SE439018B - Bleknings- och rengoringskomposition - Google Patents
Bleknings- och rengoringskompositionInfo
- Publication number
- SE439018B SE439018B SE8002599A SE8002599A SE439018B SE 439018 B SE439018 B SE 439018B SE 8002599 A SE8002599 A SE 8002599A SE 8002599 A SE8002599 A SE 8002599A SE 439018 B SE439018 B SE 439018B
- Authority
- SE
- Sweden
- Prior art keywords
- bleaching
- cleaning composition
- edtmp
- composition according
- complex
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 56
- 238000004140 cleaning Methods 0.000 title claims description 29
- 229940120146 EDTMP Drugs 0.000 claims description 66
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 claims description 45
- 238000004061 bleaching Methods 0.000 claims description 37
- -1 phosphonate compound Chemical class 0.000 claims description 33
- 239000012190 activator Substances 0.000 claims description 23
- 239000003599 detergent Substances 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 20
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical group CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 claims description 19
- 229910021645 metal ion Inorganic materials 0.000 claims description 15
- 239000011575 calcium Substances 0.000 claims description 13
- 229910052791 calcium Inorganic materials 0.000 claims description 10
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 9
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims description 9
- 229960001922 sodium perborate Drugs 0.000 claims description 9
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 claims description 9
- 239000011701 zinc Substances 0.000 claims description 9
- 229910052725 zinc Inorganic materials 0.000 claims description 8
- 229910052782 aluminium Inorganic materials 0.000 claims description 7
- 150000004696 coordination complex Chemical class 0.000 claims description 7
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 6
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 claims description 5
- 239000007844 bleaching agent Substances 0.000 claims description 4
- 239000011149 active material Substances 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- BPSYZMLXRKCSJY-UHFFFAOYSA-N 1,3,2-dioxaphosphepan-2-ium 2-oxide Chemical compound O=[P+]1OCCCCO1 BPSYZMLXRKCSJY-UHFFFAOYSA-N 0.000 claims 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 claims 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims 1
- 229940125898 compound 5 Drugs 0.000 claims 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 239000000843 powder Substances 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 16
- 239000000047 product Substances 0.000 description 13
- 239000002002 slurry Substances 0.000 description 13
- 239000002253 acid Substances 0.000 description 11
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 10
- 235000019832 sodium triphosphate Nutrition 0.000 description 10
- 239000002585 base Substances 0.000 description 8
- 229910021538 borax Inorganic materials 0.000 description 8
- 239000004615 ingredient Substances 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 8
- 239000004328 sodium tetraborate Substances 0.000 description 8
- 235000010339 sodium tetraborate Nutrition 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000007921 spray Substances 0.000 description 7
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 6
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 239000003760 tallow Substances 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000002736 nonionic surfactant Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 5
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 5
- 238000001694 spray drying Methods 0.000 description 5
- 239000013543 active substance Substances 0.000 description 4
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 150000004965 peroxy acids Chemical class 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000004115 Sodium Silicate Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 3
- 238000007580 dry-mixing Methods 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- 230000003179 granulation Effects 0.000 description 3
- 238000005469 granulation Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000002036 drum drying Methods 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000012025 fluorinating agent Substances 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 235000012149 noodles Nutrition 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- ATGAWOHQWWULNK-UHFFFAOYSA-I pentapotassium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O ATGAWOHQWWULNK-UHFFFAOYSA-I 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000003352 sequestering agent Substances 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- RKHMZKDESOMZLE-UHFFFAOYSA-N (1,3-diacetyl-5-acetyloxyimidazolidin-4-yl) acetate Chemical compound CC(=O)OC1C(OC(C)=O)N(C(C)=O)CN1C(C)=O RKHMZKDESOMZLE-UHFFFAOYSA-N 0.000 description 1
- MSELUFTVMYHJGR-UHFFFAOYSA-N (1,3-diacetyl-5-propanoyloxyimidazolidin-4-yl) propanoate Chemical compound CCC(=O)OC1C(OC(=O)CC)N(C(C)=O)CN1C(C)=O MSELUFTVMYHJGR-UHFFFAOYSA-N 0.000 description 1
- NIHKFGMYMWGERR-UHFFFAOYSA-N (3-chlorobenzoyl) 3-chlorobenzoate Chemical compound ClC1=CC=CC(C(=O)OC(=O)C=2C=C(Cl)C=CC=2)=C1 NIHKFGMYMWGERR-UHFFFAOYSA-N 0.000 description 1
- WBBAZMPYEDKGEU-UHFFFAOYSA-N (5-acetyloxy-1,3-diformylimidazolidin-4-yl) acetate Chemical compound CC(=O)OC1C(OC(C)=O)N(C=O)CN1C=O WBBAZMPYEDKGEU-UHFFFAOYSA-N 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical compound OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- VAVZXZURPCYUHS-RQOWECAXSA-N (z)-3-(hydrazinecarbonyl)-4-oxopent-2-enoic acid Chemical compound OC(=O)/C=C(C(=O)C)\C(=O)NN VAVZXZURPCYUHS-RQOWECAXSA-N 0.000 description 1
- CMPBGADGVYNAAG-UHFFFAOYSA-N 1,3-di(propanoyl)imidazolidine-2,4-dione Chemical compound CCC(=O)N1CC(=O)N(C(=O)CC)C1=O CMPBGADGVYNAAG-UHFFFAOYSA-N 0.000 description 1
- HUPQMDDKEZELTH-UHFFFAOYSA-N 1,3-diacetyl-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC(=O)N1C(=O)N(C(C)=O)C(C)(C)C1=O HUPQMDDKEZELTH-UHFFFAOYSA-N 0.000 description 1
- GJBQPJPEBXKJSF-UHFFFAOYSA-N 1,4-di(propanoyl)piperazine-2,5-dione Chemical compound CCC(=O)N1CC(=O)N(C(=O)CC)CC1=O GJBQPJPEBXKJSF-UHFFFAOYSA-N 0.000 description 1
- CBBKKVPJPRZOCM-UHFFFAOYSA-N 1,4-diacetylpiperazine-2,5-dione Chemical compound CC(=O)N1CC(=O)N(C(C)=O)CC1=O CBBKKVPJPRZOCM-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- MUSGYYOCMDPAEO-UHFFFAOYSA-N 2,4,6,8-tetrazabicyclo[3.3.1]nonane-3,7-dione Chemical compound C1C2NC(=O)NC1NC(=O)N2 MUSGYYOCMDPAEO-UHFFFAOYSA-N 0.000 description 1
- WFXJWACFHGTNEH-UHFFFAOYSA-N 3,6-dimethyl-1,4-di(propanoyl)piperazine-2,5-dione Chemical compound CCC(=O)N1C(C)C(=O)N(C(=O)CC)C(C)C1=O WFXJWACFHGTNEH-UHFFFAOYSA-N 0.000 description 1
- BTTRMCQEPDPCPA-UHFFFAOYSA-N 4-chlorophthalic anhydride Chemical compound ClC1=CC=C2C(=O)OC(=O)C2=C1 BTTRMCQEPDPCPA-UHFFFAOYSA-N 0.000 description 1
