SU784775A3 - Способ получени -замещенных сложных эфиров 9,10-дигидролизергиновой кислоты - Google Patents
Способ получени -замещенных сложных эфиров 9,10-дигидролизергиновой кислоты Download PDFInfo
- Publication number
- SU784775A3 SU784775A3 SU782637592A SU2637592A SU784775A3 SU 784775 A3 SU784775 A3 SU 784775A3 SU 782637592 A SU782637592 A SU 782637592A SU 2637592 A SU2637592 A SU 2637592A SU 784775 A3 SU784775 A3 SU 784775A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mmol
- acid
- methyl
- benzene
- general formula
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 12
- 150000002148 esters Chemical class 0.000 title claims description 3
- ORBSYPFBZQJNJE-MPKXVKKWSA-N (6ar,9r,10ar)-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carboxylic acid Chemical compound C1=CC([C@H]2C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 ORBSYPFBZQJNJE-MPKXVKKWSA-N 0.000 title description 3
- 239000002253 acid Substances 0.000 claims description 24
- 239000008346 aqueous phase Substances 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 239000012071 phase Substances 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L sulfate group Chemical group S(=O)(=O)([O-])[O-] QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical class CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 238000003786 synthesis reaction Methods 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 54
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 20
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 15
- -1 allyl ester Chemical class 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 150000004702 methyl esters Chemical class 0.000 description 9
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 8
- 239000000725 suspension Substances 0.000 description 7
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000012262 resinous product Substances 0.000 description 3
- 239000012485 toluene extract Substances 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 2
- 229940008406 diethyl sulfate Drugs 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 2
- LGAJYTCRJPCZRJ-UHFFFAOYSA-N 2-bromopentane Chemical compound CCCC(C)Br LGAJYTCRJPCZRJ-UHFFFAOYSA-N 0.000 description 1
- DMAYBPBPEUFIHJ-UHFFFAOYSA-N 4-bromobut-1-ene Chemical compound BrCCC=C DMAYBPBPEUFIHJ-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 235000010357 aspartame Nutrition 0.000 description 1
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- FSIZNIXUPRQTLZ-QMTHXVAHSA-N lysergic acid Chemical class C1=CC=C2C3=C[C@@H](C(O)=O)CN(C)[C@@H]3CC3=CN=C1[C]32 FSIZNIXUPRQTLZ-QMTHXVAHSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| YU1819/77A YU40004B (en) | 1977-07-21 | 1977-07-21 | Praocess for preparing n-substituted esters of 9,10-dihydrlysergic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU784775A3 true SU784775A3 (ru) | 1980-11-30 |
Family
ID=25555705
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU782637592A SU784775A3 (ru) | 1977-07-21 | 1978-07-20 | Способ получени -замещенных сложных эфиров 9,10-дигидролизергиновой кислоты |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4230859A (enExample) |
| EP (1) | EP0000533B1 (enExample) |
| JP (1) | JPS5436296A (enExample) |
| AT (1) | AT363195B (enExample) |
| CS (1) | CS216231B2 (enExample) |
| DE (1) | DE2860896D1 (enExample) |
| ES (1) | ES471716A1 (enExample) |
| FI (1) | FI64369C (enExample) |
| PT (1) | PT68278A (enExample) |
| SU (1) | SU784775A3 (enExample) |
| YU (1) | YU40004B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4563461A (en) * | 1983-03-10 | 1986-01-07 | Eli Lilly And Company | Selective method for blocking 5HT2 receptors |
| FR2584720B1 (fr) * | 1985-07-11 | 1987-10-02 | Rhone Poulenc Sante | Procede de preparation de derives n-methyles de l'ergoline |
| FR2584721B1 (fr) * | 1985-07-11 | 1987-10-02 | Rhone Poulenc Sante | Procede de preparation des derives n-methyles du dihydrolysergate de methyle ou du methoxylumilysergate de methyle |
| US4820713A (en) * | 1985-10-01 | 1989-04-11 | Eli Lilly And Company | Ketoalkanol esters of dihydrolysergic acid useful as 5HT receptor antagonists |
| US4772709A (en) * | 1985-10-01 | 1988-09-20 | Eli Lilly And Company | Process of making ketoalkanol esters of dihydrolysergic acid |
| US4683236A (en) * | 1985-10-01 | 1987-07-28 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid useful as 5Ht2 receptor antagonists |
| US4713384A (en) * | 1985-10-01 | 1987-12-15 | Eli Lilly And Company | Selective method for blocking 5HT2 receptors |
| US4713385A (en) * | 1985-10-01 | 1987-12-15 | Eli Lilly And Company | Alkoxy and dialkoxyalkyl esters of dihydrolysergic acid and related compounds useful as 5HT receptor antagonists |
| US4845224A (en) * | 1985-10-01 | 1989-07-04 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid having peripheral serotonin antagonist properties |
| US4906639A (en) * | 1985-10-01 | 1990-03-06 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid |
| US4810710A (en) * | 1985-10-01 | 1989-03-07 | Eli Lilly And Company | 4-hydroxycyclohexyl 1-isopropyl-9,10-dihydro-lysergate for the treatment of migraine |
| US4939258A (en) * | 1985-10-01 | 1990-07-03 | Eli Lilly And Company | Cycloalkanol esters of dihydrolysergic acid |
| US4762842A (en) * | 1985-10-01 | 1988-08-09 | Eli Lilly And Company | Selective method for blocking 5HT2 receptors |
| US4734501A (en) * | 1985-10-01 | 1988-03-29 | Eli Lilly And Company | N-alkylation of dihydrolysergic acid |
| US4847261A (en) * | 1985-10-01 | 1989-07-11 | Eli Lilly And Company | Alkoxy cycloalkanol esters of dihydrolysergic acid having peripheral serotonin antagonists properties |
| US4714704A (en) * | 1985-10-01 | 1987-12-22 | Eli Lilly And Company | Alkoxy cycloalkanol esters of dihydrolysergic acid useful as 5HT receptor antagonists |
| US4968802A (en) * | 1985-10-01 | 1990-11-06 | Eli Lilly And Company | Process of making alkoxy cycloalkanol esters of dihydrolysergic acid |
| US4704396A (en) * | 1985-12-20 | 1987-11-03 | Eli Lilly And Company | Phenacyl esters of 1-substituted-6-(substituted and unsubstituted) dihydrolysergic acids useful as 5HT receptor antagonists |
| US4683237A (en) * | 1985-12-20 | 1987-07-28 | Eli Lilly And Company | Fluoroalkyl esters of dihydrolysergic acid useful as 5HT2 receptor antagonists |
| US4704395A (en) * | 1985-12-20 | 1987-11-03 | Eli Lilly And Company | Cyclic ether esters of 2-substituted-6-(substituted and unsubstituted) dihydrolysergic acid useful as 5HT receptor antagonists |
| US4782063A (en) * | 1987-05-11 | 1988-11-01 | Eli Lilly And Company | Ergoline esters useful as serotonin antagonists |
| US4835159A (en) * | 1987-05-11 | 1989-05-30 | Eli Lilly And Company | Ergoline esters useful as serotonin antagonists |
| US4931447A (en) * | 1987-06-15 | 1990-06-05 | Eli Lilly And Company | Cycloalkylamides of (8β)-1-alkyl-6-(substituted) ergolines |
| US4981859A (en) * | 1987-06-15 | 1991-01-01 | Cycloalkylamides of (8 beta )-1-alkyl-6-(substituted)ergolines | |
| JPH01106511U (enExample) * | 1988-01-02 | 1989-07-18 | ||
| JPH02125915U (enExample) * | 1989-03-29 | 1990-10-17 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA631701A (en) * | 1961-11-28 | Sandoz A.G. | Compounds of the lysergic acid series alkylated at the indol nitrogen atom | |
| FR1175276A (fr) * | 1956-05-18 | 1959-03-23 | Sandoz Ag | Nouveaux dérivés de la série de l'acide lysergique et leur préparation |
| CH344731A (de) * | 1956-05-18 | 1960-02-29 | Sandoz Ag | Verfahren zur Herstellung von neuen, am Indolstickstoff alkylierten Derivaten der Lysergsäure-Reihe |
| US3228943A (en) * | 1962-06-11 | 1966-01-11 | Lumilysergol derivatives | |
| US3232942A (en) * | 1964-06-02 | 1966-02-01 | Sandoz Ltd | 1-substituted (+)-lysergol |
| GB1298277A (en) * | 1969-04-18 | 1972-11-29 | Sandoz Ltd | Preparation of ergot peptide alkaloids |
| US3879554A (en) * | 1970-03-20 | 1975-04-22 | Farmaceutici Italia | Use of 1,6-dimethyl-8-{62 -(5-bromonicotinoyloxymethyl)-10 {60 -methoxyergoline in treating cerebral and peripheral metabolic vascular disorders |
| NL159384B (nl) * | 1971-03-13 | 1979-02-15 | Farmaceutici Italia | Werkwijze voor het bereiden van een geneesmiddel met een adrenolytische activiteit, alsmede werkwijze voor het bereiden van een ester van 1-methyl-10-methoxylumilysergol. |
| GB1413068A (en) * | 1972-06-22 | 1975-11-05 | Farmaceutici Italia | Bromoergolines |
-
1977
- 1977-07-21 YU YU1819/77A patent/YU40004B/xx unknown
-
1978
- 1978-06-29 FI FI782081A patent/FI64369C/fi not_active IP Right Cessation
- 1978-07-06 AT AT0490078A patent/AT363195B/de not_active IP Right Cessation
- 1978-07-07 US US05/922,692 patent/US4230859A/en not_active Expired - Lifetime
- 1978-07-12 PT PT68278A patent/PT68278A/pt unknown
- 1978-07-14 ES ES471716A patent/ES471716A1/es not_active Expired
- 1978-07-18 CS CS784790A patent/CS216231B2/cs unknown
- 1978-07-18 EP EP78100419A patent/EP0000533B1/de not_active Expired
- 1978-07-18 DE DE7878100419T patent/DE2860896D1/de not_active Expired
- 1978-07-20 SU SU782637592A patent/SU784775A3/ru active
- 1978-07-21 JP JP8850978A patent/JPS5436296A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FI64369C (fi) | 1983-11-10 |
| EP0000533A1 (de) | 1979-02-07 |
| DE2860896D1 (en) | 1981-11-05 |
| ES471716A1 (es) | 1979-10-01 |
| ATA490078A (de) | 1980-12-15 |
| YU181977A (en) | 1983-01-21 |
| FI782081A7 (fi) | 1979-01-22 |
| PT68278A (en) | 1978-08-01 |
| JPS5436296A (en) | 1979-03-16 |
| EP0000533B1 (de) | 1981-08-05 |
| YU40004B (en) | 1985-06-30 |
| US4230859A (en) | 1980-10-28 |
| FI64369B (fi) | 1983-07-29 |
| CS216231B2 (en) | 1982-10-29 |
| AT363195B (de) | 1981-07-10 |
| JPS5648512B2 (enExample) | 1981-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU784775A3 (ru) | Способ получени -замещенных сложных эфиров 9,10-дигидролизергиновой кислоты | |
| PT95099B (pt) | Processo para a preparacao de amino acidos ciclicos bem como dos seus intermediarios | |
| NO300733B1 (no) | Fremgangsmåte for fremstilling av rene isoflavonderivater | |
| US2883384A (en) | Production of reserpine and analogs thereof | |
| SU873887A3 (ru) | Способ получени производных имидазо/2,1-в/тиазолина или имидазо /2,1-в/тиазина или их кислотно-аддитивных солей,в виде смеси изомеров или отдельных изомеров | |
| US4172074A (en) | Preparation of an antidepressant | |
| SU447886A1 (ru) | Способ получени защищенной 4,6-0-алкилиден- - -глюкопиранозы | |
| SU910118A3 (ru) | Способ получени N @ -глюкофуранозид-6-ил-N @ -нитрозомочевины | |
| US6271371B1 (en) | Oxidative process and products thereof | |
| SU852172A3 (ru) | Способ получени производныхизОХиНОлиНА или иХ СОлЕй | |
| Glarner et al. | The photohydration of N-glycosylpyridinium salts and of related pyridinium N, O-acetals | |
| EP0243646B1 (en) | A process for the preparation of forskolin from 9-deoxy-forskolin and intermediates used therein | |
| US3103513A (en) | Process for preparing hexadehy- | |
| SU724084A3 (ru) | Способ получени 10 -метил- или 10 -метил-2,9-диоксатрицикло (4,3,1,03,7) деканов или их солей | |
| JP2578797B2 (ja) | N−(スルホニルメチル)ホルムアミド類の製造法 | |
| SU1053755A3 (ru) | Способ получени производных эрголинов или их солей | |
| CA1202625A (en) | Process for the preparation of 5, 11-dihydro-11-[(4- methyl-1-piperazinyl)acetyl]-6h-pyrido[2,3-b] [1,4] benzodiazepin-6-ones | |
| FI70895C (fi) | Foerfarande foer framstaellning av vinkaminsyraestrar | |
| SU453842A3 (enExample) | ||
| JP3484161B2 (ja) | スルホ−n−ヒドロキシスクシンイミドおよびその製造方法 | |
| SU1038341A1 (ru) | Способ получени @ -арилиндолотриметинцианинов | |
| US3018286A (en) | Methoxy-z-j | |
| GB2039900A (en) | Octahydro-indolo[2,3- a]quinolisine derivative | |
| US4051150A (en) | 3-(2-Dialkylamino-2-dialkylphosphonylvinyl)-6,11-dihydrodibenzo-[b.e.]-thiepin-11-one | |
| SU497773A3 (ru) | Способ получени производных индазола |