SU1421257A3 - Способ получени гранул нитрата аммони - Google Patents
Способ получени гранул нитрата аммони Download PDFInfo
- Publication number
- SU1421257A3 SU1421257A3 SU802894302A SU2894302A SU1421257A3 SU 1421257 A3 SU1421257 A3 SU 1421257A3 SU 802894302 A SU802894302 A SU 802894302A SU 2894302 A SU2894302 A SU 2894302A SU 1421257 A3 SU1421257 A3 SU 1421257A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- granules
- ammonium nitrate
- spraying
- temperature
- fluidized bed
- Prior art date
Links
- 239000008187 granular material Substances 0.000 title claims abstract description 46
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 title claims description 36
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000001816 cooling Methods 0.000 claims abstract description 13
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Inorganic materials [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 claims abstract description 11
- 238000005507 spraying Methods 0.000 claims abstract description 10
- 239000000243 solution Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 8
- 238000010521 absorption reaction Methods 0.000 claims description 7
- 230000003179 granulation Effects 0.000 claims description 7
- 238000005469 granulation Methods 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 229910000514 dolomite Inorganic materials 0.000 claims description 4
- 239000010459 dolomite Substances 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 2
- 238000001704 evaporation Methods 0.000 claims description 2
- 230000008020 evaporation Effects 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 239000008188 pellet Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- 239000000725 suspension Substances 0.000 abstract description 3
- 239000012764 mineral filler Substances 0.000 abstract 1
- 239000011777 magnesium Substances 0.000 description 5
- 239000002245 particle Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000002360 explosive Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 206010051602 Laziness Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000005474 detonation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01C—AMMONIA; CYANOGEN; COMPOUNDS THEREOF
- C01C1/00—Ammonia; Compounds thereof
- C01C1/18—Nitrates of ammonium
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05C—NITROGENOUS FERTILISERS
- C05C1/00—Ammonium nitrate fertilisers
- C05C1/02—Granulation; Pelletisation; Stabilisation; Colouring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Fertilizers (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
- Catalysts (AREA)
- Medicinal Preparation (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7902086,A NL173387C (nl) | 1979-03-15 | 1979-03-15 | Werkwijze voor het maken van stabiele, ammoniumnitraat bevattende meststofkorrels. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1421257A3 true SU1421257A3 (ru) | 1988-08-30 |
Family
ID=19832816
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU802894302A SU1421257A3 (ru) | 1979-03-15 | 1980-03-14 | Способ получени гранул нитрата аммони |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4316736A (enExample) |
| JP (1) | JPS6038335B2 (enExample) |
| AT (1) | AT372361B (enExample) |
| BE (1) | BE882214A (enExample) |
| CA (1) | CA1139920A (enExample) |
| CS (1) | CS222172B2 (enExample) |
| DE (1) | DE3008891C2 (enExample) |
| DK (1) | DK151190C (enExample) |
| DZ (1) | DZ230A1 (enExample) |
| ES (1) | ES489170A1 (enExample) |
| FI (1) | FI66341C (enExample) |
| FR (1) | FR2451351A1 (enExample) |
| GB (1) | GB2045735B (enExample) |
| GR (1) | GR67266B (enExample) |
| HU (1) | HU181068B (enExample) |
| IE (1) | IE49520B1 (enExample) |
| NL (1) | NL173387C (enExample) |
| NO (1) | NO149658C (enExample) |
| PT (1) | PT70930A (enExample) |
| RO (1) | RO79840A (enExample) |
| SE (1) | SE439155B (enExample) |
| SU (1) | SU1421257A3 (enExample) |
| TR (1) | TR20418A (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2223934C1 (ru) * | 2002-09-03 | 2004-02-20 | Открытое акционерное общество "Кирово-Чепецкий химический комбинат им. Б.П.Константинова" | Способ получения известково-аммиачной селитры |