- UXVMHSYMNTYLPO-UHFFFAOYSA-N 4-ethoxycarbonyloxybenzoic acid Chemical class CCOC(=O)OC1=CC=C(C(O)=O)C=C1 UXVMHSYMNTYLPO-UHFFFAOYSA-N 0.000 description 1
- YNSJJJCTNXHMEW-UHFFFAOYSA-N 4-methoxy-n-methyl-n-methylsulfonylbenzamide Chemical compound COC1=CC=C(C(=O)N(C)S(C)(=O)=O)C=C1 YNSJJJCTNXHMEW-UHFFFAOYSA-N 0.000 description 1
- BUJPYXOTTZPZGS-UHFFFAOYSA-N 4-propoxycarbonyloxybenzenesulfonic acid Chemical class CCCOC(=O)OC1=CC=C(S(O)(=O)=O)C=C1 BUJPYXOTTZPZGS-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- OUUQCZGPVNCOIJ-UHFFFAOYSA-M Superoxide Chemical class [O-][O] OUUQCZGPVNCOIJ-UHFFFAOYSA-M 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000004973 alkali metal peroxides Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 230000003625 amylolytic effect Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 1
- QALAKUHQOSUJEU-UHFFFAOYSA-N calcium;magnesium Chemical compound [Mg+2].[Ca+2] QALAKUHQOSUJEU-UHFFFAOYSA-N 0.000 description 1
- 150000004651 carbonic acid esters Chemical class 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 150000001469 hydantoins Chemical class 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 150000002680 magnesium Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- UJPCOKISUIXFFR-UHFFFAOYSA-N n-acetyl-n-(4-methylphenyl)acetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=C(C)C=C1 UJPCOKISUIXFFR-UHFFFAOYSA-N 0.000 description 1
- KBDYPDHUODKDRK-UHFFFAOYSA-N n-acetyl-n-phenylacetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=CC=C1 KBDYPDHUODKDRK-UHFFFAOYSA-N 0.000 description 1
- QGILZBNKDUVXNM-UHFFFAOYSA-N n-methyl-n-methylsulfonyl-4-nitrobenzamide Chemical compound CS(=O)(=O)N(C)C(=O)C1=CC=C([N+]([O-])=O)C=C1 QGILZBNKDUVXNM-UHFFFAOYSA-N 0.000 description 1
- DDNVNUWFESEAHN-UHFFFAOYSA-N n-methyl-n-methylsulfonylacetamide Chemical compound CC(=O)N(C)S(C)(=O)=O DDNVNUWFESEAHN-UHFFFAOYSA-N 0.000 description 1
- FVCXXYLGLXGBDR-UHFFFAOYSA-N n-methyl-n-methylsulfonylbenzamide Chemical compound CS(=O)(=O)N(C)C(=O)C1=CC=CC=C1 FVCXXYLGLXGBDR-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000004022 organic phosphonium compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- BXRNXXXXHLBUKK-UHFFFAOYSA-N piperazine-2,5-dione Chemical class O=C1CNC(=O)CN1 BXRNXXXXHLBUKK-UHFFFAOYSA-N 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- XTHRMVQDBJOEPD-UHFFFAOYSA-N prop-1-ene;urea Chemical compound CC=C.NC(N)=O.NC(N)=O XTHRMVQDBJOEPD-UHFFFAOYSA-N 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 238000004876 x-ray fluorescence Methods 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
- 229960001763 zinc sulfate Drugs 0.000 description 1
- 229910000368 zinc sulfate Inorganic materials 0.000 description 1
- RZLVQBNCHSJZPX-UHFFFAOYSA-L zinc sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Zn+2].[O-]S([O-])(=O)=O RZLVQBNCHSJZPX-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/36—Organic compounds containing phosphorus
- C11D3/364—Organic compounds containing phosphorus containing nitrogen
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3937—Stabilising agents
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
- Cleaning And De-Greasing Of Metallic Materials By Chemical Methods (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7912141 | 1979-04-06 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8002599L SE8002599L (sv) | 1980-10-07 |
| SE439018B true SE439018B (sv) | 1985-05-28 |
Family
ID=10504389
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8002599A SE439018B (sv) | 1979-04-06 | 1980-04-03 | Bleknings- och rengoringskomposition |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4259200A (enExample) |
| JP (1) | JPS55137199A (enExample) |
| AU (1) | AU534919B2 (enExample) |
| BE (1) | BE882667A (enExample) |
| BR (1) | BR8001956A (enExample) |
| CA (1) | CA1135589A (enExample) |
| CH (1) | CH642678A5 (enExample) |
| DE (1) | DE3012922A1 (enExample) |
| DK (1) | DK144380A (enExample) |
| ES (1) | ES490294A0 (enExample) |
| FI (1) | FI66643C (enExample) |
| FR (1) | FR2453212A1 (enExample) |
| GB (1) | GB2048930B (enExample) |
| GR (1) | GR66634B (enExample) |
| IT (1) | IT1128399B (enExample) |
| NL (1) | NL182819C (enExample) |
| NO (1) | NO150445C (enExample) |
| SE (1) | SE439018B (enExample) |
| YU (1) | YU89180A (enExample) |
| ZA (1) | ZA801939B (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE7799T1 (de) * | 1980-03-21 | 1984-06-15 | Unilever Nv | Bleich- und reinigungsmittelzusammensetzungen. |
| CA1158129A (en) * | 1980-03-27 | 1983-12-06 | Dennis Postlethwaite | Detergent bleach compositions |
| FR2493294A1 (fr) * | 1980-11-04 | 1982-05-07 | Air Liquide | Compositions stabilisantes pour produits peroxydes |
| FR2503746A1 (fr) * | 1981-04-09 | 1982-10-15 | Air Liquide | Composition activante pour le blanchiment au moyen de produits peroxydes |
| DE3128336A1 (de) * | 1981-07-17 | 1983-01-27 | Henkel KGaA, 4000 Düsseldorf | "verfahren zur herstellung umhuellter koerniger bleichaktivatoren" |
| GR76237B (enExample) * | 1981-08-08 | 1984-08-04 | Procter & Gamble | |
| DE3136808A1 (de) * | 1981-09-16 | 1983-03-31 | Bayer Ag, 5090 Leverkusen | Triazolidin-3,5-dione |
| US4378300A (en) * | 1981-12-10 | 1983-03-29 | Colgate-Palmolive Company | Peroxygen bleaching composition |
| US4529534A (en) * | 1982-08-19 | 1985-07-16 | The Procter & Gamble Company | Peroxyacid bleach compositions |
| US4664837A (en) * | 1982-10-04 | 1987-05-12 | Colgate Palmolive Co. | Bleaching and laundering composition containing magnesium monoperoxyphthalate a chelating agent, a peroxygen compound and phthalic anhydride |
| GB8308003D0 (en) * | 1983-03-23 | 1983-04-27 | Albright & Wilson | Phosphonates |
| JPS6236498A (ja) * | 1985-08-09 | 1987-02-17 | ル・エ−ル・リクイツド・ソシエテ・アノニム・プ−ル・ル・エチユド・エ・ル・エクスプルワテシヨン・デ・プロセデ・ジエオルジエ・クロ−ド | セルロ−ス保護剤 |
| DE3639115A1 (de) * | 1986-11-15 | 1988-05-19 | Henkel Kgaa | Lagerbestaendiges bleichmittelgemisch mit verbessertem loesungsvermoegen |
| BE1000328A5 (fr) * | 1987-02-19 | 1988-10-25 | Interox Sa | Particules de composes peroxygenes stabilisees, procede pour leur fabrication, et compositions en contenant. |
| GB8728386D0 (en) * | 1987-12-04 | 1988-01-13 | Unilever Plc | Phosphate-free detergent bleach compositions |
| US4898681A (en) * | 1988-08-31 | 1990-02-06 | Burton Charles D | Hypochlorite distinfectant stabilized with calcium chelant |
| DE4006700C2 (de) * | 1990-02-28 | 1995-07-20 | Mannesmann Ag | Stromabnehmer |
| EP0678572A1 (en) * | 1994-04-20 | 1995-10-25 | The Procter & Gamble Company | Detergent powder compositions |
| US5780419A (en) * | 1994-04-20 | 1998-07-14 | The Procter & Gamble Company | Detergent powder compositions comprising metal ion-chelant complex and anionic functional polymer |
| EP0718398A1 (en) * | 1994-12-22 | 1996-06-26 | The Procter & Gamble Company | Laundry bleaching compositions |
