TWI765041B - 作為pge2受體調節劑之苯基衍生物 - Google Patents
作為pge2受體調節劑之苯基衍生物 Download PDFInfo
- Publication number
- TWI765041B TWI765041B TW107116759A TW107116759A TWI765041B TW I765041 B TWI765041 B TW I765041B TW 107116759 A TW107116759 A TW 107116759A TW 107116759 A TW107116759 A TW 107116759A TW I765041 B TWI765041 B TW I765041B
- Authority
- TW
- Taiwan
- Prior art keywords
- phenyl
- ethylamino
- ethoxy
- pyrimidin
- bromo
- Prior art date
Links
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 title claims abstract description 61
- 102000008866 Prostaglandin E receptors Human genes 0.000 title description 3
- 108010088540 Prostaglandin E receptors Proteins 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 284
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 110
- 201000011510 cancer Diseases 0.000 claims abstract description 65
- 238000011282 treatment Methods 0.000 claims abstract description 55
- 150000003839 salts Chemical class 0.000 claims abstract description 41
- 239000003814 drug Substances 0.000 claims abstract description 29
- 238000002360 preparation method Methods 0.000 claims abstract description 14
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 11
- 210000000987 immune system Anatomy 0.000 claims abstract description 9
- 230000028993 immune response Effects 0.000 claims abstract description 8
- 230000007420 reactivation Effects 0.000 claims abstract description 5
- -1 cyclopropane-1,1-diyl Chemical group 0.000 claims description 708
- 125000000217 alkyl group Chemical group 0.000 claims description 266
- BHKVCAWNQKTRTO-UHFFFAOYSA-N 2-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-4-ethyl-1,3-thiazole-5-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C=1SC(=C(N=1)CC)C(=O)O)F BHKVCAWNQKTRTO-UHFFFAOYSA-N 0.000 claims description 186
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 132
- 229910052739 hydrogen Inorganic materials 0.000 claims description 130
- 239000001257 hydrogen Substances 0.000 claims description 130
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 117
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 111
- 239000004593 Epoxy Substances 0.000 claims description 77
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 76
- 125000001424 substituent group Chemical group 0.000 claims description 76
- 125000004429 atom Chemical group 0.000 claims description 75
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 56
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 56
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 46
- 125000002947 alkylene group Chemical group 0.000 claims description 42
- 125000003545 alkoxy group Chemical group 0.000 claims description 41
- 150000002367 halogens Chemical class 0.000 claims description 34
- 239000011737 fluorine Substances 0.000 claims description 33
- 229910052731 fluorine Inorganic materials 0.000 claims description 33
- 125000004428 fluoroalkoxy group Chemical group 0.000 claims description 33
- 229910052736 halogen Inorganic materials 0.000 claims description 33
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 32
- 239000000460 chlorine Substances 0.000 claims description 32
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 31
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 30
- 229910052801 chlorine Inorganic materials 0.000 claims description 29
- 229910052757 nitrogen Inorganic materials 0.000 claims description 26
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 230000002265 prevention Effects 0.000 claims description 23
- 125000001072 heteroaryl group Chemical group 0.000 claims description 22
- 238000001959 radiotherapy Methods 0.000 claims description 22
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 20
- 150000002431 hydrogen Chemical class 0.000 claims description 18
- 125000006163 5-membered heteroaryl group Chemical group 0.000 claims description 17
- 239000004480 active ingredient Substances 0.000 claims description 17
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 16
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 claims description 16
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 15
- 238000002626 targeted therapy Methods 0.000 claims description 15
- 125000002619 bicyclic group Chemical group 0.000 claims description 14
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 14
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 14
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 14
- 229920006395 saturated elastomer Polymers 0.000 claims description 14
- 239000002246 antineoplastic agent Substances 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 201000010099 disease Diseases 0.000 claims description 13
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 13
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 11
- 206010005003 Bladder cancer Diseases 0.000 claims description 10
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 claims description 10
- 229940127089 cytotoxic agent Drugs 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- 201000005112 urinary bladder cancer Diseases 0.000 claims description 10
- 125000004008 6 membered carbocyclic group Chemical group 0.000 claims description 8
- 206010017993 Gastrointestinal neoplasms Diseases 0.000 claims description 8
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 8
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- 201000005202 lung cancer Diseases 0.000 claims description 8
- 208000020816 lung neoplasm Diseases 0.000 claims description 8
- 201000001441 melanoma Diseases 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 206010008342 Cervix carcinoma Diseases 0.000 claims description 7
- 206010014733 Endometrial cancer Diseases 0.000 claims description 7
- 206010014759 Endometrial neoplasm Diseases 0.000 claims description 7
- 208000008839 Kidney Neoplasms Diseases 0.000 claims description 7
- 206010033128 Ovarian cancer Diseases 0.000 claims description 7
- 206010038389 Renal cancer Diseases 0.000 claims description 7
- 208000006105 Uterine Cervical Neoplasms Diseases 0.000 claims description 7
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 7
- 201000010881 cervical cancer Diseases 0.000 claims description 7
- 201000010982 kidney cancer Diseases 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 239000012634 fragment Substances 0.000 claims description 6
- 230000004770 neurodegeneration Effects 0.000 claims description 6
- 208000002193 Pain Diseases 0.000 claims description 5
- 208000015122 neurodegenerative disease Diseases 0.000 claims description 5
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims description 4
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims description 4
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 4
- CTQPPUPWHLGKOB-UHFFFAOYSA-N 4h-oxadiazol-5-one Chemical compound O=C1CN=NO1 CTQPPUPWHLGKOB-UHFFFAOYSA-N 0.000 claims description 4
- 201000001320 Atherosclerosis Diseases 0.000 claims description 4
- 239000005711 Benzoic acid Substances 0.000 claims description 4
- 201000009273 Endometriosis Diseases 0.000 claims description 4
- 206010035664 Pneumonia Diseases 0.000 claims description 4
- 230000001154 acute effect Effects 0.000 claims description 4
- 229960004365 benzoic acid Drugs 0.000 claims description 4
- 230000035558 fertility Effects 0.000 claims description 4
- 230000000302 ischemic effect Effects 0.000 claims description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 4
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 4
- 208000030761 polycystic kidney disease Diseases 0.000 claims description 4
- 230000000392 somatic effect Effects 0.000 claims description 4
- 208000011580 syndromic disease Diseases 0.000 claims description 4
- 125000001617 2,3-dimethoxy phenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 3
- QJGLOGMNORETMH-UHFFFAOYSA-N 3-[3-ethoxy-5-[6-[2-(2,4,6-trifluorophenyl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1F)F)F)C1=NOC(N1)=O QJGLOGMNORETMH-UHFFFAOYSA-N 0.000 claims description 3
- VQJPXXKFYYMECV-UHFFFAOYSA-N 3-[3-ethoxy-5-[6-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]thiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)C(F)(F)F)F)C1=NOC(N1)=O VQJPXXKFYYMECV-UHFFFAOYSA-N 0.000 claims description 3
- GNYYWFUXPSBBRU-UHFFFAOYSA-N 3-[5-[6-[2-(3,4-dichlorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound ClC=1C=C(C=CC=1Cl)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=O)OCC GNYYWFUXPSBBRU-UHFFFAOYSA-N 0.000 claims description 3
- BJCIBKZOVPPABF-UHFFFAOYSA-N 3-[5-[6-[2-(4-bromo-2-chlorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound BrC1=CC(=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=O)OCC)Cl BJCIBKZOVPPABF-UHFFFAOYSA-N 0.000 claims description 3
- ZMUBAEDFKODQDU-UHFFFAOYSA-N 5-[4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-ethoxyphenyl]-1,2-oxazol-3-one Chemical compound BrC1=CC(=C(CCNC2=CC(=NC=N2)C2=CC(=C(C=C2)C2=CC(NO2)=O)OCC)C(=C1)F)F ZMUBAEDFKODQDU-UHFFFAOYSA-N 0.000 claims description 3
- KPCBRVFEMIFEJW-UHFFFAOYSA-N 5-[4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-methoxyphenyl]-1,2-oxazol-3-one Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C=C1)C1=CC(=NO1)O)OC)F KPCBRVFEMIFEJW-UHFFFAOYSA-N 0.000 claims description 3
- BQCLVOBRRWQCTM-UHFFFAOYSA-N BrC1=C(C=C(C=C1)Cl)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=O)OCC Chemical compound BrC1=C(C=C(C=C1)Cl)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=O)OCC BQCLVOBRRWQCTM-UHFFFAOYSA-N 0.000 claims description 3
- FOFKQTVWIRYJIL-UHFFFAOYSA-N BrC1=CC(=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=O)OCC)F Chemical compound BrC1=CC(=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=O)OCC)F FOFKQTVWIRYJIL-UHFFFAOYSA-N 0.000 claims description 3
- UETKRCWPGASLTL-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC=C1)OCC)C1=NOC(N1)=O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC=C1)OCC)C1=NOC(N1)=O UETKRCWPGASLTL-UHFFFAOYSA-N 0.000 claims description 3
- DMRVMUKPEWYJIE-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC(=C(C=C1)OC)O)C1=NOC(N1)=O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC(=C(C=C1)OC)O)C1=NOC(N1)=O DMRVMUKPEWYJIE-UHFFFAOYSA-N 0.000 claims description 3
- YZBLXDGRXJUMST-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 YZBLXDGRXJUMST-UHFFFAOYSA-N 0.000 claims description 3
- WUPMIHQBWMCPMJ-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Cl)cc2F)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Cl)cc2F)ncn1 WUPMIHQBWMCPMJ-UHFFFAOYSA-N 0.000 claims description 3
- RVIRCDAIZVACJY-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)ccc(Cl)c2F)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)ccc(Cl)c2F)ncn1 RVIRCDAIZVACJY-UHFFFAOYSA-N 0.000 claims description 3
- KXHVBNVHUDENBB-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(Br)ccc2OC)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(Br)ccc2OC)ncn1 KXHVBNVHUDENBB-UHFFFAOYSA-N 0.000 claims description 3
- PQTCZKGSFJBZDE-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(C)c(Br)cc2F)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(C)c(Br)cc2F)ncn1 PQTCZKGSFJBZDE-UHFFFAOYSA-N 0.000 claims description 3
- CKSMZXUBYYRCDE-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(F)c(Br)cc2F)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(F)c(Br)cc2F)ncn1 CKSMZXUBYYRCDE-UHFFFAOYSA-N 0.000 claims description 3
- GMGVAJQAPSHSQY-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)c(C)c2)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)c(C)c2)ncn1 GMGVAJQAPSHSQY-UHFFFAOYSA-N 0.000 claims description 3
- OIFKKSNOGUYHTN-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)c(F)c2)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)c(F)c2)ncn1 OIFKKSNOGUYHTN-UHFFFAOYSA-N 0.000 claims description 3
- KJGXATJADPBWQG-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)cc2C)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)cc2C)ncn1 KJGXATJADPBWQG-UHFFFAOYSA-N 0.000 claims description 3
- MCYZOGQNPSVEGA-UHFFFAOYSA-N CCOc1nc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 Chemical compound CCOc1nc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 MCYZOGQNPSVEGA-UHFFFAOYSA-N 0.000 claims description 3
- CYKDRLQDTUXOBO-UHFFFAOYSA-N cyclopropan-1,1-diyl Chemical group [C]1CC1 CYKDRLQDTUXOBO-UHFFFAOYSA-N 0.000 claims description 3
- 125000004304 oxazol-5-yl group Chemical group O1C=NC=C1* 0.000 claims description 3
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 claims description 3
- LIZZTEYNQCHKKS-ONEGZZNKSA-N (E)-3-[5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]prop-2-enoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)/C=C/C(=O)O)OCC)F LIZZTEYNQCHKKS-ONEGZZNKSA-N 0.000 claims description 2
- UPOSDIJZIPMWJK-UHFFFAOYSA-N 2-[2-ethoxy-4-[6-[2-[2-ethoxy-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]phenyl]acetic acid Chemical compound C(C)OC1=C(C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)C(F)(F)F)OCC)CC(=O)O UPOSDIJZIPMWJK-UHFFFAOYSA-N 0.000 claims description 2
- UNYZZEYKJJLGQR-UHFFFAOYSA-N 2-[4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-chloro-6-ethylphenyl]acetic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=C1)CC)CC(=O)O)Cl)F UNYZZEYKJJLGQR-UHFFFAOYSA-N 0.000 claims description 2
- AOONYWBXRCJZBL-UHFFFAOYSA-N 2-[5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-(difluoromethoxy)thiophen-2-yl]acetic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)CC(=O)O)OC(F)F)F AOONYWBXRCJZBL-UHFFFAOYSA-N 0.000 claims description 2
- LFGFVQLYJJQWIM-UHFFFAOYSA-N 2-[5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]acetic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)CC(=O)O)OCC)F LFGFVQLYJJQWIM-UHFFFAOYSA-N 0.000 claims description 2
- POOYSDGCTPSSCB-UHFFFAOYSA-N 2-[5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethylthiophen-2-yl]acetic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)CC(=O)O)CC)F POOYSDGCTPSSCB-UHFFFAOYSA-N 0.000 claims description 2
- ZWMXGOGMAHSYRL-UHFFFAOYSA-N 2-[5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-propylthiophen-2-yl]acetic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)CC(=O)O)CCC)F ZWMXGOGMAHSYRL-UHFFFAOYSA-N 0.000 claims description 2
- KGPPXZXCVUCFRH-UHFFFAOYSA-N 2-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-4-ethoxy-1,3-thiazole-5-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C=1SC(=C(N=1)OCC)C(=O)O)F KGPPXZXCVUCFRH-UHFFFAOYSA-N 0.000 claims description 2
- SFGFOJPGCOYQJK-UHFFFAOYSA-N 2-bromo-4-fluoro-1-methylbenzene Chemical compound CC1=CC=C(F)C=C1Br SFGFOJPGCOYQJK-UHFFFAOYSA-N 0.000 claims description 2
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 2
- TWCNGWQGTHPZFV-UHFFFAOYSA-N 2-cyclobutyloxy-4-[6-[2-(2-methoxy-4,5-dimethylphenyl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C1(CCC1)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C(=C1)C)C)OC TWCNGWQGTHPZFV-UHFFFAOYSA-N 0.000 claims description 2
- DLHNDNVYCFGEKN-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-[2-ethoxy-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)C(F)(F)F)OCC DLHNDNVYCFGEKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 2
- PYAPKDMAZAYZQJ-UHFFFAOYSA-N 3-[2-ethoxy-4-[6-[2-(2-methoxy-4,5-dimethylphenyl)ethylamino]pyrimidin-4-yl]phenoxy]propanoic acid Chemical compound C(C)OC1=C(OCCC(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C(=C1)C)C)OC PYAPKDMAZAYZQJ-UHFFFAOYSA-N 0.000 claims description 2
- QBXRJYJOLLINKR-UHFFFAOYSA-N 3-[3-ethoxy-5-[6-[2-(2-ethoxy-4-fluorophenyl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)F)OCC)C1=NOC(N1)=O QBXRJYJOLLINKR-UHFFFAOYSA-N 0.000 claims description 2
- ZITZCKGXUGXQFD-UHFFFAOYSA-N 3-[4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-ethoxyphenoxy]propanoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(OCCC(=O)O)C=C1)OCC)F ZITZCKGXUGXQFD-UHFFFAOYSA-N 0.000 claims description 2
- FJWLUPNOVVHNEP-UHFFFAOYSA-N 3-[4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-ethoxyphenyl]-4H-1,2,4-oxadiazol-5-one Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C=C1)C1=NOC(N1)=O)OCC)F FJWLUPNOVVHNEP-UHFFFAOYSA-N 0.000 claims description 2
- UOANBDNPVAFJJK-UHFFFAOYSA-N 3-[5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]propanoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)CCC(=O)O)OCC)F UOANBDNPVAFJJK-UHFFFAOYSA-N 0.000 claims description 2
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 claims description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 2
- CFNWAWZQCOZGLF-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methoxy-4,5-dimethylphenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C(=C1)C)C)OC)C(=O)O CFNWAWZQCOZGLF-UHFFFAOYSA-N 0.000 claims description 2
- WXMAOHRSZYBKGQ-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methoxy-4,6-dimethylphenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1C)C)OC)C(=O)O WXMAOHRSZYBKGQ-UHFFFAOYSA-N 0.000 claims description 2
- CMIVOKZCXIMEOV-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methoxy-4-methylsulfanylphenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)SC)OC)C(=O)O CMIVOKZCXIMEOV-UHFFFAOYSA-N 0.000 claims description 2
- RAKHENFMCGDIJN-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methoxy-6-methylphenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC=C1C)OC)C(=O)O RAKHENFMCGDIJN-UHFFFAOYSA-N 0.000 claims description 2
- KJJMIXJCWPWZEH-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(3-methoxycarbonylphenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC(=CC=C1)C(=O)OC)C(=O)O KJJMIXJCWPWZEH-UHFFFAOYSA-N 0.000 claims description 2
- YFUUNMPJQOEHTH-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(3-methoxyphenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC(=CC=C1)OC)C(=O)O YFUUNMPJQOEHTH-UHFFFAOYSA-N 0.000 claims description 2
- QJHINWAWLMLRRK-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C=C1)OC)C(=O)O QJHINWAWLMLRRK-UHFFFAOYSA-N 0.000 claims description 2
- GTKRPVSVIQHDAI-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-[2-ethoxy-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)C(F)(F)F)OCC)C(=O)O GTKRPVSVIQHDAI-UHFFFAOYSA-N 0.000 claims description 2
- KSAUOKKPBBAIAO-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-[2-fluoro-6-methoxy-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1OC)C(F)(F)F)F)C(=O)O KSAUOKKPBBAIAO-UHFFFAOYSA-N 0.000 claims description 2
- JSHINVDTYNQWJV-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-[2-methoxy-4-(trifluoromethoxy)phenyl]ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)OC(F)(F)F)OC)C(=O)O JSHINVDTYNQWJV-UHFFFAOYSA-N 0.000 claims description 2
- NFDAGUJTUVXZOL-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)C(F)(F)F)OC)C(=O)O NFDAGUJTUVXZOL-UHFFFAOYSA-N 0.000 claims description 2
- NJHSRNGDZGANPF-UHFFFAOYSA-N 3-fluoro-5-[6-[2-(4-methylphenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound FC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C=C1)C)C(=O)O NJHSRNGDZGANPF-UHFFFAOYSA-N 0.000 claims description 2
