PL80715B1 - - Google Patents
Download PDFInfo
- Publication number
- PL80715B1 PL80715B1 PL1970141392A PL14139270A PL80715B1 PL 80715 B1 PL80715 B1 PL 80715B1 PL 1970141392 A PL1970141392 A PL 1970141392A PL 14139270 A PL14139270 A PL 14139270A PL 80715 B1 PL80715 B1 PL 80715B1
- Authority
- PL
- Poland
- Prior art keywords
- titanium
- compound
- hydride
- contacting
- product obtained
- Prior art date
Links
- 239000010936 titanium Substances 0.000 claims description 67
- 229910052719 titanium Inorganic materials 0.000 claims description 47
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 45
- -1 magnesium halide Chemical class 0.000 claims description 45
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 43
- 238000000034 method Methods 0.000 claims description 42
- 150000001875 compounds Chemical class 0.000 claims description 37
- 229920000642 polymer Polymers 0.000 claims description 33
- 239000011777 magnesium Substances 0.000 claims description 22
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 21
- 150000002902 organometallic compounds Chemical class 0.000 claims description 20
- 239000003054 catalyst Substances 0.000 claims description 19
- 150000004678 hydrides Chemical class 0.000 claims description 17
- 229910052749 magnesium Inorganic materials 0.000 claims description 17
- 238000006116 polymerization reaction Methods 0.000 claims description 17
- 150000003609 titanium compounds Chemical class 0.000 claims description 16
- 238000000227 grinding Methods 0.000 claims description 10
- 230000000737 periodic effect Effects 0.000 claims description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 8
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 claims description 8
- 229910001623 magnesium bromide Inorganic materials 0.000 claims description 8
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 238000002083 X-ray spectrum Methods 0.000 claims description 4
- 150000001336 alkenes Chemical class 0.000 claims description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 3
- 230000000996 additive effect Effects 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 229910052793 cadmium Inorganic materials 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- 150000002739 metals Chemical class 0.000 claims description 3
- 239000012071 phase Substances 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 150000004703 alkoxides Chemical class 0.000 claims description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- 229910052785 arsenic Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 238000002425 crystallisation Methods 0.000 claims description 2
- 230000008025 crystallization Effects 0.000 claims description 2
- 238000007323 disproportionation reaction Methods 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002366 halogen compounds Chemical class 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000002524 organometallic group Chemical group 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 claims description 2
- 238000005979 thermal decomposition reaction Methods 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims 1
- 230000004913 activation Effects 0.000 claims 1
- 229910052782 aluminium Inorganic materials 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 150000002681 magnesium compounds Chemical class 0.000 claims 1
- 239000003960 organic solvent Substances 0.000 claims 1
- 230000007704 transition Effects 0.000 claims 1
- 239000000047 product Substances 0.000 description 43
- 239000004698 Polyethylene Substances 0.000 description 23
- 229920000573 polyethylene Polymers 0.000 description 23
- 229910003074 TiCl4 Inorganic materials 0.000 description 10
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 9
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 9
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 8
