US3547828A - Alkyl oligosaccharides and their mixtures with alkyl glucosides and alkanols - Google Patents
Alkyl oligosaccharides and their mixtures with alkyl glucosides and alkanols Download PDFInfo
- Publication number
- US3547828A US3547828A US759259A US3547828DA US3547828A US 3547828 A US3547828 A US 3547828A US 759259 A US759259 A US 759259A US 3547828D A US3547828D A US 3547828DA US 3547828 A US3547828 A US 3547828A
- Authority
- US
- United States
- Prior art keywords
- alkyl
- parts
- mixture
- alcohol
- glucoside
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 title description 87
- -1 Alkyl oligosaccharides Chemical class 0.000 title description 70
- 229920001542 oligosaccharide Polymers 0.000 title description 49
- 229930182478 glucoside Natural products 0.000 title description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 28
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 24
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 22
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 22
- 239000008103 glucose Substances 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 20
- 239000000047 product Substances 0.000 description 19
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 238000002360 preparation method Methods 0.000 description 15
- 150000002482 oligosaccharides Chemical class 0.000 description 13
- 238000004821 distillation Methods 0.000 description 12
- 150000008131 glucosides Chemical class 0.000 description 12
- 125000000217 alkyl group Chemical group 0.000 description 11
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 9
- PYIDGJJWBIBVIA-UYTYNIKBSA-N lauryl glucoside Chemical compound CCCCCCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O PYIDGJJWBIBVIA-UYTYNIKBSA-N 0.000 description 9
- 229940048848 lauryl glucoside Drugs 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 7
- 229930182470 glycoside Natural products 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000003822 preparative gas chromatography Methods 0.000 description 6
- 239000004753 textile Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- OAYXUHPQHDHDDZ-UHFFFAOYSA-N 2-(2-butoxyethoxy)ethanol Chemical compound CCCCOCCOCCO OAYXUHPQHDHDDZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 239000003599 detergent Substances 0.000 description 4
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000003147 glycosyl group Chemical group 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- BZANQLIRVMZFOS-ZKZCYXTQSA-N (3r,4s,5s,6r)-2-butoxy-6-(hydroxymethyl)oxane-3,4,5-triol Chemical compound CCCCOC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O BZANQLIRVMZFOS-ZKZCYXTQSA-N 0.000 description 3
- 239000012670 alkaline solution Substances 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000003752 hydrotrope Substances 0.000 description 3
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- UFSKIYBOKFBSOA-MLYSRARTSA-N (2r,3s,4s,5r)-2-(hydroxymethyl)-6-octadecoxyoxane-3,4,5-triol Chemical compound CCCCCCCCCCCCCCCCCCOC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O UFSKIYBOKFBSOA-MLYSRARTSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 150000002338 glycosides Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000010705 motor oil Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000002195 soluble material Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- XFRVVPUIAFSTFO-UHFFFAOYSA-N 1-Tridecanol Chemical compound CCCCCCCCCCCCCO XFRVVPUIAFSTFO-UHFFFAOYSA-N 0.000 description 1
- OWEGMIWEEQEYGQ-UHFFFAOYSA-N 100676-05-9 Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC2C(OC(O)C(O)C2O)CO)O1 OWEGMIWEEQEYGQ-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- GUBGYTABKSRVRQ-PICCSMPSSA-N Maltose Natural products O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-PICCSMPSSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000010692 aromatic oil Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 150000001720 carbohydrates Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 150000002016 disaccharides Chemical class 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001976 hemiacetal group Chemical group 0.000 description 1
- 239000002035 hexane extract Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000010687 lubricating oil Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H15/00—Compounds containing hydrocarbon or substituted hydrocarbon radicals directly attached to hetero atoms of saccharide radicals
- C07H15/02—Acyclic radicals, not substituted by cyclic structures
- C07H15/04—Acyclic radicals, not substituted by cyclic structures attached to an oxygen atom of the saccharide radical
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10M—LUBRICATING COMPOSITIONS; USE OF CHEMICAL SUBSTANCES EITHER ALONE OR AS LUBRICATING INGREDIENTS IN A LUBRICATING COMPOSITION
- C10M1/00—Liquid compositions essentially based on mineral lubricating oils or fatty oils; Their use as lubricants
- C10M1/08—Liquid compositions essentially based on mineral lubricating oils or fatty oils; Their use as lubricants with additives
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/662—Carbohydrates or derivatives
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10M—LUBRICATING COMPOSITIONS; USE OF CHEMICAL SUBSTANCES EITHER ALONE OR AS LUBRICATING INGREDIENTS IN A LUBRICATING COMPOSITION
- C10M2203/00—Organic non-macromolecular hydrocarbon compounds and hydrocarbon fractions as ingredients in lubricant compositions
- C10M2203/10—Petroleum or coal fractions, e.g. tars, solvents, bitumen
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10M—LUBRICATING COMPOSITIONS; USE OF CHEMICAL SUBSTANCES EITHER ALONE OR AS LUBRICATING INGREDIENTS IN A LUBRICATING COMPOSITION
- C10M2207/00—Organic non-macromolecular hydrocarbon compounds containing hydrogen, carbon and oxygen as ingredients in lubricant compositions
- C10M2207/02—Hydroxy compounds
- C10M2207/021—Hydroxy compounds having hydroxy groups bound to acyclic or cycloaliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10M—LUBRICATING COMPOSITIONS; USE OF CHEMICAL SUBSTANCES EITHER ALONE OR AS LUBRICATING INGREDIENTS IN A LUBRICATING COMPOSITION
- C10M2207/00—Organic non-macromolecular hydrocarbon compounds containing hydrogen, carbon and oxygen as ingredients in lubricant compositions
- C10M2207/04—Ethers; Acetals; Ortho-esters; Ortho-carbonates
- C10M2207/044—Cyclic ethers having four or more ring atoms, e.g. furans, dioxolanes
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10M—LUBRICATING COMPOSITIONS; USE OF CHEMICAL SUBSTANCES EITHER ALONE OR AS LUBRICATING INGREDIENTS IN A LUBRICATING COMPOSITION
- C10M2209/00—Organic macromolecular compounds containing oxygen as ingredients in lubricant compositions
- C10M2209/12—Polysaccharides, e.g. cellulose, biopolymers
Definitions
- the invention is concerned with the preparation of alkyl oligosaccharide mixtures whose components have the structure RO(C H O H Where R is selected from the group consisting of aliphatic hydrocarbon radicals ranging from C H to C H and m in the oligosaccharide portion, O(C H O H, is at least 2, but averages 3 or more, glycosyl units. One of the glycosyl units is connected through its first carbon atom to the alkyl group, R.
- Another object of the invention is the preparation of surface active compositions consisting of mixtures of alkyl oligosaccharides, alkyl glucosides and alkanols.
- alkyl oligosaccharides are highly effective hydrotropes for alkyl glucosides and mixtures of alkyl glucosides and alkanols. They are readily soluble in strongly alkaline solutions, thus facilitating the formulation of surface active materials in highly alkaline liquid systems. They, as well as mixtures thereof with alkyl glucosides and alkanols, also are useful as textile detergents, particularly in alkaline systems.
- R ranges from C to C in contrast with the values for R in the present invention which range from C to C
- the value for m in these maltosides is 2, but unlike the critical requirement for the compositions of the present invention the value for m does not average at least 3.
- Hori Yakugaku Zasshi, 78, 999 (1955) [C.A., 53, 3073 (1959)]
- Hori Yakugaku Zasshi, 78, 999 (1955) [C.A., 53, 3073 (1959)]
- the value for m in those compounds is 2, but does not average at least 3 and thereby fails to meet the essential requirement of the present invention.
- a lower alkyl glucoside preferably butyl glucoside
- An acid catalyst is employed in the amount of from about 0.0005 mol per mol of glucose to about 0.05 mol/mol of glucose.
- the preferred catalyst is H 50 although HCl, HNO p-toluene sulfonic acid, methanesulfonic acid, and other acid, electronaccepting compounds of the group generally classed as Lewis acids, may be employed. If sulfuric acid is employed as a catalyst it is preferred to use from 0.1 to 2.0 g./mol glucose (0.001 to 0.02 mol/mol glucose). If butanol or other lower alkanol is employed the preferred amount would be from 2 to 6 mols/mol glucose.
- the reaction is carried out at or above room temperature, preferably from to 120 C., by refluxing until the mixture is clear and the glucose is in solution. Alternatively, the water of reaction may be removed during the reflux either by distillation with or without a reflux splitter or by azeotropic separation using hexane, heptane, or other such azeotroping agents.
- the higher alcohol When conversion of the glucose to butyl glucoside has taken place, or when the reaction mixture is clear, the higher alcohol is added and the excess lower alkanol removed, the removal operation being facilitated by reducing the pressure in order to speed the distillation and keep the distillation temperature from getting too high.
- the amount of higher alcohol added generally will be from 0.5 to 4.0 mols/mol glucose, it being dependent upon the final composition desired, the average molecular weight of the higher alkyl oligosaccharides which are formed being inversely proportional to the amount of the higher alcohol used. That is, oligomers with relatively high molecular weights are formed if the mol ratio of alcohol to glucose is relatively low, and vice versa.
- an alcohol interchange reaction (transacetalation), already started, is continued by holding the reaction mixture at elevated temperatures under vacuum (if desired) so as continually to remove the lower alkanol as it and the higher alkyl glucosides and oligosaccharides are formed.
- the components of the mixtures of alkyl oligosaccharides, alkyl glucosides and alkanols which can be prepared in accordance with the present invention may vary as follows. For each parts by weight of the surface active mixture there may be present:
- components (a), (b) and (c) are present in fixed ratios to each other as stated. Those values are not absolute, however, for there may be present inert materials, such as lower alkyl glycosides, which make up the balance of the composition.
- the manner in which these ratios are varied is controlled by the amount of lower alcohol removed.
- the extent of reaction can be determined by a vapor phase chromatographic method of a sample at any time.
- the final composition of the product thus is a result not only of the amount of higher alcohol used but also the extent of the transacetalation reaction.
- the final composition may contain varying amounts of butyl glycosides which, although they do not contribute significantly to surface activity, in some cases they do insure desirable physical properties.
- Lauryl glucoside d (1 part) and 0121125 oligosaccharide (1 part) C12I%5 oligosaccharide by the mol ratio of alcohol/ glucose and the extent of the transacetalation reaction it is possible to control the nature of the end products of the invention so as to produce compositions with properties that are suitable for the intended use of the product. For example, increased higher alcohol content lowers the products solubility in water and in alkaline solutions, but may cause an improvement in the solubility, or at least lower the viscosity of the product, so that it will be highly useful in a lubricating oil or cosmetic formulation.
- Materials with relatively high alkyl glucoside contents exhibit good textile detergency although they may not be as soluble in alkaline solutions or as good hydrotropes for other nonionic surfactants as those containing less alkyl glucoside and more alkyl oligosaccharide.
- a mixture containing a relatively large amount of lauryl glucoside may have solubility properties that are similar to a mixture containing a relatively large amount of a C disaccharide.
- the novel alkyl oligosaccharide compositions from mixtures thereof along with alcohols and alkyl glucosides, this may be simply done by precipitating the alkyl oligosaccharides with a non-solvent such as acetone.