| RU2241691C2 (ru) * | 2001-01-16 | 2004-12-10 | Открытое акционерное общество "Концерн Стирол" | Способ получения прочных гранул аммиачной селитры |
| RU2290391C1 (ru) * | 2005-08-22 | 2006-12-27 | ОАО "Минудобрения" | Способ получения азотного удобрения |
| RU2312846C2 (ru) * | 2003-08-11 | 2007-12-20 | Открытое акционерное общество "Минерально-химическая компания "ЕвроХим" (ОАО "МХК "ЕвроХим") | Способ получения азотного удобрения |
| RU2436753C2 (ru) * | 2006-01-13 | 2011-12-20 | Хонейвелл Интернэншл Инк. | Композиции, содержащие двойные соли нитрата аммония |
| RU2629055C2 (ru) * | 2015-10-09 | 2017-08-24 | Геннадий Михайлович Морозов | Способ получения гранул нитрата аммония разбрызгиванием его расплава |
| RU2769477C2 (ru) * | 2017-06-23 | 2022-04-01 | Яра Интернэшнл Aсa | Улучшение антислеживающих свойств частиц нитрата аммония при хранении в закрытом контейнере |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2481611A1 (fr) * | 1980-05-05 | 1981-11-06 | Generale Engrais Sa | Procede de fabrication de produits sous forme de particules solides notamment d'engrais granules np/npk contenant du phosphate d'ammonium |
| NL8102959A (nl) * | 1981-06-19 | 1983-01-17 | Unie Van Kunstmestfab Bv | Werkwijze voor het bereiden van thermisch stabiele ammoniumnitraatbevattende granules, alsmede granules verkregen met deze werkwijze. |
| NL8102958A (nl) * | 1981-06-19 | 1983-01-17 | Unie Van Kunstmestfab Bv | Werkwijze voor het bereiden van thermisch stabiele ammoniumnitraatbevattende granules met hoog stortgewicht, alsmede granules verkregen met deze werkwijze. |
| NL8102957A (nl) * | 1981-06-19 | 1983-01-17 | Unie Van Kunstmestfab Bv | Werkwijze voor het bereiden van ammoniumnitraatbevattende granules met hoog stortgewicht, alsmede granules verkregen met deze werkwijze. |
| NL8102960A (nl) * | 1981-06-19 | 1983-01-17 | Unie Van Kunstmestfab Bv | Werkwijze voor het bereiden van thermisch stabiele ammoniumnitraatbevattende granules met hoog stortgewicht, alsmede granules verkregen met deze werkwijze. |
| NL8104285A (nl) * | 1981-09-17 | 1983-04-18 | Unie Van Kunstmestfab Bv | Werkwijze voor het koelen van hete ammoniumnitraat bevattende granules, alsmede granules verkregen met deze werkwijze. |
| NL8104284A (nl) * | 1981-09-17 | 1983-04-18 | Unie Van Kunstmestfab Bv | Werkwijze voor het bereiden van magnesiumnitraathexahydraat, alsmede voor het thermisch stabiliseren van ammoniumnitraat onder toepassing van een zo verkregen magnesiumnitraathexahydraat. |
| JPS58120587A (ja) * | 1982-01-07 | 1983-07-18 | 東洋エンジニアリング株式会社 | 粒状化成肥料の製法 |
| NL8202216A (nl) * | 1982-06-01 | 1984-01-02 | Unie Van Kunstmestfab Bv | Werkwijze voor het bereiden van niet samenbakkende ammoniumnitraat bevattende granules, alsmede granules verkregen met deze werkwijze. |
| NO151037C (no) * | 1982-09-14 | 1985-01-30 | Norsk Hydro As | Stabilisert ammoniumnitrat eller ammonium-nitrat-rike produkter samt fremgangsmaate for frmstilling av slike produkter |
| NO175814B1 (no) * | 1992-07-03 | 1995-01-02 | Yara Int Asa | Fremgangsmate ved fremstilling av frittflytende ammoniumnitratpartikler |
| FR2757842B1 (fr) * | 1996-12-31 | 1999-11-19 | Kaltenbach Thuring Sa | Procede et installation pour la fabrication de nitrate d'ammoniaque poreux |
| FR2782075B1 (fr) * | 1998-08-07 | 2000-09-15 | Hydro Agri France | Procede de preparation de produits a base de nitrate d'ammonium de stabilite thermique renforcee et produits obtenus |
| EP1304164A1 (en) * | 2001-10-15 | 2003-04-23 | Haldor Topsoe A/S | Process for the production of mixed metal oxide containing catalysts |
| JP4229840B2 (ja) * | 2002-02-08 | 2009-02-25 | エスケー エナジー 株式会社 | ヒーターチューブの洗浄のための洗浄剤および方法 |
| EP1411036B1 (en) * | 2002-10-17 | 2019-02-20 | Fertinagro Biotech, S.L. | Method of obtaining nitrogenated granular fertilizers with a high microelement content and fertilizers obtained thereby |
| RU2228919C1 (ru) * | 2003-04-21 | 2004-05-20 | Открытое акционерное общество "Акрон" | Способ получения аммиачно-нитратного удобрения |
| DE102010032021B4 (de) * | 2010-07-16 | 2016-09-29 | Sandvik Materials Technology Deutschland Gmbh | Verfahren zum Herstellen von Ammoniumnitrat enthaltenden Partikeln |
| NO336052B1 (no) | 2012-08-29 | 2015-04-27 | Yara Int Asa | Sikre blandinger av ammoniumnitrat (AN) med urea, eller av et AN-omfattende produkt med et urea-omfattende produkt |
| NO341768B1 (no) * | 2012-08-29 | 2018-01-15 | Yara Int Asa | Passivert urea og gjødselblandinger |
| CA2928871C (en) * | 2013-11-12 | 2020-11-24 | Nous, Llc | System for coating granular materials |
| EP3656463A1 (en) * | 2018-11-22 | 2020-05-27 | Yara International ASA | Method for granulating a melt of a nitrate mineral salt-based composition, system and use thereof |
| MX2021008813A (es) * | 2019-02-05 | 2021-08-24 | Dyno Nobel Asia Pacific Pty Ltd | Perlas de nitrato de amonio estabilizado en fase y productos y metodos relacionados. |
| EP3995472A1 (en) | 2020-11-06 | 2022-05-11 | Yara International ASA | Ammonium nitrate-based composition comprising struvite and method of manufacture thereof |
| EP4458790A1 (en) | 2023-05-02 | 2024-11-06 | Yara International ASA | Ammonium nitrate-based composition and method of manufacture thereof |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2007419A (en) * | 1931-01-12 | 1935-07-09 | Directie Staatsmijnen Nl | Process for manufacturing a nitrogen fertilizer |
| GB573147A (en) * | 1942-11-06 | 1945-11-08 | Frank Roffey | Improvements in or relating to explosives |
| US2782108A (en) * | 1953-09-18 | 1957-02-19 | Phillips Petroleum Co | Production of crystalline ammonium nitrate |
| GB795781A (en) * | 1955-11-11 | 1958-05-28 | Fisons Ltd | Fertilizers |
| US3117020A (en) * | 1957-11-29 | 1964-01-07 | Montedison Spa | Process for the spherical granulation of water-soluble nitrogenous material |
| GB894777A (en) * | 1958-05-14 | 1962-04-26 | Jose Jungbecker | Improvements in and relating to tubes for treating textile packages |
| NL242422A (enExample) * | 1958-08-18 | 1900-01-01 | ||
| NL268086A (enExample) * | 1960-08-11 | 1900-01-01 | ||
| FR1297512A (fr) * | 1960-08-11 | 1962-06-29 | Basf Ag | Nitrate d'ammonium à faible hygroscopicité et haute densité apparente et procédé pour sa production |
| CH431576A (de) * | 1964-01-07 | 1967-03-15 | Inventa Ag | Verfahren zum Granulieren von stickstoffhaltigen Düngemitteln |
| US3291659A (en) * | 1964-04-10 | 1966-12-13 | Monsanto Co | Ammonium nitrate disks |
| GB1060182A (en) * | 1965-01-28 | 1967-03-01 | Ici Ltd | Improvements in and relating to fertilizers |
| US3379496A (en) * | 1965-10-08 | 1968-04-23 | Chemical & Ind Corp | High density ammonium nitrate granules |
| GB1136019A (en) * | 1966-05-11 | 1968-12-11 | Armour & Co | Ammonium nitrate stabilization |
| US3317276A (en) * | 1966-10-24 | 1967-05-02 | Mississippi Chem Corp | Stabilized ammonium nitrate compositions and their production |
| US3476544A (en) * | 1967-04-12 | 1969-11-04 | Int Minerals & Chem Corp | Fertilizer prill consisting of ammonium nitrate and langbeinite and the method of preparing said prill |
| DE2355660C3 (de) * | 1973-11-07 | 1978-12-21 | Uniao Fabril Do Azoto, S.A.R.L., Lissabon | Prillturm |
| US4124368A (en) * | 1976-10-01 | 1978-11-07 | The United States Of America As Represented By The Secretary Of The Navy | Insensitive ammonium nitrate |
| GB1581761A (en) * | 1977-06-09 | 1980-12-17 | Azote Sa Cie Neerlandaise | Urea granulation |
-
1979
- 1979-03-15 NL NLAANVRAGE7902086,A patent/NL173387C/xx not_active IP Right Cessation
-
1980
- 1980-02-26 IE IE380/80A patent/IE49520B1/en not_active IP Right Cessation
- 1980-02-28 GR GR61306A patent/GR67266B/el unknown
- 1980-02-28 CA CA000346634A patent/CA1139920A/en not_active Expired
- 1980-02-28 US US06/125,497 patent/US4316736A/en not_active Expired - Lifetime
- 1980-02-29 AT AT0112780A patent/AT372361B/de not_active IP Right Cessation
- 1980-03-04 ES ES489170A patent/ES489170A1/es not_active Expired
- 1980-03-05 DZ DZ805771A patent/DZ230A1/fr active
- 1980-03-06 GB GB8007718A patent/GB2045735B/en not_active Expired
- 1980-03-07 DE DE3008891A patent/DE3008891C2/de not_active Expired
- 1980-03-11 FR FR8005398A patent/FR2451351A1/fr active Granted
- 1980-03-11 SE SE8001905A patent/SE439155B/sv not_active IP Right Cessation
- 1980-03-11 PT PT70930A patent/PT70930A/pt not_active IP Right Cessation
- 1980-03-12 FI FI800764A patent/FI66341C/fi not_active IP Right Cessation
- 1980-03-13 TR TR20418A patent/TR20418A/xx unknown
- 1980-03-13 RO RO80100477A patent/RO79840A/ro unknown
- 1980-03-14 BE BE2/58454A patent/BE882214A/nl not_active IP Right Cessation
- 1980-03-14 SU SU802894302A patent/SU1421257A3/ru active
- 1980-03-14 JP JP55031757A patent/JPS6038335B2/ja not_active Expired
- 1980-03-14 NO NO800756A patent/NO149658C/no unknown
- 1980-03-14 HU HU8080612A patent/HU181068B/hu unknown
- 1980-03-14 CS CS801775A patent/CS222172B2/cs unknown
- 1980-03-14 DK DK112080A patent/DK151190C/da active
Non-Patent Citations (1)
| Title |
|---|
| Авторское свидетельство СССР № 542545, кл. С 05 С 1/02, 1975. * |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2241691C2 (ru) * | 2001-01-16 | 2004-12-10 | Открытое акционерное общество "Концерн Стирол" | Способ получения прочных гранул аммиачной селитры |
| RU2223934C1 (ru) * | 2002-09-03 | 2004-02-20 | Открытое акционерное общество "Кирово-Чепецкий химический комбинат им. Б.П.Константинова" | Способ получения известково-аммиачной селитры |
| RU2312846C2 (ru) * | 2003-08-11 | 2007-12-20 | Открытое акционерное общество "Минерально-химическая компания "ЕвроХим" (ОАО "МХК "ЕвроХим") | Способ получения азотного удобрения |
| RU2290391C1 (ru) * | 2005-08-22 | 2006-12-27 | ОАО "Минудобрения" | Способ получения азотного удобрения |
| RU2436753C2 (ru) * | 2006-01-13 | 2011-12-20 | Хонейвелл Интернэншл Инк. | Композиции, содержащие двойные соли нитрата аммония |
| RU2629055C2 (ru) * | 2015-10-09 | 2017-08-24 | Геннадий Михайлович Морозов | Способ получения гранул нитрата аммония разбрызгиванием его расплава |
| RU2769477C2 (ru) * | 2017-06-23 | 2022-04-01 | Яра Интернэшнл Aсa | Улучшение антислеживающих свойств частиц нитрата аммония при хранении в закрытом контейнере |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1421257A3 (ru) | Способ получени гранул нитрата аммони | |
| US3533776A (en) | Prilling process for the manufacture of granules of materials adapted for fertilizers or other uses | |
| US6132484A (en) | Wet granulation method for generating fertilizer granules | |
| US6454979B1 (en) | Wet granulation method for generating granules | |
| CA2268253C (en) | Wet granulation method for generating sulfur granules | |
| US20030135957A1 (en) | Wet granulation method for generating granules | |
| NO319746B1 (no) | Fremgangsmate for fremstilling av porose granuler av ammoniumnitrat | |
| US1613334A (en) | Granular ammonium nitrate and process of making same | |
| AU751804B2 (en) | Method for manufacturing a calcium nitrate melt and products thereof | |
| CA2545073C (en) | Process for the preparation of urea granules | |
| US2115851A (en) | Process for producing ammonium nitrate | |
| US3388014A (en) | Ammonium nitrate explosive and process for producing same | |
| US3639643A (en) | Method for elimination of the 32 c. phase transition in granules and prills containing free ammonium nitrate and products produced thereby | |
| US4124663A (en) | Continuous process for pelleting explosive compositions | |
| GB2266710A (en) | Granulated ammonium nitrate products | |
| IE821555L (en) | Making urea-based granules | |
| US3518329A (en) | Preparation of diphenylolpropane granules | |
| JP7180444B2 (ja) | 粒状硫安の製造方法および粒状窒素肥料の製造方法 | |
| EP0070056B1 (en) | Process for preparing thermally stable ammonium nitrate-containing granules of high bulk density | |
| UA72007C2 (en) | An explosive composition, ammomium nitrate product in the form of particles and a method for the preparation thereof | |
| SU808493A1 (ru) | Способ получени гранулированныхКОМплЕКСНыХ удОбРЕНий | |
| US3719715A (en) | Diphenylolpropane prills | |
| SU1018929A1 (ru) | Способ уменьшени слеживаемости гранулированной аммиачной селитры | |
| PL47278B1 (enExample) |