- SGOSKDJSVLUJDZ-UHFFFAOYSA-N 3-fluoro-5-[6-[2-[4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound FC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C=C1)C(F)(F)F)C(=O)O SGOSKDJSVLUJDZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 2
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 2
- MQUORJSBJQMRPJ-UHFFFAOYSA-N 4-[6-[2-(2-methoxy-4-methylsulfanylphenyl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid Chemical compound COC1=C(C=CC(=C1)SC)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)SC MQUORJSBJQMRPJ-UHFFFAOYSA-N 0.000 claims description 2
- IAWFSZPIVVFXSY-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-(2-hydroxyethoxy)benzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OCCO)F IAWFSZPIVVFXSY-UHFFFAOYSA-N 0.000 claims description 2
- HTCBIGIGZXHIRT-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-(2-methylpropyl)benzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)CC(C)C)F HTCBIGIGZXHIRT-UHFFFAOYSA-N 0.000 claims description 2
- JLCFCZYWCOFPLT-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-butoxy-6-fluorobenzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C(=C1)F)OCCCC)F JLCFCZYWCOFPLT-UHFFFAOYSA-N 0.000 claims description 2
- NOZWHSHETZKCIO-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-butoxybenzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OCCCC)F NOZWHSHETZKCIO-UHFFFAOYSA-N 0.000 claims description 2
- URTVXVWCYVFUHT-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-cyclopropyloxybenzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OC1CC1)F URTVXVWCYVFUHT-UHFFFAOYSA-N 0.000 claims description 2
- DVMAUISIYBHXLQ-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-ethylsulfanylbenzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)SCC)F DVMAUISIYBHXLQ-UHFFFAOYSA-N 0.000 claims description 2
- WSUXZEIVWSMEKE-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-propoxybenzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OCCC)F WSUXZEIVWSMEKE-UHFFFAOYSA-N 0.000 claims description 2
- FHKKQFHJNMTBLS-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-propylbenzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)CCC)F FHKKQFHJNMTBLS-UHFFFAOYSA-N 0.000 claims description 2
- WONIPCVHNUILHG-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2-ethoxyphenyl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid Chemical compound BrC1=CC(=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OCC)OCC WONIPCVHNUILHG-UHFFFAOYSA-N 0.000 claims description 2
- CAHQYIXNQXEXPL-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2-fluorophenyl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid Chemical compound BrC1=CC(=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OCC)F CAHQYIXNQXEXPL-UHFFFAOYSA-N 0.000 claims description 2
- CWRVMYFILBALNG-UHFFFAOYSA-N 4-[6-[2-[2-ethoxy-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]-2-propylbenzoic acid Chemical compound C(C)OC1=C(C=CC(=C1)C(F)(F)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)CCC CWRVMYFILBALNG-UHFFFAOYSA-N 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 2
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 claims description 2
- CNHWYDVPKOPHGW-UHFFFAOYSA-N 5-[6-[2-(2,4-dichlorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound ClC1=C(C=CC(=C1)Cl)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC CNHWYDVPKOPHGW-UHFFFAOYSA-N 0.000 claims description 2
- GYRLNPJDNNDWJO-UHFFFAOYSA-N 5-[6-[2-(2,4-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound COC1=C(C=CC(=C1)OC)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC GYRLNPJDNNDWJO-UHFFFAOYSA-N 0.000 claims description 2
- AOFWJNZVNGKMRB-UHFFFAOYSA-N 5-[6-[2-(2,4-dimethylphenyl)ethylamino]pyrimidin-4-yl]-3-(trifluoromethyl)thiophene-2-carboxylic acid Chemical compound CC1=C(C=CC(=C1)C)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)C(F)(F)F AOFWJNZVNGKMRB-UHFFFAOYSA-N 0.000 claims description 2
- KRNOHFBNBDOFLD-UHFFFAOYSA-N 5-[6-[2-(2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethylthiophene-2-carboxylic acid Chemical compound FC1=C(C(=CC=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)CC KRNOHFBNBDOFLD-UHFFFAOYSA-N 0.000 claims description 2
- IOCNFVMVCQBVSQ-UHFFFAOYSA-N 5-[6-[2-(3,4-dichloro-2-methylphenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound ClC=1C(=C(C=CC=1Cl)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)C IOCNFVMVCQBVSQ-UHFFFAOYSA-N 0.000 claims description 2
- YRSGHOPGASKUSK-UHFFFAOYSA-N 5-[6-[2-(3,4-dimethylphenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound CC=1C=C(C=CC=1C)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC YRSGHOPGASKUSK-UHFFFAOYSA-N 0.000 claims description 2
- GRYGBXPILPGHMO-UHFFFAOYSA-N 5-[6-[2-(3-bromo-4-methoxyphenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound CCOc1cc(sc1C(O)=O)-c1cc(NCCc2ccc(OC)c(Br)c2)ncn1 GRYGBXPILPGHMO-UHFFFAOYSA-N 0.000 claims description 2
- OVMKFCFBWDWWTR-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-(2-hydroxyethoxy)thiophene-2-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCCO)F OVMKFCFBWDWWTR-UHFFFAOYSA-N 0.000 claims description 2
- DGFWNXOSDWVHHI-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-chlorothiophene-2-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)Cl)F DGFWNXOSDWVHHI-UHFFFAOYSA-N 0.000 claims description 2
- FKIKUKVKUWYWIK-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxy-N-methylsulfonylthiophene-2-carboxamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)NS(=O)(=O)C)OCC)F FKIKUKVKUWYWIK-UHFFFAOYSA-N 0.000 claims description 2
- KEWXAZISKAYEJV-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethylthiophene-2-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)CC)F KEWXAZISKAYEJV-UHFFFAOYSA-N 0.000 claims description 2
- ZJFNKSJDAXELCF-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-methoxythiophene-2-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OC)F ZJFNKSJDAXELCF-UHFFFAOYSA-N 0.000 claims description 2
- DYLLFFFNYNZFEZ-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-methylthiophene-2-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)C)F DYLLFFFNYNZFEZ-UHFFFAOYSA-N 0.000 claims description 2
- VOSSLMOQQFOLIK-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-4-chloro-3-ethoxythiophene-2-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=C(C(=C(S1)C(=O)O)OCC)Cl)F VOSSLMOQQFOLIK-UHFFFAOYSA-N 0.000 claims description 2
- XJDBUCFXLIGFSN-UHFFFAOYSA-N 5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound BrC1=CC=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC XJDBUCFXLIGFSN-UHFFFAOYSA-N 0.000 claims description 2
- XPUUZZNEHUPCFL-UHFFFAOYSA-N 5-[6-[2-(4-chloro-2-nitrophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound ClC1=CC(=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)[N+](=O)[O-] XPUUZZNEHUPCFL-UHFFFAOYSA-N 0.000 claims description 2
- IBBWJRHSVGJWSX-UHFFFAOYSA-N 5-[6-[2-(4-chlorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound ClC1=CC=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC IBBWJRHSVGJWSX-UHFFFAOYSA-N 0.000 claims description 2
- LPFYUIPLZGZGIH-UHFFFAOYSA-N 5-[6-[2-(4-methylphenyl)ethylamino]pyrimidin-4-yl]-3-(trifluoromethyl)thiophene-2-carboxylic acid Chemical compound C1(=CC=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)C(F)(F)F)C LPFYUIPLZGZGIH-UHFFFAOYSA-N 0.000 claims description 2
- ZYHXNPWPQZYPMX-UHFFFAOYSA-N 5-[6-[2-(5-bromo-2-methoxyphenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound BrC=1C=CC(=C(C=1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)OC ZYHXNPWPQZYPMX-UHFFFAOYSA-N 0.000 claims description 2
- FXTLBXLVVVSAJA-UHFFFAOYSA-N 5-[6-[2-[2-(difluoromethoxy)-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound FC(OC1=C(C=CC(=C1)C(F)(F)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)F FXTLBXLVVVSAJA-UHFFFAOYSA-N 0.000 claims description 2
- XVHOCSWPBKLVST-UHFFFAOYSA-N 5-[6-[2-[5-chloro-2-methoxy-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound ClC=1C(=CC(=C(C=1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)OC)C(F)(F)F XVHOCSWPBKLVST-UHFFFAOYSA-N 0.000 claims description 2
- SFPPOLYJLCGTTH-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(F)c(Br)cc2C)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(F)c(Br)cc2C)ncn1 SFPPOLYJLCGTTH-UHFFFAOYSA-N 0.000 claims description 2
- NZHLLPGMJXMIMG-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)c(OC)c2)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)c(OC)c2)ncn1 NZHLLPGMJXMIMG-UHFFFAOYSA-N 0.000 claims description 2
- CHCZZTLSNDDLBL-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)cc2)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)cc2)ncn1 CHCZZTLSNDDLBL-UHFFFAOYSA-N 0.000 claims description 2
- AQXNCPATZYQJGJ-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)cc2OC)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)cc2OC)ncn1 AQXNCPATZYQJGJ-UHFFFAOYSA-N 0.000 claims description 2
- RJMNOJSFWLQMDK-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(C)c(C)c2)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(C)c(C)c2)ncn1 RJMNOJSFWLQMDK-UHFFFAOYSA-N 0.000 claims description 2
- LSIWUEBJGBSNQC-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(OC)c(Cl)c2)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(OC)c(Cl)c2)ncn1 LSIWUEBJGBSNQC-UHFFFAOYSA-N 0.000 claims description 2
- ZLEWETBNRXECTR-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cccc(OC)c2OC)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cccc(OC)c2OC)ncn1 ZLEWETBNRXECTR-UHFFFAOYSA-N 0.000 claims description 2
- SCEQAWUNWZOOLR-UHFFFAOYSA-N FC1=C(C(=CC=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(=N1)O)OCC Chemical compound FC1=C(C(=CC=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(=N1)O)OCC SCEQAWUNWZOOLR-UHFFFAOYSA-N 0.000 claims description 2
- BSZWDEJEHIKFIJ-UHFFFAOYSA-N Fc1cc(Br)cc(F)c1CCNc1cc(ncn1)-c1cc(c(s1)-c1nc(=O)o[nH]1)C(F)(F)F Chemical compound Fc1cc(Br)cc(F)c1CCNc1cc(ncn1)-c1cc(c(s1)-c1nc(=O)o[nH]1)C(F)(F)F BSZWDEJEHIKFIJ-UHFFFAOYSA-N 0.000 claims description 2
- IJQZGVXLGNKJTK-UHFFFAOYSA-N N-[2-(4-bromo-2,6-difluorophenyl)ethyl]-6-[3-ethoxy-4-(2H-tetrazol-5-yl)phenyl]pyrimidin-4-amine Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=NC=NC(=C1)C1=CC(=C(C=C1)C1=NN=NN1)OCC)F IJQZGVXLGNKJTK-UHFFFAOYSA-N 0.000 claims description 2
- PCVJZQPCMCEXBI-UHFFFAOYSA-N N-[2-(4-bromophenyl)ethyl]-6-[4-ethoxy-5-(2H-tetrazol-5-yl)thiophen-2-yl]pyrimidin-4-amine Chemical compound BrC1=CC=C(C=C1)CCNC1=NC=NC(=C1)C=1SC(=C(C=1)OCC)C1=NN=NN1 PCVJZQPCMCEXBI-UHFFFAOYSA-N 0.000 claims description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N oxalic acid Substances OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- BOWYQHCFTNADQJ-UHFFFAOYSA-N OC1=CN=NO1 Chemical compound OC1=CN=NO1 BOWYQHCFTNADQJ-UHFFFAOYSA-N 0.000 claims 3
- XLDCYMRZFRLVNW-UHFFFAOYSA-N 3-[3-ethoxy-5-[6-[2-(2-ethyl-4-methoxyphenyl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)OC)CC)C1=NOC(N1)=O XLDCYMRZFRLVNW-UHFFFAOYSA-N 0.000 claims 2
- ZXFCHOFSTUKCOJ-UHFFFAOYSA-N 3-[3-ethoxy-5-[6-[2-[2-ethoxy-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]thiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)C(F)(F)F)OCC)C1=NOC(N1)=O ZXFCHOFSTUKCOJ-UHFFFAOYSA-N 0.000 claims 2
- CCDDZTDNMKMWIV-UHFFFAOYSA-N 3-[5-[6-[2-(4-bromo-2-ethoxyphenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound BrC1=CC(=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=O)OCC)OCC CCDDZTDNMKMWIV-UHFFFAOYSA-N 0.000 claims 2
- CYIGQRURNVPKFK-UHFFFAOYSA-N 3-[5-[6-[2-(4-bromo-3-chlorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound BrC1=C(C=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=O)OCC)Cl CYIGQRURNVPKFK-UHFFFAOYSA-N 0.000 claims 2
- YLSUGACLIOXGSH-UHFFFAOYSA-N BrC1=CC=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(C=C1)C1=NOC(N1)=O)OCC Chemical compound BrC1=CC=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(C=C1)C1=NOC(N1)=O)OCC YLSUGACLIOXGSH-UHFFFAOYSA-N 0.000 claims 2
- HNSLOVZJVRHJNB-UHFFFAOYSA-N C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC(=C(C=C1)O)OC)C1=NOC(N1)=O Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC(=C(C=C1)O)OC)C1=NOC(N1)=O HNSLOVZJVRHJNB-UHFFFAOYSA-N 0.000 claims 2
- JPZFVNWNJMAJJZ-UHFFFAOYSA-N CC(C)Oc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 Chemical compound CC(C)Oc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 JPZFVNWNJMAJJZ-UHFFFAOYSA-N 0.000 claims 2
- CFHTYTITSCAMJO-UHFFFAOYSA-N CCCOc1cc(Br)ccc1CCNc1cc(ncn1)-c1cc(OCC)c(s1)-c1nc(=O)o[nH]1 Chemical compound CCCOc1cc(Br)ccc1CCNc1cc(ncn1)-c1cc(OCC)c(s1)-c1nc(=O)o[nH]1 CFHTYTITSCAMJO-UHFFFAOYSA-N 0.000 claims 2
- ZUCGPYSNZVAQIC-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2OC)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2OC)ncn1 ZUCGPYSNZVAQIC-UHFFFAOYSA-N 0.000 claims 2
- TXDYFXUYEGNEOD-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Cl)cc2OC)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Cl)cc2OC)ncn1 TXDYFXUYEGNEOD-UHFFFAOYSA-N 0.000 claims 2
- CPOOEZIRKAQMNY-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(Br)ccc2SC)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2cc(Br)ccc2SC)ncn1 CPOOEZIRKAQMNY-UHFFFAOYSA-N 0.000 claims 2
- PBFGJYQMRPZKEH-UHFFFAOYSA-N Cc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 Chemical compound Cc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 PBFGJYQMRPZKEH-UHFFFAOYSA-N 0.000 claims 2
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical compound OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 claims 1
- IPWBFGUBXWMIPR-UHFFFAOYSA-N 1-bromo-2-fluorobenzene Chemical compound FC1=CC=CC=C1Br IPWBFGUBXWMIPR-UHFFFAOYSA-N 0.000 claims 1
- ZSZCXAOQVBEPME-UHFFFAOYSA-N 2-(4-bromophenyl)ethanamine Chemical compound NCCC1=CC=C(Br)C=C1 ZSZCXAOQVBEPME-UHFFFAOYSA-N 0.000 claims 1
- HMFOBPNVAAAACP-UHFFFAOYSA-N 2-[4-(trifluoromethyl)phenyl]ethanamine Chemical compound NCCC1=CC=C(C(F)(F)F)C=C1 HMFOBPNVAAAACP-UHFFFAOYSA-N 0.000 claims 1
- TZBQHKVYDSXDFF-UHFFFAOYSA-N 2-[4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-ethoxyphenyl]acetic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C=C1)CC(=O)O)OCC)F TZBQHKVYDSXDFF-UHFFFAOYSA-N 0.000 claims 1
- YZMQSSRDJFHVIQ-UHFFFAOYSA-N 2-cyclobutyloxy-4-[6-[2-[4-(difluoromethyl)-5-fluoro-2-methoxyphenyl]ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C1(CCC1)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C(=C1)F)C(F)F)OC YZMQSSRDJFHVIQ-UHFFFAOYSA-N 0.000 claims 1
- JJIDHZWJDQKVTE-UHFFFAOYSA-N 2-ethoxy-4-[6-[2-(2-methoxy-4,5-dimethylphenyl)ethylamino]pyrimidin-4-yl]benzoic acid Chemical compound C(C)OC1=C(C(=O)O)C=CC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C(=C1)C)C)OC JJIDHZWJDQKVTE-UHFFFAOYSA-N 0.000 claims 1
- BWAJWJWTQHXEEH-UHFFFAOYSA-N 3-[3-ethoxy-5-[6-[2-(2-fluoro-4-methoxyphenyl)ethylamino]pyrimidin-4-yl]thiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=C(C=C1)OC)F)C1=NOC(N1)=O BWAJWJWTQHXEEH-UHFFFAOYSA-N 0.000 claims 1
- ZONNJMNMMNSKOJ-UHFFFAOYSA-N 3-[5-[6-[2-(2,4-dichlorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]-4H-1,2,4-oxadiazol-5-one Chemical compound ClC1=C(C=CC(=C1)Cl)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=O)OCC ZONNJMNMMNSKOJ-UHFFFAOYSA-N 0.000 claims 1
- WFGYSQDPURFIFL-UHFFFAOYSA-N 3-chloro-n-methylaniline Chemical compound CNC1=CC=CC(Cl)=C1 WFGYSQDPURFIFL-UHFFFAOYSA-N 0.000 claims 1
- VWPJAQUSHSTXCS-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-(2-methylphenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=C(C=CC=C1)C)C(=O)O VWPJAQUSHSTXCS-UHFFFAOYSA-N 0.000 claims 1
- PXCFUKZMPJMQFI-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-cyclobutyloxybenzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OC1CCC1)F PXCFUKZMPJMQFI-UHFFFAOYSA-N 0.000 claims 1
- GOKAGCLEIFMRKD-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)SC)F GOKAGCLEIFMRKD-UHFFFAOYSA-N 0.000 claims 1
- YSWRYAJYAVNSMN-UHFFFAOYSA-N 4-[6-[2-[4-(difluoromethoxy)-2-methoxyphenyl]ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid Chemical compound FC(OC1=CC(=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)SC)OC)F YSWRYAJYAVNSMN-UHFFFAOYSA-N 0.000 claims 1
- NPUWSYZOZDHYCH-UHFFFAOYSA-N 5-[6-[2-[4-(difluoromethoxy)-2-methoxyphenyl]ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound FC(OC1=CC(=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)OC)F NPUWSYZOZDHYCH-UHFFFAOYSA-N 0.000 claims 1
- ABTIJEQHHVCFBA-UHFFFAOYSA-N BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC(=N1)C)C1=CC(=C(S1)C1=NOC(N1)=O)OCC)F Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC(=N1)C)C1=CC(=C(S1)C1=NOC(N1)=O)OCC)F ABTIJEQHHVCFBA-UHFFFAOYSA-N 0.000 claims 1
- GOBGCXSMLFKIOV-UHFFFAOYSA-N C(C)OC=1C=C(SC=1C1=NOC(N1)=O)C1=CC(=NC=N1)NCCC1=C(C#N)C=C(C=C1)F Chemical compound C(C)OC=1C=C(SC=1C1=NOC(N1)=O)C1=CC(=NC=N1)NCCC1=C(C#N)C=C(C=C1)F GOBGCXSMLFKIOV-UHFFFAOYSA-N 0.000 claims 1
- GBOFVGKBSXSFHH-UHFFFAOYSA-N CC1=C(C=C(C=C1)CCNC2=NC=NC(=C2)C3=CC(=C(C=C3)C(=O)S)C)C Chemical compound CC1=C(C=C(C=C1)CCNC2=NC=NC(=C2)C3=CC(=C(C=C3)C(=O)S)C)C GBOFVGKBSXSFHH-UHFFFAOYSA-N 0.000 claims 1
- WAMVPAWTYFLHLJ-UHFFFAOYSA-N CC1=CC(=C(C=C1C)OC)CCNC2=NC=NC(=C2)C3=CC(=C(C=C3)C(=O)S)C Chemical compound CC1=CC(=C(C=C1C)OC)CCNC2=NC=NC(=C2)C3=CC(=C(C=C3)C(=O)S)C WAMVPAWTYFLHLJ-UHFFFAOYSA-N 0.000 claims 1
- SCNUSBVKWLHESZ-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)ccc(F)c2Cl)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)ccc(F)c2Cl)ncn1 SCNUSBVKWLHESZ-UHFFFAOYSA-N 0.000 claims 1
- WWBYVLRDLXFHLU-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(OC)cc2OC)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(OC)cc2OC)ncn1 WWBYVLRDLXFHLU-UHFFFAOYSA-N 0.000 claims 1
- HBLHCAZBELMRGY-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(cc2F)N(C)C)ncn1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(cc2F)N(C)C)ncn1 HBLHCAZBELMRGY-UHFFFAOYSA-N 0.000 claims 1
- WZCGEZVZOGHCNO-UHFFFAOYSA-N CCc1nc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 Chemical compound CCc1nc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 WZCGEZVZOGHCNO-UHFFFAOYSA-N 0.000 claims 1
- REPJTENJCXDGEP-UHFFFAOYSA-N ClC=1C=CC(=C(C#N)C=1)CCNC1=NC=NC(=C1)C=1SC(=C(C=1)OCC)C1=NOC(N1)=O Chemical compound ClC=1C=CC(=C(C#N)C=1)CCNC1=NC=NC(=C1)C=1SC(=C(C=1)OCC)C1=NOC(N1)=O REPJTENJCXDGEP-UHFFFAOYSA-N 0.000 claims 1
- 201000003719 cervical neuroblastoma Diseases 0.000 claims 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 claims 1
- 101150032584 oxy-4 gene Proteins 0.000 claims 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 claims 1
- DENPQNAWGQXKCU-UHFFFAOYSA-N thiophene-2-carboxamide Chemical compound NC(=O)C1=CC=CS1 DENPQNAWGQXKCU-UHFFFAOYSA-N 0.000 claims 1
- 150000003180 prostaglandins Chemical class 0.000 abstract description 9
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 abstract 1
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical class C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 abstract 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 124
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 112
- 238000000034 method Methods 0.000 description 105
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 97
- 239000011541 reaction mixture Substances 0.000 description 88
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 82
- 239000007787 solid Substances 0.000 description 76
- 101001117519 Homo sapiens Prostaglandin E2 receptor EP2 subtype Proteins 0.000 description 69
- 102100024448 Prostaglandin E2 receptor EP2 subtype Human genes 0.000 description 69
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 66
- 101000836978 Homo sapiens Sperm-associated antigen 11B Proteins 0.000 description 58
- 235000019439 ethyl acetate Nutrition 0.000 description 56
- 102100024450 Prostaglandin E2 receptor EP4 subtype Human genes 0.000 description 45
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 44
- 101001117509 Homo sapiens Prostaglandin E2 receptor EP4 subtype Proteins 0.000 description 43
- 150000003141 primary amines Chemical class 0.000 description 42
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 41
- 235000019341 magnesium sulphate Nutrition 0.000 description 41
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 40
- 239000000243 solution Substances 0.000 description 36
- 230000002829 reductive effect Effects 0.000 description 34
- 239000012044 organic layer Substances 0.000 description 33
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 32
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 239000005557 antagonist Substances 0.000 description 27
- 210000004027 cell Anatomy 0.000 description 27
- 238000002512 chemotherapy Methods 0.000 description 25
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 24
- 239000012267 brine Substances 0.000 description 24
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 23
- 239000002253 acid Substances 0.000 description 23
- 150000002148 esters Chemical class 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- XEYBRNLFEZDVAW-ARSRFYASSA-N dinoprostone Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O XEYBRNLFEZDVAW-ARSRFYASSA-N 0.000 description 20
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 20
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 20
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical class O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 19
- HNUALSDMDHKUEH-UHFFFAOYSA-N 4-bromo-2,6-dimethoxybenzaldehyde Chemical compound COC1=CC(Br)=CC(OC)=C1C=O HNUALSDMDHKUEH-UHFFFAOYSA-N 0.000 description 19
- 229960002986 dinoprostone Drugs 0.000 description 19
- 239000010410 layer Substances 0.000 description 19
- 239000000203 mixture Substances 0.000 description 19
- 238000002953 preparative HPLC Methods 0.000 description 19
- XEYBRNLFEZDVAW-UHFFFAOYSA-N prostaglandin E2 Natural products CCCCCC(O)C=CC1C(O)CC(=O)C1CC=CCCCC(O)=O XEYBRNLFEZDVAW-UHFFFAOYSA-N 0.000 description 19
- XJPZKYIHCLDXST-UHFFFAOYSA-N 4,6-dichloropyrimidine Chemical compound ClC1=CC(Cl)=NC=N1 XJPZKYIHCLDXST-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 239000003255 cyclooxygenase 2 inhibitor Substances 0.000 description 17
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 17
- XVDMQGNJFRLLEW-UHFFFAOYSA-N 6-chloro-N-[2-(2-methoxy-5-methylsulfanylphenyl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC(=C1)SC)OC XVDMQGNJFRLLEW-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 101150109738 Ptger4 gene Proteins 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 15
- 229940079593 drug Drugs 0.000 description 14
- 125000000335 thiazolyl group Chemical group 0.000 description 14
- 229910052794 bromium Inorganic materials 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000003480 eluent Substances 0.000 description 13
- 239000003112 inhibitor Substances 0.000 description 13
- 239000003921 oil Substances 0.000 description 13
- 235000019198 oils Nutrition 0.000 description 13
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 12
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 12
- 230000009977 dual effect Effects 0.000 description 12
- 229940002612 prodrug Drugs 0.000 description 12
- 239000000651 prodrug Substances 0.000 description 12
- 235000017557 sodium bicarbonate Nutrition 0.000 description 12
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 11
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 11
- 201000006417 multiple sclerosis Diseases 0.000 description 11
- 125000006299 oxetan-3-yl group Chemical group [H]C1([H])OC([H])([H])C1([H])* 0.000 description 11
- 238000000746 purification Methods 0.000 description 11
- 206010006187 Breast cancer Diseases 0.000 description 10
- 208000026310 Breast neoplasm Diseases 0.000 description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 10
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 10
- 229910052796 boron Inorganic materials 0.000 description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 10
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 10
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 10
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 10
- 230000011664 signaling Effects 0.000 description 10
- 238000003786 synthesis reaction Methods 0.000 description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 10
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 9
- 230000004913 activation Effects 0.000 description 9
- 125000001544 thienyl group Chemical group 0.000 description 9
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 8
- 208000003174 Brain Neoplasms Diseases 0.000 description 8
- 201000006107 Familial adenomatous polyposis Diseases 0.000 description 8
- 206010060862 Prostate cancer Diseases 0.000 description 8
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 8
- 210000001744 T-lymphocyte Anatomy 0.000 description 8
- 208000029664 classic familial adenomatous polyposis Diseases 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 8
- 238000009169 immunotherapy Methods 0.000 description 8
- 108090000623 proteins and genes Proteins 0.000 description 8
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 7
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 7
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 7
- 102100040678 Programmed cell death protein 1 Human genes 0.000 description 7
- 101710089372 Programmed cell death protein 1 Proteins 0.000 description 7
- 102100038280 Prostaglandin G/H synthase 2 Human genes 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 7
- 229910000024 caesium carbonate Inorganic materials 0.000 description 7
- 229940111134 coxibs Drugs 0.000 description 7
- 238000001514 detection method Methods 0.000 description 7
- 125000000623 heterocyclic group Chemical group 0.000 description 7
- 125000001041 indolyl group Chemical group 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- 230000008685 targeting Effects 0.000 description 7
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 7
- 210000004881 tumor cell Anatomy 0.000 description 7
- 230000004614 tumor growth Effects 0.000 description 7
- 239000003643 water by type Substances 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- HNSDLXPSAYFUHK-UHFFFAOYSA-N 1,4-bis(2-ethylhexyl) sulfosuccinate Chemical compound CCCCC(CC)COC(=O)CC(S(O)(=O)=O)C(=O)OCC(CC)CCCC HNSDLXPSAYFUHK-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 102100039620 Granulocyte-macrophage colony-stimulating factor Human genes 0.000 description 6
- 101000725401 Homo sapiens Cytochrome c oxidase subunit 2 Proteins 0.000 description 6
- 101000605127 Homo sapiens Prostaglandin G/H synthase 2 Proteins 0.000 description 6
- 206010029260 Neuroblastoma Diseases 0.000 description 6
- 208000006265 Renal cell carcinoma Diseases 0.000 description 6
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 6
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 6
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 6
- 238000006880 cross-coupling reaction Methods 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 230000001472 cytotoxic effect Effects 0.000 description 6
- 210000004443 dendritic cell Anatomy 0.000 description 6
- 230000002496 gastric effect Effects 0.000 description 6
- 230000014509 gene expression Effects 0.000 description 6
- 125000002883 imidazolyl group Chemical group 0.000 description 6
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 6
- 125000000842 isoxazolyl group Chemical group 0.000 description 6
- 238000011813 knockout mouse model Methods 0.000 description 6
- 239000003446 ligand Substances 0.000 description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 description 6
- 125000001715 oxadiazolyl group Chemical group 0.000 description 6
- 125000003226 pyrazolyl group Chemical group 0.000 description 6
- 150000003230 pyrimidines Chemical class 0.000 description 6
- 238000012552 review Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- 230000004083 survival effect Effects 0.000 description 6
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 5
- 208000024827 Alzheimer disease Diseases 0.000 description 5
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 5
- 206010009944 Colon cancer Diseases 0.000 description 5
- 208000000461 Esophageal Neoplasms Diseases 0.000 description 5
- 206010065390 Inflammatory pain Diseases 0.000 description 5
- 108010074328 Interferon-gamma Proteins 0.000 description 5
- 102000000588 Interleukin-2 Human genes 0.000 description 5
- 108010002350 Interleukin-2 Proteins 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 241000699666 Mus <mouse, genus> Species 0.000 description 5
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical class NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 5
- 208000005718 Stomach Neoplasms Diseases 0.000 description 5
- 108010073929 Vascular Endothelial Growth Factor A Proteins 0.000 description 5
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 5
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 5
- 229960005305 adenosine Drugs 0.000 description 5
- 206010002026 amyotrophic lateral sclerosis Diseases 0.000 description 5
- 230000006907 apoptotic process Effects 0.000 description 5
- 230000004071 biological effect Effects 0.000 description 5
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 5
- 231100000504 carcinogenesis Toxicity 0.000 description 5
- 231100000433 cytotoxic Toxicity 0.000 description 5
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 210000002865 immune cell Anatomy 0.000 description 5
- 229910052740 iodine Inorganic materials 0.000 description 5
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 5
- 125000001786 isothiazolyl group Chemical group 0.000 description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 5
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 5
- 238000010172 mouse model Methods 0.000 description 5
- 210000000822 natural killer cell Anatomy 0.000 description 5
- 125000002971 oxazolyl group Chemical group 0.000 description 5
- 235000015320 potassium carbonate Nutrition 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 125000001113 thiadiazolyl group Chemical group 0.000 description 5
- 125000001425 triazolyl group Chemical group 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 238000002255 vaccination Methods 0.000 description 5
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 4
- YBQBWTLSROWKOJ-UHFFFAOYSA-N 3-(3-methoxythiophen-2-yl)oxetan-3-ol Chemical compound COC1=C(SC=C1)C1(COC1)O YBQBWTLSROWKOJ-UHFFFAOYSA-N 0.000 description 4
- 208000005623 Carcinogenesis Diseases 0.000 description 4
- 102000001301 EGF receptor Human genes 0.000 description 4
- 108060006698 EGF receptor Proteins 0.000 description 4
- 206010018338 Glioma Diseases 0.000 description 4
- 108010017213 Granulocyte-Macrophage Colony-Stimulating Factor Proteins 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- 229940076838 Immune checkpoint inhibitor Drugs 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 4
- 229930012538 Paclitaxel Natural products 0.000 description 4
- 238000006069 Suzuki reaction reaction Methods 0.000 description 4
- BPEGJWRSRHCHSN-UHFFFAOYSA-N Temozolomide Chemical compound O=C1N(C)N=NC2=C(C(N)=O)N=CN21 BPEGJWRSRHCHSN-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- IPWKHHSGDUIRAH-UHFFFAOYSA-N bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 230000036952 cancer formation Effects 0.000 description 4
- 229940000425 combination drug Drugs 0.000 description 4
- 239000012636 effector Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 4
- 239000012274 immune-checkpoint protein inhibitor Substances 0.000 description 4
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- 210000002540 macrophage Anatomy 0.000 description 4
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 210000004985 myeloid-derived suppressor cell Anatomy 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 4
- 229960001592 paclitaxel Drugs 0.000 description 4
- 201000002528 pancreatic cancer Diseases 0.000 description 4
- 208000008443 pancreatic carcinoma Diseases 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- IVDFJHOHABJVEH-UHFFFAOYSA-N pinacol Chemical class CC(C)(O)C(C)(C)O IVDFJHOHABJVEH-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 210000003289 regulatory T cell Anatomy 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 125000004434 sulfur atom Chemical group 0.000 description 4
- 238000001356 surgical procedure Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 230000002195 synergetic effect Effects 0.000 description 4
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 4
- 229960004964 temozolomide Drugs 0.000 description 4
- 125000003831 tetrazolyl group Chemical group 0.000 description 4
- 229940124597 therapeutic agent Drugs 0.000 description 4
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 4
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 4
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 4
- 238000004704 ultra performance liquid chromatography Methods 0.000 description 4
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 3
- GIBQINBJMRBYRR-UHFFFAOYSA-N 1-bromo-4-(difluoromethyl)-5-fluoro-2-methoxybenzene Chemical compound COc1cc(C(F)F)c(F)cc1Br GIBQINBJMRBYRR-UHFFFAOYSA-N 0.000 description 3
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 3
- BMIBJCFFZPYJHF-UHFFFAOYSA-N 2-methoxy-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound COC1=NC=C(C)C=C1B1OC(C)(C)C(C)(C)O1 BMIBJCFFZPYJHF-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- 206010065040 AIDS dementia complex Diseases 0.000 description 3
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 3
- 208000009746 Adult T-Cell Leukemia-Lymphoma Diseases 0.000 description 3
- 208000016683 Adult T-cell leukemia/lymphoma Diseases 0.000 description 3
- 208000036170 B-Cell Marginal Zone Lymphoma Diseases 0.000 description 3
- 208000006386 Bone Resorption Diseases 0.000 description 3
- 208000011691 Burkitt lymphomas Diseases 0.000 description 3
- 229940045513 CTLA4 antagonist Drugs 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- 201000009030 Carcinoma Diseases 0.000 description 3
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 3
- 208000006332 Choriocarcinoma Diseases 0.000 description 3
- 208000030808 Clear cell renal carcinoma Diseases 0.000 description 3
- 206010052358 Colorectal cancer metastatic Diseases 0.000 description 3
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 3
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- 208000005171 Dysmenorrhea Diseases 0.000 description 3
- 206010013935 Dysmenorrhoea Diseases 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 208000006168 Ewing Sarcoma Diseases 0.000 description 3
- 206010061850 Extranodal marginal zone B-cell lymphoma (MALT type) Diseases 0.000 description 3
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 3
- 208000022072 Gallbladder Neoplasms Diseases 0.000 description 3
- 201000010915 Glioblastoma multiforme Diseases 0.000 description 3
- 208000017604 Hodgkin disease Diseases 0.000 description 3
- 208000021519 Hodgkin lymphoma Diseases 0.000 description 3
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 3
- 102000037984 Inhibitory immune checkpoint proteins Human genes 0.000 description 3
- 108091008026 Inhibitory immune checkpoint proteins Proteins 0.000 description 3
- 102100037850 Interferon gamma Human genes 0.000 description 3
- 102000003996 Interferon-beta Human genes 0.000 description 3
- 108090000467 Interferon-beta Proteins 0.000 description 3
- 201000003791 MALT lymphoma Diseases 0.000 description 3
- 206010059282 Metastases to central nervous system Diseases 0.000 description 3
- 206010027480 Metastatic malignant melanoma Diseases 0.000 description 3
- 206010050513 Metastatic renal cell carcinoma Diseases 0.000 description 3
- 229920001410 Microfiber Polymers 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 3
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 3
- 208000001894 Nasopharyngeal Neoplasms Diseases 0.000 description 3
- YGACXVRLDHEXKY-WXRXAMBDSA-N O[C@H](C[C@H]1c2c(cccc2F)-c2cncn12)[C@H]1CC[C@H](O)CC1 Chemical compound O[C@H](C[C@H]1c2c(cccc2F)-c2cncn12)[C@H]1CC[C@H](O)CC1 YGACXVRLDHEXKY-WXRXAMBDSA-N 0.000 description 3
- 102000038030 PI3Ks Human genes 0.000 description 3
- 108091007960 PI3Ks Proteins 0.000 description 3
- 208000008900 Pancreatic Ductal Carcinoma Diseases 0.000 description 3
- 206010033701 Papillary thyroid cancer Diseases 0.000 description 3
- 208000018737 Parkinson disease Diseases 0.000 description 3
- 102100033076 Prostaglandin E synthase Human genes 0.000 description 3
- 101710096361 Prostaglandin E synthase Proteins 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 208000024770 Thyroid neoplasm Diseases 0.000 description 3
- 102000002689 Toll-like receptor Human genes 0.000 description 3
- 108020000411 Toll-like receptor Proteins 0.000 description 3
- 208000003721 Triple Negative Breast Neoplasms Diseases 0.000 description 3
- 241000700605 Viruses Species 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 208000009956 adenocarcinoma Diseases 0.000 description 3
- 238000011226 adjuvant chemotherapy Methods 0.000 description 3
- 201000006966 adult T-cell leukemia Diseases 0.000 description 3
- 230000000259 anti-tumor effect Effects 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000003886 aromatase inhibitor Substances 0.000 description 3
- 229940046844 aromatase inhibitors Drugs 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 3
- 210000000013 bile duct Anatomy 0.000 description 3
- 208000026900 bile duct neoplasm Diseases 0.000 description 3
- ACWZRVQXLIRSDF-UHFFFAOYSA-N binimetinib Chemical compound OCCONC(=O)C=1C=C2N(C)C=NC2=C(F)C=1NC1=CC=C(Br)C=C1F ACWZRVQXLIRSDF-UHFFFAOYSA-N 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 210000004204 blood vessel Anatomy 0.000 description 3
- 230000024279 bone resorption Effects 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 229960005243 carmustine Drugs 0.000 description 3
- 125000001309 chloro group Chemical group Cl* 0.000 description 3
- 206010073251 clear cell renal cell carcinoma Diseases 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 229960002271 cobimetinib Drugs 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000009096 combination chemotherapy Methods 0.000 description 3
- 238000011441 consolidation chemotherapy Methods 0.000 description 3
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 3
- 229960004397 cyclophosphamide Drugs 0.000 description 3
- 210000001151 cytotoxic T lymphocyte Anatomy 0.000 description 3
- 229960003901 dacarbazine Drugs 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 229910052805 deuterium Inorganic materials 0.000 description 3
- 229960003668 docetaxel Drugs 0.000 description 3
- 238000000105 evaporative light scattering detection Methods 0.000 description 3
- 229960002949 fluorouracil Drugs 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 210000000232 gallbladder Anatomy 0.000 description 3
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 3
- 229960005277 gemcitabine Drugs 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 208000005017 glioblastoma Diseases 0.000 description 3
- 201000010536 head and neck cancer Diseases 0.000 description 3
- 208000014829 head and neck neoplasm Diseases 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 125000005945 imidazopyridyl group Chemical group 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 230000001965 increasing effect Effects 0.000 description 3
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- 229960001388 interferon-beta Drugs 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 3
- FABUFPQFXZVHFB-CFWQTKTJSA-N ixabepilone Chemical compound C/C([C@@H]1C[C@@H]2O[C@]2(C)CCC[C@@H]([C@@H]([C@H](C)C(=O)C(C)(C)[C@H](O)CC(=O)N1)O)C)=C\C1=CSC(C)=N1 FABUFPQFXZVHFB-CFWQTKTJSA-N 0.000 description 3
- 229960002014 ixabepilone Drugs 0.000 description 3
- 208000032839 leukemia Diseases 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 208000014018 liver neoplasm Diseases 0.000 description 3
- 230000014759 maintenance of location Effects 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- 206010027191 meningioma Diseases 0.000 description 3
- 230000001394 metastastic effect Effects 0.000 description 3
- 208000021039 metastatic melanoma Diseases 0.000 description 3
- 206010061289 metastatic neoplasm Diseases 0.000 description 3
- 239000003658 microfiber Substances 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 3
- 201000011330 nonpapillary renal cell carcinoma Diseases 0.000 description 3
- 201000008968 osteosarcoma Diseases 0.000 description 3
- 230000002018 overexpression Effects 0.000 description 3
- 201000008129 pancreatic ductal adenocarcinoma Diseases 0.000 description 3
- 229960002621 pembrolizumab Drugs 0.000 description 3
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- KAQKFAOMNZTLHT-OZUDYXHBSA-N prostaglandin I2 Chemical compound O1\C(=C/CCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-OZUDYXHBSA-N 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 description 3
- 125000006085 pyrrolopyridyl group Chemical group 0.000 description 3
- 125000004550 quinolin-6-yl group Chemical group N1=CC=CC2=CC(=CC=C12)* 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 3
- 208000008732 thymoma Diseases 0.000 description 3
- 201000002510 thyroid cancer Diseases 0.000 description 3
- 208000030045 thyroid gland papillary carcinoma Diseases 0.000 description 3
- 206010044412 transitional cell carcinoma Diseases 0.000 description 3
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 3
- MZOFCQQQCNRIBI-VMXHOPILSA-N (3s)-4-[[(2s)-1-[[(2s)-1-[[(1s)-1-carboxy-2-hydroxyethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-[[2-[[(2s)-2,6-diaminohexanoyl]amino]acetyl]amino]-4-oxobutanoic acid Chemical compound OC[C@@H](C(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@@H](N)CCCCN MZOFCQQQCNRIBI-VMXHOPILSA-N 0.000 description 2
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 2
- VPVXHAANQNHFSF-UHFFFAOYSA-N 1,4-dioxan-2-one Chemical compound O=C1COCCO1 VPVXHAANQNHFSF-UHFFFAOYSA-N 0.000 description 2
- LRAQNLMPLBZRIZ-UHFFFAOYSA-N 1-bromo-5-chloro-2-methoxy-4-(trifluoromethyl)benzene Chemical compound BrC1=C(C=C(C(=C1)Cl)C(F)(F)F)OC LRAQNLMPLBZRIZ-UHFFFAOYSA-N 0.000 description 2
- ONKGEUQRVIPRSX-UHFFFAOYSA-N 1-methoxy-4-methyl-2-phenylmethoxybenzene Chemical compound COC1=CC=C(C)C=C1OCC1=CC=CC=C1 ONKGEUQRVIPRSX-UHFFFAOYSA-N 0.000 description 2
- ZADWXFSZEAPBJS-JTQLQIEISA-N 1-methyl-L-tryptophan Chemical compound C1=CC=C2N(C)C=C(C[C@H](N)C(O)=O)C2=C1 ZADWXFSZEAPBJS-JTQLQIEISA-N 0.000 description 2
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 2
- HNTHBKRTNCXPES-UHFFFAOYSA-N 2-(3,4-dichloro-2-methylphenyl)ethanamine Chemical compound ClC=1C(=C(C=CC=1Cl)CCN)C HNTHBKRTNCXPES-UHFFFAOYSA-N 0.000 description 2
- RZSZWDMTGMYCBW-UHFFFAOYSA-N 2-[4-(difluoromethyl)-5-fluoro-2-methoxyphenyl]ethanamine Chemical compound FC(C1=CC(=C(C=C1F)CCN)OC)F RZSZWDMTGMYCBW-UHFFFAOYSA-N 0.000 description 2
- LBIXCFNBKRMKLI-UHFFFAOYSA-N 2-fluoro-6-methoxy-4-(trifluoromethyl)benzaldehyde Chemical compound COc1cc(cc(F)c1C=O)C(F)(F)F LBIXCFNBKRMKLI-UHFFFAOYSA-N 0.000 description 2
- QSECPQCFCWVBKM-UHFFFAOYSA-N 2-iodoethanol Chemical compound OCCI QSECPQCFCWVBKM-UHFFFAOYSA-N 0.000 description 2
- IFNDEOYXGHGERA-UHFFFAOYSA-N 2-methoxy-5-methylphenol Chemical compound COC1=CC=C(C)C=C1O IFNDEOYXGHGERA-UHFFFAOYSA-N 0.000 description 2
- PIAOLBVUVDXHHL-UHFFFAOYSA-N 2-nitroethenylbenzene Chemical compound [O-][N+](=O)C=CC1=CC=CC=C1 PIAOLBVUVDXHHL-UHFFFAOYSA-N 0.000 description 2
- QENGPZGAWFQWCZ-UHFFFAOYSA-N 3-Methylthiophene Chemical compound CC=1C=CSC=1 QENGPZGAWFQWCZ-UHFFFAOYSA-N 0.000 description 2
- WLIKQGUMRNDRSA-UHFFFAOYSA-N 3-ethoxythiophene-2-sulfonamide Chemical compound C(C)OC1=C(SC=C1)S(=O)(=O)N WLIKQGUMRNDRSA-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- IGKMFQJDOAFGIH-UHFFFAOYSA-N 4-(difluoromethyl)-2-methoxy-5-methylphenol Chemical compound COc1cc(C(F)F)c(C)cc1O IGKMFQJDOAFGIH-UHFFFAOYSA-N 0.000 description 2
- PCGDEZIPPWSPHJ-UHFFFAOYSA-N 4-bromo-2-butoxy-6-fluorobenzoic acid Chemical compound BrC1=CC(=C(C(=O)O)C(=C1)F)OCCCC PCGDEZIPPWSPHJ-UHFFFAOYSA-N 0.000 description 2
- FRYQWMDMRFFGRO-UHFFFAOYSA-N 4-bromo-2-ethoxyaniline Chemical compound CCOC1=CC(Br)=CC=C1N FRYQWMDMRFFGRO-UHFFFAOYSA-N 0.000 description 2
- TXNLQUKVUJITMX-UHFFFAOYSA-N 4-tert-butyl-2-(4-tert-butylpyridin-2-yl)pyridine Chemical group CC(C)(C)C1=CC=NC(C=2N=CC=C(C=2)C(C)(C)C)=C1 TXNLQUKVUJITMX-UHFFFAOYSA-N 0.000 description 2
- 102100022464 5'-nucleotidase Human genes 0.000 description 2
- DIGNNADYQLBADG-UHFFFAOYSA-N 5-methoxy-2-methyl-4-phenylmethoxybenzaldehyde Chemical compound COC1=CC(C=O)=C(C)C=C1OCC1=CC=CC=C1 DIGNNADYQLBADG-UHFFFAOYSA-N 0.000 description 2
- 102000009346 Adenosine receptors Human genes 0.000 description 2
- 108050000203 Adenosine receptors Proteins 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 101710137189 Amyloid-beta A4 protein Proteins 0.000 description 2
- 102100022704 Amyloid-beta precursor protein Human genes 0.000 description 2
- 101710151993 Amyloid-beta precursor protein Proteins 0.000 description 2
- BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- 108010074708 B7-H1 Antigen Proteins 0.000 description 2
- 102000008096 B7-H1 Antigen Human genes 0.000 description 2
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical group CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 2
- 229940124638 COX inhibitor Drugs 0.000 description 2
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 description 2
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 description 2
- 108010019670 Chimeric Antigen Receptors Proteins 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 101000862089 Clarkia lewisii Glucose-6-phosphate isomerase, cytosolic 1A Proteins 0.000 description 2
- 102100039498 Cytotoxic T-lymphocyte protein 4 Human genes 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- 102100029722 Ectonucleoside triphosphate diphosphohydrolase 1 Human genes 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 2
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 2
- 239000007821 HATU Substances 0.000 description 2
- 102100029100 Hematopoietic prostaglandin D synthase Human genes 0.000 description 2
- 101000678236 Homo sapiens 5'-nucleotidase Proteins 0.000 description 2
- 101000889276 Homo sapiens Cytotoxic T-lymphocyte protein 4 Proteins 0.000 description 2
- 101001012447 Homo sapiens Ectonucleoside triphosphate diphosphohydrolase 1 Proteins 0.000 description 2
- 101000988802 Homo sapiens Hematopoietic prostaglandin D synthase Proteins 0.000 description 2
- 101000916644 Homo sapiens Macrophage colony-stimulating factor 1 receptor Proteins 0.000 description 2
- 101001117517 Homo sapiens Prostaglandin E2 receptor EP3 subtype Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 206010062016 Immunosuppression Diseases 0.000 description 2
- 102000008070 Interferon-gamma Human genes 0.000 description 2
- 102000015696 Interleukins Human genes 0.000 description 2
- 108010063738 Interleukins Proteins 0.000 description 2
- 229930194542 Keto Natural products 0.000 description 2
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 2
- 239000005511 L01XE05 - Sorafenib Substances 0.000 description 2
- 206010025323 Lymphomas Diseases 0.000 description 2
- 210000004322 M2 macrophage Anatomy 0.000 description 2
- 102000043136 MAP kinase family Human genes 0.000 description 2
- 108091054455 MAP kinase family Proteins 0.000 description 2
- 102100028198 Macrophage colony-stimulating factor 1 receptor Human genes 0.000 description 2
- 208000000172 Medulloblastoma Diseases 0.000 description 2
- 206010027406 Mesothelioma Diseases 0.000 description 2
- 206010027476 Metastases Diseases 0.000 description 2
- 208000034578 Multiple myelomas Diseases 0.000 description 2
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical compound C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 2
- 206010030155 Oesophageal carcinoma Diseases 0.000 description 2
- 235000019502 Orange oil Nutrition 0.000 description 2
- 206010035226 Plasma cell myeloma Diseases 0.000 description 2
- 108091007744 Programmed cell death receptors Proteins 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 102100024447 Prostaglandin E2 receptor EP3 subtype Human genes 0.000 description 2
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 description 2
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 238000006161 Suzuki-Miyaura coupling reaction Methods 0.000 description 2
- 229940126547 T-cell immunoglobulin mucin-3 Drugs 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 101710136122 Tryptophan 2,3-dioxygenase Proteins 0.000 description 2
- 102000057288 Tryptophan 2,3-dioxygenases Human genes 0.000 description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
- 108060008683 Tumor Necrosis Factor Receptor Proteins 0.000 description 2
- 102100040247 Tumor necrosis factor Human genes 0.000 description 2
- 102100022153 Tumor necrosis factor receptor superfamily member 4 Human genes 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 2
- 108060000200 adenylate cyclase Proteins 0.000 description 2
- 102000030621 adenylate cyclase Human genes 0.000 description 2
- 238000009098 adjuvant therapy Methods 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- DZHSAHHDTRWUTF-SIQRNXPUSA-N amyloid-beta polypeptide 42 Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(O)=O)[C@@H](C)CC)C(C)C)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C(C)C)C1=CC=CC=C1 DZHSAHHDTRWUTF-SIQRNXPUSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 230000033115 angiogenesis Effects 0.000 description 2
- 239000004037 angiogenesis inhibitor Substances 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- 239000000427 antigen Substances 0.000 description 2
- 102000036639 antigens Human genes 0.000 description 2
- 108091007433 antigens Proteins 0.000 description 2
- 229940034982 antineoplastic agent Drugs 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 2
- 125000004566 azetidin-1-yl group Chemical group N1(CCC1)* 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 229940050390 benzoate Drugs 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Inorganic materials [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 2
- 229960004117 capecitabine Drugs 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 229960004562 carboplatin Drugs 0.000 description 2
- 125000002843 carboxylic acid group Chemical group 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000009087 cell motility Effects 0.000 description 2
- 229960004316 cisplatin Drugs 0.000 description 2
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 2
- BSMCAPRUBJMWDF-KRWDZBQOSA-N cobimetinib Chemical compound C1C(O)([C@H]2NCCCC2)CN1C(=O)C1=CC=C(F)C(F)=C1NC1=CC=C(I)C=C1F BSMCAPRUBJMWDF-KRWDZBQOSA-N 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 230000016396 cytokine production Effects 0.000 description 2
- 230000001086 cytosolic effect Effects 0.000 description 2
- 230000003013 cytotoxicity Effects 0.000 description 2
- 231100000135 cytotoxicity Toxicity 0.000 description 2
- MXFYYFVVIIWKFE-UHFFFAOYSA-N dicyclohexyl-[2-[2,6-di(propan-2-yloxy)phenyl]phenyl]phosphane Chemical compound CC(C)OC1=CC=CC(OC(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 MXFYYFVVIIWKFE-UHFFFAOYSA-N 0.000 description 2
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000002526 effect on cardiovascular system Effects 0.000 description 2
- 229940056913 eftilagimod alfa Drugs 0.000 description 2
- 210000005168 endometrial cell Anatomy 0.000 description 2
- 210000002889 endothelial cell Anatomy 0.000 description 2
- 230000002708 enhancing effect Effects 0.000 description 2
- 201000004101 esophageal cancer Diseases 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- CANYUGPUMZHTAN-UHFFFAOYSA-N ethyl 2-(4-bromo-2-ethoxyphenyl)-2-oxoacetate Chemical compound BrC1=CC(=C(C=C1)C(C(=O)OCC)=O)OCC CANYUGPUMZHTAN-UHFFFAOYSA-N 0.000 description 2
- OBEATTRSQFQNSV-UHFFFAOYSA-N ethyl 4-bromo-2-ethoxy-3-fluorobenzoate Chemical compound BrC1=C(C(=C(C(=O)OCC)C=C1)OCC)F OBEATTRSQFQNSV-UHFFFAOYSA-N 0.000 description 2
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 2
- 229960005420 etoposide Drugs 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229960000255 exemestane Drugs 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 229960000304 folic acid Drugs 0.000 description 2
- 235000019152 folic acid Nutrition 0.000 description 2
- 239000011724 folic acid Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 206010017758 gastric cancer Diseases 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 125000000336 imidazol-5-yl group Chemical group [H]N1C([H])=NC([H])=C1[*] 0.000 description 2
- 230000002519 immonomodulatory effect Effects 0.000 description 2
- 230000001506 immunosuppresive effect Effects 0.000 description 2
- 210000005008 immunosuppressive cell Anatomy 0.000 description 2
- 230000001976 improved effect Effects 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 102000006639 indoleamine 2,3-dioxygenase Human genes 0.000 description 2
- 108020004201 indoleamine 2,3-dioxygenase Proteins 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 230000015788 innate immune response Effects 0.000 description 2
- 229960003130 interferon gamma Drugs 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 description 2
- 229960004768 irinotecan Drugs 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000005956 isoquinolyl group Chemical group 0.000 description 2
- 230000000670 limiting effect Effects 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 238000012423 maintenance Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 2
- 229960001924 melphalan Drugs 0.000 description 2
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 2
- 230000009401 metastasis Effects 0.000 description 2
- 229960000485 methotrexate Drugs 0.000 description 2
- SVSWELAZKXYRAS-UHFFFAOYSA-N methyl 2-(3-ethoxythiophen-2-yl)acetate Chemical compound C(C)OC1=C(SC=C1)CC(=O)OC SVSWELAZKXYRAS-UHFFFAOYSA-N 0.000 description 2
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 2
- FUNBQMGBPLZRJN-UHFFFAOYSA-N methyl 4-bromo-2-(2-hydroxyethoxy)benzoate Chemical compound BrC1=CC(=C(C(=O)OC)C=C1)OCCO FUNBQMGBPLZRJN-UHFFFAOYSA-N 0.000 description 2
- IEQTUIKLKBHLNW-UHFFFAOYSA-N methyl 4-chloro-3-ethoxythiophene-2-carboxylate Chemical compound CCOc1c(Cl)csc1C(=O)OC IEQTUIKLKBHLNW-UHFFFAOYSA-N 0.000 description 2
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 230000000394 mitotic effect Effects 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 229940021182 non-steroidal anti-inflammatory drug Drugs 0.000 description 2
- 238000007339 nucleophilic aromatic substitution reaction Methods 0.000 description 2
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 201000008482 osteoarthritis Diseases 0.000 description 2
- 229960001756 oxaliplatin Drugs 0.000 description 2
- DWAFYCQODLXJNR-BNTLRKBRSA-L oxaliplatin Chemical compound O1C(=O)C(=O)O[Pt]11N[C@@H]2CCCC[C@H]2N1 DWAFYCQODLXJNR-BNTLRKBRSA-L 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- QOFFJEBXNKRSPX-ZDUSSCGKSA-N pemetrexed Chemical compound C1=N[C]2NC(N)=NC(=O)C2=C1CCC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 QOFFJEBXNKRSPX-ZDUSSCGKSA-N 0.000 description 2
- 229960005079 pemetrexed Drugs 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229940117803 phenethylamine Drugs 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 230000001737 promoting effect Effects 0.000 description 2
- BHMBVRSPMRCCGG-OUTUXVNYSA-N prostaglandin D2 Chemical compound CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](C\C=C/CCCC(O)=O)[C@@H](O)CC1=O BHMBVRSPMRCCGG-OUTUXVNYSA-N 0.000 description 2
- BHMBVRSPMRCCGG-UHFFFAOYSA-N prostaglandine D2 Natural products CCCCCC(O)C=CC1C(CC=CCCCC(O)=O)C(O)CC1=O BHMBVRSPMRCCGG-UHFFFAOYSA-N 0.000 description 2
- LXNHXLLTXMVWPM-UHFFFAOYSA-N pyridoxine Chemical compound CC1=NC=C(CO)C(CO)=C1O LXNHXLLTXMVWPM-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 125000005493 quinolyl group Chemical group 0.000 description 2
- ZADWXFSZEAPBJS-UHFFFAOYSA-N racemic N-methyl tryptophan Natural products C1=CC=C2N(C)C=C(CC(N)C(O)=O)C2=C1 ZADWXFSZEAPBJS-UHFFFAOYSA-N 0.000 description 2
- 229940044551 receptor antagonist Drugs 0.000 description 2
- 239000002464 receptor antagonist Substances 0.000 description 2
- 201000009410 rhabdomyosarcoma Diseases 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 150000003384 small molecules Chemical class 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- PNGLEYLFMHGIQO-UHFFFAOYSA-M sodium;3-(n-ethyl-3-methoxyanilino)-2-hydroxypropane-1-sulfonate;dihydrate Chemical compound O.O.[Na+].[O-]S(=O)(=O)CC(O)CN(CC)C1=CC=CC(OC)=C1 PNGLEYLFMHGIQO-UHFFFAOYSA-M 0.000 description 2
- 229960003787 sorafenib Drugs 0.000 description 2
- 201000011549 stomach cancer Diseases 0.000 description 2
- 210000002536 stromal cell Anatomy 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- QERYCTSHXKAMIS-UHFFFAOYSA-M thiophene-2-carboxylate Chemical compound [O-]C(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-M 0.000 description 2
- DSNBHJFQCNUKMA-SCKDECHMSA-N thromboxane A2 Chemical compound OC(=O)CCC\C=C/C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)O[C@@H]2O[C@H]1C2 DSNBHJFQCNUKMA-SCKDECHMSA-N 0.000 description 2
- ONDSBJMLAHVLMI-UHFFFAOYSA-N trimethylsilyldiazomethane Chemical compound C[Si](C)(C)[CH-][N+]#N ONDSBJMLAHVLMI-UHFFFAOYSA-N 0.000 description 2
- 230000005747 tumor angiogenesis Effects 0.000 description 2
- 229940030325 tumor cell vaccine Drugs 0.000 description 2
- 230000005740 tumor formation Effects 0.000 description 2
- 102000003298 tumor necrosis factor receptor Human genes 0.000 description 2
- 230000003827 upregulation Effects 0.000 description 2
- 229950005972 urelumab Drugs 0.000 description 2
- 229960005486 vaccine Drugs 0.000 description 2
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 2
- 229960004528 vincristine Drugs 0.000 description 2
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 2
- MNKCGUKVRJZKEQ-MIXQCLKLSA-N (1z,5z)-cycloocta-1,5-diene;iridium;methanol Chemical compound [Ir].[Ir].OC.OC.C\1C\C=C/CC\C=C/1.C\1C\C=C/CC\C=C/1 MNKCGUKVRJZKEQ-MIXQCLKLSA-N 0.000 description 1
- MWDNZMWVENFVHT-UHFFFAOYSA-L (2-decoxy-2-oxoethyl)-[2-[2-[(2-decoxy-2-oxoethyl)-dimethylazaniumyl]ethylsulfanyl]ethyl]-dimethylazanium;dichloride Chemical compound [Cl-].[Cl-].CCCCCCCCCCOC(=O)C[N+](C)(C)CCSCC[N+](C)(C)CC(=O)OCCCCCCCCCC MWDNZMWVENFVHT-UHFFFAOYSA-L 0.000 description 1
- ZADWXFSZEAPBJS-SNVBAGLBSA-N (2r)-2-amino-3-(1-methylindol-3-yl)propanoic acid Chemical compound C1=CC=C2N(C)C=C(C[C@@H](N)C(O)=O)C2=C1 ZADWXFSZEAPBJS-SNVBAGLBSA-N 0.000 description 1
- YPBKTZBXSBLTDK-PKNBQFBNSA-N (3e)-3-[(3-bromo-4-fluoroanilino)-nitrosomethylidene]-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole Chemical compound NS(=O)(=O)NCCNC1=NON\C1=C(N=O)/NC1=CC=C(F)C(Br)=C1 YPBKTZBXSBLTDK-PKNBQFBNSA-N 0.000 description 1
- SSOORFWOBGFTHL-OTEJMHTDSA-N (4S)-5-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[2-[(2S)-2-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S,3S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-[[(2S)-5-carbamimidamido-1-[[(2S)-5-carbamimidamido-1-[[(1S)-4-carbamimidamido-1-carboxybutyl]amino]-1-oxopentan-2-yl]amino]-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-1-oxohexan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-[[(2S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-5-oxopentanoic acid Chemical compound CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@@H](N)CCCCN)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O SSOORFWOBGFTHL-OTEJMHTDSA-N 0.000 description 1
- MSTNYGQPCMXVAQ-RYUDHWBXSA-N (6S)-5,6,7,8-tetrahydrofolic acid Chemical compound C([C@H]1CNC=2N=C(NC(=O)C=2N1)N)NC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 MSTNYGQPCMXVAQ-RYUDHWBXSA-N 0.000 description 1
- PXGPLTODNUVGFL-BRIYLRKRSA-N (E,Z)-(1R,2R,3R,5S)-7-(3,5-Dihydroxy-2-((3S)-(3-hydroxy-1-octenyl))cyclopentyl)-5-heptenoic acid Chemical compound CCCCC[C@H](O)C=C[C@H]1[C@H](O)C[C@H](O)[C@@H]1CC=CCCCC(O)=O PXGPLTODNUVGFL-BRIYLRKRSA-N 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- FUOSTELFLYZQCW-UHFFFAOYSA-N 1,2-oxazol-3-one Chemical compound OC=1C=CON=1 FUOSTELFLYZQCW-UHFFFAOYSA-N 0.000 description 1
- QTYUSOHYEPOHLV-FNORWQNLSA-N 1,3-Octadiene Chemical class CCCC\C=C\C=C QTYUSOHYEPOHLV-FNORWQNLSA-N 0.000 description 1
- XEEDNRFJZOEGKT-UHFFFAOYSA-N 1-(difluoromethyl)-5-methoxy-2-methyl-4-phenylmethoxybenzene Chemical compound C(C1=CC=CC=C1)OC1=C(C=C(C(=C1)C)C(F)F)OC XEEDNRFJZOEGKT-UHFFFAOYSA-N 0.000 description 1
- BSRSUBVCEBLPAX-UHFFFAOYSA-N 1-bromo-2-(difluoromethoxy)-4-(trifluoromethyl)benzene Chemical compound FC(F)OC1=CC(C(F)(F)F)=CC=C1Br BSRSUBVCEBLPAX-UHFFFAOYSA-N 0.000 description 1
- XPBAUEMRAAGQAJ-UHFFFAOYSA-N 1-bromo-2-methoxy-4-methylsulfanylbenzene Chemical compound COC1=CC(SC)=CC=C1Br XPBAUEMRAAGQAJ-UHFFFAOYSA-N 0.000 description 1
- FNRIGXVAVWLNKH-UHFFFAOYSA-N 1-bromo-3,4-dichloro-2-methylbenzene Chemical compound CC1=C(Br)C=CC(Cl)=C1Cl FNRIGXVAVWLNKH-UHFFFAOYSA-N 0.000 description 1
- KPUZODUHXYIKJD-UHFFFAOYSA-N 1-bromo-4-(difluoromethoxy)-2-methoxybenzene Chemical compound COC1=CC(OC(F)F)=CC=C1Br KPUZODUHXYIKJD-UHFFFAOYSA-N 0.000 description 1
- BXGMPSVPTZMJTA-UHFFFAOYSA-N 1-bromo-5-methoxy-2-methyl-4-phenylmethoxybenzene Chemical compound C1(OC)=C(OCC2=CC=CC=C2)C=C(C(=C1)Br)C BXGMPSVPTZMJTA-UHFFFAOYSA-N 0.000 description 1
- DFPYXQYWILNVAU-UHFFFAOYSA-N 1-hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1.C1=CC=C2N(O)N=NC2=C1 DFPYXQYWILNVAU-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 125000004778 2,2-difluoroethyl group Chemical group [H]C([H])(*)C([H])(F)F 0.000 description 1
- VSHKYWVSLPHVQB-UHFFFAOYSA-N 2-(2,6-difluoro-4-methoxyphenyl)ethanamine Chemical compound COC1=CC(F)=C(CCN)C(F)=C1 VSHKYWVSLPHVQB-UHFFFAOYSA-N 0.000 description 1
- ADHKZSNGELMMAG-UHFFFAOYSA-N 2-(2,6-difluorophenyl)ethanamine Chemical compound NCCC1=C(F)C=CC=C1F ADHKZSNGELMMAG-UHFFFAOYSA-N 0.000 description 1
- UEJJHQNACJXSKW-UHFFFAOYSA-N 2-(2,6-dioxopiperidin-3-yl)-1H-isoindole-1,3(2H)-dione Chemical class O=C1C2=CC=CC=C2C(=O)N1C1CCC(=O)NC1=O UEJJHQNACJXSKW-UHFFFAOYSA-N 0.000 description 1
- JZWJPHGJWHGWGI-UHFFFAOYSA-N 2-(2-aminoethyl)-5-chloro-N-methylaniline Chemical compound NCCC1=C(NC)C=C(C=C1)Cl JZWJPHGJWHGWGI-UHFFFAOYSA-N 0.000 description 1
- WLSNSGGYSAGNDF-UHFFFAOYSA-N 2-(2-fluoro-6-methoxyphenyl)ethanamine Chemical compound COC1=CC=CC(F)=C1CCN WLSNSGGYSAGNDF-UHFFFAOYSA-N 0.000 description 1
- QBAJZPYRWMWDPQ-UHFFFAOYSA-N 2-(2-methoxy-4,6-dimethylphenyl)ethanamine Chemical compound COC1=CC(C)=CC(C)=C1CCN QBAJZPYRWMWDPQ-UHFFFAOYSA-N 0.000 description 1
- PZDXUEQHNDKWAK-UHFFFAOYSA-N 2-(2-methoxy-4-methylsulfanylphenyl)ethanamine hydrochloride Chemical compound Cl.COc1cc(SC)ccc1CCN PZDXUEQHNDKWAK-UHFFFAOYSA-N 0.000 description 1
- KNBFYBAVLQEOTO-UHFFFAOYSA-N 2-(2-methoxy-5-methylsulfanylphenyl)ethanamine Chemical compound COC1=CC=C(SC)C=C1CCN KNBFYBAVLQEOTO-UHFFFAOYSA-N 0.000 description 1
- BAPBSLSLPLLIHZ-UHFFFAOYSA-N 2-(4,5-difluoro-2-methoxyphenyl)ethanamine Chemical compound COC1=CC(F)=C(F)C=C1CCN BAPBSLSLPLLIHZ-UHFFFAOYSA-N 0.000 description 1
- GQUQWFAHJZJDMP-UHFFFAOYSA-N 2-(4-bromo-2,6-dimethoxyphenyl)ethanamine Chemical compound COc1cc(Br)cc(OC)c1CCN GQUQWFAHJZJDMP-UHFFFAOYSA-N 0.000 description 1
- DOBQWGZGXKIKSP-UHFFFAOYSA-N 2-(4-bromo-2-ethoxyphenyl)ethanamine Chemical compound BrC1=CC(=C(C=C1)CCN)OCC DOBQWGZGXKIKSP-UHFFFAOYSA-N 0.000 description 1
- YLTYNHVNGYHYEV-UHFFFAOYSA-N 2-(4-bromo-2-fluoro-6-methoxyphenyl)ethanamine Chemical compound COc1cc(Br)cc(F)c1CCN YLTYNHVNGYHYEV-UHFFFAOYSA-N 0.000 description 1
- ZEVSDILNYWGVMN-UHFFFAOYSA-N 2-(4-bromo-2-hydroxyphenyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1=CC=C(Br)C=C1O ZEVSDILNYWGVMN-UHFFFAOYSA-N 0.000 description 1
- IEXWTEFGTUYYIA-UHFFFAOYSA-N 2-(4-bromo-2-propoxyphenyl)ethanamine Chemical compound BrC1=CC(=C(C=C1)CCN)OCCC IEXWTEFGTUYYIA-UHFFFAOYSA-N 0.000 description 1
- JOSYSKGRRCDRRU-UHFFFAOYSA-N 2-(4-chloro-2-fluoro-6-methoxyphenyl)ethanamine Chemical compound ClC1=CC(=C(C(=C1)OC)CCN)F JOSYSKGRRCDRRU-UHFFFAOYSA-N 0.000 description 1
- KTFDYVNEGTXQCV-UHFFFAOYSA-N 2-Thiophenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CS1 KTFDYVNEGTXQCV-UHFFFAOYSA-N 0.000 description 1
- XUXRLRMSNIMFLO-UHFFFAOYSA-N 2-[2-(difluoromethoxy)-4-(trifluoromethyl)phenyl]ethanamine Chemical compound FC(OC1=C(C=CC(=C1)C(F)(F)F)CCN)F XUXRLRMSNIMFLO-UHFFFAOYSA-N 0.000 description 1
- NCMGEOOGUPLECH-UHFFFAOYSA-N 2-[2-ethoxy-4-(trifluoromethyl)phenyl]ethanamine Chemical compound C(C)OC1=C(C=CC(=C1)C(F)(F)F)CCN NCMGEOOGUPLECH-UHFFFAOYSA-N 0.000 description 1
- UJWUOHDTZMZEHM-UHFFFAOYSA-N 2-[2-fluoro-6-methoxy-4-(trifluoromethyl)phenyl]ethanamine Chemical compound FC1=C(C(=CC(=C1)C(F)(F)F)OC)CCN UJWUOHDTZMZEHM-UHFFFAOYSA-N 0.000 description 1
- ZTMXZECFYNWNTH-UHFFFAOYSA-N 2-[4-(difluoromethoxy)-2-methoxyphenyl]ethanamine Chemical compound FC(OC1=CC(=C(C=C1)CCN)OC)F ZTMXZECFYNWNTH-UHFFFAOYSA-N 0.000 description 1
- RSRWISRPKFEKSH-UHFFFAOYSA-N 2-[4-(difluoromethyl)-2-methoxy-5-methylphenyl]ethanamine Chemical compound FC(C1=CC(=C(C=C1C)CCN)OC)F RSRWISRPKFEKSH-UHFFFAOYSA-N 0.000 description 1
- TWKVSGPYKBUZLV-UHFFFAOYSA-N 2-[4-(difluoromethyl)-2-methoxy-5-methylphenyl]ethylcarbamic acid Chemical compound COc1cc(C(F)F)c(C)cc1CCNC(O)=O TWKVSGPYKBUZLV-UHFFFAOYSA-N 0.000 description 1
- TVQSFTDJOKWLLW-UHFFFAOYSA-N 2-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-1H-indole-4-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C=1NC=2C=CC=C(C=2C=1)C(=O)O)F TVQSFTDJOKWLLW-UHFFFAOYSA-N 0.000 description 1
- LIHKEMBLOBMQPT-UHFFFAOYSA-N 2-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-1H-indole-5-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C=1NC2=CC=C(C=C2C=1)C(=O)O)F LIHKEMBLOBMQPT-UHFFFAOYSA-N 0.000 description 1
- HAWZEUNUSROMGU-UHFFFAOYSA-N 2-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-1H-indole-6-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C=1NC2=CC(=CC=C2C=1)C(=O)O)F HAWZEUNUSROMGU-UHFFFAOYSA-N 0.000 description 1
- QXPIKRPIGDPKJD-UHFFFAOYSA-N 2-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-1H-indole-7-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C=1NC2=C(C=CC=C2C=1)C(=O)O)F QXPIKRPIGDPKJD-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- BVAAYGAFEBJYRW-UHFFFAOYSA-N 2-bromo-5-chloro-n-methylaniline;hydrochloride Chemical compound Cl.CNC1=CC(Cl)=CC=C1Br BVAAYGAFEBJYRW-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 1
- LNJMHEJAYSYZKK-UHFFFAOYSA-N 2-methylpyrimidine Chemical class CC1=NC=CC=N1 LNJMHEJAYSYZKK-UHFFFAOYSA-N 0.000 description 1
- GUGQQGROXHPINL-UHFFFAOYSA-N 2-oxobutanoyl chloride Chemical compound CCC(=O)C(Cl)=O GUGQQGROXHPINL-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- NDMPLJNOPCLANR-UHFFFAOYSA-N 3,4-dihydroxy-15-(4-hydroxy-18-methoxycarbonyl-5,18-seco-ibogamin-18-yl)-16-methoxy-1-methyl-6,7-didehydro-aspidospermidine-3-carboxylic acid methyl ester Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 NDMPLJNOPCLANR-UHFFFAOYSA-N 0.000 description 1
- OGTLOZRGFHYKIF-UHFFFAOYSA-N 3-(4-bromo-2-ethoxyphenoxy)propanoic acid Chemical compound CCOC1=CC(Br)=CC=C1OCCC(O)=O OGTLOZRGFHYKIF-UHFFFAOYSA-N 0.000 description 1
- INJVJPDDSBYUMW-UHFFFAOYSA-N 3-(4-bromophenyl)-2h-1,2,4-oxadiazol-5-one Chemical compound C1=CC(Br)=CC=C1C1=NOC(=O)N1 INJVJPDDSBYUMW-UHFFFAOYSA-N 0.000 description 1
- CORHGUPIEQAJDV-UHFFFAOYSA-N 3-(trifluoromethyl)thiophene Chemical compound FC(F)(F)C=1C=CSC=1 CORHGUPIEQAJDV-UHFFFAOYSA-N 0.000 description 1
- RORUTVAAZYUSSQ-UHFFFAOYSA-N 3-(trifluoromethyl)thiophene-2-carboxylic acid Chemical compound OC(=O)C=1SC=CC=1C(F)(F)F RORUTVAAZYUSSQ-UHFFFAOYSA-N 0.000 description 1
- JPXOSDMVQPFDDI-UHFFFAOYSA-N 3-[4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]phenyl]-4-hydroxycyclobut-3-ene-1,2-dione Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC=C(C=C1)C=1C(C(C=1O)=O)=O)F JPXOSDMVQPFDDI-UHFFFAOYSA-N 0.000 description 1
- CSIJNBMZUQEEEC-UHFFFAOYSA-N 3-[5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]-2H-1,2,4-oxadiazole-5-thione Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=S)OCC)F CSIJNBMZUQEEEC-UHFFFAOYSA-N 0.000 description 1
- PZLNFGAPGTVAOH-UHFFFAOYSA-N 3-[5-[6-[2-(4-bromophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]-2H-1,2,4-oxadiazole-5-thione Chemical compound BrC1=CC=C(C=C1)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C1=NOC(N1)=S)OCC PZLNFGAPGTVAOH-UHFFFAOYSA-N 0.000 description 1
- USEXQPWLCGBYNT-UHFFFAOYSA-N 3-bromo-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC(Br)=C1 USEXQPWLCGBYNT-UHFFFAOYSA-N 0.000 description 1
- QEYMMOKECZBKAC-UHFFFAOYSA-N 3-chloropropanoic acid Chemical compound OC(=O)CCCl QEYMMOKECZBKAC-UHFFFAOYSA-N 0.000 description 1
- QKTAIZOOEIUNRG-UHFFFAOYSA-N 3-ethoxy-5-[6-[2-[4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound C(C)OC1=C(SC(=C1)C1=NC=NC(=C1)NCCC1=CC=C(C=C1)C(F)(F)F)C(=O)O QKTAIZOOEIUNRG-UHFFFAOYSA-N 0.000 description 1
- BSMFSESXBONEOI-UHFFFAOYSA-N 3-ethylthiophene-2-carboxylic acid Chemical compound CCC=1C=CSC=1C(O)=O BSMFSESXBONEOI-UHFFFAOYSA-N 0.000 description 1
- ROADCYAOHVSOLQ-UHFFFAOYSA-N 3-oxetanone Chemical compound O=C1COC1 ROADCYAOHVSOLQ-UHFFFAOYSA-N 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 1
- KCHQXPGUJBVNTN-UHFFFAOYSA-N 4,4-diphenylbut-3-en-2-one Chemical compound C=1C=CC=CC=1C(=CC(=O)C)C1=CC=CC=C1 KCHQXPGUJBVNTN-UHFFFAOYSA-N 0.000 description 1
- 125000000972 4,5-dimethylthiazol-2-yl group Chemical group [H]C([H])([H])C1=C(N=C(*)S1)C([H])([H])[H] 0.000 description 1
- LBVUFZJYMWUZIW-UHFFFAOYSA-N 4,6-diiodopyrimidine Chemical compound IC1=CC(I)=NC=N1 LBVUFZJYMWUZIW-UHFFFAOYSA-N 0.000 description 1
- CLPFFLWZZBQMAO-UHFFFAOYSA-N 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)benzonitrile Chemical compound C1=CC(C#N)=CC=C1C1N2C=NC=C2CCC1 CLPFFLWZZBQMAO-UHFFFAOYSA-N 0.000 description 1
- FHBLJHRVHHAUMX-UHFFFAOYSA-N 4-[6-[2-(2,6-difluoro-4-methoxyphenyl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid Chemical compound FC1=C(C(=CC(=C1)OC)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)SC FHBLJHRVHHAUMX-UHFFFAOYSA-N 0.000 description 1
- INWMQYJLDUVXRH-UHFFFAOYSA-N 4-[6-[2-(2-methoxy-4,5-dimethylphenyl)ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid Chemical compound COC1=C(C=C(C(=C1)C)C)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)SC INWMQYJLDUVXRH-UHFFFAOYSA-N 0.000 description 1
- XRTMZLUVZPGQIB-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-(2-methylpropoxy)benzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OCC(C)C)F XRTMZLUVZPGQIB-UHFFFAOYSA-N 0.000 description 1
- KHLXRYKEUGYJQN-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-(difluoromethoxy)benzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)OC(F)F)F KHLXRYKEUGYJQN-UHFFFAOYSA-N 0.000 description 1
- KTHCIYPQQCVUQM-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-(ethylamino)benzamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)N)C=C1)NCC)F KTHCIYPQQCVUQM-UHFFFAOYSA-N 0.000 description 1
- SSOUAPYCJJWLIU-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-(methylamino)benzoic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)NC)F SSOUAPYCJJWLIU-UHFFFAOYSA-N 0.000 description 1
- CBVYJPKPWLJAJE-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)N)C=C1)OCC)F CBVYJPKPWLJAJE-UHFFFAOYSA-N 0.000 description 1
- FIZGSUARYNCKNT-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-propylbenzamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)N)C=C1)CCC)F FIZGSUARYNCKNT-UHFFFAOYSA-N 0.000 description 1
- VWDZJBJRMFUFGN-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-N-(2-hydroxy-2-methylpropyl)-2-propylbenzamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)NCC(C)(C)O)C=C1)CCC)F VWDZJBJRMFUFGN-UHFFFAOYSA-N 0.000 description 1
- KDEJKRDUXRZIJT-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-N-(2-hydroxyethyl)-2-(methylamino)benzamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)NCCO)C=C1)NC)F KDEJKRDUXRZIJT-UHFFFAOYSA-N 0.000 description 1
- JXUORTYYXUQRIA-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-N-(2-hydroxyethyl)-2-propylbenzamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)NCCO)C=C1)CCC)F JXUORTYYXUQRIA-UHFFFAOYSA-N 0.000 description 1
- XSSAWNUPAGUDKO-UHFFFAOYSA-N 4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-N-(2-methoxyethyl)-2-(methylamino)benzamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)NCCOC)C=C1)NC)F XSSAWNUPAGUDKO-UHFFFAOYSA-N 0.000 description 1
- VQNWBGFHRJDKLL-UHFFFAOYSA-N 4-[6-[2-[2-ethoxy-4-(trifluoromethyl)phenyl]ethylamino]pyrimidin-4-yl]-2-methylsulfanylbenzoic acid Chemical compound C(C)OC1=C(C=CC(=C1)C(F)(F)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=O)O)C=C1)SC VQNWBGFHRJDKLL-UHFFFAOYSA-N 0.000 description 1
- IRHPJGPQWZEZRX-UHFFFAOYSA-N 4-bromo-2,6-difluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=C(Br)C=C1F IRHPJGPQWZEZRX-UHFFFAOYSA-N 0.000 description 1
- BWZLXDPXWIKMBI-UHFFFAOYSA-N 4-bromo-2-(difluoromethoxy)benzoic acid Chemical compound OC(=O)C1=CC=C(Br)C=C1OC(F)F BWZLXDPXWIKMBI-UHFFFAOYSA-N 0.000 description 1
- RCLVJRISTAVSBL-UHFFFAOYSA-N 4-bromo-2-ethoxybenzaldehyde Chemical compound CCOC1=CC(Br)=CC=C1C=O RCLVJRISTAVSBL-UHFFFAOYSA-N 0.000 description 1
- TWHBNRXZMJJLJO-UHFFFAOYSA-N 4-bromo-2-fluoro-5-methoxybenzaldehyde Chemical compound COC1=CC(C=O)=C(F)C=C1Br TWHBNRXZMJJLJO-UHFFFAOYSA-N 0.000 description 1
- UYDAONQHEUSARR-UHFFFAOYSA-N 4-bromo-2-fluoro-6-propylbenzoic acid Chemical compound BrC1=CC(=C(C(=O)O)C(=C1)CCC)F UYDAONQHEUSARR-UHFFFAOYSA-N 0.000 description 1
- UZYDWJLYGWIVCE-UHFFFAOYSA-N 4-bromo-2-propoxybenzaldehyde Chemical compound CCCOC1=CC(Br)=CC=C1C=O UZYDWJLYGWIVCE-UHFFFAOYSA-N 0.000 description 1
- JSWHARUAJCATOJ-UHFFFAOYSA-N 4-bromo-3-fluoro-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C(F)=C1O JSWHARUAJCATOJ-UHFFFAOYSA-N 0.000 description 1
- VKJXAQYPOTYDLO-UHFFFAOYSA-N 4-methylphenethylamine Chemical compound CC1=CC=C(CCN)C=C1 VKJXAQYPOTYDLO-UHFFFAOYSA-N 0.000 description 1
- RXSFZYSNXZGVCU-UHFFFAOYSA-N 4h-oxadiazole-5-thione Chemical compound S=C1CN=NO1 RXSFZYSNXZGVCU-UHFFFAOYSA-N 0.000 description 1
- ZCHNCEWRBASKAC-UHFFFAOYSA-N 5-[5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophen-2-yl]-3H-1,3,4-oxadiazol-2-one Chemical compound CCOc1cc(sc1-c1n[nH]c(=O)o1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 ZCHNCEWRBASKAC-UHFFFAOYSA-N 0.000 description 1
- JFPFJIXOGLXHKY-UHFFFAOYSA-N 5-[6-[2-(2,5-dimethoxyphenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound COC1=C(C=C(C=C1)OC)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC JFPFJIXOGLXHKY-UHFFFAOYSA-N 0.000 description 1
- ZXIRGMLTPADHDI-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)N)OCC)F ZXIRGMLTPADHDI-UHFFFAOYSA-N 0.000 description 1
- BAHVLNJPLKUOPF-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3-ethylthiophene-2-carboxamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)N)CC)F BAHVLNJPLKUOPF-UHFFFAOYSA-N 0.000 description 1
- AAVWUFLDHFHJNK-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-4-chloro-3-ethoxythiophene-2-carboxamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=C(C(=C(S1)C(=O)N)OCC)Cl)F AAVWUFLDHFHJNK-UHFFFAOYSA-N 0.000 description 1
- QTNAHNNPBJJIOD-UHFFFAOYSA-N 5-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]thiophene-2-carboxylic acid Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC=C(S1)C(=O)O)F QTNAHNNPBJJIOD-UHFFFAOYSA-N 0.000 description 1
