SE466852B - Foerfarande foer framstaellning av n-acyl-l-prolinderivat - Google Patents
Foerfarande foer framstaellning av n-acyl-l-prolinderivatInfo
- Publication number
- SE466852B SE466852B SE8504824A SE8504824A SE466852B SE 466852 B SE466852 B SE 466852B SE 8504824 A SE8504824 A SE 8504824A SE 8504824 A SE8504824 A SE 8504824A SE 466852 B SE466852 B SE 466852B
- Authority
- SE
- Sweden
- Prior art keywords
- formula
- proline
- methylpropionyl
- carboxylic acid
- bromo
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 23
- 150000003147 proline derivatives Chemical class 0.000 title 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 27
- 229960002429 proline Drugs 0.000 claims description 25
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 claims description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 18
- 229930182821 L-proline Natural products 0.000 claims description 15
- 239000011541 reaction mixture Substances 0.000 claims description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 12
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 11
- -1 trimethylsilyl ester Chemical class 0.000 claims description 11
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 claims description 10
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 238000000926 separation method Methods 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 150000007529 inorganic bases Chemical group 0.000 claims description 2
- 150000007530 organic bases Chemical group 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 239000002516 radical scavenger Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 26
- 235000013930 proline Nutrition 0.000 description 9
- 238000005917 acylation reaction Methods 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 230000010933 acylation Effects 0.000 description 5
- ZVDKTPOXSAEUQU-UHFFFAOYSA-N 3-bromo-2-methylpropanoyl chloride Chemical compound BrCC(C)C(Cl)=O ZVDKTPOXSAEUQU-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- KQMSTUBQCCIYNK-FJXQXJEOSA-N Cl.C[Si](C)(C)OC(=O)[C@@H]1CCCN1 Chemical compound Cl.C[Si](C)(C)OC(=O)[C@@H]1CCCN1 KQMSTUBQCCIYNK-FJXQXJEOSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 150000003148 prolines Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- AAPLIUHOKVUFCC-UHFFFAOYSA-N trimethylsilanol Chemical compound C[Si](C)(C)O AAPLIUHOKVUFCC-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- MBHJFHKNCUQKCQ-UHFFFAOYSA-N trimethylsilylformic acid Chemical class C[Si](C)(C)C(O)=O MBHJFHKNCUQKCQ-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/16—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU843901A HU196369B (en) | 1984-10-18 | 1984-10-18 | New process for producing n-acylized l-prolin derivatives |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SE8504824D0 SE8504824D0 (sv) | 1985-10-16 |
| SE8504824L SE8504824L (sv) | 1986-04-19 |
| SE466852B true SE466852B (sv) | 1992-04-13 |
Family
ID=10965983
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8504824A SE466852B (sv) | 1984-10-18 | 1985-10-16 | Foerfarande foer framstaellning av n-acyl-l-prolinderivat |
Country Status (16)
| Country | Link |
|---|---|
| AT (1) | AT383345B (ca) |
| BG (1) | BG45852A3 (ca) |
| CH (1) | CH666263A5 (ca) |
| CS (1) | CS250250B2 (ca) |
| DD (1) | DD239200A5 (ca) |
| DK (1) | DK477285A (ca) |
| ES (1) | ES8704151A1 (ca) |
| FI (1) | FI85264C (ca) |
| GR (1) | GR852533B (ca) |
| HU (1) | HU196369B (ca) |
| NO (1) | NO166786C (ca) |
| PL (1) | PL145341B1 (ca) |
| PT (1) | PT81323B (ca) |
| SE (1) | SE466852B (ca) |
| SU (1) | SU1470180A3 (ca) |
| YU (1) | YU44526B (ca) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU509899B2 (en) * | 1976-02-13 | 1980-05-29 | E.R. Squibb & Sons, Inc. | Proline derivatives and related compounds |
-
1984
- 1984-10-18 HU HU843901A patent/HU196369B/hu unknown
-
1985
- 1985-10-14 CH CH4416/85A patent/CH666263A5/de not_active IP Right Cessation
