SE439633B - Forfarande for framstellning av heterocykliska derivat av 1-(1,3-dioxolan-2-ylmetyl)-1h-imidazoler och 1h-1,2,4-triazoler - Google Patents
Forfarande for framstellning av heterocykliska derivat av 1-(1,3-dioxolan-2-ylmetyl)-1h-imidazoler och 1h-1,2,4-triazolerInfo
- Publication number
- SE439633B SE439633B SE7801089A SE7801089A SE439633B SE 439633 B SE439633 B SE 439633B SE 7801089 A SE7801089 A SE 7801089A SE 7801089 A SE7801089 A SE 7801089A SE 439633 B SE439633 B SE 439633B
- Authority
- SE
- Sweden
- Prior art keywords
- formula
- parts
- compound
- phenyl
- ylmethyl
- Prior art date
Links
- -1 1,3-DIOXOLAN-2-YLMETHYL Chemical class 0.000 title claims description 95
- 238000000034 method Methods 0.000 title claims description 56
- 150000001875 compounds Chemical class 0.000 claims description 101
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims description 64
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 56
- 238000006243 chemical reaction Methods 0.000 claims description 55
- 150000003839 salts Chemical class 0.000 claims description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims description 29
- 239000001257 hydrogen Substances 0.000 claims description 28
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 28
- 239000003960 organic solvent Substances 0.000 claims description 19
- 150000002148 esters Chemical group 0.000 claims description 18
- 150000002431 hydrogen Chemical class 0.000 claims description 17
- 238000002360 preparation method Methods 0.000 claims description 16
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 11
- 239000000376 reactant Substances 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 238000007254 oxidation reaction Methods 0.000 claims description 10
- 125000001475 halogen functional group Chemical group 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 7
- 125000004414 alkyl thio group Chemical group 0.000 claims description 7
- 150000001540 azides Chemical class 0.000 claims description 7
- 238000010438 heat treatment Methods 0.000 claims description 7
- 239000007800 oxidant agent Substances 0.000 claims description 7
- 150000002989 phenols Chemical class 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 230000003647 oxidation Effects 0.000 claims description 5
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 claims description 4
- 238000005804 alkylation reaction Methods 0.000 claims description 3
- 230000003009 desulfurizing effect Effects 0.000 claims description 3
- 239000003495 polar organic solvent Substances 0.000 claims description 3
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 claims description 2
- 150000001336 alkenes Chemical class 0.000 claims 1
- 150000007980 azole derivatives Chemical class 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 91
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 82
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 78
- 239000000203 mixture Substances 0.000 description 73
- 239000000047 product Substances 0.000 description 68
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 60
- 238000002844 melting Methods 0.000 description 59
- 230000008018 melting Effects 0.000 description 59
- 239000011541 reaction mixture Substances 0.000 description 48
- 239000000543 intermediate Substances 0.000 description 47
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 45
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 34
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- 239000000284 extract Substances 0.000 description 33
- 238000003756 stirring Methods 0.000 description 32
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 28
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 28
- 239000003480 eluent Substances 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- 229960001701 chloroform Drugs 0.000 description 26
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 25
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 20
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 20
- 239000007858 starting material Substances 0.000 description 20
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 17
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- 239000002585 base Substances 0.000 description 15
- 238000004440 column chromatography Methods 0.000 description 15
