PL62320B1 - - Google Patents
Download PDFInfo
- Publication number
- PL62320B1 PL62320B1 PL118333A PL11833367A PL62320B1 PL 62320 B1 PL62320 B1 PL 62320B1 PL 118333 A PL118333 A PL 118333A PL 11833367 A PL11833367 A PL 11833367A PL 62320 B1 PL62320 B1 PL 62320B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- dyes
- hydrogen atom
- group
- methyl
- Prior art date
Links
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 239000000987 azo dye Substances 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 150000004982 aromatic amines Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229910014033 C-OH Inorganic materials 0.000 claims 2
- 229910014570 C—OH Inorganic materials 0.000 claims 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims 1
- 239000000975 dye Substances 0.000 description 12
- 239000000835 fiber Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 210000002268 wool Anatomy 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001174 sulfone group Chemical group 0.000 description 2
- FZCQMIRJCGWWCL-UHFFFAOYSA-N 2-amino-5-chlorophenol Chemical compound NC1=CC=C(Cl)C=C1O FZCQMIRJCGWWCL-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- -1 o-tolylcarbamyl Chemical group 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL62320B1 true PL62320B1 (enEXAMPLES) | 1971-02-27 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2237885A (en) | Stable diazo compounds | |
| PL62320B1 (enEXAMPLES) | ||
| DE1644192A1 (de) | Chrom-Mischkomplex-Azofarbstoffe | |
| CH326959A (de) | Verfahren zur Herstellung metallisierbarer Disazofarbstoffe | |
| DE617665C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2150598A1 (de) | Azofarbstoffe und Verfahren zur Herstellung derselben | |
| DE448141C (de) | Verfahren zur Herstellung von Chromverbindungen von o-Oxyazofarbstoffen | |
| DE925669C (de) | Verfahren zur Herstellung gelber metallisierbarer Disazofarbstoffe und deren Metallkomplexverbindungen | |
| CH346309A (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| PL48179B1 (enEXAMPLES) | ||
| CH342311A (de) | Verfahren zur Herstellung eines substantiven Disazofarbstoffes | |
| CH365162A (de) | Verfahren zur Herstellung saurer Monoazofarbstoffe | |
| CH342315A (de) | Verfahren zur Herstellung eines substantiven Disazofarbstoffes | |
| CH342314A (de) | Verfahren zur Herstellung eines substantiven Disazofarbstoffes | |
| CH222126A (de) | Verfahren zur Darstellung eines grünen Chromierungsfarbstoffes. | |
| PL160811B1 (pl) | Sposób wytwarzania dlslarczków arylowych | |
| CH342310A (de) | Verfahren zur Herstellung eines substantiven Disazofarbstoffes | |
| NO142501B (no) | Anordning ved trugebinding. | |
| CH309790A (de) | Verfahren zur Herstellung eines gelben Monoazofarbstoffes. | |
| CH221205A (de) | Verfahren zur Herstellung eines Azofarbstoffes. | |
| CH342312A (de) | Verfahren zur Herstellung eines substantiven Disazofarbstoffes | |
| CH217492A (de) | Verfahren zur Herstellung eines Azofarbstoffes. | |
| PL116317B2 (en) | Method for manufacturing novel reactive azo dyes containing thiosulfuric acid radical | |
| DE2237554A1 (de) | Mono-disazoamino-substituierte farbstoffe, zwischenprodukte und verfahren zu ihrer herstellung | |
| DE2755683A1 (de) | Citrazinsaeure-rest enthaltende azofarbstoffe und verfahren zu ihrer herstellung |