SK280516B6 - Amidy, spôsob ich prípravy a farmaceutická kompozí - Google Patents
Amidy, spôsob ich prípravy a farmaceutická kompozí Download PDFInfo
- Publication number
- SK280516B6 SK280516B6 SK2342-92A SK234292A SK280516B6 SK 280516 B6 SK280516 B6 SK 280516B6 SK 234292 A SK234292 A SK 234292A SK 280516 B6 SK280516 B6 SK 280516B6
- Authority
- SK
- Slovakia
- Prior art keywords
- group
- phenyl
- hydroxy
- mmol
- aromatic
- Prior art date
Links
- 150000001408 amides Chemical class 0.000 title claims abstract description 49
- 238000000034 method Methods 0.000 title claims abstract description 24
- 230000008569 process Effects 0.000 title claims abstract description 10
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 8
- 238000002360 preparation method Methods 0.000 title claims description 7
- 150000002148 esters Chemical class 0.000 claims abstract description 29
- 150000003839 salts Chemical class 0.000 claims abstract description 22
- 238000001727 in vivo Methods 0.000 claims abstract description 18
- -1 phenylthio, phenylsulfinyl Chemical group 0.000 claims description 286
- 150000001875 compounds Chemical class 0.000 claims description 106
- 239000000460 chlorine Substances 0.000 claims description 68
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 56
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 54
- 239000002253 acid Substances 0.000 claims description 50
- 125000001424 substituent group Chemical group 0.000 claims description 43
- 125000004432 carbon atom Chemical group C* 0.000 claims description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 21
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 21
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 16
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 15
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 229910052717 sulfur Chemical group 0.000 claims description 15
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 14
- 125000001072 heteroaryl group Chemical group 0.000 claims description 14
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 13
- 125000001153 fluoro group Chemical group F* 0.000 claims description 12
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 11
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 10
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 claims description 10
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 10
- 229910052731 fluorine Inorganic materials 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 10
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 8
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 8
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 150000001721 carbon Chemical group 0.000 claims description 8
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 125000005842 heteroatom Chemical group 0.000 claims description 8
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 8
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 8
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 7
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 238000005859 coupling reaction Methods 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 239000002585 base Substances 0.000 claims description 6
- 230000008878 coupling Effects 0.000 claims description 6
- 238000010168 coupling process Methods 0.000 claims description 6
- 125000005647 linker group Chemical group 0.000 claims description 6
- 239000001301 oxygen Chemical group 0.000 claims description 6
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 6
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 5
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 4
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- LVEDGSIMCSQNNX-UHFFFAOYSA-N n-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CC=C1 LVEDGSIMCSQNNX-UHFFFAOYSA-N 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- 125000006239 protecting group Chemical group 0.000 claims description 4
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- GNVWYNKNTYVESS-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-n-(4-pyridin-4-ylsulfonylphenyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=NC=C1 GNVWYNKNTYVESS-UHFFFAOYSA-N 0.000 claims description 3
- HJLSQMSOURVULD-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-(3-hydroxy-4-pyridin-4-ylsulfonylphenyl)-2-methylpropanamide Chemical compound OC1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=NC=C1 HJLSQMSOURVULD-UHFFFAOYSA-N 0.000 claims description 3
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 claims description 3
- 125000006305 3-iodophenyl group Chemical group [H]C1=C([H])C(I)=C([H])C(*)=C1[H] 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- GVFFQGQURYOONH-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-(4-pyridin-4-ylsulfonylphenyl)-2-(trifluoromethyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)(F)F)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=NC=C1 GVFFQGQURYOONH-UHFFFAOYSA-N 0.000 claims description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 2
- 150000004791 alkyl magnesium halides Chemical class 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 125000004802 cyanophenyl group Chemical group 0.000 claims description 2
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical class C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 claims description 2
- SYDYULNRBNEQFP-UHFFFAOYSA-N n-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-n-methyl-2-(trifluoromethyl)propanamide Chemical compound C1=CC(N(C(=O)C(O)(C(F)(F)F)C(F)(F)F)C)=CC=C1C(=O)C1=CC=CC=C1 SYDYULNRBNEQFP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 claims description 2
- JQPMDTQDAXRDGS-UHFFFAOYSA-N triphenylalumane Chemical class C1=CC=CC=C1[Al](C=1C=CC=CC=1)C1=CC=CC=C1 JQPMDTQDAXRDGS-UHFFFAOYSA-N 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 4
- SLGBZMMZGDRARJ-UHFFFAOYSA-N Triphenylene Natural products C1=CC=C2C3=CC=CC=C3C3=CC=CC=C3C2=C1 SLGBZMMZGDRARJ-UHFFFAOYSA-N 0.000 claims 1
- 125000000068 chlorophenyl group Chemical group 0.000 claims 1
- 125000000714 pyrimidinyl group Chemical group 0.000 claims 1
- 125000005580 triphenylene group Chemical group 0.000 claims 1
- 206010046543 Urinary incontinence Diseases 0.000 abstract description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 411
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 306
- 239000000243 solution Substances 0.000 description 252
- 125000003118 aryl group Chemical group 0.000 description 246
- 239000007787 solid Substances 0.000 description 205
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 183
- 239000000203 mixture Substances 0.000 description 165
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 153
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 149
- 239000011541 reaction mixture Substances 0.000 description 146
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 120
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 114
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 112
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 112
- 238000000921 elemental analysis Methods 0.000 description 110
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 103
- 238000001819 mass spectrum Methods 0.000 description 95
- 238000005160 1H NMR spectroscopy Methods 0.000 description 76
- 239000000047 product Substances 0.000 description 70
- 239000002904 solvent Substances 0.000 description 70
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 69
- 238000002844 melting Methods 0.000 description 62
- 230000008018 melting Effects 0.000 description 62
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 60
- 235000019341 magnesium sulphate Nutrition 0.000 description 60
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 54
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 51
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 44
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 44