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 13
- 239000000741 silica gel Substances 0.000 description 13
- 229910002027 silica gel Inorganic materials 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 11
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 229960000583 acetic acid Drugs 0.000 description 10
- 239000006185 dispersion Substances 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- 239000012312 sodium hydride Substances 0.000 description 10
- 229910000104 sodium hydride Inorganic materials 0.000 description 10
- 238000010992 reflux Methods 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 8
- 239000003513 alkali Substances 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 7
- 229910000564 Raney nickel Inorganic materials 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 238000007363 ring formation reaction Methods 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 5
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 208000015181 infectious disease Diseases 0.000 description 5
- 150000002540 isothiocyanates Chemical class 0.000 description 5
- 229910017604 nitric acid Inorganic materials 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 4
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Natural products OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 238000006477 desulfuration reaction Methods 0.000 description 4
- 230000023556 desulfurization Effects 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- BSCCSDNZEIHXOK-UHFFFAOYSA-N phenyl carbamate Chemical compound NC(=O)OC1=CC=CC=C1 BSCCSDNZEIHXOK-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- FQHCPFMTXFJZJS-UHFFFAOYSA-N (4-methoxyphenyl)hydrazine;hydrochloride Chemical compound Cl.COC1=CC=C(NN)C=C1 FQHCPFMTXFJZJS-UHFFFAOYSA-N 0.000 description 3
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 3
- NREYXGIIWDPEJL-UHFFFAOYSA-N 2-(4-methoxyphenyl)-3-methyl-1h-1,2,4-triazole-5-thione Chemical compound C1=CC(OC)=CC=C1N1C(C)=NC(S)=N1 NREYXGIIWDPEJL-UHFFFAOYSA-N 0.000 description 3
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 3
- MLRAJZNPKPVUDQ-UHFFFAOYSA-N 3-sulfanyl-1,2-dihydrotriazole Chemical compound SN1NNC=C1 MLRAJZNPKPVUDQ-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- 241000233866 Fungi Species 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 3
- 150000001266 acyl halides Chemical class 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 230000000843 anti-fungal effect Effects 0.000 description 3
- 230000000845 anti-microbial effect Effects 0.000 description 3
- 229940121375 antifungal agent Drugs 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 150000002823 nitrates Chemical class 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- FGODPVCKFLEVFG-UHFFFAOYSA-N (2-methoxyphenyl)hydrazine Chemical compound COC1=CC=CC=C1NN FGODPVCKFLEVFG-UHFFFAOYSA-N 0.000 description 2
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 2
- GMTFWFRCTPYXAW-UHFFFAOYSA-N 1-(4-methoxyphenyl)-2-methylimidazole Chemical compound C1=CC(OC)=CC=C1N1C(C)=NC=C1 GMTFWFRCTPYXAW-UHFFFAOYSA-N 0.000 description 2
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 description 2
- SEULWJSKCVACTH-UHFFFAOYSA-N 1-phenylimidazole Chemical compound C1=NC=CN1C1=CC=CC=C1 SEULWJSKCVACTH-UHFFFAOYSA-N 0.000 description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 2
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 2
- AFBBKYQYNPNMAT-UHFFFAOYSA-N 1h-1,2,4-triazol-1-ium-3-thiolate Chemical class SC=1N=CNN=1 AFBBKYQYNPNMAT-UHFFFAOYSA-N 0.000 description 2
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 2
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 2
- BWVQKWRYCUXWOS-UHFFFAOYSA-N 3-(4-methoxyphenyl)-4-phenyl-1h-imidazole-2-thione Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC=CC=2)=CN=C1S BWVQKWRYCUXWOS-UHFFFAOYSA-N 0.000 description 2
- CYKCUAPYWQDIKR-UHFFFAOYSA-N 4-(1h-imidazol-1-yl)phenol Chemical compound C1=CC(O)=CC=C1N1C=NC=C1 CYKCUAPYWQDIKR-UHFFFAOYSA-N 0.000 description 2
- AORBDCJKXDLPCC-UHFFFAOYSA-N 4-(4-methoxyphenyl)-1h-1,2,4-triazole-5-thione Chemical class C1=CC(OC)=CC=C1N1C(=S)NN=C1 AORBDCJKXDLPCC-UHFFFAOYSA-N 0.000 description 2
- QJPJQTDYNZXKQF-UHFFFAOYSA-N 4-bromoanisole Chemical compound COC1=CC=C(Br)C=C1 QJPJQTDYNZXKQF-UHFFFAOYSA-N 0.000 description 2
