CA1262911A - Pollen formation inhibiting pyrazoles - Google Patents
Pollen formation inhibiting pyrazolesInfo
- Publication number
- CA1262911A CA1262911A CA000491462A CA491462A CA1262911A CA 1262911 A CA1262911 A CA 1262911A CA 000491462 A CA000491462 A CA 000491462A CA 491462 A CA491462 A CA 491462A CA 1262911 A CA1262911 A CA 1262911A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- seed
- female parent
- carboxy
- pollen formation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000015572 biosynthetic process Effects 0.000 title claims abstract description 50
- 230000002401 inhibitory effect Effects 0.000 title claims description 28
- 150000003217 pyrazoles Chemical class 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 167
- 150000003839 salts Chemical class 0.000 claims abstract description 26
- 239000001257 hydrogen Substances 0.000 claims abstract description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 20
- 239000004464 cereal grain Substances 0.000 claims abstract description 11
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims abstract description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims abstract description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 4
- 238000004519 manufacturing process Methods 0.000 claims abstract description 4
- 125000003302 alkenyloxy group Chemical group 0.000 claims abstract description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims abstract 5
- 239000000203 mixture Substances 0.000 claims description 135
- 238000000034 method Methods 0.000 claims description 28
- -1 methoxy, ethoxy Chemical group 0.000 claims description 18
- RGGCHHCVNLUMKH-UHFFFAOYSA-N 5-carbamoyl-1-(3-chlorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=CC(Cl)=C1 RGGCHHCVNLUMKH-UHFFFAOYSA-N 0.000 claims description 12
- GMJFALMFZHXWSI-UHFFFAOYSA-N 5-carbamoyl-1-(3-methylphenyl)pyrazole-4-carboxylic acid Chemical compound CC1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 GMJFALMFZHXWSI-UHFFFAOYSA-N 0.000 claims description 7
- 239000003085 diluting agent Substances 0.000 claims description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 125000001246 bromo group Chemical group Br* 0.000 claims description 5
- 238000003306 harvesting Methods 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000005336 allyloxy group Chemical group 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 1
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 76
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 72
- 241000196324 Embryophyta Species 0.000 description 60
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- 238000009472 formulation Methods 0.000 description 40
- 239000000047 product Substances 0.000 description 40
- 239000000725 suspension Substances 0.000 description 35
- 238000010992 reflux Methods 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- 239000007787 solid Substances 0.000 description 26
- 241000209140 Triticum Species 0.000 description 25
- 235000021307 Triticum Nutrition 0.000 description 25
- 238000012360 testing method Methods 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 21
- 238000000921 elemental analysis Methods 0.000 description 20
- 239000002518 antifoaming agent Substances 0.000 description 19
- 239000008187 granular material Substances 0.000 description 19
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 17
- 229960000892 attapulgite Drugs 0.000 description 17
- 229910052625 palygorskite Inorganic materials 0.000 description 17
- 239000000543 intermediate Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000002253 acid Substances 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000002474 experimental method Methods 0.000 description 12