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 42
- CTGJACFEVDCYMC-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid Chemical compound OC(=O)C(O)(C)C(F)(F)F CTGJACFEVDCYMC-UHFFFAOYSA-N 0.000 description 39
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 39
- 238000001953 recrystallisation Methods 0.000 description 36
- 210000003932 urinary bladder Anatomy 0.000 description 36
- 238000003818 flash chromatography Methods 0.000 description 35
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 34
- 239000007864 aqueous solution Substances 0.000 description 34
- 238000010992 reflux Methods 0.000 description 33
- 238000006243 chemical reaction Methods 0.000 description 32
- 238000012360 testing method Methods 0.000 description 30
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 30
- 239000000741 silica gel Substances 0.000 description 29
- 229910002027 silica gel Inorganic materials 0.000 description 29
- 238000001704 evaporation Methods 0.000 description 28
- 239000000284 extract Substances 0.000 description 27
- 230000008020 evaporation Effects 0.000 description 25
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 239000005457 ice water Substances 0.000 description 24
- 239000000706 filtrate Substances 0.000 description 23
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 22
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 20
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 18
- 229960000583 acetic acid Drugs 0.000 description 17
- 238000001914 filtration Methods 0.000 description 17
- 239000002244 precipitate Substances 0.000 description 17
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000012286 potassium permanganate Substances 0.000 description 15
- 239000003480 eluent Substances 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 230000000694 effects Effects 0.000 description 12
- 239000012362 glacial acetic acid Substances 0.000 description 12
- 239000012299 nitrogen atmosphere Substances 0.000 description 12
- 238000000746 purification Methods 0.000 description 12
- CMQUGOHGJUTDGZ-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid Chemical compound OC(=O)C(O)(C(F)(F)F)C(F)(F)F CMQUGOHGJUTDGZ-UHFFFAOYSA-N 0.000 description 11
- GDYFDXDATVPPDR-UHFFFAOYSA-N 4-(benzenesulfonyl)aniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 GDYFDXDATVPPDR-UHFFFAOYSA-N 0.000 description 11
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 11
- 229940045348 brown mixture Drugs 0.000 description 11
- 230000008602 contraction Effects 0.000 description 11
- 239000012153 distilled water Substances 0.000 description 11
- 238000010438 heat treatment Methods 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 10
- 239000012267 brine Substances 0.000 description 10
- 229910052938 sodium sulfate Inorganic materials 0.000 description 10
- 235000011152 sodium sulphate Nutrition 0.000 description 10
- 235000010265 sodium sulphite Nutrition 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 9
- WFKAJVHLWXSISD-UHFFFAOYSA-N anhydrous dimethyl-acetamide Natural products CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 9
- 230000008859 change Effects 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 238000002425 crystallisation Methods 0.000 description 9
- 230000008025 crystallization Effects 0.000 description 9
- 238000010908 decantation Methods 0.000 description 9
- 238000001035 drying Methods 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 9
- 210000001519 tissue Anatomy 0.000 description 9
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- 229910052700 potassium Inorganic materials 0.000 description 8
- 239000011591 potassium Substances 0.000 description 8
- 150000003457 sulfones Chemical class 0.000 description 8
- 238000001665 trituration Methods 0.000 description 8
- KJKLHUYKWBQANF-UHFFFAOYSA-N 2-(difluoromethyl)-3,3-difluoro-2-hydroxypropanoic acid Chemical compound OC(=O)C(O)(C(F)F)C(F)F KJKLHUYKWBQANF-UHFFFAOYSA-N 0.000 description 7
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 7
- 239000002038 ethyl acetate fraction Substances 0.000 description 7
- 239000012044 organic layer Substances 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- RPQAROOAFRNNHH-UHFFFAOYSA-N 4-pyridin-4-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=NC=C1 RPQAROOAFRNNHH-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 6
- 239000012965 benzophenone Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 229920000137 polyphosphoric acid Polymers 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- RBKHNGHPZZZJCI-UHFFFAOYSA-N (4-aminophenyl)-phenylmethanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC=C1 RBKHNGHPZZZJCI-UHFFFAOYSA-N 0.000 description 5
- CJNZHMCUOMOIPB-UHFFFAOYSA-N 4-pyridin-2-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=N1 CJNZHMCUOMOIPB-UHFFFAOYSA-N 0.000 description 5
- 206010007559 Cardiac failure congestive Diseases 0.000 description 5
- 239000004698 Polyethylene Substances 0.000 description 5
- 102000004257 Potassium Channel Human genes 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 230000036772 blood pressure Effects 0.000 description 5
- 239000001569 carbon dioxide Substances 0.000 description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 description 5
- 239000003610 charcoal Substances 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 5
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 5
- 230000003287 optical effect Effects 0.000 description 5
- 108020001213 potassium channel Proteins 0.000 description 5
- 238000007790 scraping Methods 0.000 description 5
- 239000012265 solid product Substances 0.000 description 5
- RGINXMPQTJUCOC-UHFFFAOYSA-N (4-aminophenyl)-(3-fluorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC(F)=C1 RGINXMPQTJUCOC-UHFFFAOYSA-N 0.000 description 4
- OTRZNQQMXMJNEF-UHFFFAOYSA-N (4-aminophenyl)-pyridin-2-ylmethanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC=N1 OTRZNQQMXMJNEF-UHFFFAOYSA-N 0.000 description 4
- 238000004293 19F NMR spectroscopy Methods 0.000 description 4
- RRPOXOJXECFGDO-UHFFFAOYSA-N 4-(benzenesulfonyl)-3-fluoroaniline Chemical compound FC1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 RRPOXOJXECFGDO-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 239000002024 ethyl acetate extract Substances 0.000 description 4
- 125000000623 heterocyclic group Chemical group 0.000 description 4
- 238000004128 high performance liquid chromatography Methods 0.000 description 4
- 238000001802 infusion Methods 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 150000002828 nitro derivatives Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 210000002460 smooth muscle Anatomy 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- 210000002700 urine Anatomy 0.000 description 4
- FRGXRXKVVAHXBO-UHFFFAOYSA-N (4-aminophenyl)-(2-fluorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC=C1F FRGXRXKVVAHXBO-UHFFFAOYSA-N 0.000 description 3
- WYAKUPXWXWLWDL-UHFFFAOYSA-N (4-aminophenyl)-pyridin-3-ylmethanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CN=C1 WYAKUPXWXWLWDL-UHFFFAOYSA-N 0.000 description 3
- DSCJETUEDFKYGN-UHFFFAOYSA-N 2-Methoxybenzenethiol Chemical compound COC1=CC=CC=C1S DSCJETUEDFKYGN-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 3
- SVMCOPQGDDIXOJ-UHFFFAOYSA-N 3-fluoro-2-hydroxy-2-methylpropanoic acid Chemical compound FCC(O)(C)C(O)=O SVMCOPQGDDIXOJ-UHFFFAOYSA-N 0.000 description 3
- RWCINFKAYRVTFF-UHFFFAOYSA-N 4-(1,3-thiazol-5-ylsulfonyl)aniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CN=CS1 RWCINFKAYRVTFF-UHFFFAOYSA-N 0.000 description 3
- SXOFYPXQBMOPNV-UHFFFAOYSA-N 4-(2-methoxyphenyl)sulfonylaniline Chemical compound COC1=CC=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 SXOFYPXQBMOPNV-UHFFFAOYSA-N 0.000 description 3
- MUDBXLRIOAWFNX-UHFFFAOYSA-N 4-(3-methylphenyl)sulfonylaniline Chemical compound CC1=CC=CC(S(=O)(=O)C=2C=CC(N)=CC=2)=C1 MUDBXLRIOAWFNX-UHFFFAOYSA-N 0.000 description 3
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 3
- DRTZAGWWGHUJOR-UHFFFAOYSA-N 4-pyridin-3-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CN=C1 DRTZAGWWGHUJOR-UHFFFAOYSA-N 0.000 description 3
- BIGAQSPPHVBONE-UHFFFAOYSA-N 5-amino-2-phenylsulfanylbenzonitrile Chemical compound N#CC1=CC(N)=CC=C1SC1=CC=CC=C1 BIGAQSPPHVBONE-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 244000025254 Cannabis sativa Species 0.000 description 3
- TVZCRIROJQEVOT-CABCVRRESA-N Cromakalim Chemical compound N1([C@@H]2C3=CC(=CC=C3OC([C@H]2O)(C)C)C#N)CCCC1=O TVZCRIROJQEVOT-CABCVRRESA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 3
- 229940127315 Potassium Channel Openers Drugs 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 3
- 230000004872 arterial blood pressure Effects 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000007822 coupling agent Substances 0.000 description 3
- 229950004210 cromakalim Drugs 0.000 description 3
- 238000004042 decolorization Methods 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 210000003205 muscle Anatomy 0.000 description 3
- JOHGREWJSUDXHI-UHFFFAOYSA-N n-(3-cyano-4-phenylsulfanylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound N#CC1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1SC1=CC=CC=C1 JOHGREWJSUDXHI-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 230000000069 prophylactic effect Effects 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 230000033764 rhythmic process Effects 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- 239000008247 solid mixture Substances 0.000 description 3
- 239000012258 stirred mixture Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 238000005303 weighing Methods 0.000 description 3
- DJZIJGMEQTTYCK-UHFFFAOYSA-N (4-aminophenyl)-(2,3-difluorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC(F)=C1F DJZIJGMEQTTYCK-UHFFFAOYSA-N 0.000 description 2
- ZOIBPLOEXLBYMF-UHFFFAOYSA-N (4-aminophenyl)-(2,5-difluorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC(F)=CC=C1F ZOIBPLOEXLBYMF-UHFFFAOYSA-N 0.000 description 2
- JHRKKHFDXTWUJO-UHFFFAOYSA-N (4-aminophenyl)-(4-fluorophenyl)methanone Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=C(F)C=C1 JHRKKHFDXTWUJO-UHFFFAOYSA-N 0.000 description 2
- SBFAVQPGDJEDCY-UHFFFAOYSA-N (4-nitrophenyl)-pyridin-3-ylmethanone Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CC=CN=C1 SBFAVQPGDJEDCY-UHFFFAOYSA-N 0.000 description 2
- QAPXLUZMMFIIBI-UHFFFAOYSA-N 1,1,3,3-tetrafluoropropan-2-one Chemical compound FC(F)C(=O)C(F)F QAPXLUZMMFIIBI-UHFFFAOYSA-N 0.000 description 2
- 125000006002 1,1-difluoroethyl group Chemical group 0.000 description 2
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 2
- YUAWCHJIODXIFW-UHFFFAOYSA-N 1-methyl-3-(4-nitrophenyl)sulfonylbenzene Chemical compound CC1=CC=CC(S(=O)(=O)C=2C=CC(=CC=2)[N+]([O-])=O)=C1 YUAWCHJIODXIFW-UHFFFAOYSA-N 0.000 description 2
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 2
- 125000004778 2,2-difluoroethyl group Chemical group [H]C([H])(*)C([H])(F)F 0.000 description 2
- HJSYZAWBXPDYCO-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfanylbenzonitrile Chemical compound C1=CC([N+](=O)[O-])=CC=C1SC1=CC=CC=C1C#N HJSYZAWBXPDYCO-UHFFFAOYSA-N 0.000 description 2
- BNWSRXYXTUEQIR-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfonylpyridine Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CC=CC=N1 BNWSRXYXTUEQIR-UHFFFAOYSA-N 0.000 description 2
- OZMLUMPWPFZWTP-UHFFFAOYSA-N 2-(tributyl-$l^{5}-phosphanylidene)acetonitrile Chemical compound CCCCP(CCCC)(CCCC)=CC#N OZMLUMPWPFZWTP-UHFFFAOYSA-N 0.000 description 2
- LXVSANCQXSSLPA-UHFFFAOYSA-N 2-Ethyl-2-hydroxy-butyric acid Chemical compound CCC(O)(CC)C(O)=O LXVSANCQXSSLPA-UHFFFAOYSA-N 0.000 description 2
- QXZDGMZJCONOGX-UHFFFAOYSA-N 2-fluoro-4-nitro-1-phenylsulfanylbenzene Chemical compound FC1=CC([N+](=O)[O-])=CC=C1SC1=CC=CC=C1 QXZDGMZJCONOGX-UHFFFAOYSA-N 0.000 description 2
- NGOKGAIFSOUVIU-UHFFFAOYSA-N 2-methyl-4-nitro-1-phenylsulfanylbenzene Chemical compound CC1=CC([N+]([O-])=O)=CC=C1SC1=CC=CC=C1 NGOKGAIFSOUVIU-UHFFFAOYSA-N 0.000 description 2
- QDVJAJNCRWJSIO-UHFFFAOYSA-N 2-methylsulfanyl-4-nitro-1-phenylbenzene Chemical compound CSC1=CC([N+]([O-])=O)=CC=C1C1=CC=CC=C1 QDVJAJNCRWJSIO-UHFFFAOYSA-N 0.000 description 2
- IZSBBJBJMBSJGJ-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-(3-methoxy-4-pyridin-4-ylsulfonylphenyl)-2-methylpropanamide Chemical compound COC1=CC(NC(=O)C(C)(O)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=NC=C1 IZSBBJBJMBSJGJ-UHFFFAOYSA-N 0.000 description 2
- GQTVIGRRCJRTBX-UHFFFAOYSA-N 3,3,3-trifluoro-n-[4-(3-fluorobenzoyl)phenyl]-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CC(F)=C1 GQTVIGRRCJRTBX-UHFFFAOYSA-N 0.000 description 2
- IGCQAJNFEBAMJJ-UHFFFAOYSA-N 3,3-difluoro-2-hydroxy-2-methylpropanoic acid Chemical compound FC(F)C(O)(C)C(O)=O IGCQAJNFEBAMJJ-UHFFFAOYSA-N 0.000 description 2
- FDSYXKNYHZKPHO-UHFFFAOYSA-N 3-(4-nitrophenyl)sulfonylpyridine Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CC=CN=C1 FDSYXKNYHZKPHO-UHFFFAOYSA-N 0.000 description 2
- SCHQWAPTRCCHGR-UHFFFAOYSA-N 3-methoxy-4-pyridin-4-ylsulfonylaniline Chemical compound COC1=CC(N)=CC=C1S(=O)(=O)C1=CC=NC=C1 SCHQWAPTRCCHGR-UHFFFAOYSA-N 0.000 description 2
- WVDXEDVIGUVYTA-UHFFFAOYSA-N 4-(2-chlorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1Cl WVDXEDVIGUVYTA-UHFFFAOYSA-N 0.000 description 2
- GGABKJDTKJFOOS-UHFFFAOYSA-N 4-(2-fluorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1F GGABKJDTKJFOOS-UHFFFAOYSA-N 0.000 description 2
- FQMOFUPNDCROBN-UHFFFAOYSA-N 4-(2-methoxy-4-nitrophenyl)sulfanylpyridine Chemical compound COC1=CC([N+]([O-])=O)=CC=C1SC1=CC=NC=C1 FQMOFUPNDCROBN-UHFFFAOYSA-N 0.000 description 2
- TYBWNOXLIDGMGO-UHFFFAOYSA-N 4-(2-methylphenyl)sulfonylaniline Chemical compound CC1=CC=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 TYBWNOXLIDGMGO-UHFFFAOYSA-N 0.000 description 2
- JJKIEHUKBJREET-UHFFFAOYSA-N 4-(3-fluorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC(F)=C1 JJKIEHUKBJREET-UHFFFAOYSA-N 0.000 description 2
- IIIBGHFAYVJNTN-UHFFFAOYSA-N 4-(benzenesulfonyl)-3-chloroaniline Chemical compound ClC1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 IIIBGHFAYVJNTN-UHFFFAOYSA-N 0.000 description 2
- UCGJCVWDWRMVSB-UHFFFAOYSA-N 4-(benzenesulfonyl)-3-methylaniline Chemical compound CC1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 UCGJCVWDWRMVSB-UHFFFAOYSA-N 0.000 description 2
- RMMCVPVNGDXOAJ-UHFFFAOYSA-N 4-amino-2-phenylsulfanylbenzonitrile Chemical compound NC1=CC=C(C#N)C(SC=2C=CC=CC=2)=C1 RMMCVPVNGDXOAJ-UHFFFAOYSA-N 0.000 description 2
- 125000006418 4-methylphenylsulfonyl group Chemical group 0.000 description 2
- LYHXEBSPXKYZHP-UHFFFAOYSA-N 4-pyrazin-2-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CN=CC=N1 LYHXEBSPXKYZHP-UHFFFAOYSA-N 0.000 description 2
- QTHRNZUSIRIYDI-UHFFFAOYSA-N 4-pyrimidin-2-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=NC=CC=N1 QTHRNZUSIRIYDI-UHFFFAOYSA-N 0.000 description 2
- ABPFQVOLERTHTN-UHFFFAOYSA-N 4-thiophen-2-ylsulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=CS1 ABPFQVOLERTHTN-UHFFFAOYSA-N 0.000 description 2
- GKTKCGAOXFHFTD-UHFFFAOYSA-N 5-(4-nitrophenyl)sulfonyl-1,3-thiazol-2-amine Chemical compound S1C(N)=NC=C1S(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1 GKTKCGAOXFHFTD-UHFFFAOYSA-N 0.000 description 2
- JTLFPFJOGGQGNZ-UHFFFAOYSA-N 5-(4-nitrophenyl)sulfonyl-1,3-thiazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CN=CS1 JTLFPFJOGGQGNZ-UHFFFAOYSA-N 0.000 description 2
- KUWFTPAQURHOBN-UHFFFAOYSA-N 5-nitro-2-phenylsulfanylbenzonitrile Chemical compound N#CC1=CC([N+](=O)[O-])=CC=C1SC1=CC=CC=C1 KUWFTPAQURHOBN-UHFFFAOYSA-N 0.000 description 2