- BSRYVVGNTFKXNY-UHFFFAOYSA-N 5-bromo-5-methoxycyclohexa-1,3-diene Chemical compound COC1(Br)CC=CC=C1 BSRYVVGNTFKXNY-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 241000222122 Candida albicans Species 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- ADVGKWPZRIDURE-UHFFFAOYSA-N N-Ac-2-Aminophenol Natural products CC(=O)NC1=CC=CC=C1O ADVGKWPZRIDURE-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- 238000007126 N-alkylation reaction Methods 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- 241000286209 Phasianidae Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- BIVUUOPIAYRCAP-UHFFFAOYSA-N aminoazanium;chloride Chemical compound Cl.NN BIVUUOPIAYRCAP-UHFFFAOYSA-N 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000005997 bromomethyl group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 210000003756 cervix mucus Anatomy 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- WBYWAXJHAXSJNI-UHFFFAOYSA-N cinnamic acid Chemical compound OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002085 enols Chemical class 0.000 description 2
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- DNRXKUPYJHTZJE-UHFFFAOYSA-N phenol;hydrobromide Chemical compound Br.OC1=CC=CC=C1 DNRXKUPYJHTZJE-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 150000003217 pyrazoles Chemical class 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- IVPLWVYHXOWMRG-UHFFFAOYSA-N (4-methoxyanilino)thiourea Chemical compound COC1=CC=C(NNC(N)=S)C=C1 IVPLWVYHXOWMRG-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-ZETCQYMHSA-N (S)-mandelic acid Chemical compound OC(=O)[C@@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-ZETCQYMHSA-N 0.000 description 1
- SYGMJJGNALBQQK-UHFFFAOYSA-N (n-acetyl-4-methoxyanilino)thiourea Chemical compound COC1=CC=C(N(NC(N)=S)C(C)=O)C=C1 SYGMJJGNALBQQK-UHFFFAOYSA-N 0.000 description 1
- STJJXBBWLDKYHD-UHFFFAOYSA-N 1-(4-methoxyphenyl)-2-methylsulfanyl-5-phenylimidazole Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC=CC=2)=CN=C1SC STJJXBBWLDKYHD-UHFFFAOYSA-N 0.000 description 1
- KBCQCHRVAVEOGF-UHFFFAOYSA-N 1-(4-methoxyphenyl)-2-methylsulfanylimidazole;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1N1C(SC)=NC=C1 KBCQCHRVAVEOGF-UHFFFAOYSA-N 0.000 description 1
- MFEOVBZDIZGBPT-UHFFFAOYSA-N 1-(4-methoxyphenyl)-2-propan-2-ylsulfanylimidazole;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1N1C(SC(C)C)=NC=C1 MFEOVBZDIZGBPT-UHFFFAOYSA-N 0.000 description 1
- CSMDEFOFZVWRQR-UHFFFAOYSA-N 1-(4-methoxyphenyl)-3,5-dimethylpyrazole;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1N1C(C)=CC(C)=N1 CSMDEFOFZVWRQR-UHFFFAOYSA-N 0.000 description 1
- PKVWNAOTHNMNPR-UHFFFAOYSA-N 1-(4-methoxyphenyl)-3,5-diphenylpyrazole Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC=CC=2)=CC(C=2C=CC=CC=2)=N1 PKVWNAOTHNMNPR-UHFFFAOYSA-N 0.000 description 1
- CLAALJYCMMNXSU-UHFFFAOYSA-N 1-(4-methoxyphenyl)-3-methyl-5-phenylpyrazole Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC=CC=2)=CC(C)=N1 CLAALJYCMMNXSU-UHFFFAOYSA-N 0.000 description 1
- MQACDVWXQOMBAL-UHFFFAOYSA-N 1-(4-methoxyphenyl)-3-methylpyrazole Chemical compound C1=CC(OC)=CC=C1N1N=C(C)C=C1 MQACDVWXQOMBAL-UHFFFAOYSA-N 0.000 description 1
- NFWYRGFLNREGJY-UHFFFAOYSA-N 1-(4-methoxyphenyl)-3-methylsulfanyl-1,2,4-triazole Chemical compound C1=CC(OC)=CC=C1N1N=C(SC)N=C1 NFWYRGFLNREGJY-UHFFFAOYSA-N 0.000 description 1
- SPBGNVPWPMRPRG-UHFFFAOYSA-N 1-(4-methoxyphenyl)-5-methyl-3-methylsulfanyl-1,2,4-triazole;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1N1C(C)=NC(SC)=N1 SPBGNVPWPMRPRG-UHFFFAOYSA-N 0.000 description 1
- VXZNTBPUGUJHLF-UHFFFAOYSA-N 1-(4-methoxyphenyl)-5-phenyl-1,2,4-triazole Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC=CC=2)=NC=N1 VXZNTBPUGUJHLF-UHFFFAOYSA-N 0.000 description 1
- AAXVRSDLXDRWAY-UHFFFAOYSA-N 1-(4-methoxyphenyl)-5-phenylimidazole Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC=CC=2)=CN=C1 AAXVRSDLXDRWAY-UHFFFAOYSA-N 0.000 description 1
- ALFKACWMXFQUGW-UHFFFAOYSA-N 1-amino-3-(2-methoxyphenyl)urea Chemical compound COC1=CC=CC=C1NC(=O)NN ALFKACWMXFQUGW-UHFFFAOYSA-N 0.000 description 1
- XFTUQILJEQYQHK-UHFFFAOYSA-N 1-amino-3-(4-methoxyphenyl)thiourea Chemical compound COC1=CC=C(NC(=S)NN)C=C1 XFTUQILJEQYQHK-UHFFFAOYSA-N 0.000 description 1
- VRPQCVLBOZOYCG-UHFFFAOYSA-N 1-isothiocyanato-4-methoxybenzene Chemical compound COC1=CC=C(N=C=S)C=C1 VRPQCVLBOZOYCG-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- YRAJNWYBUCUFBD-UHFFFAOYSA-N 2,2,6,6-tetramethylheptane-3,5-dione Chemical compound CC(C)(C)C(=O)CC(=O)C(C)(C)C YRAJNWYBUCUFBD-UHFFFAOYSA-N 0.000 description 1
- SCLPQRXZOIDEQN-UHFFFAOYSA-N 2-(2-methoxyphenyl)-1h-1,2,4-triazole-5-thione Chemical compound COC1=CC=CC=C1N1NC(=S)N=C1 SCLPQRXZOIDEQN-UHFFFAOYSA-N 0.000 description 1
- KXNONBQLSLDBLJ-UHFFFAOYSA-N 2-(4-methoxyphenyl)-1h-1,2,4-triazole-5-thione Chemical compound C1=CC(OC)=CC=C1N1N=C(S)N=C1 KXNONBQLSLDBLJ-UHFFFAOYSA-N 0.000 description 1
- LMXYJQSLZSUIIY-UHFFFAOYSA-N 2-(4-methoxyphenyl)-3-phenyl-1h-1,2,4-triazole-5-thione Chemical compound C1=CC(OC)=CC=C1N1C(C=2C=CC=CC=2)=NC(S)=N1 LMXYJQSLZSUIIY-UHFFFAOYSA-N 0.000 description 1
- LYIIBVSRGJSHAV-UHFFFAOYSA-N 2-aminoacetaldehyde Chemical compound NCC=O LYIIBVSRGJSHAV-UHFFFAOYSA-N 0.000 description 1
- KJVRURZDIOVSSQ-UHFFFAOYSA-N 2-bromo-1-(3-chlorophenyl)ethanone Chemical compound ClC1=CC=CC(C(=O)CBr)=C1 KJVRURZDIOVSSQ-UHFFFAOYSA-N 0.000 description 1
- PQAMFDRRWURCFQ-UHFFFAOYSA-N 2-ethyl-1h-imidazole Chemical compound CCC1=NC=CN1 PQAMFDRRWURCFQ-UHFFFAOYSA-N 0.000 description 1
- CWFLDJZJTHXMTF-UHFFFAOYSA-N 2-ethylsulfanyl-1-(4-methoxyphenyl)imidazole;hydrochloride Chemical compound Cl.CCSC1=NC=CN1C1=CC=C(OC)C=C1 CWFLDJZJTHXMTF-UHFFFAOYSA-N 0.000 description 1
- LODHFNUFVRVKTH-ZHACJKMWSA-N 2-hydroxy-n'-[(e)-3-phenylprop-2-enoyl]benzohydrazide Chemical compound OC1=CC=CC=C1C(=O)NNC(=O)\C=C\C1=CC=CC=C1 LODHFNUFVRVKTH-ZHACJKMWSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- YNKRJGZPPAUPLQ-UHFFFAOYSA-N 2-methylsulfonyl-1h-imidazole Chemical compound CS(=O)(=O)C1=NC=CN1 YNKRJGZPPAUPLQ-UHFFFAOYSA-N 0.000 description 1
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 description 1
- CQZHSOTUHRUOTI-UHFFFAOYSA-N 3,5-ditert-butyl-1-(4-methoxyphenyl)pyrazole Chemical compound C1=CC(OC)=CC=C1N1C(C(C)(C)C)=CC(C(C)(C)C)=N1 CQZHSOTUHRUOTI-UHFFFAOYSA-N 0.000 description 1
- LIEBCNQPMNARMP-UHFFFAOYSA-N 3-(4-methoxyphenyl)-1h-imidazole-2-thione Chemical compound C1=CC(OC)=CC=C1N1C(=S)NC=C1 LIEBCNQPMNARMP-UHFFFAOYSA-N 0.000 description 1
- BHWMORLQDQSWHP-UHFFFAOYSA-N 3-(4-methoxyphenyl)-4-methyl-1h-imidazole-2-thione Chemical compound C1=CC(OC)=CC=C1N1C(S)=NC=C1C BHWMORLQDQSWHP-UHFFFAOYSA-N 0.000 description 1
- IDTWTIQHYASRCG-UHFFFAOYSA-N 3-(4-methoxyphenyl)-4-phenyl-1h-imidazol-2-one Chemical compound C1=CC(OC)=CC=C1N1C(=O)NC=C1C1=CC=CC=C1 IDTWTIQHYASRCG-UHFFFAOYSA-N 0.000 description 1
- WOTRNSNRBKKUPI-UHFFFAOYSA-N 3-ethyl-2-(4-methoxyphenyl)-1h-1,2,4-triazole-5-thione Chemical compound CCC1=NC(S)=NN1C1=CC=C(OC)C=C1 WOTRNSNRBKKUPI-UHFFFAOYSA-N 0.000 description 1
- FNOMXCNLHPBCHG-UHFFFAOYSA-N 3-ethyl-4-(4-methoxyphenyl)-1,2,4-triazole Chemical compound CCC1=NN=CN1C1=CC=C(OC)C=C1 FNOMXCNLHPBCHG-UHFFFAOYSA-N 0.000 description 1
- GFHVSFJTZKZWRM-UHFFFAOYSA-N 3-ethyl-4-(4-methoxyphenyl)-1,2,4-triazole;hydrochloride Chemical compound Cl.CCC1=NN=CN1C1=CC=C(OC)C=C1 GFHVSFJTZKZWRM-UHFFFAOYSA-N 0.000 description 1
- PJCCSZUMZMCWSX-UHFFFAOYSA-N 4,4-Dimethoxy-2-butanone Chemical compound COC(OC)CC(C)=O PJCCSZUMZMCWSX-UHFFFAOYSA-N 0.000 description 1
- ZOPIBCDDKMAEII-UHFFFAOYSA-N 4-(1,2,4-triazol-1-yl)phenol Chemical compound C1=CC(O)=CC=C1N1N=CN=C1 ZOPIBCDDKMAEII-UHFFFAOYSA-N 0.000 description 1
- JQZPTIWPVFCHJJ-UHFFFAOYSA-N 4-(2-ethylimidazol-1-yl)phenol Chemical compound CCC1=NC=CN1C1=CC=C(O)C=C1 JQZPTIWPVFCHJJ-UHFFFAOYSA-N 0.000 description 1
- BHKFKVUSAMKYDM-UHFFFAOYSA-N 4-(2-methylimidazol-1-yl)phenol;hydrobromide Chemical compound Br.CC1=NC=CN1C1=CC=C(O)C=C1 BHKFKVUSAMKYDM-UHFFFAOYSA-N 0.000 description 1
- JYSXRLYKVLZQBX-UHFFFAOYSA-N 4-(2-methylsulfanyl-5-phenylimidazol-1-yl)phenol Chemical compound C=1C=C(O)C=CC=1N1C(SC)=NC=C1C1=CC=CC=C1 JYSXRLYKVLZQBX-UHFFFAOYSA-N 0.000 description 1
- IQATWIJVMAWBLE-UHFFFAOYSA-N 4-(2-methylsulfanylimidazol-1-yl)phenol Chemical compound CSC1=NC=CN1C1=CC=C(O)C=C1 IQATWIJVMAWBLE-UHFFFAOYSA-N 0.000 description 1
- JZZQDUBNKXYQED-UHFFFAOYSA-N 4-(3,5-dimethylpyrazol-1-yl)phenol Chemical compound N1=C(C)C=C(C)N1C1=CC=C(O)C=C1 JZZQDUBNKXYQED-UHFFFAOYSA-N 0.000 description 1
- CLBYAJJIZSWAHG-UHFFFAOYSA-N 4-(3,5-ditert-butylpyrazol-1-yl)phenol Chemical compound N1=C(C(C)(C)C)C=C(C(C)(C)C)N1C1=CC=C(O)C=C1 CLBYAJJIZSWAHG-UHFFFAOYSA-N 0.000 description 1
- GXXNBBFKOLYEDB-UHFFFAOYSA-N 4-(3-ethylsulfanyl-1,2,4-triazol-1-yl)phenol Chemical compound N1=C(SCC)N=CN1C1=CC=C(O)C=C1 GXXNBBFKOLYEDB-UHFFFAOYSA-N 0.000 description 1
- WKRKBADJIBJDHF-UHFFFAOYSA-N 4-(3-methyl-5-methylsulfanyl-1,2,4-triazol-4-yl)phenol Chemical compound CSC1=NN=C(C)N1C1=CC=C(O)C=C1 WKRKBADJIBJDHF-UHFFFAOYSA-N 0.000 description 1
- BUXWDNFPNIUQFB-UHFFFAOYSA-N 4-(3-methylsulfanyl-1,2,4-triazol-1-yl)phenol Chemical compound N1=C(SC)N=CN1C1=CC=C(O)C=C1 BUXWDNFPNIUQFB-UHFFFAOYSA-N 0.000 description 1
- YYJXQKGXMMUNCP-UHFFFAOYSA-N 4-(3-methylsulfonyl-1,2,4-triazol-4-yl)phenol Chemical compound CS(=O)(=O)C1=NN=CN1C1=CC=C(O)C=C1 YYJXQKGXMMUNCP-UHFFFAOYSA-N 0.000 description 1
- VKKQVVBVYHYIOK-UHFFFAOYSA-N 4-(3-propyl-1,2,4-triazol-4-yl)phenol Chemical compound CCCC1=NN=CN1C1=CC=C(O)C=C1 VKKQVVBVYHYIOK-UHFFFAOYSA-N 0.000 description 1
- KLPXNKOOEUJDAN-UHFFFAOYSA-N 4-(4-methoxyphenyl)-3-methyl-1h-1,2,4-triazole-5-thione Chemical compound C1=CC(OC)=CC=C1N1C(=S)NN=C1C KLPXNKOOEUJDAN-UHFFFAOYSA-N 0.000 description 1
- DXUCHSNKSCIEOP-UHFFFAOYSA-N 4-(4-methoxyphenyl)-3-methylsulfonyl-1,2,4-triazole Chemical compound C1=CC(OC)=CC=C1N1C(S(C)(=O)=O)=NN=C1 DXUCHSNKSCIEOP-UHFFFAOYSA-N 0.000 description 1
- QSUJFKAKXVTJJO-UHFFFAOYSA-N 4-(4-methoxyphenyl)-3-propyl-1,2,4-triazole;hydrochloride Chemical compound Cl.CCCC1=NN=CN1C1=CC=C(OC)C=C1 QSUJFKAKXVTJJO-UHFFFAOYSA-N 0.000 description 1
- KLPFVXBIXAYFRO-UHFFFAOYSA-N 4-(5-ethyl-1,2,4-triazol-1-yl)phenol Chemical compound CCC1=NC=NN1C1=CC=C(O)C=C1 KLPFVXBIXAYFRO-UHFFFAOYSA-N 0.000 description 1
- RDLXZFSZUZESJV-UHFFFAOYSA-N 4-(5-methyl-1,2,4-triazol-1-yl)phenol;hydrobromide Chemical compound Br.CC1=NC=NN1C1=CC=C(O)C=C1 RDLXZFSZUZESJV-UHFFFAOYSA-N 0.000 description 1
- SWVPKVJGPQVMJT-UHFFFAOYSA-N 4-(5-methyl-3-methylsulfanyl-1,2,4-triazol-1-yl)phenol;hydrobromide Chemical compound Br.N1=C(SC)N=C(C)N1C1=CC=C(O)C=C1 SWVPKVJGPQVMJT-UHFFFAOYSA-N 0.000 description 1
- QFVKNJUTSVBVCK-UHFFFAOYSA-N 4-(5-phenyl-1,2,4-triazol-1-yl)phenol;hydrobromide Chemical compound Br.C1=CC(O)=CC=C1N1C(C=2C=CC=CC=2)=NC=N1 QFVKNJUTSVBVCK-UHFFFAOYSA-N 0.000 description 1
- OVJSFERAONDWMY-UHFFFAOYSA-N 4-(5-phenylimidazol-1-yl)phenol Chemical compound C1=CC(O)=CC=C1N1C(C=2C=CC=CC=2)=CN=C1 OVJSFERAONDWMY-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- LVQFHDAKZHGEAJ-UHFFFAOYSA-M 4-methylbenzenesulfonate Chemical compound [CH2]C1=CC=C(S([O-])(=O)=O)C=C1 LVQFHDAKZHGEAJ-UHFFFAOYSA-M 0.000 description 1
- KBIWNQVZKHSHTI-UHFFFAOYSA-N 4-n,4-n-dimethylbenzene-1,4-diamine;oxalic acid Chemical compound OC(=O)C(O)=O.CN(C)C1=CC=C(N)C=C1 KBIWNQVZKHSHTI-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- FIFHJKONXHKCAQ-UHFFFAOYSA-N 5-ethyl-3-ethylsulfanyl-1-(4-methoxyphenyl)-1,2,4-triazole;hydrochloride Chemical compound Cl.N1=C(SCC)N=C(CC)N1C1=CC=C(OC)C=C1 FIFHJKONXHKCAQ-UHFFFAOYSA-N 0.000 description 1
- OQLZINXFSUDMHM-UHFFFAOYSA-N Acetamidine Chemical compound CC(N)=N OQLZINXFSUDMHM-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- 206010007134 Candida infections Diseases 0.000 description 1
- 241000222178 Candida tropicalis Species 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- 201000007336 Cryptococcosis Diseases 0.000 description 1
- 241000221204 Cryptococcus neoformans Species 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical class [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical group [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-L Oxalate Chemical compound [O-]C(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-L 0.000 description 1
- 241001531356 Phialophora verrucosa Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N Salicylic acid Natural products OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 1
- 241000223229 Trichophyton rubrum Species 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 201000007096 Vulvovaginal Candidiasis Diseases 0.000 description 1
- 241000546263 Xorides Species 0.000 description 1
- BJRZOLZLJJNTAX-UHFFFAOYSA-N [2-(3-chlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl methanesulfonate;hydrochloride Chemical compound Cl.O1C(COS(=O)(=O)C)COC1(C=1C=C(Cl)C=CC=1)CN1C=NC=C1 BJRZOLZLJJNTAX-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 1
- 238000011888 autopsy Methods 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 1