- 239000005977 Ethylene Substances 0.000 description 8
- 150000004820 halides Chemical class 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 238000003801 milling Methods 0.000 description 7
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 229910010062 TiCl3 Inorganic materials 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 3
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- KCXZNSGUUQJJTR-UHFFFAOYSA-N Di-n-hexyl phthalate Chemical compound CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCC KCXZNSGUUQJJTR-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- OWJVEZJJRYZWNI-UHFFFAOYSA-N 1,1-dinitrocyclohexane Chemical compound [O-][N+](=O)C1([N+]([O-])=O)CCCCC1 OWJVEZJJRYZWNI-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- 229910010199 LiAl Inorganic materials 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229910010068 TiCl2 Inorganic materials 0.000 description 1
- UATJOMSPNYCXIX-UHFFFAOYSA-N Trinitrobenzene Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 UATJOMSPNYCXIX-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium chloride Substances Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical class [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- IEPRKVQEAMIZSS-AATRIKPKSA-N diethyl fumarate Chemical compound CCOC(=O)\C=C\C(=O)OCC IEPRKVQEAMIZSS-AATRIKPKSA-N 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- ZWWCURLKEXEFQT-UHFFFAOYSA-N dinitrogen pentaoxide Chemical compound [O-][N+](=O)O[N+]([O-])=O ZWWCURLKEXEFQT-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002483 hydrogen compounds Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 150000003608 titanium Chemical class 0.000 description 1
- ZWYDDDAMNQQZHD-UHFFFAOYSA-L titanium(ii) chloride Chemical compound [Cl-].[Cl-].[Ti+2] ZWYDDDAMNQQZHD-UHFFFAOYSA-L 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/02—Carriers therefor
- C08F4/022—Magnesium halide as support anhydrous or hydrated or complexed by means of a Lewis base for Ziegler-type catalysts
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S526/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S526/906—Comminution of transition metal containing catalyst
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1846269 | 1969-06-20 | ||
| IT1882369 | 1969-06-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL80715B1 true PL80715B1 (Direct) | 1975-08-30 |
Family
ID=26326998
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970141392A PL80715B1 (Direct) | 1969-06-20 | 1970-06-17 |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4544717A (Direct) |
| JP (1) | JPS5819334B1 (Direct) |
| AT (1) | AT302648B (Direct) |
| BE (1) | BE752252A (Direct) |
| CS (1) | CS153084B2 (Direct) |
| DE (1) | DE2029992C3 (Direct) |
| DK (1) | DK130744B (Direct) |
| ES (1) | ES380918A1 (Direct) |
| FR (1) | FR2052706A5 (Direct) |
| GB (1) | GB1310547A (Direct) |
| IL (1) | IL34739A (Direct) |
| NL (1) | NL162664B (Direct) |
| PL (1) | PL80715B1 (Direct) |
| RO (1) | RO62731A (Direct) |
| SE (1) | SE417611B (Direct) |
| SU (1) | SU414770A3 (Direct) |
| YU (1) | YU36189B (Direct) |
Families Citing this family (107)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL162664B (nl) * | 1969-06-20 | 1980-01-15 | Montedison Spa | Werkwijze om een katalysator te bereiden voor de poly- merisatie van alkenen-1. |
| NL7113778A (Direct) * | 1970-10-13 | 1972-04-17 | ||
| NL7114641A (Direct) * | 1970-10-29 | 1972-05-03 | ||
| CH543546A (fr) | 1971-03-23 | 1973-10-31 | Solvay | Système catalytique de polymérisation des alpha-oléfines |
| US4226963A (en) | 1971-06-25 | 1980-10-07 | Montedison S.P.A. | Process for the stereoregular polymerization of alpha-olephins |
| US4107413A (en) | 1971-06-25 | 1978-08-15 | Montedison S.P.A. | Process for the stereoregular polymerization of alpha olefins |