- UDPFENQZHIOLIT-UHFFFAOYSA-N 6-phenylsulfanylpyridin-3-amine Chemical compound N1=CC(N)=CC=C1SC1=CC=CC=C1 UDPFENQZHIOLIT-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 206010002091 Anaesthesia Diseases 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- BQHLZYXUSUBMTH-UHFFFAOYSA-N CC(C(=O)NC1=CC=C(C=C1)C2=CC=CC=C2OC)(C(F)(F)F)O Chemical compound CC(C(=O)NC1=CC=C(C=C1)C2=CC=CC=C2OC)(C(F)(F)F)O BQHLZYXUSUBMTH-UHFFFAOYSA-N 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- 206010019280 Heart failures Diseases 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 239000012839 Krebs-Henseleit buffer Substances 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 101100109871 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) aro-8 gene Proteins 0.000 description 2
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 101100226004 Rattus norvegicus Erc2 gene Proteins 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 210000000683 abdominal cavity Anatomy 0.000 description 2
- 230000003187 abdominal effect Effects 0.000 description 2
- 210000003489 abdominal muscle Anatomy 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 230000037005 anaesthesia Effects 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 210000005068 bladder tissue Anatomy 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 210000001715 carotid artery Anatomy 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 description 2
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 2
- 230000003226 decolorizating effect Effects 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 238000005462 in vivo assay Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 230000027939 micturition Effects 0.000 description 2
- DFQCVXOIMDPCJO-UHFFFAOYSA-N n-(4-benzoyl-3-fluorophenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound FC1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CC=C1 DFQCVXOIMDPCJO-UHFFFAOYSA-N 0.000 description 2
- HSWBBZLWIGINOW-UHFFFAOYSA-N n-(4-cyano-3-phenylsulfanylphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound FC(F)(F)C(O)(C)C(=O)NC1=CC=C(C#N)C(SC=2C=CC=CC=2)=C1 HSWBBZLWIGINOW-UHFFFAOYSA-N 0.000 description 2
- AROQPSZAXZCVAD-UHFFFAOYSA-N n-[4-(benzenesulfonyl)-3-methoxyphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound COC1=CC(NC(=O)C(C)(O)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1 AROQPSZAXZCVAD-UHFFFAOYSA-N 0.000 description 2
- KFNDYUFUQFHQRK-UHFFFAOYSA-N n-[4-(benzenesulfonyl)phenyl]-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)(F)F)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1 KFNDYUFUQFHQRK-UHFFFAOYSA-N 0.000 description 2
- 229940105631 nembutal Drugs 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000002504 physiological saline solution Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 238000009958 sewing Methods 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 238000002424 x-ray crystallography Methods 0.000 description 2
- MLIWQXBKMZNZNF-KUHOPJCQSA-N (2e)-2,6-bis[(4-azidophenyl)methylidene]-4-methylcyclohexan-1-one Chemical compound O=C1\C(=C\C=2C=CC(=CC=2)N=[N+]=[N-])CC(C)CC1=CC1=CC=C(N=[N+]=[N-])C=C1 MLIWQXBKMZNZNF-KUHOPJCQSA-N 0.000 description 1
- ZLEFKGAGSCJDBB-UHFFFAOYSA-N (4-amino-2-fluorophenyl)-phenylmethanone Chemical compound FC1=CC(N)=CC=C1C(=O)C1=CC=CC=C1 ZLEFKGAGSCJDBB-UHFFFAOYSA-N 0.000 description 1
- YCLQTMVHFMKKJV-UHFFFAOYSA-N (4-amino-2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC(N)=CC=C1C(=O)C1=CC=CC=C1 YCLQTMVHFMKKJV-UHFFFAOYSA-N 0.000 description 1
- RUBQQRMAWLSCCJ-UHFFFAOYSA-N 1,2-difluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(F)=C1 RUBQQRMAWLSCCJ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- NTKADLOYTKVXQN-UHFFFAOYSA-N 1-bromo-2-methoxy-4-nitrobenzene Chemical compound COC1=CC([N+]([O-])=O)=CC=C1Br NTKADLOYTKVXQN-UHFFFAOYSA-N 0.000 description 1
- JXIJUAWSDBACEB-UHFFFAOYSA-N 1-chloro-2-methoxy-4-nitrobenzene Chemical compound COC1=CC([N+]([O-])=O)=CC=C1Cl JXIJUAWSDBACEB-UHFFFAOYSA-N 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- CPKVUHPKYQGHMW-UHFFFAOYSA-N 1-ethenylpyrrolidin-2-one;molecular iodine Chemical compound II.C=CN1CCCC1=O CPKVUHPKYQGHMW-UHFFFAOYSA-N 0.000 description 1
- JJABOWZNFOCHMN-UHFFFAOYSA-N 1-hydroxycyclopentane-1-carboxylic acid Chemical compound OC(=O)C1(O)CCCC1 JJABOWZNFOCHMN-UHFFFAOYSA-N 0.000 description 1
- GQXURJDNDYACGE-UHFFFAOYSA-N 1-hydroxycyclopropane-1-carboxylic acid Chemical compound OC(=O)C1(O)CC1 GQXURJDNDYACGE-UHFFFAOYSA-N 0.000 description 1
- YPQMECSSHSSKIG-UHFFFAOYSA-N 1-methoxy-3-(4-nitrophenyl)sulfanylbenzene Chemical compound COC1=CC=CC(SC=2C=CC(=CC=2)[N+]([O-])=O)=C1 YPQMECSSHSSKIG-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- JLZVIWSFUPLSOR-UHFFFAOYSA-N 2,3-difluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(F)=C1F JLZVIWSFUPLSOR-UHFFFAOYSA-N 0.000 description 1
- LBQMIAVIGLLBGW-UHFFFAOYSA-N 2,5-difluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=CC=C1F LBQMIAVIGLLBGW-UHFFFAOYSA-N 0.000 description 1
- IVSRTFGFSPGVAG-UHFFFAOYSA-N 2-(2-methoxyphenyl)-1-[2-(2-methoxyphenyl)-4-nitrophenyl]sulfanyl-4-nitrobenzene Chemical compound COC1=CC=CC=C1C1=CC([N+]([O-])=O)=CC=C1SC1=CC=C([N+]([O-])=O)C=C1C1=CC=CC=C1OC IVSRTFGFSPGVAG-UHFFFAOYSA-N 0.000 description 1
- JZIAXHDTLXCVNV-UHFFFAOYSA-N 2-(2-methoxyphenyl)-1-[2-(2-methoxyphenyl)-4-nitrophenyl]sulfonyl-4-nitrobenzene Chemical compound COC1=CC=CC=C1C1=CC([N+]([O-])=O)=CC=C1S(=O)(=O)C1=CC=C([N+]([O-])=O)C=C1C1=CC=CC=C1OC JZIAXHDTLXCVNV-UHFFFAOYSA-N 0.000 description 1
- LGDOGDJADXLHLA-UHFFFAOYSA-N 2-(4-nitrophenyl)-1,3-thiazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1=NC=CS1 LGDOGDJADXLHLA-UHFFFAOYSA-N 0.000 description 1
- PIBPBGMHPUPAMF-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfanyl-1,3-thiazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1SC1=NC=CS1 PIBPBGMHPUPAMF-UHFFFAOYSA-N 0.000 description 1
- DRZHMCCSGGGUDN-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfanylpyrazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1SC1=CN=CC=N1 DRZHMCCSGGGUDN-UHFFFAOYSA-N 0.000 description 1
- MIEGJGVFPKVZQJ-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfonyl-1,3-thiazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=NC=CS1 MIEGJGVFPKVZQJ-UHFFFAOYSA-N 0.000 description 1
- KNXDWZLVOLZISA-UHFFFAOYSA-N 2-(4-nitrophenyl)sulfonylpyrazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CN=CC=N1 KNXDWZLVOLZISA-UHFFFAOYSA-N 0.000 description 1
- BPXKZEMBEZGUAH-UHFFFAOYSA-N 2-(chloromethoxy)ethyl-trimethylsilane Chemical compound C[Si](C)(C)CCOCCl BPXKZEMBEZGUAH-UHFFFAOYSA-N 0.000 description 1
- RWMUNDDPPSAKGI-UHFFFAOYSA-N 2-(difluoromethyl)-3,3-difluoro-2-hydroxy-n-(4-pyridin-2-ylsulfonylphenyl)propanamide Chemical compound C1=CC(NC(=O)C(C(F)F)(C(F)F)O)=CC=C1S(=O)(=O)C1=CC=CC=N1 RWMUNDDPPSAKGI-UHFFFAOYSA-N 0.000 description 1
- ZLIUSWWNQWBPJO-UHFFFAOYSA-N 2-(difluoromethyl)-3,3-difluoro-2-hydroxy-n-(4-pyridin-4-ylsulfonylphenyl)propanamide Chemical compound C1=CC(NC(=O)C(C(F)F)(C(F)F)O)=CC=C1S(=O)(=O)C1=CC=NC=C1 ZLIUSWWNQWBPJO-UHFFFAOYSA-N 0.000 description 1
- UFDXCRVMBHRDSQ-UHFFFAOYSA-N 2-(difluoromethyl)-3,3-difluoro-2-hydroxy-n-[4-(pyridine-2-carbonyl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(C(F)F)(C(F)F)O)=CC=C1C(=O)C1=CC=CC=N1 UFDXCRVMBHRDSQ-UHFFFAOYSA-N 0.000 description 1
- AFMPMSCZPVNPEM-UHFFFAOYSA-N 2-bromobenzonitrile Chemical compound BrC1=CC=CC=C1C#N AFMPMSCZPVNPEM-UHFFFAOYSA-N 0.000 description 1
- ZGILLTVEEBNDOB-UHFFFAOYSA-N 2-chloro-5-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C#N)=C1 ZGILLTVEEBNDOB-UHFFFAOYSA-N 0.000 description 1
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- GELVZYOEQVJIRR-UHFFFAOYSA-N 2-chloropyrazine Chemical compound ClC1=CN=CC=N1 GELVZYOEQVJIRR-UHFFFAOYSA-N 0.000 description 1
- NSTREUWFTAOOKS-UHFFFAOYSA-N 2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1F NSTREUWFTAOOKS-UHFFFAOYSA-N 0.000 description 1
- MBIQENSCDNJOIY-UHFFFAOYSA-N 2-hydroxy-2-methylbutyric acid Chemical compound CCC(C)(O)C(O)=O MBIQENSCDNJOIY-UHFFFAOYSA-N 0.000 description 1
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical compound OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 1
- KSUALKLHLMDLGR-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-N-[4-(pyridine-3-carbonyl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CN=C1 KSUALKLHLMDLGR-UHFFFAOYSA-N 0.000 description 1
- MCAJQCKVQVTKOO-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-n-(4-pyrazin-2-ylsulfonylphenyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CN=CC=N1 MCAJQCKVQVTKOO-UHFFFAOYSA-N 0.000 description 1
- CBVDKJDKOREVOE-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-n-(4-pyridin-3-ylsulfonylphenyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CN=C1 CBVDKJDKOREVOE-UHFFFAOYSA-N 0.000 description 1
- ZBXNHZDPASGDOU-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-n-(4-thiophen-2-ylsulfonylphenyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CS1 ZBXNHZDPASGDOU-UHFFFAOYSA-N 0.000 description 1
- VLAQPMGYVZZRGM-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-n-[4-(1,3-thiazol-2-ylsulfonyl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=NC=CS1 VLAQPMGYVZZRGM-UHFFFAOYSA-N 0.000 description 1
- VFBGBNVAOFVHRV-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-n-[4-(1,3-thiazol-5-ylsulfonyl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CN=CS1 VFBGBNVAOFVHRV-UHFFFAOYSA-N 0.000 description 1
- GGWJIYRHWWWLAN-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-n-[4-(2-methylphenyl)sulfonylphenyl]propanamide Chemical compound CC1=CC=CC=C1S(=O)(=O)C1=CC=C(NC(=O)C(C)(O)C(F)(F)F)C=C1 GGWJIYRHWWWLAN-UHFFFAOYSA-N 0.000 description 1
- QQFFMRYSIPMXIN-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-n-[4-(3-methylphenyl)sulfonylphenyl]propanamide Chemical compound CC1=CC=CC(S(=O)(=O)C=2C=CC(NC(=O)C(C)(O)C(F)(F)F)=CC=2)=C1 QQFFMRYSIPMXIN-UHFFFAOYSA-N 0.000 description 1
- SSTLIFXXHILBDW-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-2-methyl-n-[4-(pyridine-2-carbonyl)phenyl]propanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CC=N1 SSTLIFXXHILBDW-UHFFFAOYSA-N 0.000 description 1
- YVNBCEJIQXTGGO-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-(3-pyridin-2-ylsulfonylphenyl)-2-(trifluoromethyl)propanamide Chemical compound FC(F)(F)C(C(F)(F)F)(O)C(=O)NC1=CC=CC(S(=O)(=O)C=2N=CC=CC=2)=C1 YVNBCEJIQXTGGO-UHFFFAOYSA-N 0.000 description 1
- IDDNGQJMAIRFTN-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-(4-pyridin-2-ylsulfonylphenyl)-2-(trifluoromethyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)(F)F)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=N1 IDDNGQJMAIRFTN-UHFFFAOYSA-N 0.000 description 1
- FTVVTTPQUSNKBN-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-[4-(2-hydroxyphenyl)sulfonylphenyl]-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1O FTVVTTPQUSNKBN-UHFFFAOYSA-N 0.000 description 1
- JQXOEXCBLVHYEO-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-[4-(3-hydroxyphenyl)sulfonylphenyl]-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC(O)=C1 JQXOEXCBLVHYEO-UHFFFAOYSA-N 0.000 description 1
- WSNUQMQZFVEAAU-UHFFFAOYSA-N 3,3,3-trifluoro-2-hydroxy-n-[4-(3-methoxyphenyl)sulfonylphenyl]-2-methylpropanamide Chemical compound COC1=CC=CC(S(=O)(=O)C=2C=CC(NC(=O)C(C)(O)C(F)(F)F)=CC=2)=C1 WSNUQMQZFVEAAU-UHFFFAOYSA-N 0.000 description 1
- OJBLMXHXUYFFPS-UHFFFAOYSA-N 3,3,3-trifluoro-2-phenylmethoxy-2-(trifluoromethyl)propanoic acid Chemical compound OC(=O)C(C(F)(F)F)(C(F)(F)F)OCC1=CC=CC=C1 OJBLMXHXUYFFPS-UHFFFAOYSA-N 0.000 description 1
- UGCQONPMPYXRNS-UHFFFAOYSA-N 3,3,3-trifluoro-n-[4-(2-fluorobenzoyl)phenyl]-2-hydroxy-2-(trifluoromethyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)(F)F)C(F)(F)F)=CC=C1C(=O)C1=CC=CC=C1F UGCQONPMPYXRNS-UHFFFAOYSA-N 0.000 description 1
- BWSPNJIWXYYHAT-UHFFFAOYSA-N 3,3,3-trifluoro-n-[4-(2-fluorobenzoyl)phenyl]-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=CC=C1F BWSPNJIWXYYHAT-UHFFFAOYSA-N 0.000 description 1
- XMTZARBQNINRNK-UHFFFAOYSA-N 3,3,3-trifluoro-n-[4-(2-fluorophenyl)sulfonylphenyl]-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1F XMTZARBQNINRNK-UHFFFAOYSA-N 0.000 description 1
- OZLGCTPQDOTOSW-UHFFFAOYSA-N 3,3,3-trifluoro-n-[4-(3-fluorobenzoyl)phenyl]-2-hydroxy-2-(trifluoromethyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)(F)F)C(F)(F)F)=CC=C1C(=O)C1=CC=CC(F)=C1 OZLGCTPQDOTOSW-UHFFFAOYSA-N 0.000 description 1
- WGQLUICMTUFYFZ-UHFFFAOYSA-N 3,3,3-trifluoro-n-[4-(3-fluorophenyl)sulfonylphenyl]-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC(F)=C1 WGQLUICMTUFYFZ-UHFFFAOYSA-N 0.000 description 1
- LNTIYGUDDGCZHR-UHFFFAOYSA-N 3,3,3-trifluoro-n-[4-(4-fluorobenzoyl)phenyl]-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1C(=O)C1=CC=C(F)C=C1 LNTIYGUDDGCZHR-UHFFFAOYSA-N 0.000 description 1
- AIXKMRNUULJVSM-UHFFFAOYSA-N 3-fluoro-2-hydroxy-2-methyl-n-(4-pyridin-4-ylsulfonylphenyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(CF)C)=CC=C1S(=O)(=O)C1=CC=NC=C1 AIXKMRNUULJVSM-UHFFFAOYSA-N 0.000 description 1
- QZVQQUVWFIZUBQ-UHFFFAOYSA-N 3-fluoroaniline Chemical compound NC1=CC=CC(F)=C1 QZVQQUVWFIZUBQ-UHFFFAOYSA-N 0.000 description 1
- MXNBDFWNYRNIBH-UHFFFAOYSA-N 3-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(F)=C1 MXNBDFWNYRNIBH-UHFFFAOYSA-N 0.000 description 1
- ZMLMBLYLMRDXOJ-UHFFFAOYSA-N 4-(1,3-thiazol-2-ylsulfonyl)aniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=NC=CS1 ZMLMBLYLMRDXOJ-UHFFFAOYSA-N 0.000 description 1
- SLHDEXFDIMAHRG-UHFFFAOYSA-N 4-(2-methoxy-4-nitrophenyl)sulfonylpyridine Chemical compound COC1=CC([N+]([O-])=O)=CC=C1S(=O)(=O)C1=CC=NC=C1 SLHDEXFDIMAHRG-UHFFFAOYSA-N 0.000 description 1
- VPUUSIRSYXBBJA-UHFFFAOYSA-N 4-(2-methoxyphenyl)aniline Chemical compound COC1=CC=CC=C1C1=CC=C(N)C=C1 VPUUSIRSYXBBJA-UHFFFAOYSA-N 0.000 description 1
- FALWGMKGZCNVKK-UHFFFAOYSA-N 4-(3-methoxyphenyl)sulfonylaniline Chemical compound COC1=CC=CC(S(=O)(=O)C=2C=CC(N)=CC=2)=C1 FALWGMKGZCNVKK-UHFFFAOYSA-N 0.000 description 1
- YKLGSFACDTUTPG-UHFFFAOYSA-N 4-(4-fluorophenyl)sulfonylaniline Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(F)C=C1 YKLGSFACDTUTPG-UHFFFAOYSA-N 0.000 description 1
- FOFYJTZGGPTCOU-UHFFFAOYSA-N 4-(benzenesulfonyl)-3-methoxyaniline Chemical compound COC1=CC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 FOFYJTZGGPTCOU-UHFFFAOYSA-N 0.000 description 1
- ZFBKYGFPUCUYIF-UHFFFAOYSA-N 4-amino-2-chlorobenzonitrile Chemical compound NC1=CC=C(C#N)C(Cl)=C1 ZFBKYGFPUCUYIF-UHFFFAOYSA-N 0.000 description 1
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- DFGKGUXTPFWHIX-UHFFFAOYSA-N 6-[2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]acetyl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)C1=CC2=C(NC(O2)=O)C=C1 DFGKGUXTPFWHIX-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 208000000884 Airway Obstruction Diseases 0.000 description 1
- 201000004384 Alopecia Diseases 0.000 description 1
- 238000012935 Averaging Methods 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- KYNSBQPICQTCGU-UHFFFAOYSA-N Benzopyrane Chemical compound C1=CC=C2C=CCOC2=C1 KYNSBQPICQTCGU-UHFFFAOYSA-N 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- LJKSNFDHFOFKFR-UHFFFAOYSA-N COC1=CC=CC=C1C2=C(C=CC(=C2)[N+](=O)[O-])S(=O)(=O)O Chemical compound COC1=CC=CC=C1C2=C(C=CC(=C2)[N+](=O)[O-])S(=O)(=O)O LJKSNFDHFOFKFR-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- 108091006146 Channels Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 208000033999 Device damage Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 208000000059 Dyspnea Diseases 0.000 description 1
- 206010013975 Dyspnoeas Diseases 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 206010020853 Hypertonic bladder Diseases 0.000 description 1
- 206010021639 Incontinence Diseases 0.000 description 1
- YQEZLKZALYSWHR-UHFFFAOYSA-N Ketamine Chemical compound C=1C=CC=C(Cl)C=1C1(NC)CCCCC1=O YQEZLKZALYSWHR-UHFFFAOYSA-N 0.000 description 1
- 208000000913 Kidney Calculi Diseases 0.000 description 1
- 229920006063 Lamide® Polymers 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- LJLXQHHFAKVTNP-UHFFFAOYSA-N N-[4-(benzenesulfonyl)phenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1 LJLXQHHFAKVTNP-UHFFFAOYSA-N 0.000 description 1
- LKJPYSCBVHEWIU-UHFFFAOYSA-N N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide Chemical compound C=1C=C(C#N)C(C(F)(F)F)=CC=1NC(=O)C(O)(C)CS(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-UHFFFAOYSA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 206010029148 Nephrolithiasis Diseases 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 206010033799 Paralysis Diseases 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 208000018262 Peripheral vascular disease Diseases 0.000 description 1
- 229920002565 Polyethylene Glycol 400 Polymers 0.000 description 1
- 229920000153 Povidone-iodine Polymers 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 238000007351 Smiles rearrangement reaction Methods 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229960001413 acetanilide Drugs 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 210000000577 adipose tissue Anatomy 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004873 anchoring Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000002280 anti-androgenic effect Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- HAVZTGSQJIEKPI-UHFFFAOYSA-N benzothiadiazine Chemical compound C1=CC=C2C=NNSC2=C1 HAVZTGSQJIEKPI-UHFFFAOYSA-N 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 1
- 210000003443 bladder cell Anatomy 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- 125000004775 chlorodifluoromethyl group Chemical group FC(F)(Cl)* 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- NSNHWTBQMQIDCF-UHFFFAOYSA-N dihydrate;hydrochloride Chemical compound O.O.Cl NSNHWTBQMQIDCF-UHFFFAOYSA-N 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000002031 ethanolic fraction Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- AZLPEJUVWWGLHA-UHFFFAOYSA-N ethyl acetate;hexane;methanol Chemical compound OC.CCCCCC.CCOC(C)=O AZLPEJUVWWGLHA-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000003676 hair loss Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000011597 hartley guinea pig Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- RCBVKBFIWMOMHF-UHFFFAOYSA-L hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine Chemical compound C1=CC=NC=C1.C1=CC=NC=C1.O[Cr](=O)(=O)O[Cr](O)(=O)=O RCBVKBFIWMOMHF-UHFFFAOYSA-L 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 230000036724 intravesical pressure Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 208000002551 irritable bowel syndrome Diseases 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 229960003299 ketamine Drugs 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- YECIFGHRMFEPJK-UHFFFAOYSA-N lidocaine hydrochloride monohydrate Chemical compound O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C YECIFGHRMFEPJK-UHFFFAOYSA-N 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- CYEBJEDOHLIWNP-UHFFFAOYSA-N methanethioamide Chemical class NC=S CYEBJEDOHLIWNP-UHFFFAOYSA-N 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 238000004452 microanalysis Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 208000031225 myocardial ischemia Diseases 0.000 description 1
- GDHTXIIHBPIDSA-UHFFFAOYSA-N n-(4-benzoylphenyl)-2-(difluoromethyl)-3,3-difluoro-2-hydroxypropanamide Chemical compound C1=CC(NC(=O)C(C(F)F)(C(F)F)O)=CC=C1C(=O)C1=CC=CC=C1 GDHTXIIHBPIDSA-UHFFFAOYSA-N 0.000 description 1
- MXVQUUZRPMKMDB-UHFFFAOYSA-N n-(4-benzoylphenyl)-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)(F)F)C(F)(F)F)=CC=C1C(=O)C1=CC=CC=C1 MXVQUUZRPMKMDB-UHFFFAOYSA-N 0.000 description 1
- DLWRNOUZHFNEIR-UHFFFAOYSA-N n-(4-benzoylphenyl)-3-fluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(CF)C)=CC=C1C(=O)C1=CC=CC=C1 DLWRNOUZHFNEIR-UHFFFAOYSA-N 0.000 description 1
- HQNJRDMUIQHXSI-UHFFFAOYSA-N n-[3-(benzenesulfonyl)-4-cyanophenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound FC(F)(F)C(O)(C)C(=O)NC1=CC=C(C#N)C(S(=O)(=O)C=2C=CC=CC=2)=C1 HQNJRDMUIQHXSI-UHFFFAOYSA-N 0.000 description 1
- OQAQASAFCBJWTB-UHFFFAOYSA-N n-[4-(2-chlorophenyl)sulfonylphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1Cl OQAQASAFCBJWTB-UHFFFAOYSA-N 0.000 description 1
- LJAVVZVABCBCCZ-UHFFFAOYSA-N n-[4-(3-chlorophenyl)sulfonylphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC(Cl)=C1 LJAVVZVABCBCCZ-UHFFFAOYSA-N 0.000 description 1
- RUNHZUHHCYBZMD-UHFFFAOYSA-N n-[4-(benzenesulfonyl)-3-fluorophenyl]-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide Chemical compound FC1=CC(NC(=O)C(O)(C(F)(F)F)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1 RUNHZUHHCYBZMD-UHFFFAOYSA-N 0.000 description 1
- LRGGYMDTDQHDIF-UHFFFAOYSA-N n-[4-(benzenesulfonyl)-3-fluorophenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound FC1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1 LRGGYMDTDQHDIF-UHFFFAOYSA-N 0.000 description 1
- PXUHSBKGJFYMON-UHFFFAOYSA-N n-[4-(benzenesulfonyl)-3-hydroxyphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound OC1=CC(NC(=O)C(O)(C)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1 PXUHSBKGJFYMON-UHFFFAOYSA-N 0.000 description 1
- SJEPCZDBIROJSP-UHFFFAOYSA-N n-[4-(benzenesulfonyl)-3-methylphenyl]-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide Chemical compound CC1=CC(NC(=O)C(C)(O)C(F)(F)F)=CC=C1S(=O)(=O)C1=CC=CC=C1 SJEPCZDBIROJSP-UHFFFAOYSA-N 0.000 description 1
- AUOAESSTGMYALR-UHFFFAOYSA-N n-[4-(benzenesulfonyl)phenyl]-2-(difluoromethyl)-3,3-difluoro-2-hydroxypropanamide Chemical compound C1=CC(NC(=O)C(C(F)F)(C(F)F)O)=CC=C1S(=O)(=O)C1=CC=CC=C1 AUOAESSTGMYALR-UHFFFAOYSA-N 0.000 description 1
- ONMNODLTEZQJDD-UHFFFAOYSA-N n-[4-(benzenesulfonyl)phenyl]-3,3,3-trifluoro-2-phenylmethoxy-2-(trifluoromethyl)propanamide Chemical compound C=1C=C(S(=O)(=O)C=2C=CC=CC=2)C=CC=1NC(=O)C(C(F)(F)F)(C(F)(F)F)OCC1=CC=CC=C1 ONMNODLTEZQJDD-UHFFFAOYSA-N 0.000 description 1
- NIWPQMZRFCOXMJ-UHFFFAOYSA-N n-[4-(benzenesulfonyl)phenyl]-3,3-difluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(C(F)F)C)=CC=C1S(=O)(=O)C1=CC=CC=C1 NIWPQMZRFCOXMJ-UHFFFAOYSA-N 0.000 description 1
- ISBCYEAIWGZFRJ-UHFFFAOYSA-N n-[4-(benzenesulfonyl)phenyl]-3-fluoro-2-hydroxy-2-methylpropanamide Chemical compound C1=CC(NC(=O)C(O)(CF)C)=CC=C1S(=O)(=O)C1=CC=CC=C1 ISBCYEAIWGZFRJ-UHFFFAOYSA-N 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 125000001736 nosyl group Chemical group S(=O)(=O)(C1=CC=C([N+](=O)[O-])C=C1)* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 208000021090 palsy Diseases 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 238000005897 peptide coupling reaction Methods 0.000 description 1
- 239000008014 pharmaceutical binder Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical class O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 102000054765 polymorphisms of proteins Human genes 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- HDBKDTGEDPPATF-UHFFFAOYSA-M potassium;2-methoxybenzenethiolate Chemical compound [K+].COC1=CC=CC=C1[S-] HDBKDTGEDPPATF-UHFFFAOYSA-M 0.000 description 1
- ROVXLNOMZDLGDB-UHFFFAOYSA-M potassium;3-methoxybenzenethiolate Chemical compound [K+].COC1=CC=CC([S-])=C1 ROVXLNOMZDLGDB-UHFFFAOYSA-M 0.000 description 1
- INFNXSSRRJMZAM-UHFFFAOYSA-M potassium;4-nitrobenzenethiolate Chemical compound [K+].[O-][N+](=O)C1=CC=C([S-])C=C1 INFNXSSRRJMZAM-UHFFFAOYSA-M 0.000 description 1
- GFFZAFIBOVCKCQ-UHFFFAOYSA-M potassium;pyridine-4-thiolate Chemical compound [K+].[S-]C1=CC=NC=C1 GFFZAFIBOVCKCQ-UHFFFAOYSA-M 0.000 description 1
- 229960001621 povidone-iodine Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000012289 standard assay Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 206010044008 tonsillitis Diseases 0.000 description 1
- 210000003437 trachea Anatomy 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 1
- SBXWFLISHPUINY-UHFFFAOYSA-N triphenyltin Chemical compound C1=CC=CC=C1[Sn](C=1C=CC=CC=1)C1=CC=CC=C1 SBXWFLISHPUINY-UHFFFAOYSA-N 0.000 description 1
- 210000003708 urethra Anatomy 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/38—Heterocyclic compounds having sulfur as a ring hetero atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/02—Drugs for disorders of the urinary system of urine or of the urinary tract, e.g. urine acidifiers
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C235/16—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C317/34—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring
- C07C317/38—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring with the nitrogen atom of at least one amino group being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfones
- C07C317/40—Y being a hydrogen or a carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/44—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/44—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton
- C07C317/48—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton the carbon skeleton being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C317/50—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton the carbon skeleton being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/38—One sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/18—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/34—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Reproductive Health (AREA)
- Endocrinology (AREA)
- Urology & Nephrology (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Steroid Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919116069A GB9116069D0 (en) | 1991-07-25 | 1991-07-25 | Therapeutic amides |
| GB929209416A GB9209416D0 (en) | 1992-04-30 | 1992-04-30 | Therapeutic amides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SK234292A3 SK234292A3 (en) | 1995-03-08 |
| SK280516B6 true SK280516B6 (sk) | 2000-03-13 |
Family
ID=26299285
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK2342-92A SK280516B6 (sk) | 1991-07-25 | 1992-07-24 | Amidy, spôsob ich prípravy a farmaceutická kompozí |
Country Status (24)
| Country | Link |
|---|---|
| US (7) | US5272163A (Sortimente) |
| EP (1) | EP0524781B1 (Sortimente) |
| JP (1) | JP3192228B2 (Sortimente) |
| KR (1) | KR100239077B1 (Sortimente) |
| CN (1) | CN1038413C (Sortimente) |
| AT (1) | ATE136027T1 (Sortimente) |
| AU (1) | AU648423B2 (Sortimente) |
| CA (1) | CA2074605A1 (Sortimente) |
| CZ (1) | CZ282503B6 (Sortimente) |
| DE (1) | DE69209395T2 (Sortimente) |
| DK (1) | DK0524781T3 (Sortimente) |
| ES (1) | ES2084944T3 (Sortimente) |
| FI (1) | FI112940B (Sortimente) |
| GB (1) | GB9214120D0 (Sortimente) |
| GR (1) | GR3019446T3 (Sortimente) |
| HU (2) | HU213605B (Sortimente) |
| IE (1) | IE72507B1 (Sortimente) |
| IL (1) | IL102626A (Sortimente) |
| NO (1) | NO178300C (Sortimente) |
| NZ (1) | NZ243686A (Sortimente) |
| PL (1) | PL171933B1 (Sortimente) |
| SG (1) | SG48002A1 (Sortimente) |
| SK (1) | SK280516B6 (Sortimente) |
| TW (1) | TW221053B (Sortimente) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE161531T1 (de) * | 1991-10-21 | 1998-01-15 | Zeneca Ltd | Acridine-1,8-dionderivate als therapeutisches mittel |
| IL105558A (en) * | 1992-05-18 | 1998-04-05 | Zeneca Ltd | Tertiary carbinols having potassium channel activity, process for their preparation and pharmaceutical compositions containing them |
| GB9305295D0 (en) * | 1993-03-15 | 1993-05-05 | Zeneca Ltd | Therapeutic compounds |
| GB9310069D0 (en) * | 1993-05-17 | 1993-06-30 | Zeneca Ltd | Heterocyclic compounds |
| GB9310095D0 (en) * | 1993-05-17 | 1993-06-30 | Zeneca Ltd | Therapeutic compounds |
| AT402926B (de) * | 1994-12-05 | 1997-09-25 | Hafslund Nycomed Pharma | Heterocyclische amide, verfahren zu ihrer herstellung und verwendung |
| DE19506652A1 (de) * | 1995-02-25 | 1996-08-29 | Nycomed Arzneimittel Gmbh | Heterocyclische Amide, Verfahren zu ihrer Herstellung und ihre Verwendung |
| ATE259232T1 (de) | 1995-03-03 | 2004-02-15 | Endo Pharmaceuticals Inc | Verwendung von dextromethorphan oder dextrorphan zur behandlung der harninkontinenz |
| CN1168133A (zh) * | 1995-10-16 | 1997-12-17 | 协和发酵工业株式会社 | 三环化合物 |
| US5756005A (en) * | 1995-11-01 | 1998-05-26 | Rohm And Haas Company | Stabilization of non-halogenated 3-isothiazolones in aggressive systems |
| AU2030397A (en) * | 1996-03-06 | 1997-09-22 | L'oreal | Use of n-aryl-2-hydroxyalkylamides for stimulating or inducing hair growth and/or arresting hair loss |
| FR2747039B1 (fr) * | 1996-04-05 | 1998-05-22 | Oreal | Utilisation du n-(3,4-dicyano-phenyl)- 3,3,3-trifluoro- 2-hydroxy-2-methylpropionamide pour stimuler ou induire la pousse des cheveux et/ou stopper leur chute |
| GB9607458D0 (en) | 1996-04-10 | 1996-06-12 | Zeneca Ltd | Enzymatic process for stereoselective preparation of therapeutic amides |
| DE19614859A1 (de) * | 1996-04-16 | 1997-10-23 | Basf Ag | Herbizide Benzoylisothiazole |
| DE19614858A1 (de) * | 1996-04-16 | 1997-10-23 | Basf Ag | Herbizide heterocyclisch substituierte Benzoylisothiazole |
| DE19614856A1 (de) * | 1996-04-16 | 1997-10-23 | Basf Ag | Herbizide heterocyclisch anellierte Benzoylisothiazole |
| US6171298B1 (en) | 1996-05-03 | 2001-01-09 | Situs Corporation | Intravesical infuser |
| ES2308788T3 (es) * | 1996-07-10 | 2008-12-01 | Lonza Ag | Proceso para la produccion de acido (s)- o (r)-3,3,3-trifluoro-2-hidroxi-2-metilpropionico. |
| EP0927035A4 (en) * | 1996-09-13 | 2002-11-13 | Merck & Co Inc | THROMBIN INHIBITORS |
| ES2273413T3 (es) * | 1997-04-15 | 2007-05-01 | Kyowa Hakko Kogyo Co., Ltd. | Compuestos triciclicos. |
| CN1265643A (zh) * | 1997-08-05 | 2000-09-06 | 美国家用产品公司 | 邻氨基苯甲酸类似物 |
| AU8684598A (en) * | 1997-08-05 | 1999-03-01 | American Home Products Corporation | Anthranilic acid analogs |
| US6127392A (en) * | 1997-08-05 | 2000-10-03 | American Home Products Corporation | Anthranilic acid analogs |
| FR2770842B1 (fr) * | 1997-11-13 | 1999-12-17 | Oreal | Nouveaux composes derives de n-aryl 2-hydroxy alkylamides |
| ATE236136T1 (de) * | 1998-01-16 | 2003-04-15 | Hoffmann La Roche | Benzosulfonderivate |
| GB9804648D0 (en) | 1998-03-06 | 1998-04-29 | Zeneca Ltd | Chemical compounds |
| US6183461B1 (en) | 1998-03-11 | 2001-02-06 | Situs Corporation | Method for delivering a medication |
| GB9805520D0 (en) | 1998-03-17 | 1998-05-13 | Zeneca Ltd | Chemical compounds |
| GB9811427D0 (en) | 1998-05-29 | 1998-07-22 | Zeneca Ltd | Chemical compounds |
| US6096770A (en) * | 1998-08-03 | 2000-08-01 | American Home Products Corporation | Anthranilic acid analogs |
| PT1155138E (pt) | 1999-02-23 | 2005-04-29 | Lonza Ag | Processo para a producao de derivados de acido 3,3,3-trifluorometil-2-alquilpropionico opticamente activos |
| ATE277905T1 (de) | 1999-02-24 | 2004-10-15 | Hoffmann La Roche | 4-phenylpyridinderivate und deren verwendung als nk-1 rezeptorantagonisten |
| US6599942B1 (en) | 1999-03-29 | 2003-07-29 | Novartis Ag | Thyromimetic organic compounds |
| US6790978B2 (en) | 1999-03-29 | 2004-09-14 | Novartis Ag | Thyromimetic organic compounds |
| MY122278A (en) | 1999-07-19 | 2006-04-29 | Upjohn Co | 1,2,3,4,5,6-hexahydroazepino[4,5-b]indoles containing arylsulfones at the 9-position |
| US7030109B2 (en) | 1999-07-19 | 2006-04-18 | Pharmacia & Upjohn Company | 1,2,3,4,5,6-Hexahydroazepino[4,5-b]indoles containing arylsulfones at the 9-position |
| ES2307528T3 (es) | 1999-09-04 | 2008-12-01 | Astrazeneca Ab | Amidas como inhibidores para la piruvato deshidrogenasa. |
| HUP0202725A3 (en) * | 1999-09-04 | 2005-04-28 | Astrazeneca Ab | Substituted n-phenyl 2-hydroxy-2-methyl-3,3,3-trifluoropropanamide derivatives which elevate pyruvate dehydrogenase activity, process for their preparation and pharmaceutical compositions containing them |
| JP2003508514A (ja) | 1999-09-04 | 2003-03-04 | アストラゼネカ アクチボラグ | 化学的化合物 |
| DE10061876A1 (de) * | 2000-12-12 | 2002-06-20 | Aventis Pharma Gmbh | Arylierte Furan- und Thiophencarbonsäureamide, Verfahren zu ihrer Herstellung, ihre Verwendung als Medikament sowie sie enthaltende pharmazeutische Zubereitungen |
| US7765153B2 (en) * | 2003-06-10 | 2010-07-27 | Kagi, Inc. | Method and apparatus for verifying financial account information |
| US7288658B2 (en) | 2003-07-15 | 2007-10-30 | Hoffmann-La Roche Inc. | Process for preparation of pyridine derivatives |
| US7404324B2 (en) * | 2005-08-19 | 2008-07-29 | Honeywell International Inc. | Gunhard shock isolation system |
| NZ566419A (en) | 2005-09-23 | 2010-03-26 | Hoffmann La Roche | Novel dosage formulation |
| US10865184B2 (en) | 2015-04-21 | 2020-12-15 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| US10093613B2 (en) | 2015-04-21 | 2018-10-09 | Gtx, Inc. | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| US10441570B2 (en) | 2015-04-21 | 2019-10-15 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) Ligands and methods of use thereof |
| US10806720B2 (en) | 2015-04-21 | 2020-10-20 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| US10654809B2 (en) | 2016-06-10 | 2020-05-19 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| CN105218418A (zh) * | 2015-10-01 | 2016-01-06 | 宜春学院 | 一种硫醚的制备方法 |
| US11230523B2 (en) | 2016-06-10 | 2022-01-25 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (SARD) ligands and methods of use thereof |
| WO2020051344A1 (en) | 2018-09-05 | 2020-03-12 | University Of Tennessee Research Foundation | Selective androgen receptor degrader (sard) ligands and methods of use thereof |
| CN112007027B (zh) * | 2020-09-14 | 2022-07-15 | 长春金赛药业有限责任公司 | 含酯基芳香丙酰胺类化合物及其代谢产物在制备治疗心衰药物中的应用 |
| EP4571056A1 (de) | 2023-12-13 | 2025-06-18 | MTU Aero Engines AG | Schaufelverstellarm für eine gasturbine, strömungsmaschine mit dem schaufelverstellarm und verfahren zur montage eines schaufelverstellarms für eine strömungsmaschine |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3365485A (en) * | 1963-05-29 | 1968-01-23 | American Home Prod | 2-acetoxyacetamido-5-chlorobenzophenone |
| US3468878A (en) * | 1963-05-29 | 1969-09-23 | American Home Prod | Process for preparing 3 - acyloxy-1,3-dihydro - 5 - aryl-2h-1,4-benzodiazepin-2-ones |
| NL7008627A (Sortimente) * | 1969-06-25 | 1970-12-29 | ||
| NL7008629A (Sortimente) * | 1969-06-25 | 1970-12-29 | ||
| US3715375A (en) * | 1970-09-17 | 1973-02-06 | Merck & Co Inc | New diphenyl sulfones |
| DE2730174C2 (de) * | 1977-07-04 | 1981-12-10 | Ludwig Merckle Kg Chem. Pharm. Fabrik, 7902 Blaubeuren | Aminobenzoesäurederivate und Arzneimittel enthaltend solche Aminobenzoesäurederivate |
| DE2862100D1 (en) * | 1977-10-12 | 1983-01-05 | Ici Plc | Acylanilides, process for their manufacture and pharmaceutical and veterinary compositions containing them |
| US4191775A (en) * | 1977-12-15 | 1980-03-04 | Imperial Chemical Industries Limited | Amide derivatives |
| JPS55108796A (en) * | 1979-02-14 | 1980-08-21 | Matsushita Electric Industrial Co Ltd | Device for inserting component |
| NZ197008A (en) * | 1980-05-22 | 1984-10-19 | Ici Ltd | Acylanilide derivatives and pharmaceutical compositions |
| AU8961382A (en) * | 1981-11-06 | 1983-05-12 | Imperial Chemical Industries Plc | Amide derivatives |
| LU88769I2 (fr) * | 1982-07-23 | 1996-11-05 | Zeneca Ltd | Bicalutamide et ses sels et esters pharmaceutiquement acceptables (Casodex (R)) |
| GB8406000D0 (en) * | 1984-03-07 | 1984-04-11 | Ici Plc | Olefine derivatives |
| NO174506B (no) * | 1984-10-30 | 1994-02-07 | Usv Pharma Corp | Analogifremgangsmaate ved fremstilling av terapeutisk aktive forbindelser |
| EP0189142A3 (en) * | 1985-01-17 | 1987-09-16 | Usv Pharmaceutical Corporation | Arylalkoxyphenyl-allylic alcohols as agents for the treatment of hypersensitive ailments |
| GB8617653D0 (en) * | 1986-07-18 | 1986-08-28 | Ici Plc | Amide derivatives |
| GB8617652D0 (en) * | 1986-07-18 | 1986-08-28 | Ici Plc | Acylanilide derivatives |
| US4851423A (en) * | 1986-12-10 | 1989-07-25 | Schering Corporation | Pharmaceutically active compounds |
| US5272982A (en) * | 1989-06-01 | 1993-12-28 | Giat Industries | Device for maintaining a projectile relative to the casing of a telescoping ammunition |
| IE902111A1 (en) * | 1989-07-18 | 1991-06-19 | Ici Plc | Diaryl ether cycloalkanes |
| IE64358B1 (en) * | 1989-07-18 | 1995-07-26 | Ici Plc | Diaryl ether heterocycles |
| GB9220570D0 (en) * | 1991-10-21 | 1992-11-11 | Ici Plc | Therapeutic agent |
-
1992
- 1992-07-03 GB GB929214120A patent/GB9214120D0/en active Pending
- 1992-07-17 EP EP92306588A patent/EP0524781B1/en not_active Expired - Lifetime
- 1992-07-17 ES ES92306588T patent/ES2084944T3/es not_active Expired - Lifetime
- 1992-07-17 SG SG1996006045A patent/SG48002A1/en unknown
- 1992-07-17 AT AT92306588T patent/ATE136027T1/de not_active IP Right Cessation
- 1992-07-17 DE DE69209395T patent/DE69209395T2/de not_active Expired - Fee Related
- 1992-07-17 DK DK92306588.2T patent/DK0524781T3/da active
- 1992-07-23 NZ NZ243686A patent/NZ243686A/en unknown
- 1992-07-23 AU AU20476/92A patent/AU648423B2/en not_active Ceased
- 1992-07-23 US US07/918,982 patent/US5272163A/en not_active Expired - Lifetime
- 1992-07-23 IL IL10262692A patent/IL102626A/en not_active IP Right Cessation
- 1992-07-24 IE IE922427A patent/IE72507B1/en not_active IP Right Cessation
- 1992-07-24 FI FI923379A patent/FI112940B/fi active
- 1992-07-24 HU HU9202429A patent/HU213605B/hu not_active IP Right Cessation
- 1992-07-24 NO NO922942A patent/NO178300C/no unknown
- 1992-07-24 CZ CS922342A patent/CZ282503B6/cs not_active IP Right Cessation
- 1992-07-24 CA CA002074605A patent/CA2074605A1/en not_active Abandoned
- 1992-07-24 SK SK2342-92A patent/SK280516B6/sk unknown
- 1992-07-24 PL PL92295405A patent/PL171933B1/pl unknown
- 1992-07-25 CN CN92109759A patent/CN1038413C/zh not_active Expired - Fee Related
- 1992-07-25 KR KR1019920013404A patent/KR100239077B1/ko not_active Expired - Fee Related
- 1992-07-27 JP JP19995492A patent/JP3192228B2/ja not_active Expired - Fee Related
- 1992-08-08 TW TW081106280A patent/TW221053B/zh active
-
1993
- 1993-09-24 US US08/126,350 patent/US5382598A/en not_active Expired - Lifetime
-
1994
- 1994-10-26 US US08/329,188 patent/US5474999A/en not_active Expired - Lifetime
-
1995
- 1995-06-07 US US08/476,007 patent/US5565477A/en not_active Expired - Lifetime
- 1995-06-07 US US08/476,407 patent/US5567735A/en not_active Expired - Lifetime
- 1995-06-07 US US08/476,413 patent/US5565465A/en not_active Expired - Lifetime
- 1995-06-16 HU HU95P/P00228P patent/HU211138A9/hu unknown
-
1996
- 1996-03-28 GR GR960400647T patent/GR3019446T3/el unknown
- 1996-08-23 US US08/701,820 patent/US5684198A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK280516B6 (sk) | Amidy, spôsob ich prípravy a farmaceutická kompozí | |
| JP5632612B2 (ja) | ラクタム化合物又はその塩及びppar活性化剤 | |
| TWI409247B (zh) | 4-取代之苯氧基苯基乙酸衍生物 | |
| EP0617010B1 (en) | Therapeutic compounds | |
| JP2009501721A (ja) | レチノイン酸受容体における活性を伴う化合物 | |
| EP0979823B1 (en) | Novel amide compounds and drugs containing the same | |
| JPH06263735A (ja) | ジアミノトリフルオロメチルピリジン誘導体、それらの製造方法及びそれらを含有するホスホリパーゼ▲a2▼阻害剤 | |
| CA2080949A1 (en) | Therapeutic agents | |
| JPH06135934A (ja) | ピリジン誘導体又はその塩を含有するホスホリパーゼ▲a2▼阻害剤、抗炎症剤又は抗膵炎剤 | |
| DK2875026T3 (en) | IMIDAZOPYRIDINE DERIVATE USED TO TREAT DIABETES | |
| JP2003505367A (ja) | マトリックスメタロプロテイナーゼ阻害剤としての3−アリールスルホニル−2−(置換メチル)プロパン酸誘導体 | |
| RU2074173C1 (ru) | Амиды, способы их получения и фармацевтическая композиция, обладающая свойствами открывателя каналов для клеточного калия | |
| EP3330263B1 (en) | Phenylurea derivatives as isocitrate dehydrogenase 2 inhibitors for treating cancer | |
| HK1003570B (en) | Therapeutic amides | |
| EP4257583A1 (en) | Biphenyl pyrrolidine and biphenyl dihydroimidazole derivatives for inhibiting activity of 5-ht7 serotonin receptor, and pharmaceutical composition comprising same as active ingredient | |
| JP2001507001A (ja) | アルドースレダクターゼ阻害剤としてのニトロメチルチオベンゼン誘導体 | |
| JPWO2001016091A1 (ja) | ビスシクロプロパンカルボン酸アミド化合物およびその医薬用途 |