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 201000003984 candidiasis Diseases 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- NZZIMKJIVMHWJC-UHFFFAOYSA-N dibenzoylmethane Chemical compound C=1C=CC=CC=1C(=O)CC(=O)C1=CC=CC=C1 NZZIMKJIVMHWJC-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 150000004862 dioxolanes Chemical class 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229960005309 estradiol Drugs 0.000 description 1
- 229930182833 estradiol Natural products 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- HCPOCMMGKBZWSJ-UHFFFAOYSA-N ethyl 3-hydrazinyl-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)NN HCPOCMMGKBZWSJ-UHFFFAOYSA-N 0.000 description 1
- JKLNYGDWYRKFKR-UHFFFAOYSA-N ethyl methyl sulfate Chemical compound CCOS(=O)(=O)OC JKLNYGDWYRKFKR-UHFFFAOYSA-N 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000005907 ketalization reaction Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 210000003097 mucus Anatomy 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- CVXGFPPAIUELDV-UHFFFAOYSA-N phenacylazanium;chloride Chemical compound [Cl-].[NH3+]CC(=O)C1=CC=CC=C1 CVXGFPPAIUELDV-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000000902 placebo Substances 0.000 description 1
- 229940068196 placebo Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- RFAKLMBNSZNUNX-UHFFFAOYSA-N potassium;isothiocyanate Chemical compound [K+].[N-]=C=S RFAKLMBNSZNUNX-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000010956 selective crystallization Methods 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical group NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- ASRFZLADLOWUMP-UHFFFAOYSA-M sodium;4-(2-phenylimidazol-1-yl)phenolate Chemical compound [Na+].C1=CC([O-])=CC=C1N1C(C=2C=CC=CC=2)=NC=C1 ASRFZLADLOWUMP-UHFFFAOYSA-M 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229960005137 succinic acid Drugs 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/10—Antimycotics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/64—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms, e.g. histidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/84—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/12—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/20—Free hydroxyl or mercaptan
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/24—Radicals substituted by singly bound oxygen or sulfur atoms esterified
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US76426577A | 1977-01-31 | 1977-01-31 | |
| US05/853,726 US4160841A (en) | 1977-01-31 | 1977-11-21 | Heterocyclic derivatives of 1-(1,3-dioxolan-2-ylmethyl)-1H-imidazoles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7801089L SE7801089L (sv) | 1978-08-01 |
| SE439633B true SE439633B (sv) | 1985-06-24 |
Family
ID=27117425
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7801089A SE439633B (sv) | 1977-01-31 | 1978-01-30 | Forfarande for framstellning av heterocykliska derivat av 1-(1,3-dioxolan-2-ylmetyl)-1h-imidazoler och 1h-1,2,4-triazoler |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US4160841A (OSRAM) |
| JP (1) | JPS53101377A (OSRAM) |
| AT (1) | AT367419B (OSRAM) |
| AU (1) | AU511358B2 (OSRAM) |
| BE (1) | BE863437A (OSRAM) |
| CA (1) | CA1117534A (OSRAM) |
| CH (1) | CH644117A5 (OSRAM) |
| DE (1) | DE2803870A1 (OSRAM) |
| DK (1) | DK42778A (OSRAM) |
| ES (1) | ES466483A1 (OSRAM) |
| FI (1) | FI62836C (OSRAM) |
| FR (1) | FR2378780A1 (OSRAM) |
| GB (1) | GB1594860A (OSRAM) |
| GR (1) | GR66115B (OSRAM) |
| HU (1) | HU177458B (OSRAM) |
| IE (1) | IE46055B1 (OSRAM) |
| IL (1) | IL53924A (OSRAM) |
| IT (1) | IT1105153B (OSRAM) |
| LU (1) | LU78969A1 (OSRAM) |
| NL (1) | NL7801088A (OSRAM) |
| PH (1) | PH13955A (OSRAM) |
| PT (1) | PT67599B (OSRAM) |
| SE (1) | SE439633B (OSRAM) |
| SU (1) | SU703020A3 (OSRAM) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4144346A (en) * | 1977-01-31 | 1979-03-13 | Janssen Pharmaceutica N.V. | Novel 1-(1,3-dioxolan-2-ylmethyl)-1H-imidazoles |
| US4267179A (en) * | 1978-06-23 | 1981-05-12 | Janssen Pharmaceutica, N.V. | Heterocyclic derivatives of (4-phenylpiperazin-1-yl-aryloxymethyl-1,3-dioxolan-2-yl)methyl-1H-imidazoles and 1H-1,2,4-triazoles |
| DE2967202D1 (en) * | 1978-07-03 | 1984-10-11 | Janssen Pharmaceutica Nv | Derivatives of (4-(piperazin-1-yl-phenyloxymethyl)-1.3-dioxolan-2-ylmethyl)-1h-imidazoles and -1h-1.2.4-triazoles, their preparation and use as fungicides and bactericides |