- 1985-10-16 SE SE8504824A patent/SE466852B/sv not_active IP Right Cessation
- 1985-10-17 YU YU1655/85A patent/YU44526B/xx unknown
- 1985-10-17 AT AT0300585A patent/AT383345B/de not_active IP Right Cessation
- 1985-10-17 FI FI854055A patent/FI85264C/fi not_active IP Right Cessation
- 1985-10-17 PT PT81323A patent/PT81323B/pt not_active IP Right Cessation
- 1985-10-17 PL PL1985255810A patent/PL145341B1/pl unknown
- 1985-10-17 BG BG072072A patent/BG45852A3/xx unknown
- 1985-10-17 ES ES547960A patent/ES8704151A1/es not_active Expired
- 1985-10-17 DD DD85281836A patent/DD239200A5/de not_active IP Right Cessation
- 1985-10-17 NO NO854136A patent/NO166786C/no unknown
- 1985-10-17 DK DK477285A patent/DK477285A/da not_active Application Discontinuation
- 1985-10-17 SU SU853964102A patent/SU1470180A3/ru active
- 1985-10-18 GR GR852533A patent/GR852533B/el unknown
- 1985-10-18 CS CS857466A patent/CS250250B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES547960A0 (es) | 1987-04-01 |
| DK477285D0 (da) | 1985-10-17 |
| FI854055A0 (fi) | 1985-10-17 |
| PL145341B1 (en) | 1988-09-30 |
| NO854136L (no) | 1986-04-21 |
| SE8504824L (sv) | 1986-04-19 |
| NO166786B (no) | 1991-05-27 |
| DD239200A5 (de) | 1986-09-17 |
| FI85264C (fi) | 1992-03-25 |
| SU1470180A3 (ru) | 1989-03-30 |
| BG45852A3 (en) | 1989-08-15 |
| DK477285A (da) | 1986-04-19 |
| FI854055L (fi) | 1986-04-19 |
| HU196369B (en) | 1988-11-28 |
| SE8504824D0 (sv) | 1985-10-16 |
| PT81323B (pt) | 1987-10-20 |
| YU44526B (en) | 1990-08-31 |
| HUT38903A (en) | 1986-07-28 |
| PT81323A (en) | 1985-11-01 |
| YU165585A (en) | 1987-12-31 |
| CS250250B2 (en) | 1987-04-16 |
| AT383345B (de) | 1987-06-25 |
| CH666263A5 (de) | 1988-07-15 |
| NO166786C (no) | 1991-09-04 |
| GR852533B (ca) | 1986-02-19 |
| FI85264B (fi) | 1991-12-13 |
| ES8704151A1 (es) | 1987-04-01 |
| PL255810A1 (en) | 1986-09-23 |
| ATA300585A (de) | 1986-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4152326A (en) | Cyclic sulphonyloxyimides | |
| US5550283A (en) | Process for producing alanylglutamine | |
| JPS6011917B2 (ja) | 新規なセファロスポリン化合物 | |
| CN107540574A (zh) | R‑联苯丙氨醇的制备方法 | |
| US5831086A (en) | Production of cefotaxime and new sodium salts | |
| CA2546506C (fr) | Procede de synthese du perindopril et de ses sels pharmaceutiquement acceptables | |
| CA2043817A1 (en) | Process and intermediates for beta-lactams having aminothiazole (iminooxyacetic acid) acetic acid sidechains | |
| US6271371B1 (en) | Oxidative process and products thereof | |
| SE466852B (sv) | Foerfarande foer framstaellning av n-acyl-l-prolinderivat | |
| EP0018546A2 (en) | Process for the production of phenylglycyl chloride hydrochlorides | |
| US6407262B1 (en) | Process for the preparation of Ramipril | |
| KR100281826B1 (ko) | N,n-디아실이미다졸론 유도체를 이용한 아민의 아실화 방법 | |
| US5276207A (en) | Process for preparing 1-[/2S/-methyl -3-mercapto-propionyl]-pyrrolidine-/2S/-carboxylic acid | |
| US4075219A (en) | Epimerization process | |
| US3998841A (en) | Chlorothio-n-phthalimide and process therefor | |
| US5338868A (en) | Process for preparing alpha-amino-phenylacetic acid-trifluoromethane sulfonic acid mixed anhydrides | |
| US4477677A (en) | Process for the preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indoleacetoxyacetic acid | |
| CN102267946B (zh) | 高光学纯度含手性联萘骨架的α-季碳氨基酸酯类化合物、其制备方法及用途 | |
| KR100281827B1 (ko) | 메틸렌디포스폰산의제조방법 | |
| KR100280423B1 (ko) | 전압레벨변환회로 | |
| US6229019B1 (en) | Phosphinopyrroline compounds and process for producing the same | |
| US4977274A (en) | 4-hydroxyindole derivatives, the process for preparation thereof and their use | |
| KR100209298B1 (ko) | 새로운 아민고리 화합물 | |
| US4585880A (en) | Process for the preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indoleacetoxyacetic acid | |
| KR950006149B1 (ko) | 신규 n-(2-할로알카노일옥시)석신이미드 유도체 및 그 제조방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8504824-7 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8504824-7 Format of ref document f/p: F |