SU648047A3 - Гербицидна композици - Google Patents
Гербицидна композициInfo
- Publication number
- SU648047A3 SU648047A3 SU762422654A SU2422654A SU648047A3 SU 648047 A3 SU648047 A3 SU 648047A3 SU 762422654 A SU762422654 A SU 762422654A SU 2422654 A SU2422654 A SU 2422654A SU 648047 A3 SU648047 A3 SU 648047A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- isopropyl
- dioxide
- compound
- tab
- herbicide
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title description 2
- 239000004009 herbicide Substances 0.000 title 1
- 150000001875 compounds Chemical class 0.000 description 7
- 239000013543 active substance Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- -1 halide methyl esters Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 230000003245 working effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/15—Six-membered rings
- C07D285/16—Thiadiazines; Hydrogenated thiadiazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2553209A DE2553209C2 (de) | 1975-11-27 | 1975-11-27 | 1-Methoxymethyl-3-isopropyl-2,1,3-benzothiadiazin(4)on-2,2-dioxid und diese enthaltende Herbizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU648047A3 true SU648047A3 (ru) | 1979-02-15 |
Family
ID=5962736
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU762422654A SU648047A3 (ru) | 1975-11-27 | 1976-11-25 | Гербицидна композици |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4075004A (OSRAM) |
| JP (1) | JPS5268192A (OSRAM) |
| AR (1) | AR223802A1 (OSRAM) |
| AT (1) | AT350837B (OSRAM) |
| AU (1) | AU502268B2 (OSRAM) |
| BE (1) | BE848694A (OSRAM) |
| BR (1) | BR7607937A (OSRAM) |
| CA (1) | CA1074794A (OSRAM) |
| CH (1) | CH625395A5 (OSRAM) |
| DE (1) | DE2553209C2 (OSRAM) |
| DK (1) | DK145496C (OSRAM) |
| FR (1) | FR2332986A1 (OSRAM) |
| GB (1) | GB1561050A (OSRAM) |
| IL (1) | IL50702A (OSRAM) |
| IT (1) | IT1066622B (OSRAM) |
| NL (1) | NL7613158A (OSRAM) |
| NZ (1) | NZ182537A (OSRAM) |
| SE (1) | SE7613038L (OSRAM) |
| SU (1) | SU648047A3 (OSRAM) |
| ZA (1) | ZA766301B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2458343A1 (de) * | 1974-12-10 | 1976-06-16 | Basf Ag | N-n'-disubstituierte 2,1,3-benzothiadiazin(4)on-2.2-dioxide |
| DE2656290A1 (de) * | 1976-12-11 | 1978-06-15 | Basf Ag | Benzothiadiazinverbindungen |
| JPH0239520A (ja) * | 1988-07-29 | 1990-02-08 | Tokyo Electron Ltd | レジスト膜厚の測定方法 |
| DE19814805A1 (de) | 1998-04-02 | 1999-10-07 | Bosch Gmbh Robert | Beschichtungsverfahren eines Wischergummis |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1354761A (fr) * | 1959-09-30 | 1964-03-13 | Geigy Ag J R | Nouveaux 1.1-dioxydes de 3-oxo-1.2.6-thiadiazines et leur préparation |
| DE2105687C2 (de) * | 1971-02-08 | 1981-09-24 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von 3-substituierten 2,1,3-Benzothiadiazin-4-on-2,2-dioxiden |
| CA1031339A (en) * | 1973-09-17 | 1978-05-16 | Lennon H. Mckendry | Substituted 4(3h)-oxobenzo-2,1,3-thiadiazine-2,2-dioxides and their use as herbicides |
| CA1024144A (en) * | 1973-09-17 | 1978-01-10 | The Dow Chemical Company | 4(3h)-oxobenzo-2,1,3-thiadiazine-2,2-dioxides |
| DE2349114C2 (de) * | 1973-09-29 | 1985-11-14 | Basf Ag, 6700 Ludwigshafen | 3-sek.-Butyl-2,1,3-benzothiadiazin-(4)-on-2,2-dioxid |
| DE2355113A1 (de) * | 1973-11-03 | 1975-05-15 | Basf Ag | N,n'-disubstituierte 2,1,3-benzothiadiazin-(4)-on-2,2-dioxide |
| US3920641A (en) * | 1973-11-05 | 1975-11-18 | Dow Chemical Co | 1H-pyrido(2,3-c or 4,3-c) (1,2,6)thiadiazin-4(3H)-one-2,2-dioxides |
| DE2458343A1 (de) * | 1974-12-10 | 1976-06-16 | Basf Ag | N-n'-disubstituierte 2,1,3-benzothiadiazin(4)on-2.2-dioxide |
-
1975
- 1975-11-27 DE DE2553209A patent/DE2553209C2/de not_active Expired
-
1976
- 1976-10-18 US US05/733,524 patent/US4075004A/en not_active Expired - Lifetime
- 1976-10-18 IL IL50702A patent/IL50702A/xx unknown
- 1976-10-20 AU AU18855/76A patent/AU502268B2/en not_active Expired
- 1976-10-22 ZA ZA766301A patent/ZA766301B/xx unknown
- 1976-10-29 CA CA264,746A patent/CA1074794A/en not_active Expired
- 1976-11-02 AR AR265314A patent/AR223802A1/es active
- 1976-11-05 NZ NZ182537A patent/NZ182537A/xx unknown
- 1976-11-22 SE SE7613038A patent/SE7613038L/xx not_active Application Discontinuation
- 1976-11-24 BE BE172651A patent/BE848694A/xx not_active IP Right Cessation
- 1976-11-25 JP JP51140827A patent/JPS5268192A/ja active Granted
- 1976-11-25 CH CH1486776A patent/CH625395A5/de not_active IP Right Cessation
- 1976-11-25 NL NL7613158A patent/NL7613158A/xx not_active Application Discontinuation
- 1976-11-25 SU SU762422654A patent/SU648047A3/ru active
- 1976-11-25 IT IT52348/76A patent/IT1066622B/it active
- 1976-11-26 AT AT877776A patent/AT350837B/de not_active IP Right Cessation
- 1976-11-26 GB GB49368/76A patent/GB1561050A/en not_active Expired
- 1976-11-26 FR FR7635800A patent/FR2332986A1/fr active Granted
- 1976-11-26 BR BR7607937A patent/BR7607937A/pt unknown
- 1976-11-26 DK DK534976A patent/DK145496C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT350837B (de) | 1979-06-25 |
| BR7607937A (pt) | 1977-11-08 |
| CA1074794A (en) | 1980-04-01 |
| NZ182537A (en) | 1978-04-03 |
| ZA766301B (en) | 1977-10-26 |
| DK145496C (da) | 1983-05-09 |
| IL50702A0 (en) | 1976-12-31 |
| ATA877776A (de) | 1978-11-15 |
| DK534976A (da) | 1977-05-28 |
| JPS6115072B2 (OSRAM) | 1986-04-22 |
| FR2332986A1 (fr) | 1977-06-24 |
| NL7613158A (nl) | 1977-06-01 |
| AU1885576A (en) | 1978-04-27 |
| BE848694A (fr) | 1977-05-24 |
| SE7613038L (sv) | 1977-05-28 |
| DE2553209A1 (de) | 1977-06-16 |
| US4075004A (en) | 1978-02-21 |
| GB1561050A (en) | 1980-02-13 |
| IT1066622B (it) | 1985-03-12 |
| FR2332986B1 (OSRAM) | 1980-03-28 |
| AU502268B2 (en) | 1979-07-19 |
| JPS5268192A (en) | 1977-06-06 |
| DE2553209C2 (de) | 1986-01-02 |
| IL50702A (en) | 1979-10-31 |
| CH625395A5 (OSRAM) | 1981-09-30 |
| AR223802A1 (es) | 1981-09-30 |
| DK145496B (da) | 1982-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU654145A3 (ru) | Способ борьбы с грибками | |
| SU510984A3 (ru) | Гербицидный состав | |
| DE3070413D1 (en) | Quinoxalinyloxyphenoxyalkane carboxylic acid derivatives, their preparation and their use as herbicides | |
| SU670194A3 (ru) | Гербицидна композици | |
| SU648047A3 (ru) | Гербицидна композици | |
| SU708977A3 (ru) | Гербицидное средство | |
| SU552010A3 (ru) | Гербицидное средство | |
| SU667099A3 (ru) | Гербицидное средство | |
| SU522767A3 (ru) | Гербицидный состав | |
| SU563893A3 (ru) | Гербицидный состав | |
| SU572174A3 (ru) | Гербицидна композици | |
| SU710498A3 (ru) | Гербицидный состав | |
| SU577933A3 (ru) | Гербицидное средство | |
| SU571175A3 (ru) | Гербицидное средство | |
| SU582738A3 (ru) | Регул тор роста растений | |
| SU507202A3 (ru) | Гербицидный состав | |
| SU495802A3 (ru) | Гербицидный состав | |
| SU639410A3 (ru) | Гербицидное средство | |
| SU701518A3 (ru) | Пестицидна композици | |
| SU503483A3 (ru) | Гербицидна смесь | |
| SU843696A3 (ru) | Гербицидный состав | |
| SU710501A3 (ru) | Гербицидный состав | |
| SU659064A3 (ru) | Инсектицидное средство | |
| SU504449A3 (ru) | Гербицидный состав | |
| SU552892A3 (ru) | Гербицидна композици |