SU667132A3 - Способ получени производных индола или их солей - Google Patents
Способ получени производных индола или их солейInfo
- Publication number
- SU667132A3 SU667132A3 SU752307502A SU2307502A SU667132A3 SU 667132 A3 SU667132 A3 SU 667132A3 SU 752307502 A SU752307502 A SU 752307502A SU 2307502 A SU2307502 A SU 2307502A SU 667132 A3 SU667132 A3 SU 667132A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- indole
- methyl
- ethylthio
- hydrogen
- mmol
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 5
- 150000003839 salts Chemical class 0.000 title description 4
- 150000002475 indoles Chemical class 0.000 title description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- 229910052739 hydrogen Inorganic materials 0.000 description 22
- 239000001257 hydrogen Substances 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 125000000217 alkyl group Chemical group 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 239000000243 solution Substances 0.000 description 15
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- -1 triethyloxonium tetrafluoroborate Chemical compound 0.000 description 14
- 239000000047 product Substances 0.000 description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- YAMYNGYKAFZBTE-UHFFFAOYSA-N 2-ethylsulfanyl-1h-indole Chemical compound C1=CC=C2NC(SCC)=CC2=C1 YAMYNGYKAFZBTE-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 150000002431 hydrogen Chemical group 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- CVHZOJJKTDOEJC-UHFFFAOYSA-M 1,1-dioxo-1,2-benzothiazol-3-olate Chemical compound C1=CC=C2C([O-])=NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-M 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- CCZOANFFMASREE-UHFFFAOYSA-N cyclohexane;sulfamic acid Chemical compound NS(O)(=O)=O.C1CCCCC1 CCZOANFFMASREE-UHFFFAOYSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 3
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 125000004149 thio group Chemical group *S* 0.000 description 3
- IGJWTYFTQNHSEK-UHFFFAOYSA-N 1,3-dihydroindole-2-thione Chemical compound C1=CC=C2NC(=S)CC2=C1 IGJWTYFTQNHSEK-UHFFFAOYSA-N 0.000 description 2
- NAJUALUXJIMLNZ-UHFFFAOYSA-N 2-(1h-indol-2-ylsulfanyl)ethanamine Chemical compound C1=CC=C2NC(SCCN)=CC2=C1 NAJUALUXJIMLNZ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- 229910001948 sodium oxide Inorganic materials 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
- PTXVSDKCUJCCLC-UHFFFAOYSA-N 1-hydroxyindole Chemical compound C1=CC=C2N(O)C=CC2=C1 PTXVSDKCUJCCLC-UHFFFAOYSA-N 0.000 description 1
- MYRQVOZLLKJJIK-UHFFFAOYSA-N 1-methyl-3-phenylpyrrolidin-2-one Chemical compound O=C1N(C)CCC1C1=CC=CC=C1 MYRQVOZLLKJJIK-UHFFFAOYSA-N 0.000 description 1
- CWJVJGSIZDTKAQ-UHFFFAOYSA-N 2-(1h-indol-2-ylsulfanyl)acetonitrile Chemical compound C1=CC=C2NC(SCC#N)=CC2=C1 CWJVJGSIZDTKAQ-UHFFFAOYSA-N 0.000 description 1
- RZCPVVSHZUUUCW-UHFFFAOYSA-N 2-(1h-indol-3-ylsulfanyl)ethanamine Chemical compound C1=CC=C2C(SCCN)=CNC2=C1 RZCPVVSHZUUUCW-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000006022 2-methyl-2-propenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 description 1
- 235000011437 Amygdalus communis Nutrition 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- ZWXPDGCFMMFNRW-UHFFFAOYSA-N N-methylcaprolactam Chemical compound CN1CCCCCC1=O ZWXPDGCFMMFNRW-UHFFFAOYSA-N 0.000 description 1
- 241000220304 Prunus dulcis Species 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- WACQKHWOTAEEFS-UHFFFAOYSA-N cyclohexane;ethyl acetate Chemical compound CCOC(C)=O.C1CCCCC1 WACQKHWOTAEEFS-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000003046 intermediate neglect of differential overlap Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- DGEYTDCFMQMLTH-UHFFFAOYSA-N methanol;propan-2-ol Chemical compound OC.CC(C)O DGEYTDCFMQMLTH-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- DWCSXQCXXITVKE-UHFFFAOYSA-N triethyloxidanium Chemical compound CC[O+](CC)CC DWCSXQCXXITVKE-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US53761274A | 1974-12-30 | 1974-12-30 | |
| US63179875A | 1975-11-13 | 1975-11-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU667132A3 true SU667132A3 (ru) | 1979-06-05 |
Family
ID=27065555
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU752307502A SU667132A3 (ru) | 1974-12-30 | 1975-12-30 | Способ получени производных индола или их солей |
Country Status (27)
| Country | Link |
|---|---|
| JP (1) | JPS51131872A (enExample) |
| AR (1) | AR219052A1 (enExample) |
| AT (1) | AT356648B (enExample) |
| AU (1) | AU505215B2 (enExample) |
| CA (1) | CA1065874A (enExample) |
| CH (1) | CH622516A5 (enExample) |
| DD (1) | DD125781A5 (enExample) |
| DE (1) | DE2559211A1 (enExample) |
| DK (1) | DK580175A (enExample) |
| ES (1) | ES443935A1 (enExample) |
| FI (1) | FI64590C (enExample) |
| FR (2) | FR2296413A1 (enExample) |
| GB (1) | GB1527510A (enExample) |
| HU (2) | HU174948B (enExample) |
| IE (1) | IE42390B1 (enExample) |
| IL (1) | IL48756A (enExample) |
| IN (1) | IN142735B (enExample) |
| IT (1) | IT1052654B (enExample) |
| NL (1) | NL7515100A (enExample) |
| NO (1) | NO145383C (enExample) |
| NZ (1) | NZ179580A (enExample) |
| PH (1) | PH12328A (enExample) |
| PL (1) | PL99353B1 (enExample) |
| RO (1) | RO69196A (enExample) |
| SE (1) | SE422210B (enExample) |
| SU (1) | SU667132A3 (enExample) |
| YU (1) | YU332275A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1595056A (en) * | 1976-10-12 | 1981-08-05 | Wellcome Found | Pharmaceutical combination |
| FR2540109B1 (fr) * | 1983-01-28 | 1985-08-30 | Logeais Labor Jacques | Imino-2 pyrrolidines, leur procede de preparation et leurs applications en therapeutique |
| US4558048A (en) * | 1984-04-06 | 1985-12-10 | Pfizer Inc. | Method of treating diarrhoea using indole compounds |
| WO2001023350A1 (fr) * | 1999-09-28 | 2001-04-05 | Nihon Nohyaku Co., Ltd. | Derives de thioalkylamine et methode de preparation desdits derives |
| UA79504C2 (en) * | 2002-11-07 | 2007-06-25 | Organon Nv | Indols for treating diseases associated with androgen receptors |
| MXPA05004929A (es) | 2002-11-07 | 2005-08-18 | Akzo Nobel Nv | Indoles utiles en el tratamiento de enfermedades relacionadas a receptor de androgeno. |
| TW200602317A (en) | 2004-04-23 | 2006-01-16 | Akzo Nobel Nv | Novel androgens |
| WO2007020653A1 (en) * | 2005-08-12 | 2007-02-22 | Suven Life Sciences Limited | Thioether derivatives as functional 5-ht6 ligands |
-
1975
- 1975-12-17 NZ NZ179580A patent/NZ179580A/xx unknown
- 1975-12-17 IN IN2354/CAL/75A patent/IN142735B/en unknown
- 1975-12-18 NO NO754313A patent/NO145383C/no unknown
- 1975-12-19 SE SE7514458A patent/SE422210B/xx unknown
- 1975-12-19 DK DK580175A patent/DK580175A/da not_active Application Discontinuation
- 1975-12-24 CH CH1679775A patent/CH622516A5/de not_active IP Right Cessation
- 1975-12-24 NL NL7515100A patent/NL7515100A/xx not_active Application Discontinuation
- 1975-12-26 JP JP50155154A patent/JPS51131872A/ja active Pending
- 1975-12-29 AT AT986075A patent/AT356648B/de not_active IP Right Cessation
- 1975-12-29 ES ES443935A patent/ES443935A1/es not_active Expired
- 1975-12-29 PH PH7517930A patent/PH12328A/en unknown
- 1975-12-29 RO RO7584353A patent/RO69196A/ro unknown
- 1975-12-29 IT IT7552899A patent/IT1052654B/it active
- 1975-12-29 IL IL48756A patent/IL48756A/xx unknown
- 1975-12-29 GB GB53024/75A patent/GB1527510A/en not_active Expired
- 1975-12-29 YU YU03322/75A patent/YU332275A/xx unknown
- 1975-12-29 DD DD190619A patent/DD125781A5/xx unknown
- 1975-12-29 FI FI753669A patent/FI64590C/fi not_active IP Right Cessation
- 1975-12-29 CA CA242,669A patent/CA1065874A/en not_active Expired
- 1975-12-30 AU AU87916/75A patent/AU505215B2/en not_active Expired
- 1975-12-30 HU HU75ME1936A patent/HU174948B/hu unknown
- 1975-12-30 FR FR7540132A patent/FR2296413A1/fr active Granted
- 1975-12-30 AR AR261797A patent/AR219052A1/es active
- 1975-12-30 DE DE19752559211 patent/DE2559211A1/de not_active Ceased
- 1975-12-30 HU HU75ME2020A patent/HU174949B/hu unknown
- 1975-12-30 PL PL1975186097A patent/PL99353B1/pl unknown
- 1975-12-30 SU SU752307502A patent/SU667132A3/ru active
- 1975-12-30 IE IE2830/75A patent/IE42390B1/en unknown
-
1976
- 1976-08-30 FR FR7626153A patent/FR2315921A1/fr active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69717845T2 (de) | Substituierte oximderivate anwendbar als neurokinin-antagonisten | |
| DE69808765T2 (de) | Verbindungen | |
| EP0254322B1 (en) | Benzimidazole derivatives | |
| US4904666A (en) | Pyrazolo(3,4-d)pyrimidine compounds, compositions and method of use | |
| JP2002504483A (ja) | ヒスタミンh3受容体リガンド | |
| SU1380614A3 (ru) | Способ получени производных арилтиазолов или их хлористоводородных или бромистоводородных солей | |
| SU667132A3 (ru) | Способ получени производных индола или их солей | |
| NZ548530A (en) | Aryloxyalkylcarbamate-type derivatives, preparation method thereof and use of same in therapeutics | |
| CA2246118A1 (en) | Substituted quinolone derivatives and pharmaceuticals containing the same | |
| IE42978B1 (en) | Triaryl alkyl azabicyclo compounds | |
| JP3135170B2 (ja) | アミノメチル置換2,3−ジヒドロピラノ〔2,3−b〕ピリジン類 | |
| JPH02225468A (ja) | ピペリジン‐ジオン‐誘導体の還元法及び中間体 | |
| JPS63301871A (ja) | ピリミジンカルボン酸誘導体 | |
| US5030738A (en) | Synthesis of antiulcer compounds | |
| CA2173693A1 (en) | 4-indolylpiperazinyl derivatives | |
| EP0299449A2 (en) | Pyridazinone, triazinone and oxapyridazinone lipoxygenase inhibiting compounds | |
| WO2005005409A1 (de) | Verfahren zur herstellung von substituierten 2,6-dioxopiperidin-3-yl-verbindungen | |
| DE69223422T2 (de) | Benzothiadiazinderivate | |
| CA2033771C (en) | Indolylpropanols, process for their preparation and their use and preparations containing the compounds | |
| US3433802A (en) | 3-(n-lower-alkylanilino)pyrrolidines | |
| SU722480A3 (ru) | Способ получени -аминоалкоксициклоалканов или их солей | |
| US5120748A (en) | Substituted 1,2,3,6-tetrahydropyridines as central nervous system agents | |
| US4452803A (en) | Pyrrolylaminopiperidines | |
| CA2103663A1 (en) | 1-oxa-2,9-diphenyl-spiro(4,4)nonane derivatives as paf antagonists | |
| SU492517A1 (ru) | Способ получени 1-/ -аминофенил/-3 -/ -аминофенил/-7н-пирмдо-/2,3-с/карбазола |