CA1077957A - Hypolipidemic 4-(monoalkylamino) benzoic acid derivatives - Google Patents
Hypolipidemic 4-(monoalkylamino) benzoic acid derivativesInfo
- Publication number
- CA1077957A CA1077957A CA210,303A CA210303A CA1077957A CA 1077957 A CA1077957 A CA 1077957A CA 210303 A CA210303 A CA 210303A CA 1077957 A CA1077957 A CA 1077957A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- formula
- benzoic acid
- ethyl
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000000055 hyoplipidemic effect Effects 0.000 title description 11
- 150000001558 benzoic acid derivatives Chemical class 0.000 title description 7
- 150000003839 salts Chemical class 0.000 claims abstract description 24
- 235000010233 benzoic acid Nutrition 0.000 claims abstract description 10
- 150000001875 compounds Chemical class 0.000 claims description 60
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 claims description 42
- -1 aryl sulfonate ester Chemical group 0.000 claims description 34
- 125000000217 alkyl group Chemical group 0.000 claims description 33
- 239000000047 product Substances 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 30
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 29
- 239000002253 acid Substances 0.000 claims description 26
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 16
- QXWKHSSBFQDQPR-UHFFFAOYSA-N 4-(hexadecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 QXWKHSSBFQDQPR-UHFFFAOYSA-N 0.000 claims description 15
- 150000007513 acids Chemical class 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 230000007062 hydrolysis Effects 0.000 claims description 12
- 238000006460 hydrolysis reaction Methods 0.000 claims description 12
- 239000002585 base Substances 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- 239000005711 Benzoic acid Substances 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- 150000002431 hydrogen Chemical group 0.000 claims description 6
- OCHHYNXJGSPCKN-UHFFFAOYSA-N 4-(pentadecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 OCHHYNXJGSPCKN-UHFFFAOYSA-N 0.000 claims description 5
- 150000008052 alkyl sulfonates Chemical group 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 230000009467 reduction Effects 0.000 claims description 5
- 238000006722 reduction reaction Methods 0.000 claims description 5
- HNTGIJLWHDPAFN-UHFFFAOYSA-N 1-bromohexadecane Chemical compound CCCCCCCCCCCCCCCCBr HNTGIJLWHDPAFN-UHFFFAOYSA-N 0.000 claims description 4
- NPFIXBKVMRANIW-UHFFFAOYSA-N 4-(heptadecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 NPFIXBKVMRANIW-UHFFFAOYSA-N 0.000 claims description 4
- 230000001476 alcoholic effect Effects 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 claims description 4
- NIOYUNMRJMEDGI-UHFFFAOYSA-N hexadecanal Chemical compound CCCCCCCCCCCCCCCC=O NIOYUNMRJMEDGI-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 4
- JERBHTIKPOTHFN-UHFFFAOYSA-N 4-(tetradecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 JERBHTIKPOTHFN-UHFFFAOYSA-N 0.000 claims description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 239000000460 chlorine Chemical group 0.000 claims description 2
- 125000000524 functional group Chemical group 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims description 2
- 238000007254 oxidation reaction Methods 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 7
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 claims 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims 3
- 230000003301 hydrolyzing effect Effects 0.000 claims 3
- 125000002252 acyl group Chemical group 0.000 claims 2
- 239000003638 chemical reducing agent Substances 0.000 claims 2
- HHSDZLLPIXMEIU-UHFFFAOYSA-N 1-bromoheptadecane Chemical compound CCCCCCCCCCCCCCCCCBr HHSDZLLPIXMEIU-UHFFFAOYSA-N 0.000 claims 1
- JKOTZBXSNOGCIF-UHFFFAOYSA-N 1-bromopentadecane Chemical compound CCCCCCCCCCCCCCCBr JKOTZBXSNOGCIF-UHFFFAOYSA-N 0.000 claims 1
- KOFZTCSTGIWCQG-UHFFFAOYSA-N 1-bromotetradecane Chemical compound CCCCCCCCCCCCCCBr KOFZTCSTGIWCQG-UHFFFAOYSA-N 0.000 claims 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- 125000005228 aryl sulfonate group Chemical group 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Chemical group 0.000 claims 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims 1
- 238000006555 catalytic reaction Methods 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 229910052731 fluorine Inorganic materials 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- ARBOVOVUTSQWSS-UHFFFAOYSA-N hexadecanoyl chloride Chemical compound CCCCCCCCCCCCCCCC(Cl)=O ARBOVOVUTSQWSS-UHFFFAOYSA-N 0.000 claims 1
- 239000011780 sodium chloride Substances 0.000 claims 1
- 150000002148 esters Chemical class 0.000 abstract description 19
- 210000002966 serum Anatomy 0.000 abstract description 15
- 150000002632 lipids Chemical class 0.000 abstract description 9
- 150000001559 benzoic acids Chemical class 0.000 abstract description 5
- 241000124008 Mammalia Species 0.000 abstract description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 110
- 239000000203 mixture Substances 0.000 description 64
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 24
- 239000007787 solid Substances 0.000 description 23
- 239000013078 crystal Substances 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 229940050390 benzoate Drugs 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 229960000443 hydrochloric acid Drugs 0.000 description 12
- 235000011167 hydrochloric acid Nutrition 0.000 description 12
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- 229940093956 potassium carbonate Drugs 0.000 description 12
- 235000011181 potassium carbonates Nutrition 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 8
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 8
- 229930182558 Sterol Natural products 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 150000003432 sterols Chemical class 0.000 description 8
- 235000003702 sterols Nutrition 0.000 description 8
- 239000002775 capsule Substances 0.000 description 7
- VCFLGAOCYOZUMD-UHFFFAOYSA-N ethyl 4-(hexadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 VCFLGAOCYOZUMD-UHFFFAOYSA-N 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 150000001350 alkyl halides Chemical class 0.000 description 6
- 150000003904 phospholipids Chemical class 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 6
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 238000005917 acylation reaction Methods 0.000 description 5
- 229940076134 benzene Drugs 0.000 description 5
- 235000005911 diet Nutrition 0.000 description 5
- 230000037213 diet Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- XJPFHIYOQHZAOW-UHFFFAOYSA-N 4-(dodecylamino)benzoic acid Chemical compound CCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 XJPFHIYOQHZAOW-UHFFFAOYSA-N 0.000 description 4
- 229920002261 Corn starch Polymers 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 229940100198 alkylating agent Drugs 0.000 description 4
- 239000002168 alkylating agent Substances 0.000 description 4
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 4
- 239000008120 corn starch Substances 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000006188 syrup Substances 0.000 description 4
- 235000020357 syrup Nutrition 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000699694 Gerbillinae Species 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- WVHBHPATSLQXGC-UHFFFAOYSA-N benzene;ethanol Chemical compound CCO.C1=CC=CC=C1 WVHBHPATSLQXGC-UHFFFAOYSA-N 0.000 description 3
- CMDKPGRTAQVGFQ-RMKNXTFCSA-N cinoxate Chemical compound CCOCCOC(=O)\C=C\C1=CC=C(OC)C=C1 CMDKPGRTAQVGFQ-RMKNXTFCSA-N 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- VGCWDPSEZSPOQV-UHFFFAOYSA-N ethyl 3-(hexadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCCNC1=CC=CC(C(=O)OCC)=C1 VGCWDPSEZSPOQV-UHFFFAOYSA-N 0.000 description 3
- FRUOAAOGFLFXMB-UHFFFAOYSA-N ethyl 4-(heptadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 FRUOAAOGFLFXMB-UHFFFAOYSA-N 0.000 description 3
- DGGGBDLOUZPPQJ-UHFFFAOYSA-N ethyl 4-(tetradecylamino)benzoate Chemical compound CCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 DGGGBDLOUZPPQJ-UHFFFAOYSA-N 0.000 description 3
- MPKWKBNGMMLYKV-UHFFFAOYSA-N ethyl 4-(tridecylamino)benzoate Chemical compound CCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 MPKWKBNGMMLYKV-UHFFFAOYSA-N 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 2
- FDIAQFIWISNAQO-UHFFFAOYSA-N 4-(nonadecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 FDIAQFIWISNAQO-UHFFFAOYSA-N 0.000 description 2
- GEISIMATOLPHFV-UHFFFAOYSA-N 4-(octadecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 GEISIMATOLPHFV-UHFFFAOYSA-N 0.000 description 2
- UOPFJBGJNMUVAW-UHFFFAOYSA-N 4-(octylamino)benzoic acid Chemical compound CCCCCCCCNC1=CC=C(C(O)=O)C=C1 UOPFJBGJNMUVAW-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- 229940086681 4-aminobenzoate Drugs 0.000 description 2
- 201000001320 Atherosclerosis Diseases 0.000 description 2
- 241000167854 Bourreria succulenta Species 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 125000003047 N-acetyl group Chemical group 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 229960004050 aminobenzoic acid Drugs 0.000 description 2
- 230000003444 anaesthetic effect Effects 0.000 description 2
- 239000003524 antilipemic agent Substances 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 230000036765 blood level Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000019693 cherries Nutrition 0.000 description 2
- 239000007958 cherry flavor Substances 0.000 description 2
- 235000012000 cholesterol Nutrition 0.000 description 2
- 229940107161 cholesterol Drugs 0.000 description 2
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 2
- 229960001214 clofibrate Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 2
- 229940008406 diethyl sulfate Drugs 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- QGKMIOPBDSQNBK-UHFFFAOYSA-N ethyl 4-(hexylamino)benzoate Chemical compound CCCCCCNC1=CC=C(C(=O)OCC)C=C1 QGKMIOPBDSQNBK-UHFFFAOYSA-N 0.000 description 2
- LANWANJHTIFLHR-UHFFFAOYSA-N ethyl 4-(nonadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 LANWANJHTIFLHR-UHFFFAOYSA-N 0.000 description 2
- OPXKELKVCZNZNP-UHFFFAOYSA-N ethyl 4-(octadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 OPXKELKVCZNZNP-UHFFFAOYSA-N 0.000 description 2
- HJGYCVSNMOFJDP-UHFFFAOYSA-N ethyl 4-(pentadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 HJGYCVSNMOFJDP-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000003589 local anesthetic agent Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- LZXXNPOYQCLXRS-UHFFFAOYSA-N methyl 4-aminobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1 LZXXNPOYQCLXRS-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- MBXNQZHITVCSLJ-UHFFFAOYSA-N methyl fluorosulfonate Chemical compound COS(F)(=O)=O MBXNQZHITVCSLJ-UHFFFAOYSA-N 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 229960002900 methylcellulose Drugs 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 239000004299 sodium benzoate Substances 0.000 description 2
- 235000010234 sodium benzoate Nutrition 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 150000003626 triacylglycerols Chemical class 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- GEAOJWKXHMGANA-UHFFFAOYSA-N $l^{1}-stannane Chemical compound [SnH] GEAOJWKXHMGANA-UHFFFAOYSA-N 0.000 description 1
- FJLUATLTXUNBOT-UHFFFAOYSA-N 1-Hexadecylamine Chemical compound CCCCCCCCCCCCCCCCN FJLUATLTXUNBOT-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- SXVRSCIZJBGJGB-UHFFFAOYSA-N 1-chloropropan-2-ylbenzene Chemical compound ClCC(C)C1=CC=CC=C1 SXVRSCIZJBGJGB-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- GIUUCQVKMWBSRT-UHFFFAOYSA-N 2-bromododecane Chemical compound CCCCCCCCCCC(C)Br GIUUCQVKMWBSRT-UHFFFAOYSA-N 0.000 description 1
- BBSGKRZCCPTXTC-UHFFFAOYSA-N 3-(hexadecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCCCNC1=CC=CC(C(O)=O)=C1 BBSGKRZCCPTXTC-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- JYKPLFBDBCGSKA-UHFFFAOYSA-N 4-(dodecan-2-ylamino)benzoic acid Chemical compound CCCCCCCCCCC(C)NC1=CC=C(C(O)=O)C=C1 JYKPLFBDBCGSKA-UHFFFAOYSA-N 0.000 description 1
- SJYYPRBPSAAUIH-UHFFFAOYSA-N 4-(hexadecylamino)benzoic acid;hydrochloride Chemical compound Cl.CCCCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 SJYYPRBPSAAUIH-UHFFFAOYSA-N 0.000 description 1
- LXOKKPODGWECLI-UHFFFAOYSA-N 4-(hexylamino)benzoic acid Chemical compound CCCCCCNC1=CC=C(C(O)=O)C=C1 LXOKKPODGWECLI-UHFFFAOYSA-N 0.000 description 1
- ZGUSAZNJASVWEY-UHFFFAOYSA-N 4-(tridecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 ZGUSAZNJASVWEY-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- ZHMAQGUCJTXHEM-UHFFFAOYSA-N 4-[acetyl(hexadecyl)amino]benzoic acid Chemical compound CCCCCCCCCCCCCCCCN(C(C)=O)C1=CC=C(C(O)=O)C=C1 ZHMAQGUCJTXHEM-UHFFFAOYSA-N 0.000 description 1
- YVTMANRNFDBNJU-UHFFFAOYSA-N 4-[ethyl(heptadecyl)amino]benzoic acid Chemical compound CCCCCCCCCCCCCCCCCN(CC)C1=CC=C(C(O)=O)C=C1 YVTMANRNFDBNJU-UHFFFAOYSA-N 0.000 description 1
- AJQJXNZNRGZLCV-UHFFFAOYSA-N 4-[ethyl(hexadecyl)amino]benzoic acid Chemical compound CCCCCCCCCCCCCCCCN(CC)C1=CC=C(C(O)=O)C=C1 AJQJXNZNRGZLCV-UHFFFAOYSA-N 0.000 description 1
- IDZZQQALEWGWKY-UHFFFAOYSA-N 4-[ethyl(octadecyl)amino]benzoic acid Chemical compound CCCCCCCCCCCCCCCCCCN(CC)C1=CC=C(C(O)=O)C=C1 IDZZQQALEWGWKY-UHFFFAOYSA-N 0.000 description 1
- ITBZZXUNTUJHNJ-UHFFFAOYSA-N 4-[ethyl(tetradecyl)amino]benzoic acid Chemical compound CCCCCCCCCCCCCCN(CC)C1=CC=C(C(O)=O)C=C1 ITBZZXUNTUJHNJ-UHFFFAOYSA-N 0.000 description 1
- UHSPSWKQELNGSB-UHFFFAOYSA-N 4-[heptadecyl(methyl)amino]benzoic acid Chemical compound CCCCCCCCCCCCCCCCCN(C)C1=CC=C(C(O)=O)C=C1 UHSPSWKQELNGSB-UHFFFAOYSA-N 0.000 description 1
- MUYUBDPZROOXQN-UHFFFAOYSA-N 4-[hexadecyl(methyl)amino]benzoic acid Chemical compound CCCCCCCCCCCCCCCCN(C)C1=CC=C(C(O)=O)C=C1 MUYUBDPZROOXQN-UHFFFAOYSA-N 0.000 description 1
- AEEAROPTARQAIP-UHFFFAOYSA-N 4-[methyl(octadecyl)amino]benzoic acid Chemical compound CCCCCCCCCCCCCCCCCCN(C)C1=CC=C(C(O)=O)C=C1 AEEAROPTARQAIP-UHFFFAOYSA-N 0.000 description 1
- YWLXLRUDGLRYDR-ZHPRIASZSA-N 5beta,20-epoxy-1,7beta,10beta,13alpha-tetrahydroxy-9-oxotax-11-ene-2alpha,4alpha-diyl 4-acetate 2-benzoate Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](O)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 YWLXLRUDGLRYDR-ZHPRIASZSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241001535291 Analges Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical compound IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 206010014476 Elevated cholesterol Diseases 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- 240000001238 Gaultheria procumbens Species 0.000 description 1
- 235000007297 Gaultheria procumbens Nutrition 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000035150 Hypercholesterolemia Diseases 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- WINXNKPZLFISPD-UHFFFAOYSA-M Saccharin sodium Chemical compound [Na+].C1=CC=C2C(=O)[N-]S(=O)(=O)C2=C1 WINXNKPZLFISPD-UHFFFAOYSA-M 0.000 description 1
- RJFAYQIBOAGBLC-BYPYZUCNSA-N Selenium-L-methionine Chemical compound C[Se]CC[C@H](N)C(O)=O RJFAYQIBOAGBLC-BYPYZUCNSA-N 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940064734 aminobenzoate Drugs 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- HYGWNUKOUCZBND-UHFFFAOYSA-N azanide Chemical compound [NH2-] HYGWNUKOUCZBND-UHFFFAOYSA-N 0.000 description 1
- JXHYCCGOZUGBFD-UHFFFAOYSA-N benzoic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=CC=C1 JXHYCCGOZUGBFD-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229940112822 chewing gum Drugs 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical class OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000003405 delayed action preparation Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229960001767 dextrothyroxine Drugs 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 229940113088 dimethylacetamide Drugs 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- ZIZAFXGDZITLPT-UHFFFAOYSA-N ethyl 4-(dodecan-2-ylamino)benzoate Chemical compound CCCCCCCCCCC(C)NC1=CC=C(C(=O)OCC)C=C1 ZIZAFXGDZITLPT-UHFFFAOYSA-N 0.000 description 1
- CYTUNEIXWQUYDZ-UHFFFAOYSA-N ethyl 4-(octylamino)benzoate Chemical compound CCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 CYTUNEIXWQUYDZ-UHFFFAOYSA-N 0.000 description 1
- BXTRQUXTYDYJCX-UHFFFAOYSA-N ethyl 4-[ethyl(hexadecyl)amino]benzoate Chemical compound CCCCCCCCCCCCCCCCN(CC)C1=CC=C(C(=O)OCC)C=C1 BXTRQUXTYDYJCX-UHFFFAOYSA-N 0.000 description 1
- GBGWJZTVXCHHIV-UHFFFAOYSA-N ethyl 4-[hexadecyl(methyl)amino]benzoate Chemical compound CCCCCCCCCCCCCCCCN(C)C1=CC=C(C(=O)OCC)C=C1 GBGWJZTVXCHHIV-UHFFFAOYSA-N 0.000 description 1
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 1
- 230000006203 ethylation Effects 0.000 description 1
- 238000006200 ethylation reaction Methods 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- KRRYGFCJUCTWMH-UHFFFAOYSA-N fluorosulfonyloxyethane Chemical compound CCOS(F)(=O)=O KRRYGFCJUCTWMH-UHFFFAOYSA-N 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000007887 hard shell capsule Substances 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 208000020346 hyperlipoproteinemia Diseases 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical group COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- QXLPXWSKPNOQLE-UHFFFAOYSA-N methylpentynol Chemical compound CCC(C)(O)C#C QXLPXWSKPNOQLE-UHFFFAOYSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 1
- IXEGRINNWXKNJO-UHFFFAOYSA-N n-hexadecylaniline Chemical compound CCCCCCCCCCCCCCCCNC1=CC=CC=C1 IXEGRINNWXKNJO-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000007968 orange flavor Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000036515 potency Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007886 soft shell capsule Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000005490 tosylate group Chemical group 0.000 description 1
- ZMCBYSBVJIMENC-UHFFFAOYSA-N tricaine Chemical compound CCOC(=O)C1=CC=CC(N)=C1 ZMCBYSBVJIMENC-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical class OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- QDNCLIPKBNMUPP-UHFFFAOYSA-N trimethyloxidanium Chemical compound C[O+](C)C QDNCLIPKBNMUPP-UHFFFAOYSA-N 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229940074411 xylene Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/52—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C229/54—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton with amino and carboxyl groups bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C229/60—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton with amino and carboxyl groups bound to carbon atoms of the same non-condensed six-membered aromatic ring with amino and carboxyl groups bound in meta- or para- positions
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Obesity (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US402212A US3868416A (en) | 1973-10-01 | 1973-10-01 | Hypolipidemic 4-(monoalkylamino)benzoic acid derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1077957A true CA1077957A (en) | 1980-05-20 |
Family
ID=23590998
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA210,303A Expired CA1077957A (en) | 1973-10-01 | 1974-09-30 | Hypolipidemic 4-(monoalkylamino) benzoic acid derivatives |
Country Status (22)
| Country | Link |
|---|---|
| US (2) | US3868416A (da) |
| JP (1) | JPS5747901B2 (da) |
| AR (1) | AR211687A1 (da) |
| AT (1) | AT338250B (da) |
| BE (1) | BE820542A (da) |
| CA (1) | CA1077957A (da) |
| CH (1) | CH609676A5 (da) |
| DD (1) | DD116031A5 (da) |
| DE (1) | DE2446010C2 (da) |
| DK (1) | DK141844B (da) |
| ES (1) | ES430574A1 (da) |
| FR (1) | FR2246267B1 (da) |
| GB (1) | GB1488674A (da) |
| GT (1) | GT197851174A (da) |
| HU (1) | HU175875B (da) |
| IE (1) | IE40527B1 (da) |
| IL (1) | IL45643A (da) |
| NL (1) | NL179725C (da) |
| SE (1) | SE410595B (da) |
| SU (1) | SU590311A1 (da) |
| YU (1) | YU262274A (da) |
| ZA (1) | ZA745732B (da) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1471431A (en) * | 1974-04-30 | 1977-04-27 | Science Union & Cie | Alkanolamine derivatives processes for their preparation and pharmaceutical compositions containing them |
| US4185115A (en) * | 1975-03-12 | 1980-01-22 | American Cyanamid Company | Antilipidemic para-[aryl(alkyl or alkenyl)amino]-benzoic acid derivatives |
| US4350822A (en) * | 1975-03-12 | 1982-09-21 | American Cyanamid Company | Antilipidemicpara-[aryl(alkyl or alkenyl)amino]benzoic acid derivatives |
| US4058550A (en) * | 1975-10-28 | 1977-11-15 | American Cyanamid Company | Polysubstituted-alkyl esters of 4-alkylaminobenzoic acids |
| US4182776A (en) * | 1975-12-09 | 1980-01-08 | American Cyanamid Company | Method of treating lipidemia with aryloxyalkylaminobenzoic acids and esters |
| AU500881B2 (en) * | 1976-01-19 | 1979-06-07 | Dow Chemical Company, The | Hypolipidemic p-aminobenzoic acids |
| GB1576007A (en) * | 1976-02-11 | 1980-10-01 | Beecham Group Ltd | Hypolipidaemic compositions |
| US4105791A (en) * | 1976-03-22 | 1978-08-08 | The Dow Chemical Company | Hypolipidemic cycloalkylaminobenzoic acids |
| US4133890A (en) * | 1977-01-05 | 1979-01-09 | The Dow Chemical Company | Hypolipidemic compositions and method employing derivatives of 4-(((1,3-benzodioxol-5-yl)methyl)amino)benzoic acid |
| US4348399A (en) * | 1978-02-02 | 1982-09-07 | American Cyanamid Company | Antiatherosclerotic and hypolipidemic 4-(monoalkylamino)phenyl alkane, alkene and alkyne carbinols, aldehydes, carboxylic acids and derivatives |
| US4242273A (en) * | 1977-09-27 | 1980-12-30 | American Cyanamid Company | 4-(Monoalkylamino)benzoic acid amides and imidates |
| US4245120A (en) * | 1977-09-27 | 1981-01-13 | American Cyanamid Company | 4-(Monoalkylamino)benzene polycarboxylic acids |
| US4136256A (en) * | 1977-09-27 | 1979-01-23 | American Cyanamid Company | 4-(monoalkylamino)benzoic acid imidates |
| US4154756A (en) * | 1977-12-15 | 1979-05-15 | American Cyanamid Company | 2-Substituted-4'-(monoalkylamino)-acetophenones |
| US4245119A (en) * | 1977-09-27 | 1981-01-13 | American Cyanamid Company | 4-(Monoalkylamino) benzene polycarboxylic acids |
| US4117158A (en) * | 1977-09-27 | 1978-09-26 | American Cyanamid Company | 4-(monoalkylamino)benzonitriles useful as anti-atherosclerotic agents |
| US4272546A (en) * | 1977-12-19 | 1981-06-09 | American Cyanamid Company | Esters of 4-(monoalkylamino)benzoic hydroxyalkanoic acids |
| US4254138A (en) * | 1977-12-19 | 1981-03-03 | American Cyanamid Company | Esters of 4-(monoalkylamino)benzoic hydroxyalkanoic acids |
| IL56517A0 (en) * | 1978-02-02 | 1979-03-12 | American Cyanamid Co | Novel 4-(cycloalkyl or cyclalkenyl substituted) amino, alkylamino or alkenylamino benzoic acids, salts and derivatives |
| US4243609A (en) * | 1978-02-02 | 1981-01-06 | American Cyanamid Company | Ring-fluorinated 4-(hexadecyl-amino) N-substituted benzamide compounds |
| US4205085A (en) * | 1978-03-09 | 1980-05-27 | American Cyanamid Company | Hypolipidemic and antiatherosclerotic 4-(polyfluoroalkylamino)phenyl compounds |
| US4333940A (en) * | 1978-02-02 | 1982-06-08 | American Cyanamid Company | Ring-fluorinated 4-(monosubstituted-amino) phenyl compounds in inhibiting atherosclerotic lesion development |
| US4230878A (en) * | 1978-03-08 | 1980-10-28 | American Cyanamid Company | Hypolipidemic and antiatherosclerotic 4-[(cyclopropyl alkyl)amino]benzoic acids and derivatives |
| US4245097A (en) * | 1978-02-27 | 1981-01-13 | American Cyanamid Company | 4-[(Monosubstituted-alkyl) amino] benzoic acids and analogs as hypolipidemic and antiatherosclerotic agents |
| US4230628A (en) * | 1978-04-12 | 1980-10-28 | American Cyanamid Company | 4-[(Carboxyl- and sulfamyl-substituted alkyl)-amino] benzoic acids and analogs |
| US4311846A (en) * | 1978-02-27 | 1982-01-19 | American Cyanamid Company | 4-[(Monosubstituted-alkyl) amino]benzoic acids and analogs as hypolipidemic and antiatherosclerotic agents |
| US4178385A (en) * | 1978-03-03 | 1979-12-11 | The Dow Chemical Company | Method for treating hyperlipidemia in primates using 4-((4-fluorophenylmethyl)amino)benzoic acid |
| US4305959A (en) * | 1978-03-09 | 1981-12-15 | American Cyanamid Company | Hypolipidemic and antiatherosclerotic 4-(polyfluoro-alkylamino)phenyl compounds |
| US4318914A (en) * | 1978-03-09 | 1982-03-09 | American Cyanamid Company | Hypolipidemic and antiatherosclerotic 4-(polyfluoro-alkylamino)phenyl compounds |
| US4310545A (en) * | 1978-03-09 | 1982-01-12 | American Cyanamid Company | Hypolipidemic and antiatherosclerotic 4-(polyfluoroalkylamino) phenyl compounds |
| US4307113A (en) * | 1978-04-20 | 1981-12-22 | Sandoz, Inc. | Anthranilic acid derivatives |
| US4181737A (en) * | 1978-05-18 | 1980-01-01 | The Dow Chemical Company | 4-((3-Methoxyphenyl)amino)benzoic acid, a method for treating hyperlipidemia, and compositions thereof |
| US4206223A (en) * | 1979-01-05 | 1980-06-03 | The Dow Chemical Company | Method for treating hyperglycemia in mammals using 4-(((1,3-benzodioxol-5-yl)methyl)amino)benzoic acid or derivatives thereof |
| US4281019A (en) * | 1979-02-01 | 1981-07-28 | American Cyanamid Company | 4-[(Unsaturated or cyclopropylated alkyl)amino]phenyl compounds useful as hypolipidemic and antiatherosclerotic agents |
| YU57979A (en) * | 1979-03-09 | 1982-10-31 | Lek Tovarna Farmacevtskih | Process for preparing 4-9n-hexadecylamino0-benzoic acid |
| US4263320A (en) * | 1979-06-04 | 1981-04-21 | The Dow Chemical Company | Hypoglycemic phenylpropynylamino benzoic acids |
| US4311694A (en) * | 1979-12-31 | 1982-01-19 | American Cyanamid Company | Amorphous coprecipitates of 4-(monoalkylamino) benzoic acid and derivatives and certain water-soluble materials |
| US4375478A (en) * | 1982-03-02 | 1983-03-01 | Abbott Laboratories | Aminobenzoic acid derivatives |
| JP2659488B2 (ja) * | 1992-01-22 | 1997-09-30 | 川崎重工業株式会社 | 引戸装置 |
| US6080428A (en) * | 1993-09-20 | 2000-06-27 | Bova; David J. | Nicotinic acid compositions for treating hyperlipidemia and related methods therefor |
| US6818229B1 (en) | 1993-09-20 | 2004-11-16 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia |
| US6746691B2 (en) | 1993-09-20 | 2004-06-08 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia having unique biopharmaceutical characteristics |
| US20080045573A1 (en) * | 1993-09-20 | 2008-02-21 | Bova David J | Methods and Sustained Release Nicotinic Acid Compositions for Treating Hyperlipidemia |
| US6676967B1 (en) | 1993-09-20 | 2004-01-13 | Kos Pharmaceuticals, Inc. | Methods for reducing flushing in individuals being treated with nicotinic acid for hyperlipidemia |
| US6129930A (en) * | 1993-09-20 | 2000-10-10 | Bova; David J. | Methods and sustained release nicotinic acid compositions for treating hyperlipidemia at night |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3758561A (en) * | 1968-10-18 | 1973-09-11 | Merck & Co Inc | 2-loweralkylamino-4-amino benzoic acids, their salts and esters, and acid addition salts thereof |
| US3716644A (en) * | 1971-07-15 | 1973-02-13 | American Cyanamid Co | Hypolipidemic agents |
-
1973
- 1973-10-01 US US402212A patent/US3868416A/en not_active Expired - Lifetime
-
1974
- 1974-09-09 ZA ZA00745732A patent/ZA745732B/xx unknown
- 1974-09-11 IL IL45643A patent/IL45643A/xx unknown
- 1974-09-17 GB GB40539/74A patent/GB1488674A/en not_active Expired
- 1974-09-23 AR AR255678A patent/AR211687A1/es active
- 1974-09-26 DE DE2446010A patent/DE2446010C2/de not_active Expired
- 1974-09-27 YU YU02622/74A patent/YU262274A/xx unknown
- 1974-09-27 IE IE2015/74A patent/IE40527B1/xx unknown
- 1974-09-30 SE SE7412307A patent/SE410595B/xx not_active IP Right Cessation
- 1974-09-30 DK DK515474AA patent/DK141844B/da not_active IP Right Cessation
- 1974-09-30 FR FR7432894A patent/FR2246267B1/fr not_active Expired
- 1974-09-30 BE BE149073A patent/BE820542A/xx not_active IP Right Cessation
- 1974-09-30 CA CA210,303A patent/CA1077957A/en not_active Expired
- 1974-10-01 DD DD181444A patent/DD116031A5/xx unknown
- 1974-10-01 JP JP49113271A patent/JPS5747901B2/ja not_active Expired
- 1974-10-01 SU SU742065154A patent/SU590311A1/ru active
- 1974-10-01 HU HU74AE427A patent/HU175875B/hu unknown
- 1974-10-01 AT AT788574A patent/AT338250B/de not_active IP Right Cessation
- 1974-10-01 CH CH1321774A patent/CH609676A5/xx not_active IP Right Cessation
- 1974-10-01 NL NLAANVRAGE7412956,A patent/NL179725C/xx not_active IP Right Cessation
- 1974-10-02 ES ES430574A patent/ES430574A1/es not_active Expired
- 1974-10-25 US US518022A patent/US3924001A/en not_active Expired - Lifetime
-
1978
- 1978-03-01 GT GT197851174A patent/GT197851174A/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7412956A (nl) | 1975-04-03 |
| NL179725B (nl) | 1986-06-02 |
| ZA745732B (en) | 1975-09-24 |
| NL179725C (nl) | 1986-11-03 |
| FR2246267B1 (da) | 1977-10-28 |
| AR211687A1 (es) | 1978-02-28 |
| HU175875B (en) | 1980-11-28 |
| GT197851174A (es) | 1979-08-23 |
| IE40527B1 (en) | 1979-06-20 |
| DK141844B (da) | 1980-06-30 |
| ES430574A1 (es) | 1977-02-16 |
| JPS5059347A (da) | 1975-05-22 |
| DK515474A (da) | 1975-06-09 |
| DD116031A5 (da) | 1975-11-05 |
| IL45643A0 (en) | 1974-11-29 |
| DK141844C (da) | 1980-11-10 |
| US3924001A (en) | 1975-12-02 |
| YU262274A (en) | 1982-02-25 |
| US3868416A (en) | 1975-02-25 |
| SE7412307L (da) | 1975-04-02 |
| DE2446010C2 (de) | 1985-05-15 |
| BE820542A (fr) | 1975-04-01 |
| FR2246267A1 (da) | 1975-05-02 |
| ATA788574A (de) | 1976-12-15 |
| GB1488674A (en) | 1977-10-12 |
| CH609676A5 (da) | 1979-03-15 |
| SU590311A1 (ru) | 1978-01-30 |
| JPS5747901B2 (da) | 1982-10-13 |
| IE40527L (en) | 1975-04-01 |
| AT338250B (de) | 1977-08-10 |
| DE2446010A1 (de) | 1975-04-03 |
| SE410595B (sv) | 1979-10-22 |
| IL45643A (en) | 1979-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1077957A (en) | Hypolipidemic 4-(monoalkylamino) benzoic acid derivatives | |
| DE69409525T2 (de) | Acetamidderivate und ihre verwendung als modifizierungsmittel des verhaltens der verdauung | |
| CA1087205A (en) | 2-amino-3-(5-and 6-)benzoylphenylacetic acids, esters and metal salts thereof | |
| DE2923815C2 (da) | ||
| US4632934A (en) | Imidazole derivatives and pharmaceutical use thereof | |
| EP0504695A1 (de) | Neue Carbonsäureamide, ihre Herstellung und pharmazeutische Präparate, die diese Verbindungen enthalten | |
| EP0002892A1 (en) | Amide derivatives, process for their manufacture and pharmaceutical or veterinary compositions containing them | |
| US4185115A (en) | Antilipidemic para-[aryl(alkyl or alkenyl)amino]-benzoic acid derivatives | |
| US5512595A (en) | Substituted phenoxyisobutyric acids and esters | |
| US3639477A (en) | Novel propoxyguanidine compounds and means of producing the same | |
| FI76569B (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva substituerade imidazolderivat. | |
| US4350822A (en) | Antilipidemicpara-[aryl(alkyl or alkenyl)amino]benzoic acid derivatives | |
| UA75353C2 (en) | N-[2-hydroxy-3-(1-piperidinyl)propoxy]piridine-1-oxide-3-carboxamidine and a method for transformation thereof into pharmaceutically effective compounds | |
| DE69108408T2 (de) | 4,5-dihydroxy und 4,5,8-trihydroxy-9,10-dioxo-2-anthracencarbonsäure-dikohlensäureester und urethane mit therapeutischer wirkung. | |
| US3989746A (en) | Substituted naphthyl anthranilic acids | |
| US3985875A (en) | ω-(N-acylamino)alkylphosphoryl ethanolamines, pharmaceutical compositions containing them, and their uses | |
| JPS61218571A (ja) | 新規ラクタム誘導体及び新規チオラクタム誘導体並びに抗炎症剤 | |
| EP0121806B1 (en) | Pyrazolo(1,5-a)pyridine derivatives and compositions containing them | |
| EP0491263A1 (de) | Phenylalkylaminoalkyl-Verbindungen sowie Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE69803445T2 (de) | 5-hydroxymethyl-2-aminotetraline als cardiovasculäre mittel | |
| KR810000354B1 (ko) | 4-(모노알킬아미노)-벤조산 유도체의 제조방법 | |
| DE2618936A1 (de) | N-acylglutamine und verfahren zu ihrer herstellung | |
| EP0058009A1 (en) | Novel benzanilide derivatives and pharmaceutical compositions containing them | |
| NO823213L (no) | Fremgangsmaate for fremstilling av antranilsyreestere | |
| US4942176A (en) | N-substituted aminoalkanoic acids, a process for their preparation, their use and pharmaceutical products based on these compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |