparation, compositions and use as medicaments |
| US7056917B2 (en) * | 2001-04-26 | 2006-06-06 | Daiichi Pharmaceutical Co., Ltd. | Drug efflux pump inhibitor |
| JPWO2002087589A1 (ja) * | 2001-04-26 | 2004-08-12 | 第一製薬株式会社 | 薬剤排出ポンプ阻害薬 |
| US6777420B2 (en) * | 2001-06-15 | 2004-08-17 | Microbiotix, Inc. | Heterocyclic antibacterial compounds |
| US6664267B1 (en) * | 2002-05-28 | 2003-12-16 | Wockhardt Limited | Crystalline fluoroquinolone arginine salt form |
| EP2078718A1 (en) * | 2002-07-05 | 2009-07-15 | Targacept, Inc. | N-aryl diazaspiracyclic compounds and methods of preparation and use thereof |
| ATE366734T1 (de) * | 2003-09-04 | 2007-08-15 | Wockhardt Ltd | Benzochinolizin-2-carbonsäureargininsalz- tetrahydrat |
| ES2424676T3 (es) * | 2003-09-10 | 2013-10-07 | Kyorin Pharmaceutical Co., Ltd. | Derivado de ácido 7-(3-ciclopropilaminometil-1-pirrolidinil 4-sustituido)quinoloncarboxílico |
| CA2618370A1 (en) | 2005-08-04 | 2007-02-15 | Sirtris Pharmaceuticals, Inc. | Oxazolopyridine derivatives as sirtuin modulators |
| JP4876165B2 (ja) * | 2006-03-28 | 2012-02-15 | ザ プロクター アンド ギャンブル カンパニー | キノロン中間体を調製するための水素化物還元法 |
| HRP20110558T1 (hr) * | 2006-03-28 | 2011-09-30 | Warner Chilcott Company | Malatne soli i polimorfi od (3s, 5s)-7-[3-amino-5-metil-piperidinil]-1-ciklopropil-1, 4-dihidro-8-metoksi-4-okso-3-kinolinkarboksilne kiseline |
| WO2007110835A2 (en) * | 2006-03-28 | 2007-10-04 | The Procter & Gamble Company | A coupling process for preparing quinolone intermediates |
| JP5322927B2 (ja) * | 2007-05-24 | 2013-10-23 | 杏林製薬株式会社 | 14位置換基に複素芳香環カルボン酸構造を有するムチリン誘導体 |
| FR2916446B1 (fr) | 2007-05-24 | 2009-08-21 | Biocodex Sa | Nouveau procede de synthese de fluoroquinolones |
| US7902227B2 (en) * | 2007-07-27 | 2011-03-08 | Janssen Pharmaceutica Nv. | C-7 isoxazolinyl quinolone / naphthyridine derivatives useful as antibacterial agents |
| IN2014DN09251A (index.php) * | 2012-05-08 | 2015-07-10 | Ishihara Sangyo Kaisha | |
| CN103626687B (zh) * | 2013-12-06 | 2015-12-02 | 江苏弘和药物研发有限公司 | 一种(3r)-1-[(r)-1-苯乙基]-3-羟甲基吡咯烷的合成方法 |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3963736A (en) * | 1970-01-28 | 1976-06-15 | Sumitomo Chemical Company, Limited | Preparation of 1-(lower alkyl)-1,4-dihydro-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acids |
| US3753993A (en) * | 1971-05-17 | 1973-08-21 | Sterling Drug Inc | 1,4-dihydro-4-oxo-7-pyridyl-3-quinoline-carboxylic acid derivatives |
| US3907808A (en) * | 1971-05-17 | 1975-09-23 | Sterling Drug Inc | 1,4-Dihydro-4-oxo-7-pyridyl-3-quinolinecarboxylic acid derivatives |
| JPS53141286A (en) * | 1977-05-16 | 1978-12-08 | Kyorin Seiyaku Kk | Novel substituted quinolinecarboxylic acid |
| DE2808070A1 (de) * | 1978-02-24 | 1979-08-30 | Bayer Ag | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
| JPS5845426B2 (ja) * | 1978-09-29 | 1983-10-08 | 杏林製薬株式会社 | 置換キノリンカルボン酸誘導体 |
| JPS5649382A (en) * | 1979-09-28 | 1981-05-02 | Dainippon Pharmaceut Co Ltd | 6-fluoro-7-cyclic amino-1,8-naphthylidine derivative and its salt |
| JPS5746986A (en) * | 1980-09-02 | 1982-03-17 | Dai Ichi Seiyaku Co Ltd | Pyrido(1,2,3-de)(1,4)benzoxazine derivative |
| DE3033157A1 (de) * | 1980-09-03 | 1982-04-01 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-4-oxo-1,4-dihydro-naphthyridin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| SE440354B (sv) * | 1981-02-19 | 1985-07-29 | Kyorin Seiyaku Kk | Kinolinkarboxylsyraderivat |
| US4382937A (en) * | 1981-02-27 | 1983-05-10 | Dainippon Pharmaceutical Co., Ltd. | Naphthyridine derivatives and their use as anti-bacterials |
| JPS57145862A (en) * | 1981-03-06 | 1982-09-09 | Kyorin Pharmaceut Co Ltd | Quinolinecarboxylic acid derivative |
| JPS58164271A (ja) * | 1982-03-25 | 1983-09-29 | Nec Corp | Mis型圧力センサ |
| US4499091A (en) * | 1982-03-31 | 1985-02-12 | Sterling Drug Inc. | 1-Amino (or substituted amino)-1,4-dihydro-4-oxo-6-fluoro-7-heterylquinoline-3-carboxylic acids and their use as antibacterial agents |