| US5945392A (en) * | 1995-06-20 | 1999-08-31 | Procter & Gamble Company | Nonaqueous, particulate-containing detergent compositions |
| US5958866A (en) * | 1996-03-23 | 1999-09-28 | The Procter & Gamble Company | Spray-dried component comprising chelant |
| ATE218611T1 (de) * | 1996-03-23 | 2002-06-15 | Procter & Gamble | Chelatbildner enthaltender sprühgetrockneter waschmittelbestandteil |
| US5731276A (en) | 1996-07-30 | 1998-03-24 | The Clorox Company | Thickened aqueous cleaning composition and methods of preparation thereof and cleaning therewith |
| US6453050B1 (en) | 1998-05-11 | 2002-09-17 | Matsushita Electric Industrial Co., Ltd. | Piezoelectric speaker, method for producing the same, and speaker system including the same |
| US6451224B1 (en) * | 1999-07-21 | 2002-09-17 | The Dow Chemical Company | Stable free-flowing solid chelants |
| KR100328267B1 (ko) * | 2000-02-23 | 2002-03-16 | 성재갑 | 액체 세정제 조성물 |
| GB0030671D0 (en) * | 2000-12-15 | 2001-01-31 | Unilever Plc | Detergent compositions |
| DE60208245T2 (de) | 2001-01-22 | 2006-07-13 | Matsushita Electric Industrial Co., Ltd., Kadoma | Lautsprechersystem |
| US8014547B2 (en) | 2005-02-17 | 2011-09-06 | Panasonic Corporation | Piezoelectric speaker and method for manufacturing the same |
| US20060234900A1 (en) * | 2005-04-13 | 2006-10-19 | Ecolab Inc. | Composition and process for preparing a phosphonate and phosphate-free automatic dishwashing powder |
| US20100075883A1 (en) * | 2008-09-24 | 2010-03-25 | Ecolab Inc. | Granular cleaning and disinfecting composition |
| US8034759B2 (en) * | 2008-10-31 | 2011-10-11 | Ecolab Usa Inc. | Enhanced stability peracid compositions |
| CN102199869B (zh) * | 2011-04-02 | 2013-02-06 | 绍兴县友邦助剂有限公司 | 氧漂稳定剂及其应用 |
| US9783766B2 (en) | 2015-04-03 | 2017-10-10 | Ecolab Usa Inc. | Enhanced peroxygen stability using anionic surfactant in TAED-containing peroxygen solid |
| US10280386B2 (en) | 2015-04-03 | 2019-05-07 | Ecolab Usa Inc. | Enhanced peroxygen stability in multi-dispense TAED-containing peroxygen solid |
| EP3810743B1 (en) | 2018-06-15 | 2024-03-13 | Ecolab USA Inc. | Enhanced peroxygen stability using fatty acid in bleach activating agent containing peroxygen solid |
| CN111484520A (zh) * | 2019-01-25 | 2020-08-04 | 金发科技股份有限公司 | 一种乙二胺四亚甲基膦酸铝阻燃剂及其制备方法和用途 |
| CN111777798A (zh) * | 2019-04-03 | 2020-10-16 | 金发科技股份有限公司 | 一种二乙烯三胺五亚甲基膦酸铝阻燃剂及其制备方法和用途 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3629124A (en) * | 1969-08-27 | 1971-12-21 | Monsanto Co | Bleaching sterilizing disinfecting and deterging compositions |
| GB1392284A (en) * | 1971-03-30 | 1975-04-30 | Unilever Ltd | Stabilisation of active oxygen releasing compounds |
| DE2614148A1 (de) * | 1976-04-02 | 1977-10-20 | Henkel & Cie Gmbh | Oxidations-, bleich- und waschmittel mit einem gehalt an bleichaktivatoren |
| DE2654164C2 (de) * | 1976-11-30 | 1978-08-10 | Schuelke & Mayr Gmbh, 2000 Norderstedt | Wäßrige Perglutarsäurelösung und deren Verwendung |
| FR2396114A1 (fr) * | 1977-06-29 | 1979-01-26 | Protex Manuf Prod Chimiq | Perfectionnements aux procedes de blanchiment oxydant |
| FI64639C (fi) * | 1978-09-27 | 1983-12-12 | Unilever Nv | Bleknings- och rengoeringskomposition |
| DD141844B1 (de) * | 1978-12-28 | 1982-04-28 | Rudolf Opitz | Bleichmittel |
-
1980
- 1980-03-31 CH CH250680A patent/CH642678A5/de not_active IP Right Cessation
- 1980-03-31 FI FI801003A patent/FI66643C/fi not_active IP Right Cessation
- 1980-03-31 BR BR8001956A patent/BR8001956A/pt not_active IP Right Cessation
