SU736856A3 - Способ борьбы с грибными заболевани ми растений - Google Patents
Способ борьбы с грибными заболевани ми растений Download PDFInfo
- Publication number
- SU736856A3 SU736856A3 SU731890161A SU1890161A SU736856A3 SU 736856 A3 SU736856 A3 SU 736856A3 SU 731890161 A SU731890161 A SU 731890161A SU 1890161 A SU1890161 A SU 1890161A SU 736856 A3 SU736856 A3 SU 736856A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- hydrogen
- alkyl
- cyano
- alkoxycarbonyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 7
- 201000010099 disease Diseases 0.000 title description 8
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 title description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 21
- 239000001257 hydrogen Substances 0.000 claims abstract description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 14
- -1 methyl - carbamoyl Chemical group 0.000 claims abstract description 12
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 11
- 208000031888 Mycoses Diseases 0.000 claims abstract description 5
- 125000002252 acyl group Chemical group 0.000 claims abstract description 5
- 229910052751 metal Inorganic materials 0.000 claims abstract description 4
- 239000002184 metal Substances 0.000 claims abstract description 4
- 229910052717 sulfur Chemical group 0.000 claims abstract description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 3
- 239000001301 oxygen Substances 0.000 claims abstract description 3
- 239000011593 sulfur Chemical group 0.000 claims abstract description 3
- 239000013543 active substance Substances 0.000 claims description 5
- 239000011575 calcium Substances 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 2
- 239000011572 manganese Substances 0.000 claims description 2
- 229910052748 manganese Inorganic materials 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 5
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 claims 2
- 125000002947 alkylene group Chemical group 0.000 claims 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 16
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 abstract description 6
- 229920000940 maneb Polymers 0.000 abstract description 6
- 239000000203 mixture Substances 0.000 abstract description 5
- 239000005809 Metiram Substances 0.000 abstract description 4
- 230000000855 fungicidal effect Effects 0.000 abstract description 4
- 239000000417 fungicide Substances 0.000 abstract description 4
- 229920000257 metiram Polymers 0.000 abstract description 4
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 abstract description 2
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 abstract description 2
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 abstract description 2
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 abstract description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 5
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 abstract 2
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 abstract 2
- ORQGCZICHIRLTG-UHFFFAOYSA-N 2-amino-n-methoxy-2-oxoethanimidoyl cyanide Chemical compound CON=C(C#N)C(N)=O ORQGCZICHIRLTG-UHFFFAOYSA-N 0.000 abstract 1
- CAFXGFHPOQBGJP-UHFFFAOYSA-N 2-cyano-2-hydroxyiminoacetamide Chemical compound NC(=O)C(=NO)C#N CAFXGFHPOQBGJP-UHFFFAOYSA-N 0.000 abstract 1
- 239000005747 Chlorothalonil Substances 0.000 abstract 1
- DCVHDRRDXGNVOU-UHFFFAOYSA-N N-carbamoyl-2-cyano-2-methoxyacetamide Chemical compound C(N)(=O)NC(C(OC)C#N)=O DCVHDRRDXGNVOU-UHFFFAOYSA-N 0.000 abstract 1
- 239000000642 acaricide Substances 0.000 abstract 1
- 150000003869 acetamides Chemical class 0.000 abstract 1
- 125000004423 acyloxy group Chemical group 0.000 abstract 1
- 239000011717 all-trans-retinol Substances 0.000 abstract 1
- 235000019169 all-trans-retinol Nutrition 0.000 abstract 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 239000003899 bactericide agent Substances 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 235000013399 edible fruits Nutrition 0.000 abstract 1
- 239000003337 fertilizer Substances 0.000 abstract 1
- 230000005094 fruit set Effects 0.000 abstract 1
- 239000003906 humectant Substances 0.000 abstract 1
- 239000003701 inert diluent Substances 0.000 abstract 1
- 239000004615 ingredient Substances 0.000 abstract 1
- 239000002917 insecticide Substances 0.000 abstract 1
- 239000005645 nematicide Substances 0.000 abstract 1
- 231100001184 nonphytotoxic Toxicity 0.000 abstract 1
- 239000003921 oil Substances 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
- 229920000642 polymer Polymers 0.000 abstract 1
- 239000004094 surface-active agent Substances 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 20
- 239000000725 suspension Substances 0.000 description 10
- 230000001629 suppression Effects 0.000 description 8
- 241000227653 Lycopersicon Species 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- AARJUIWTWZTQBC-UHFFFAOYSA-L dithiocarboxyazanide ethene manganese(2+) Chemical compound C=C.SC(=S)N[Mn]NC(S)=S AARJUIWTWZTQBC-UHFFFAOYSA-L 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 229940093499 ethyl acetate Drugs 0.000 description 1
- 235000019439 ethyl acetate Nutrition 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/50—Y being a hydrogen or an acyclic carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23499772A | 1972-03-15 | 1972-03-15 | |
| US33045773A | 1973-02-07 | 1973-02-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU736856A3 true SU736856A3 (ru) | 1980-05-25 |
Family
ID=26928470
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU731890161A SU736856A3 (ru) | 1972-03-15 | 1973-03-14 | Способ борьбы с грибными заболевани ми растений |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5828243B2 (cg-RX-API-DMAC7.html) |
| AR (1) | AR208496A1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU474556B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1040530A (cg-RX-API-DMAC7.html) |
| CH (1) | CH570106A5 (cg-RX-API-DMAC7.html) |
| CS (1) | CS190387B2 (cg-RX-API-DMAC7.html) |
| DD (1) | DD105112A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2312956A1 (cg-RX-API-DMAC7.html) |
| EG (1) | EG10809A (cg-RX-API-DMAC7.html) |
| FR (1) | FR2187224B1 (cg-RX-API-DMAC7.html) |
| GB (2) | GB1425621A (cg-RX-API-DMAC7.html) |
| HU (1) | HU167737B (cg-RX-API-DMAC7.html) |
| IL (1) | IL41581A (cg-RX-API-DMAC7.html) |
| IT (1) | IT979609B (cg-RX-API-DMAC7.html) |
| PH (1) | PH16838A (cg-RX-API-DMAC7.html) |
| SU (1) | SU736856A3 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA731111B (cg-RX-API-DMAC7.html) |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE38344B1 (en) * | 1972-10-13 | 1978-02-15 | Ciba Geigy Ag | Cyano-hydroxyimino-acetamide derivatives as plant growth regulants and fungicides |
| ZA757990B (en) | 1975-01-30 | 1976-12-29 | Du Pont | Stabilized formulations of 2-alkoxyiminon-carbamoyl-2-cyanoacetamides |
| DK333276A (da) * | 1975-09-11 | 1977-03-12 | Du Pont | Fungicide, substituerede 2-cyanoacet-amidderivater |
| DE2552867A1 (de) * | 1975-11-25 | 1977-06-02 | Du Pont | Mittel zum bekaempfen von funguserkrankungen bei pflanzen |
| JPS5266631A (en) * | 1975-12-02 | 1977-06-02 | Du Pont | Combined germicide |
| US4178383A (en) * | 1976-05-28 | 1979-12-11 | Bayer Aktiengesellschaft | Fungicidally active oxime-ethers of isonitrosocyanoacetamides |
| US4188401A (en) | 1977-06-04 | 1980-02-12 | Bayer Aktiengesellschaft | Combating fungi with 1-(ω-substituted pentyl)-3-(2-cyano-acetyl)-ureas |
| AT365410B (de) * | 1978-08-31 | 1982-01-11 | Ciba Geigy Ag | Mittel zum schutz von kulturpflanzen vor aggressi-ven herbiziden |
| DE2837863A1 (de) * | 1978-09-04 | 1980-03-13 | Ciba Geigy Ag | Oxim-derivate zum schutz von pflanzenkulturen |
| DE3041998A1 (de) * | 1980-11-07 | 1982-06-09 | Bayer Ag, 5090 Leverkusen | Pyrazolsubstituierte oximino-cyan-acetamid-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| JPS5848782U (ja) * | 1981-09-24 | 1983-04-01 | 津田駒工業株式会社 | 流体噴射式織機用メインノズル |
| CH654979A5 (de) * | 1982-01-26 | 1986-03-27 | Sandoz Ag | Fungizide und ihre verwendung. |
| DE3206235A1 (de) * | 1982-02-20 | 1983-09-01 | Bayer Ag, 5090 Leverkusen | Substituierte oximinoacetanilide, verfahren zu ihrer herstellung sowie ihre verwendung als schaedlingsbekaempfungsmittel |
| DE3222961A1 (de) * | 1982-06-19 | 1983-12-22 | Bayer Ag, 5090 Leverkusen | Azolsubstituierte oximino-cyan-acetamid-derivate |
| JPS6139182U (ja) * | 1984-08-07 | 1986-03-12 | ユニチカ株式会社 | ウオ−タジエツトル−ム用緯糸噴射ノズル |
| JPS61103485U (cg-RX-API-DMAC7.html) * | 1984-12-07 | 1986-07-01 | ||
| DE3602243A1 (de) * | 1985-06-13 | 1986-12-18 | Bayer Ag, 5090 Leverkusen | E-isomere von n(pfeil hoch)(alpha)(pfeil hoch)-(2-cyan-2-alkoximino-acetyl)-aminosaeurederivaten und -peptiden |
| DE3625497A1 (de) * | 1986-07-28 | 1988-02-11 | Bayer Ag | E/z-isomerengemische und reine z-isomere von n(pfeil hoch)(alpha)(pfeil hoch)-(2-cyan-2-alkoximinoacetyl)-aminosaeurederivaten und -peptiden |
| DE3630732A1 (de) * | 1986-09-10 | 1988-03-17 | Bayer Ag | 2-cyano-2-alkoximino-acetamide |
| US5231109A (en) * | 1986-09-10 | 1993-07-27 | Bayer Aktiengesellschaft | 2-cyano-2-alkoximino-acetamides |
| DE3702283A1 (de) * | 1987-01-27 | 1988-08-04 | Bayer Ag | Verfahren zur herstellung von 2-cyano-2-oximino-acetamid-derivaten |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| DE502006008090D1 (de) | 2005-06-09 | 2010-11-25 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| EA020314B9 (ru) | 2009-03-25 | 2015-03-31 | Байер Кропсайенс Аг | Пестицидная комбинация биологически активных веществ |
| CN103548836A (zh) | 2009-07-16 | 2014-02-05 | 拜尔农作物科学股份公司 | 含苯基三唑的协同活性物质结合物 |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH484604A (de) * | 1966-11-10 | 1970-01-31 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| FR1542325A (fr) * | 1966-11-10 | 1968-10-11 | Ciba Geigy | Nouveaux agents pesticides |
| US3694482A (en) * | 1970-04-15 | 1972-09-26 | Exxon Research Engineering Co | Malononitrile oxime derivatives |
-
1973
- 1973-02-16 ZA ZA731111A patent/ZA731111B/xx unknown
- 1973-02-19 IL IL41581A patent/IL41581A/en unknown
- 1973-02-28 CA CA164,860A patent/CA1040530A/en not_active Expired
- 1973-02-28 IT IT21024/73A patent/IT979609B/it active
- 1973-03-05 PH PH14391A patent/PH16838A/en unknown
- 1973-03-13 HU HUDU200A patent/HU167737B/hu unknown
- 1973-03-14 AR AR247003A patent/AR208496A1/es active
- 1973-03-14 EG EG94/73A patent/EG10809A/xx active
- 1973-03-14 AU AU53258/73A patent/AU474556B2/en not_active Expired
- 1973-03-14 DD DD169440A patent/DD105112A5/xx unknown
- 1973-03-14 FR FR737309083A patent/FR2187224B1/fr not_active Expired
- 1973-03-14 JP JP48029098A patent/JPS5828243B2/ja not_active Expired
- 1973-03-14 SU SU731890161A patent/SU736856A3/ru active
- 1973-03-14 CS CS731846A patent/CS190387B2/cs unknown
- 1973-03-14 CH CH373873A patent/CH570106A5/xx not_active IP Right Cessation
- 1973-03-15 DE DE2312956A patent/DE2312956A1/de active Granted
- 1973-03-15 GB GB1245873A patent/GB1425621A/en not_active Expired
- 1973-03-15 GB GB3615575A patent/GB1425622A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2312956C2 (cg-RX-API-DMAC7.html) | 1987-10-01 |
| GB1425622A (en) | 1976-02-18 |
| EG10809A (en) | 1976-06-30 |
| AU5325873A (en) | 1974-09-19 |
| FR2187224A1 (cg-RX-API-DMAC7.html) | 1974-01-18 |
| AR208496A1 (es) | 1977-02-15 |
| JPS49427A (cg-RX-API-DMAC7.html) | 1974-01-05 |
| CH570106A5 (cg-RX-API-DMAC7.html) | 1975-12-15 |
| IL41581A0 (en) | 1973-04-30 |
| FR2187224B1 (cg-RX-API-DMAC7.html) | 1979-02-09 |
| JPS5828243B2 (ja) | 1983-06-15 |
| DE2312956A1 (de) | 1973-09-20 |
| DD105112A5 (cg-RX-API-DMAC7.html) | 1974-04-12 |
| IT979609B (it) | 1974-09-30 |
| PH16838A (en) | 1984-03-15 |
| AU474556B2 (en) | 1976-07-29 |
| CS190387B2 (en) | 1979-05-31 |
| CA1040530A (en) | 1978-10-17 |
| ZA731111B (en) | 1974-03-27 |
| GB1425621A (en) | 1976-02-18 |
| HU167737B (cg-RX-API-DMAC7.html) | 1975-12-25 |
| IL41581A (en) | 1976-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU736856A3 (ru) | Способ борьбы с грибными заболевани ми растений | |
| SU1153831A3 (ru) | Фунгицидна композици | |
| RU2017735C1 (ru) | Способ получения производных 2-анилинопиримидина или их кислотно-аддитивных солей | |
| PL98627B1 (pl) | Srodek szkodnikobojczy | |
| US4980346A (en) | Synergistic fungicidal and acaricidal and compositions containing two or three active ingredients | |
| DE2741437C2 (cg-RX-API-DMAC7.html) | ||
| DE2643403C2 (de) | Thiocarbonsäurederivate, Verfahren zu deren Herstellung und diese enthaltende Mittel | |
| SU1245251A3 (ru) | Фунгицидное средство | |
| US3356483A (en) | Method for plant growth altering | |
| SU661992A3 (ru) | Антимикробна композици | |
| SU580801A3 (ru) | Гербицидное средство | |
| SU651642A3 (ru) | Фунгицидна композици | |
| DE2919825C2 (cg-RX-API-DMAC7.html) | ||
| SU519109A3 (ru) | Фунгицидное средство | |
| SU415846A3 (ru) | Фунгицид | |
| PL188887B1 (pl) | O-etylofosfonian dimetylo-[3-(propoksykarbonyloamino) propylo] amoniowy | |
| JP2001181114A (ja) | 農園芸用殺菌剤組成物 | |
| SU1111673A3 (ru) | Способ борьбы с сорн ками | |
| US3366538A (en) | Method of disinfecting seeds | |
| PL94342B1 (cg-RX-API-DMAC7.html) | ||
| US4018896A (en) | Halo-substituted -2,4,6-trinitrodiphenylamines for control of foliar phytopathogens | |
| RU2207342C2 (ru) | О-этилфосфит n,n-диметил-[3-(пропоксикарбониламино)пропил]аммония, обладающий фунгицидной активностью | |
| SU681779A1 (ru) | Ртутные соли @ -(1-окси-2,2,2-трихлорэтил)-лактамов,обладающие свойствами фунгицидов и протравителей сем н | |
| US4613615A (en) | Dithiocarbamate plant fungicides | |
| EP0252983B1 (de) | Salze der n-(vinyloxyäthyl)dithiokarbamidsäure, herstellungsverfahren und schädlingsbekämpfungsmittel |