SU564813A3 - Способ получени производных индолохинолизина или их солей - Google Patents
Способ получени производных индолохинолизина или их солейInfo
- Publication number
- SU564813A3 SU564813A3 SU7502133393A SU2133393A SU564813A3 SU 564813 A3 SU564813 A3 SU 564813A3 SU 7502133393 A SU7502133393 A SU 7502133393A SU 2133393 A SU2133393 A SU 2133393A SU 564813 A3 SU564813 A3 SU 564813A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- salts
- indoloquinolysine
- formula
- obtaining derivatives
- derivatives
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title description 8
- 238000000034 method Methods 0.000 title description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 10
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- -1 aliphatic carboxylic anhydride Chemical class 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 3
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 150000007530 organic bases Chemical group 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- NMDQVCDFLXXRTG-UHFFFAOYSA-N 1,2,3,4,6,7,8,12c-octahydroindolo[3,2-a]quinolizine Chemical group N1C2=CC=CC=C2C2=C1CCN1CCCCC12 NMDQVCDFLXXRTG-UHFFFAOYSA-N 0.000 description 1
- GAZNVVBKELWTBC-UHFFFAOYSA-N 2,3,4-trimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C(OC)=C1OC GAZNVVBKELWTBC-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000000112 colonic effect Effects 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002496 iodine Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI536A HU170495B (enExample) | 1974-05-07 | 1974-05-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU564813A3 true SU564813A3 (ru) | 1977-07-05 |
Family
ID=11000947
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7502133393A SU564813A3 (ru) | 1974-05-07 | 1975-05-06 | Способ получени производных индолохинолизина или их солей |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4036841A (enExample) |
| JP (1) | JPS5218717B2 (enExample) |
| AT (1) | AT344697B (enExample) |
| BE (1) | BE828621A (enExample) |
| BG (1) | BG27089A3 (enExample) |
| CA (1) | CA1051900A (enExample) |
| CH (1) | CH615182A5 (enExample) |
| CS (1) | CS198166B2 (enExample) |
| DD (1) | DD120196A5 (enExample) |
| DE (1) | DE2520131C3 (enExample) |
| DK (1) | DK141068C (enExample) |
| FR (1) | FR2269947B1 (enExample) |
| HU (1) | HU170495B (enExample) |
| IL (1) | IL47169A (enExample) |
| NL (1) | NL181007C (enExample) |
| PL (1) | PL95414B1 (enExample) |
| SE (1) | SE420411B (enExample) |
| SU (1) | SU564813A3 (enExample) |
| YU (1) | YU39201B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU178700B (en) * | 1978-02-10 | 1982-06-28 | Richter Gedeon Vegyeszet | Process for preparing 1,1-disubstituted octahydro-indolo/2,3-a/-quinolizines |
| HU195214B (en) * | 1985-04-19 | 1988-04-28 | Richter Gedeon Vegyeszet | Process for producing 12b-substituted-1-(hydroxymethyl)-octahydro-indolo /2,3-a/ quinolizine derivatives and pharmaceutical preparations comprising these compounds |
| HU194221B (en) * | 1985-04-19 | 1988-01-28 | Richter Gedeon Vegyeszet | Process for preparing novel octahydro-indolo/2,3-a/quinoline derivative and pharmaceutical comprising this compound |
| HU207070B (en) * | 1990-10-31 | 1993-03-01 | Richter Gedeon Vegyeszet | Process for producing 1beta-ethyl-1alpha-hydroxymethyl-1,2,3,4,6,712,12balpha-octahydroindolo(2,3-a) quinolizine |
| US7592350B2 (en) * | 2002-04-03 | 2009-09-22 | Orion Corporation | Polycyclic compounds as potent alpha2-adrenoceptor antagonists |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3120538A (en) * | 1964-02-04 | -y-bromine butyric acid ethylester |
-
1974
- 1974-05-07 HU HURI536A patent/HU170495B/hu unknown
-
1975
- 1975-04-24 IL IL47169A patent/IL47169A/xx unknown
- 1975-04-24 CA CA225,577A patent/CA1051900A/en not_active Expired
- 1975-04-26 YU YU01078/75A patent/YU39201B/xx unknown
- 1975-04-29 NL NLAANVRAGE7505079,A patent/NL181007C/xx not_active IP Right Cessation
- 1975-04-29 FR FR7513360A patent/FR2269947B1/fr not_active Expired
- 1975-04-30 BE BE155983A patent/BE828621A/xx not_active IP Right Cessation
- 1975-04-30 BG BG029833A patent/BG27089A3/xx unknown
- 1975-05-05 CS CS753112A patent/CS198166B2/cs unknown
- 1975-05-06 US US05/575,038 patent/US4036841A/en not_active Expired - Lifetime
- 1975-05-06 DE DE2520131A patent/DE2520131C3/de not_active Expired
- 1975-05-06 PL PL1975180180A patent/PL95414B1/pl unknown
- 1975-05-06 DD DD185860A patent/DD120196A5/xx unknown
- 1975-05-06 SU SU7502133393A patent/SU564813A3/ru active
- 1975-05-06 AT AT345075A patent/AT344697B/de not_active IP Right Cessation
- 1975-05-06 CH CH579875A patent/CH615182A5/de not_active IP Right Cessation
- 1975-05-06 SE SE7505272A patent/SE420411B/xx not_active IP Right Cessation
- 1975-05-06 DK DK198175A patent/DK141068C/da not_active IP Right Cessation
- 1975-05-07 JP JP50053955A patent/JPS5218717B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1051900A (en) | 1979-04-03 |
| FR2269947B1 (enExample) | 1978-10-06 |
| IL47169A0 (en) | 1975-07-28 |
| YU107875A (en) | 1982-05-31 |
| DE2520131B2 (de) | 1980-10-23 |
| HU170495B (enExample) | 1977-06-28 |
| DE2520131C3 (de) | 1981-07-30 |
| DD120196A5 (enExample) | 1976-06-05 |
| AU8054575A (en) | 1976-10-28 |
| PL95414B1 (pl) | 1977-10-31 |
| NL181007B (nl) | 1987-01-02 |
| NL181007C (nl) | 1987-06-01 |
| US4036841A (en) | 1977-07-19 |
| CS198166B2 (en) | 1980-05-30 |
| DK141068B (da) | 1980-01-07 |
| BG27089A3 (bg) | 1979-08-15 |
| ATA345075A (de) | 1977-12-15 |
| DK198175A (da) | 1975-11-08 |
| SE420411B (sv) | 1981-10-05 |
| DK141068C (da) | 1980-06-16 |
| JPS50151898A (enExample) | 1975-12-06 |
| FR2269947A1 (enExample) | 1975-12-05 |
| BE828621A (fr) | 1975-08-18 |
| SE7505272L (sv) | 1975-11-10 |
| NL7505079A (nl) | 1975-11-11 |
| IL47169A (en) | 1978-06-15 |
| CH615182A5 (enExample) | 1980-01-15 |
| DE2520131A1 (de) | 1975-11-27 |
| YU39201B (en) | 1984-08-31 |
| AT344697B (de) | 1978-08-10 |
| JPS5218717B2 (enExample) | 1977-05-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU931104A3 (ru) | Способ получени 1-/п-метоксибензоил/-2-пирролидинона | |
| SU510999A3 (ru) | Способ получени (метоксиметил-фурилметил)6,7-бензоморфанов илиморфинанов | |
| JPH0236595B2 (enExample) | ||
| US2883384A (en) | Production of reserpine and analogs thereof | |
| SU719499A3 (ru) | Способ получени производных 1,2,3,4,6,7-гексагидро-11 в н-бензо( )-хинолизина или их солей | |
| SU481155A3 (ru) | Способ получени -(фурил-метил)морфинанов | |
| SU564813A3 (ru) | Способ получени производных индолохинолизина или их солей | |
| SU818484A3 (ru) | Способ получени 4а, 9 -транс-гЕКСАгидРО - -КАРбОлиНА | |
| SU575031A3 (ru) | Способ получени конденсированных трициклических производных имидазола или их солей | |
| JPS6284083A (ja) | ジヒドロリセルグ酸のn−アルキル化法 | |
| US4308206A (en) | Process for preparing derivatives of 5,11-dihydro-6h-pyrido[2,3-b][1,4]-benzodiazepin-6-one, and the final derivatives and synthesis intermediates obtained thereby | |
| NO137999B (no) | Analogifremgangsm}te ved fremstilling av terapeutisk aktive oxofurylestere av 6-(alfa-aminofenylacetamido)-penicillansyre | |
| US4044012A (en) | Indolo-quinolizidine derivatives | |
| US4988822A (en) | Intermediates for preparing 5-aroyl-1,2-dihydro-3H-pyrrolo(1,2-A)pyrrole-1,1-dicarboxylates | |
| SU786902A3 (ru) | Способ получени 6-амино-2,3,5,6-тетрагидро-спиро /пенам-2,4-(4н)(тио)пиран/-3карбоновой кислоты или ее сложного эфира | |
| SU539521A3 (ru) | Способ получени аминоэфиров или их солей | |
| SU971099A3 (ru) | Способ получени производных октагидроиндоло /2,3-а/ хинолизина или их солей | |
| SU900802A3 (ru) | Способ получени этиленимино-циано-азометинов | |
| SAIGA et al. | Synthesis of 1, 2, 3, 4-tetrahydro-β-carboline derivatives as hepatoprotective agents. IV. Positional isomers of 1, 2, 3, 4-tetrahydro-2-methylthiothiocarbonyl-β-carboline-3-carboxylic acid and its 1-alkylated derivatives | |
| SU415882A3 (enExample) | ||
| SU1313856A1 (ru) | Способ получени производных цис- или транс-диаминодибензоилдибензо-18-краун-6 | |
| SU440837A1 (enExample) | ||
| SU764321A1 (ru) | Способ получени производных 5-тозилиндоло(3,2-в) индола | |
| SU687075A1 (ru) | Способ получени 2,3-дизамещенных 6-азаиндола | |
| NO300688B1 (no) | Fremgangsmåte for fremstilling av 1<beta>-ethyl-1<alfa>-(hydroxymethyl)-1,2,3,4,6,7,12,12b<alfa>octahydro-indolo£2,3-a|kinolizin og nye mellomprodukter |