CA1235881A - Stabilization of peroxide systems in the presence of alkaline earth metal ions - Google Patents
Stabilization of peroxide systems in the presence of alkaline earth metal ionsInfo
- Publication number
- CA1235881A CA1235881A CA000496865A CA496865A CA1235881A CA 1235881 A CA1235881 A CA 1235881A CA 000496865 A CA000496865 A CA 000496865A CA 496865 A CA496865 A CA 496865A CA 1235881 A CA1235881 A CA 1235881A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- composition
- alkali metal
- acid
- ammonium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000002978 peroxides Chemical class 0.000 title abstract description 27
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 title abstract description 3
- 230000006641 stabilisation Effects 0.000 title description 7
- 238000011105 stabilization Methods 0.000 title description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 57
- 239000000203 mixture Substances 0.000 claims abstract description 29
- 239000002253 acid Substances 0.000 claims abstract description 28
- 150000001408 amides Chemical class 0.000 claims abstract description 17
- 238000000354 decomposition reaction Methods 0.000 claims abstract description 16
- 239000007864 aqueous solution Substances 0.000 claims abstract description 7
- 239000003112 inhibitor Substances 0.000 claims abstract description 6
- -1 amine salt Chemical class 0.000 claims description 35
- 239000013522 chelant Substances 0.000 claims description 29
- 229910052783 alkali metal Inorganic materials 0.000 claims description 26
- 150000001340 alkali metals Chemical class 0.000 claims description 26
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 23
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical compound NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 claims description 23
- 229920000642 polymer Polymers 0.000 claims description 22
- 239000000243 solution Substances 0.000 claims description 20
- 239000003381 stabilizer Substances 0.000 claims description 18
- 238000004061 bleaching Methods 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000000654 additive Substances 0.000 claims description 7
- 230000000996 additive effect Effects 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 5
- 239000005977 Ethylene Substances 0.000 claims description 5
- 125000000524 functional group Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 229940000425 combination drug Drugs 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 230000002401 inhibitory effect Effects 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229960002163 hydrogen peroxide Drugs 0.000 claims 7
- 150000001735 carboxylic acids Chemical class 0.000 claims 3
- 229940124530 sulfonamide Drugs 0.000 claims 3
- 150000003456 sulfonamides Chemical class 0.000 claims 3
- 150000002431 hydrogen Chemical class 0.000 claims 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 abstract description 8
- 239000010949 copper Substances 0.000 abstract description 7
- 229910052791 calcium Inorganic materials 0.000 abstract description 6
- 229910052749 magnesium Inorganic materials 0.000 abstract description 6
- 150000007513 acids Chemical class 0.000 abstract description 5
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 abstract description 4
- 229910052742 iron Inorganic materials 0.000 abstract description 4
- 239000011572 manganese Substances 0.000 abstract description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 abstract description 3
- 229910052802 copper Inorganic materials 0.000 abstract description 3
- 229910052748 manganese Inorganic materials 0.000 abstract description 3
- 150000003458 sulfonic acid derivatives Chemical class 0.000 abstract description 3
- 239000002243 precursor Substances 0.000 abstract description 2
- 229910001428 transition metal ion Inorganic materials 0.000 abstract description 2
- 235000002908 manganese Nutrition 0.000 abstract 1
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 description 17
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 14
- 239000011777 magnesium Substances 0.000 description 11
- 239000011575 calcium Substances 0.000 description 10
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 9
- 229910052723 transition metal Inorganic materials 0.000 description 8
- 150000003624 transition metals Chemical class 0.000 description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 238000007792 addition Methods 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 230000015556 catabolic process Effects 0.000 description 5
- 238000006731 degradation reaction Methods 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 150000001342 alkaline earth metals Chemical class 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000000123 paper Substances 0.000 description 4
- 229920002401 polyacrylamide Polymers 0.000 description 4
- 229920000058 polyacrylate Polymers 0.000 description 4
- 230000000087 stabilizing effect Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 3
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910021645 metal ion Inorganic materials 0.000 description 3
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 3
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M sodium polyacrylate Chemical compound [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 description 3
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 2
- 240000000491 Corchorus aestuans Species 0.000 description 2
- 235000011777 Corchorus aestuans Nutrition 0.000 description 2
- 235000010862 Corchorus capsularis Nutrition 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 2
- 229920001131 Pulp (paper) Polymers 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 229910001424 calcium ion Inorganic materials 0.000 description 2
- 239000002738 chelating agent Substances 0.000 description 2
- 229910001431 copper ion Inorganic materials 0.000 description 2
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 2
- DKPHLYCEFBDQKM-UHFFFAOYSA-H hexapotassium;1-phosphonato-n,n-bis(phosphonatomethyl)methanamine Chemical compound [K+].[K+].[K+].[K+].[K+].[K+].[O-]P([O-])(=O)CN(CP([O-])([O-])=O)CP([O-])([O-])=O DKPHLYCEFBDQKM-UHFFFAOYSA-H 0.000 description 2
- 239000002655 kraft paper Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229960003330 pentetic acid Drugs 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000004076 pulp bleaching Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 239000004386 Erythritol Substances 0.000 description 1
- UNXHWFMMPAWVPI-UHFFFAOYSA-N Erythritol Natural products OCC(O)C(O)CO UNXHWFMMPAWVPI-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 240000001987 Pyrus communis Species 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 229940090960 diethylenetriamine pentamethylene phosphonic acid Drugs 0.000 description 1
- 229940042400 direct acting antivirals phosphonic acid derivative Drugs 0.000 description 1
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 description 1
- UNXHWFMMPAWVPI-ZXZARUISSA-N erythritol Chemical compound OC[C@H](O)[C@H](O)CO UNXHWFMMPAWVPI-ZXZARUISSA-N 0.000 description 1
- 229940009714 erythritol Drugs 0.000 description 1
- 235000019414 erythritol Nutrition 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 238000009897 hydrogen peroxide bleaching Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910001437 manganese ion Inorganic materials 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 150000003007 phosphonic acid derivatives Chemical class 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- AZIQALWHRUQPHV-UHFFFAOYSA-N prop-2-eneperoxoic acid Chemical compound OOC(=O)C=C AZIQALWHRUQPHV-UHFFFAOYSA-N 0.000 description 1
- GJAWHXHKYYXBSV-UHFFFAOYSA-N quinolinic acid Chemical compound OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/037—Stabilisation by additives
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3937—Stabilising agents
- C11D3/394—Organic compounds
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/10—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs using agents which develop oxygen
- D06L4/12—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs using agents which develop oxygen combined with specific additives
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21C—PRODUCTION OF CELLULOSE BY REMOVING NON-CELLULOSE SUBSTANCES FROM CELLULOSE-CONTAINING MATERIALS; REGENERATION OF PULPING LIQUORS; APPARATUS THEREFOR
- D21C9/00—After-treatment of cellulose pulp, e.g. of wood pulp, or cotton linters ; Treatment of dilute or dewatered pulp or process improvement taking place after obtaining the raw cellulosic material and not provided for elsewhere
- D21C9/10—Bleaching ; Apparatus therefor
- D21C9/16—Bleaching ; Apparatus therefor with per compounds
- D21C9/163—Bleaching ; Apparatus therefor with per compounds with peroxides
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Wood Science & Technology (AREA)
- Textile Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Detergent Compositions (AREA)
- Paper (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US686,111 | 1984-12-24 | ||
| US06/686,111 US4614646A (en) | 1984-12-24 | 1984-12-24 | Stabilization of peroxide systems in the presence of alkaline earth metal ions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1235881A true CA1235881A (en) | 1988-05-03 |
Family
ID=24754964
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000496865A Expired CA1235881A (en) | 1984-12-24 | 1985-12-04 | Stabilization of peroxide systems in the presence of alkaline earth metal ions |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4614646A (enExample) |
| EP (1) | EP0186990B1 (enExample) |
| JP (1) | JPS61155208A (enExample) |
| AR (1) | AR240302A1 (enExample) |
| AU (1) | AU576280B2 (enExample) |
| BR (1) | BR8506446A (enExample) |
| CA (1) | CA1235881A (enExample) |
| DE (1) | DE3584669D1 (enExample) |
| DK (1) | DK167491B1 (enExample) |
| FI (1) | FI79825C (enExample) |
| NO (1) | NO168940C (enExample) |
| NZ (1) | NZ214537A (enExample) |
| ZA (1) | ZA859707B (enExample) |
Families Citing this family (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5180514A (en) * | 1985-06-17 | 1993-01-19 | The Clorox Company | Stabilizing system for liquid hydrogen peroxide compositions |
| US4744968A (en) * | 1985-09-03 | 1988-05-17 | Technicon Instruments Corporation | Stabilized aqueous hydrogen peroxide solution |
| US4959075A (en) * | 1985-12-23 | 1990-09-25 | Henkel Kommanditgesellschaft Auf Aktien | Silicate- and magnesium-free stabilizer hydrogen peroxide mixtures for bleaching processes |
| DE3545909A1 (de) * | 1985-12-23 | 1987-06-25 | Henkel Kgaa | Silikat- und magnesiumfreie wirkstoffgemische |
| US4732650A (en) * | 1986-09-15 | 1988-03-22 | The Dow Chemical Company | Bleaching of cellulosic pulps using hydrogen peroxide |
| US4889689A (en) * | 1986-10-14 | 1989-12-26 | Ciba-Geigy Corporation | Method of disinfecting a soft contact lens with a diethylene triamine penta(methylenephosphonic acid) stabilized hydrogen peroxide solution |
| US4963157A (en) * | 1987-04-17 | 1990-10-16 | Nippon Peroxide Co., Ltd. | Method for bleaching cellulosic fiber material with hydrogen peroxide |
| DE3720277A1 (de) * | 1987-06-19 | 1988-12-29 | Degussa | Verfahren zur verminderung der neigung zum zusammenbacken von teilchenfoermigen aktivsauerstoffverbindungen |
| FR2632625B1 (fr) * | 1988-06-13 | 1990-09-07 | Atochem | Stabilisation du peroxyde d'hydrogene |
| US5607698A (en) * | 1988-08-04 | 1997-03-04 | Ciba-Geigy Corporation | Method of preserving ophthalmic solution and compositions therefor |
| GB8826431D0 (en) * | 1988-11-11 | 1988-12-14 | Albright & Wilson | Phosphate composition |
| GB8925376D0 (en) * | 1989-11-09 | 1989-12-28 | Interox Chemicals Ltd | Stabilisation of concentrated hydrogen peroxide solutions |
| US5145558A (en) * | 1989-11-15 | 1992-09-08 | The Dow Chemical Company | Composition for alkaline peroxide bleaching of wood pulp using a quaternary amine as additive |
| US5013404A (en) * | 1989-11-15 | 1991-05-07 | The Dow Chemical Company | Process for alkaline peroxide bleaching of wood pulp using a quaternary amine as additive |
| JP2602563B2 (ja) * | 1989-12-15 | 1997-04-23 | 花王株式会社 | 液体酸素系漂白剤組成物 |
| GB9007232D0 (en) * | 1990-03-30 | 1990-05-30 | Monsanto Europe Sa | Method for the preparation and/or maintenance of alkaline bleaching baths and hydrogen peroxide solutions for use therein |
| US5207919A (en) * | 1990-04-16 | 1993-05-04 | Baker Hughes Incorporated | Metal ion complexes for use as scale inhibitors |
| US5057228A (en) * | 1990-04-16 | 1991-10-15 | Baker Hughes Incorporated | Metal ion complexes for use as scale inhibitors |
| DE4035813A1 (de) * | 1990-11-10 | 1992-05-14 | Akzo Gmbh | Sauerstoffbleichung |
| JP3075290B2 (ja) * | 1991-02-28 | 2000-08-14 | 三菱瓦斯化学株式会社 | 半導体基板の洗浄液 |
| US5205907A (en) * | 1991-11-25 | 1993-04-27 | Macmillan Bloedel Limited | Removal of manganese from pulp using a chelating agent and magnesium sulphate |
| US5223091A (en) * | 1991-11-25 | 1993-06-29 | Macmillan Bloedel Limited | Method of brightening mechanical pulp using silicate-free peroxide bleaching |
| CA2063351C (en) * | 1992-03-18 | 1996-08-13 | Stanley Alan Heimburger | Process for bleaching hardwood pulp |
| US5292449A (en) * | 1992-11-24 | 1994-03-08 | Akzo Nv | Scale inhibiting composition |
| EP0678572A1 (en) * | 1994-04-20 | 1995-10-25 | The Procter & Gamble Company | Detergent powder compositions |
| US5780419A (en) * | 1994-04-20 | 1998-07-14 | The Procter & Gamble Company | Detergent powder compositions comprising metal ion-chelant complex and anionic functional polymer |
| DE4416208A1 (de) * | 1994-05-07 | 1995-11-09 | Henkel Kgaa | Verwendung von phosphorfreien, wasserlöslichen Polymeren und Polyhydroxymono- oder dicarboxylaten zur Stabilisierung von Erdalkalisilikaten bei der Textilbleiche |
| JPH10140192A (ja) * | 1996-11-05 | 1998-05-26 | Hoechst Ind Kk | 過酸化水素含有漂白液およびそれによる漂白法 |
| ATE254688T1 (de) | 1997-08-14 | 2003-12-15 | Takashi Watanabe | Chemisches verfahren zur depolymerisation von lignin |
| US6120554A (en) * | 1998-02-02 | 2000-09-19 | American Renewable Resources Llc | Catalyzed alkaline hydrogen peroxide bleaching of dye-containing cellulose textiles |
| US7550123B2 (en) * | 2000-03-03 | 2009-06-23 | Steen Research, Llc | Method and apparatus for use of reacted hydrogen peroxide compounds in industrial process waters |
| AU2001245416A1 (en) * | 2000-03-03 | 2001-09-17 | Steen Research, Llc | Method and apparatus for use of reacted hydrogen peroxide compounds in industrial process waters |
| FR2820034B1 (fr) * | 2001-01-26 | 2003-05-02 | Oreal | Composition oxydante pour le traitement des matieres keratiniques comprenant un poly(vinyllactame) cationique |
| US20070092582A1 (en) * | 2002-01-18 | 2007-04-26 | Fu-Pao Tsao | Methods of preserving ophthalmic solutions and preserved ophthalmic solutions |
| US7591780B2 (en) | 2002-03-18 | 2009-09-22 | Sterling Lc | Miniaturized imaging device with integrated circuit connector system |
| US7459005B2 (en) * | 2002-11-22 | 2008-12-02 | Akzo Nobel N.V. | Chemical composition and method |
| US8262850B2 (en) * | 2003-09-23 | 2012-09-11 | International Paper Company | Chemical activation and refining of southern pine kraft fibers |
| ITMI20040162A1 (it) * | 2004-02-02 | 2004-05-02 | Bozzetto Giovanni Spa | Uso di polliaaminometilenfosfonati quali agenti disperdenti |
| WO2005087951A2 (en) | 2004-03-05 | 2005-09-22 | Gen-Probe Incorporated | Reagents, methods and kits for use in deactivating nucleic acids |
| US7351764B2 (en) * | 2004-03-31 | 2008-04-01 | Nalco Company | Methods to enhance brightness of pulp and optimize use of bleaching chemicals |
| EP2840182B1 (en) | 2005-05-02 | 2019-07-03 | International Paper Company | Ligno cellulosic materials and the products made therefrom |
| US20070048389A1 (en) * | 2005-08-26 | 2007-03-01 | Fu-Pao Tsao | Stabilized and preserved ketotifen ophthalmic compositions |
| US20070048388A1 (en) * | 2005-08-26 | 2007-03-01 | Fu-Pao Tsao | Stabilized and preserved ketotifen ophthalmic compositions |
| US8138106B2 (en) | 2005-09-30 | 2012-03-20 | Rayonier Trs Holdings Inc. | Cellulosic fibers with odor control characteristics |
| BRPI0803102A2 (pt) * | 2007-05-01 | 2011-11-01 | Sicor Inc | um processo para preparar drospirenona e intermediários da mesma |
| US20090004288A1 (en) * | 2007-06-29 | 2009-01-01 | Collins Gary L | Stabilized ophthalmic solutions |
| FR2932093B1 (fr) * | 2008-06-05 | 2012-07-20 | Anios Lab Sarl | Composition pour la desinfection et la decontamination simultanees de corps contamines par des agents transmissibles conventionnels (atc) et non conventionnels (atnc). |
| WO2010053916A2 (en) | 2008-11-04 | 2010-05-14 | Sterling Lc | Method and device for wavelength shifted imaging |
| GB0901207D0 (en) | 2009-01-26 | 2009-03-11 | Innospec Ltd | Chelating agents and methods relating thereto |
| US9511167B2 (en) | 2009-05-28 | 2016-12-06 | Gp Cellulose Gmbh | Modified cellulose from chemical kraft fiber and methods of making and using the same |
| US9512563B2 (en) | 2009-05-28 | 2016-12-06 | Gp Cellulose Gmbh | Surface treated modified cellulose from chemical kraft fiber and methods of making and using same |
| US9512237B2 (en) | 2009-05-28 | 2016-12-06 | Gp Cellulose Gmbh | Method for inhibiting the growth of microbes with a modified cellulose fiber |
| KR101805048B1 (ko) | 2009-05-28 | 2017-12-05 | 게페 첼루로제 게엠베하 | 화학적 크래프트 섬유로부터의 변형된 셀룰로즈 및 이들을 제조 및 사용하는 방법 |
| US20120097350A1 (en) * | 2009-06-15 | 2012-04-26 | Arkema Inc. | Alkaline peroxide treatment of rejects in an intergrated neutral-alkaline paper mill |
| US9144664B2 (en) | 2009-10-01 | 2015-09-29 | Sarcos Lc | Method and apparatus for manipulating movement of a micro-catheter |
| CA2877908C (en) | 2012-06-28 | 2019-05-28 | Steen Research, Llc | Methods and equipment for treatment of odorous gas streams from industrial plants |
| EP2948194A4 (en) | 2013-01-22 | 2017-01-25 | Steen Research, LLC | Methods and equipment for treatment of odorous gas streams |
| US10138598B2 (en) | 2013-03-14 | 2018-11-27 | Gp Cellulose Gmbh | Method of making a highly functional, low viscosity kraft fiber using an acidic bleaching sequence and a fiber made by the process |
| EP2971338A2 (en) | 2013-03-15 | 2016-01-20 | GP Cellulose GmbH | A low viscosity kraft fiber having an enhanced carboxyl content and methods of making and using the same |
| EP3496840A4 (en) | 2016-08-15 | 2020-03-04 | Steen Research, LLC | METHOD FOR REMOVING A NITROGEN-BASED CONNECTION FROM A GAS OR LIQUID FLOW FOR PRODUCING A NITROGEN-BASED PRODUCT |
| CA3040734A1 (en) | 2016-11-16 | 2018-05-24 | Gp Cellulose Gmbh | Modified cellulose from chemical fiber and methods of making and using the same |
| RU2729701C1 (ru) | 2017-03-21 | 2020-08-11 | Интернэшнл Пэйпа Кампани | Целлюлозная композиция со способностью устранения неприятного запаха |
| CN111770895A (zh) * | 2018-02-27 | 2020-10-13 | 凯米拉公司 | 用于在水性环境中稳定铁化合物的组合物和方法及组合物的用途 |
| JP7061758B2 (ja) * | 2018-07-11 | 2022-05-02 | 中部キレスト株式会社 | 過酸化水素安定化剤および過酸化水素組成物 |
| KR20210037665A (ko) * | 2018-08-02 | 2021-04-06 | 에보닉 코포레이션 | 중합체-안정화된 과산화수소 수용액 및 관련 방법 |
| BR112021001898A2 (pt) * | 2018-08-02 | 2021-04-27 | Evonik Corporation | processo para preparar uma solução aquosa de peróxido de hidrogênio estabilizada |
| CA3153019A1 (en) | 2019-08-28 | 2021-03-04 | Steen Research, Llc | Methods for absorbing a targeted compound from a gas stream for subsequent processing or use |
| CA3074198A1 (en) * | 2020-02-28 | 2021-08-28 | Fluid Energy Group Ltd. | Modified methanesulfonic acid and uses thereof |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL130828C (enExample) * | 1959-06-03 | |||
| US3234140A (en) * | 1964-06-05 | 1966-02-08 | Monsanto Co | Stabilization of peroxy solutions |
| DE1806594C3 (de) * | 1968-11-02 | 1979-05-03 | Joh. A. Benckiser Gmbh, 6700 Ludwigshafen | Verwendung eines Gemisches aus Aminoalkylenphosphonsäure und polymerer Verbindungen zur Verhinderung von Steinbildenden Ablagerungen in wässrigen Systemen |
| US3701825A (en) * | 1970-10-23 | 1972-10-31 | Fmc Corp | Stabilization of hydrogen peroxide with ethylenediamine tetra (methylenephosphonic acid) |
| BE795085A (fr) * | 1972-03-10 | 1973-05-29 | Benckiser Knapsack Gmbh | Procede de blanchiment de fibres cellulosiques seules ou en melange avec des fibres synthetiques |
| DE2506799B2 (de) * | 1975-02-18 | 1977-03-31 | Basf Ag, 6700 Ludwigshafen | Verfahren zur stabilisierung alkalischer, silikat und erdalkalimetallhaltige peroxidstabilisatoren enthaltender peroxidbleichflotten |
| US4130501A (en) * | 1976-09-20 | 1978-12-19 | Fmc Corporation | Stable viscous hydrogen peroxide solutions containing a surfactant and a method of preparing the same |
| US4132762A (en) * | 1977-10-31 | 1979-01-02 | Shell Oil Company | Hydrogen peroxide stabilization |
| GB2033937B (en) * | 1978-09-27 | 1983-07-27 | Unilever Ltd | Bleaching and cleaning composition |
| US4239643A (en) * | 1979-01-02 | 1980-12-16 | Monsanto Company | Peroxide stabilization |
| US4294575A (en) * | 1979-01-02 | 1981-10-13 | Monsanto Company | Peroxide stabilization |
| US4238282A (en) * | 1979-07-23 | 1980-12-09 | Nalco Chemical Company | Chemical treatments in bleaching stages which increase pulp brightness |
| US4333844A (en) * | 1979-11-12 | 1982-06-08 | Lever Brothers Company | Detergent compositions |
| FR2476684A1 (fr) * | 1980-02-21 | 1981-08-28 | Interox | Procede pour inhiber la corrosion d'appareils en titane |
| GB8312185D0 (en) * | 1983-05-04 | 1983-06-08 | Unilever Plc | Bleaching and cleaning composition |
| DE3472571D1 (en) * | 1983-08-27 | 1988-08-11 | Procter & Gamble | Detergent compositions |
| DE3423452A1 (de) * | 1984-06-26 | 1986-01-02 | Sandoz-Patent-GmbH, 7850 Lörrach | Stabilisierende mischung zur peroxidbleiche zellulosehaltiger materialien |
-
1984
- 1984-12-24 US US06/686,111 patent/US4614646A/en not_active Expired - Lifetime
-
1985
- 1985-12-04 CA CA000496865A patent/CA1235881A/en not_active Expired
- 1985-12-06 AR AR302499A patent/AR240302A1/es active
- 1985-12-10 EP EP85308960A patent/EP0186990B1/en not_active Expired - Lifetime
- 1985-12-10 DE DE8585308960T patent/DE3584669D1/de not_active Expired - Fee Related
- 1985-12-12 NZ NZ214537A patent/NZ214537A/xx unknown
- 1985-12-16 AU AU51256/85A patent/AU576280B2/en not_active Ceased
- 1985-12-19 ZA ZA859707A patent/ZA859707B/xx unknown
- 1985-12-23 DK DK604285A patent/DK167491B1/da active
- 1985-12-23 BR BR8506446A patent/BR8506446A/pt not_active IP Right Cessation
- 1985-12-23 JP JP60288047A patent/JPS61155208A/ja active Granted
- 1985-12-23 FI FI855151A patent/FI79825C/fi not_active IP Right Cessation
- 1985-12-23 NO NO855253A patent/NO168940C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI79825C (fi) | 1990-03-12 |
| EP0186990A2 (en) | 1986-07-09 |
| FI855151A0 (fi) | 1985-12-23 |
| NO168940C (no) | 1992-04-29 |
| DK604285A (da) | 1986-06-25 |
| DE3584669D1 (de) | 1991-12-19 |
| NO855253L (no) | 1986-06-25 |
| DK604285D0 (da) | 1985-12-23 |
| BR8506446A (pt) | 1986-09-02 |
| ZA859707B (en) | 1987-08-26 |
| JPH0549602B2 (enExample) | 1993-07-26 |
| US4614646A (en) | 1986-09-30 |
| AR240302A1 (es) | 1990-03-30 |
| EP0186990B1 (en) | 1991-11-13 |
| NZ214537A (en) | 1989-08-29 |
| JPS61155208A (ja) | 1986-07-14 |
| EP0186990A3 (en) | 1987-11-19 |
| FI855151L (fi) | 1986-06-25 |
| AU5125685A (en) | 1986-07-03 |
| FI79825B (fi) | 1989-11-30 |
| NO168940B (no) | 1992-01-13 |
| DK167491B1 (da) | 1993-11-08 |
| AU576280B2 (en) | 1988-08-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1235881A (en) | Stabilization of peroxide systems in the presence of alkaline earth metal ions | |
| CA1106574A (en) | Stabilisation of hydrogen peroxide | |
| CA1284558C (en) | Bleaching of cellulosic pulps using hydrogen peroxide | |
| US3766078A (en) | Processes for stabilizing peroxy solutions | |
| US3234140A (en) | Stabilization of peroxy solutions | |
| US5464563A (en) | Bleaching composition | |
| CA1137256A (en) | Chemical treatments in bleaching stages which increase pulp brightness | |
| US5616280A (en) | Bleaching composition | |
| US4752354A (en) | Process and composition for bleaching wood pulp | |
| US5013404A (en) | Process for alkaline peroxide bleaching of wood pulp using a quaternary amine as additive | |
| US4963157A (en) | Method for bleaching cellulosic fiber material with hydrogen peroxide | |
| WO1997006303B1 (de) | Verfahren zur stabilisierung von alkalischen peroxidenthaltenden bleichflotten für die bleiche von zellstoffen und anderen faserstoffen | |
| US4384970A (en) | Stabilizing compositions for peroxide products | |
| JPH0434595B2 (enExample) | ||
| EP0369711B1 (en) | Phosphate composition and uses thereof | |
| US5145558A (en) | Composition for alkaline peroxide bleaching of wood pulp using a quaternary amine as additive | |
| US20030216275A1 (en) | Nª,n -dialkyl aminomethylenephosphonic acids and use thereof | |
| JPH07109107A (ja) | 次亜塩素酸塩水溶液の安定化剤 | |
| EP1276744A1 (en) | N-alpha , n-omega -dialkyl aminomethylenephosphonic acids and use thereof | |
| JP2533104B2 (ja) | 砕木パルプの酸化漂白法 | |
| CN118979373A (zh) | 一种生物基氧漂稳定剂及其制备方法和应用 | |
| US3829358A (en) | Groundwood pulp bleaching with sodium hydrosulfite containing diglycolates |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |