SK282386B6 - Spôsob výroby mono-N-substituovaných derivátov tetraazacyklododekánu a tetraazacyklotetradekánu - Google Patents
Spôsob výroby mono-N-substituovaných derivátov tetraazacyklododekánu a tetraazacyklotetradekánu Download PDFInfo
- Publication number
- SK282386B6 SK282386B6 SK3573-92A SK357392A SK282386B6 SK 282386 B6 SK282386 B6 SK 282386B6 SK 357392 A SK357392 A SK 357392A SK 282386 B6 SK282386 B6 SK 282386B6
- Authority
- SK
- Slovakia
- Prior art keywords
- hours
- optionally
- formula
- room temperature
- range
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 10
- 238000000034 method Methods 0.000 claims abstract description 34
- 238000002360 preparation method Methods 0.000 claims abstract description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 102
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 100
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 99
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 72
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 62
- 239000000203 mixture Substances 0.000 claims description 52
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 51
- -1 phenyleneoxy Chemical group 0.000 claims description 50
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 44
- 239000002904 solvent Substances 0.000 claims description 41
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 39
- 239000011541 reaction mixture Substances 0.000 claims description 37
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 35
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 31
- 150000001875 compounds Chemical class 0.000 claims description 31
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 31
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 30
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 30
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 30
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 29
- 125000004432 carbon atom Chemical group C* 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 22
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 22
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 21
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 20
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 18
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 claims description 18
- 235000019441 ethanol Nutrition 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- QBPPRVHXOZRESW-UHFFFAOYSA-N 1,4,7,10-tetraazacyclododecane Chemical group C1CNCCNCCNCCN1 QBPPRVHXOZRESW-UHFFFAOYSA-N 0.000 claims description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 15
- 239000000543 intermediate Substances 0.000 claims description 15
- 238000003756 stirring Methods 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 239000007858 starting material Substances 0.000 claims description 14
- 125000006239 protecting group Chemical group 0.000 claims description 13
- 239000012467 final product Substances 0.000 claims description 12
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 12
- 239000003960 organic solvent Substances 0.000 claims description 12
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 claims description 11
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 11
- 150000007529 inorganic bases Chemical class 0.000 claims description 11
- 239000011707 mineral Substances 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 239000000010 aprotic solvent Substances 0.000 claims description 10
- 229910001863 barium hydroxide Inorganic materials 0.000 claims description 10
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 10
- 239000000920 calcium hydroxide Substances 0.000 claims description 10
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 10
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 9
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 150000003254 radicals Chemical class 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 238000010511 deprotection reaction Methods 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- MDAXKAUIABOHTD-UHFFFAOYSA-N 1,4,8,11-tetraazacyclotetradecane Chemical compound C1CNCCNCCCNCCNC1 MDAXKAUIABOHTD-UHFFFAOYSA-N 0.000 claims description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000006165 cyclic alkyl group Chemical group 0.000 claims description 4
- 150000002118 epoxides Chemical class 0.000 claims description 4
- 229910001577 potassium mineral Chemical class 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000004682 aminothiocarbonyl group Chemical group NC(=S)* 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 238000001816 cooling Methods 0.000 claims description 3
- XXFPKOQFZFXZNS-UHFFFAOYSA-N hexane;methylsulfinylmethane Chemical compound CS(C)=O.CCCCCC XXFPKOQFZFXZNS-UHFFFAOYSA-N 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- HLRWRACNIJFYEO-UHFFFAOYSA-N 1,4,7,10-tetrazacyclotetradecane Chemical group C1CCNCCNCCNCCNC1 HLRWRACNIJFYEO-UHFFFAOYSA-N 0.000 claims description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 claims description 2
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- HOSGXJWQVBHGLT-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical group N1C(=O)CCC2=CC(O)=CC=C21 HOSGXJWQVBHGLT-UHFFFAOYSA-N 0.000 claims description 2
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002540 isothiocyanates Chemical class 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims 2
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 claims 2
- 238000004821 distillation Methods 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 239000000126 substance Substances 0.000 description 25
- 239000012299 nitrogen atmosphere Substances 0.000 description 21
- 238000010992 reflux Methods 0.000 description 20
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 14
- 230000002829 reductive effect Effects 0.000 description 14
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical group COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- 238000003786 synthesis reaction Methods 0.000 description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 239000000376 reactant Substances 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 238000003776 cleavage reaction Methods 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 235000010755 mineral Nutrition 0.000 description 6
- 230000007017 scission Effects 0.000 description 6
- 239000007787 solid Substances 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 235000009508 confectionery Nutrition 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- VBNWSEVVMYMVLC-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonylaziridine Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1CC1 VBNWSEVVMYMVLC-UHFFFAOYSA-N 0.000 description 2