| US4156063A (en) | 1971-06-25 | 1979-05-22 | Montecanti Edison, S.p.A. | Process for the stereoregular polymerization of alpha olefins |
| US4187196A (en) | 1971-06-25 | 1980-02-05 | Montedison S.P.A. | Process for the stereoregular polymerization of alpha-olefins |
| NL160286C (Direct) * | 1971-06-25 | |||
| US4107414A (en) | 1971-06-25 | 1978-08-15 | Montecatini Edison S.P.A. | Process for the stereoregular polymerization of alpha olefins |
| IT967867B (it) * | 1972-09-26 | 1974-03-11 | Montedison Spa | Procedimento per la polimerizzazio ne stereospecifica delle alfa ole fine |
| IT1005486B (it) | 1974-02-15 | 1976-08-20 | Montedison Spa | Gomme termoplastiche e processo per la loro preparazione |
| NL177314C (nl) * | 1974-04-08 | 1985-09-02 | Mitsubishi Chem Ind | Werkwijze voor het bereiden van een katalysatorcomplex, en werkwijze voor het polymeriseren van een alkeen met deze katalysator. |
| US4174429A (en) * | 1975-03-28 | 1979-11-13 | Montedison S.P.A. | Process for polymerizing olefins |
| JPS5242584A (en) | 1975-10-02 | 1977-04-02 | Nippon Oil Co Ltd | Process for producing polyolefine |
| IT1054410B (it) * | 1975-11-21 | 1981-11-10 | Mitsui Petrochemical Ind | Catalizzatori per la polimerizzazione delle alfa olefine |
| JPS5952643B2 (ja) * | 1977-01-27 | 1984-12-20 | 三井化学株式会社 | エチレン共重合体 |
| CA1125733A (en) * | 1978-03-27 | 1982-06-15 | Arthur W. Langer, Jr. | T.sub.nmr' in3-n xx cocatalysts |
| CA1142161A (en) * | 1978-03-29 | 1983-03-01 | Exxon Research And Engineering Company | Trialkyl aluminum cocatalyst |
| CA1144300A (en) * | 1978-11-20 | 1983-04-05 | Allen Noshay | Preparation of low density ethylene copolymers in fluid bed reactor |
| US4243552A (en) | 1978-12-11 | 1981-01-06 | Phillips Petroleum Company | Polymerization catalyst and process |
| JPS5923561B2 (ja) * | 1979-02-06 | 1984-06-02 | 三井化学株式会社 | オレフインの重合方法 |
| US4224182A (en) * | 1979-03-07 | 1980-09-23 | Exxon Research & Engineering Co. | Novel hindered alkyl aluminum amide cocatalysts |
| US4308369A (en) * | 1979-09-28 | 1981-12-29 | The Dow Chemical Company | High efficiency catalyst for polymerizing olefins |
| US4482687A (en) * | 1979-10-26 | 1984-11-13 | Union Carbide Corporation | Preparation of low-density ethylene copolymers in fluid bed reactor |
| IT1209255B (it) * | 1980-08-13 | 1989-07-16 | Montedison Spa | Catalizzatori per la polimerizzazione di olefine. |
| US6777508B1 (en) | 1980-08-13 | 2004-08-17 | Basell Poliolefine Italia S.P.A. | Catalysts for the polymerization of olefins |
| JPS58125706A (ja) * | 1982-01-22 | 1983-07-26 | Mitsubishi Petrochem Co Ltd | エチレンの重合法 |
| US5064795A (en) * | 1982-08-27 | 1991-11-12 | Phillips Petroleum Company | Polymerization of olefins |
| JPS58189189A (ja) * | 1982-09-20 | 1983-11-04 | Mitsubishi Chem Ind Ltd | 塩化マグネシウム・テトラビドロフラン錯体のテトラヒドロフラン溶液の製造方法 |
| US4988656A (en) * | 1984-03-23 | 1991-01-29 | Amoco Corporation | Olefin polymerization catalyst |
| US4866022A (en) * | 1984-03-23 | 1989-09-12 | Amoco Corporation | Olefin polymerization catalyst |
| FI75841C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| FI75845C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| FI75842C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| FI75843C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| FI75844C (fi) * | 1986-04-01 | 1988-08-08 | Neste Oy | Katalytkomponenter foer polymeringskatalyter av alfaolefiner och foerfarande foer deras framstaellning. |
| US4829038A (en) * | 1986-06-17 | 1989-05-09 | Amoco Corporation | Alpha-olefin polymerization catalyst system including an advantageous modifier component |
| IT1197320B (it) * | 1986-10-02 | 1988-11-30 | Ausimont Spa | Catalizzatori per la preparazione di copolimeri olefinici elastomerici,saturi ed insaturi,e vopolimeri con essi ottenuti |
| US4810761A (en) * | 1987-03-31 | 1989-03-07 | Union Carbide Corporation | Ethylene polymerization catalyst |