| IE55898B1 (en) * | 1982-09-09 | 1991-02-14 | Warner Lambert Co | Antibacterial agents |
| DE3318145A1 (de) * | 1983-05-18 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-6,8-difluor-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| JPS60260577A (ja) * | 1984-06-06 | 1985-12-23 | Dainippon Pharmaceut Co Ltd | 1,8−ナフチリジン誘導体 |
| JPS6028978A (ja) * | 1983-07-27 | 1985-02-14 | Dainippon Pharmaceut Co Ltd | 1,8−ナフチリジン誘導体 |
| CS274601B2 (en) * | 1983-07-27 | 1991-09-15 | Dainippon Pharmaceutical Co | Method of 1,8-naphthyridine derivative production |
| JPS6089480A (ja) * | 1983-10-21 | 1985-05-20 | Dainippon Pharmaceut Co Ltd | ピリドンカルボン酸誘導体 |
| JPS60197686A (ja) * | 1984-03-19 | 1985-10-07 | Dai Ichi Seiyaku Co Ltd | 1,8−ナフチリジン誘導体 |
| JPS6172753A (ja) * | 1984-09-18 | 1986-04-14 | Dainippon Pharmaceut Co Ltd | ピリジルケトン誘導体 |
| IN162769B (index.php) * | 1984-11-13 | 1988-07-09 | Kyorin Seiyaku Kk | |
| JP2874664B2 (ja) * | 1996-09-18 | 1999-03-24 | 日本電気株式会社 | ページプリンタ |
-
1985
- 1985-01-23 US US06/692,820 patent/US4665079A/en not_active Expired - Lifetime
- 1985-02-01 IE IE25585A patent/IE58098B1/en not_active IP Right Cessation
- 1985-02-04 ZA ZA85854A patent/ZA85854B/xx unknown
- 1985-02-04 CA CA000473502A patent/CA1289956C/en not_active Expired - Lifetime
- 1985-02-11 AU AU38618/85A patent/AU568004B2/en not_active Ceased
- 1985-02-14 DK DK068785A patent/DK161889C/da not_active IP Right Cessation
- 1985-02-14 GR GR850396A patent/GR850396B/el not_active IP Right Cessation
- 1985-02-15 JP JP60026669A patent/JPH0755945B2/ja not_active Expired - Lifetime
- 1985-02-15 ES ES540441A patent/ES8705422A1/es not_active Expired
- 1985-02-15 HU HU85580A patent/HUT37149A/hu unknown
- 1985-02-15 EP EP85301009A patent/EP0153163B1/en not_active Expired
- 1985-02-15 PT PT79971A patent/PT79971B/pt unknown
- 1985-02-15 OA OA58529A patent/OA08300A/xx unknown
- 1985-02-15 NZ NZ211137A patent/NZ211137A/xx unknown
- 1985-02-15 PH PH31861A patent/PH20942A/en unknown
- 1985-02-15 NO NO850614A patent/NO161370C/no not_active IP Right Cessation
- 1985-02-15 FI FI850631A patent/FI83312C/fi not_active IP Right Cessation
- 1985-02-15 DE DE8585301009T patent/DE3574972D1/de not_active Expired - Lifetime
- 1985-02-18 KR KR1019850001009A patent/KR900004995B1/ko not_active Expired
-
1994
- 1994-10-19 JP JP6278595A patent/JP2604124B2/ja not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1289956C (en) | Naphthyridine- and quinolonecarboxylic acids as antibacterial agents | |
| CA1340721C (en) | 1,4-dihydro-quinoline-and naphthyridine-3-carboxylic acid antibacterial agents | |
| US4638067A (en) | Antibacterial agents | |
| CA1336089C (en) | 4-oxo-1,4-dihydro-quinoline-3-carboxylic acid derivatives as antibacterial agents | |
| EP0172651B1 (en) | Substituted-9-fluoro-3-methyl-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de][1,4]benzoxazine-6-carboxylic acids; substituted-5-amino-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acids; substituted-5-amino-6-fluoro-1,4-dihydro-4-oxo-1,8-naphthyridine-3-carboxylic acids; derivatives thereof; pharmaceutical compositions comprising the compounds; and processes for producing the compounds | |
| US4777175A (en) | Antibacterial agents | |
| US4771054A (en) | Antibacterial agents | |
| US5281612A (en) | Naphthyridine antibacterial agents | |
| EP0202763B1 (en) | 5,6-difluoronaphthyridines and 5,6,8-trifluoro-quinolines as antibacterial agents | |
| US5097032A (en) | Antibacterial agents - II | |
| CA1340292C (en) | Antibacterial agent precursor and use of same | |
| CA2247018A1 (en) | Pyridonecarboxylic acid derivatives and intermediates for the synthesis thereof | |
| NZ221955A (en) | Naphthyridine-, quinoline- and benzoxaline-carboxylic acids and antibacterial compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed | ||
| MKEC | Expiry (correction) |
Effective date: 20121205 |