| US4287195A (en) * | 1978-07-14 | 1981-09-01 | Janssen Pharmaceutica, N.V. | Heterocyclic derivatives of [4-(piperazin-1-yl-phenyloxymethyl)-1,3-dioxolan-2-ylmethyl]-1H-imidazoles and 1H-1,2,4-triazoles |
| US4338327A (en) * | 1978-10-06 | 1982-07-06 | Janssen Pharmaceutica, N.V. | Substituted 1-(2-aryl-1,3-dioxolan-2-ylmethyl)-1H-1,2,4-triazoles |
| US4402957A (en) * | 1979-04-04 | 1983-09-06 | Janssen Pharmaceutica N.V. | Heterocyclic derivatives of [4-(piperazin-1-ylphenyloxymethyl)-1,3-dioxolan-2-ylmethyl]-1H-imidazoles and 1H-1,2,4-triazoles |
| DE3039087A1 (de) * | 1980-10-16 | 1982-05-19 | Hoechst Ag, 6000 Frankfurt | 1-(1,3-dioxolan-2-ylmethyl)-azole, ihre salze, verfahren zu ihrer herstellung und ihre verwendung |
| DE3104311A1 (de) * | 1981-02-07 | 1982-08-19 | Bayer Ag, 5090 Leverkusen | 2-azolylmethyl-1,3-dioxolan- und -dioxan-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| DE3104380A1 (de) * | 1981-02-07 | 1982-08-19 | Bayer Ag, 5090 Leverkusen | Antimikrobielle mittel |
| US4456605A (en) * | 1981-05-07 | 1984-06-26 | Janssen Pharmaceutica N.V. | Heterocyclic derivatives of [4-(piperazin-1-yl-phenyloxymethyl)-1,3-dioxolan-2-ylmethyl]-1H-imidazoles and 1H-1,2,4-triazoles |
| JPS59139380A (ja) * | 1983-01-28 | 1984-08-10 | Yoshiki Hamada | 1,3―ジオキソランアシラート誘導体及びその製造法 |
| US4619931A (en) * | 1983-02-28 | 1986-10-28 | Janssen Pharmaceutica, N.V. | [[4-[4-(4-phenyl-1-piperazinyl)phenoxymethyl]-1,3-dioxolan-2-yl]methyl]-1H-imidazoles and 1H-1,2,4-triazoles |
| EP0121081B1 (de) * | 1983-03-03 | 1991-01-30 | BASF Aktiengesellschaft | Azolylmethylcycloalkane, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| DE3308554A1 (de) * | 1983-03-10 | 1984-09-13 | Hoechst Ag, 6230 Frankfurt | 1-/1,3-dioxolan-2-ylmethyl)-azole, ihre salze, verfahren zu ihrer herstellung und ihre verwendung |
| JPS59205366A (ja) * | 1983-04-12 | 1984-11-20 | スミスクライン・ベツクマン・コ−ポレイシヨン | ド−パミン−β−ヒドロキシラ−ゼ抑制物質 |
| WO2002032877A2 (en) * | 2000-10-16 | 2002-04-25 | Chugai Seiyaku Kabushiki Kaisha | Process for preparation of n-substituted 2-sulfanylimidazoles |
| US20050074494A1 (en) * | 2003-10-06 | 2005-04-07 | Xiu-Xiu Cheng | Itraconazole immediate release formulation |
| CA2618724A1 (en) | 2005-08-18 | 2007-02-22 | Synta Pharmaceuticals Corp. | Imidazole compounds that modulate hsp90 activity |
| KR100793693B1 (ko) | 2006-05-09 | 2008-01-10 | (주)유케이케미팜 | 이트라코나졸의 개선된 제조 방법 |
| AU2013369473B2 (en) * | 2012-12-25 | 2017-03-09 | Hua Medicine (Shanghai) Ltd. | Process for the preparation of 1-((1,3)dioxolan-4-ylmethyl)-1h-pyrazol-3-ylamine |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3575999A (en) * | 1968-08-19 | 1971-04-20 | Janssen Pharmaceutica Nv | Ketal derivatives of imidazole |
| US3936470A (en) * | 1975-01-27 | 1976-02-03 | Janssen Pharmaceutica N.V. | 1,3-Dioxolan-2-ylmethylimidazoles |
| US4101666A (en) * | 1975-10-06 | 1978-07-18 | Janssen Pharmaceutica N.V. | 1-(2-Ar-4-R-1,3-dioxolan-2-ylmethyl)imidazoles |
| CA1065873A (en) * | 1975-01-27 | 1979-11-06 | Janssen Pharmaceutica Naamloze Vennootschap | Imidazole derivatives |
-
1977
- 1977-11-21 US US05/853,726 patent/US4160841A/en not_active Expired - Lifetime
-
1978
- 1978-01-14 PH PH20761A patent/PH13955A/en unknown
- 1978-01-20 GB GB2468/78A patent/GB1594860A/en not_active Expired
- 1978-01-25 GR GR55266A patent/GR66115B/el unknown
- 1978-01-26 CA CA000295742A patent/CA1117534A/en not_active Expired
- 1978-01-30 SE SE7801089A patent/SE439633B/sv not_active IP Right Cessation
- 1978-01-30 HU HU78JA809A patent/HU177458B/hu not_active IP Right Cessation
- 1978-01-30 DE DE19782803870 patent/DE2803870A1/de not_active Ceased
- 1978-01-30 FR FR7802565A patent/FR2378780A1/fr active Granted
- 1978-01-30 JP JP841678A patent/JPS53101377A/ja active Granted
- 1978-01-30 BE BE184722A patent/BE863437A/xx unknown
- 1978-01-30 IT IT47838/78A patent/IT1105153B/it active
- 1978-01-30 IL IL53924A patent/IL53924A/xx unknown
- 1978-01-30 FI FI780293A patent/FI62836C/fi not_active IP Right Cessation
- 1978-01-30 ES ES466483A patent/ES466483A1/es not_active Expired
- 1978-01-30 PT PT67599A patent/PT67599B/pt unknown
- 1978-01-30 AT AT0063778A patent/AT367419B/de not_active IP Right Cessation
- 1978-01-30 DK DK42778A patent/DK42778A/da not_active Application Discontinuation
- 1978-01-30 IE IE196/78A patent/IE46055B1/en unknown
- 1978-01-31 CH CH105778A patent/CH644117A5/de not_active IP Right Cessation
- 1978-01-31 NL NL7801088A patent/NL7801088A/xx not_active Application Discontinuation
- 1978-01-31 AU AU32852/78A patent/AU511358B2/en not_active Expired
- 1978-01-31 LU LU78969A patent/LU78969A1/xx unknown
- 1978-01-31 SU SU782571951A patent/SU703020A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| AT367419B (de) | 1982-07-12 |
| DK42778A (da) | 1978-08-01 |
| IE780196L (en) | 1978-07-31 |
| IT1105153B (it) | 1985-10-28 |
| BE863437A (nl) | 1978-07-31 |
| GR66115B (OSRAM) | 1981-01-16 |
| PT67599B (en) | 1980-01-14 |
| DE2803870A1 (de) | 1978-08-03 |
| SU703020A3 (ru) | 1979-12-05 |
| US4160841A (en) | 1979-07-10 |
| ATA63778A (de) | 1981-11-15 |
| FR2378780A1 (fr) | 1978-08-25 |
| CA1117534A (en) | 1982-02-02 |
| PT67599A (en) | 1978-02-01 |
| IL53924A0 (en) | 1978-04-30 |
| ES466483A1 (es) | 1979-06-01 |
| LU78969A1 (fr) | 1978-06-21 |
| AU511358B2 (en) | 1980-08-14 |
| PH13955A (en) | 1980-11-12 |
| JPS6339595B2 (OSRAM) | 1988-08-05 |
| FR2378780B1 (OSRAM) | 1984-11-30 |
| FI62836B (fi) | 1982-11-30 |
| HU177458B (en) | 1981-10-28 |
| IE46055B1 (en) | 1983-02-09 |
| GB1594860A (en) | 1981-08-05 |
| NL7801088A (nl) | 1978-08-02 |
| JPS53101377A (en) | 1978-09-04 |
| FI62836C (fi) | 1983-03-10 |
| AU3285278A (en) | 1979-08-09 |
| SE7801089L (sv) | 1978-08-01 |
| IL53924A (en) | 1981-12-31 |
| CH644117A5 (de) | 1984-07-13 |
| FI780293A7 (fi) | 1978-08-01 |
| IT7847838A0 (it) | 1978-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE439633B (sv) | Forfarande for framstellning av heterocykliska derivat av 1-(1,3-dioxolan-2-ylmetyl)-1h-imidazoler och 1h-1,2,4-triazoler | |
| US4218458A (en) | Heterocyclic derivatives of (4-aryloxy-methyl-1,3-dioxolan-2-yl)methyl-1H-imidazoles and 1H-1,2,4-triazoles | |
| JP2574656B2 (ja) | 置換(4−フエニル−1−ピペラジニル)フエノール誘導体及びその製造方法 | |
| US4791111A (en) | [[4-[4-(4-phenyl-1-piperazinyl)phenoxymethyl]-1,3-dioxolan-2-yl]methyl]-1H-imidazoles and 1H-1,2,4-triazoles having anti-microbial properties | |
| US4916134A (en) | 4-[4-[4-[4-[[2-(2,4-difluorophenyl)-2-(1H-azolylmethyl)-1,3-dioxolan-4-yl]me]phenyl]-1-piperazinyl]phenyl]triazolones | |
| AU600107B2 (en) | 4-(4-(4-((2-(2,4-difluorophenyl)-2-(1h-azolylmethyl)-1,3- dioxolan-4-yl)methoxy)phenyl)-1-piperazinyl)phenyl) triazolones | |
| HU215602B (hu) | Eljárás 4-/4-/4-/4-//2-(2,4-difluor-fenil)-2-(1H-azolil-metil)-1,3-dioxolán-4-il/-metoxi/-fenil/-1-piperazinil/-fenil/-triazolon- származékok és -imidazolon-származékok, valamint ilyen vegyületeket tartalmazó gyógyászati készítmények előállítására | |
| US4490530A (en) | Heterocyclic derivatives of (4-phenylpiperazin-1-yl-aryloxymethyl-1,3-dioxolan-2-yl)-methyl-1H-imidazoles and 1H-1,2,4-triazoles | |
| US4368200A (en) | Heterocyclic derivatives of (4-phenyl-piperazine-1-yl-aryloxymethyl-1,3-dioxolan-2-yl)-methyl-1H-imidazoles and 1H-1,2,4-triazoles | |
| US4229460A (en) | Heterocyclic derivatives of 1-(1,3-dioxolan-2-ylmethyl)-1H-1,2,4-triazoles having antifungal and antibacterial properties | |
| US4229581A (en) | Hydrazine carboxamide derivatives of 1-(1,3-dioxolan-2-ylmethyl)-1H-imidazoles and 1H-1,2,4-triazoles | |
| US4313953A (en) | Heterocyclic derivatives of (4-aryloxymethyl-1,3-dioxolan-2-yl)methyl-1H-imidazoles and 1H-1,2,4-triazoles | |
| US4232034A (en) | Heterocyclic derivatives of 1-(1,3-dioxolan-2-ylmethyl)-1H-imidazoles | |
| US4268680A (en) | Heterocyclic derivatives of 1-(1,3-dioxolan-2-ylmethyl)-1H-imidazoles and 1H-1,2,4-triazoles | |
| KR810000676B1 (ko) | 디옥소란의 헤테로 고리치환체 제조방법 | |
| US4533550A (en) | Heterocyclic derivatives of (4-aryloxymethyl-1,3-dioxolan-2-yl)methyl-1H-imidazoles and 1H-1,2,4-triazoles | |
| BG60430B2 (bg) | Хетероциклични производни на (4-фенилпиперазин-1-ил-арилокси- метил-1,3-диоксолан-2-ил)-метил-1н-имидазоли и 1н-1,2,4-триа- золи,методи за тяхното получаване и състави,които ги съдържат | |
| CS241468B2 (en) | Method of 1h-imidazole and 1h-1,2,4-triazole new derivatives production | |
| HU184845B (en) | Process for producing 1-bracket-1,3-dioxol-2-nyl-methyl-bracket closed-1h-1,2,4-triazole derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7801089-9 Effective date: 19910805 Format of ref document f/p: F |