PL69080B1 - - Google Patents
Download PDFInfo
- Publication number
- PL69080B1 PL69080B1 PL12294267A PL12294267A PL69080B1 PL 69080 B1 PL69080 B1 PL 69080B1 PL 12294267 A PL12294267 A PL 12294267A PL 12294267 A PL12294267 A PL 12294267A PL 69080 B1 PL69080 B1 PL 69080B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- phenoxy
- phenyl
- aniline
- nitro
- Prior art date
Links
- -1 phenyl mercapto Chemical group 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 9
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 6
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- CGQKBVHAWXBMCL-UHFFFAOYSA-N 4-nitro-2-phenoxyaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1OC1=CC=CC=C1 CGQKBVHAWXBMCL-UHFFFAOYSA-N 0.000 claims description 4
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical class C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 3
- 239000000987 azo dye Substances 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- DBWLUUARTZZKIO-UHFFFAOYSA-N 4-nitro-3-phenoxyaniline Chemical compound NC1=CC=C([N+]([O-])=O)C(OC=2C=CC=CC=2)=C1 DBWLUUARTZZKIO-UHFFFAOYSA-N 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- MGQNMYSRDBFUIR-UHFFFAOYSA-N nitro cyanoformate Chemical group [O-][N+](=O)OC(=O)C#N MGQNMYSRDBFUIR-UHFFFAOYSA-N 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical group O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 claims 1
- 230000003381 solubilizing effect Effects 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 239000000975 dye Substances 0.000 description 35
- 229910052757 nitrogen Inorganic materials 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- 238000004043 dyeing Methods 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 239000000835 fiber Substances 0.000 description 8
- 229920000728 polyester Polymers 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000004744 fabric Substances 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- 238000000859 sublimation Methods 0.000 description 4
- 230000008022 sublimation Effects 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 238000006193 diazotization reaction Methods 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- SCDKUQBOSDILAR-UHFFFAOYSA-N 2-methoxy-5-phenoxyaniline Chemical compound C1=C(N)C(OC)=CC=C1OC1=CC=CC=C1 SCDKUQBOSDILAR-UHFFFAOYSA-N 0.000 description 2
- LDSIOPGMLLPSSR-UHFFFAOYSA-N 3-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C(Cl)=C1 LDSIOPGMLLPSSR-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- 229920003043 Cellulose fiber Polymers 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000005470 impregnation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- RCTGMCJBQGBLKT-PAMTUDGESA-N scarlet red Chemical compound CC1=CC=CC=C1\N=N\C(C=C1C)=CC=C1\N=N\C1=C(O)C=CC2=CC=CC=C12 RCTGMCJBQGBLKT-PAMTUDGESA-N 0.000 description 2
- 229960005369 scarlet red Drugs 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- 239000000984 vat dye Substances 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- RJCBYBQJVXVVKB-UHFFFAOYSA-N 1-nitro-4-phenylsulfanylbenzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1SC1=CC=CC=C1 RJCBYBQJVXVVKB-UHFFFAOYSA-N 0.000 description 1