- DZMUBAMSENKVHA-UHFFFAOYSA-N 2-(4-nitrophenyl)-3-[[3-(4-nitrophenyl)oxiran-2-yl]methoxymethyl]oxirane Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1C(COCC2C(O2)C=2C=CC(=CC=2)[N+]([O-])=O)O1 DZMUBAMSENKVHA-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 2
- ZNYRFEPBTVGZDN-UHFFFAOYSA-N 5S,6S-epoxy-15R-hydroxy-ETE Chemical group COCCOCCOCCOCCO ZNYRFEPBTVGZDN-UHFFFAOYSA-N 0.000 description 2
- 206010013647 Drowning Diseases 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- JLGLQAWTXXGVEM-UHFFFAOYSA-N triethylene glycol monomethyl ether Chemical group COCCOCCOCCO JLGLQAWTXXGVEM-UHFFFAOYSA-N 0.000 description 2
- FXGAYTVRICVFGL-UHFFFAOYSA-N 1-(1,4,7,10-tetrazacyclododec-1-yl)propan-2-ol Chemical compound CC(O)CN1CCNCCNCCNCC1 FXGAYTVRICVFGL-UHFFFAOYSA-N 0.000 description 1
- DJLRUKDQBZYEPQ-UHFFFAOYSA-N 1-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-(1,4,8,11-tetrazacyclotetradec-1-yl)ethanol Chemical compound O1C(C)(C)OCC1C(O)CN1CCNCCCNCCNCCC1 DJLRUKDQBZYEPQ-UHFFFAOYSA-N 0.000 description 1
- WDGZBWNOIJKORW-UHFFFAOYSA-N 1-(4-nitrophenoxy)-3-(1,4,7,10-tetrazacyclododec-1-yl)propan-2-ol Chemical compound C1CNCCNCCNCCN1CC(O)COC1=CC=C([N+]([O-])=O)C=C1 WDGZBWNOIJKORW-UHFFFAOYSA-N 0.000 description 1
- LFIWTCWJXUVRRC-UHFFFAOYSA-N 1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-(1,4,7,10-tetrazacyclododec-1-yl)propan-2-ol Chemical compound O1C(C)(C)OCC1COCC(O)CN1CCNCCNCCNCC1 LFIWTCWJXUVRRC-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- ULIBLGGHYYDEJD-UHFFFAOYSA-N 1-methylsulfonylaziridine Chemical compound CS(=O)(=O)N1CC1 ULIBLGGHYYDEJD-UHFFFAOYSA-N 0.000 description 1
- FRELRIWZBXADCT-UHFFFAOYSA-N 2,2-dimethyl-6-(1,4,7,10-tetrazacyclododec-1-yl)-1,3-dioxepan-5-ol Chemical compound C1OC(C)(C)OCC(O)C1N1CCNCCNCCNCC1 FRELRIWZBXADCT-UHFFFAOYSA-N 0.000 description 1
- RLQBMCJDOYVNMA-UHFFFAOYSA-N 2-(propoxymethyl)-1,3-dioxolane Chemical compound CCCOCC1OCCO1 RLQBMCJDOYVNMA-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- VNONLLDTIHTNMX-UHFFFAOYSA-N 3-(1,4,7,10-tetrazacyclododec-1-yl)propanenitrile Chemical compound N#CCCN1CCNCCNCCNCC1 VNONLLDTIHTNMX-UHFFFAOYSA-N 0.000 description 1
- NAPAGVOSAQOZRS-UHFFFAOYSA-N 3-(1,4,7,10-tetrazacyclododec-1-yl)propanoic acid Chemical compound OC(=O)CCN1CCNCCNCCNCC1 NAPAGVOSAQOZRS-UHFFFAOYSA-N 0.000 description 1
- WCDLCPLAAKUJNY-UHFFFAOYSA-N 4-[4-[3-(1h-pyrazol-4-yl)pyrazolo[1,5-a]pyrimidin-6-yl]phenyl]morpholine Chemical compound C1COCCN1C1=CC=C(C2=CN3N=CC(=C3N=C2)C2=CNN=C2)C=C1 WCDLCPLAAKUJNY-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- HRNGFHALKZNVGZ-UHFFFAOYSA-N 4-methyl-n-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]benzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NCCN1CCNCCNCCNCC1 HRNGFHALKZNVGZ-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- PZASAAIJIFDWSB-CKPDSHCKSA-N 8-[(1S)-1-[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid Chemical compound FC(F)(F)C=1C2=CC([C@@H](N3C4CCC3CC(C4)C(O)=O)C)=CC=C2C=CC=1OC1CCC(C(F)(F)F)CC1 PZASAAIJIFDWSB-CKPDSHCKSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BFGMYIAAEMOZMY-UHFFFAOYSA-N CCOC(=O)CCN1CCNCCN(CCN1)NC=O Chemical compound CCOC(=O)CCN1CCNCCN(CCN1)NC=O BFGMYIAAEMOZMY-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 102100026466 POU domain, class 2, transcription factor 3 Human genes 0.000 description 1
