SU422146A3 - - Google Patents
Info
- Publication number
- SU422146A3 SU422146A3 SU1777511A SU1777511A SU422146A3 SU 422146 A3 SU422146 A3 SU 422146A3 SU 1777511 A SU1777511 A SU 1777511A SU 1777511 A SU1777511 A SU 1777511A SU 422146 A3 SU422146 A3 SU 422146A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- ether
- bromophenyl
- bromine
- chlorine
- pyridyl
- Prior art date
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 230000018044 dehydration Effects 0.000 claims description 4
- 238000006297 dehydration reaction Methods 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003222 pyridines Chemical class 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 238000002955 isolation Methods 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 36
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- -1 for example Substances 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003509 tertiary alcohols Chemical class 0.000 description 2
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 1
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 1
- BSDGZUDFPKIYQG-UHFFFAOYSA-N 4-bromopyridine Chemical compound BrC1=CC=NC=C1 BSDGZUDFPKIYQG-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- CCZVEWRRAVASGL-UHFFFAOYSA-N lithium;2-methanidylpropane Chemical compound [Li+].CC(C)[CH2-] CCZVEWRRAVASGL-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE05496/71A SE361663B (https=) | 1971-04-28 | 1971-04-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU422146A3 true SU422146A3 (https=) | 1974-03-30 |
Family
ID=20266610
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1777511A SU422146A3 (https=) | 1971-04-28 | 1972-04-24 |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS5512424B1 (https=) |
| AT (1) | AT319242B (https=) |
| AU (1) | AU469519B2 (https=) |
| BE (1) | BE781105A (https=) |
| BR (1) | BR7202598D0 (https=) |
| CA (1) | CA974999A (https=) |
| CH (1) | CH577474A5 (https=) |
| CY (1) | CY876A (https=) |
| DE (1) | DE2220333C3 (https=) |
| DK (1) | DK138987B (https=) |
| ES (1) | ES401908A1 (https=) |
| FI (1) | FI56378C (https=) |
| FR (1) | FR2134379B1 (https=) |
| GB (1) | GB1366241A (https=) |
| HK (1) | HK69576A (https=) |
| IE (1) | IE36330B1 (https=) |
| IT (1) | IT1188904B (https=) |
| NL (1) | NL170731C (https=) |
| NO (1) | NO135590C (https=) |
| SE (1) | SE361663B (https=) |
| SU (1) | SU422146A3 (https=) |
| ZA (1) | ZA721503B (https=) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE409706B (sv) * | 1976-05-21 | 1979-09-03 | Astra Pharma Prod | Forfarande for framstellning av n,n-dimetyl-3-(4-bromfenyl)-3-3(3-pyridyl)-allylamin dihydroklorid monohydrat |
| SE7909514L (sv) * | 1979-11-16 | 1981-05-17 | Astra Laekemedel Ab | Nya halofenyl-pyridyl-allylaminderivat |
| CA1327795C (en) * | 1987-08-14 | 1994-03-15 | Jules Freedman | Antidepressants which are aryloxy inadanamines |
| US5585388A (en) * | 1995-04-07 | 1996-12-17 | Sibia Neurosciences, Inc. | Substituted pyridines useful as modulators of acetylcholine receptors |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2712020A (en) * | 1948-07-20 | 1955-06-28 | Burroughs Wellcome Co | Heterocyclic allylamines |
-
1971
- 1971-04-28 SE SE05496/71A patent/SE361663B/xx unknown
-
1972
- 1972-03-06 ZA ZA721503A patent/ZA721503B/xx unknown
- 1972-03-23 BE BE781105A patent/BE781105A/xx not_active IP Right Cessation
- 1972-03-28 FI FI858/72A patent/FI56378C/fi active
- 1972-04-05 NO NO1147/72A patent/NO135590C/no unknown
- 1972-04-10 AU AU40965/72A patent/AU469519B2/en not_active Expired
- 1972-04-12 FR FR7212835A patent/FR2134379B1/fr not_active Expired
- 1972-04-19 ES ES401908A patent/ES401908A1/es not_active Expired
- 1972-04-21 CH CH593872A patent/CH577474A5/xx not_active IP Right Cessation
- 1972-04-24 AT AT357372A patent/AT319242B/de not_active IP Right Cessation
- 1972-04-24 SU SU1777511A patent/SU422146A3/ru active
- 1972-04-26 DE DE2220333A patent/DE2220333C3/de not_active Expired
- 1972-04-26 DK DK205772AA patent/DK138987B/da unknown
- 1972-04-27 BR BR2598/72A patent/BR7202598D0/pt unknown
- 1972-04-27 IE IE555/72A patent/IE36330B1/xx unknown
- 1972-04-27 CA CA140,717A patent/CA974999A/en not_active Expired
- 1972-04-27 GB GB1958872A patent/GB1366241A/en not_active Expired
- 1972-04-27 CY CY876A patent/CY876A/xx unknown
- 1972-04-28 JP JP4602272A patent/JPS5512424B1/ja active Pending
- 1972-04-28 NL NLAANVRAGE7205850,A patent/NL170731C/xx not_active IP Right Cessation
-
1976
- 1976-11-04 HK HK695/76*UA patent/HK69576A/xx unknown
-
1980
- 1980-02-15 IT IT47915/80A patent/IT1188904B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| IT1188904B (it) | 1988-01-28 |
| DK138987B (da) | 1978-11-27 |
| ZA721503B (en) | 1972-11-29 |
| DE2220333B2 (de) | 1979-03-01 |
| AT319242B (de) | 1974-12-10 |
| AU469519B2 (en) | 1972-10-18 |
| CY876A (en) | 1977-03-18 |
| NO135590B (https=) | 1977-01-17 |
| CA974999A (en) | 1975-09-23 |
| BR7202598D0 (pt) | 1973-07-17 |
| DE2220333A1 (de) | 1974-01-31 |
| IT8047915A1 (it) | 1981-08-15 |
| BE781105A (fr) | 1972-07-17 |
| SE361663B (https=) | 1973-11-12 |
| NL170731C (nl) | 1982-12-16 |
| NL7205850A (https=) | 1972-10-31 |
| GB1366241A (en) | 1974-09-11 |
| IE36330B1 (en) | 1976-10-13 |
| HK69576A (en) | 1976-11-12 |
| FR2134379B1 (https=) | 1976-09-17 |
| DE2220333C3 (de) | 1979-11-22 |
| IT8047915A0 (it) | 1980-02-15 |
| FI56378C (fi) | 1980-01-10 |
| JPS5512424B1 (https=) | 1980-04-02 |
| AU4096572A (en) | 1972-10-18 |
| CH577474A5 (https=) | 1976-07-15 |
| NL170731B (nl) | 1982-07-16 |
| FR2134379A1 (https=) | 1972-12-08 |
| DK138987C (https=) | 1979-05-14 |
| FI56378B (fi) | 1979-09-28 |
| IE36330L (en) | 1972-10-28 |
| NO135590C (https=) | 1977-04-27 |
| ES401908A1 (es) | 1975-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU543343A3 (ru) | Способ получени производных индола или их солей | |
| SU450398A3 (ru) | Способ получени -арил-2аминоалкоксистиролов | |
| SU1077566A3 (ru) | Способ получени производных пиридоксина или их солей с кислотами | |
| SU439965A1 (ru) | Способ получени -арил-2-аминоалкоксистилолов | |
| SU503521A3 (ru) | Способ получени производных морфолина | |
| SU416945A3 (ru) | Способ получения рацемических или оптически активных производных пиперазина | |
| SU422146A3 (https=) | ||
| CN107652228B (zh) | 抗肾纤维化药物1-(取代苄基)-5-三氟甲基-2(1h)-吡啶酮盐酸盐的合成方法 | |
| SU489321A3 (ru) | Способ получени замещенных индолинов | |
| US2704757A (en) | 5-hydroxy-3, 4, 5, 6-tetrahydropyriminines | |
| US2970149A (en) | Certain 1-[(2-pyridyl)-lower alkyl]-2-(tertamino-lower alkyl)-indan-1-ols, and acid addition salts | |
| US4504482A (en) | [5(or 4)-(Pyridinyl)-2-pyrimidinyl]ureas and cardiotonic use thereof | |
| SU664564A3 (ru) | Способ получени производных фенилпиперазина или их солей | |
| SU518133A3 (ru) | Способ получени производных имидазо /2,1-в/ тиазола | |
| SU481153A3 (ru) | Способ получени цианфеноксиацетонитрилов | |
| SU486508A3 (ru) | Способ получени замещенных гуанидинофенилмочевины | |
| US2485662A (en) | Alpha-(aminoalkyl)-stilbenes | |
| US3075971A (en) | Triaryl-ethenes | |
| US2761866A (en) | 3-pyridine sulfinic acid and process | |
| NO126374B (https=) | ||
| SU455952A1 (ru) | Способ очистки сульфониламидных препаратов | |
| SU430554A1 (ru) | Способ получения производных 2,3-бензоксазепина | |
| SU428600A3 (ru) | Способ получения третичных аминокислот или их солей | |
| US2949461A (en) | Certain alpha-phenyl-imino-3-phenyl-thiazolines | |
| JPS62167781A (ja) | イソキノリン誘導体およびその製造法 |