SE413663B - Sett for kontinuerlig framstellning av en blandning av klordioxid, dlor och ett neutralt alkalimetallsalt - Google Patents
Sett for kontinuerlig framstellning av en blandning av klordioxid, dlor och ett neutralt alkalimetallsaltInfo
- Publication number
- SE413663B SE413663B SE6902955A SE295569A SE413663B SE 413663 B SE413663 B SE 413663B SE 6902955 A SE6902955 A SE 6902955A SE 295569 A SE295569 A SE 295569A SE 413663 B SE413663 B SE 413663B
- Authority
- SE
- Sweden
- Prior art keywords
- reaction solution
- alkali metal
- reaction
- chlorine
- chloride
- Prior art date
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 title claims description 26
- 229910052783 alkali metal Inorganic materials 0.000 title claims description 20
- 230000007935 neutral effect Effects 0.000 title claims description 5
- 150000001340 alkali metals Chemical class 0.000 title claims 2
- 238000002360 preparation method Methods 0.000 title description 2
- 239000011833 salt mixture Substances 0.000 title 1
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 claims description 63
- 238000006243 chemical reaction Methods 0.000 claims description 53
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims description 49
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 34
- 235000019398 chlorine dioxide Nutrition 0.000 claims description 32
- 239000004155 Chlorine dioxide Substances 0.000 claims description 31
- -1 alkali metal chlorate Chemical class 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 27
- 239000002253 acid Substances 0.000 claims description 24
- 239000000460 chlorine Substances 0.000 claims description 19
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 18
- 229910052801 chlorine Inorganic materials 0.000 claims description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 11
- 239000003054 catalyst Substances 0.000 claims description 10
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 claims description 10
- 239000013078 crystal Substances 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- 229910001514 alkali metal chloride Inorganic materials 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 claims 2
- 239000003513 alkali Substances 0.000 claims 1
- 238000009395 breeding Methods 0.000 claims 1
- 230000001488 breeding effect Effects 0.000 claims 1
- 238000010924 continuous production Methods 0.000 claims 1
- 229940077449 dichromate ion Drugs 0.000 claims 1
- 239000000243 solution Substances 0.000 description 35
- 229910001868 water Inorganic materials 0.000 description 26
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 23
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 20
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 13
- 239000007788 liquid Substances 0.000 description 13
- 229910052938 sodium sulfate Inorganic materials 0.000 description 11
- 235000011152 sodium sulphate Nutrition 0.000 description 11
- 239000011780 sodium chloride Substances 0.000 description 10
- 238000002425 crystallisation Methods 0.000 description 9
- 230000008025 crystallization Effects 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 239000012527 feed solution Substances 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- 239000006193 liquid solution Substances 0.000 description 4
- 239000012452 mother liquor Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000003784 tall oil Substances 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 229910052785 arsenic Inorganic materials 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 239000002655 kraft paper Substances 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- HAYXDMNJJFVXCI-UHFFFAOYSA-N arsenic(5+) Chemical compound [As+5] HAYXDMNJJFVXCI-UHFFFAOYSA-N 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229940005989 chlorate ion Drugs 0.000 description 1
- QEEKASZBZSQJIA-UHFFFAOYSA-N chloric acid hydrochloride Chemical compound Cl.O[Cl](=O)=O QEEKASZBZSQJIA-UHFFFAOYSA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910001919 chlorite Inorganic materials 0.000 description 1