- 235000011167 hydrochloric acid Nutrition 0.000 description 12
- 229960000443 hydrochloric acid Drugs 0.000 description 12
- 229920001285 xanthan gum Polymers 0.000 description 12
- 239000000230 xanthan gum Substances 0.000 description 12
- 229940082509 xanthan gum Drugs 0.000 description 12
- 235000010493 xanthan gum Nutrition 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000006185 dispersion Substances 0.000 description 11
- 239000004615 ingredient Substances 0.000 description 11
- 229920001296 polysiloxane Polymers 0.000 description 11
- 238000001914 filtration Methods 0.000 description 10
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 9
- 239000002245 particle Substances 0.000 description 9
- 239000002689 soil Substances 0.000 description 9
- 241000894007 species Species 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000004157 Nitrosyl chloride Substances 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 8
- 235000019392 nitrosyl chloride Nutrition 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000003960 organic solvent Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 240000005979 Hordeum vulgare Species 0.000 description 6
- 235000007340 Hordeum vulgare Nutrition 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 6
- 229940075894 denatured ethanol Drugs 0.000 description 6
- 239000000377 silicon dioxide Substances 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 5
- 240000008042 Zea mays Species 0.000 description 5
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 5
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 5
- 239000002671 adjuvant Substances 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 239000003610 charcoal Substances 0.000 description 5
- 235000005822 corn Nutrition 0.000 description 5
- 230000035558 fertility Effects 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000004094 surface-active agent Substances 0.000 description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 240000001140 Mimosa pudica Species 0.000 description 4
- 235000016462 Mimosa pudica Nutrition 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- DIKBFYAXUHHXCS-UHFFFAOYSA-N bromoform Chemical compound BrC(Br)Br DIKBFYAXUHHXCS-UHFFFAOYSA-N 0.000 description 4
- 150000003857 carboxamides Chemical class 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000004563 wettable powder Substances 0.000 description 4
- PLFJWWUZKJKIPZ-UHFFFAOYSA-N 2-[2-[2-(2,6,8-trimethylnonan-4-yloxy)ethoxy]ethoxy]ethanol Chemical compound CC(C)CC(C)CC(CC(C)C)OCCOCCOCCO PLFJWWUZKJKIPZ-UHFFFAOYSA-N 0.000 description 3
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- 229920002059 Pluronic® P 104 Polymers 0.000 description 3
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 230000005587 bubbling Effects 0.000 description 3
- 230000000875 corresponding effect Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000004495 emulsifiable concentrate Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000009396 hybridization Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- GOTYRUGSSMKFNF-UHFFFAOYSA-N lenalidomide Chemical compound C1C=2C(N)=CC=CC=2C(=O)N1C1CCC(=O)NC1=O GOTYRUGSSMKFNF-UHFFFAOYSA-N 0.000 description 3
- 229920005610 lignin Polymers 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- 239000004576 sand Substances 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- KPEHRPKBJVEDMJ-UHFFFAOYSA-N 5-carbamoyl-1-(3-methoxyphenyl)pyrazole-4-carboxylic acid Chemical compound COC1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 KPEHRPKBJVEDMJ-UHFFFAOYSA-N 0.000 description 2