| US4870039A (en) * | 1987-11-24 | 1989-09-26 | Shell Oil Company | Olefin polymerization catalysts from soluble magnesium alkoxides made from mixed magnesium alkyls and aryls |
| US4870040A (en) * | 1987-11-24 | 1989-09-26 | Shell Oil Company | Olefin polymerization catalysts from soluble magnesium alkoxides made from alkyl or aryl magnesium mixed with a branched or aromatic aldehyde |
| FR2639351B1 (Direct) * | 1988-11-23 | 1992-12-31 | Atochem | |
| NO176841C (no) * | 1989-04-27 | 1995-06-07 | Sumitomo Chemical Co | Flytende katalysatorkomponent, katalysatorsystem inneholdende denne og fremgangsmåte for fremstilling av etylen - lefin-kopolymerer ved anvendelse av katalysatorsystemet |
| FI85151C (fi) * | 1989-09-06 | 1992-03-10 | Neste Oy | Ny baerarkatalysator foer polymerisation av eten. |
| FR2686608B1 (fr) * | 1992-01-27 | 1994-03-18 | Elf Atochem Sa | Procede d'activation de support a base de chlorure de magnesium entrant dans la fabrication de la composante catalytique de polymerisation de l'ethylene. |
| US5378672A (en) * | 1992-03-04 | 1995-01-03 | Fina Technology, Inc. | Methods and systems for multi-component catalyst formulation |
| FR2697526B1 (fr) * | 1992-10-30 | 1994-12-16 | Bp Chemicals Snc | Procédé de préparation d'un catalyseur de type Ziegler-Natta pour la polymérisation des oléfines. |
| EP0585511B1 (en) * | 1992-08-31 | 1997-01-15 | Fina Research S.A. | Magnesium chloride complexes, process and uses |
| IT1255523B (it) * | 1992-09-24 | 1995-11-09 | Himont Inc | Componenti e catalizzatori per la polimerizzazione di olefine |
| JPH09328513A (ja) * | 1996-04-09 | 1997-12-22 | Mitsui Petrochem Ind Ltd | 固体状チタン触媒成分の調製方法、オレフィンの重合用触媒およびオレフィン重合方法 |
| US5807800A (en) * | 1997-02-11 | 1998-09-15 | Fina Technology, Inc. | Process for producing stereospecific polymers |
| TW396168B (en) * | 1997-08-28 | 2000-07-01 | Toho Titanium K K | Solid catalyst component and catalyst for polymerization of olefins |
| US5908594A (en) * | 1997-09-24 | 1999-06-01 | Fina Technology, Inc. | Process of making polypropylene fiber |
| US6090325A (en) | 1997-09-24 | 2000-07-18 | Fina Technology, Inc. | Biaxially-oriented metallocene-based polypropylene films |
| US5997679A (en) * | 1997-10-17 | 1999-12-07 | Fina Technology, Inc. | Heat-seal strength in polyolefin films |
| US5958566A (en) | 1997-10-17 | 1999-09-28 | Fina Technology, Inc. | Metal bond strength in polyolefin films |
| US6207093B1 (en) | 1998-04-24 | 2001-03-27 | Fina Technology, Inc. | Compositions for improved orientation processing |
| EP1020404A1 (en) | 1999-01-18 | 2000-07-19 | Fina Research S.A. | Production of powder catalysts |
| US6416699B1 (en) | 1999-06-09 | 2002-07-09 | Fina Technology, Inc. | Reduced shrinkage in metallocene isotactic polypropylene fibers |
| US6905637B2 (en) | 2001-01-18 | 2005-06-14 | General Electric Company | Electrically conductive thermoset composition, method for the preparation thereof, and articles derived therefrom |
| US7235192B2 (en) | 1999-12-01 | 2007-06-26 | General Electric Company | Capped poly(arylene ether) composition and method |
| US6878782B2 (en) * | 1999-12-01 | 2005-04-12 | General Electric | Thermoset composition, method, and article |
| SG95635A1 (en) * | 2000-03-30 | 2003-04-23 | Sumitomo Chemical Co | Process for producing catalyst for ethylene polymerization and process for producing ehtylene polymer |
| US6916892B2 (en) * | 2001-12-03 | 2005-07-12 | Fina Technology, Inc. | Method for transitioning between Ziegler-Natta and metallocene catalysts in a bulk loop reactor for the production of polypropylene |
| US6733719B2 (en) * | 2002-01-14 | 2004-05-11 | Sunoco Inc. (R&M) | Polypropylene biaxially oriented film |
| US6998431B2 (en) | 2002-03-28 | 2006-02-14 | Fina Technology, Inc. | Polymerization process |