- WAPNOHKVXSQRPX-UHFFFAOYSA-N 1-phenylethanol Chemical compound CC(O)C1=CC=CC=C1 WAPNOHKVXSQRPX-UHFFFAOYSA-N 0.000 description 1
- KOPFEFZSAMLEHK-UHFFFAOYSA-N 1h-pyrazole-5-carboxylic acid Chemical class OC(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-N 0.000 description 1
- JBXZCPXEYAEMJS-UHFFFAOYSA-N 2,5-dichloro-4-nitroaniline Chemical compound NC1=CC(Cl)=C([N+]([O-])=O)C=C1Cl JBXZCPXEYAEMJS-UHFFFAOYSA-N 0.000 description 1
- HDKINPJVJNWZSX-UHFFFAOYSA-N 2-(N-ethyl-3-phenoxyanilino)ethyl acetate Chemical compound C(C)N(C1=CC(=CC=C1)OC1=CC=CC=C1)CCOC(C)=O HDKINPJVJNWZSX-UHFFFAOYSA-N 0.000 description 1
- KMLMCHZWMDCYPI-UHFFFAOYSA-N 2-(n-ethyl-3-methylanilino)ethyl acetate Chemical compound CC(=O)OCCN(CC)C1=CC=CC(C)=C1 KMLMCHZWMDCYPI-UHFFFAOYSA-N 0.000 description 1
- GPCCXIVDZANEJZ-UHFFFAOYSA-N 2-(n-ethylanilino)ethyl acetate Chemical compound CC(=O)OCCN(CC)C1=CC=CC=C1 GPCCXIVDZANEJZ-UHFFFAOYSA-N 0.000 description 1
- RRGWFPOSTSQIQE-UHFFFAOYSA-N 2-[n-(2-cyanoethyl)anilino]ethyl acetate Chemical compound CC(=O)OCCN(CCC#N)C1=CC=CC=C1 RRGWFPOSTSQIQE-UHFFFAOYSA-N 0.000 description 1
- PSPRBFPNQXPKNF-UHFFFAOYSA-N 2-[n-ethyl-3-(propanoylamino)anilino]ethyl acetate Chemical compound CC(=O)OCCN(CC)C1=CC=CC(NC(=O)CC)=C1 PSPRBFPNQXPKNF-UHFFFAOYSA-N 0.000 description 1
- FRZYULCOPOKABN-UHFFFAOYSA-N 2-chloro-4-nitro-5-phenylsulfanylaniline Chemical compound C1=C(Cl)C(N)=CC(SC=2C=CC=CC=2)=C1[N+]([O-])=O FRZYULCOPOKABN-UHFFFAOYSA-N 0.000 description 1
- FXRALOSAFSMKNJ-UHFFFAOYSA-N 2-methoxy-4-nitro-5-phenoxyaniline Chemical compound NC1=C(C=C(C(=C1)OC1=CC=CC=C1)[N+](=O)[O-])OC FXRALOSAFSMKNJ-UHFFFAOYSA-N 0.000 description 1
- DTYBRSLINXBXMP-UHFFFAOYSA-N 2-methoxy-5-phenylaniline Chemical compound C1=C(N)C(OC)=CC=C1C1=CC=CC=C1 DTYBRSLINXBXMP-UHFFFAOYSA-N 0.000 description 1
- VDLGLFVMQUNFST-UHFFFAOYSA-N 2-phenoxy-n-phenylacetamide Chemical compound C=1C=CC=CC=1NC(=O)COC1=CC=CC=C1 VDLGLFVMQUNFST-UHFFFAOYSA-N 0.000 description 1
- NMFFUUFPJJOWHK-UHFFFAOYSA-N 2-phenoxyaniline Chemical compound NC1=CC=CC=C1OC1=CC=CC=C1 NMFFUUFPJJOWHK-UHFFFAOYSA-N 0.000 description 1
- TWBPWBPGNQWFSJ-UHFFFAOYSA-N 2-phenylaniline Chemical group NC1=CC=CC=C1C1=CC=CC=C1 TWBPWBPGNQWFSJ-UHFFFAOYSA-N 0.000 description 1
- YDJLOMISTGVMPL-UHFFFAOYSA-N 3-(2-anilinoethoxy)propanenitrile Chemical compound N#CCCOCCNC1=CC=CC=C1 YDJLOMISTGVMPL-UHFFFAOYSA-N 0.000 description 1
- LRRNFOCEZLNULM-UHFFFAOYSA-N 3-(2-methoxy-5-phenoxyanilino)propanenitrile Chemical compound C(#N)CCNC1=C(C=CC(=C1)OC1=CC=CC=C1)OC LRRNFOCEZLNULM-UHFFFAOYSA-N 0.000 description 1
- NPCCPMHHNIOSHL-UHFFFAOYSA-N 3-(n-ethyl-3-methylanilino)propanenitrile Chemical compound N#CCCN(CC)C1=CC=CC(C)=C1 NPCCPMHHNIOSHL-UHFFFAOYSA-N 0.000 description 1
- WYRNRZQRKCXPLA-UHFFFAOYSA-N 3-(n-ethylanilino)propanenitrile Chemical compound N#CCCN(CC)C1=CC=CC=C1 WYRNRZQRKCXPLA-UHFFFAOYSA-N 0.000 description 1
- OSNNWHRYDJYFJL-UHFFFAOYSA-N 3-[n-(2-hydroxyethyl)-3-methylanilino]propanenitrile Chemical compound CC1=CC=CC(N(CCO)CCC#N)=C1 OSNNWHRYDJYFJL-UHFFFAOYSA-N 0.000 description 1