- PWGFXIMOCMRSIM-UHFFFAOYSA-N 5-carbamoyl-1h-pyrazole-4-carboxylic acid Chemical compound NC(=O)C=1NN=CC=1C(O)=O PWGFXIMOCMRSIM-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229920001732 Lignosulfonate Polymers 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- 235000007238 Secale cereale Nutrition 0.000 description 2
- 244000082988 Secale cereale Species 0.000 description 2
- 235000019714 Triticale Nutrition 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 239000003905 agrochemical Substances 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical group C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 description 2
- 229950005228 bromoform Drugs 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000007333 cyanation reaction Methods 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 239000011928 denatured alcohol Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- PJABQHODPAEOFU-UHFFFAOYSA-N diethyl(dipropyl)azanium Chemical group CCC[N+](CC)(CC)CCC PJABQHODPAEOFU-UHFFFAOYSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- KTMGNAIGXYODKQ-VOTSOKGWSA-N ethyl (e)-2-cyano-3-ethoxyprop-2-enoate Chemical compound CCO\C=C(/C#N)C(=O)OCC KTMGNAIGXYODKQ-VOTSOKGWSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical class CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229920001983 poloxamer Polymers 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 229940068977 polysorbate 20 Drugs 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- BHZRJJOHZFYXTO-UHFFFAOYSA-L potassium sulfite Chemical compound [K+].[K+].[O-]S([O-])=O BHZRJJOHZFYXTO-UHFFFAOYSA-L 0.000 description 2
- 235000019252 potassium sulphite Nutrition 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JJPVWQWOOQYHCB-UHFFFAOYSA-N triethyl(phenyl)azanium Chemical group CC[N+](CC)(CC)C1=CC=CC=C1 JJPVWQWOOQYHCB-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 241000228158 x Triticosecale Species 0.000 description 2
- CRRIAWUJYMLJOE-UHFFFAOYSA-N (3-chlorophenyl)hydrazine;hydron;chloride Chemical compound Cl.NNC1=CC=CC(Cl)=C1 CRRIAWUJYMLJOE-UHFFFAOYSA-N 0.000 description 1
- XHJNKGFUXFLNAG-UHFFFAOYSA-N (3-ethylphenyl)hydrazine Chemical class CCC1=CC=CC(NN)=C1 XHJNKGFUXFLNAG-UHFFFAOYSA-N 0.000 description 1
- JWJSWCNKBBQJMP-UHFFFAOYSA-N (3-ethylphenyl)hydrazine;hydrochloride Chemical compound Cl.CCC1=CC=CC(NN)=C1 JWJSWCNKBBQJMP-UHFFFAOYSA-N 0.000 description 1
- GPTOGZLZMLJZCV-UHFFFAOYSA-N (3-methylphenyl)hydrazine Chemical compound CC1=CC=CC(NN)=C1 GPTOGZLZMLJZCV-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical compound OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 description 1
- JNJMDUVNKABIHZ-UHFFFAOYSA-N 1-(3-bromo-4-methylphenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound C1=C(Br)C(C)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 JNJMDUVNKABIHZ-UHFFFAOYSA-N 0.000 description 1
- YCXSKLLCJDDKSH-UHFFFAOYSA-N 1-(3-bromophenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=CC(Br)=C1 YCXSKLLCJDDKSH-UHFFFAOYSA-N 0.000 description 1
- LIRDCTZQZVJFJO-UHFFFAOYSA-N 1-(4-bromophenyl)-5-carbamoylpyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(Br)C=C1 LIRDCTZQZVJFJO-UHFFFAOYSA-N 0.000 description 1
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical compound NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 1
- YMJLEPMVGQBLHL-UHFFFAOYSA-N 1h-pyrazole-5-carbonitrile Chemical compound N#CC1=CC=NN1 YMJLEPMVGQBLHL-UHFFFAOYSA-N 0.000 description 1
- BNYCHCAYYYRJSH-UHFFFAOYSA-N 1h-pyrazole-5-carboxamide Chemical compound NC(=O)C1=CC=NN1 BNYCHCAYYYRJSH-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NTSMOUACTOCHOU-UHFFFAOYSA-N 3-cyano-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1C=C(C#N)NN=1 NTSMOUACTOCHOU-UHFFFAOYSA-N 0.000 description 1
- AMKPQMFZCBTTAT-UHFFFAOYSA-N 3-ethylaniline Chemical compound CCC1=CC=CC(N)=C1 AMKPQMFZCBTTAT-UHFFFAOYSA-N 0.000 description 1
- ZRXHLJNBNWVNIM-UHFFFAOYSA-N 3-methyl-1-benzofuran Chemical compound C1=CC=C2C(C)=COC2=C1 ZRXHLJNBNWVNIM-UHFFFAOYSA-N 0.000 description 1
- BFMGSMOYBHOHGI-UHFFFAOYSA-N 5-amino-1-phenylpyrazole-4-carboxylic acid Chemical compound NC1=C(C(O)=O)C=NN1C1=CC=CC=C1 BFMGSMOYBHOHGI-UHFFFAOYSA-N 0.000 description 1
- XHZWFUVEKDDQPF-UHFFFAOYSA-N 5-bromo-1h-pyrazole Chemical compound BrC1=CC=NN1 XHZWFUVEKDDQPF-UHFFFAOYSA-N 0.000 description 1
- AQEWWELUWIOFHJ-UHFFFAOYSA-N 5-carbamoyl-1-(2,4-dichlorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(Cl)C=C1Cl AQEWWELUWIOFHJ-UHFFFAOYSA-N 0.000 description 1
- ARJHEMDDIIWFPJ-UHFFFAOYSA-N 5-carbamoyl-1-(2-methyl-4-propan-2-ylphenyl)pyrazole-4-carboxylic acid Chemical compound CC1=CC(C(C)C)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 ARJHEMDDIIWFPJ-UHFFFAOYSA-N 0.000 description 1
- SUFHYKCKQJBXNS-UHFFFAOYSA-N 5-carbamoyl-1-(3,4-dichlorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(Cl)C(Cl)=C1 SUFHYKCKQJBXNS-UHFFFAOYSA-N 0.000 description 1
- BWWRKONHBJBVCD-UHFFFAOYSA-N 5-carbamoyl-1-(3,4-diethylphenyl)pyrazole-4-carboxylic acid Chemical compound C1=C(CC)C(CC)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 BWWRKONHBJBVCD-UHFFFAOYSA-N 0.000 description 1
- DGNXUWVZMWDZFS-UHFFFAOYSA-N 5-carbamoyl-1-(3,4-difluorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(F)C(F)=C1 DGNXUWVZMWDZFS-UHFFFAOYSA-N 0.000 description 1
- YCYQTXBVPJFNLI-UHFFFAOYSA-N 5-carbamoyl-1-(3,4-dimethylphenyl)pyrazole-4-carboxylic acid Chemical compound C1=C(C)C(C)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 YCYQTXBVPJFNLI-UHFFFAOYSA-N 0.000 description 1
- XMDNXOYKEGPFJT-UHFFFAOYSA-N 5-carbamoyl-1-(3-chloro-4-methylphenyl)pyrazole-4-carboxylic acid Chemical compound C1=C(Cl)C(C)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 XMDNXOYKEGPFJT-UHFFFAOYSA-N 0.000 description 1
- KUOQKODUOLZEJZ-UHFFFAOYSA-N 5-carbamoyl-1-(3-ethylphenyl)pyrazole-4-carboxylic acid Chemical compound CCC1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 KUOQKODUOLZEJZ-UHFFFAOYSA-N 0.000 description 1
- NWSLOWWHIFDJAJ-UHFFFAOYSA-N 5-carbamoyl-1-(3-fluorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=CC(F)=C1 NWSLOWWHIFDJAJ-UHFFFAOYSA-N 0.000 description 1
- BSWIFACGGDSGQB-UHFFFAOYSA-N 5-carbamoyl-1-(4-ethyl-2-fluorophenyl)pyrazole-4-carboxylic acid Chemical compound FC1=CC(CC)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 BSWIFACGGDSGQB-UHFFFAOYSA-N 0.000 description 1
- IBAQSRUBOLDQOG-UHFFFAOYSA-N 5-carbamoyl-1-(4-fluorophenyl)pyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=C(F)C=C1 IBAQSRUBOLDQOG-UHFFFAOYSA-N 0.000 description 1
- WUXWGHOQHLIISU-UHFFFAOYSA-N 5-carbamoyl-1-(4-methylphenyl)pyrazole-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1N1C(C(N)=O)=C(C(O)=O)C=N1 WUXWGHOQHLIISU-UHFFFAOYSA-N 0.000 description 1
- QTUFEYWJMPIRNK-UHFFFAOYSA-N 5-carbamoyl-1-[3-(2-methylpropyl)phenyl]pyrazole-4-carboxylic acid Chemical compound CC(C)CC1=CC=CC(N2C(=C(C(O)=O)C=N2)C(N)=O)=C1 QTUFEYWJMPIRNK-UHFFFAOYSA-N 0.000 description 1
- OTGQGZUBLONPQW-UHFFFAOYSA-N 5-carbamoyl-1-phenylpyrazole-4-carboxylic acid Chemical compound NC(=O)C1=C(C(O)=O)C=NN1C1=CC=CC=C1 OTGQGZUBLONPQW-UHFFFAOYSA-N 0.000 description 1
- IJPFBRONCJOTTA-UHFFFAOYSA-N 5-chloro-1h-pyrazole Chemical compound ClC1=CC=NN1 IJPFBRONCJOTTA-UHFFFAOYSA-N 0.000 description 1
- VQPNTPPRCQFSJM-UHFFFAOYSA-N 5-cyano-1h-pyrazole-4-carboxylic acid Chemical compound OC(=O)C=1C=NNC=1C#N VQPNTPPRCQFSJM-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- UFRKHRTYACWGOX-UHFFFAOYSA-N OC1=C(C=NN1C1=CC(=CC=C1)C)C(=O)OCC Chemical compound OC1=C(C=NN1C1=CC(=CC=C1)C)C(=O)OCC UFRKHRTYACWGOX-UHFFFAOYSA-N 0.000 description 1