- NCVJZIZJGHUHLY-UHFFFAOYSA-N 5-[6-[2-[4-(difluoromethyl)-5-fluoro-2-methoxyphenyl]ethylamino]pyrimidin-4-yl]-3-ethoxythiophene-2-carboxylic acid Chemical compound FC(C1=CC(=C(C=C1F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)C(=O)O)OCC)OC)F NCVJZIZJGHUHLY-UHFFFAOYSA-N 0.000 description 1
- BXBYTCWXAGPUMN-UHFFFAOYSA-N 6-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-3H-1,3-benzoxazol-2-one Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC2=C(NC(O2)=O)C=C1)F BXBYTCWXAGPUMN-UHFFFAOYSA-N 0.000 description 1
- MLWQMAKMGKSOEK-UHFFFAOYSA-N 6-chloro-N-[2-(2,6-difluoro-4-methoxyphenyl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C=C1F)OC)F MLWQMAKMGKSOEK-UHFFFAOYSA-N 0.000 description 1
- HCWHZMLOLFFIMR-UHFFFAOYSA-N 6-chloro-N-[2-(2-fluoro-6-methoxyphenyl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=CC=C1OC)F HCWHZMLOLFFIMR-UHFFFAOYSA-N 0.000 description 1
- UHQVHFMAOSGEBI-UHFFFAOYSA-N 6-chloro-N-[2-(2-methoxy-4,6-dimethylphenyl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C=C1C)C)OC UHQVHFMAOSGEBI-UHFFFAOYSA-N 0.000 description 1
- HZKFZVOOKCTDDJ-UHFFFAOYSA-N 6-chloro-N-[2-(3,4-dichloro-2-methylphenyl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C(=C(C=C1)Cl)Cl)C HZKFZVOOKCTDDJ-UHFFFAOYSA-N 0.000 description 1
- RVTQUCZJZOCYES-UHFFFAOYSA-N 6-chloro-N-[2-(4,5-difluoro-2-methoxyphenyl)ethyl]pyrimidin-4-amine Chemical compound COC1=C(CCNC2=CC(Cl)=NC=N2)C=C(F)C(F)=C1 RVTQUCZJZOCYES-UHFFFAOYSA-N 0.000 description 1
- CVJZAUORJXRRBP-UHFFFAOYSA-N 6-chloro-N-[2-(4-methylphenyl)ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=CC=C(C=C1)C CVJZAUORJXRRBP-UHFFFAOYSA-N 0.000 description 1
- KDTCPADIZNJANQ-UHFFFAOYSA-N 6-chloro-N-[2-[2-(difluoromethoxy)-4-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C=C1)C(F)(F)F)OC(F)F KDTCPADIZNJANQ-UHFFFAOYSA-N 0.000 description 1
- QKBZBMJITAEPME-UHFFFAOYSA-N 6-chloro-N-[2-[2-ethoxy-4-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C=C1)C(F)(F)F)OCC QKBZBMJITAEPME-UHFFFAOYSA-N 0.000 description 1
- PVXWBSCXTISUHP-UHFFFAOYSA-N 6-chloro-N-[2-[2-fluoro-6-methoxy-4-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C=C1OC)C(F)(F)F)F PVXWBSCXTISUHP-UHFFFAOYSA-N 0.000 description 1
- KHXCKIXMBIFMOR-UHFFFAOYSA-N 6-chloro-N-[2-[2-methoxy-4-(trifluoromethoxy)phenyl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C=C1)OC(F)(F)F)OC KHXCKIXMBIFMOR-UHFFFAOYSA-N 0.000 description 1
- YHIZUYXDCLQDGB-UHFFFAOYSA-N 6-chloro-N-[2-[2-methoxy-4-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C=C1)C(F)(F)F)OC YHIZUYXDCLQDGB-UHFFFAOYSA-N 0.000 description 1
- AWSKAMFXDDDSJE-UHFFFAOYSA-N 6-chloro-N-[2-[4-(difluoromethoxy)-2-methoxyphenyl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C=C1)OC(F)F)OC AWSKAMFXDDDSJE-UHFFFAOYSA-N 0.000 description 1
- YLMAOYDRFFXASY-UHFFFAOYSA-N 6-chloro-N-[2-[4-(difluoromethyl)-2-methoxy-5-methylphenyl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C(=C1)C)C(F)F)OC YLMAOYDRFFXASY-UHFFFAOYSA-N 0.000 description 1
- AHDPMJZZYYRNEB-UHFFFAOYSA-N 6-chloro-N-[2-[4-(difluoromethyl)-5-fluoro-2-methoxyphenyl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C(=C1)F)C(F)F)OC AHDPMJZZYYRNEB-UHFFFAOYSA-N 0.000 description 1
- HVKNDFNHZGLZOU-UHFFFAOYSA-N 6-chloro-N-[2-[5-chloro-2-methoxy-4-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine Chemical compound ClC1=CC(=NC=N1)NCCC1=C(C=C(C(=C1)Cl)C(F)(F)F)OC HVKNDFNHZGLZOU-UHFFFAOYSA-N 0.000 description 1
- 125000006164 6-membered heteroaryl group Chemical group 0.000 description 1
- VVIAGPKUTFNRDU-UHFFFAOYSA-N 6S-folinic acid Natural products C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-UHFFFAOYSA-N 0.000 description 1
- KURQKNMKCGYWRJ-HNNXBMFYSA-N 7-(5-methylfuran-2-yl)-3-[[6-[[(3s)-oxolan-3-yl]oxymethyl]pyridin-2-yl]methyl]triazolo[4,5-d]pyrimidin-5-amine Chemical compound O1C(C)=CC=C1C1=NC(N)=NC2=C1N=NN2CC1=CC=CC(CO[C@@H]2COCC2)=N1 KURQKNMKCGYWRJ-HNNXBMFYSA-N 0.000 description 1
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 1
- 230000035502 ADME Effects 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229940123702 Adenosine A2a receptor antagonist Drugs 0.000 description 1
- 108700023418 Amidases Proteins 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 1
- 208000037260 Atherosclerotic Plaque Diseases 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 229910015845 BBr3 Inorganic materials 0.000 description 1
- 229940125565 BMS-986016 Drugs 0.000 description 1
- 108010006654 Bleomycin Proteins 0.000 description 1
- OPHDKQGJKFWZRC-UHFFFAOYSA-N BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=C1)C)O)C)F Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C(=C1)C)O)C)F OPHDKQGJKFWZRC-UHFFFAOYSA-N 0.000 description 1
- MDHNNWZASFJVPW-UHFFFAOYSA-N BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)N1N=NNC1=O)OCC)F Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(S1)N1N=NNC1=O)OCC)F MDHNNWZASFJVPW-UHFFFAOYSA-N 0.000 description 1
- RXZZHDXCEXWDRV-UHFFFAOYSA-N BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC=C(C=C1)C1=NOC(N1)=O)F Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC=C(C=C1)C1=NOC(N1)=O)F RXZZHDXCEXWDRV-UHFFFAOYSA-N 0.000 description 1
- QLHHHCRJKWXQHB-UHFFFAOYSA-N BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC=C(S1)C1=NOC(N1)=O)F Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC=C(S1)C1=NOC(N1)=O)F QLHHHCRJKWXQHB-UHFFFAOYSA-N 0.000 description 1
- SFRWWGUBXVPROW-UHFFFAOYSA-N BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C=1C=C(N(C=1)CC)C1=NOC(N1)=O)F Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C=1C=C(N(C=1)CC)C1=NOC(N1)=O)F SFRWWGUBXVPROW-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- XIRLDOWCKRWHJZ-UHFFFAOYSA-N CC1=C(C=CC(=C1)C2=CC(=NC=N2)NCCC3=C(C=C(C=C3)OC(F)F)OC)C(=O)S Chemical compound CC1=C(C=CC(=C1)C2=CC(=NC=N2)NCCC3=C(C=C(C=C3)OC(F)F)OC)C(=O)S XIRLDOWCKRWHJZ-UHFFFAOYSA-N 0.000 description 1
- IXVZDWLSFUNVCG-UHFFFAOYSA-N CCNc1cc(Br)ccc1C(O)=O Chemical compound CCNc1cc(Br)ccc1C(O)=O IXVZDWLSFUNVCG-UHFFFAOYSA-N 0.000 description 1
- TYPROPXGGIXTSL-UHFFFAOYSA-N CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)cc2)nc(C)n1 Chemical compound CCOc1cc(sc1-c1nc(=O)o[nH]1)-c1cc(NCCc2ccc(Br)cc2)nc(C)n1 TYPROPXGGIXTSL-UHFFFAOYSA-N 0.000 description 1
- RWUPRZQQZXWYSU-UHFFFAOYSA-N CNc1cc(ccc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 Chemical compound CNc1cc(ccc1-c1nc(=O)o[nH]1)-c1cc(NCCc2c(F)cc(Br)cc2F)ncn1 RWUPRZQQZXWYSU-UHFFFAOYSA-N 0.000 description 1
- 101100180402 Caenorhabditis elegans jun-1 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 108010071942 Colony-Stimulating Factors Proteins 0.000 description 1
- 102000008130 Cyclic AMP-Dependent Protein Kinases Human genes 0.000 description 1
- 108010049894 Cyclic AMP-Dependent Protein Kinases Proteins 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 1
- 102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 1
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 1
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 1
- 230000033616 DNA repair Effects 0.000 description 1
- 108010092160 Dactinomycin Proteins 0.000 description 1
- 108700022150 Designed Ankyrin Repeat Proteins Proteins 0.000 description 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 1
- 206010061818 Disease progression Diseases 0.000 description 1
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- 108060002716 Exonuclease Proteins 0.000 description 1
- 208000009386 Experimental Arthritis Diseases 0.000 description 1
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 1
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 1
- HPXQJMXAUHXUJB-UHFFFAOYSA-N Fc1cc(Br)cc(F)c1CCNc1cc(ncn1)-c1ccc(nc1)-c1nc(=O)o[nH]1 Chemical compound Fc1cc(Br)cc(F)c1CCNc1cc(ncn1)-c1ccc(nc1)-c1nc(=O)o[nH]1 HPXQJMXAUHXUJB-UHFFFAOYSA-N 0.000 description 1
- DEZZLWQELQORIU-RELWKKBWSA-N GDC-0879 Chemical compound N=1N(CCO)C=C(C=2C=C3CCC(/C3=CC=2)=N\O)C=1C1=CC=NC=C1 DEZZLWQELQORIU-RELWKKBWSA-N 0.000 description 1
- 229940032072 GVAX vaccine Drugs 0.000 description 1
- 208000034826 Genetic Predisposition to Disease Diseases 0.000 description 1
- 208000032612 Glial tumor Diseases 0.000 description 1
- 238000006842 Henry reaction Methods 0.000 description 1
- 102100034458 Hepatitis A virus cellular receptor 2 Human genes 0.000 description 1
- 101710083479 Hepatitis A virus cellular receptor 2 homolog Proteins 0.000 description 1
- 101000919849 Homo sapiens Cytochrome c oxidase subunit 1 Proteins 0.000 description 1
- 101000946889 Homo sapiens Monocyte differentiation antigen CD14 Proteins 0.000 description 1
- 101001117317 Homo sapiens Programmed cell death 1 ligand 1 Proteins 0.000 description 1
- 101001073427 Homo sapiens Prostaglandin E2 receptor EP1 subtype Proteins 0.000 description 1
- 101000605122 Homo sapiens Prostaglandin G/H synthase 1 Proteins 0.000 description 1
- 101000831007 Homo sapiens T-cell immunoreceptor with Ig and ITIM domains Proteins 0.000 description 1
- 101000712674 Homo sapiens TGF-beta receptor type-1 Proteins 0.000 description 1
- 101000801234 Homo sapiens Tumor necrosis factor receptor superfamily member 18 Proteins 0.000 description 1
- 101001052849 Homo sapiens Tyrosine-protein kinase Fer Proteins 0.000 description 1
- 208000004454 Hyperalgesia Diseases 0.000 description 1
- 208000035154 Hyperesthesia Diseases 0.000 description 1
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 1
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- 108010021625 Immunoglobulin Fragments Proteins 0.000 description 1
- 102000008394 Immunoglobulin Fragments Human genes 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 102000006992 Interferon-alpha Human genes 0.000 description 1
- 108010047761 Interferon-alpha Proteins 0.000 description 1
- 102000003812 Interleukin-15 Human genes 0.000 description 1
- 108090000172 Interleukin-15 Proteins 0.000 description 1
- 208000007766 Kaposi sarcoma Diseases 0.000 description 1
- 239000005411 L01XE02 - Gefitinib Substances 0.000 description 1
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 1
- 239000002136 L01XE07 - Lapatinib Substances 0.000 description 1
- 102000017578 LAG3 Human genes 0.000 description 1
- 101150030213 Lag3 gene Proteins 0.000 description 1
- GQYIWUVLTXOXAJ-UHFFFAOYSA-N Lomustine Chemical compound ClCCN(N=O)C(=O)NC1CCCCC1 GQYIWUVLTXOXAJ-UHFFFAOYSA-N 0.000 description 1
- 229910017741 MH2O Inorganic materials 0.000 description 1
- 241000282553 Macaca Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000276489 Merlangius merlangus Species 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- PGBFYLVIMDQYMS-UHFFFAOYSA-N Methyl thiophene-2-carboxylate Chemical compound COC(=O)C1=CC=CS1 PGBFYLVIMDQYMS-UHFFFAOYSA-N 0.000 description 1
- 102000004232 Mitogen-Activated Protein Kinase Kinases Human genes 0.000 description 1
- 108090000744 Mitogen-Activated Protein Kinase Kinases Proteins 0.000 description 1
- 102100024193 Mitogen-activated protein kinase 1 Human genes 0.000 description 1
- 238000003461 Miyaura Borylation reaction Methods 0.000 description 1
- 102100035877 Monocyte differentiation antigen CD14 Human genes 0.000 description 1
- 241000699660 Mus musculus Species 0.000 description 1
- 101100335081 Mus musculus Flt3 gene Proteins 0.000 description 1
- FBKMWOJEPMPVTQ-UHFFFAOYSA-N N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide Chemical compound NS(=O)(=O)NCCNC1=NON=C1C(=NO)NC1=CC=C(F)C(Br)=C1 FBKMWOJEPMPVTQ-UHFFFAOYSA-N 0.000 description 1
- HYLBNYBBPNMIJC-UHFFFAOYSA-N N(=[N+]=[N-])CC(=O)C=1SC=CC1OCC Chemical compound N(=[N+]=[N-])CC(=O)C=1SC=CC1OCC HYLBNYBBPNMIJC-UHFFFAOYSA-N 0.000 description 1
- VWGZMQDHXRVCBP-UHFFFAOYSA-N N-(4-bromo-2-ethoxyphenyl)formamide Chemical compound BrC1=CC(=C(C=C1)NC=O)OCC VWGZMQDHXRVCBP-UHFFFAOYSA-N 0.000 description 1
- CMLIIHWSFMAKCX-UHFFFAOYSA-N N-[2-(4-bromo-2,6-difluorophenyl)ethyl]-6-(1H-indazol-5-yl)pyrimidin-4-amine Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=NC=NC(=C1)C=1C=C2C=NNC2=CC=1)F CMLIIHWSFMAKCX-UHFFFAOYSA-N 0.000 description 1
- RPTAQMGXJNTSJJ-UHFFFAOYSA-N N-[2-(4-bromo-2,6-difluorophenyl)ethyl]-6-(1H-indol-5-yl)pyrimidin-4-amine Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=NC=NC(=C1)C=1C=C2C=CNC2=CC=1)F RPTAQMGXJNTSJJ-UHFFFAOYSA-N 0.000 description 1
- AJPHPMUBFJDTTO-UHFFFAOYSA-N N-[2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]formamide Chemical compound C(C)OC1=C(C=CC(=C1)B1OC(C(O1)(C)C)(C)C)NC=O AJPHPMUBFJDTTO-UHFFFAOYSA-N 0.000 description 1
- KCKPNESPBIMRCH-UHFFFAOYSA-N N-[4-[6-[2-(4-bromo-2,6-difluorophenyl)ethylamino]pyrimidin-4-yl]-2-ethoxyphenyl]formamide Chemical compound BrC1=CC(=C(C(=C1)F)CCNC1=CC(=NC=N1)C1=CC(=C(C=C1)NC=O)OCC)F KCKPNESPBIMRCH-UHFFFAOYSA-N 0.000 description 1
- 208000003788 Neoplasm Micrometastasis Diseases 0.000 description 1
- 208000036110 Neuroinflammatory disease Diseases 0.000 description 1
- 206010029350 Neurotoxicity Diseases 0.000 description 1
- 206010061534 Oesophageal squamous cell carcinoma Diseases 0.000 description 1
- 208000001132 Osteoporosis Diseases 0.000 description 1
- YZDJQTHVDDOVHR-UHFFFAOYSA-N PLX-4720 Chemical compound CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C=2C3=CC(Cl)=CN=C3NC=2)=C1F YZDJQTHVDDOVHR-UHFFFAOYSA-N 0.000 description 1
- QPFYXYFORQJZEC-FOCLMDBBSA-N Phenazopyridine Chemical compound NC1=NC(N)=CC=C1\N=N\C1=CC=CC=C1 QPFYXYFORQJZEC-FOCLMDBBSA-N 0.000 description 1
- 102000001105 Phosphofructokinases Human genes 0.000 description 1
- 108010069341 Phosphofructokinases Proteins 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100024216 Programmed cell death 1 ligand 1 Human genes 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 108050000258 Prostaglandin D receptors Proteins 0.000 description 1
- 102100024212 Prostaglandin D2 receptor Human genes 0.000 description 1
- 102100035842 Prostaglandin E2 receptor EP1 subtype Human genes 0.000 description 1
- 101710115969 Prostaglandin E2 receptor EP2 subtype Proteins 0.000 description 1
- 101710195838 Prostaglandin E2 receptor EP4 subtype Proteins 0.000 description 1
- 102100038277 Prostaglandin G/H synthase 1 Human genes 0.000 description 1
- 108050003267 Prostaglandin G/H synthase 2 Proteins 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 208000000453 Skin Neoplasms Diseases 0.000 description 1
- 208000000102 Squamous Cell Carcinoma of Head and Neck Diseases 0.000 description 1
- 208000036765 Squamous cell carcinoma of the esophagus Diseases 0.000 description 1
- 108091008035 T cell costimulatory receptors Proteins 0.000 description 1
- 102100024834 T-cell immunoreceptor with Ig and ITIM domains Human genes 0.000 description 1
- 102100033456 TGF-beta receptor type-1 Human genes 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 1
- AVRWEULSKHQETA-UHFFFAOYSA-N Thiophene-2 Chemical compound S1C=2CCCCCC=2C(C(=O)OC)=C1NC(=O)C1=C(F)C(F)=C(F)C(F)=C1F AVRWEULSKHQETA-UHFFFAOYSA-N 0.000 description 1
- FOCVUCIESVLUNU-UHFFFAOYSA-N Thiotepa Chemical compound C1CN1P(N1CC1)(=S)N1CC1 FOCVUCIESVLUNU-UHFFFAOYSA-N 0.000 description 1
- 201000009365 Thymic carcinoma Diseases 0.000 description 1
- 208000033781 Thyroid carcinoma Diseases 0.000 description 1
- 206010044221 Toxic encephalopathy Diseases 0.000 description 1
- 102100033728 Tumor necrosis factor receptor superfamily member 18 Human genes 0.000 description 1
- 101710165473 Tumor necrosis factor receptor superfamily member 4 Proteins 0.000 description 1
- 102100024537 Tyrosine-protein kinase Fer Human genes 0.000 description 1
- 240000001717 Vaccinium macrocarpon Species 0.000 description 1
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 1
- OPGTXAUDXWCGFI-UHFFFAOYSA-N [1-[[6-[[3-(3-dodecanoyloxytetradecanoylamino)-6-(hydroxymethyl)-5-phosphonooxy-4-(3-tetradecanoyloxytetradecanoyloxy)oxan-2-yl]oxymethyl]-2,4,5-trihydroxyoxan-3-yl]amino]-1-oxotetradecan-3-yl] hexadecanoate Chemical compound OC1C(O)C(NC(=O)CC(CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(O)OC1COC1C(NC(=O)CC(CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)C(OC(=O)CC(CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC)C(OP(O)(O)=O)C(CO)O1 OPGTXAUDXWCGFI-UHFFFAOYSA-N 0.000 description 1
- JFYOIWRDTYVTEL-UHFFFAOYSA-N [K].C(N)(OC(C)(C)C)=O Chemical compound [K].C(N)(OC(C)(C)C)=O JFYOIWRDTYVTEL-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- YBCVMFKXIKNREZ-UHFFFAOYSA-N acoh acetic acid Chemical compound CC(O)=O.CC(O)=O YBCVMFKXIKNREZ-UHFFFAOYSA-N 0.000 description 1
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000002467 adenosine A2a receptor antagonist Substances 0.000 description 1
- ULXXDDBFHOBEHA-CWDCEQMOSA-N afatinib Chemical compound N1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC1=CC=C(F)C(Cl)=C1 ULXXDDBFHOBEHA-CWDCEQMOSA-N 0.000 description 1
- 229960001686 afatinib Drugs 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000000735 allogeneic effect Effects 0.000 description 1
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 1
- 229960000473 altretamine Drugs 0.000 description 1
- 102000005922 amidase Human genes 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229960002932 anastrozole Drugs 0.000 description 1
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 description 1
- 239000002870 angiogenesis inducing agent Substances 0.000 description 1
- 229940121369 angiogenesis inhibitor Drugs 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000000781 anti-lymphocytic effect Effects 0.000 description 1
- 230000000340 anti-metabolite Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940100197 antimetabolite Drugs 0.000 description 1
- 239000002256 antimetabolite Substances 0.000 description 1
- 230000001640 apoptogenic effect Effects 0.000 description 1
- 238000003782 apoptosis assay Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000008209 arabinosides Chemical class 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 229960003852 atezolizumab Drugs 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- 230000003190 augmentative effect Effects 0.000 description 1
- 229940120638 avastin Drugs 0.000 description 1
- 229950002916 avelumab Drugs 0.000 description 1
- 229960003005 axitinib Drugs 0.000 description 1
- RITAVMQDGBJQJZ-FMIVXFBMSA-N axitinib Chemical compound CNC(=O)C1=CC=CC=C1SC1=CC=C(C(\C=C\C=2N=CC=CC=2)=NN2)C2=C1 RITAVMQDGBJQJZ-FMIVXFBMSA-N 0.000 description 1
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
- 229950003054 binimetinib Drugs 0.000 description 1
- 230000000975 bioactive effect Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 229960001561 bleomycin Drugs 0.000 description 1
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
- 229960003008 blinatumomab Drugs 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 238000006795 borylation reaction Methods 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 229950010831 cabiralizumab Drugs 0.000 description 1
- 230000009702 cancer cell proliferation Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 210000000845 cartilage Anatomy 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229960000590 celecoxib Drugs 0.000 description 1
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000007541 cellular toxicity Effects 0.000 description 1
- 229960005395 cetuximab Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000012627 chemopreventive agent Substances 0.000 description 1
- 229940124443 chemopreventive agent Drugs 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 239000012829 chemotherapy agent Substances 0.000 description 1
- 229940044683 chemotherapy drug Drugs 0.000 description 1
- 229960004630 chlorambucil Drugs 0.000 description 1
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 1
- 210000001612 chondrocyte Anatomy 0.000 description 1
- 208000037516 chromosome inversion disease Diseases 0.000 description 1
- RESIMIUSNACMNW-BXRWSSRYSA-N cobimetinib fumarate Chemical compound OC(=O)\C=C\C(O)=O.C1C(O)([C@H]2NCCCC2)CN1C(=O)C1=CC=C(F)C(F)=C1NC1=CC=C(I)C=C1F.C1C(O)([C@H]2NCCCC2)CN1C(=O)C1=CC=C(F)C(F)=C1NC1=CC=C(I)C=C1F RESIMIUSNACMNW-BXRWSSRYSA-N 0.000 description 1
- 230000003920 cognitive function Effects 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 229940124558 contraceptive agent Drugs 0.000 description 1
- 239000003433 contraceptive agent Substances 0.000 description 1
- 101150031809 cox1/2 gene Proteins 0.000 description 1
- 235000021019 cranberries Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001352 cyclobutyloxy group Chemical group C1(CCC1)O* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 230000037416 cystogenesis Effects 0.000 description 1
- 229960000684 cytarabine Drugs 0.000 description 1
- CTMZLDSMFCVUNX-VMIOUTBZSA-N cytidylyl-(3'->5')-guanosine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@H](OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@@H](O2)N2C3=C(C(N=C(N)N3)=O)N=C2)O)[C@@H](CO)O1 CTMZLDSMFCVUNX-VMIOUTBZSA-N 0.000 description 1
- 229940127071 cytotoxic antineoplastic agent Drugs 0.000 description 1
- 238000011393 cytotoxic chemotherapy Methods 0.000 description 1
- BFSMGDJOXZAERB-UHFFFAOYSA-N dabrafenib Chemical compound S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 BFSMGDJOXZAERB-UHFFFAOYSA-N 0.000 description 1
- 229960002465 dabrafenib Drugs 0.000 description 1
- 229950007409 dacetuzumab Drugs 0.000 description 1
- 229960000640 dactinomycin Drugs 0.000 description 1
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 1
- 229960000975 daunorubicin Drugs 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 125000004431 deuterium atom Chemical group 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- LFQCJSBXBZRMTN-OAQYLSRUSA-N diflomotecan Chemical compound CC[C@@]1(O)CC(=O)OCC(C2=O)=C1C=C1N2CC2=CC3=CC(F)=C(F)C=C3N=C21 LFQCJSBXBZRMTN-OAQYLSRUSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 230000005750 disease progression Effects 0.000 description 1
- 239000003534 dna topoisomerase inhibitor Substances 0.000 description 1
- 230000003828 downregulation Effects 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 229950009791 durvalumab Drugs 0.000 description 1
- 229940121647 egfr inhibitor Drugs 0.000 description 1
- 239000012039 electrophile Substances 0.000 description 1
- KAQREZSTQZWNAG-GDLZYMKVSA-N elomotecan Chemical compound C([C@]1(O)CC)C(=O)OCC(C(N2CC3=4)=O)=C1C=C2C3=NC1=CC(Cl)=C(C)C=C1C=4CN1CCC(C)CC1 KAQREZSTQZWNAG-GDLZYMKVSA-N 0.000 description 1
- 229950003007 elomotecan Drugs 0.000 description 1
- 229950004647 emactuzumab Drugs 0.000 description 1
- 230000002357 endometrial effect Effects 0.000 description 1
- 210000004696 endometrium Anatomy 0.000 description 1
- 229950006370 epacadostat Drugs 0.000 description 1
- 229960001904 epirubicin Drugs 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 229960001123 epoprostenol Drugs 0.000 description 1
- 229960001433 erlotinib Drugs 0.000 description 1
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 1
- 208000007276 esophageal squamous cell carcinoma Diseases 0.000 description 1
- 210000003238 esophagus Anatomy 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- FRPJXPJMRWBBIH-RBRWEJTLSA-N estramustine Chemical compound ClCCN(CCCl)C(=O)OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 FRPJXPJMRWBBIH-RBRWEJTLSA-N 0.000 description 1
- 229960001842 estramustine Drugs 0.000 description 1
- OLAMWIPURJGSKE-UHFFFAOYSA-N et2o diethylether Chemical compound CCOCC.CCOCC OLAMWIPURJGSKE-UHFFFAOYSA-N 0.000 description 1
- OCLXJTCGWSSVOE-UHFFFAOYSA-N ethanol etoh Chemical compound CCO.CCO OCLXJTCGWSSVOE-UHFFFAOYSA-N 0.000 description 1
- HMRBMCCGTKRLCQ-UHFFFAOYSA-N ethyl 2-(4-bromo-2-ethoxyanilino)-2-oxoacetate Chemical compound BrC1=CC(=C(C=C1)NC(C(=O)OCC)=O)OCC HMRBMCCGTKRLCQ-UHFFFAOYSA-N 0.000 description 1
- CPEACRXZAZSRDN-UHFFFAOYSA-N ethyl 3-(trifluoromethyl)thiophene-2-carboxylate Chemical compound CCOC(=O)c1sccc1C(F)(F)F CPEACRXZAZSRDN-UHFFFAOYSA-N 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 230000017188 evasion or tolerance of host immune response Effects 0.000 description 1
- 102000013165 exonuclease Human genes 0.000 description 1
- 210000002744 extracellular matrix Anatomy 0.000 description 1
- 229950011548 fadrozole Drugs 0.000 description 1
- 229940124981 favezelimab Drugs 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 1
- 231100000502 fertility decrease Toxicity 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229960000390 fludarabine Drugs 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- 125000006005 fluoroethoxy group Chemical group 0.000 description 1
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- VVIAGPKUTFNRDU-ABLWVSNPSA-N folinic acid Chemical compound C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-ABLWVSNPSA-N 0.000 description 1
- 235000008191 folinic acid Nutrition 0.000 description 1
- 239000011672 folinic acid Substances 0.000 description 1
- 229960004421 formestane Drugs 0.000 description 1
- OSVMTWJCGUFAOD-KZQROQTASA-N formestane Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1O OSVMTWJCGUFAOD-KZQROQTASA-N 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 229960004783 fotemustine Drugs 0.000 description 1
- YAKWPXVTIGTRJH-UHFFFAOYSA-N fotemustine Chemical compound CCOP(=O)(OCC)C(C)NC(=O)N(CCCl)N=O YAKWPXVTIGTRJH-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 108020001507 fusion proteins Proteins 0.000 description 1
- 102000037865 fusion proteins Human genes 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229960002584 gefitinib Drugs 0.000 description 1
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 1
- 238000003209 gene knockout Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 239000003862 glucocorticoid Substances 0.000 description 1
- 230000034659 glycolysis Effects 0.000 description 1
- 229930182470 glycoside Natural products 0.000 description 1
- 150000002338 glycosides Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 201000000459 head and neck squamous cell carcinoma Diseases 0.000 description 1
- UUVWYPNAQBNQJQ-UHFFFAOYSA-N hexamethylmelamine Chemical compound CN(C)C1=NC(N(C)C)=NC(N(C)C)=N1 UUVWYPNAQBNQJQ-UHFFFAOYSA-N 0.000 description 1
- 230000005745 host immune response Effects 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229950007440 icotinib Drugs 0.000 description 1
- QQLKULDARVNMAL-UHFFFAOYSA-N icotinib Chemical compound C#CC1=CC=CC(NC=2C3=CC=4OCCOCCOCCOC=4C=C3N=CN=2)=C1 QQLKULDARVNMAL-UHFFFAOYSA-N 0.000 description 1
- 229960000908 idarubicin Drugs 0.000 description 1
- 229960001101 ifosfamide Drugs 0.000 description 1
- HOMGKSMUEGBAAB-UHFFFAOYSA-N ifosfamide Chemical compound ClCCNP1(=O)OCCCN1CCCl HOMGKSMUEGBAAB-UHFFFAOYSA-N 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- 229960002751 imiquimod Drugs 0.000 description 1
- DOUYETYNHWVLEO-UHFFFAOYSA-N imiquimod Chemical compound C1=CC=CC2=C3N(CC(C)C)C=NC3=C(N)N=C21 DOUYETYNHWVLEO-UHFFFAOYSA-N 0.000 description 1
- 102000027596 immune receptors Human genes 0.000 description 1
- 108091008915 immune receptors Proteins 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 230000004957 immunoregulator effect Effects 0.000 description 1
- 230000001024 immunotherapeutic effect Effects 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- 229950009034 indoximod Drugs 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000028709 inflammatory response Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000011368 intensive chemotherapy Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007917 intracranial administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 230000005865 ionizing radiation Effects 0.000 description 1
- 229960005386 ipilimumab Drugs 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000004501 isothiazol-5-yl group Chemical group S1N=CC=C1* 0.000 description 1
- 230000000155 isotopic effect Effects 0.000 description 1
- 125000004284 isoxazol-3-yl group Chemical group [H]C1=C([H])C(*)=NO1 0.000 description 1
- 125000004499 isoxazol-5-yl group Chemical group O1N=CC=C1* 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 229960004891 lapatinib Drugs 0.000 description 1
- BCFGMOOMADDAQU-UHFFFAOYSA-N lapatinib Chemical compound O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 BCFGMOOMADDAQU-UHFFFAOYSA-N 0.000 description 1
- 229960004942 lenalidomide Drugs 0.000 description 1
- GOTYRUGSSMKFNF-UHFFFAOYSA-N lenalidomide Chemical compound C1C=2C(N)=CC=CC=2C(=O)N1C1CCC(=O)NC1=O GOTYRUGSSMKFNF-UHFFFAOYSA-N 0.000 description 1
- 229960003881 letrozole Drugs 0.000 description 1
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 description 1
- 229960001691 leucovorin Drugs 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- CMJCXYNUCSMDBY-ZDUSSCGKSA-N lgx818 Chemical compound COC(=O)N[C@@H](C)CNC1=NC=CC(C=2C(=NN(C=2)C(C)C)C=2C(=C(NS(C)(=O)=O)C=C(Cl)C=2)F)=N1 CMJCXYNUCSMDBY-ZDUSSCGKSA-N 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002514 liquid chromatography mass spectrum Methods 0.000 description 1
- 229950011263 lirilumab Drugs 0.000 description 1
- 238000006138 lithiation reaction Methods 0.000 description 1
- 229960002247 lomustine Drugs 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 229950004563 lucatumumab Drugs 0.000 description 1
- 201000005243 lung squamous cell carcinoma Diseases 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 229950008001 matuzumab Drugs 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229960004961 mechlorethamine Drugs 0.000 description 1
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical compound ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 1
- BCVXHSPFUWZLGQ-UHFFFAOYSA-N mecn acetonitrile Chemical compound CC#N.CC#N BCVXHSPFUWZLGQ-UHFFFAOYSA-N 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- 229960001428 mercaptopurine Drugs 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- FGYYROXHUINQAS-UHFFFAOYSA-N methyl 2-(4-bromo-2-ethoxyanilino)acetate Chemical compound BrC1=CC(=C(C=C1)NCC(=O)OC)OCC FGYYROXHUINQAS-UHFFFAOYSA-N 0.000 description 1
- BRWROFVPMUPMJQ-UHFFFAOYSA-N methyl 3-methylthiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1C BRWROFVPMUPMJQ-UHFFFAOYSA-N 0.000 description 1
- FTMUWUSLJGRONP-UHFFFAOYSA-N methyl 4-bromo-2-butoxy-6-fluorobenzoate Chemical compound BrC1=CC(=C(C(=O)OC)C(=C1)F)OCCCC FTMUWUSLJGRONP-UHFFFAOYSA-N 0.000 description 1
- QXWLOFCMJIYTHD-UHFFFAOYSA-N methyl 4-bromo-2-fluoro-6-hydroxybenzoate Chemical compound COC(=O)C1=C(O)C=C(Br)C=C1F QXWLOFCMJIYTHD-UHFFFAOYSA-N 0.000 description 1
- JEMVEVUWSJXZMX-UHFFFAOYSA-N methyl 4-bromo-2-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(Br)C=C1O JEMVEVUWSJXZMX-UHFFFAOYSA-N 0.000 description 1
- ZJAVQZHWDFGPQG-UHFFFAOYSA-N methyl 4-chloro-3-hydroxythiophene-2-carboxylate Chemical compound COC(=O)C=1SC=C(Cl)C=1O ZJAVQZHWDFGPQG-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 210000000274 microglia Anatomy 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229960004857 mitomycin Drugs 0.000 description 1
- 229960001156 mitoxantrone Drugs 0.000 description 1
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N monoethyl amine Natural products CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- PEECTLLHENGOKU-UHFFFAOYSA-N n,n-dimethylpyridin-4-amine Chemical compound CN(C)C1=CC=NC=C1.CN(C)C1=CC=NC=C1 PEECTLLHENGOKU-UHFFFAOYSA-N 0.000 description 1
- WOOWBQQQJXZGIE-UHFFFAOYSA-N n-ethyl-n-propan-2-ylpropan-2-amine Chemical compound CCN(C(C)C)C(C)C.CCN(C(C)C)C(C)C WOOWBQQQJXZGIE-UHFFFAOYSA-N 0.000 description 1
- KCXYZMFPZHYUFO-UHFFFAOYSA-N n-methyl-n-phosphanylmethanamine Chemical compound CN(C)P KCXYZMFPZHYUFO-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 230000007896 negative regulation of T cell activation Effects 0.000 description 1
- 238000011227 neoadjuvant chemotherapy Methods 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000010309 neoplastic transformation Effects 0.000 description 1
- 210000002241 neurite Anatomy 0.000 description 1
- 210000004498 neuroglial cell Anatomy 0.000 description 1
- 230000003959 neuroinflammation Effects 0.000 description 1
- 230000003961 neuronal insult Effects 0.000 description 1
- 230000000324 neuroprotective effect Effects 0.000 description 1
- 230000007135 neurotoxicity Effects 0.000 description 1
- 231100000228 neurotoxicity Toxicity 0.000 description 1
- 229950010203 nimotuzumab Drugs 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 229960003301 nivolumab Drugs 0.000 description 1
- VWBWQOUWDOULQN-UHFFFAOYSA-N nmp n-methylpyrrolidone Chemical compound CN1CCCC1=O.CN1CCCC1=O VWBWQOUWDOULQN-UHFFFAOYSA-N 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 108010028584 nucleotidase Proteins 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003349 osteoarthritic effect Effects 0.000 description 1
- 210000002997 osteoclast Anatomy 0.000 description 1
- 125000004287 oxazol-2-yl group Chemical group [H]C1=C([H])N=C(*)O1 0.000 description 1
- 125000003145 oxazol-4-yl group Chemical group O1C=NC(=C1)* 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000004792 oxidative damage Effects 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 229960001972 panitumumab Drugs 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000013610 patient sample Substances 0.000 description 1
- JGWRKYUXBBNENE-UHFFFAOYSA-N pexidartinib Chemical compound C1=NC(C(F)(F)F)=CC=C1CNC(N=C1)=CC=C1CC1=CNC2=NC=C(Cl)C=C12 JGWRKYUXBBNENE-UHFFFAOYSA-N 0.000 description 1
- 230000009038 pharmacological inhibition Effects 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 238000002428 photodynamic therapy Methods 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 229950010773 pidilizumab Drugs 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229960000688 pomalidomide Drugs 0.000 description 1
- UVSMNLNDYGZFPF-UHFFFAOYSA-N pomalidomide Chemical compound O=C1C=2C(N)=CC=CC=2C(=O)N1C1CCC(=O)NC1=O UVSMNLNDYGZFPF-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000005522 programmed cell death Effects 0.000 description 1
- 230000002062 proliferating effect Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 229940070891 pyridium Drugs 0.000 description 1
- 235000008160 pyridoxine Nutrition 0.000 description 1
- 239000011677 pyridoxine Substances 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229960002633 ramucirumab Drugs 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000007115 recruitment Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- BXNMTOQRYBFHNZ-UHFFFAOYSA-N resiquimod Chemical compound C1=CC=CC2=C(N(C(COCC)=N3)CC(C)(C)O)C3=C(N)N=C21 BXNMTOQRYBFHNZ-UHFFFAOYSA-N 0.000 description 1
- 229950010550 resiquimod Drugs 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 238000011808 rodent model Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- CYOHGALHFOKKQC-UHFFFAOYSA-N selumetinib Chemical compound OCCONC(=O)C=1C=C2N(C)C=NC2=C(F)C=1NC1=CC=C(Br)C=C1Cl CYOHGALHFOKKQC-UHFFFAOYSA-N 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- CLDWGXZGFUNWKB-UHFFFAOYSA-M silver;benzoate Chemical compound [Ag+].[O-]C(=O)C1=CC=CC=C1 CLDWGXZGFUNWKB-UHFFFAOYSA-M 0.000 description 1
- 201000000849 skin cancer Diseases 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229950007213 spartalizumab Drugs 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 229960001052 streptozocin Drugs 0.000 description 1
- ZSJLQEPLLKMAKR-GKHCUFPYSA-N streptozocin Chemical compound O=NN(C)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O ZSJLQEPLLKMAKR-GKHCUFPYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 230000003319 supportive effect Effects 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 210000001179 synovial fluid Anatomy 0.000 description 1
- ATFXVNUWQOXRRU-UHFFFAOYSA-N taminadenant Chemical compound BrC=1C(N)=NC(N2N=CC=C2)=NC=1N1C=CC=N1 ATFXVNUWQOXRRU-UHFFFAOYSA-N 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 229940126625 tavolimab Drugs 0.000 description 1
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 1
- 229960001278 teniposide Drugs 0.000 description 1
- ULWPTKWUQBEFQY-UHFFFAOYSA-N tert-butyl N-[2-(2-methoxy-4-methylsulfanylphenyl)ethyl]carbamate Chemical compound COC1=C(C=CC(=C1)SC)CCNC(OC(C)(C)C)=O ULWPTKWUQBEFQY-UHFFFAOYSA-N 0.000 description 1
- VERZYFRKUNLADC-UHFFFAOYSA-N tert-butyl N-[2-(3,4-dichloro-2-methylphenyl)ethyl]carbamate Chemical compound ClC=1C(=C(CCNC(OC(C)(C)C)=O)C=CC=1Cl)C VERZYFRKUNLADC-UHFFFAOYSA-N 0.000 description 1
- IPZRUALBBSQQFT-UHFFFAOYSA-N tert-butyl N-[2-[2-ethoxy-4-(trifluoromethyl)phenyl]ethyl]carbamate Chemical compound C(C)OC1=C(CCNC(OC(C)(C)C)=O)C=CC(=C1)C(F)(F)F IPZRUALBBSQQFT-UHFFFAOYSA-N 0.000 description 1
- AOBSEWCDBBADCX-UHFFFAOYSA-N tert-butyl N-[2-[4-(difluoromethoxy)-2-methoxyphenyl]ethyl]carbamate Chemical compound FC(OC1=CC(=C(CCNC(OC(C)(C)C)=O)C=C1)OC)F AOBSEWCDBBADCX-UHFFFAOYSA-N 0.000 description 1
- CCWNSKVCOUXIQD-UHFFFAOYSA-N tert-butyl N-[2-[4-(difluoromethyl)-2-methoxy-5-methylphenyl]ethyl]carbamate Chemical compound FC(C1=CC(=C(CCNC(OC(C)(C)C)=O)C=C1C)OC)F CCWNSKVCOUXIQD-UHFFFAOYSA-N 0.000 description 1
- OIJWGXLRZSFQJH-UHFFFAOYSA-N tert-butyl N-[2-[4-chloro-2-(methylamino)phenyl]ethyl]carbamate Chemical compound ClC1=CC(=C(CCNC(OC(C)(C)C)=O)C=C1)NC OIJWGXLRZSFQJH-UHFFFAOYSA-N 0.000 description 1
- FMTHQBKRKVRBTR-UHFFFAOYSA-N tert-butyl N-[2-[5-chloro-2-methoxy-4-(trifluoromethyl)phenyl]ethyl]carbamate Chemical compound ClC=1C(=CC(=C(CCNC(OC(C)(C)C)=O)C=1)OC)C(F)(F)F FMTHQBKRKVRBTR-UHFFFAOYSA-N 0.000 description 1
- RUPAXCPQAAOIPB-UHFFFAOYSA-N tert-butyl formate Chemical group CC(C)(C)OC=O RUPAXCPQAAOIPB-UHFFFAOYSA-N 0.000 description 1
- 239000005460 tetrahydrofolate Substances 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 125000004588 thienopyridyl group Chemical group S1C(=CC2=C1C=CC=N2)* 0.000 description 1
- 229960001196 thiotepa Drugs 0.000 description 1
- RZWIIPASKMUIAC-VQTJNVASSA-N thromboxane Chemical compound CCCCCCCC[C@H]1OCCC[C@@H]1CCCCCCC RZWIIPASKMUIAC-VQTJNVASSA-N 0.000 description 1
- 208000013077 thyroid gland carcinoma Diseases 0.000 description 1
- 108010078373 tisagenlecleucel Proteins 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 229940044693 topoisomerase inhibitor Drugs 0.000 description 1
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 description 1
- 229960000303 topotecan Drugs 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 231100000440 toxicity profile Toxicity 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000759 toxicological effect Toxicity 0.000 description 1
- LIRYPHYGHXZJBZ-UHFFFAOYSA-N trametinib Chemical compound CC(=O)NC1=CC=CC(N2C(N(C3CC3)C(=O)C3=C(NC=4C(=CC(I)=CC=4)F)N(C)C(=O)C(C)=C32)=O)=C1 LIRYPHYGHXZJBZ-UHFFFAOYSA-N 0.000 description 1
- 238000011830 transgenic mouse model Methods 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- PBIMIGNDTBRRPI-UHFFFAOYSA-N trifluoro borate Chemical compound FOB(OF)OF PBIMIGNDTBRRPI-UHFFFAOYSA-N 0.000 description 1
- 208000022679 triple-negative breast carcinoma Diseases 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 1
- 235000019798 tripotassium phosphate Nutrition 0.000 description 1
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 1
- 230000005751 tumor progression Effects 0.000 description 1
- 210000004981 tumor-associated macrophage Anatomy 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- GPXBXXGIAQBQNI-UHFFFAOYSA-N vemurafenib Chemical compound CCCS(=O)(=O)NC1=CC=C(F)C(C(=O)C=2C3=CC(=CN=C3NC=2)C=2C=CC(Cl)=CC=2)=C1F GPXBXXGIAQBQNI-UHFFFAOYSA-N 0.000 description 1
- 229960003862 vemurafenib Drugs 0.000 description 1
- 229960003048 vinblastine Drugs 0.000 description 1
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 description 1
- UGGWPQSBPIFKDZ-KOTLKJBCSA-N vindesine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(N)=O)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1N=C1[C]2C=CC=C1 UGGWPQSBPIFKDZ-KOTLKJBCSA-N 0.000 description 1
- 229960004355 vindesine Drugs 0.000 description 1
- GBABOYUKABKIAF-GHYRFKGUSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 description 1
- 229960002066 vinorelbine Drugs 0.000 description 1
- 229940011671 vitamin b6 Drugs 0.000 description 1
- 229960001771 vorozole Drugs 0.000 description 1
- XLMPPFTZALNBFS-INIZCTEOSA-N vorozole Chemical compound C1([C@@H](C2=CC=C3N=NN(C3=C2)C)N2N=CN=C2)=CC=C(Cl)C=C1 XLMPPFTZALNBFS-INIZCTEOSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229950008250 zalutumumab Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K45/00—Medicinal preparations containing active ingredients not provided for in groups A61K31/00 - A61K41/00
- A61K45/06—Mixtures of active ingredients without chemical characterisation, e.g. antiphlogistics and cardiaca
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/04—Antineoplastic agents specific for metastasis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Epidemiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ??PCT/EP2017/062031 | 2017-05-18 | ||
| WOPCT/EP2017/062031 | 2017-05-18 | ||
| EP2017062031 | 2017-05-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| TW201900175A TW201900175A (zh) | 2019-01-01 |
| TWI765041B true TWI765041B (zh) | 2022-05-21 |
Family
ID=62186480
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW107116759A TWI765041B (zh) | 2017-05-18 | 2018-05-17 | 作為pge2受體調節劑之苯基衍生物 |
Country Status (32)
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CR20180323A (es) | 2015-11-20 | 2018-08-06 | Idorsia Pharmaceuticals Ltd | Derivados de indol n-sustituídos como moduladores de los receptores de pge2 |
| WO2018210992A1 (en) | 2017-05-18 | 2018-11-22 | Idorsia Pharmaceuticals Ltd | Pyrimidine derivatives |
| EP3625227B1 (en) | 2017-05-18 | 2022-09-14 | Idorsia Pharmaceuticals Ltd | Benzofurane and benzothiophene derivatives as pge2 receptor modulators |
| AR111808A1 (es) | 2017-05-18 | 2019-08-21 | Idorsia Pharmaceuticals Ltd | Derivados de pirimidina como moduladores del receptor de pge2 |
| JP2021510153A (ja) | 2018-01-05 | 2021-04-15 | アイカーン スクール オブ メディシン アット マウント サイナイ | 膵臓ベータ細胞の増殖を増加させる方法、治療方法、および組成物 |
| CN112135613A (zh) | 2018-03-20 | 2020-12-25 | 西奈山伊坎医学院 | 激酶抑制剂化合物和组合物及使用方法 |
| EP3906028A4 (en) * | 2018-12-31 | 2022-10-12 | Icahn School of Medicine at Mount Sinai | KINA INHIBITOR COMPOUNDS AND COMPOSITIONS AND METHODS OF USE |
| EP4245301A4 (en) | 2020-11-13 | 2024-08-21 | ONO Pharmaceutical Co., Ltd. | TREATMENT OF CANCER BY COMBINED USE OF AN EP4 ANTAGONIST AND AN IMMUNE CHECKPOINT INHIBITOR |
| EP4359399A4 (en) | 2021-06-24 | 2025-04-23 | Reservoir Neuroscience, Inc. | EP2 antagonist compounds |
| WO2025229177A1 (en) | 2024-05-02 | 2025-11-06 | Idorsia Pharmaceuticals Ltd | Crystalline forms of an n-substituted indole derivative |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP2014657A1 (de) * | 2007-06-21 | 2009-01-14 | Bayer Schering Pharma Aktiengesellschaft | Diaminopyrimidine als Modulatoren des EP2-Rezeptors |
| WO2015058031A1 (en) * | 2013-10-17 | 2015-04-23 | Vertex Pharmaceuticals Incorporated | Dna-pk inhibitors |
Family Cites Families (86)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5948786A (en) | 1996-04-12 | 1999-09-07 | Sumitomo Pharmaceuticals Company, Limited | Piperidinylpyrimidine derivatives |
| DE60038902D1 (de) | 2000-03-24 | 2008-06-26 | Asterand Uk Ltd | Verwendung von prostanoid-ep4-rezeptor-antagonisten zur behandlung von kopfschmerzen und nachweisverfahren für solche antagonisten |
| HN2001000224A (es) | 2000-10-19 | 2002-06-13 | Pfizer | Compuestos de imidazol condensado con arilo o heteroarilo como agentes anti - inflamatorios y analgesicos. |
| GB0031302D0 (en) | 2000-12-21 | 2001-01-31 | Glaxo Group Ltd | Napthalene derivatives |
| GB0031295D0 (en) | 2000-12-21 | 2001-01-31 | Glaxo Group Ltd | Naphthalene derivatives |
| GB0103269D0 (en) | 2001-02-09 | 2001-03-28 | Glaxo Group Ltd | Napthalene derivatives |
| AU2003216579A1 (en) | 2002-04-12 | 2003-10-27 | Pfizer Inc. | Imidazole compounds as anti-inflammatory and analgesic agents |
| MXPA04009960A (es) | 2002-04-12 | 2004-12-13 | Pfizer | Compuestos de pirazol como agentes anti-inflamatorios y analgesicos. |
| AU2003233297A1 (en) | 2002-05-23 | 2003-12-12 | Theratechnologies Inc | Antagonistic peptides of prostaglandin e2 receptor subtype ep4 |
| ATE396182T1 (de) | 2003-01-29 | 2008-06-15 | Asterand Uk Ltd | Hemmstoffe des ep4-rezeptors |
| CN1871240B (zh) | 2003-08-26 | 2012-11-07 | 帝人制药株式会社 | 吡咯并嘧啶酮衍生物 |
| KR100747401B1 (ko) | 2003-09-03 | 2007-08-08 | 화이자 인코포레이티드 | 프로스타글란딘 e2 길항제로서의 페닐 또는 피리딜 아미드 화합물 |
| EP1678147B1 (en) | 2003-09-15 | 2012-08-08 | Lead Discovery Center GmbH | Pharmaceutically active 4,6-disubstituted aminopyrimidine derivatives as modulators of protein kinases |
| GB0324269D0 (en) | 2003-10-16 | 2003-11-19 | Pharmagene Lab Ltd | EP4 receptor antagonists |
| EP1756042B8 (en) | 2004-05-04 | 2014-06-04 | RaQualia Pharma Inc | Substituted methyl aryl or heteroaryl amide compounds |
| AP2006003769A0 (en) | 2004-05-04 | 2006-10-31 | Pfizer | Ortho substituted aryl or heteroaryl amide compounds |
| GT200500284A (es) | 2004-10-15 | 2006-03-27 | Aventis Pharma Inc | Pirimidinas como antagonistas del receptor de prostaglandina d2 |
| WO2006122403A1 (en) | 2005-05-19 | 2006-11-23 | Merck Frosst Canada Ltd. | Quinoline derivatives as ep4 antagonists |
| WO2006128129A2 (en) | 2005-05-26 | 2006-11-30 | Synta Pharmaceuticals Corp. | Method for treating cancer |
| DOP2007000068A (es) | 2006-04-12 | 2007-10-31 | Sanofi Aventis Us Llc | Compuestos de amino-pirimidina 2,6-sustituidos-4-monosustituidos como antagonistas del receptor de prostaglandina d2 |
| US7968578B2 (en) | 2006-04-24 | 2011-06-28 | Merck Frosst Canada Ltd. | Indole amide derivatives as EP4 receptor antagonists |
| EP2035376B1 (en) | 2006-06-12 | 2014-08-27 | Merck Canada Inc. | Indoline amide derivatives as ep4 receptor ligands |
| US20080280891A1 (en) | 2006-06-27 | 2008-11-13 | Locus Pharmaceuticals, Inc. | Anti-cancer agents and uses thereof |
| WO2008008059A1 (en) | 2006-07-12 | 2008-01-17 | Locus Pharmaceuticals, Inc. | Anti-cancer agents ans uses thereof |
| AR061974A1 (es) | 2006-07-14 | 2008-08-10 | Novartis Ag | Derivados de pirimidina como inhibidores de alk, composiciones farmaceuticas y procesos de obtencion |
| EP2054401B1 (en) | 2006-08-11 | 2013-05-01 | Merck Canada Inc. | Thiophenecarboxamide derivatives as ep4 receptor ligands |
| WO2008039882A1 (en) | 2006-09-30 | 2008-04-03 | Sanofi-Aventis U.S. Llc | A combination of niacin and a prostaglandin d2 receptor antagonist |
| CN101622230B (zh) | 2007-02-26 | 2012-08-22 | 默克弗罗斯特加拿大有限公司 | 作为ep4受体拮抗剂的吲哚和二氢吲哚环丙基酰胺衍生物 |
| CN101636385B (zh) | 2007-03-26 | 2012-09-05 | 默克弗罗斯特加拿大有限公司 | 作为ep4受体拮抗剂的萘和喹啉磺酰脲衍生物 |
| US8030489B2 (en) | 2007-03-26 | 2011-10-04 | Astellas Pharma Inc. | Ornithine derivative |
| WO2009005076A1 (ja) | 2007-07-03 | 2009-01-08 | Astellas Pharma Inc. | アミド化合物 |
| SI2212297T1 (sl) | 2007-10-12 | 2011-09-30 | Ingenium Pharmaceuticals Gmbh | Inhibitorji protein kinaz |
| CA2714743C (en) | 2008-02-19 | 2017-01-17 | Janssen Pharmaceutica N.V. | Aryl-hydroxyethylamino-pyrimidines and triazines as modulators of fatty acid amide hydrolase |
| JP5375824B2 (ja) | 2008-05-14 | 2013-12-25 | アステラス製薬株式会社 | アミド化合物 |
| US20130225528A1 (en) | 2008-05-21 | 2013-08-29 | Ariad Pharmaceuticals, Inc. | Phosphorus Derivatives as Kinase Inhibitors |
| US8404736B2 (en) | 2008-08-14 | 2013-03-26 | Beta Pharma Canada Inc. | Heterocyclic amide derivatives as EP4 receptor antagonists |
| CN102164942B (zh) | 2008-09-19 | 2017-02-15 | 生物科技研究有限公司 | 三萜系化合物及其使用的方法 |
| EP2346866B1 (en) | 2008-09-25 | 2013-11-27 | Merck Canada Inc. | Beta-carboline sulphonylurea derivatives as ep4 receptor antagonists |
| US8906914B2 (en) | 2009-08-18 | 2014-12-09 | Janssen Pharmaceutica Nv | Ethylene diamine modulators of fatty acid hydrolase |
| US20110124667A1 (en) | 2009-11-23 | 2011-05-26 | Philip Manton Brown | Methods for the treatment of irritable bowel syndrome |
| MX2012013274A (es) | 2010-05-21 | 2013-05-28 | Chemilia Ab | Novedosos derivados de la pirimidina. |
| ME02575B (me) | 2010-09-21 | 2017-06-20 | Eisai R&D Man Co Ltd | Farmaceutska kompozicija |
| CN106046158A (zh) | 2010-09-29 | 2016-10-26 | 株式会社Nb健康研究所 | 针对人前列腺素e2 受体ep4 的抗体 |
| EA201390717A1 (ru) | 2010-11-17 | 2013-10-30 | Новартис Аг | 3-(аминоарил)пиридиновые соединения |
| WO2012066065A1 (en) | 2010-11-17 | 2012-05-24 | Novartis Ag | Phenyl-heteroaryl amine compounds and their uses |
| EP2649061B1 (en) | 2010-12-10 | 2015-05-13 | Rottapharm Biotech S.r.l. | Pyridine amide derivatives as ep4 receptor antagonists |
| WO2012103071A2 (en) | 2011-01-25 | 2012-08-02 | Eisai R&D Management Co., Ltd. | Compounds and compositions |
| JP5886411B2 (ja) | 2011-03-24 | 2016-03-16 | ノビガ・リサーチ・エービーNoviga Research AB | 新規のピリミジン誘導体 |
| EP2702043A1 (en) | 2011-04-29 | 2014-03-05 | Exelixis, Inc. | Inhibitors of inducible form of 6-phosphofructose-2-kinase |
| CA2839956A1 (en) | 2011-06-20 | 2012-12-27 | Emory University | Prostaglandin receptor ep2 antagonists, derivatives, compositions, and uses related thereto |
| RU2565596C2 (ru) | 2011-07-04 | 2015-10-20 | Роттафарм Биотек С.Р.Л. | Производные циклических аминов в качестве антагонистов рецептора ер4 |
| EP2554662A1 (en) | 2011-08-05 | 2013-02-06 | M Maria Pia Cosma | Methods of treatment of retinal degeneration diseases |
| US20150004175A1 (en) | 2011-12-13 | 2015-01-01 | Yale University | Compositions and Methods for Reducing CTL Exhaustion |
| IN2014KN02601A (cg-RX-API-DMAC7.html) * | 2012-04-24 | 2015-05-08 | Vertex Pharma | |
| TWI572597B (zh) | 2012-06-29 | 2017-03-01 | 美國禮來大藥廠 | 二甲基-苯甲酸化合物 |
| AR091429A1 (es) | 2012-06-29 | 2015-02-04 | Lilly Co Eli | Compuestos de fenoxietil piperidina |
| EP2711364A1 (en) | 2012-09-21 | 2014-03-26 | Chemilia AB | 4-(Indolyl or benzimidazolyl)amino-2-(2-(indol-3-yl)ethyl)aminopyrimidines useful for the treatment of cancer |
| PE20151412A1 (es) | 2012-11-27 | 2015-10-10 | Thomas Helledays Stiftelse For Medicinsk Forskning | Derivados de pirimidin-2,4-diamina para el tratamiento de cancer |
| UA115576C2 (uk) | 2012-12-06 | 2017-11-27 | Байєр Фарма Акцієнгезелльшафт | Похідні бензимідазолу як антагоністи ер4 |
| EP2765128A1 (en) | 2013-02-07 | 2014-08-13 | Almirall, S.A. | Substituted benzamides with activity towards EP4 receptors |
| TW201443004A (zh) | 2013-02-15 | 2014-11-16 | Lilly Co Eli | 苯氧基乙氧基化合物 |
| TWI636046B (zh) | 2013-05-17 | 2018-09-21 | 美國禮來大藥廠 | 苯氧基乙基二氫-1h-異喹啉化合物 |
| CN105263924B (zh) | 2013-05-30 | 2018-10-19 | 爱杜西亚制药有限公司 | Cxcr7受体调节剂 |
| HUE039015T2 (hu) | 2013-06-12 | 2018-12-28 | Kaken Pharma Co Ltd | 4-Alkinil-imidazol-származék és ezt hatóanyagként tartalmazó gyógyszerkészítmény |
| CN105705489B (zh) | 2013-09-04 | 2019-04-26 | 百时美施贵宝公司 | 用作免疫调节剂的化合物 |
| RS57508B1 (sr) | 2013-09-06 | 2018-10-31 | Aurigene Discovery Tech Ltd | 1,2,4-derivati oksadiazola kao imunomodulatori |
| WO2015044900A1 (en) | 2013-09-27 | 2015-04-02 | Aurigene Discovery Technologies Limited | Therapeutic immunomodulating compounds |
| MX361488B (es) | 2013-10-17 | 2018-12-07 | Vertex Pharma | Cocristales de (s)-n-metil-8-(1-((2'-metil-[4,5'-bipirimidin]-6-il ) amino)propan-2-il)quinolina-4-carboxamida y sus derivados deuterados como inhibidores de proteínas cinasa dependientes de adn (adn-pk). |
| ES2727329T3 (es) | 2013-12-17 | 2019-10-15 | Lilly Co Eli | Compuestos de ácido dimetilbenzoico |
| LT3083562T (lt) | 2013-12-17 | 2018-01-10 | Eli Lilly & Company | Fenoksietilo cikliniai amino dariniai ir jų aktyvumas kaip ep4 receptoriaus moduliatorių |
| TW201607943A (zh) | 2013-12-19 | 2016-03-01 | 拜耳製藥公司 | 作為ep4配體之新穎苯并咪唑衍生物 |
| TW201623277A (zh) | 2014-03-26 | 2016-07-01 | 安斯泰來製藥股份有限公司 | 醯胺化合物 |
| EP3137074B1 (en) | 2014-04-29 | 2020-08-05 | Emory University | Prostaglandin receptor ep2 antagonists, derivatives, compositions, and uses related thereto |
| CA2949961C (en) | 2014-05-23 | 2023-09-19 | Eisai R&D Management Co., Ltd. | Combination therapies for the treatment of cancer |
| WO2015187089A1 (en) | 2014-06-04 | 2015-12-10 | Thomas Helledays Stiftelse För Medicinsk Forskning | Mth1 inhibitors for treatment of inflammatory and autoimmune conditions |
| SG11201610517PA (en) | 2014-06-19 | 2017-01-27 | Ariad Pharma Inc | Heteroaryl compounds for kinase inhibition |
| WO2016021742A1 (en) | 2014-08-07 | 2016-02-11 | Takeda Pharmaceutical Company Limited | Heterocyclic compounds as ep4 receptor antagonists |
| TWI783617B (zh) | 2015-01-09 | 2022-11-11 | 日商小野藥品工業股份有限公司 | 三環性螺化合物之用途 |
| DK3325490T3 (da) | 2015-07-23 | 2020-02-03 | Takeda Pharmaceuticals Co | 1-substituerede 1,2,3,4-tetrahydro-1,7-naphthyridin-8-aminderivater og deres anvendelse som ep4-receptorantagonister |
| MX390051B (es) | 2015-10-16 | 2025-03-20 | Eisai R&D Man Co Ltd | Antagonistas de ep4. |
| CR20180323A (es) | 2015-11-20 | 2018-08-06 | Idorsia Pharmaceuticals Ltd | Derivados de indol n-sustituídos como moduladores de los receptores de pge2 |
| CN109863143B (zh) | 2016-07-13 | 2021-10-15 | 威泰克斯制药公司 | 提高基因组编辑效率的方法、组合物和试剂盒 |
| EP3625227B1 (en) | 2017-05-18 | 2022-09-14 | Idorsia Pharmaceuticals Ltd | Benzofurane and benzothiophene derivatives as pge2 receptor modulators |
| AR111808A1 (es) | 2017-05-18 | 2019-08-21 | Idorsia Pharmaceuticals Ltd | Derivados de pirimidina como moduladores del receptor de pge2 |
| TWI768043B (zh) | 2017-05-18 | 2022-06-21 | 瑞士商愛杜西亞製藥有限公司 | N-取代吲哚衍生物 |
| WO2018210992A1 (en) | 2017-05-18 | 2018-11-22 | Idorsia Pharmaceuticals Ltd | Pyrimidine derivatives |
-
2018
- 2018-05-17 SI SI201830422T patent/SI3625222T1/sl unknown
- 2018-05-17 HU HUE18725222A patent/HUE056080T2/hu unknown
- 2018-05-17 BR BR112019024109-4A patent/BR112019024109A2/pt not_active IP Right Cessation
- 2018-05-17 RS RS20211256A patent/RS62440B1/sr unknown
- 2018-05-17 UA UAA201911975A patent/UA125123C2/uk unknown
- 2018-05-17 SG SG11201908729U patent/SG11201908729UA/en unknown
- 2018-05-17 CR CR20190559A patent/CR20190559A/es unknown
- 2018-05-17 MA MA49126A patent/MA49126B1/fr unknown
- 2018-05-17 EA EA201992676A patent/EA201992676A1/ru unknown
- 2018-05-17 CN CN201880031321.4A patent/CN110612296A/zh active Pending
- 2018-05-17 PL PL18725222T patent/PL3625222T3/pl unknown
- 2018-05-17 CA CA3060597A patent/CA3060597A1/en active Pending
- 2018-05-17 KR KR1020197037298A patent/KR102632028B1/ko active Active
- 2018-05-17 AR ARP180101315A patent/AR111941A1/es not_active Application Discontinuation
- 2018-05-17 IL IL270623A patent/IL270623B2/en unknown
- 2018-05-17 ES ES18725222T patent/ES2893452T3/es active Active
- 2018-05-17 LT LTEPPCT/EP2018/062862T patent/LT3625222T/lt unknown
- 2018-05-17 AU AU2018269666A patent/AU2018269666B2/en not_active Ceased
- 2018-05-17 HR HRP20211533TT patent/HRP20211533T1/hr unknown
- 2018-05-17 US US16/614,594 patent/US11712438B2/en active Active
- 2018-05-17 PE PE2019002396A patent/PE20191814A1/es unknown
- 2018-05-17 PT PT18725222T patent/PT3625222T/pt unknown
- 2018-05-17 WO PCT/EP2018/062862 patent/WO2018210994A1/en not_active Ceased
- 2018-05-17 MX MX2019013718A patent/MX388256B/es unknown
- 2018-05-17 EP EP18725222.6A patent/EP3625222B1/en active Active
- 2018-05-17 DK DK18725222.6T patent/DK3625222T3/da active
- 2018-05-17 TW TW107116759A patent/TWI765041B/zh not_active IP Right Cessation
- 2018-05-17 JP JP2019563491A patent/JP7159214B2/ja active Active
-
2019
- 2019-09-27 CO CONC2019/0010578A patent/CO2019010578A2/es unknown
- 2019-11-15 CL CL2019003275A patent/CL2019003275A1/es unknown
- 2019-11-15 PH PH12019502563A patent/PH12019502563A1/en unknown
-
2021
- 2021-10-19 CY CY20211100906T patent/CY1124608T1/el unknown
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP2014657A1 (de) * | 2007-06-21 | 2009-01-14 | Bayer Schering Pharma Aktiengesellschaft | Diaminopyrimidine als Modulatoren des EP2-Rezeptors |
| WO2015058031A1 (en) * | 2013-10-17 | 2015-04-23 | Vertex Pharmaceuticals Incorporated | Dna-pk inhibitors |
Non-Patent Citations (3)
| Title |
|---|
| Chen: "Prostaglandin E2 and the protein kinase A pathway mediate arachidonic acid induction of c-fos in human prostate cancer cells", British Journal of cancer, vol. 82, no. 12; * |
| Jonathan F. Goodwin,Beyond DNA Repair: DNA-PK Function in Cancer,CANCER DISCOVERY, vol. 4, no. 10 * |
| Jonathan F. Goodwin,Beyond DNA Repair: DNA-PK Function in Cancer,CANCER DISCOVERY, vol. 4, no. 10。 |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI765041B (zh) | 作為pge2受體調節劑之苯基衍生物 | |
| TWI754397B (zh) | 做為pge2受體調節劑之n-取代吲哚衍生物 | |
| KR102612649B1 (ko) | Pge2 수용체 조절제로서의 벤조푸란 및 벤조티오페논 유도체 | |
| JP7253500B2 (ja) | ピリミジン誘導体 | |
| EA043145B1 (ru) | Фенильные производные в качестве модуляторов pge2 рецепторов | |
| HK40020598A (en) | Phenyl derivatives as pge2 receptor modulators | |
| HK40020598B (en) | Phenyl derivatives as pge2 receptor modulators |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Annulment or lapse of patent due to non-payment of fees |