PL205847B1 - Sposób bejcowania drewna, wodna bejca drewna, zastosowanie stabilizatora barwnika oraz zastosowanie wodnej bejcy drewna - Google Patents
Sposób bejcowania drewna, wodna bejca drewna, zastosowanie stabilizatora barwnika oraz zastosowanie wodnej bejcy drewnaInfo
- Publication number
- PL205847B1 PL205847B1 PL358303A PL35830301A PL205847B1 PL 205847 B1 PL205847 B1 PL 205847B1 PL 358303 A PL358303 A PL 358303A PL 35830301 A PL35830301 A PL 35830301A PL 205847 B1 PL205847 B1 PL 205847B1
- Authority
- PL
- Poland
- Prior art keywords
- wood
- dye
- dyes
- hydroxy
- substituted
- Prior art date
Links
- 239000002023 wood Substances 0.000 title claims abstract description 69
- 238000000034 method Methods 0.000 title claims abstract description 28
- 238000010186 staining Methods 0.000 title claims abstract description 14
- -1 amino, carboxyl Chemical group 0.000 claims abstract description 58
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 43
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 39
- 239000003381 stabilizer Substances 0.000 claims abstract description 36
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims abstract description 18
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims abstract description 13
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims abstract description 13
- 150000001449 anionic compounds Chemical group 0.000 claims abstract description 10
- 150000001450 anions Chemical class 0.000 claims abstract description 10
- 150000001768 cations Chemical class 0.000 claims abstract description 10
- 150000002891 organic anions Chemical group 0.000 claims abstract description 10
- 150000002148 esters Chemical class 0.000 claims abstract description 9
- 125000004043 oxo group Chemical group O=* 0.000 claims abstract description 8
- 238000002360 preparation method Methods 0.000 claims abstract description 6
- 239000000975 dye Substances 0.000 claims description 79
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 11
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- SJEYSFABYSGQBG-UHFFFAOYSA-M Patent blue Chemical compound [Na+].C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 SJEYSFABYSGQBG-UHFFFAOYSA-M 0.000 claims description 7
- 239000000980 acid dye Substances 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 6
- 239000000434 metal complex dye Substances 0.000 claims description 6
- 239000000985 reactive dye Substances 0.000 claims description 6
- QANCGMMOAAIIGG-UHFFFAOYSA-N 2-(hydroxymethyl)-2,6,6-trimethylpiperidin-4-ol Chemical group CC1(C)CC(O)CC(C)(CO)N1 QANCGMMOAAIIGG-UHFFFAOYSA-N 0.000 claims description 5
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 5
- 125000002091 cationic group Chemical group 0.000 claims description 5
- 230000006641 stabilisation Effects 0.000 claims description 4
- 238000011105 stabilization Methods 0.000 claims description 4
- 239000013011 aqueous formulation Substances 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims 4
- 125000003368 amide group Chemical group 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 description 51
- 239000001257 hydrogen Substances 0.000 description 49
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 38
- 125000004430 oxygen atom Chemical group O* 0.000 description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 11
- 229910052799 carbon Inorganic materials 0.000 description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 10
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 8
- 150000003254 radicals Chemical class 0.000 description 8
- QPCDCPDFJACHGM-UHFFFAOYSA-K pentetate(3-) Chemical group OC(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O QPCDCPDFJACHGM-UHFFFAOYSA-K 0.000 description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- CSGAUKGQUCHWDP-UHFFFAOYSA-N 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1O CSGAUKGQUCHWDP-UHFFFAOYSA-N 0.000 description 5
- TXXNVPVRPSACBM-UHFFFAOYSA-N 2-hydroxypropane-1,2,3-tricarboxylic acid;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)[NH+]1O.CC1(C)CC(O)CC(C)(C)[NH+]1O.CC1(C)CC(O)CC(C)(C)[NH+]1O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O TXXNVPVRPSACBM-UHFFFAOYSA-N 0.000 description 5
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 5
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 4
- KMEUSKGEUADGET-UHFFFAOYSA-N 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)N1O KMEUSKGEUADGET-UHFFFAOYSA-N 0.000 description 4
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 4
- YYTYIUAYFBFKHX-UHFFFAOYSA-N n-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)acetamide Chemical compound CC(=O)NC1CC(C)(C)N(O)C(C)(C)C1 YYTYIUAYFBFKHX-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 229910052727 yttrium Inorganic materials 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000012937 correction Methods 0.000 description 3
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 3
- 229910021645 metal ion Inorganic materials 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 230000000737 periodic effect Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000000542 sulfonic acid group Chemical group 0.000 description 3
- 125000006839 xylylene group Chemical group 0.000 description 3
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 2
- QCJDXHSSMDQRBO-UHFFFAOYSA-N 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-ol;chloride Chemical compound [Cl-].CC1(C)CC(O)CC(C)(C)[NH+]1O QCJDXHSSMDQRBO-UHFFFAOYSA-N 0.000 description 2
- BTLXPCBPYBNQNR-UHFFFAOYSA-N 1-hydroxyanthraquinone Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2O BTLXPCBPYBNQNR-UHFFFAOYSA-N 0.000 description 2
- WQFZLUAKGBOQEN-UHFFFAOYSA-N 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)[NH+]1O.CC1(C)CC(=O)CC(C)(C)[NH+]1O.CC1(C)CC(=O)CC(C)(C)[NH+]1O.CC1(C)CC(=O)CC(C)(C)[NH+]1O.[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O WQFZLUAKGBOQEN-UHFFFAOYSA-N 0.000 description 2
- CAZAXTALZNYAGA-UHFFFAOYSA-N 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;n-(1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl)acetamide Chemical compound CC(=O)NC1CC(C)(C)[NH+](O)C(C)(C)C1.CC(=O)NC1CC(C)(C)[NH+](O)C(C)(C)C1.CC(=O)NC1CC(C)(C)[NH+](O)C(C)(C)C1.CC(=O)NC1CC(C)(C)[NH+](O)C(C)(C)C1.[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O CAZAXTALZNYAGA-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- 244000089742 Citrus aurantifolia Species 0.000 description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical group OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Natural products CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 241000758196 Triplochiton scleroxylon Species 0.000 description 2
- 229910052770 Uranium Inorganic materials 0.000 description 2
- LUTRAMFAYXFIQK-UHFFFAOYSA-N acetic acid;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC([O-])=O.CC1(C)CC(O)CC(C)(C)[NH+]1O LUTRAMFAYXFIQK-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical group 0.000 description 2
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 2
- 150000004056 anthraquinones Chemical class 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 229940072107 ascorbate Drugs 0.000 description 2
- 235000010323 ascorbic acid Nutrition 0.000 description 2
- 239000011668 ascorbic acid Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- REZIEVJVJYHZKK-UHFFFAOYSA-N hydrogen sulfate;1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-ol Chemical compound OS([O-])(=O)=O.CC1(C)CC(O)CC(C)(C)[NH+]1O REZIEVJVJYHZKK-UHFFFAOYSA-N 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- VMGAPWLDMVPYIA-HIDZBRGKSA-N n'-amino-n-iminomethanimidamide Chemical compound N\N=C\N=N VMGAPWLDMVPYIA-HIDZBRGKSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- BOLDJAUMGUJJKM-LSDHHAIUSA-N renifolin D Natural products CC(=C)[C@@H]1Cc2c(O)c(O)ccc2[C@H]1CC(=O)c3ccc(O)cc3O BOLDJAUMGUJJKM-LSDHHAIUSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 229940124543 ultraviolet light absorber Drugs 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- CRGBPDJWOLULDY-UHFFFAOYSA-N (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) acetate Chemical compound CC(=O)OC1CC(C)(C)N(O)C(C)(C)C1 CRGBPDJWOLULDY-UHFFFAOYSA-N 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 description 1
- 125000006710 (C2-C12) alkenyl group Chemical group 0.000 description 1
- 125000006711 (C2-C12) alkynyl group Chemical group 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- JTPNRXUCIXHOKM-UHFFFAOYSA-N 1-chloronaphthalene Chemical compound C1=CC=C2C(Cl)=CC=CC2=C1 JTPNRXUCIXHOKM-UHFFFAOYSA-N 0.000 description 1
- DOIAXYYFHLZFJT-UHFFFAOYSA-N 1-hydroxy-2,2,6,6-tetramethyl-4-propoxypiperidin-1-ium;acetate Chemical compound CC([O-])=O.CCCOC1CC(C)(C)[NH+](O)C(C)(C)C1 DOIAXYYFHLZFJT-UHFFFAOYSA-N 0.000 description 1
- QDNPLNOHUNPYHZ-UHFFFAOYSA-N 1-hydroxy-2,2,6,6-tetramethyl-4-propoxypiperidine Chemical compound CCCOC1CC(C)(C)N(O)C(C)(C)C1 QDNPLNOHUNPYHZ-UHFFFAOYSA-N 0.000 description 1
- OMLXPSWZYGQPCR-UHFFFAOYSA-N 1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-one;acetate Chemical compound CC([O-])=O.CC1(C)CC(=O)CC(C)(C)[NH+]1O OMLXPSWZYGQPCR-UHFFFAOYSA-N 0.000 description 1
- NIPVMEKAVWIWRO-UHFFFAOYSA-N 1-hydroxy-4-methoxy-2,2,6,6-tetramethylpiperidin-1-ium;acetate Chemical compound CC([O-])=O.COC1CC(C)(C)[NH+](O)C(C)(C)C1 NIPVMEKAVWIWRO-UHFFFAOYSA-N 0.000 description 1
- KRNWYBIEWUXCOB-UHFFFAOYSA-N 1-hydroxy-4-methoxy-2,2,6,6-tetramethylpiperidine Chemical compound COC1CC(C)(C)N(O)C(C)(C)C1 KRNWYBIEWUXCOB-UHFFFAOYSA-N 0.000 description 1
- OPOJRMTZHYUKLY-UHFFFAOYSA-N 1h-1,3,5-triazin-2-one Chemical compound O=C1N=CN=CN1 OPOJRMTZHYUKLY-UHFFFAOYSA-N 0.000 description 1
- IMNZCNLFZBWMDI-UHFFFAOYSA-N 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)[NH+]1O.CC1(C)CC(O)CC(C)(C)[NH+]1O.CC1(C)CC(O)CC(C)(C)[NH+]1O.CC1(C)CC(O)CC(C)(C)[NH+]1O.[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O IMNZCNLFZBWMDI-UHFFFAOYSA-N 0.000 description 1
- VXBXRPKTLUBAHQ-UHFFFAOYSA-N 2-[bis(carboxylatomethyl)amino]acetate;1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)[NH+]1O.CC1(C)CC(O)CC(C)(C)[NH+]1O.CC1(C)CC(O)CC(C)(C)[NH+]1O.[O-]C(=O)CN(CC([O-])=O)CC([O-])=O VXBXRPKTLUBAHQ-UHFFFAOYSA-N 0.000 description 1
- ZGDIZLYJGRHLDL-UHFFFAOYSA-N 2-[bis(carboxylatomethyl)amino]acetate;n-(1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl)acetamide Chemical compound [O-]C(=O)CN(CC([O-])=O)CC([O-])=O.CC(=O)NC1CC(C)(C)[NH+](O)C(C)(C)C1.CC(=O)NC1CC(C)(C)[NH+](O)C(C)(C)C1.CC(=O)NC1CC(C)(C)[NH+](O)C(C)(C)C1 ZGDIZLYJGRHLDL-UHFFFAOYSA-N 0.000 description 1
- VZOFQIJZHYEQSJ-UHFFFAOYSA-N 2-hydroxypropane-1,2,3-tricarboxylate;(1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl) acetate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.CC(=O)OC1CC(C)(C)[NH+](O)C(C)(C)C1.CC(=O)OC1CC(C)(C)[NH+](O)C(C)(C)C1.CC(=O)OC1CC(C)(C)[NH+](O)C(C)(C)C1 VZOFQIJZHYEQSJ-UHFFFAOYSA-N 0.000 description 1
- YWBXOXPKPRNECI-UHFFFAOYSA-N 2-hydroxypropane-1,2,3-tricarboxylic acid;1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)[NH+]1O.CC1(C)CC(O)CC(C)(C)[NH+]1O.OC(=O)CC(O)(C([O-])=O)CC([O-])=O YWBXOXPKPRNECI-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- JSTCPNFNKICNNO-UHFFFAOYSA-N 4-nitrosophenol Chemical compound OC1=CC=C(N=O)C=C1 JSTCPNFNKICNNO-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- 241000208140 Acer Species 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 235000018185 Betula X alpestris Nutrition 0.000 description 1
- 235000018212 Betula X uliginosa Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- SCJBEZKWVYBIRT-UHFFFAOYSA-N CC1(C)CC(=O)CC(C)(C)[NH+]1O.CC1(C)CC(=O)CC(C)(C)[NH+]1O.CC1(C)CC(=O)CC(C)(C)[NH+]1O.[O-]C(=O)CN(CC([O-])=O)CC([O-])=O Chemical compound CC1(C)CC(=O)CC(C)(C)[NH+]1O.CC1(C)CC(=O)CC(C)(C)[NH+]1O.CC1(C)CC(=O)CC(C)(C)[NH+]1O.[O-]C(=O)CN(CC([O-])=O)CC([O-])=O SCJBEZKWVYBIRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241001070941 Castanea Species 0.000 description 1
- 235000014036 Castanea Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000005946 Cypermethrin Substances 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- YVGGHNCTFXOJCH-UHFFFAOYSA-N DDT Chemical compound C1=CC(Cl)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(Cl)C=C1 YVGGHNCTFXOJCH-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical group C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 240000000731 Fagus sylvatica Species 0.000 description 1
- 235000010099 Fagus sylvatica Nutrition 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-L L-tartrate(2-) Chemical compound [O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O FEWJPZIEWOKRBE-JCYAYHJZSA-L 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical group SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- RXTCWPTWYYNTOA-UHFFFAOYSA-N O=P1OCCCCCO1 Chemical compound O=P1OCCCCCO1 RXTCWPTWYYNTOA-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 241000218657 Picea Species 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 240000008299 Pinus lambertiana Species 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 241000183024 Populus tremula Species 0.000 description 1
- 239000005822 Propiconazole Substances 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- 240000001987 Pyrus communis Species 0.000 description 1
- 241000124033 Salix Species 0.000 description 1
- 244000186561 Swietenia macrophylla Species 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000000981 basic dye Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 150000001602 bicycloalkyls Chemical group 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- SXPLGYBFGPYAHS-UHFFFAOYSA-N bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate Chemical compound C1C(C)(C)N(O)C(C)(C)CC1OC(=O)CCCCCCCCC(=O)OC1CC(C)(C)N(O)C(C)(C)C1 SXPLGYBFGPYAHS-UHFFFAOYSA-N 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical group 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 229910001430 chromium ion Inorganic materials 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910001429 cobalt ion Inorganic materials 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004090 cyclononenyl group Chemical group C1(=CCCCCCCC1)* 0.000 description 1
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- KAATUXNTWXVJKI-UHFFFAOYSA-N cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 1
- 229960005424 cypermethrin Drugs 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- PPSZHCXTGRHULJ-UHFFFAOYSA-N dioxazine Chemical compound O1ON=CC=C1 PPSZHCXTGRHULJ-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical compound [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XQEZPIIANZJBMP-UHFFFAOYSA-N hydrogen sulfate;n-(1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl)acetamide Chemical compound OS([O-])(=O)=O.CC(=O)NC1CC(C)(C)[NH+](O)C(C)(C)C1 XQEZPIIANZJBMP-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N itaconic acid Chemical compound OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-L malate(2-) Chemical compound [O-]C(=O)C(O)CC([O-])=O BJEPYKJPYRNKOW-UHFFFAOYSA-L 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-M mandelate Chemical compound [O-]C(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-M 0.000 description 1
- 125000002960 margaryl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- FTWUXYZHDFCGSV-UHFFFAOYSA-N n,n'-diphenyloxamide Chemical group C=1C=CC=CC=1NC(=O)C(=O)NC1=CC=CC=C1 FTWUXYZHDFCGSV-UHFFFAOYSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- LCCNCVORNKJIRZ-UHFFFAOYSA-N parathion Chemical compound CCOP(=S)(OCC)OC1=CC=C([N+]([O-])=O)C=C1 LCCNCVORNKJIRZ-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 125000002071 phenylalkoxy group Chemical group 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 239000011120 plywood Substances 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- STJLVHWMYQXCPB-UHFFFAOYSA-N propiconazole Chemical compound O1C(CCC)COC1(C=1C(=CC(Cl)=CC=1)Cl)CN1N=CN=C1 STJLVHWMYQXCPB-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Chemical group CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 239000010875 treated wood Substances 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical compound C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09D—COATING COMPOSITIONS, e.g. PAINTS, VARNISHES OR LACQUERS; FILLING PASTES; CHEMICAL PAINT OR INK REMOVERS; INKS; CORRECTING FLUIDS; WOODSTAINS; PASTES OR SOLIDS FOR COLOURING OR PRINTING; USE OF MATERIALS THEREFOR
- C09D15/00—Woodstains
Landscapes
- Engineering & Computer Science (AREA)
- Wood Science & Technology (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Detergent Compositions (AREA)
- Paints Or Removers (AREA)
- Chemical And Physical Treatments For Wood And The Like (AREA)
- Hydrogenated Pyridines (AREA)
- Cosmetics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pigments, Carbon Blacks, Or Wood Stains (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP00810402 | 2000-05-11 | ||
| PCT/EP2001/004982 WO2001085857A1 (en) | 2000-05-11 | 2001-05-03 | Process for the staining of wood with aqueous wood stains |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL358303A1 PL358303A1 (en) | 2004-08-09 |
| PL205847B1 true PL205847B1 (pl) | 2010-06-30 |
Family
ID=8174689
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL358303A PL205847B1 (pl) | 2000-05-11 | 2001-05-03 | Sposób bejcowania drewna, wodna bejca drewna, zastosowanie stabilizatora barwnika oraz zastosowanie wodnej bejcy drewna |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US6630002B2 (enExample) |
| EP (1) | EP1280864A1 (enExample) |
| JP (1) | JP2003532569A (enExample) |
| KR (1) | KR100849438B1 (enExample) |
| CN (1) | CN1289617C (enExample) |
| AU (2) | AU2001273985B2 (enExample) |
| BR (1) | BR0110649A (enExample) |
| CA (1) | CA2405196C (enExample) |
| CZ (1) | CZ20024032A3 (enExample) |
| HU (1) | HUP0302328A3 (enExample) |
| MX (1) | MXPA02010296A (enExample) |
| PL (1) | PL205847B1 (enExample) |
| RU (1) | RU2280049C2 (enExample) |
| SK (1) | SK17242002A3 (enExample) |
| WO (1) | WO2001085857A1 (enExample) |
| ZA (1) | ZA200209142B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN1649566B (zh) * | 2002-05-02 | 2010-05-26 | 西巴特殊化学品控股有限公司 | 稳定的护体产品、家用产品、纺织品和织物 |
| DE10236741A1 (de) * | 2002-08-09 | 2004-02-19 | Remmers Baustofftechnik Gmbh | Stabilisierung von Polymeren gegenüber lichtinduziertem Abbau |
| KR101158266B1 (ko) * | 2003-11-03 | 2012-06-19 | 시바 홀딩 인코포레이티드 | 안정화된 바디 케어 제품, 가정용품, 직물원료 및 직물 |
| CA2547817A1 (en) * | 2003-12-08 | 2005-06-23 | Osmose, Inc. | Composition and process for coloring and preserving wood |
| EP1614742B1 (en) * | 2004-07-08 | 2007-12-05 | The Procter & Gamble Company | Bleaching composition comprising a cyclic hindered amine |
| JP2008183864A (ja) * | 2007-01-31 | 2008-08-14 | Yamada Chem Co Ltd | 染色木材及びその耐光性改良方法 |
| US20080218590A1 (en) * | 2007-03-08 | 2008-09-11 | Sang Jun Park | Method and system for multiple-codec surveillance video storage and retrieval |
| US20110014444A1 (en) * | 2009-07-17 | 2011-01-20 | Jessica Alessandro | Uv protecting treatment for wooden interior trim |
| US8304044B2 (en) * | 2009-09-23 | 2012-11-06 | Eastman Kodak Company | Dye transferable material with improved image stability |
| WO2011080051A1 (de) * | 2010-01-04 | 2011-07-07 | Basf Se | Formulierung und deren verwendung |
| CN102528869B (zh) * | 2010-12-22 | 2014-12-17 | 展辰涂料集团股份有限公司 | 一种浸泡松木的水性木器色水及其制备方法 |
| US20140041134A1 (en) | 2011-04-20 | 2014-02-13 | Huntsman International Llc | Method of Dyeing Polyester |
| EP3138675A1 (en) * | 2015-09-04 | 2017-03-08 | ETH Zurich | Uv-stable and superhydrophobic wood surface |
| DE202021004188U1 (de) | 2020-09-29 | 2023-01-13 | ADLER-Werk Lackfabrik Johann Berghofer GmbH & Co. KG | Beizmittel |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH660599A5 (de) * | 1984-07-26 | 1987-05-15 | Ciba Geigy Ag | Loesungen anionischer farbstoffe. |
| DE3852742T3 (de) * | 1987-09-21 | 2005-02-10 | Ciba Speciality Chemicals Holding Inc. | N-substituierte sterisch gehinderte Amin-Stabilisatoren. |
| DE4031279A1 (de) * | 1990-10-04 | 1992-04-09 | Basf Ag | Stabilisatoren enthaltende holzbeizen |
| RU2126393C1 (ru) * | 1992-02-05 | 1999-02-20 | Циба Спешиалти Кемикэлс Холдинг Инк. | Замешенные бензотриазолы и стабилизированная композиция и покрывная система, их содержания |
| DE4427299A1 (de) * | 1994-08-02 | 1996-02-08 | Faber Castell A W | Beize und Verfahren zum Färben von Holz |
| US5851238A (en) * | 1996-07-31 | 1998-12-22 | Basf Corporation | Photochemically stabilized polyamide compositions |
| CA2295631A1 (en) | 1997-07-23 | 1999-02-04 | Ciba Specialty Chemicals Holding Inc. | Inhibition of pulp and paper yellowing using nitroxides and other coadditives |
| DE19735255B4 (de) * | 1997-08-14 | 2007-08-23 | Clariant Produkte (Deutschland) Gmbh | Synergistisches Stabilisatorgemisch auf Basis von Polyalkyl-1-oxa-diazaspirodecan-Verbindungen und dessen Verwendung |
| JPH11170686A (ja) * | 1997-12-11 | 1999-06-29 | Fuji Photo Film Co Ltd | 画像形成材料及び画像形成方法 |
| TWI224995B (en) * | 1998-03-19 | 2004-12-11 | Ciba Sc Holding Ag | Stabilization of wood substrates |
-
2001
- 2001-05-03 MX MXPA02010296A patent/MXPA02010296A/es active IP Right Grant
- 2001-05-03 EP EP01940392A patent/EP1280864A1/en not_active Ceased
- 2001-05-03 JP JP2001582450A patent/JP2003532569A/ja active Pending
- 2001-05-03 RU RU2002133090/04A patent/RU2280049C2/ru not_active IP Right Cessation
- 2001-05-03 BR BR0110649-0A patent/BR0110649A/pt not_active Application Discontinuation
- 2001-05-03 CA CA002405196A patent/CA2405196C/en not_active Expired - Fee Related
- 2001-05-03 AU AU2001273985A patent/AU2001273985B2/en not_active Ceased
- 2001-05-03 AU AU7398501A patent/AU7398501A/xx active Pending
- 2001-05-03 KR KR1020027014992A patent/KR100849438B1/ko not_active Expired - Fee Related
- 2001-05-03 CZ CZ20024032A patent/CZ20024032A3/cs unknown
- 2001-05-03 SK SK1724-2002A patent/SK17242002A3/sk not_active Application Discontinuation
- 2001-05-03 HU HU0302328A patent/HUP0302328A3/hu unknown
- 2001-05-03 WO PCT/EP2001/004982 patent/WO2001085857A1/en not_active Ceased
- 2001-05-03 CN CNB01812481XA patent/CN1289617C/zh not_active Expired - Lifetime
- 2001-05-03 PL PL358303A patent/PL205847B1/pl unknown
- 2001-05-07 US US09/850,493 patent/US6630002B2/en not_active Expired - Lifetime
-
2002
- 2002-11-11 ZA ZA200209142A patent/ZA200209142B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU7398501A (en) | 2001-11-20 |
| CN1289617C (zh) | 2006-12-13 |
| RU2280049C2 (ru) | 2006-07-20 |
| KR100849438B1 (ko) | 2008-07-31 |
| CA2405196C (en) | 2009-10-13 |
| HUP0302328A2 (hu) | 2003-10-28 |
| ZA200209142B (en) | 2003-10-22 |
| CZ20024032A3 (cs) | 2003-04-16 |
| HUP0302328A3 (en) | 2007-11-28 |
| US6630002B2 (en) | 2003-10-07 |
| JP2003532569A (ja) | 2003-11-05 |
| SK17242002A3 (sk) | 2003-05-02 |
| KR20020094025A (ko) | 2002-12-16 |
| BR0110649A (pt) | 2003-04-15 |
| MXPA02010296A (es) | 2003-04-25 |
| WO2001085857A1 (en) | 2001-11-15 |
| CA2405196A1 (en) | 2001-11-15 |
| CN1440448A (zh) | 2003-09-03 |
| US20020000011A1 (en) | 2002-01-03 |
| PL358303A1 (en) | 2004-08-09 |
| EP1280864A1 (en) | 2003-02-05 |
| AU2001273985B2 (en) | 2006-03-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP4689778B2 (ja) | 木材基板の安定化 | |
| US6630002B2 (en) | Process for the staining of wood with aqueous wood stains | |
| AU2001273985A1 (en) | Process for the staining of wood with aqueous wood stains | |
| JP4963472B2 (ja) | 天然複合材の安定化 | |
| FI102968B (fi) | Menetelmä tanniinin aiheuttaman värjäytymisen vähentämiseksi tai estäm iseksi tanniinin aiheuttamalle värjäytymiselle alttiilla pinnalla käyt tämällä siirtymämetalli-ionille tarkoitettua kompleksointiainetta ja tällaista kompleksointiainetta sisältäviä ko | |
| EP0479075B1 (de) | Stabilisatoren enthaltende Holzbeizen | |
| DE60002100T2 (de) | Verfahren zur pigmentierung von holz | |
| TW514581B (en) | A method of protecting wood against light-induced degradation by treatment with an impregnation which penetrates the surface of the wood | |
| US20170326753A9 (en) | Protection of wood | |
| CA1095203A (en) | Gelled nonpigmented wood stains | |
| JP2005246761A (ja) | 立木染色方法及びその染色木材並びにその構造物 | |
| KR20030090657A (ko) | 목재 또는 목재 제품 처리용의 수용성 중합체 분산액에사용하기 위한 첨가제 | |
| US20240417590A1 (en) | Process for improving resin performance using lewis acids | |
| GB2215732A (en) | Water-based wood-staining composition |