- KWLMWNNBQUFTLX-UHFFFAOYSA-N OC1=CC=NN1C1=CC(=CC=C1)C Chemical compound OC1=CC=NN1C1=CC(=CC=C1)C KWLMWNNBQUFTLX-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 229920001938 Vegetable gum Polymers 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- VBQDSLGFSUGBBE-UHFFFAOYSA-N benzyl(triethyl)azanium Chemical class CC[N+](CC)(CC)CC1=CC=CC=C1 VBQDSLGFSUGBBE-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- HRNJXGRZDDWLOM-UHFFFAOYSA-N butan-2-yl(trimethyl)azanium Chemical group CCC(C)[N+](C)(C)C HRNJXGRZDDWLOM-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUNCEDRRUNZACO-UHFFFAOYSA-N butyl(trimethyl)azanium Chemical class CCCC[N+](C)(C)C IUNCEDRRUNZACO-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- CDJLHQRURPECEZ-UHFFFAOYSA-N dibutyl(diethyl)azanium Chemical group CCCC[N+](CC)(CC)CCCC CDJLHQRURPECEZ-UHFFFAOYSA-N 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- ZJHQDSMOYNLVLX-UHFFFAOYSA-N diethyl(dimethyl)azanium Chemical group CC[N+](C)(C)CC ZJHQDSMOYNLVLX-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MXTMXRYBYWOAGX-UHFFFAOYSA-N dimethyl(diphenyl)azanium Chemical class C=1C=CC=CC=1[N+](C)(C)C1=CC=CC=C1 MXTMXRYBYWOAGX-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- GKEWLUXDKOQYFL-UHFFFAOYSA-N ethyl 1-(3-chloro-4-methylphenyl)-5-cyanopyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(C)C(Cl)=C1 GKEWLUXDKOQYFL-UHFFFAOYSA-N 0.000 description 1
- JPKWVUOGGMHDQQ-UHFFFAOYSA-N ethyl 1-(3-chlorophenyl)-5-cyanopyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC(Cl)=C1 JPKWVUOGGMHDQQ-UHFFFAOYSA-N 0.000 description 1
- TWGLRUQZUNIEBJ-UHFFFAOYSA-N ethyl 1-(4-bromophenyl)-5-cyanopyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(Br)C=C1 TWGLRUQZUNIEBJ-UHFFFAOYSA-N 0.000 description 1
- LTOXVDYMHRQESR-UHFFFAOYSA-N ethyl 5-amino-1-(3-ethylphenyl)pyrazole-4-carboxylate Chemical compound NC1=C(C(=O)OCC)C=NN1C1=CC=CC(CC)=C1 LTOXVDYMHRQESR-UHFFFAOYSA-N 0.000 description 1
- IVPHBHOKIBKHEE-UHFFFAOYSA-N ethyl 5-amino-1-(3-methoxyphenyl)pyrazole-4-carboxylate Chemical compound NC1=C(C(=O)OCC)C=NN1C1=CC=CC(OC)=C1 IVPHBHOKIBKHEE-UHFFFAOYSA-N 0.000 description 1
- KNTBFUFWHAQCRF-UHFFFAOYSA-N ethyl 5-bromo-1-(3-methoxyphenyl)pyrazole-4-carboxylate Chemical compound BrC1=C(C(=O)OCC)C=NN1C1=CC=CC(OC)=C1 KNTBFUFWHAQCRF-UHFFFAOYSA-N 0.000 description 1
- RTFLPOJCXDZQIN-UHFFFAOYSA-N ethyl 5-carbamoyl-1-(2,4-dibromophenyl)pyrazole-4-carboxylate Chemical compound NC(=O)C1=C(C(=O)OCC)C=NN1C1=CC=C(Br)C=C1Br RTFLPOJCXDZQIN-UHFFFAOYSA-N 0.000 description 1
- MUZYZOUAGNKICN-UHFFFAOYSA-N ethyl 5-carbamoyl-1-(3-chlorophenyl)pyrazole-4-carboxylate Chemical compound NC(=O)C1=C(C(=O)OCC)C=NN1C1=CC=CC(Cl)=C1 MUZYZOUAGNKICN-UHFFFAOYSA-N 0.000 description 1
- CBWBLNNGPMXDKI-UHFFFAOYSA-N ethyl 5-chloro-1-(3-chlorophenyl)pyrazole-4-carboxylate Chemical compound ClC1=C(C(=O)OCC)C=NN1C1=CC=CC(Cl)=C1 CBWBLNNGPMXDKI-UHFFFAOYSA-N 0.000 description 1
- JVYOFICHEZBZMV-UHFFFAOYSA-N ethyl 5-chloro-1-(3-ethylphenyl)pyrazole-4-carboxylate Chemical compound ClC1=C(C(=O)OCC)C=NN1C1=CC=CC(CC)=C1 JVYOFICHEZBZMV-UHFFFAOYSA-N 0.000 description 1
- ADVBQQQXVWFMDT-UHFFFAOYSA-N ethyl 5-cyano-1-(2,3-dichlorophenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC(Cl)=C1Cl ADVBQQQXVWFMDT-UHFFFAOYSA-N 0.000 description 1
- SWXAQICAWLOVGW-UHFFFAOYSA-N ethyl 5-cyano-1-(3,4-dichlorophenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(Cl)C(Cl)=C1 SWXAQICAWLOVGW-UHFFFAOYSA-N 0.000 description 1
- IHHZRXCNMQXMAV-UHFFFAOYSA-N ethyl 5-cyano-1-(3,4-dimethylphenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=C(C)C(C)=C1 IHHZRXCNMQXMAV-UHFFFAOYSA-N 0.000 description 1