- WZJJWQVBLSPALW-UHFFFAOYSA-N 3-[n-(2-hydroxyethyl)anilino]propanenitrile Chemical compound N#CCCN(CCO)C1=CC=CC=C1 WZJJWQVBLSPALW-UHFFFAOYSA-N 0.000 description 1
- FENJKTQEFUPECW-UHFFFAOYSA-N 3-anilinopropanenitrile Chemical compound N#CCCNC1=CC=CC=C1 FENJKTQEFUPECW-UHFFFAOYSA-N 0.000 description 1
- UCSYVYFGMFODMY-UHFFFAOYSA-N 3-phenoxyaniline Chemical compound NC1=CC=CC(OC=2C=CC=CC=2)=C1 UCSYVYFGMFODMY-UHFFFAOYSA-N 0.000 description 1
- WFBXYWYRLONTJK-UHFFFAOYSA-N 4-nitro-2-phenylaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C1=CC=CC=C1 WFBXYWYRLONTJK-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- 239000004604 Blowing Agent Substances 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- RZUGORMYMMNOIV-UHFFFAOYSA-N C(C)N(C1=C(C=CC(=C1)SC1=CC=CC=C1)OC)CCC#N Chemical compound C(C)N(C1=C(C=CC(=C1)SC1=CC=CC=C1)OC)CCC#N RZUGORMYMMNOIV-UHFFFAOYSA-N 0.000 description 1
- CEOPXVMZXNPRRO-UHFFFAOYSA-N N#CCCN(CC)C1=CC(C)=CC=C1OC Chemical compound N#CCCN(CC)C1=CC(C)=CC=C1OC CEOPXVMZXNPRRO-UHFFFAOYSA-N 0.000 description 1
- WODMGMNNQTWUSP-UHFFFAOYSA-N N,N-diethyl-2-methoxy-5-phenoxyaniline Chemical compound C(C)N(C1=C(C=CC(=C1)OC1=CC=CC=C1)OC)CC WODMGMNNQTWUSP-UHFFFAOYSA-N 0.000 description 1
- QKUSSDMNZYDXNL-UHFFFAOYSA-N N1C(=O)NC(=O)CC1=O.N1=NC(C=C1)=O Chemical group N1C(=O)NC(=O)CC1=O.N1=NC(C=C1)=O QKUSSDMNZYDXNL-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- UCEYQFLQQSRUIE-UHFFFAOYSA-N [ClH]1NN=CC=C1 Chemical group [ClH]1NN=CC=C1 UCEYQFLQQSRUIE-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 1
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical group C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000005159 cyanoalkoxy group Chemical group 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000009837 dry grinding Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229940060367 inert ingredients Drugs 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- GAWNADADLZIUQM-UHFFFAOYSA-N methyl 4-amino-3-phenoxybenzoate Chemical compound COC(=O)C1=CC=C(N)C(OC=2C=CC=CC=2)=C1 GAWNADADLZIUQM-UHFFFAOYSA-N 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- KYPIASPTMDEDQB-UHFFFAOYSA-N n,2-diphenylacetamide Chemical compound C=1C=CC=CC=1NC(=O)CC1=CC=CC=C1 KYPIASPTMDEDQB-UHFFFAOYSA-N 0.000 description 1
- RPWRIWAWNASJKB-UHFFFAOYSA-N n,n-diethyl-2-methoxy-5-methylaniline Chemical compound CCN(CC)C1=CC(C)=CC=C1OC RPWRIWAWNASJKB-UHFFFAOYSA-N 0.000 description 1
- CIPVVROJHKLHJI-UHFFFAOYSA-N n,n-diethyl-3-methylaniline Chemical compound CCN(CC)C1=CC=CC(C)=C1 CIPVVROJHKLHJI-UHFFFAOYSA-N 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- BTJCIVXKBILNPY-UHFFFAOYSA-N n-[3-(diethylamino)-4-methoxyphenyl]acetamide Chemical compound CCN(CC)C1=CC(NC(C)=O)=CC=C1OC BTJCIVXKBILNPY-UHFFFAOYSA-N 0.000 description 1
- FPUKYOSOAAPHTN-UHFFFAOYSA-N n-[3-(diethylamino)phenyl]acetamide Chemical compound CCN(CC)C1=CC=CC(NC(C)=O)=C1 FPUKYOSOAAPHTN-UHFFFAOYSA-N 0.000 description 1
- CUKQQJOLONSVTL-UHFFFAOYSA-N n-[3-[2-(2-cyanoethoxy)ethylamino]-4-methoxyphenyl]acetamide Chemical compound COC1=CC=C(NC(C)=O)C=C1NCCOCCC#N CUKQQJOLONSVTL-UHFFFAOYSA-N 0.000 description 1
- ITCQFSOCCFSHHU-UHFFFAOYSA-N n-[3-[2-cyanoethyl(2-hydroxyethyl)amino]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(N(CCO)CCC#N)=C1 ITCQFSOCCFSHHU-UHFFFAOYSA-N 0.000 description 1
- GMJYHCWSTTTWRT-UHFFFAOYSA-N n-[3-[2-cyanoethyl(ethyl)amino]-4-methoxyphenyl]acetamide Chemical compound N#CCCN(CC)C1=CC(NC(C)=O)=CC=C1OC GMJYHCWSTTTWRT-UHFFFAOYSA-N 0.000 description 1
- WTEINCFQQDGGPB-UHFFFAOYSA-N n-[3-[2-cyanoethyl(ethyl)amino]phenyl]acetamide Chemical compound N#CCCN(CC)C1=CC=CC(NC(C)=O)=C1 WTEINCFQQDGGPB-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000985 reactive dye Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000004048 vat dyeing Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Landscapes
- Coloring (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL12294267A PL69080B1 (enExample) | 1967-10-09 | 1967-10-09 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL12294267A PL69080B1 (enExample) | 1967-10-09 | 1967-10-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL69080B1 true PL69080B1 (enExample) | 1973-02-28 |
Family
ID=19949751
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL12294267A PL69080B1 (enExample) | 1967-10-09 | 1967-10-09 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL69080B1 (enExample) |
-
1967
- 1967-10-09 PL PL12294267A patent/PL69080B1/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS626592B2 (enExample) | ||
| US4264326A (en) | New disperse dyestuffs; their preparation and their applications to the coloration of synthetic materials | |
| JPH0147500B2 (enExample) | ||
| US3523936A (en) | 2 - sulfonamido - 4 - (n,n - disubstituted amino)benzeneazo - 1,4 - naphthalene-or 1,4-benzene-azobenzene dyes | |
| PL69080B1 (enExample) | ||
| DE1644129C3 (de) | Wasserunlösliche Monoazofarbstoffe und Verfahren zum Färben von Polyesterfasern | |
| DE1644135A1 (de) | Neue,wasserunloesliche Azofarbstoffe und Verfahren zu deren Herstellung | |
| DE2606716C2 (de) | Neue Dispersionsfarbstoffe | |
| US3530111A (en) | Water-insoluble phenyl-azo-phenyl dyestuffs | |
| DE2724567A1 (de) | Neue dispersionsfarbstoffe | |
| US3580902A (en) | Water-insoluble monoazo dyestuffs | |
| JPS5853022B2 (ja) | 分散性モノアゾ染料の製法 | |
| US3856773A (en) | Water insoluble 4-(2{40 -cyano-4{40 -nitrophenylazo)-2-chloro-n-(b-cyanoethyl)-aniline | |
| DE2724566A1 (de) | Naphtholaktam-farbstoffe | |
| PL76374B1 (enExample) | ||
| US3881866A (en) | Polyester or polyacrylonitrile fibers dyed by quaternized or unquarternized azoanilino-toluene sulfonamidoalkyleneamine | |
| JPH0376349B2 (enExample) | ||
| DE2343115A1 (de) | Neue anthrachinonfarbstoffe, deren herstellung und verwendung | |
| US2025117A (en) | Azo dyes and methods for their preparation | |
| US3759663A (en) | Process for dyeing polyester fabrics with disazo dyestuffs | |
| US4226596A (en) | Process for printing unions | |
| DE1644125C3 (de) | Wasserunlösliche Monoazofarbstoffe der Dispersionsreihe | |
| US2394258A (en) | Azo dyestuffs | |
| AT232158B (de) | Verfahren zur Herstellung neuer, organischer Reaktiv-Farbstoffe | |
| PL69022B1 (enExample) |