| US7025919B2 (en) * | 2002-03-28 | 2006-04-11 | Fina Technology, Inc. | Syndiotactic polypropylene fibers |
| US6824721B2 (en) * | 2002-03-29 | 2004-11-30 | Fina Technology, Inc. | Polypropylene fibers |
| US20030215588A1 (en) * | 2002-04-09 | 2003-11-20 | Yeager Gary William | Thermoset composition, method, and article |
| US6878327B2 (en) * | 2002-04-19 | 2005-04-12 | Fina Technology, Inc. | Process of making polypropylene fibers |
| US6657024B1 (en) | 2002-09-03 | 2003-12-02 | Fina Technology, Inc. | Polymerization catalyst system using n-butylmethyldimethoxysilane for preparation of polypropylene film grade resins |
| DE60336074D1 (de) * | 2002-10-11 | 2011-03-31 | Univ Connecticut | Mischungen von amorphen und semikristallinen polymeren mit formgedächtniseigenscchaften |
| US7078468B2 (en) * | 2003-06-27 | 2006-07-18 | Fina Technology, Inc. | Polymerization catalyst system using di-sec-butyldimethoxysilane for preparation of polypropylene |
| US20060009603A1 (en) * | 2004-07-09 | 2006-01-12 | David Young | Fibrillation-resistant polypropylene tape |
| CN100338018C (zh) | 2004-10-29 | 2007-09-19 | 中国石油化工股份有限公司 | 一种环戊酯类化合物及其合成方法和应用 |
| US7053163B1 (en) | 2005-02-22 | 2006-05-30 | Fina Technology, Inc. | Controlled comonomer distribution along a reactor for copolymer production |
| US7413812B2 (en) * | 2005-04-26 | 2008-08-19 | Fina Technology, Inc. | Polypropylene article and method of preparing polypropylene article |
| US20060279026A1 (en) * | 2005-06-09 | 2006-12-14 | Fina Technology, Inc. | Polypropylene composition for injection stretch blow molding |
| US20070045894A1 (en) * | 2005-08-31 | 2007-03-01 | Mcleod Michael A | Process for producing polyolefin films |
| US20070110997A1 (en) * | 2005-11-17 | 2007-05-17 | Fina Technology, Inc. | Polymeric film structures and compositions for high surface treatment retention |
| US7446167B2 (en) * | 2006-04-13 | 2008-11-04 | Fina Technology, Inc. | Catalyst deactivation agents and methods for use of same |
| US20080061468A1 (en) * | 2006-09-07 | 2008-03-13 | Frank Li | Fiber processing of high ethylene level propylene-ethylene random copolymers by use of nucleators |
| CA2664910A1 (en) | 2006-12-15 | 2008-07-03 | Fina Technology, Inc. | Polypropylene blown film |
| US7851578B2 (en) * | 2006-12-29 | 2010-12-14 | Fina Technology, Inc. | Succinate-containing polymerization catalyst system using n-butylmethyldimethoxysilane for preparation of polypropylene film grade resins |
| US7473751B2 (en) * | 2007-01-22 | 2009-01-06 | Fina Technology, Inc. | Biaxially-oriented metallocene-based polypropylene films having reduced thickness |
| US8859084B2 (en) * | 2008-01-29 | 2014-10-14 | Fina Technology, Inc. | Modifiers for oriented polypropylene |
| US20090202770A1 (en) * | 2008-02-08 | 2009-08-13 | Fengkui Li | Polypropylene/polyisobutylene blends and films prepared from same |
| US8759446B2 (en) | 2008-06-30 | 2014-06-24 | Fina Technology, Inc. | Compatibilized polypropylene and polylactic acid blends and methods of making and using same |
| US8268913B2 (en) * | 2008-06-30 | 2012-09-18 | Fina Technology, Inc. | Polymeric blends and methods of using same |
| US8545971B2 (en) * | 2008-06-30 | 2013-10-01 | Fina Technology, Inc. | Polymeric compositions comprising polylactic acid and methods of making and using same |
| US20100087602A1 (en) * | 2008-10-08 | 2010-04-08 | Fina Technology, Inc. | Long chain branched polypropylene for cast film applications |
| CN101735346B (zh) | 2008-11-07 | 2012-05-30 | 中国石油天然气股份有限公司 | 一种丙烯均聚和共聚的催化剂及其制备方法和应用 |
| US20100125124A1 (en) * | 2008-11-17 | 2010-05-20 | Fina Technology, Inc. | Methods of catalyst activation |
| US9174384B2 (en) * | 2009-09-01 | 2015-11-03 | Fina Technology, Inc. | Multilayer polypropylene films and methods of making and using same |
| US8652986B2 (en) | 2009-12-31 | 2014-02-18 | Hyosung Corporation | Ziegler-Natta catalyst for olefin polymerization |
| RU2458938C1 (ru) * | 2010-12-02 | 2012-08-20 | Закрытое Акционерное Общество "Сибур Холдинг" | Каталитическая система, способ ее получения и полиолефины, полученные на ее основе |
| CA3024108A1 (en) | 2016-05-20 | 2017-11-23 | Equistar Chemicals, Lp | In-line polyolefin based adhesive compositions having graft polyolefin/elastomer copolymers |
| US10683408B2 (en) | 2016-10-28 | 2020-06-16 | Fina Technology, Inc. | Use of agents to reduce crystallinity in polypropylene for BOPP applications |
| US10570270B2 (en) | 2016-11-18 | 2020-02-25 | Equistar Chemicals, Lp | Polyolefin materials for rotational molding applications having improved impact properties and color stability |
| BR112019015073B1 (pt) | 2017-01-27 | 2021-09-21 | Equistar Chemicals, Lp | Composições de polietileno modificado por peróxido e processos para preparar polietileno modificado por peróxido e para preparar composição de fio e cabo curável por umidificação |
| US10654956B2 (en) | 2017-05-03 | 2020-05-19 | Equistar Chemicals, Lp | Ethylene alpha-olefin copolymers and methods |
| US20190077129A1 (en) | 2017-09-08 | 2019-03-14 | Equistar Chemicals, Lp | Polyolefin based adhesive compositions having grafted polyolefin copolymers and methods of formation |
| WO2020056119A1 (en) | 2018-09-14 | 2020-03-19 | Fina Technology, Inc. | Polyethylene and controlled rheology polypropylene polymer blends and methods of use |
| MX2021006769A (es) | 2019-02-20 | 2021-07-15 | Fina Technology | Composiciones de polimero con baja distorsion. |
| CA3180539A1 (en) | 2020-06-30 | 2022-01-06 | Douglas Burmaster | Clear polypropylene composition for thermoforming |
| EP4626939A1 (en) | 2022-11-29 | 2025-10-08 | FINA Technology Inc. | Polypropylenes for additive manufacturing |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2981725A (en) * | 1955-11-16 | 1961-04-25 | Shell Oil Co | Process for polymerizing olefins |
| US3008943A (en) * | 1955-12-01 | 1961-11-14 | Exxon Research Engineering Co | Polymerization catalyst |
| NL213771A (Direct) * | 1956-01-18 | |||
| LU36706A1 (Direct) * | 1957-12-23 | |||
| BE576984A (Direct) * | 1958-03-24 | |||
| NL240240A (Direct) * | 1958-06-27 | |||
| BE584091A (Direct) * | 1958-10-30 | |||
| US3193545A (en) * | 1958-12-03 | 1965-07-06 | Exxon Research Engineering Co | Catalyst and process for polymerizing alpha-olefins utilizing titanium halide derivatives |
| BE585927A (Direct) * | 1958-12-23 | |||
| US3238146A (en) * | 1960-03-21 | 1966-03-01 | Shell Oil Co | Catalysts and their preparation |
| FR1291788A (fr) * | 1960-03-21 | 1962-04-27 | Shell Int Research | Procédé de préparation de nouveaux catalyseurs de polymérisation |
| NL263699A (Direct) * | 1960-04-27 | |||
| DE1445225B2 (de) * | 1960-09-24 | 1971-11-18 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Verfahren zur polymerisation von monoalpha olefinen mit drei oder mehr kohlenstoffatomen |
| NL273776A (Direct) * | 1961-01-30 | |||
| US3210332A (en) * | 1963-05-03 | 1965-10-05 | Phillips Petroleum Co | Production of solid olefin polymers |
| US3476730A (en) * | 1966-07-22 | 1969-11-04 | Huels Chemische Werke Ag | Process for low-pressure polymerization of alpha-olefines |
| NL137056C (Direct) * | 1966-10-21 | |||
| CA920299A (en) * | 1968-08-01 | 1973-01-30 | Mitsui Petrochemical Industries | Process for the polymerization and/or copolymerization of olefins with use of ziegler-type catalytsts supported on carrier |
| YU35844B (en) * | 1968-11-25 | 1981-08-31 | Montedison Spa | Process for obtaining catalysts for the polymerization of olefines |
| SE367327B (Direct) * | 1969-03-24 | 1974-05-27 | Montedison Spa | |
| NL162664B (nl) * | 1969-06-20 | 1980-01-15 | Montedison Spa | Werkwijze om een katalysator te bereiden voor de poly- merisatie van alkenen-1. |
-
1970
- 1970-06-15 NL NL7008708.A patent/NL162664B/xx not_active Application Discontinuation
- 1970-06-16 DK DK309870AA patent/DK130744B/da not_active IP Right Cessation
- 1970-06-16 SE SE7008315A patent/SE417611B/sv unknown
- 1970-06-17 YU YU1539/70A patent/YU36189B/xx unknown
- 1970-06-17 IL IL34739A patent/IL34739A/xx unknown
- 1970-06-17 SU SU1444973A patent/SU414770A3/ru active
- 1970-06-17 GB GB2930170A patent/GB1310547A/en not_active Expired
- 1970-06-17 PL PL1970141392A patent/PL80715B1/pl unknown
- 1970-06-17 FR FR7022249A patent/FR2052706A5/fr not_active Expired
- 1970-06-18 DE DE2029992A patent/DE2029992C3/de not_active Expired
- 1970-06-18 JP JP45052439A patent/JPS5819334B1/ja active Granted
- 1970-06-19 AT AT552370A patent/AT302648B/de not_active IP Right Cessation
- 1970-06-19 ES ES380918A patent/ES380918A1/es not_active Expired
- 1970-06-19 CS CS432070A patent/CS153084B2/cs unknown
- 1970-06-19 BE BE752252D patent/BE752252A/xx not_active IP Right Cessation
- 1970-06-20 RO RO7000063695A patent/RO62731A/ro unknown
-
1980
- 1980-05-22 US US06/152,531 patent/US4544717A/en not_active Expired - Lifetime
-
1985
- 1985-07-30 US US06/760,539 patent/US4636486A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4544717A (en) | 1985-10-01 |
| NL162664B (nl) | 1980-01-15 |
| BE752252A (fr) | 1970-12-21 |
| DE2029992C3 (de) | 1975-04-17 |
| DE2029992A1 (Direct) | 1970-12-23 |
| YU153970A (en) | 1981-06-30 |
| IL34739A (en) | 1973-10-25 |
| CS153084B2 (Direct) | 1974-02-22 |
| DE2029992B2 (de) | 1974-08-15 |
| IL34739A0 (en) | 1970-08-19 |
| RO62731A (fr) | 1978-03-15 |
| DK130744C (Direct) | 1975-09-08 |
| JPS5819334B1 (Direct) | 1983-04-18 |
| NL7008708A (Direct) | 1970-12-22 |
| GB1310547A (en) | 1973-03-21 |
| SU414770A3 (ru) | 1974-02-05 |
| US4636486A (en) | 1987-01-13 |
| DK130744B (da) | 1975-04-07 |
| YU36189B (en) | 1982-02-25 |
| FR2052706A5 (Direct) | 1971-04-09 |
| ES380918A1 (es) | 1973-04-01 |
| AT302648B (de) | 1972-10-25 |
| SE417611B (sv) | 1981-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL80715B1 (Direct) | ||
| PL77395B1 (Direct) | ||
| US4124532A (en) | Catalysts for polymerizing olefins | |
| DE69314628T2 (de) | Tris-(pentafluorophenyl)boran-komplexe und daraus erhaltene katalysatoren | |
| US4006101A (en) | Polymerization of olefins and catalysts therefor | |
| EP0250229B1 (en) | Alpha-olefin polymerization catalyst system including an advantageous modifier component | |
| EP0103120A2 (en) | Process for producing a catalyst component used for the polymerization of alpha-olefins | |
| FR2768148A1 (fr) | Systeme catalytique heterogene pour la polymerisation d'olefines et son procede d'utilisation | |
| PL80658B1 (Direct) | ||
| EP0110608B1 (en) | Process for making olefin polymerization catalyst | |
| PL105364B1 (pl) | Sposob polimeryzacji alfa-olefin zawierajacych co najmniej 3 atomy wegla | |
| US4614727A (en) | Polymerization catalyst | |
| AU755262B2 (en) | Gas-phase polymerization process for producing propylene/1-pentene copolymers | |
| US4120883A (en) | Method for producing an organomagnesium complex | |
| WO1998040421A1 (en) | Cationic group 13 complexes incorporating bidentate ligands as polymerization catalysts | |
| EP0449302A2 (en) | Hyperpure propylene polymers | |
| CA1081677A (en) | Process for the production of a catalyst composition for polymerization of alpha-olefin | |
| WO1993024542A1 (en) | Process for the preparation of a catalyst | |
| JPS60221322A (ja) | ゲルマン類の製法 | |
| US4174429A (en) | Process for polymerizing olefins | |
| GB2040968A (en) | Preparation of supported components of olefine polymerisation catalysts | |
| US4127505A (en) | Process for the production of a catalyst component for use in the polymerization of α-olefins | |
| PL81312B1 (Direct) | ||
| US4065611A (en) | Process for the production of polyolefins | |
| US3707530A (en) | Method for producing polymers of ethylene |