- 101710084413 POU domain, class 2, transcription factor 3 Proteins 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- YYILQFNZULLVNL-UHFFFAOYSA-N [4-[2-hydroxy-3-(1,4,8,11-tetrazacyclotetradec-1-yl)propoxy]phenyl] nitrate Chemical compound C1CCNCCNCCCNCCN1CC(O)COC1=CC=C(O[N+]([O-])=O)C=C1 YYILQFNZULLVNL-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 239000002872 contrast media Substances 0.000 description 1
- 150000003950 cyclic amides Chemical group 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005909 ethyl alcohol group Chemical group 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- RGUOJYYIMVSCNC-UHFFFAOYSA-N n,n-dimethylformamide;2-methylpropanoic acid Chemical compound CN(C)C=O.CC(C)C(O)=O RGUOJYYIMVSCNC-UHFFFAOYSA-N 0.000 description 1
- WOANNRLAJDGARY-UHFFFAOYSA-N n-[2-(1,4,7,10-tetrazacyclododec-1-yl)ethyl]methanesulfonamide Chemical compound CS(=O)(=O)NCCN1CCNCCNCCNCC1 WOANNRLAJDGARY-UHFFFAOYSA-N 0.000 description 1
- XOXBXKQFSLQDBL-UHFFFAOYSA-N n-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyethyl]-1,4,8,11-tetrazacyclotetradec-1-yl]formamide Chemical compound O1C(C)(C)OCC1C(O)CN1CCN(NC=O)CCCNCCNCCC1 XOXBXKQFSLQDBL-UHFFFAOYSA-N 0.000 description 1
- BRNZSYIBTKLNCI-UHFFFAOYSA-N n-[7-(2-hydroxypropyl)-1,4,7,10-tetrazacyclododec-1-yl]formamide Chemical compound CC(O)CN1CCNCCN(NC=O)CCNCC1 BRNZSYIBTKLNCI-UHFFFAOYSA-N 0.000 description 1
- FEPHUMAQSIRXPT-UHFFFAOYSA-N n-[7-(6-hydroxy-2,2-dimethyl-1,3-dioxepan-5-yl)-1,4,7,10-tetrazacyclododec-1-yl]formamide Chemical compound C1OC(C)(C)OCC(O)C1N1CCNCCN(NC=O)CCNCC1 FEPHUMAQSIRXPT-UHFFFAOYSA-N 0.000 description 1
- UGUPARQBQADNMB-UHFFFAOYSA-N n-[7-[2-(methanesulfonamido)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]formamide Chemical compound CS(=O)(=O)NCCN1CCNCCN(NC=O)CCNCC1 UGUPARQBQADNMB-UHFFFAOYSA-N 0.000 description 1
- MZTAXACBNCJVJC-UHFFFAOYSA-N n-[7-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]formamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NCCN1CCNCCN(NC=O)CCNCC1 MZTAXACBNCJVJC-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- LOHQJWJZAHGMLY-UHFFFAOYSA-N n-phenyl-1,4,7,10-tetrazacyclododecane-1-carboxamide Chemical compound C1CNCCNCCNCCN1C(=O)NC1=CC=CC=C1 LOHQJWJZAHGMLY-UHFFFAOYSA-N 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 229940117953 phenylisothiocyanate Drugs 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- FZUJWWOKDIGOKH-UHFFFAOYSA-N sulfuric acid hydrochloride Chemical compound Cl.OS(O)(=O)=O FZUJWWOKDIGOKH-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4140779A DE4140779A1 (de) | 1991-12-06 | 1991-12-06 | Verfahren zur herstellung von mono-n-substituierten tetraazamakrocyclen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SK357392A3 SK357392A3 (en) | 1993-08-11 |
| SK282386B6 true SK282386B6 (sk) | 2002-01-07 |
Family
ID=6446767
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK3573-92A SK282386B6 (sk) | 1991-12-06 | 1992-12-04 | Spôsob výroby mono-N-substituovaných derivátov tetraazacyklododekánu a tetraazacyklotetradekánu |
Country Status (13)
| Country | Link |
|---|---|
| EP (1) | EP0545511B1 (cs) |
| JP (1) | JP3471836B2 (cs) |
| AT (1) | ATE218131T1 (cs) |
| CA (1) | CA2084582C (cs) |
| CZ (1) | CZ290232B6 (cs) |
| DE (2) | DE4140779A1 (cs) |
| DK (1) | DK0545511T3 (cs) |
| ES (1) | ES2176183T3 (cs) |
| HU (2) | HU9203860D0 (cs) |
| IL (1) | IL103996A (cs) |
| NO (5) | NO303496B1 (cs) |
| PT (1) | PT545511E (cs) |
| SK (1) | SK282386B6 (cs) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4237943C2 (de) * | 1992-11-06 | 1997-10-23 | Schering Ag | Verfahren zur Herstellung von Metallkomplexen der N-beta-Hydroxyalkyl-tri-N-carboxyalkyl-1,4,7,10-tetraazacyclododecan- und N-beta-Hydroxyalkyl-tri-N-carboxyalkyl-1,4,8,11-tetraazacyclotetradecan-Derivate |
| DE4317588C2 (de) * | 1993-05-24 | 1998-04-16 | Schering Ag | Fluorhaltige makrocyclische Metallkomplexe, Verfahren zu ihrer Herstellung, sowie ihre Verwendung |
| DE4318369C1 (de) * | 1993-05-28 | 1995-02-09 | Schering Ag | Verwendung von makrocyclischen Metallkomplexen als Temperatursonden |
| DE4340809C2 (de) * | 1993-11-24 | 2000-08-03 | Schering Ag | 1.4,7,10-Tetraazacyclododecan-Derivate, diese enthaltende pharmazeutische Mittel und Verfahren zu deren Herstellung |
| FR2725449B1 (fr) * | 1994-10-05 | 1996-12-27 | Air Liquide | Derives de polyazacycloalcanes, leurs complexes metalliques et produits pharmaceutiques incorporant ces complexes |
| DE19724186C2 (de) * | 1997-06-02 | 2002-07-18 | Schering Ag | Verfahren zur Mono- und 1,7-Bis-N-ß-Hydroxyalkylierung von Cyclen und die entsprechenden N-ß-Hydroxyalkyl-1,4,7,10-tetraazacyclododecan-Li-Salz-Komplexe |
| IT1297035B1 (it) | 1997-12-30 | 1999-08-03 | Bracco Spa | Derivati dell'acido 1,4,7,10-tetraazaciclododecan-1,4-diacetico |
| DE19914101C1 (de) * | 1999-03-22 | 2000-10-12 | Schering Ag | Perfluoralkylamide, ihre Herstellung und ihre Verwendung in der Diagnostik |
| DE10002939C1 (de) * | 2000-01-13 | 2001-09-20 | Schering Ag | Paramagnetische DOTA-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung für die Herstellung von pharmazeutischen Mitteln |
| CN103189057B (zh) * | 2010-08-26 | 2015-02-18 | 崔坤元 | 大环脂类化合物及其应用 |
| KR20190079682A (ko) | 2011-04-21 | 2019-07-05 | 바이엘 인텔렉쳐 프로퍼티 게엠베하 | 고순도 가도부트롤의 제조 |
| KR101653064B1 (ko) * | 2014-12-26 | 2016-09-09 | 에스티팜 주식회사 | 가도부트롤의 제조방법 |
| KR102033964B1 (ko) * | 2018-01-19 | 2019-10-18 | 주식회사 엔지켐생명과학 | 가도테리돌 중간체 및 이를 이용한 가도테리돌 제조방법 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0232751B1 (en) * | 1986-01-23 | 1991-09-11 | E.R. Squibb & Sons, Inc. | 1-substituted-4,7,10-triscarboxymethyl-1,4,7,10-tetraazacyclododecane and analogs |
| DE3625417C2 (de) * | 1986-07-28 | 1998-10-08 | Schering Ag | Tetraazacyclododecan-Derivate |
| US4994560A (en) * | 1987-06-24 | 1991-02-19 | The Dow Chemical Company | Functionalized polyamine chelants and radioactive rhodium complexes thereof for conjugation to antibodies |
| FR2644453A1 (fr) * | 1989-03-20 | 1990-09-21 | Centre Nat Rech Scient | Procede de preparation de tetramines cycliques monofonctionnalisees |
| AU6709390A (en) * | 1989-12-22 | 1991-06-27 | E.R. Squibb & Sons, Inc. | 10-(2'-hydroxy-3'-polyoxaalkyl)-1,4,7-tris-carboxymethyl -1,4,7,10-tetraazacyclododecane |
| AU625529B2 (en) * | 1989-12-22 | 1992-07-16 | E.R. Squibb & Sons, Inc. | 10-(2'-hydroxy-3'-alkoxy-1,4,7-triscarboxymethyl-1,4,7,10- tetraazacyclododecanes |
| DE4009119A1 (de) * | 1990-03-19 | 1991-09-26 | Schering Ag | 1,4,7,10-tetraazacyclododecan-butyltriole, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische mittel |
| DE4035760A1 (de) * | 1990-11-08 | 1992-05-14 | Schering Ag | Mono-n-substituierte 1,4,7,10-tetraazacyclododecan-derivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische mittel |
-
1991
- 1991-12-06 DE DE4140779A patent/DE4140779A1/de not_active Withdrawn
-
1992
- 1992-12-03 DE DE59209957T patent/DE59209957D1/de not_active Expired - Lifetime
- 1992-12-03 ES ES92250351T patent/ES2176183T3/es not_active Expired - Lifetime