- FCKLUTFWDUMLPR-UHFFFAOYSA-N ethyl 5-cyano-1-(3-ethylphenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC(CC)=C1 FCKLUTFWDUMLPR-UHFFFAOYSA-N 0.000 description 1
- CETUIEPODWICIR-UHFFFAOYSA-N ethyl 5-cyano-1-(3-methoxyphenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC(OC)=C1 CETUIEPODWICIR-UHFFFAOYSA-N 0.000 description 1
- ABGIIDLTTLKRLV-UHFFFAOYSA-N ethyl 5-cyano-1-(3-methylphenyl)pyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC(C)=C1 ABGIIDLTTLKRLV-UHFFFAOYSA-N 0.000 description 1
- LEVIYCDZXKNQPL-UHFFFAOYSA-N ethyl 5-cyano-1-phenylpyrazole-4-carboxylate Chemical compound N#CC1=C(C(=O)OCC)C=NN1C1=CC=CC=C1 LEVIYCDZXKNQPL-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000727 fraction Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 239000011086 glassine Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- GMXFZBZOVZOYNQ-UHFFFAOYSA-N hydron;(3-methoxyphenyl)hydrazine;chloride Chemical compound Cl.COC1=CC=CC(NN)=C1 GMXFZBZOVZOYNQ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 101150085091 lat-2 gene Proteins 0.000 description 1
- 235000019357 lignosulphonate Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- NPQMWAIOIBCSQY-UHFFFAOYSA-N methyl 5-carbamoyl-1-(3-chlorophenyl)pyrazole-4-carboxylate Chemical compound NC(=O)C1=C(C(=O)OC)C=NN1C1=CC=CC(Cl)=C1 NPQMWAIOIBCSQY-UHFFFAOYSA-N 0.000 description 1
- AEPTXICUZNPHNX-UHFFFAOYSA-N methyl 5-carbamoyl-1-(4-ethylphenyl)pyrazole-4-carboxylate Chemical compound C1=CC(CC)=CC=C1N1C(C(N)=O)=C(C(=O)OC)C=N1 AEPTXICUZNPHNX-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- MDXJYGLKYYBRCZ-UHFFFAOYSA-M potassium;n-amino-n-(3-ethylphenyl)sulfamate Chemical compound [K+].CCC1=CC=CC(N(N)S([O-])(=O)=O)=C1 MDXJYGLKYYBRCZ-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 230000010153 self-pollination Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000008054 sulfonate salts Chemical class 0.000 description 1
- 229940032330 sulfuric acid Drugs 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 1
- SPJZSTLXABSXII-UHFFFAOYSA-N tert-butyl(trimethyl)azanium Chemical group CC(C)(C)[N+](C)(C)C SPJZSTLXABSXII-UHFFFAOYSA-N 0.000 description 1
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical class CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 1
- MHZQPZCBHKCIEN-UHFFFAOYSA-N tetrakis(2-methylpropyl)azanium Chemical class CC(C)C[N+](CC(C)C)(CC(C)C)CC(C)C MHZQPZCBHKCIEN-UHFFFAOYSA-N 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical group C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- OSBSFAARYOCBHB-UHFFFAOYSA-N tetrapropylammonium Chemical class CCC[N+](CCC)(CCC)CCC OSBSFAARYOCBHB-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 125000004954 trialkylamino group Chemical group 0.000 description 1
- DLJBCWLKMQZRFN-UHFFFAOYSA-N triethyl(2-methylpropyl)azanium Chemical group CC[N+](CC)(CC)CC(C)C DLJBCWLKMQZRFN-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Plant Substances (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Cosmetics (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Investigating Or Analysing Biological Materials (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
- Steroid Compounds (AREA)
- Breeding Of Plants And Reproduction By Means Of Culturing (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65406184A | 1984-09-25 | 1984-09-25 | |
| US654,061 | 1984-09-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1262911A true CA1262911A (en) | 1989-11-14 |
Family
ID=24623299
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000491462A Expired CA1262911A (en) | 1984-09-25 | 1985-09-24 | Pollen formation inhibiting pyrazoles |
Country Status (27)
| Country | Link |
|---|---|
| US (2) | US4666504A (https=) |
| EP (1) | EP0177242B1 (https=) |
| JP (1) | JPS6187668A (https=) |
| KR (1) | KR910002078B1 (https=) |
| CN (1) | CN1016398B (https=) |
| AT (1) | ATE49197T1 (https=) |
| AU (1) | AU581927B2 (https=) |
| BG (1) | BG60351B2 (https=) |
| BR (1) | BR8504722A (https=) |
| CA (1) | CA1262911A (https=) |
| CS (1) | CS259532B2 (https=) |
| DD (1) | DD236870A5 (https=) |
| DE (1) | DE3575129D1 (https=) |
| DK (1) | DK432685A (https=) |
| DO (1) | DOP1985004354A (https=) |
| ES (1) | ES8703141A1 (https=) |
| FI (1) | FI853644A7 (https=) |
| GR (1) | GR852318B (https=) |
| HU (1) | HU196291B (https=) |
| IL (1) | IL76463A0 (https=) |
| NZ (1) | NZ213590A (https=) |
| PH (1) | PH21852A (https=) |
| PL (1) | PL148599B1 (https=) |
| PT (1) | PT81174B (https=) |
| RO (1) | RO92792B (https=) |
| SU (1) | SU1440343A3 (https=) |
| ZA (1) | ZA857343B (https=) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR870008849A (ko) * | 1986-03-19 | 1987-10-21 | 메어리 앤 턱커 | 생식자 박멸효능을 갖는 피라졸류 |
| US4966623A (en) * | 1986-03-19 | 1990-10-30 | Ackmann Stephen A | Use of gametocidal pyrazoles to produce hybrid seed |
| US4801326A (en) * | 1986-03-19 | 1989-01-31 | Eli Lilly And Company | 1-phenylpyrazole-4,5-dicarboxylic acid derivatives, composition containing them, and pollen formation inhibiting method of using them |
| US4913604A (en) * | 1987-09-23 | 1990-04-03 | Vargus Ltd. Tool Manufacturing Co. | Thread milling tool |
| AU610203B2 (en) * | 1988-03-17 | 1991-05-16 | Institut Elementoorganicheskikh Soedineny Imeni A.N.Nesmeyanova Akademii Nauk Sssr | Method of sterilizing anthers using phosphoric and thiophosphoric acids |
| DE3931786A1 (de) * | 1989-09-23 | 1991-04-04 | Basf Ag | Pyrazol-3-carbonsaeureamide |
| US5587485A (en) * | 1994-07-20 | 1996-12-24 | Monsanto Company | Heterocyclic- and carbocyclic- substituted benzoic acids and synthesis thereof |
| ID21775A (id) * | 1996-10-25 | 1999-07-22 | Yoshitomi Pharmaceutical | Senyawa-senyawa 1-fenilpirazol dan penggunaan farmasinya |
| DK175612B1 (da) * | 2003-11-11 | 2004-12-27 | Vks Inventa As | Ophængningsarrangement samt fremgangsmåde til fremstilling af et sådant arrangement |
| CN110731265B (zh) * | 2019-12-05 | 2021-04-02 | 河北省农林科学院旱作农业研究所 | 一种饲用小黑麦新种质的杂交选育方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3922163A (en) * | 1970-01-30 | 1975-11-25 | Upjohn Co | Organic compounds and process |
| US4147528A (en) * | 1973-04-23 | 1979-04-03 | Rohm And Haas Company | 6-Oxopyrimidine plant growth regulators |
| US4134987A (en) * | 1976-01-14 | 1979-01-16 | Huppatz John L | Compounds and compositions |
| US4345934A (en) * | 1977-03-10 | 1982-08-24 | Rohm And Haas Company | Method of producing hybrid cereal grain seeds by application of 1-aryl-1,4-dihydro-4-oxo(thio)-pyridazines |
| US4238220A (en) * | 1977-07-15 | 1980-12-09 | Rohm And Haas Company | 1-Aryl-5-carboxy-2-pyridones and derivatives thereof |
| DE2747531A1 (de) * | 1977-10-22 | 1979-04-26 | Basf Ag | Substituierte 3-aminopyrazole |
| DE2829289A1 (de) * | 1978-07-04 | 1980-01-24 | Basf Ag | Pyrazolaetherderivate |
| FR2486940A1 (fr) * | 1980-07-18 | 1982-01-22 | Ugine Kuhlmann | Procede de preparation de phenyl-1 carbamoyl-3 pyrazolones-5 |
| GR75799B (https=) * | 1980-10-03 | 1984-08-02 | Ici Plc | |
| DE3129429A1 (de) * | 1981-07-25 | 1983-02-10 | Basf Ag, 6700 Ludwigshafen | 5-amino-1-phenyl-pyrazol-4-carbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| KR870008849A (ko) * | 1986-03-19 | 1987-10-21 | 메어리 앤 턱커 | 생식자 박멸효능을 갖는 피라졸류 |
-
1985
- 1985-08-05 US US06/762,732 patent/US4666504A/en not_active Expired - Fee Related
- 1985-09-20 DO DO1985004354A patent/DOP1985004354A/es unknown