- 229910052619 chlorite group Inorganic materials 0.000 description 1
- QBWCMBCROVPCKQ-UHFFFAOYSA-N chlorous acid Chemical compound OCl=O QBWCMBCROVPCKQ-UHFFFAOYSA-N 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Inorganic materials Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 1
- XQHAGELNRSUUGU-UHFFFAOYSA-M lithium chlorate Chemical compound [Li+].[O-]Cl(=O)=O XQHAGELNRSUUGU-UHFFFAOYSA-M 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000010587 phase diagram Methods 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M potassium chloride Inorganic materials [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B11/00—Oxides or oxyacids of halogens; Salts thereof
- C01B11/02—Oxides of chlorine
- C01B11/022—Chlorine dioxide (ClO2)
- C01B11/023—Preparation from chlorites or chlorates
- C01B11/025—Preparation from chlorites or chlorates from chlorates without any other reaction reducing agent than chloride ions
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S162/00—Paper making and fiber liberation
- Y10S162/08—Chlorine-containing liquid regeneration
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Geology (AREA)
- Inorganic Chemistry (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71064868A | 1968-03-05 | 1968-03-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE413663B true SE413663B (sv) | 1980-06-16 |
Family
ID=24854942
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE6902955A SE413663B (sv) | 1968-03-05 | 1969-03-04 | Sett for kontinuerlig framstellning av en blandning av klordioxid, dlor och ett neutralt alkalimetallsalt |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3563702A (Direct) |
| JP (1) | JPS546516B1 (Direct) |
| BE (1) | BE729357A (Direct) |
| DE (1) | DE1900998C3 (Direct) |
| FR (1) | FR2003223A1 (Direct) |
| GB (1) | GB1249366A (Direct) |
| NL (1) | NL6903418A (Direct) |
| SE (1) | SE413663B (Direct) |
Families Citing this family (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3933987A (en) * | 1966-10-24 | 1976-01-20 | Hooker Chemicals & Plastics Corporation | Simultaneous production of chlorine dioxide and a salt of a strong acid |
| US3933988A (en) * | 1966-10-24 | 1976-01-20 | Hooker Chemicals & Plastics Corporation | Method of simultaneously producing chlorine dioxide and a sulfate salt |
| US3760065A (en) * | 1970-05-29 | 1973-09-18 | Erco Ind Ltd | Production of chlorine dioxide |
| FR2163818A5 (Direct) * | 1970-06-10 | 1973-07-27 | Electric Reduction Cy Ca | |
| AU461684B2 (en) * | 1971-01-22 | 1975-06-05 | Kemanord A.B. | Production of chlorine dioxide |
| US3764663A (en) * | 1972-10-31 | 1973-10-09 | Ethyl Corp | Chlorine dioxide production |
| US3789108A (en) * | 1973-02-08 | 1974-01-29 | Erco Ind Ltd | Production of chlorine dioxide |
| US3895100A (en) * | 1973-07-05 | 1975-07-15 | Erco Ind Ltd | Production of chlorine dioxide |
| US3975505A (en) * | 1974-12-13 | 1976-08-17 | Hooker Chemicals & Plastics Corporation | Production of chlorine dioxide |
| US3976758A (en) * | 1975-03-07 | 1976-08-24 | Hooker Chemicals & Plastics Corporation | Production of chlorine dioxide |
| US3974266A (en) * | 1975-03-07 | 1976-08-10 | Hooker Chemicals & Plastics Corporation | Production of chlorine dioxide |
| CA1195477A (en) * | 1976-02-24 | 1985-10-22 | W.Howard Rapson | Production of chlorine dioxide at high efficiency |
| NZ183379A (en) * | 1976-02-24 | 1979-03-28 | Erco Ind Ltd | Chlorine dioxide from sodium chlorate reduced by hydrochloric acid |
| CA1090091A (en) * | 1976-03-19 | 1980-11-25 | Richard Swindells | Production of chlorine dioxide from buffered reaction media |
| US4145401A (en) * | 1976-03-19 | 1979-03-20 | Erco Industries Limited | High efficiency chlorine dioxide production at low acidity with methanol addition |
| US4154809A (en) * | 1976-03-19 | 1979-05-15 | Erco Industries Limited | High efficiency chlorine dioxide production using HCl as acid and methanol addition |
| JPS538398A (en) * | 1976-07-12 | 1978-01-25 | Japan Carlit Co Ltd | Manufacturing method of chlorine dioxide |
| US4079123A (en) * | 1976-12-30 | 1978-03-14 | Hooker Chemicals & Plastics Corporation | Process for the production of chlorine dioxide |
| JPS5474296A (en) * | 1977-11-26 | 1979-06-14 | Japan Carlit Co Ltd | Manufacture of chlorine dioxide |
| US4178356A (en) * | 1977-12-02 | 1979-12-11 | The Japan Carlit Co., Ltd. | Process for manufacturing chlorine dioxide |
| US4169134A (en) * | 1977-12-02 | 1979-09-25 | The Japan Carlit Co., Ltd. | Manufacturing chlorine dioxide with thallium and silver or palladium catalysts |
| ZA786778B (en) * | 1978-01-03 | 1980-07-30 | Erco Ind Ltd | Improved washing procedure in chlorine dioxide production |
| US4325934A (en) * | 1980-09-22 | 1982-04-20 | Erco Industries Limited | Production of chlorine dioxide with conversion of by-product solid phase sodium acid sulphate to its neutral form |
| US4362707A (en) * | 1981-04-23 | 1982-12-07 | Diamond Shamrock Corporation | Preparation of chlorine dioxide with platinum group metal oxide catalysts |
| US4451444A (en) * | 1981-10-21 | 1984-05-29 | Lamb-Weston, Inc. | Method and apparatus for producing chlorine dioxide |
| US4886653A (en) * | 1988-03-25 | 1989-12-12 | Olin Corporation | Process and apparatus for producing an aqueous solution containing chlorine dioxide and chlorine |
| US4839152A (en) * | 1988-03-25 | 1989-06-13 | Olin Corporation | Process for producing an aqueous solution containing chlorine dioxide and chlorine |
| SE463669B (sv) * | 1988-06-17 | 1991-01-07 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| SE463670B (sv) * | 1988-10-11 | 1991-01-07 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| SE464193B (sv) * | 1988-10-20 | 1991-03-18 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| SE463671B (sv) * | 1988-10-25 | 1991-01-07 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| SE465569B (sv) * | 1989-04-18 | 1991-09-30 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| US5078908A (en) * | 1989-10-02 | 1992-01-07 | Allergan, Inc. | Methods for generating chlorine dioxide and compositions for disinfecting |
| US5246662A (en) * | 1989-10-02 | 1993-09-21 | Allergan, Inc. | Methods for generating chlorine dioxide and compositions for disinfecting |
| SE467252B (sv) * | 1990-03-16 | 1992-06-22 | Eka Nobel Ab | Foerfarande foer framstaellning av klordioxid |
| SE9002262D0 (sv) * | 1990-06-27 | 1990-06-27 | Eka Nobel Ab | Foerfarande foer framstaellning av klorioxid |
| SE500043C2 (sv) * | 1990-08-31 | 1994-03-28 | Eka Nobel Ab | Förfarande för kontinuerlig framställning av klordioxid |
| SE500042C2 (sv) * | 1990-08-31 | 1994-03-28 | Eka Nobel Ab | Förfarande för kontinuerlig framställning av klordioxid |
| US5376350A (en) * | 1992-12-10 | 1994-12-27 | Eka Nobel Ab | Plug flow process for the production of chlorine dioxide |
| US5380517B1 (en) * | 1993-02-26 | 1999-01-19 | Eka Nobel Inc | Process for continuously producing chlorine dioxide |
| US5487881A (en) * | 1993-02-26 | 1996-01-30 | Eka Nobel Inc. | Process of producing chlorine dioxide |
| US5736165A (en) * | 1993-05-25 | 1998-04-07 | Allergan | In-the-eye use of chlorine dioxide-containing compositions |
| US5648074A (en) * | 1993-05-25 | 1997-07-15 | Allergan | Compositions and methods for disinfecting contact lenses and reducing proteinaceous deposit formation |
| US5478446A (en) * | 1993-07-02 | 1995-12-26 | Eka Nobel Inc. | Electrochemical process |
| NZ272769A (en) * | 1994-08-18 | 1996-03-26 | Eka Nobel Inc | Process for producing chlorine dioxide by reducing chlorate in acidic reaction medium |
| SE9402856L (sv) * | 1994-08-26 | 1995-11-27 | Eka Nobel Ab | Process of producing chlorine dioxide |
| US6024954A (en) * | 1994-12-12 | 2000-02-15 | Allergan | Compositions and methods for disinfecting contact lenses and preserving contact lens care products |
| DE19751852C1 (de) * | 1997-11-22 | 1999-07-15 | Amler Harald | Zange zum Erfassen und Fixieren von Gegenständen |
| US20040062680A1 (en) * | 2002-09-30 | 2004-04-01 | Bernard Technologies, Inc. | Apparatus and method for generation of chlorine dioxide gas |
| US7300637B2 (en) * | 2002-09-30 | 2007-11-27 | Ethicon, Inc. | Sterilization container kit |
| US20040241065A1 (en) * | 2002-09-30 | 2004-12-02 | Bernard Technologies, Inc. | Apparatus and kit for generation of chlorine dioxide gas |
| UY32927A (es) * | 2009-10-12 | 2011-03-31 | Akzo Nobel Chemicals Int Bv | Proceso para la producción de dióxido de cloro |
| CN110015638A (zh) * | 2019-04-25 | 2019-07-16 | 兰州泰邦化工科技有限公司 | 一种基于氯酸和双氧水生产亚氯酸钠的设备及其生产方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5816312B2 (ja) * | 1975-06-23 | 1983-03-30 | 日本信号株式会社 | ランプノ ダンシンケンチキ |
-
1968
- 1968-03-05 US US710648A patent/US3563702A/en not_active Expired - Lifetime
- 1968-12-19 JP JP9365568A patent/JPS546516B1/ja active Pending
-
1969
- 1969-01-09 DE DE1900998A patent/DE1900998C3/de not_active Expired
- 1969-01-09 GB GB0440/69A patent/GB1249366A/en not_active Expired
- 1969-01-14 FR FR6900422A patent/FR2003223A1/fr active Pending
- 1969-03-04 BE BE729357D patent/BE729357A/xx unknown
- 1969-03-04 SE SE6902955A patent/SE413663B/sv unknown
- 1969-03-05 NL NL6903418A patent/NL6903418A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1900998A1 (de) | 1970-02-05 |
| BE729357A (Direct) | 1969-09-04 |
| JPS546516B1 (Direct) | 1979-03-29 |
| NL6903418A (Direct) | 1969-09-09 |
| FR2003223A1 (Direct) | 1969-11-07 |
| US3563702A (en) | 1971-02-16 |
| DE1900998B2 (de) | 1980-01-17 |
| DE1900998C3 (de) | 1980-10-16 |
| GB1249366A (en) | 1971-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE413663B (sv) | Sett for kontinuerlig framstellning av en blandning av klordioxid, dlor och ett neutralt alkalimetallsalt | |
| US3864456A (en) | Manufacture of chlorine dioxide, chlorine and anhydrous sodium sulphate | |
| CA1079931A (en) | High efficiency production of chlorine dioxide by solvay process | |
| US4180547A (en) | Process for recovery of chemicals from saline water | |
| CA2515712C (en) | Method for recovering purified sodium bicarbonate and ammonium sulfate | |
| US3998935A (en) | Manufacture of potassium sulfate | |
| CA1287596C (en) | Production of sodium chlorate | |
| US3933988A (en) | Method of simultaneously producing chlorine dioxide and a sulfate salt | |
| FI81555C (fi) | Framstaellning av klordioxid. | |
| US3754081A (en) | Process for the production of chlorine dioxide,chlorine and a mixtureof an alkali metal sulfate and bisulfate | |
| US3341288A (en) | Production of chlorine dioxide | |
| US6491807B2 (en) | Process for producing sodium persulfate | |
| SE448864B (sv) | Sett att framstella en vattenlosning lemplig for framstellning av klordioxid och samtidig reducering av klorinnehallet i en gasformig klordioxidstrom | |
| US3347628A (en) | Production of chlorine dioxide | |
| US3760065A (en) | Production of chlorine dioxide | |
| US3883406A (en) | Process for recovering electrolytically produced alkali metal chlorates | |
| US3929974A (en) | Production of chlorine dioxide | |
| US3933987A (en) | Simultaneous production of chlorine dioxide and a salt of a strong acid | |
| CA1105877A (en) | Process for producing chlorine dioxide | |
| US3241912A (en) | Process of aqueous chlorination | |
| EP0047363B1 (en) | Continuous process for the direct conversion of potassium chloride to potassium chlorate by electrolysis | |
| SE504562C2 (sv) | Förfarande för avlägsnande av sulfat från en vattenhaltig lösning av alkalimetallklorat | |
| CA2181613C (en) | Impurity removal from sodium chlorate | |
| US2758912A (en) | Process for producing a substantially sulfate-free and potassium-free magnesium chloride solution | |
| SE465569B (sv) | Foerfarande foer framstaellning av klordioxid |