- the isolated oligosaccharides are useful as hydrotropes for alkyl glucosides and other surface active agents.
- Lauryl glucoside prepared from dodeeyl alcohol and glucose and purified in a manner similar to lauryl glucoside Analysis:
- EXAMPLE 1 Preparation of lauryl glucoside-lauryl oligosaccharidelauryl alcohol mixture
- EXAMPLE 2 Preparation of octadecyl oligosaccharide A mixture of 180 parts of glucose, 444 parts of butanol, 40 parts of hexane and 2 parts of concentrated sulfuric acid was reacted in a flask with an attached water separator while the water of reaction was collected and butyl glycosides were formed. There was then added 540 parts of stearyl alcohol, and butanol was distilled out. The mixture was maintained at 100105 C./4-5 mm. Hg. while the alcohol interchange reaction took place. The mixture was neutralized with 50% aqueous sodium hydroxide. The product was washed seven times with 3 liter portions of acetone.
- EXAMPLE 4 Preparation of a mixture of alcohols, alkyl glucosides and alkyl oligosaccharides in which the alkyl group of each component is a mixture of C H and C H
- a mixture of parts of glucose, 111 parts of butanol, about 4 parts of hexane and 0.25 part of concentrated sulfuric acid was stirred and refluxed while 10 parts of water was collected in a water separator.
- the mixture was held at 110 C./ 10 millimeters of mercury while butanol was removed by distillation and the alcohol interchange reaction was taking place.
- the mixture was then neutralized with 5 parts of 50% sodium hydroxide solution. It was diluted with parts of heptane and a practically clear solution resulted.
- a sample was removed for evaluation as a surfactant in gasoline.
- EXAMPLE 4a Preparation of a mixture of octadecyl alcohol, octadecyl glucoside and octadecyl oligosaccharides
- EXAMPLE 5 Preparation of a mixture of a quaternary ammonium cat- 1on1c surface active agent and an alkyl glucoside-alkyl oligosaccharide-alkanol mixture
- EXAMPLE 6 Preparation of various mixtures of alkanols, alkyl glucosides and alkyl oligosaccharides
- the general procedure, already described, for synthesizing a mixture of alkanols, alkyl glucosides, and alkyl oligosaccharides from glucose and a higher alcohol via a butyl glycoside intermediate was used to prepare a variety of products.
- the alcohol used in these experiments was a commercially available mixture comprised predominantly of dodecyl and tridecyl alcohols, leading to the formation of C H and C H alkanols, alkyl glycosides and alkyl oligosaccharides.
- Various mol ratios of alcohol/glucose were used, the products were analyzed by vapor phase chromatography of the trimethylsilyl derivatives, and the results are shown in Table II below:
- EXAMPLE 7 The same general preparative method was used to prepare a series of alkyl oligosaccharide-alkyl glucoside-alkanol mixtures. These crude mixtures were washed with acetone to remove the alcohol and alkyl glucoside. The residual alkyl oligosaccharide mixtures were analyzed by vapor phase chromatography of the trimethylsilyl derivatives and are shown in the following table.
- a mixture consisting essentially of alkyl oligosaccharides, alkyl glucosides and alkanols, the surface active ingredients of which mixture, for each 100 parts by weight present, consists of:
- ROH is a mixture of H25C120H, H27C13OH, H29C140H and H31C15OH; is a mixture Of H25C1ZOG, H27C13OG, H29C14OG, and H C OG; and R'O(C H O H is a mixture of 25 1z e 1o 5)m 2'1 1a 6 10 5)m 29 14 6 10 5)m and H31C150 6 10 s)m
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Molecular Biology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Wood Science & Technology (AREA)
- Crystallography & Structural Chemistry (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Saccharide Compounds (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75925968A | 1968-09-03 | 1968-09-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3547828A true US3547828A (en) | 1970-12-15 |
Family
ID=25054991
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US759259A Expired - Lifetime US3547828A (en) | 1968-09-03 | 1968-09-03 | Alkyl oligosaccharides and their mixtures with alkyl glucosides and alkanols |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3547828A (enExample) |
| BE (1) | BE737973A (enExample) |
| DE (1) | DE1943689A1 (enExample) |
| FR (1) | FR2017240A1 (enExample) |
| GB (1) | GB1284456A (enExample) |
| NL (1) | NL6913461A (enExample) |
Cited By (165)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3839318A (en) * | 1970-09-27 | 1974-10-01 | Rohm & Haas | Process for preparation of alkyl glucosides and alkyl oligosaccharides |
| US3912713A (en) * | 1973-08-29 | 1975-10-14 | Scholten Honig Research Nv | Guar gum derivatives and process for preparation |
| US4196201A (en) * | 1977-05-18 | 1980-04-01 | L'oreal | Non-irritating eye make-up remover composition |
| JPS58104625A (ja) * | 1981-07-13 | 1983-06-22 | ザ・プロクタ−・エンド・ギヤンブル・カンパニ− | 起泡性界面活性剤組成物 |
| US4393203A (en) * | 1982-04-26 | 1983-07-12 | The Procter & Gamble Company | Process of preparing alkylpolysaccharides |
| US4396520A (en) * | 1982-04-26 | 1983-08-02 | The Procter & Gamble Company | Detergent compositions |
| US4483779A (en) * | 1982-04-26 | 1984-11-20 | The Procter & Gamble Company | Detergent compositions comprising polyglycoside and polyethoxylate surfactants and anionic fluorescer |
| US4483780A (en) * | 1982-04-26 | 1984-11-20 | The Procter & Gamble Company | Detergent compositions containing polyglycoside and polyethoxylate detergent surfactants |
| US4488981A (en) * | 1983-09-06 | 1984-12-18 | A. E. Staley Manufacturing Company | Lower alkyl glycosides to reduce viscosity in aqueous liquid detergents |
| US4493773A (en) * | 1982-05-10 | 1985-01-15 | The Procter & Gamble Company | Low phosphate, softening laundry detergent containing ethoxylated nonionic, alkylpolysaccharide and cationic surfactants |
| US4536318A (en) * | 1982-04-26 | 1985-08-20 | The Procter & Gamble Company | Foaming surfactant compositions |
| US4536317A (en) * | 1982-04-26 | 1985-08-20 | The Procter & Gamble Company | Foaming surfactant compositions |
| US4557729A (en) * | 1984-05-24 | 1985-12-10 | A. E. Staley Manufacturing Company | Color stabilization of glycosides |
| US4565647A (en) * | 1982-04-26 | 1986-01-21 | The Procter & Gamble Company | Foaming surfactant compositions |
| US4571306A (en) * | 1984-04-26 | 1986-02-18 | A. E. Staley Manufacturing Company | Separation of lipophilic components from solutions by adsorption |
| US4599188A (en) * | 1982-04-26 | 1986-07-08 | The Procter & Gamble Company | Foaming surfactant compositions |
| USH171H (en) | 1985-06-24 | 1986-12-02 | A. E. Staley Manufacturing Company | Branched chain glycosides |
| WO1987002050A1 (en) * | 1985-09-26 | 1987-04-09 | A. E. Staley Manufacturing Company | Fine fabric detergent composition |
| WO1987002051A1 (en) * | 1985-09-26 | 1987-04-09 | A. E. Staley Manufacturing Company | Nonionic fine fabric detergent composition |
| US4663069A (en) * | 1982-04-26 | 1987-05-05 | The Procter & Gamble Company | Light-duty liquid detergent and shampoo compositions |
| US4675392A (en) * | 1982-06-23 | 1987-06-23 | Svenska Sockerfabriks Ab | Glycosides |
| US4683297A (en) * | 1983-06-07 | 1987-07-28 | Daicel Chemical Industries Ltd. | Process for the preparation of glycosides |
| US4704453A (en) * | 1982-09-03 | 1987-11-03 | Basf Aktiengesellschaft | Preparation of alkylglucosides |
| US4716222A (en) * | 1984-04-06 | 1987-12-29 | Hoechst Aktiengesellschaft | Substrates for hydrolases |
| US4762918A (en) * | 1984-11-21 | 1988-08-09 | Staley Continental, Inc. | Decolorization of glycosides |
| US4820814A (en) * | 1986-07-23 | 1989-04-11 | Huls Aktiengesellschaft | Process for producing colorless butyloligoglycosides |
| US4888325A (en) * | 1985-12-23 | 1989-12-19 | Henkel Kommanditgesellschaft Auf Aktien | Controlling plant pests with compositions containing alkyl glycoside |
| US4900721A (en) * | 1986-06-09 | 1990-02-13 | Henkel Kommanditgesellschaft Auf Aktien | Disinfectants and their use for disinfecting the skin and mucous membrane |
| WO1990001489A1 (de) | 1988-08-13 | 1990-02-22 | Henkel Kommanditgesellschaft Auf Aktien | Verfahren zur herstellung von alkylglucosidverbindungen aus oligo- und/oder polysacchariden |
| WO1990002163A1 (de) | 1988-08-16 | 1990-03-08 | Henkel Kommanditgesellschaft Auf Aktien | Pastenförmiges wasch- und renigungsmittel und verfahren zur herstellung |
| US4920100A (en) * | 1986-06-09 | 1990-04-24 | Henkel Kommanditgesellschaft Auf Aktien | Alkyl gylcosides as potentiating agents in antiseptic compositions |
| US4923685A (en) * | 1987-07-30 | 1990-05-08 | Henkel Kommanditgesellschaft Auf Aktien | Antimicrobial flavored compositions having particular utility as mouth washes |
| WO1990006353A1 (de) | 1988-12-07 | 1990-06-14 | Henkel Kommanditgesellschaft Auf Aktien | Phosphatfreies, flüssiges waschmittel mit hoher alkalität |
| US4939245A (en) * | 1988-12-21 | 1990-07-03 | Henkel Kommanditgesellschaft Auf Aktien | Process for the direct production of glysoside product in the presence of solid saccharide |
| US4939246A (en) * | 1988-02-13 | 1990-07-03 | Basf Aktiengesellschaft | Purification of long-chain alkylglucosides |
| WO1990007516A1 (en) * | 1988-12-23 | 1990-07-12 | Henkel Kommanditgesellschaft Auf Aktien | Process for production of glycosides |
| US4942054A (en) * | 1987-05-13 | 1990-07-17 | Curtice-Burns, Inc. | Process for producing low calorie foods from alkyl glycoside fatty acid polyesters |
| US4950743A (en) * | 1987-07-29 | 1990-08-21 | Henkel Kommanditgesellschaft Auf Aktien | Process for preparation of alkylglycosides |
| US4959468A (en) * | 1987-06-12 | 1990-09-25 | Henkel Kommanditgesellschaft Auf Aktien | Color stabilization method for glycoside products |
| EP0396044A1 (de) * | 1989-05-05 | 1990-11-07 | Henkel Kommanditgesellschaft auf Aktien | Mischung aus Alkylglucosiden und Alkoholen als Entschäumer |
| US4987225A (en) * | 1988-12-23 | 1991-01-22 | Henkel Kommanditgesellschaft Auf Aktien | Removal of water miscible materials from glycoside mixtures |
| DE3927919A1 (de) * | 1989-08-24 | 1991-02-28 | Henkel Kgaa | Verfahren zur herstellung von alkylglykosiden |
| US5077039A (en) * | 1988-10-15 | 1991-12-31 | Basf Aktiengesellschaft | Substituted glucosides |
| EP0444262A3 (en) * | 1990-02-26 | 1992-01-22 | Huels Aktiengesellschaft | Liquid foaming detergent |
| EP0474915A1 (de) * | 1990-09-13 | 1992-03-18 | Hüls Aktiengesellschaft | Waschmittel |
| US5108585A (en) * | 1985-10-17 | 1992-04-28 | Henkel Kommanditgesellschaft Auf Aktien | Flotation of non-sulfidic ore with a glycosidic collector |
| US5130420A (en) * | 1989-03-17 | 1992-07-14 | Kao Corporation | Process for the production of alkyl glycoside |
| US5221343A (en) * | 1992-04-10 | 1993-06-22 | Henkel Corporation | Dispersant, setting retarder and air entrainment additive for cement |
| US5223165A (en) * | 1988-05-31 | 1993-06-29 | Henkel Kommanditgesellschaft Auf Aktien | Use of alkyl glycosides for dust suppression |
| US5258142A (en) * | 1990-06-05 | 1993-11-02 | Henkel Kommanditgesellschaft Auf Aktien | Liquid, free-flowing and pumpable surfactant concentrate containing mixed anionic surfactant and alkyl polyglycoside surfactant |
| US5266690A (en) * | 1991-12-19 | 1993-11-30 | Henkel Corporation | Preparation of alkylpolyglycosides |
| US5268126A (en) * | 1989-08-04 | 1993-12-07 | Huels Aktiengesellschaft | Emulsifiers for the preparation of aqueous polysiloxane emulsions and aqueous polysiloxane-paraffin oil emulsions with long shelf lives |
| US5286406A (en) * | 1990-03-26 | 1994-02-15 | Henkel Kommanditgesellschaft Auf Aktien | Liquid body-cleansing agents based on alkyl glycosides |
| US5292500A (en) * | 1989-08-25 | 1994-03-08 | Henkel Kommanditgesellschaft Auf Aktien | Plaque-inhibiting toothpaste comprising antibacterial biguanides |
| US5330674A (en) * | 1992-09-09 | 1994-07-19 | Henkel Corporation | Method for increasing the efficiency of a disinfectant cleaning composition using alkyl polyglycosides |
| WO1994020116A1 (en) * | 1993-03-10 | 1994-09-15 | University Of Alabama Research Foundation | Artificial primers for glycogen synthesis |
| US5362861A (en) * | 1992-07-15 | 1994-11-08 | Henkel Corporation | Continuous bleaching of alkylpolyglycosides |
| US5374716A (en) * | 1987-07-18 | 1994-12-20 | Henkel Kommanditgesellschaft Auf Aktien | Process for the production of surface active alkyl glycosides |
| US5385750A (en) * | 1992-05-14 | 1995-01-31 | Henkel Corporation | Alkyl glycoside compositions with improved wetting properties |
| US5430131A (en) * | 1992-04-24 | 1995-07-04 | Henkel Corporation | Method for preparing stabilized alkyl glycosides |
| US5432275A (en) * | 1994-02-25 | 1995-07-11 | Henkel Corporation | Continuous bleaching of alkylpolyglycosides |
| US5449763A (en) * | 1991-10-10 | 1995-09-12 | Henkel Corporation | Preparation of alkylpolyglycosides |
| US5476610A (en) * | 1991-07-22 | 1995-12-19 | Henkel Kommanditgesellschaft Auf Aktien | Process for stabilizing aqueous zeolite suspensions |
| US5498704A (en) * | 1992-04-21 | 1996-03-12 | Basf Aktiengesellschaft | Preparation of alkyl glycosides |
| US5516747A (en) * | 1994-04-18 | 1996-05-14 | Henkel Corporation | Pesticidal surfactant mixtures comprising alkyl polyglycosides and alkyl naphthalene sulfonates |
| US5523016A (en) * | 1991-05-29 | 1996-06-04 | Henkel Kommanditgesellschaft Auf Aktien | Liquid pourable and pumpable surfactant preparation |
| US5538669A (en) * | 1990-11-09 | 1996-07-23 | Henkel Kommanditgesellschaft Auf Aktien | Stabilized surfactant paste |
| US5550220A (en) * | 1987-05-13 | 1996-08-27 | Curtice-Burns, Inc. | Alkyl glycoside fatty acid polyester fat substitute food compositions and process to produce the same |
| US5556950A (en) * | 1992-04-24 | 1996-09-17 | Henkel Corporation | Method for preparing stabilized alkyl glycosides |
| US5591377A (en) * | 1991-10-15 | 1997-01-07 | Henkel Kommanditgesellschaft Auf Aktien | Viscous water-based surfactant preparation |
| WO1997000609A1 (en) * | 1995-06-21 | 1997-01-09 | Henkel Corporation | Method for increasing the efficacy of an odor masking agent |
| US5631003A (en) * | 1991-09-25 | 1997-05-20 | Henkel Kommanditgesellschaft Auf Aktien | Hair treatment prepartation |
| US5691295A (en) * | 1995-01-17 | 1997-11-25 | Cognis Gesellschaft Fuer Biotechnologie Mbh | Detergent compositions |
| US5696074A (en) * | 1993-06-18 | 1997-12-09 | Henkel Kommanditgesellschaft Auf Aktien | Liquid crystalline, aqueous surfactant preparations |
| US5734029A (en) * | 1991-10-10 | 1998-03-31 | Henkel Corporation | Preparation of improved alkypolygloycoside surfactant mixtures |
| DE19710112A1 (de) * | 1997-03-12 | 1998-09-17 | Henkel Kgaa | Verfahren zur kontinuierlichen Herstellung von Alkyl- und/oder Alkenyloligoglykosiden |
| US5811386A (en) * | 1993-01-28 | 1998-09-22 | Henkel Kommanditgesellschaft Auf Aktien | Clear surface-active mixtures containing anionic surfactant, APG, and temporarily cationic copolymer |
| DE19714255A1 (de) * | 1997-04-07 | 1998-10-08 | Henkel Kgaa | Verfahren zur Herstellung von Alkyl- und/oder Alkenyloligoglykosiden |
| US5840943A (en) * | 1994-06-13 | 1998-11-24 | Henkel Kommanditgesellschaft Auf Aktien | Polyolpolyhydroxystearates |
| US5856290A (en) * | 1994-09-26 | 1999-01-05 | Henkel Kommanditgesellschaft Auf Aktien | Disinfecting cleanser for hard surfaces based on mixtures of APG and C8 -C18 alkyl ether |
| US5880299A (en) * | 1995-10-26 | 1999-03-09 | Henkel Corporation | Esterquats |
| US5888482A (en) * | 1995-05-24 | 1999-03-30 | Societe D'exploitation De Produits Pour L'industrie Chimique Seppic | Emulsifying composition based on alkylpolyglycosides and its uses |
| EP0913403A1 (en) * | 1997-10-30 | 1999-05-06 | CONDEA AUGUSTA S.p.A. | Process for the synthesis of alkylpolyglucosides |
| US5904736A (en) * | 1995-04-28 | 1999-05-18 | Henkel Kommanditgesellschaft Auf Aktien | Cellulase-containing washing agents |
| US5939081A (en) * | 1996-02-27 | 1999-08-17 | Henkel Kommanditgesellschaft Auf Aktien | Esters of alkyl and/or alkenyl oligoglycosides with fatty acids |
| US5958431A (en) * | 1990-10-17 | 1999-09-28 | Societe D'exploitation De Produits Pour Les Industries Chimique S.E.P.P.I.C. | Use of fatty alcohol based compositions for preparing emulsions; method of preparing emulsions and emulsions so obtained |
| US5962663A (en) * | 1994-12-02 | 1999-10-05 | Henkel Kommanditgesellschaft Auf Aktien | Cationic biopolymers |
| US5972668A (en) * | 1994-06-28 | 1999-10-26 | Henkel Kommanditgesellschaft Auf Aktien | Production of multi-enzyme granules |
| US5980874A (en) * | 1995-08-17 | 1999-11-09 | Henkel Kommanditgesellschaft Auf Aktien | Translucent antiperspirants/deodorants |
| US6071429A (en) * | 1992-09-21 | 2000-06-06 | Henkel Corporation | Viscosity-stabilized amide composition, methods of preparing and using same |
| US6077945A (en) * | 1997-02-18 | 2000-06-20 | Eastman Chemical Company | Process for making alkylpolyglycosides |
| US6121331A (en) * | 1996-06-07 | 2000-09-19 | Henkel Kommanditgesellschaft Auf Aktien | Aqueous nacreous luster concentrates |
| US6221370B1 (en) | 1996-09-02 | 2001-04-24 | Henkel Kommanditgesellschaft Auf Aktien | Fatty acid ethoxylates and partial glycerides for preparing phase inversion temperature emulsions |
| US6228831B1 (en) | 1996-06-07 | 2001-05-08 | Henkel Kommanditgesellschaft Auf Aktien | Aqueous nacreous lustre concentrates |
| US6235702B1 (en) | 1996-05-30 | 2001-05-22 | Henkel Kommaditgesellschaft Auf Aktien | Aqueous nacreous lustre concentrate |
| US6255253B1 (en) | 1997-08-18 | 2001-07-03 | Cognis Deutschland Gmbh | Microemulsions |
| US6514927B2 (en) | 1997-06-17 | 2003-02-04 | Clariant Gmbh | Detergent and cleaner containing soil release polymer and alkanesulfonate and/or α-olefinsulfonate |
| US6537562B1 (en) | 1997-01-29 | 2003-03-25 | Cognis Deutschland Gmbh & Co. Kg | Cosmetic PIT emulsions |
| US6589945B1 (en) | 1996-10-17 | 2003-07-08 | Cognis Deutschland Gmbh & Co. Kg | Use of sterolsulfates as active substances for producing means to inhibit serin proteases |
| US6617301B1 (en) * | 1999-05-18 | 2003-09-09 | Lamberti S.P.A. | Mixtures of surfactants used as wetting agents and/or emulsifiers in agrochemical preparations |
| US20030232726A1 (en) * | 2002-06-12 | 2003-12-18 | Fisk James V. | Silicic acid mud lubricants |
| US6667043B1 (en) | 1996-02-09 | 2003-12-23 | Cognis Deutschland Gmbh & Co. Kg | Technical di- and triglyceride mixtures |
| US20040014603A1 (en) * | 2000-10-24 | 2004-01-22 | Horst-Werner Wollenweber | Aqueous agents containing pesticides |
| US6710082B1 (en) | 1996-06-03 | 2004-03-23 | Cognis Deutschland Gbmh & Co. Kg | Use of hydroxycarboxylic acid esters as thickeners |
| US6716443B1 (en) | 1999-02-27 | 2004-04-06 | Cognis Deutschland Gmbh & Co. Kg | PIT emulsions |
| US20040224871A1 (en) * | 2001-10-22 | 2004-11-11 | Josef Penninger | Cotton active, dirt removing urethane-based polymers |
| US20050002964A1 (en) * | 2001-12-18 | 2005-01-06 | Dirk Bockmuhl | Adhesion inhibition of fungi |
| US20050239681A1 (en) * | 2002-12-20 | 2005-10-27 | Horst-Dieter Speckmann | Bleach-containing washing or cleaning agents |
| US20050272922A1 (en) * | 1999-07-12 | 2005-12-08 | Andrea Heilemann | Processes for preparing crosslinker-free, biopolymer-containing three dimensional structures, and products prepared thereby |
| US20050281773A1 (en) * | 2002-12-20 | 2005-12-22 | Henkel Kommanditgesellschaft Auf Aktien | Subtilisin variants with improved perhydrolase activity |
| US20050282261A1 (en) * | 2002-12-20 | 2005-12-22 | Henkel Kommanditgesellschaft Auf Aktien | Novel choline oxidases |
| US20060030504A1 (en) * | 2003-02-10 | 2006-02-09 | Josef Penninger | Detergents or cleaning agents comprising a water-soluble building block system and a cellulose derivative with dirt dissolving properties |
| US20060035806A1 (en) * | 2003-02-10 | 2006-02-16 | Josef Penninger | Increase in the water absorption capacity of textiles |
| US20060035801A1 (en) * | 2003-02-10 | 2006-02-16 | Josef Penninger | Bleach-containing laundry detergents or cleaning compositions comprising water-soluble builder system and soil release-capable cellulose derivative |
| US20060035804A1 (en) * | 2003-02-10 | 2006-02-16 | Josef Penninger | Use of cellulose derivatives as foam regulators |
| US20060035805A1 (en) * | 2003-02-10 | 2006-02-16 | Josef Penninger | Bleach-containing laundry detergent comprising cotton-active soil release-capable cellulose derivative |
| US20060046969A1 (en) * | 2004-08-25 | 2006-03-02 | Aegis Therapeutics Llc | Antibacterial compositions for drug administration |
| US20060046950A1 (en) * | 2003-02-10 | 2006-03-02 | Josef Penninger | Enhancement of the cleaning performance of laundry detergents by cellulose derivative and hygroscopic polymer |
| US20060046951A1 (en) * | 2003-02-10 | 2006-03-02 | Josef Penninger | Enhancement of the cleaning performance of laundry detergents by a combination of cellulose derivatives |
| US20060128813A1 (en) * | 2003-06-17 | 2006-06-15 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Inhibition of the asexual reproduction of fungi by eugenol and/or derivatives thereof |
| US20060134239A1 (en) * | 2003-06-17 | 2006-06-22 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Agents against microorganisms containing patchouli oil, patchouli alcohol and/or the derivatives thereof |
| EP1762220A2 (de) | 2005-09-09 | 2007-03-14 | Henkel Kommanditgesellschaft auf Aktien | Mittel zur Färbung keratinischer Fasern enthaltend Polymere mit kleiner Molmasse |
| WO2007054203A2 (de) | 2005-11-08 | 2007-05-18 | Henkel Ag & Co. Kgaa | Enzym / subtstrat sytem zur generierung von wasserstoffperoxid enthaltend sorbitol oxidase aus streptomyces c0elic0l0r und sorbitol |
| US20070142261A1 (en) * | 2005-12-15 | 2007-06-21 | Clark James W | Wiper for use with disinfectants |
| US20080004357A1 (en) * | 2006-07-01 | 2008-01-03 | Goldschmidt Gmbh | Method of producing finely divided oil-in-water emulsions |
| US20080050398A1 (en) * | 2005-03-29 | 2008-02-28 | Dirk Bockmuehl | Composition Comprising Beta-Defensin 2 |
| US20080090746A1 (en) * | 2005-06-08 | 2008-04-17 | Josef Penninger | Boosting the cleaning performance of laundry detergents by polymer |
| US20080200418A1 (en) * | 2004-08-25 | 2008-08-21 | Aegis Therapeutics, Inc. | Compositions for drug administration |
| US20080207734A1 (en) * | 2003-12-03 | 2008-08-28 | Stefan Stumpe | Novel alkoxylactones, alkoxylactams and alkoxythiolactams for controlling processes based on microbial interaction |
| DE102007023870A1 (de) | 2007-05-21 | 2008-11-27 | Henkel Ag & Co. Kgaa | Waschmittel, enthaltend reaktive cyclische Carbonate oder Harnstoffe oder deren Derivate als die Primärwaschkraft verbessernde Wirkstoffe |
| DE102007023827A1 (de) | 2007-05-21 | 2008-11-27 | Henkel Ag & Co. Kgaa | Waschmittel, enthaltend reaktive cyclische Carbonate oder Harnstoffe oder deren Derivate als schmutzablösevermögende Wirkstoffe |
| US20080299079A1 (en) * | 2004-08-25 | 2008-12-04 | Aegis Therapeutics, Llc | Absorption Enhancers for Drug Administration |
| US20090036669A1 (en) * | 2005-03-15 | 2009-02-05 | Rauzah Hashim | Glycolipids of branched chain alkyl oligosaccharides for liquid crystal and related applications |
| DE102007036392A1 (de) | 2007-07-31 | 2009-02-05 | Henkel Ag & Co. Kgaa | Zusammensetzungen enthaltend Perhydrolasen und Alkylenglykoldiacetate |
| US20090047347A1 (en) * | 2005-07-29 | 2009-02-19 | Aegis Therapeutics, Inc. | Compositions for Drug Administration |
| US20090095936A1 (en) * | 2007-10-16 | 2009-04-16 | Michael Jeffrey D | Fluoroalkenyl Poly[1,6]glycosides |
| US20090163447A1 (en) * | 2004-08-25 | 2009-06-25 | Maggio Edward T | Compositions for Drug Administration |
| EP2153889A2 (de) | 2008-08-15 | 2010-02-17 | Evonik Goldschmidt GmbH | Nanoemulsionen und Verfahren zu deren Herstellung, sowie deren Verwendung als Formulierungen von Pflanzenschutz- und/oder Schädlingsbekämpfungsmitteln und/oder kosmetischen Zubereitungen |
| US20100068209A1 (en) * | 2004-08-25 | 2010-03-18 | Aegis Therapeuttics LLC | Antibacterial compositions for drug administration |
| DE102008047743A1 (de) | 2008-09-17 | 2010-04-15 | Henkel Ag & Co. Kgaa | Verwendung von Harnstoff-Derivaten und Phenacylthiazolium-Salzen zur Behandlung von Körpergeruch |
| DE102008053034A1 (de) | 2008-10-24 | 2010-04-29 | Henkel Ag & Co. Kgaa | Verwendung von Hydroxyzimtsäuren und ihren Derivaten und/oder von Pflanzenextrakten zur Behandlung von Körpergeruch |
| DE102010031263A1 (de) | 2009-07-10 | 2011-03-03 | Hohenester, Hermann, Dr. | Zubereitung enthaltend Zucchini und/oder Ingwer und/oder Papaya und/oder Ananas zur Behandlung von Körperteilen bzw. zur kosmetischen Pflege und insbesondere zur Mundpflege |
| US8034123B2 (en) | 2005-06-08 | 2011-10-11 | Henkel Ag & Co., Kgaa | Boosting cleaning power of detergents by means of a polymer |
| WO2012126976A1 (de) | 2011-03-24 | 2012-09-27 | Basf Se | Verfahren zur erdölförderung unter verwendung von tensiden aus der klasse der alkylpolyglucoside |
| DE102011102052A1 (de) * | 2011-05-19 | 2012-11-22 | Anke Gmbh & Co. Kg | Netzmittel für elektrolytische Anwendung und dessen Verwendung |
| US8895546B2 (en) | 2009-03-27 | 2014-11-25 | Hale Biopharma Ventures, Llc | Administration of benzodiazepine compositions |
| DE102013218616A1 (de) | 2013-09-17 | 2015-03-19 | Henkel Ag & Co. Kgaa | Verwendung von Alkyl-/Alkenyl-Oligoglykosidderivaten zur Textilbehandlung |
| US9283280B2 (en) | 2008-12-22 | 2016-03-15 | Aegis Therapeutics, Llc | Compositions for drug administration |
| DE102014223885A1 (de) | 2014-11-24 | 2016-05-25 | Henkel Ag & Co. Kgaa | Flüssigwaschmittel enthaltend Zitronensäure und Niotensid |
| DE102015201698A1 (de) | 2015-01-30 | 2016-08-04 | Henkel Ag & Co. Kgaa | Saures Flüssigkompaktwaschmittel enthaltend Hydroxycarbonsäure, Niotensid und a-Amylase |
| DE102015201702A1 (de) | 2015-01-30 | 2016-08-04 | Henkel Ag & Co. Kgaa | Saures Flüssigkompaktwaschmittel enthaltend Hydroxycarbonsäure, Niotensid und Enzym |
| EP3106503A1 (fr) | 2015-06-18 | 2016-12-21 | Rhodia Operations | Agents desorbants alkyl polyglucosides pour la recuperation assistee du petrole |
| US20160376489A1 (en) * | 2013-12-29 | 2016-12-29 | Halliburton Energy Services, Inc. | LUBRICANT FOR HIGH pH WATER BASED MUD SYSTEM |
| DE102015215591A1 (de) | 2015-08-14 | 2017-02-16 | Henkel Ag & Co. Kgaa | Wasserarme, zweiphasige Flüssigwaschmittel mit saurem pH-Wert |
| JP2017537924A (ja) * | 2014-12-03 | 2017-12-21 | テレオス・スターチ・アンド・スウィートナーズ・ベルギーTereos Starch & Sweeteners Belgium | 長アルキル鎖を含む糖モノエーテルの合成および界面活性剤としての使用 |
| US9895444B2 (en) | 2004-08-25 | 2018-02-20 | Aegis Therapeutics, Llc | Compositions for drug administration |
| WO2018053202A1 (en) | 2016-09-14 | 2018-03-22 | Reg Life Sciences Llc | 1,3-fatty diol compounds and derivatives thereof |
| US10046025B2 (en) | 2006-06-23 | 2018-08-14 | Aegis Therapeutics, Llc | Stabilizing alkylglycoside compositions and methods thereof |
| US10265402B2 (en) | 2004-08-25 | 2019-04-23 | Aegis Therapeutics, Llc | Absorption enhancers for drug administration |
| EP3508563A1 (de) | 2001-09-20 | 2019-07-10 | Ecolab USA Inc. | Verwendung von o/w-emulsionen zur kettenschmierung |
| US10653598B2 (en) | 2015-11-11 | 2020-05-19 | Henkel Ag & Co. Kgaa | Decoloring of dyed keratin fibers |
| US10682414B2 (en) | 2018-02-06 | 2020-06-16 | Aegis Therapeutics, Llc | Intranasal epinephrine formulations and methods for the treatment of disease |
| WO2021170283A1 (de) | 2020-02-27 | 2021-09-02 | Henkel Ag & Co. Kgaa | Bio-fermentierte tenside zur verringerung der abrasion von zahnschmelz |
| US11241414B2 (en) | 2008-03-28 | 2022-02-08 | Neurelis, Inc. | Administration of benzodiazepine compositions |
| US12521400B2 (en) | 2024-07-24 | 2026-01-13 | Neurelis, Inc. | Administration of benzodiazepine compositions |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3470543D1 (en) * | 1983-06-15 | 1988-05-26 | Procter & Gamble | Improved process for preparing alkyl glycosides |
| FR2557134B1 (fr) * | 1983-12-23 | 1986-11-28 | Produits Ind Cie Fse | Additif pour bains de nettoyage alcalins, produit complet le contenant et utilisation |
| DE3444958A1 (de) * | 1984-12-10 | 1986-06-12 | Henkel KGaA, 4000 Düsseldorf | Verwendung von alkylglykosiden als potenzierungsmittel in antiseptischen mitteln sowie desinfektions- und reinigungsmittel mit verstaerkter bakterizider wirkung |
| DE3619796A1 (de) * | 1986-06-12 | 1987-12-17 | Huels Chemische Werke Ag | Verfahren zur herstellung von alkyloligoglycosiden |
| LU86756A1 (fr) * | 1987-02-03 | 1988-11-17 | Oreal | Compositions cosmetiques non agressives contenant un tensio-actif moussant et un tensio-actif non ionique a deux chaines grasses |
| DE3842541A1 (de) * | 1988-12-17 | 1990-06-21 | Henkel Kgaa | Verfahren zur herstellung von oberflaechenaktiven alkylglucosiden |
| FR2650281A1 (fr) | 1989-07-31 | 1991-02-01 | Beghin Say Sa | Nouveau procede de preparation d'alkyl-1-thioglycosides et d'alkyl-glycosides, nouveaux melanges d'anomeres obtenus par ce procede et leur application comme detergents non ioniques |
| DE3925846A1 (de) * | 1989-08-04 | 1991-02-14 | Huels Chemische Werke Ag | Emulgatoren zur herstellung von lagerstabilen, waessrigen polysiloxan- bzw. polysiloxan-paraffinoel-emulsionen |
| US5217637A (en) * | 1989-08-10 | 1993-06-08 | Huels Aktiengesellschaft | Aqueous hydraulic fluids for energy transfer |
| DE3926397A1 (de) * | 1989-08-10 | 1991-02-14 | Huels Chemische Werke Ag | Hydraulikfluessigkeiten |
| DE4225224A1 (de) * | 1992-07-30 | 1994-02-03 | Henkel Kgaa | Verfahren zur Herstellung von lagerstabilen nichtionischen Tensiden |
| DE4344991A1 (de) * | 1993-12-30 | 1995-07-06 | Huels Chemische Werke Ag | Verfahren zur Umwandlung hexagonal flüssig-kristalliner wäßriger Tensidphasen |
| WO2011042409A2 (en) | 2009-10-05 | 2011-04-14 | Momentive Performance Materials Gmbh | Aqueous emulsions of polyorganosiloxanes |
| EP4279495A1 (en) * | 2022-05-20 | 2023-11-22 | Basf Se | Process of manufacturing alkylpolyglycoside |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2218569A (en) * | 1939-09-13 | 1940-10-22 | Dow Chemical Co | Glycosides of pentose ethers |
| US2235783A (en) * | 1939-09-13 | 1941-03-18 | Dow Chemical Co | Ethers of glucosides |
| US2258168A (en) * | 1939-09-13 | 1941-10-07 | Dow Chemical Co | Glucoside ether from polysaccharide ethers |
-
1968
- 1968-09-03 US US759259A patent/US3547828A/en not_active Expired - Lifetime
-
1969
- 1969-08-08 GB GB39747/69A patent/GB1284456A/en not_active Expired
- 1969-08-26 BE BE737973A patent/BE737973A/xx unknown
- 1969-08-27 FR FR6929316A patent/FR2017240A1/fr not_active Withdrawn
- 1969-08-28 DE DE19691943689 patent/DE1943689A1/de active Pending
- 1969-09-03 NL NL6913461A patent/NL6913461A/xx unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2218569A (en) * | 1939-09-13 | 1940-10-22 | Dow Chemical Co | Glycosides of pentose ethers |
| US2235783A (en) * | 1939-09-13 | 1941-03-18 | Dow Chemical Co | Ethers of glucosides |
| US2258168A (en) * | 1939-09-13 | 1941-10-07 | Dow Chemical Co | Glucoside ether from polysaccharide ethers |
Cited By (216)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3839318A (en) * | 1970-09-27 | 1974-10-01 | Rohm & Haas | Process for preparation of alkyl glucosides and alkyl oligosaccharides |
| US3912713A (en) * | 1973-08-29 | 1975-10-14 | Scholten Honig Research Nv | Guar gum derivatives and process for preparation |
| US4196201A (en) * | 1977-05-18 | 1980-04-01 | L'oreal | Non-irritating eye make-up remover composition |
| JPS58104625A (ja) * | 1981-07-13 | 1983-06-22 | ザ・プロクタ−・エンド・ギヤンブル・カンパニ− | 起泡性界面活性剤組成物 |
| US4536318A (en) * | 1982-04-26 | 1985-08-20 | The Procter & Gamble Company | Foaming surfactant compositions |
| US4393203A (en) * | 1982-04-26 | 1983-07-12 | The Procter & Gamble Company | Process of preparing alkylpolysaccharides |
| US4483779A (en) * | 1982-04-26 | 1984-11-20 | The Procter & Gamble Company | Detergent compositions comprising polyglycoside and polyethoxylate surfactants and anionic fluorescer |
| US4483780A (en) * | 1982-04-26 | 1984-11-20 | The Procter & Gamble Company | Detergent compositions containing polyglycoside and polyethoxylate detergent surfactants |
| US4663069A (en) * | 1982-04-26 | 1987-05-05 | The Procter & Gamble Company | Light-duty liquid detergent and shampoo compositions |
| US4396520A (en) * | 1982-04-26 | 1983-08-02 | The Procter & Gamble Company | Detergent compositions |
| US4599188A (en) * | 1982-04-26 | 1986-07-08 | The Procter & Gamble Company | Foaming surfactant compositions |
| US4536317A (en) * | 1982-04-26 | 1985-08-20 | The Procter & Gamble Company | Foaming surfactant compositions |
| US4565647A (en) * | 1982-04-26 | 1986-01-21 | The Procter & Gamble Company | Foaming surfactant compositions |
| US4493773A (en) * | 1982-05-10 | 1985-01-15 | The Procter & Gamble Company | Low phosphate, softening laundry detergent containing ethoxylated nonionic, alkylpolysaccharide and cationic surfactants |
| US4675392A (en) * | 1982-06-23 | 1987-06-23 | Svenska Sockerfabriks Ab | Glycosides |
| US4704453A (en) * | 1982-09-03 | 1987-11-03 | Basf Aktiengesellschaft | Preparation of alkylglucosides |
| US4683297A (en) * | 1983-06-07 | 1987-07-28 | Daicel Chemical Industries Ltd. | Process for the preparation of glycosides |
| US4488981A (en) * | 1983-09-06 | 1984-12-18 | A. E. Staley Manufacturing Company | Lower alkyl glycosides to reduce viscosity in aqueous liquid detergents |
| US4716222A (en) * | 1984-04-06 | 1987-12-29 | Hoechst Aktiengesellschaft | Substrates for hydrolases |
| US4571306A (en) * | 1984-04-26 | 1986-02-18 | A. E. Staley Manufacturing Company | Separation of lipophilic components from solutions by adsorption |
| US4557729A (en) * | 1984-05-24 | 1985-12-10 | A. E. Staley Manufacturing Company | Color stabilization of glycosides |
| US4762918A (en) * | 1984-11-21 | 1988-08-09 | Staley Continental, Inc. | Decolorization of glycosides |
| USH171H (en) | 1985-06-24 | 1986-12-02 | A. E. Staley Manufacturing Company | Branched chain glycosides |
| WO1987002051A1 (en) * | 1985-09-26 | 1987-04-09 | A. E. Staley Manufacturing Company | Nonionic fine fabric detergent composition |
| WO1987002050A1 (en) * | 1985-09-26 | 1987-04-09 | A. E. Staley Manufacturing Company | Fine fabric detergent composition |
| US5108585A (en) * | 1985-10-17 | 1992-04-28 | Henkel Kommanditgesellschaft Auf Aktien | Flotation of non-sulfidic ore with a glycosidic collector |
| US4888325A (en) * | 1985-12-23 | 1989-12-19 | Henkel Kommanditgesellschaft Auf Aktien | Controlling plant pests with compositions containing alkyl glycoside |
| US4900721A (en) * | 1986-06-09 | 1990-02-13 | Henkel Kommanditgesellschaft Auf Aktien | Disinfectants and their use for disinfecting the skin and mucous membrane |
| US4920100A (en) * | 1986-06-09 | 1990-04-24 | Henkel Kommanditgesellschaft Auf Aktien | Alkyl gylcosides as potentiating agents in antiseptic compositions |
| US4820814A (en) * | 1986-07-23 | 1989-04-11 | Huls Aktiengesellschaft | Process for producing colorless butyloligoglycosides |
| US5550220A (en) * | 1987-05-13 | 1996-08-27 | Curtice-Burns, Inc. | Alkyl glycoside fatty acid polyester fat substitute food compositions and process to produce the same |
| US4942054A (en) * | 1987-05-13 | 1990-07-17 | Curtice-Burns, Inc. | Process for producing low calorie foods from alkyl glycoside fatty acid polyesters |
| US4959468A (en) * | 1987-06-12 | 1990-09-25 | Henkel Kommanditgesellschaft Auf Aktien | Color stabilization method for glycoside products |
| US5374716A (en) * | 1987-07-18 | 1994-12-20 | Henkel Kommanditgesellschaft Auf Aktien | Process for the production of surface active alkyl glycosides |
| US4950743A (en) * | 1987-07-29 | 1990-08-21 | Henkel Kommanditgesellschaft Auf Aktien | Process for preparation of alkylglycosides |
| US4923685A (en) * | 1987-07-30 | 1990-05-08 | Henkel Kommanditgesellschaft Auf Aktien | Antimicrobial flavored compositions having particular utility as mouth washes |
| US4939246A (en) * | 1988-02-13 | 1990-07-03 | Basf Aktiengesellschaft | Purification of long-chain alkylglucosides |
| US5223165A (en) * | 1988-05-31 | 1993-06-29 | Henkel Kommanditgesellschaft Auf Aktien | Use of alkyl glycosides for dust suppression |
| WO1990001489A1 (de) | 1988-08-13 | 1990-02-22 | Henkel Kommanditgesellschaft Auf Aktien | Verfahren zur herstellung von alkylglucosidverbindungen aus oligo- und/oder polysacchariden |
| WO1990002163A1 (de) | 1988-08-16 | 1990-03-08 | Henkel Kommanditgesellschaft Auf Aktien | Pastenförmiges wasch- und renigungsmittel und verfahren zur herstellung |
| US5077039A (en) * | 1988-10-15 | 1991-12-31 | Basf Aktiengesellschaft | Substituted glucosides |
| WO1990006353A1 (de) | 1988-12-07 | 1990-06-14 | Henkel Kommanditgesellschaft Auf Aktien | Phosphatfreies, flüssiges waschmittel mit hoher alkalität |
| US4939245A (en) * | 1988-12-21 | 1990-07-03 | Henkel Kommanditgesellschaft Auf Aktien | Process for the direct production of glysoside product in the presence of solid saccharide |
| US5003057A (en) * | 1988-12-23 | 1991-03-26 | Henkel Kommanditgesellschaft Auf Aktien | Process for production of glycosides |
| WO1990007516A1 (en) * | 1988-12-23 | 1990-07-12 | Henkel Kommanditgesellschaft Auf Aktien | Process for production of glycosides |
| US4987225A (en) * | 1988-12-23 | 1991-01-22 | Henkel Kommanditgesellschaft Auf Aktien | Removal of water miscible materials from glycoside mixtures |
| US5130420A (en) * | 1989-03-17 | 1992-07-14 | Kao Corporation | Process for the production of alkyl glycoside |
| EP0396044A1 (de) * | 1989-05-05 | 1990-11-07 | Henkel Kommanditgesellschaft auf Aktien | Mischung aus Alkylglucosiden und Alkoholen als Entschäumer |
| WO1990013345A1 (de) * | 1989-05-05 | 1990-11-15 | Henkel Kommanditgesellschaft Auf Aktien | Mischung aus alkylglucosiden und alkoholen als entschäumer |
| US5268126A (en) * | 1989-08-04 | 1993-12-07 | Huels Aktiengesellschaft | Emulsifiers for the preparation of aqueous polysiloxane emulsions and aqueous polysiloxane-paraffin oil emulsions with long shelf lives |
| DE3927919C2 (de) * | 1989-08-24 | 2002-10-31 | Cognis Deutschland Gmbh | Verfahren zur Herstellung von Alkylglykosiden |
| DE3927919A1 (de) * | 1989-08-24 | 1991-02-28 | Henkel Kgaa | Verfahren zur herstellung von alkylglykosiden |
| US5292500A (en) * | 1989-08-25 | 1994-03-08 | Henkel Kommanditgesellschaft Auf Aktien | Plaque-inhibiting toothpaste comprising antibacterial biguanides |
| EP0444262A3 (en) * | 1990-02-26 | 1992-01-22 | Huels Aktiengesellschaft | Liquid foaming detergent |
| EP0444262B1 (de) * | 1990-02-26 | 1996-02-28 | Hüls Aktiengesellschaft | Flüssiges, schäumendes Reinigungsmittel |
| US5286406A (en) * | 1990-03-26 | 1994-02-15 | Henkel Kommanditgesellschaft Auf Aktien | Liquid body-cleansing agents based on alkyl glycosides |
| US5258142A (en) * | 1990-06-05 | 1993-11-02 | Henkel Kommanditgesellschaft Auf Aktien | Liquid, free-flowing and pumpable surfactant concentrate containing mixed anionic surfactant and alkyl polyglycoside surfactant |
| US5370816A (en) * | 1990-09-13 | 1994-12-06 | Huels Aktiengesellschaft | Detergent composition containing a mixture of alkyl polyglycosides |
| EP0474915A1 (de) * | 1990-09-13 | 1992-03-18 | Hüls Aktiengesellschaft | Waschmittel |
| US5958431A (en) * | 1990-10-17 | 1999-09-28 | Societe D'exploitation De Produits Pour Les Industries Chimique S.E.P.P.I.C. | Use of fatty alcohol based compositions for preparing emulsions; method of preparing emulsions and emulsions so obtained |
| US5538669A (en) * | 1990-11-09 | 1996-07-23 | Henkel Kommanditgesellschaft Auf Aktien | Stabilized surfactant paste |
| US5523016A (en) * | 1991-05-29 | 1996-06-04 | Henkel Kommanditgesellschaft Auf Aktien | Liquid pourable and pumpable surfactant preparation |
| US5476610A (en) * | 1991-07-22 | 1995-12-19 | Henkel Kommanditgesellschaft Auf Aktien | Process for stabilizing aqueous zeolite suspensions |
| US5631003A (en) * | 1991-09-25 | 1997-05-20 | Henkel Kommanditgesellschaft Auf Aktien | Hair treatment prepartation |
| US5859218A (en) * | 1991-10-10 | 1999-01-12 | Henkel Corporation | Preparation of alkylpolyglycosides |
| US5449763A (en) * | 1991-10-10 | 1995-09-12 | Henkel Corporation | Preparation of alkylpolyglycosides |
| US5734029A (en) * | 1991-10-10 | 1998-03-31 | Henkel Corporation | Preparation of improved alkypolygloycoside surfactant mixtures |
| US5962399A (en) * | 1991-10-10 | 1999-10-05 | Henkel Corporation | Preparation of alkylpolyglycosides and cleaning compositions comprising same |
| US5591377A (en) * | 1991-10-15 | 1997-01-07 | Henkel Kommanditgesellschaft Auf Aktien | Viscous water-based surfactant preparation |
| US5266690A (en) * | 1991-12-19 | 1993-11-30 | Henkel Corporation | Preparation of alkylpolyglycosides |
| US5221343A (en) * | 1992-04-10 | 1993-06-22 | Henkel Corporation | Dispersant, setting retarder and air entrainment additive for cement |
| US5498704A (en) * | 1992-04-21 | 1996-03-12 | Basf Aktiengesellschaft | Preparation of alkyl glycosides |
| US5556950A (en) * | 1992-04-24 | 1996-09-17 | Henkel Corporation | Method for preparing stabilized alkyl glycosides |
| US5430131A (en) * | 1992-04-24 | 1995-07-04 | Henkel Corporation | Method for preparing stabilized alkyl glycosides |
| US5385750A (en) * | 1992-05-14 | 1995-01-31 | Henkel Corporation | Alkyl glycoside compositions with improved wetting properties |
| US5554740A (en) * | 1992-07-15 | 1996-09-10 | Henkel Corporation | Continuous bleaching of alkylpolyglycosides |
| US5362861A (en) * | 1992-07-15 | 1994-11-08 | Henkel Corporation | Continuous bleaching of alkylpolyglycosides |
| US5330674A (en) * | 1992-09-09 | 1994-07-19 | Henkel Corporation | Method for increasing the efficiency of a disinfectant cleaning composition using alkyl polyglycosides |
| US6071429A (en) * | 1992-09-21 | 2000-06-06 | Henkel Corporation | Viscosity-stabilized amide composition, methods of preparing and using same |
| US5811386A (en) * | 1993-01-28 | 1998-09-22 | Henkel Kommanditgesellschaft Auf Aktien | Clear surface-active mixtures containing anionic surfactant, APG, and temporarily cationic copolymer |
| WO1994020116A1 (en) * | 1993-03-10 | 1994-09-15 | University Of Alabama Research Foundation | Artificial primers for glycogen synthesis |
| US5817634A (en) * | 1993-03-10 | 1998-10-06 | The Uab Research Foundation | Methods of treating diabetes mellitus and clycogen storage disease |
| US5696074A (en) * | 1993-06-18 | 1997-12-09 | Henkel Kommanditgesellschaft Auf Aktien | Liquid crystalline, aqueous surfactant preparations |
| US5432275A (en) * | 1994-02-25 | 1995-07-11 | Henkel Corporation | Continuous bleaching of alkylpolyglycosides |
| US5516747A (en) * | 1994-04-18 | 1996-05-14 | Henkel Corporation | Pesticidal surfactant mixtures comprising alkyl polyglycosides and alkyl naphthalene sulfonates |
| US5840943A (en) * | 1994-06-13 | 1998-11-24 | Henkel Kommanditgesellschaft Auf Aktien | Polyolpolyhydroxystearates |
| US5972668A (en) * | 1994-06-28 | 1999-10-26 | Henkel Kommanditgesellschaft Auf Aktien | Production of multi-enzyme granules |
| US5856290A (en) * | 1994-09-26 | 1999-01-05 | Henkel Kommanditgesellschaft Auf Aktien | Disinfecting cleanser for hard surfaces based on mixtures of APG and C8 -C18 alkyl ether |
| US5962663A (en) * | 1994-12-02 | 1999-10-05 | Henkel Kommanditgesellschaft Auf Aktien | Cationic biopolymers |
| US5691295A (en) * | 1995-01-17 | 1997-11-25 | Cognis Gesellschaft Fuer Biotechnologie Mbh | Detergent compositions |
| US5855625A (en) * | 1995-01-17 | 1999-01-05 | Henkel Kommanditgesellschaft Auf Aktien | Detergent compositions |
| US5904736A (en) * | 1995-04-28 | 1999-05-18 | Henkel Kommanditgesellschaft Auf Aktien | Cellulase-containing washing agents |
| US5888482A (en) * | 1995-05-24 | 1999-03-30 | Societe D'exploitation De Produits Pour L'industrie Chimique Seppic | Emulsifying composition based on alkylpolyglycosides and its uses |
| WO1997000609A1 (en) * | 1995-06-21 | 1997-01-09 | Henkel Corporation | Method for increasing the efficacy of an odor masking agent |
| US5980874A (en) * | 1995-08-17 | 1999-11-09 | Henkel Kommanditgesellschaft Auf Aktien | Translucent antiperspirants/deodorants |
| US5880299A (en) * | 1995-10-26 | 1999-03-09 | Henkel Corporation | Esterquats |
| US6667043B1 (en) | 1996-02-09 | 2003-12-23 | Cognis Deutschland Gmbh & Co. Kg | Technical di- and triglyceride mixtures |
| US5939081A (en) * | 1996-02-27 | 1999-08-17 | Henkel Kommanditgesellschaft Auf Aktien | Esters of alkyl and/or alkenyl oligoglycosides with fatty acids |
| US6235702B1 (en) | 1996-05-30 | 2001-05-22 | Henkel Kommaditgesellschaft Auf Aktien | Aqueous nacreous lustre concentrate |
| US6710082B1 (en) | 1996-06-03 | 2004-03-23 | Cognis Deutschland Gbmh & Co. Kg | Use of hydroxycarboxylic acid esters as thickeners |
| US6121331A (en) * | 1996-06-07 | 2000-09-19 | Henkel Kommanditgesellschaft Auf Aktien | Aqueous nacreous luster concentrates |
| US6228831B1 (en) | 1996-06-07 | 2001-05-08 | Henkel Kommanditgesellschaft Auf Aktien | Aqueous nacreous lustre concentrates |
| US6221370B1 (en) | 1996-09-02 | 2001-04-24 | Henkel Kommanditgesellschaft Auf Aktien | Fatty acid ethoxylates and partial glycerides for preparing phase inversion temperature emulsions |
| US6589945B1 (en) | 1996-10-17 | 2003-07-08 | Cognis Deutschland Gmbh & Co. Kg | Use of sterolsulfates as active substances for producing means to inhibit serin proteases |
| US6537562B1 (en) | 1997-01-29 | 2003-03-25 | Cognis Deutschland Gmbh & Co. Kg | Cosmetic PIT emulsions |
| US6077945A (en) * | 1997-02-18 | 2000-06-20 | Eastman Chemical Company | Process for making alkylpolyglycosides |
| DE19710112A1 (de) * | 1997-03-12 | 1998-09-17 | Henkel Kgaa | Verfahren zur kontinuierlichen Herstellung von Alkyl- und/oder Alkenyloligoglykosiden |
| DE19714255B4 (de) * | 1997-04-07 | 2004-04-22 | Cognis Deutschland Gmbh & Co. Kg | Verfahren zur Herstellung von Alkyl- und/oder Alkenyloligoglykosiden durch direkte Acetalisierung einer Glucose/Fettalkohol-Suspension in Gegenwart saurer Katalysatoren |
| DE19714255A1 (de) * | 1997-04-07 | 1998-10-08 | Henkel Kgaa | Verfahren zur Herstellung von Alkyl- und/oder Alkenyloligoglykosiden |
| US6514927B2 (en) | 1997-06-17 | 2003-02-04 | Clariant Gmbh | Detergent and cleaner containing soil release polymer and alkanesulfonate and/or α-olefinsulfonate |
| US6255253B1 (en) | 1997-08-18 | 2001-07-03 | Cognis Deutschland Gmbh | Microemulsions |
| US6156885A (en) * | 1997-10-30 | 2000-12-05 | Condea Augusta S.P.A. | Process for the synthesis of alkylpolyglucosides |
| EP0913403A1 (en) * | 1997-10-30 | 1999-05-06 | CONDEA AUGUSTA S.p.A. | Process for the synthesis of alkylpolyglucosides |
| US6716443B1 (en) | 1999-02-27 | 2004-04-06 | Cognis Deutschland Gmbh & Co. Kg | PIT emulsions |
| US6617301B1 (en) * | 1999-05-18 | 2003-09-09 | Lamberti S.P.A. | Mixtures of surfactants used as wetting agents and/or emulsifiers in agrochemical preparations |
| US20050272922A1 (en) * | 1999-07-12 | 2005-12-08 | Andrea Heilemann | Processes for preparing crosslinker-free, biopolymer-containing three dimensional structures, and products prepared thereby |
| US20040014603A1 (en) * | 2000-10-24 | 2004-01-22 | Horst-Werner Wollenweber | Aqueous agents containing pesticides |
| EP3508563A1 (de) | 2001-09-20 | 2019-07-10 | Ecolab USA Inc. | Verwendung von o/w-emulsionen zur kettenschmierung |
| US20040224871A1 (en) * | 2001-10-22 | 2004-11-11 | Josef Penninger | Cotton active, dirt removing urethane-based polymers |
| US7098179B2 (en) | 2001-10-22 | 2006-08-29 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Cotton active, dirt removing urethane-based polymers |
| US20050002964A1 (en) * | 2001-12-18 | 2005-01-06 | Dirk Bockmuhl | Adhesion inhibition of fungi |
| US20050009929A1 (en) * | 2001-12-18 | 2005-01-13 | Dirk Bockmuhl | Inhibition of the asexual reproduction of fungi |
| US6989352B2 (en) * | 2002-06-12 | 2006-01-24 | Halliburton Energy Services, Inc. | Silicic acid mud lubricants |
| US20030232726A1 (en) * | 2002-06-12 | 2003-12-18 | Fisk James V. | Silicic acid mud lubricants |
| US20050282261A1 (en) * | 2002-12-20 | 2005-12-22 | Henkel Kommanditgesellschaft Auf Aktien | Novel choline oxidases |
| US7456143B2 (en) | 2002-12-20 | 2008-11-25 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Bleach-containing washing or cleaning agents containing a sulfate/silicate coated percarbonate |
| US20050239681A1 (en) * | 2002-12-20 | 2005-10-27 | Horst-Dieter Speckmann | Bleach-containing washing or cleaning agents |
| US20050281773A1 (en) * | 2002-12-20 | 2005-12-22 | Henkel Kommanditgesellschaft Auf Aktien | Subtilisin variants with improved perhydrolase activity |
| US7510859B2 (en) | 2002-12-20 | 2009-03-31 | Henkel Kommanditgesellschaft Auf Aktien | Subtilisin variants with improved perhydrolase activity |
| US20060035804A1 (en) * | 2003-02-10 | 2006-02-16 | Josef Penninger | Use of cellulose derivatives as foam regulators |
| US7375072B2 (en) | 2003-02-10 | 2008-05-20 | Henkel Kommanditgesellschaft Auf Aktien | Bleach-containing laundry detergents or cleaning compositions comprising water-soluble builder system and soil release-capable cellulose derivative |
| US20060046950A1 (en) * | 2003-02-10 | 2006-03-02 | Josef Penninger | Enhancement of the cleaning performance of laundry detergents by cellulose derivative and hygroscopic polymer |
| US20060046951A1 (en) * | 2003-02-10 | 2006-03-02 | Josef Penninger | Enhancement of the cleaning performance of laundry detergents by a combination of cellulose derivatives |
| US20060030504A1 (en) * | 2003-02-10 | 2006-02-09 | Josef Penninger | Detergents or cleaning agents comprising a water-soluble building block system and a cellulose derivative with dirt dissolving properties |
| US20060035805A1 (en) * | 2003-02-10 | 2006-02-16 | Josef Penninger | Bleach-containing laundry detergent comprising cotton-active soil release-capable cellulose derivative |
| US20060035801A1 (en) * | 2003-02-10 | 2006-02-16 | Josef Penninger | Bleach-containing laundry detergents or cleaning compositions comprising water-soluble builder system and soil release-capable cellulose derivative |
| US20060035806A1 (en) * | 2003-02-10 | 2006-02-16 | Josef Penninger | Increase in the water absorption capacity of textiles |
| US7316995B2 (en) | 2003-02-10 | 2008-01-08 | Henkel Kommanditgesellschaft Auf Aktien | Detergents or cleaning agents comprising a water-soluble building block system and a cellulose derivative with dirt dissolving properties |
| US20060128813A1 (en) * | 2003-06-17 | 2006-06-15 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Inhibition of the asexual reproduction of fungi by eugenol and/or derivatives thereof |
| US7557145B2 (en) | 2003-06-17 | 2009-07-07 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Inhibition of the asexual reproduction of fungi by eugenol and/or derivatives thereof |
| US20060134239A1 (en) * | 2003-06-17 | 2006-06-22 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Agents against microorganisms containing patchouli oil, patchouli alcohol and/or the derivatives thereof |
| US20080207734A1 (en) * | 2003-12-03 | 2008-08-28 | Stefan Stumpe | Novel alkoxylactones, alkoxylactams and alkoxythiolactams for controlling processes based on microbial interaction |
| US7825268B2 (en) | 2003-12-23 | 2010-11-02 | Henkel Ag & Co. Kgaa | Alkoxylactones, alkoxylactams and alkoxythiolactams for controlling processes based on microbial interaction |
| US20100068209A1 (en) * | 2004-08-25 | 2010-03-18 | Aegis Therapeuttics LLC | Antibacterial compositions for drug administration |
| US20080299079A1 (en) * | 2004-08-25 | 2008-12-04 | Aegis Therapeutics, Llc | Absorption Enhancers for Drug Administration |
| US8642564B2 (en) | 2004-08-25 | 2014-02-04 | Aegis Therapeutics, Llc | Compositions for drug administration |
| US8551468B2 (en) | 2004-08-25 | 2013-10-08 | Aegis Therapeutics Llc | Absorption enhancers for intranasal interferon administration |
| US9895444B2 (en) | 2004-08-25 | 2018-02-20 | Aegis Therapeutics, Llc | Compositions for drug administration |
| US20060046969A1 (en) * | 2004-08-25 | 2006-03-02 | Aegis Therapeutics Llc | Antibacterial compositions for drug administration |
| US10265402B2 (en) | 2004-08-25 | 2019-04-23 | Aegis Therapeutics, Llc | Absorption enhancers for drug administration |
| US9114069B2 (en) | 2004-08-25 | 2015-08-25 | Aegis Therapeutics, Llc | Antibacterial compositions for drug administration |
| US8268791B2 (en) | 2004-08-25 | 2012-09-18 | Aegis Therapeutics, Llc. | Alkylglycoside compositions for drug administration |
| US20080200418A1 (en) * | 2004-08-25 | 2008-08-21 | Aegis Therapeutics, Inc. | Compositions for drug administration |
| US8927497B2 (en) | 2004-08-25 | 2015-01-06 | Aegis Therapeutics, Llc. | Absorption enhancers for intranasal administration |
| US10512694B2 (en) | 2004-08-25 | 2019-12-24 | Aegis Therapeutics, Llc | Compositions for oral drug administration |
| US9642913B2 (en) | 2004-08-25 | 2017-05-09 | Aegis Therapeutics, Llc. | Pharmaceutical composition including alkyl glycoside and an anti-seizure agent |
| US20090163447A1 (en) * | 2004-08-25 | 2009-06-25 | Maggio Edward T | Compositions for Drug Administration |
| US10576156B2 (en) | 2004-08-25 | 2020-03-03 | Aegis Therapeutics, Llc | Compositions for drug administration |
| US11173209B2 (en) | 2004-08-25 | 2021-11-16 | Aegis Therapeutics, Llc | Compositions for drug administration |
| US20090036669A1 (en) * | 2005-03-15 | 2009-02-05 | Rauzah Hashim | Glycolipids of branched chain alkyl oligosaccharides for liquid crystal and related applications |
| US8304525B2 (en) | 2005-03-15 | 2012-11-06 | Universiti Malaya | Glycolipids of branched chain alkyl oligosaccharides for liquid crystal and related applications |
| US20080050398A1 (en) * | 2005-03-29 | 2008-02-28 | Dirk Bockmuehl | Composition Comprising Beta-Defensin 2 |
| US20080090746A1 (en) * | 2005-06-08 | 2008-04-17 | Josef Penninger | Boosting the cleaning performance of laundry detergents by polymer |
| US7431739B2 (en) | 2005-06-08 | 2008-10-07 | Henkel Kommanditgesellschaft Auf Aktien | Boosting the cleaning performance of laundry detergents by polymer of styrene/methyl methacrylate/methyl polyethylene glycol |
| US8034123B2 (en) | 2005-06-08 | 2011-10-11 | Henkel Ag & Co., Kgaa | Boosting cleaning power of detergents by means of a polymer |
| US20090047347A1 (en) * | 2005-07-29 | 2009-02-19 | Aegis Therapeutics, Inc. | Compositions for Drug Administration |
| EP1762220A2 (de) | 2005-09-09 | 2007-03-14 | Henkel Kommanditgesellschaft auf Aktien | Mittel zur Färbung keratinischer Fasern enthaltend Polymere mit kleiner Molmasse |
| WO2007054203A2 (de) | 2005-11-08 | 2007-05-18 | Henkel Ag & Co. Kgaa | Enzym / subtstrat sytem zur generierung von wasserstoffperoxid enthaltend sorbitol oxidase aus streptomyces c0elic0l0r und sorbitol |
| US8859481B2 (en) | 2005-12-15 | 2014-10-14 | Kimberly-Clark Worldwide, Inc. | Wiper for use with disinfectants |
| US20070142261A1 (en) * | 2005-12-15 | 2007-06-21 | Clark James W | Wiper for use with disinfectants |
| US10046025B2 (en) | 2006-06-23 | 2018-08-14 | Aegis Therapeutics, Llc | Stabilizing alkylglycoside compositions and methods thereof |
| US20080004357A1 (en) * | 2006-07-01 | 2008-01-03 | Goldschmidt Gmbh | Method of producing finely divided oil-in-water emulsions |
| DE102007023870A1 (de) | 2007-05-21 | 2008-11-27 | Henkel Ag & Co. Kgaa | Waschmittel, enthaltend reaktive cyclische Carbonate oder Harnstoffe oder deren Derivate als die Primärwaschkraft verbessernde Wirkstoffe |
| DE102007023827A1 (de) | 2007-05-21 | 2008-11-27 | Henkel Ag & Co. Kgaa | Waschmittel, enthaltend reaktive cyclische Carbonate oder Harnstoffe oder deren Derivate als schmutzablösevermögende Wirkstoffe |
| DE102007036392A1 (de) | 2007-07-31 | 2009-02-05 | Henkel Ag & Co. Kgaa | Zusammensetzungen enthaltend Perhydrolasen und Alkylenglykoldiacetate |
| US20100196287A1 (en) * | 2007-07-31 | 2010-08-05 | O'connell Timothy | Compositions Comprising Perhydrolases and Alkylene Glycol Diacetates |
| US8298436B2 (en) | 2007-10-16 | 2012-10-30 | Ansul, Incorporated | Fluoroalkenyl poly[1,6]glycosides |
| US20090095936A1 (en) * | 2007-10-16 | 2009-04-16 | Michael Jeffrey D | Fluoroalkenyl Poly[1,6]glycosides |
| US9763876B2 (en) | 2008-03-28 | 2017-09-19 | Hale Biopharma Ventures, Llc | Administration of benzodiazepine compositions |
| US12268664B1 (en) | 2008-03-28 | 2025-04-08 | Neurelis, Inc. | Administration of benzodiazepine compositions |
| US11241414B2 (en) | 2008-03-28 | 2022-02-08 | Neurelis, Inc. | Administration of benzodiazepine compositions |
| US11793786B2 (en) | 2008-03-28 | 2023-10-24 | Neurelis, Inc. | Administration of benzodiazepine compositions |
| EP2153889A2 (de) | 2008-08-15 | 2010-02-17 | Evonik Goldschmidt GmbH | Nanoemulsionen und Verfahren zu deren Herstellung, sowie deren Verwendung als Formulierungen von Pflanzenschutz- und/oder Schädlingsbekämpfungsmitteln und/oder kosmetischen Zubereitungen |
| DE102008047743A1 (de) | 2008-09-17 | 2010-04-15 | Henkel Ag & Co. Kgaa | Verwendung von Harnstoff-Derivaten und Phenacylthiazolium-Salzen zur Behandlung von Körpergeruch |
| DE102008053034A1 (de) | 2008-10-24 | 2010-04-29 | Henkel Ag & Co. Kgaa | Verwendung von Hydroxyzimtsäuren und ihren Derivaten und/oder von Pflanzenextrakten zur Behandlung von Körpergeruch |
| US9283280B2 (en) | 2008-12-22 | 2016-03-15 | Aegis Therapeutics, Llc | Compositions for drug administration |
| US8895546B2 (en) | 2009-03-27 | 2014-11-25 | Hale Biopharma Ventures, Llc | Administration of benzodiazepine compositions |
| DE102010031263A1 (de) | 2009-07-10 | 2011-03-03 | Hohenester, Hermann, Dr. | Zubereitung enthaltend Zucchini und/oder Ingwer und/oder Papaya und/oder Ananas zur Behandlung von Körperteilen bzw. zur kosmetischen Pflege und insbesondere zur Mundpflege |
| WO2012126976A1 (de) | 2011-03-24 | 2012-09-27 | Basf Se | Verfahren zur erdölförderung unter verwendung von tensiden aus der klasse der alkylpolyglucoside |
| WO2012156102A2 (de) | 2011-05-19 | 2012-11-22 | Anke Gmbh & Co. Kg | Netzmittel für elektrolytische anwendungen und dessen verwendung |
| DE102011102052A1 (de) * | 2011-05-19 | 2012-11-22 | Anke Gmbh & Co. Kg | Netzmittel für elektrolytische Anwendung und dessen Verwendung |
| US12324852B2 (en) | 2011-06-14 | 2025-06-10 | Neurelis, Inc. | Administration of benzodiazepine compositions |
| US12337061B2 (en) | 2011-06-14 | 2025-06-24 | Neurelis, Inc. | Administration of benzodiazepine compositions |
| DE102013218616A1 (de) | 2013-09-17 | 2015-03-19 | Henkel Ag & Co. Kgaa | Verwendung von Alkyl-/Alkenyl-Oligoglykosidderivaten zur Textilbehandlung |
| US20160376489A1 (en) * | 2013-12-29 | 2016-12-29 | Halliburton Energy Services, Inc. | LUBRICANT FOR HIGH pH WATER BASED MUD SYSTEM |
| DE102014223885A1 (de) | 2014-11-24 | 2016-05-25 | Henkel Ag & Co. Kgaa | Flüssigwaschmittel enthaltend Zitronensäure und Niotensid |
| JP2017537924A (ja) * | 2014-12-03 | 2017-12-21 | テレオス・スターチ・アンド・スウィートナーズ・ベルギーTereos Starch & Sweeteners Belgium | 長アルキル鎖を含む糖モノエーテルの合成および界面活性剤としての使用 |
| US10577562B2 (en) | 2015-01-30 | 2020-03-03 | Henkel Ag & Co. Kgaa | Acid liquid compact washing agent including hydroxycarboxylic acid, non-ionic surfactant, and an enzyme |
| DE102015201698A1 (de) | 2015-01-30 | 2016-08-04 | Henkel Ag & Co. Kgaa | Saures Flüssigkompaktwaschmittel enthaltend Hydroxycarbonsäure, Niotensid und a-Amylase |
| DE102015201702A1 (de) | 2015-01-30 | 2016-08-04 | Henkel Ag & Co. Kgaa | Saures Flüssigkompaktwaschmittel enthaltend Hydroxycarbonsäure, Niotensid und Enzym |
| US10329517B2 (en) | 2015-01-30 | 2019-06-25 | Henkel Ag & Co. Kgaa | Acid liquid compact washing agent including hydroxycarboxylic acid, non-ionic surfactant, and an-amylase |
| EP3106503A1 (fr) | 2015-06-18 | 2016-12-21 | Rhodia Operations | Agents desorbants alkyl polyglucosides pour la recuperation assistee du petrole |
| DE102015215591A1 (de) | 2015-08-14 | 2017-02-16 | Henkel Ag & Co. Kgaa | Wasserarme, zweiphasige Flüssigwaschmittel mit saurem pH-Wert |
| US10653598B2 (en) | 2015-11-11 | 2020-05-19 | Henkel Ag & Co. Kgaa | Decoloring of dyed keratin fibers |
| EP3795576A1 (en) | 2016-09-14 | 2021-03-24 | Genomatica, Inc. | 1,3-fatty diol compounds and glycosylated derivatives thereof |
| WO2018053202A1 (en) | 2016-09-14 | 2018-03-22 | Reg Life Sciences Llc | 1,3-fatty diol compounds and derivatives thereof |
| EP4223765A1 (en) | 2016-09-14 | 2023-08-09 | Genomatica, Inc. | 1,3-fatty diol compounds and derivatives thereof |
| US10682414B2 (en) | 2018-02-06 | 2020-06-16 | Aegis Therapeutics, Llc | Intranasal epinephrine formulations and methods for the treatment of disease |
| US11918655B2 (en) | 2018-12-21 | 2024-03-05 | Aegis Therapeutics, Llc | Intranasal epinephrine formulations and methods for the treatment of disease |
| US11744895B2 (en) | 2018-12-21 | 2023-09-05 | Aegis Therapeutics, Llc | Intranasal epinephrine formulations and methods for the treatment of disease |
| US11717571B2 (en) | 2018-12-21 | 2023-08-08 | Aegis Therapeutics, Llc | Intranasal epinephrine formulations and methods for the treatment of disease |
| US11191838B2 (en) | 2018-12-21 | 2021-12-07 | Aegis Therapeutics, Llc | Intranasal epinephrine formulations and methods for the treatment of disease |
| US12324838B2 (en) | 2018-12-21 | 2025-06-10 | Aegis Therapeutics, Llc | Intranasal epinephrine formulations and methods for the treatment of disease |
| DE102020105116A1 (de) | 2020-02-27 | 2021-09-02 | Henkel Ag & Co. Kgaa | Bio-fermentierte Tenside zur Verringerung der Abrasion von Zahnschmelz |
| WO2021170283A1 (de) | 2020-02-27 | 2021-09-02 | Henkel Ag & Co. Kgaa | Bio-fermentierte tenside zur verringerung der abrasion von zahnschmelz |
| US12521400B2 (en) | 2024-07-24 | 2026-01-13 | Neurelis, Inc. | Administration of benzodiazepine compositions |
Also Published As
| Publication number | Publication date |
|---|---|
| NL6913461A (enExample) | 1970-03-05 |
| BE737973A (enExample) | 1970-02-26 |
| FR2017240A1 (enExample) | 1970-05-22 |
| GB1284456A (en) | 1972-08-09 |
| DE1943689A1 (de) | 1970-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3547828A (en) | Alkyl oligosaccharides and their mixtures with alkyl glucosides and alkanols | |
| US3640998A (en) | Alkylene oxide adducts of alkyloligosaccharides and their mixtures with alkylene oxide adducts of bord alkyl glucosides and alkanols | |
| CA1195323A (en) | Glycosidic surfactants | |
| Mccloskey | Benzyl ethers of sugars | |
| EP0092876B1 (en) | Process of preparing alkylpolysaccharides | |
| US3219656A (en) | Alkylpolyalkoxyalkyl glucosides and process of preparation therefor | |
| US3737426A (en) | Biodegradeable surfactants from starch-derived glycosides | |
| US3707535A (en) | Process for preparing mono- and polyglycosides | |
| US3772269A (en) | Glycoside compositions and process for the preparation thereof | |
| US3721633A (en) | Aqueous built liquid detergents containing alkyl glycosides | |
| US4349669A (en) | Purification of alkylglycosides by distillative removal of unconverted alcohols | |
| EP0077167B1 (en) | A process for preparing surface-active glycosides and the use of the glycosides in cosmetic, pharmaceutical and household products | |
| US3598865A (en) | Polyglycosides and process of preparing mono and polyglycosides | |
| DE69904596T2 (de) | Grenzflächenaktive-alkylurethanen von fructan | |
| US4889925A (en) | Process for the purification of alkyl glycosides, products obtainable by this process and their use | |
| US4215213A (en) | Process for producing a glycolipid ester | |
| US3314936A (en) | Process for the production of ethers of organic polyhydroxy compounds | |
| US2356565A (en) | Glucosidic compounds and process of making them | |
| EP1436306B1 (de) | Verfahren zur herstellung von tensidgemischen | |
| US3170915A (en) | Sucrose ethers | |
| US5480979A (en) | Process for the production of alkyl and/or alkenyl oligoglycosides | |
| US6774113B2 (en) | Process for preparing solubilization adjuvants from fusel oils and saccharides | |
| CA2096308C (en) | Process for preparing alkyl polyglucosides | |
| EP0729970B1 (en) | Alkylpolyglycosides with a high degree of polymerisation and a process for the preparation thereof | |
| JPH01249794A (ja) | 長鎖アルキルグルコシドの精製法 |