- 1985-09-23 GR GR852318A patent/GR852318B/el unknown
- 1985-09-23 IL IL76463A patent/IL76463A0/xx not_active IP Right Cessation
- 1985-09-23 PL PL1985255491A patent/PL148599B1/pl unknown
- 1985-09-23 CN CN85107078A patent/CN1016398B/zh not_active Expired
- 1985-09-23 AU AU47680/85A patent/AU581927B2/en not_active Ceased
- 1985-09-23 BG BG071779A patent/BG60351B2/bg unknown
- 1985-09-23 PT PT81174A patent/PT81174B/pt not_active IP Right Cessation
- 1985-09-23 CS CS856783A patent/CS259532B2/cs unknown
- 1985-09-23 RO RO120183A patent/RO92792B/ro unknown
- 1985-09-23 SU SU853954000A patent/SU1440343A3/ru active
- 1985-09-23 FI FI853644A patent/FI853644A7/fi not_active Application Discontinuation
- 1985-09-24 ZA ZA857343A patent/ZA857343B/xx unknown
- 1985-09-24 EP EP85306762A patent/EP0177242B1/en not_active Expired - Lifetime
- 1985-09-24 DK DK432685A patent/DK432685A/da not_active Application Discontinuation
- 1985-09-24 CA CA000491462A patent/CA1262911A/en not_active Expired
- 1985-09-24 ES ES547260A patent/ES8703141A1/es not_active Expired
- 1985-09-24 KR KR1019850007017A patent/KR910002078B1/ko not_active Expired
- 1985-09-24 HU HU853599A patent/HU196291B/hu not_active IP Right Cessation
- 1985-09-24 DE DE8585306762T patent/DE3575129D1/de not_active Expired - Lifetime
- 1985-09-24 NZ NZ213590A patent/NZ213590A/xx unknown
- 1985-09-24 AT AT85306762T patent/ATE49197T1/de not_active IP Right Cessation
- 1985-09-24 PH PH32826A patent/PH21852A/en unknown
- 1985-09-25 JP JP60213600A patent/JPS6187668A/ja active Pending
- 1985-09-25 BR BR8504722A patent/BR8504722A/pt unknown
- 1985-09-25 DD DD85281017A patent/DD236870A5/de not_active IP Right Cessation
-
1987
- 1987-02-02 US US07/009,971 patent/US4775409A/en not_active Expired - Fee Related
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3088456B2 (ja) | 除草剤に対して栽培植物を保護するためのピラゾリン | |
| US4643757A (en) | Herbicidal 4-benzoyl-1-methyl-5-hydroxypyrazoles | |
| CA1082105A (en) | Pyidozinone derivatives and their use as agricultural fungicides | |
| CA1262911A (en) | Pollen formation inhibiting pyrazoles | |
| US4345934A (en) | Method of producing hybrid cereal grain seeds by application of 1-aryl-1,4-dihydro-4-oxo(thio)-pyridazines | |
| DE3226513A1 (de) | Als herbizide verwendbare n-phenylpyrazolderivate | |
| EP0003884A2 (en) | Alpha-beta unsaturated ketone derivatives useful as herbicides | |
| EP0974587A1 (en) | 1-substituted 4-carbamoyl-1,2,4-triazol-5-one derivatives and herbicide | |
| US4059434A (en) | Cycloalkanapyrazole herbicides | |
| CA1152498A (en) | Herbicides | |
| EP0138527A2 (en) | Herbicidal pyrazole derivatives | |
| JPH02178276A (ja) | 除草剤化合物、除草剤組成物及び雑草の撲滅又は抑制方法 | |
| US3948937A (en) | Pyrazole plant growth regulants | |
| CA1250292A (en) | Pollen suppressant comprising a fused pyridazine | |
| JPH0225886B2 (https=) | ||
| US4661145A (en) | Plant growth regulating 1-aryl-1,4-dihydro-4-oxo(thio)-pyridazines | |
| US4801326A (en) | 1-phenylpyrazole-4,5-dicarboxylic acid derivatives, composition containing them, and pollen formation inhibiting method of using them | |
| JPH11506767A (ja) | 除草性置換3−アリール−ピラゾール | |
| AU604012B2 (en) | Gametocidal pyrazoles | |
| EP0363236A1 (en) | Pollen suppressant comprising a 5-oxy- or amino-substituted cinnoline | |
| US4966623A (en) | Use of gametocidal pyrazoles to produce hybrid seed | |
| US4055409A (en) | Pyrazole plant growth regulants | |
| US4902808A (en) | Process for preparing 4-carboxy-1-(3,5-dimethylphenyl)-5-pyrazolecarboxamide | |
| JPS61282365A (ja) | 1−アリ−ル−4−シアノ−5−ハロゲノピラゾ−ル類 | |
| CA1276149C (en) | 5-acyl-1-aryl-1,4-dihydro-4-oxo-3-carboxypyridazines and their use as plant hybridization agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |