ZA200209142B - Process for the staining of wood with aqueous wood stains. - Google Patents
Process for the staining of wood with aqueous wood stains. Download PDFInfo
- Publication number
- ZA200209142B ZA200209142B ZA200209142A ZA200209142A ZA200209142B ZA 200209142 B ZA200209142 B ZA 200209142B ZA 200209142 A ZA200209142 A ZA 200209142A ZA 200209142 A ZA200209142 A ZA 200209142A ZA 200209142 B ZA200209142 B ZA 200209142B
- Authority
- ZA
- South Africa
- Prior art keywords
- wood
- hydroxyl
- total number
- oxyl
- staining
- Prior art date
Links
- 239000002023 wood Substances 0.000 title claims description 28
- 238000000034 method Methods 0.000 title claims description 11
- 238000010186 staining Methods 0.000 title claims description 7
- -1 oxyl Chemical group 0.000 claims description 21
- 239000000975 dye Substances 0.000 claims description 15
- 229910052799 carbon Inorganic materials 0.000 claims description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 239000003381 stabilizer Substances 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 150000001449 anionic compounds Chemical group 0.000 claims description 5
- 150000001450 anions Chemical class 0.000 claims description 5
- 150000001768 cations Chemical class 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 150000002891 organic anions Chemical group 0.000 claims description 5
- 125000004043 oxo group Chemical group O=* 0.000 claims description 5
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 5
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 5
- 125000003368 amide group Chemical group 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 3
- 230000006641 stabilisation Effects 0.000 claims description 3
- 238000011105 stabilization Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 2
- CSGAUKGQUCHWDP-UHFFFAOYSA-N 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1O CSGAUKGQUCHWDP-UHFFFAOYSA-N 0.000 claims 1
- SJEYSFABYSGQBG-UHFFFAOYSA-M Patent blue Chemical compound [Na+].C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 SJEYSFABYSGQBG-UHFFFAOYSA-M 0.000 claims 1
- 239000000980 acid dye Substances 0.000 claims 1
- 150000001408 amides Chemical class 0.000 claims 1
- 125000002091 cationic group Chemical group 0.000 claims 1
- 239000000434 metal complex dye Substances 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 239000000985 reactive dye Substances 0.000 claims 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 3
- 230000035515 penetration Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 101150065749 Churc1 gene Proteins 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 102100038239 Protein Churchill Human genes 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229940072107 ascorbate Drugs 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-K pentetate(3-) Chemical compound OC(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O QPCDCPDFJACHGM-UHFFFAOYSA-K 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-L L-tartrate(2-) Chemical compound [O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O FEWJPZIEWOKRBE-JCYAYHJZSA-L 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 150000001602 bicycloalkyls Chemical group 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical compound [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N itaconic acid Chemical compound OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-L malate(2-) Chemical compound [O-]C(=O)C(O)CC([O-])=O BJEPYKJPYRNKOW-UHFFFAOYSA-L 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- UIERETOOQGIECD-ONEGZZNKSA-N tiglic acid Chemical compound C\C=C(/C)C(O)=O UIERETOOQGIECD-ONEGZZNKSA-N 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09D—COATING COMPOSITIONS, e.g. PAINTS, VARNISHES OR LACQUERS; FILLING PASTES; CHEMICAL PAINT OR INK REMOVERS; INKS; CORRECTING FLUIDS; WOODSTAINS; PASTES OR SOLIDS FOR COLOURING OR PRINTING; USE OF MATERIALS THEREFOR
- C09D15/00—Woodstains
Landscapes
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Detergent Compositions (AREA)
- Paints Or Removers (AREA)
- Chemical And Physical Treatments For Wood And The Like (AREA)
- Hydrogenated Pyridines (AREA)
- Cosmetics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pigments, Carbon Blacks, Or Wood Stains (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP00810402 | 2000-05-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA200209142B true ZA200209142B (en) | 2003-10-22 |
Family
ID=8174689
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA200209142A ZA200209142B (en) | 2000-05-11 | 2002-11-11 | Process for the staining of wood with aqueous wood stains. |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US6630002B2 (enExample) |
| EP (1) | EP1280864A1 (enExample) |
| JP (1) | JP2003532569A (enExample) |
| KR (1) | KR100849438B1 (enExample) |
| CN (1) | CN1289617C (enExample) |
| AU (2) | AU2001273985B2 (enExample) |
| BR (1) | BR0110649A (enExample) |
| CA (1) | CA2405196C (enExample) |
| CZ (1) | CZ20024032A3 (enExample) |
| HU (1) | HUP0302328A3 (enExample) |
| MX (1) | MXPA02010296A (enExample) |
| PL (1) | PL205847B1 (enExample) |
| RU (1) | RU2280049C2 (enExample) |
| SK (1) | SK17242002A3 (enExample) |
| WO (1) | WO2001085857A1 (enExample) |
| ZA (1) | ZA200209142B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1649566B (zh) * | 2002-05-02 | 2010-05-26 | 西巴特殊化学品控股有限公司 | 稳定的护体产品、家用产品、纺织品和织物 |
| DE10236741A1 (de) * | 2002-08-09 | 2004-02-19 | Remmers Baustofftechnik Gmbh | Stabilisierung von Polymeren gegenüber lichtinduziertem Abbau |
| KR101158266B1 (ko) * | 2003-11-03 | 2012-06-19 | 시바 홀딩 인코포레이티드 | 안정화된 바디 케어 제품, 가정용품, 직물원료 및 직물 |
| CA2547817A1 (en) * | 2003-12-08 | 2005-06-23 | Osmose, Inc. | Composition and process for coloring and preserving wood |
| EP1614742B1 (en) * | 2004-07-08 | 2007-12-05 | The Procter & Gamble Company | Bleaching composition comprising a cyclic hindered amine |
| JP2008183864A (ja) * | 2007-01-31 | 2008-08-14 | Yamada Chem Co Ltd | 染色木材及びその耐光性改良方法 |
| US20080218590A1 (en) * | 2007-03-08 | 2008-09-11 | Sang Jun Park | Method and system for multiple-codec surveillance video storage and retrieval |
| US20110014444A1 (en) * | 2009-07-17 | 2011-01-20 | Jessica Alessandro | Uv protecting treatment for wooden interior trim |
| US8304044B2 (en) * | 2009-09-23 | 2012-11-06 | Eastman Kodak Company | Dye transferable material with improved image stability |
| WO2011080051A1 (de) * | 2010-01-04 | 2011-07-07 | Basf Se | Formulierung und deren verwendung |
| CN102528869B (zh) * | 2010-12-22 | 2014-12-17 | 展辰涂料集团股份有限公司 | 一种浸泡松木的水性木器色水及其制备方法 |
| US20140041134A1 (en) | 2011-04-20 | 2014-02-13 | Huntsman International Llc | Method of Dyeing Polyester |
| EP3138675A1 (en) * | 2015-09-04 | 2017-03-08 | ETH Zurich | Uv-stable and superhydrophobic wood surface |
| DE202021004188U1 (de) | 2020-09-29 | 2023-01-13 | ADLER-Werk Lackfabrik Johann Berghofer GmbH & Co. KG | Beizmittel |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH660599A5 (de) * | 1984-07-26 | 1987-05-15 | Ciba Geigy Ag | Loesungen anionischer farbstoffe. |
| DE3852742T3 (de) * | 1987-09-21 | 2005-02-10 | Ciba Speciality Chemicals Holding Inc. | N-substituierte sterisch gehinderte Amin-Stabilisatoren. |
| DE4031279A1 (de) * | 1990-10-04 | 1992-04-09 | Basf Ag | Stabilisatoren enthaltende holzbeizen |
| RU2126393C1 (ru) * | 1992-02-05 | 1999-02-20 | Циба Спешиалти Кемикэлс Холдинг Инк. | Замешенные бензотриазолы и стабилизированная композиция и покрывная система, их содержания |
| DE4427299A1 (de) * | 1994-08-02 | 1996-02-08 | Faber Castell A W | Beize und Verfahren zum Färben von Holz |
| US5851238A (en) * | 1996-07-31 | 1998-12-22 | Basf Corporation | Photochemically stabilized polyamide compositions |
| CA2295631A1 (en) | 1997-07-23 | 1999-02-04 | Ciba Specialty Chemicals Holding Inc. | Inhibition of pulp and paper yellowing using nitroxides and other coadditives |
| DE19735255B4 (de) * | 1997-08-14 | 2007-08-23 | Clariant Produkte (Deutschland) Gmbh | Synergistisches Stabilisatorgemisch auf Basis von Polyalkyl-1-oxa-diazaspirodecan-Verbindungen und dessen Verwendung |
| JPH11170686A (ja) * | 1997-12-11 | 1999-06-29 | Fuji Photo Film Co Ltd | 画像形成材料及び画像形成方法 |
| TWI224995B (en) * | 1998-03-19 | 2004-12-11 | Ciba Sc Holding Ag | Stabilization of wood substrates |
-
2001
- 2001-05-03 MX MXPA02010296A patent/MXPA02010296A/es active IP Right Grant
- 2001-05-03 EP EP01940392A patent/EP1280864A1/en not_active Ceased
- 2001-05-03 JP JP2001582450A patent/JP2003532569A/ja active Pending
- 2001-05-03 RU RU2002133090/04A patent/RU2280049C2/ru not_active IP Right Cessation
- 2001-05-03 BR BR0110649-0A patent/BR0110649A/pt not_active Application Discontinuation
- 2001-05-03 CA CA002405196A patent/CA2405196C/en not_active Expired - Fee Related
- 2001-05-03 AU AU2001273985A patent/AU2001273985B2/en not_active Ceased
- 2001-05-03 AU AU7398501A patent/AU7398501A/xx active Pending
- 2001-05-03 KR KR1020027014992A patent/KR100849438B1/ko not_active Expired - Fee Related
- 2001-05-03 CZ CZ20024032A patent/CZ20024032A3/cs unknown
- 2001-05-03 SK SK1724-2002A patent/SK17242002A3/sk not_active Application Discontinuation
- 2001-05-03 HU HU0302328A patent/HUP0302328A3/hu unknown
- 2001-05-03 WO PCT/EP2001/004982 patent/WO2001085857A1/en not_active Ceased
- 2001-05-03 CN CNB01812481XA patent/CN1289617C/zh not_active Expired - Lifetime
- 2001-05-03 PL PL358303A patent/PL205847B1/pl unknown
- 2001-05-07 US US09/850,493 patent/US6630002B2/en not_active Expired - Lifetime
-
2002
- 2002-11-11 ZA ZA200209142A patent/ZA200209142B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU7398501A (en) | 2001-11-20 |
| CN1289617C (zh) | 2006-12-13 |
| RU2280049C2 (ru) | 2006-07-20 |
| KR100849438B1 (ko) | 2008-07-31 |
| CA2405196C (en) | 2009-10-13 |
| HUP0302328A2 (hu) | 2003-10-28 |
| CZ20024032A3 (cs) | 2003-04-16 |
| HUP0302328A3 (en) | 2007-11-28 |
| US6630002B2 (en) | 2003-10-07 |
| JP2003532569A (ja) | 2003-11-05 |
| SK17242002A3 (sk) | 2003-05-02 |
| KR20020094025A (ko) | 2002-12-16 |
| BR0110649A (pt) | 2003-04-15 |
| MXPA02010296A (es) | 2003-04-25 |
| WO2001085857A1 (en) | 2001-11-15 |
| CA2405196A1 (en) | 2001-11-15 |
| CN1440448A (zh) | 2003-09-03 |
| PL205847B1 (pl) | 2010-06-30 |
| US20020000011A1 (en) | 2002-01-03 |
| PL358303A1 (en) | 2004-08-09 |
| EP1280864A1 (en) | 2003-02-05 |
| AU2001273985B2 (en) | 2006-03-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2060598C (en) | Bleed alleviation in ink-jet inks | |
| CN100379724C (zh) | 利用硝基氧和其它共添加剂抑制纸浆及纸张的返黄 | |
| KR100351016B1 (ko) | 피리티온함유피복조성물로도포된기판 | |
| JP2000025010A (ja) | 木材基板の安定化 | |
| KR20180117162A (ko) | 분산 페인트 | |
| DE602004017427D1 (de) | Zusammensetzung zur Aufhellung und Färbung der Keratinfasern | |
| US6630002B2 (en) | Process for the staining of wood with aqueous wood stains | |
| GB9120227D0 (en) | Printing process and pretreatment composition | |
| RU2000104506A (ru) | Ингибирование пожелтения целлюлозы и бумаги с использованием нитроксидов и других совместно вводимых добавок | |
| RU2003124075A (ru) | Краска для струйной печати и регистрирующий материал | |
| FI102968B (fi) | Menetelmä tanniinin aiheuttaman värjäytymisen vähentämiseksi tai estäm iseksi tanniinin aiheuttamalle värjäytymiselle alttiilla pinnalla käyt tämällä siirtymämetalli-ionille tarkoitettua kompleksointiainetta ja tällaista kompleksointiainetta sisältäviä ko | |
| AU2001273985A1 (en) | Process for the staining of wood with aqueous wood stains | |
| DE69010551D1 (de) | Haarbehandlungszusammensetzung, Bleichzusammensetzung und Zusammensetzung zur Modifizierung des Haarfarbtones. | |
| PT100123B (pt) | Processo para acabamento de madeiras ambientalmente seguro e composicao para o tratamento de superficies de madeira | |
| JP2014532123A5 (enExample) | ||
| ZA200201733B (en) | Stabilization of wood substrates. | |
| EP0434179A1 (en) | Water-resistant ink composition | |
| US20030226211A1 (en) | Waterborne fabric and textile coating or treatment | |
| CA1095203A (en) | Gelled nonpigmented wood stains | |
| EP0448096A1 (en) | Stabilized resin composition | |
| AU637217B2 (en) | Wood preservative compositions | |
| US5504211A (en) | Polyalkylpiperidinyl-containing β-aminoacrylic ester derivatives | |
| US4430091A (en) | Oxidation base dye composition and method of dyeing therewith | |
| GB1165007A (en) | Stabilized Quaternary Ammonium Compositions | |
| WO2023072128A1 (en) | Colorant composition and coated article |