- 1992-12-03 AT AT92250351T patent/ATE218131T1/de active
- 1992-12-03 EP EP92250351A patent/EP0545511B1/de not_active Expired - Lifetime
- 1992-12-03 DK DK92250351T patent/DK0545511T3/da active
- 1992-12-03 PT PT92250351T patent/PT545511E/pt unknown
- 1992-12-04 HU HU9203860A patent/HU9203860D0/hu unknown
- 1992-12-04 HU HU9203860A patent/HU224923B1/hu unknown
- 1992-12-04 CZ CS19923573A patent/CZ290232B6/cs not_active IP Right Cessation
- 1992-12-04 NO NO924690A patent/NO303496B1/no not_active IP Right Cessation
- 1992-12-04 CA CA002084582A patent/CA2084582C/en not_active Expired - Lifetime
- 1992-12-04 SK SK3573-92A patent/SK282386B6/sk not_active IP Right Cessation
- 1992-12-06 IL IL103996A patent/IL103996A/en not_active IP Right Cessation
- 1992-12-07 JP JP32657092A patent/JP3471836B2/ja not_active Expired - Lifetime
-
1997
- 1997-08-04 NO NO973580A patent/NO303386B1/no not_active IP Right Cessation
- 1997-08-04 NO NO973578A patent/NO303384B1/no not_active IP Right Cessation
- 1997-08-04 NO NO973579A patent/NO303387B1/no not_active IP Right Cessation
- 1997-08-04 NO NO973581A patent/NO303385B1/no not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5386028A (en) | Process for the production of N-β-hydroxyalkyl-tri-N-carboxyalkyl-1,4,7,10-tetraazacyclododecane and N-β-hydroxyalkyl-tri-N-carboxyalkyl-1,4,8,11-tetraazacyclotetradecane derivatives and their metal complexes | |
| RU1819263C (ru) | Способ получени замещенных имидазолов или их нетоксичных фармацевтически приемлемых аддитивных солей | |
| SK282386B6 (sk) | Spôsob výroby mono-N-substituovaných derivátov tetraazacyklododekánu a tetraazacyklotetradekánu | |
| US5587451A (en) | Process for preparing polyazamacrocycles | |
| KR20060004967A (ko) | 방향족 옥시페닐 및 방향족 설파닐페닐 유도체 | |
| US5410043A (en) | Process for the production of mono-N-substituted tetraaza macrocycles | |
| JPS6139949B2 (cs) | ||
| Malhotra et al. | Substituted pyrazolines and their cardiovascular activity | |
| CZ285411B6 (cs) | Způsob výroby kovových komplexů N-beta-hydroxyalkyltri-N-karboxyalkyl-1,4,7,10-tetraazacyklododekanových a N-beta-hydroxyalkyltri-N-karboxyalkyl-1, 4,8,11-tetraazacyklotetradekanových derivátů | |
| JP3119872B2 (ja) | 前もって固定された対称性をもつキレート化剤のための中間体およびそれらの製造方法 | |
| PL156483B1 (en) | Method of obtaining novel 1h-imidazole derivatives | |
| EP0730616B1 (en) | Process for preparing polyazamacrocycles | |
| US4820722A (en) | Disubstituted tetrazoles and their use as leukotriene antagonists | |
| Kornet | Synthesis and anticonvulsant activity of 2‐aryl‐3, 4‐dialkyltetrahydro‐1, 3, 4‐oxadiazines and 2‐aryl‐3, 4‐dialkyltetrahydro‐1, 3, 4‐oxadiazin‐5‐ones | |
| KR870000234B1 (ko) | 트랜스-dI-5-치환된-7-임의 치환된-4,4a,5,6,7,8,8a,9-옥타하이드로-1H(및 2H)피라졸로[3,4-g] 퀴나졸린의 제조 방법 | |
| EP1463725B1 (en) | Process and intermediates for pyridazinone antidiabetic agents | |
| Kappe et al. | Reactions of cyclic oxalyl compounds, 37. Substituent effects on the site of nucleophilic attack at 1H‐pyrrole‐2, 3‐diones | |
| RU2207340C2 (ru) | Способ получения 1,2,3,9-тетрагидро-9-метил-3-[(2-метил-1н-имидазол-1-ил)метил]-4н-карбазол -4-она или его фармацевтически приемлемых солей | |
| Abadlehb | Mustafa M. El-Abadelah, Firas F. Awwadi, Monther S. Zreid, and | |
| JPH08231538A (ja) | Ｎ−（２−ピリミジル）ピペラジニルブチルイミドの調製方法 | |
| JPS6137778A (ja) | カルデノライド誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK4A | Patent expired |
Expiry date: 20121204 |