- 1980-03-31 US US06/135,416 patent/US4259200A/en not_active Expired - Lifetime
- 1980-03-31 NO NO800930A patent/NO150445C/no unknown
- 1980-04-01 ZA ZA00801939A patent/ZA801939B/xx unknown
- 1980-04-01 YU YU00891/80A patent/YU89180A/xx unknown
- 1980-04-02 DE DE19803012922 patent/DE3012922A1/de active Granted
- 1980-04-02 ES ES490294A patent/ES490294A0/es active Granted
- 1980-04-02 FR FR8007494A patent/FR2453212A1/fr active Granted
- 1980-04-02 GR GR61610A patent/GR66634B/el unknown
- 1980-04-02 NL NLAANVRAGE8001929,A patent/NL182819C/xx not_active IP Right Cessation
- 1980-04-02 DK DK144380A patent/DK144380A/da not_active IP Right Cessation
- 1980-04-03 GB GB8011322A patent/GB2048930B/en not_active Expired
- 1980-04-03 CA CA000349228A patent/CA1135589A/en not_active Expired
- 1980-04-03 JP JP4403880A patent/JPS55137199A/ja active Granted
- 1980-04-03 SE SE8002599A patent/SE439018B/sv not_active IP Right Cessation
- 1980-04-03 AU AU57181/80A patent/AU534919B2/en not_active Ceased
- 1980-04-04 IT IT67541/80A patent/IT1128399B/it active
- 1980-04-04 BE BE0/200137A patent/BE882667A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE8002599L (sv) | 1980-10-07 |
| FI66643B (fi) | 1984-07-31 |
| NO800930L (no) | 1980-10-07 |
| GR66634B (enExample) | 1981-04-03 |
| GB2048930A (en) | 1980-12-17 |
| FR2453212A1 (fr) | 1980-10-31 |
| NO150445B (no) | 1984-07-09 |
| DK144380A (da) | 1980-10-07 |
| ZA801939B (en) | 1981-11-25 |
| DE3012922C2 (enExample) | 1991-05-02 |
| FI801003A7 (fi) | 1980-10-07 |
| NL8001929A (nl) | 1980-10-08 |
| FI66643C (fi) | 1984-11-12 |
| IT8067541A0 (it) | 1980-04-04 |
| CA1135589A (en) | 1982-11-16 |
| GB2048930B (en) | 1983-12-21 |
| ES8104394A1 (es) | 1981-04-16 |
| AU534919B2 (en) | 1984-02-23 |
| FR2453212B1 (enExample) | 1983-11-04 |
| NO150445C (no) | 1984-10-17 |
| ES490294A0 (es) | 1981-04-16 |
| CH642678A5 (de) | 1984-04-30 |
| BR8001956A (pt) | 1980-11-25 |
| JPS618878B2 (enExample) | 1986-03-18 |
| NL182819B (nl) | 1987-12-16 |
| DE3012922A1 (de) | 1980-10-23 |
| YU89180A (en) | 1984-02-29 |
| BE882667A (fr) | 1980-10-06 |
| IT1128399B (it) | 1986-05-28 |
| US4259200A (en) | 1981-03-31 |
| AU5718180A (en) | 1980-10-09 |
| NL182819C (nl) | 1991-12-16 |
| JPS55137199A (en) | 1980-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE439018B (sv) | Bleknings- och rengoringskomposition | |
| EP0464880B1 (en) | Bleaching composition | |
| EP0053859B1 (en) | Bleach activator granules | |
| EP0141470B1 (en) | Manganese adjuncts, their preparation and use | |
| US4111826A (en) | Bleaching assistants | |
| JP2575350B2 (ja) | 漂白剤活性剤化合物 | |
| US5069812A (en) | Bleach/builder precursors | |
| EP0458396A1 (en) | Bleaching composition | |
| EP0267047A2 (en) | Bleaching compositions, glycolate ester peracids and precursors | |
| US5462692A (en) | Stable solid acetylperoxyborate compounds | |
| KR101944345B1 (ko) | 입상 세제 조성물 및 그 제조 방법 | |
| US4618445A (en) | Peroxide bleach and compositions comprising said bleach | |
| EP0056723B1 (en) | Detergent compositions | |
| EP0527039A2 (en) | Bleaching detergent composition containing sugar derivatives as bleach precursors | |
| EP0333248A2 (en) | Bleach precursors and their use in bleaching and/or detergent composition | |
| GB2136839A (en) | Stabilised peroxide bleach | |
| JPH07228899A (ja) | 漂白洗浄剤組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8002599-2 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8002599-2 Format of ref document f/p: F |